Phone (USA) +1 212-348-5610
Whatsapp: +1 516-336-9307
WeChat: chembuyersguide
Chemical Search
 


























BLD Pharmatech Ltd.




Country: China

BLD Pharmatech Ltd.
488 Taoqiao Road, Building 5, 5F
HuiNan Town, Pudong New Area,
Shanghai 201203, China


Phone: +86-21-61629022
E-Mail:E-Mail this Supplier

Contact: Elva Cui

http://www.bldpharm.com

BLD Pharmatech Ltd.

Page: Home | 1 | 2 | 3 | 4 | 5 | 6 | 7 | 8 | 9 | 10 | 11 | 12 | 13 | 14 | 15 | 16 | 17 | 18 | 19 | 20 | 21 | 22 | 23 | 24 | 25 | 26 | 27 | 28 | 29 | 30 | 31 | 32 | 33 | 34 | 35 | 36 | 37 | 38 | 39 | 40 | 41 | 42 | 43 | 44 | 45 | 46 | 47 | 48 | 49 | 50 | 51 | 52 | 53 | 54 | 55 | 56 | 57 | 58 | 59 | 60 | 61 | 62 | 63 | 64 | 65 | 66 | 67 | 68 | 69 | 70 | 71 | 72 | 73 | 74 | 75 | 76 | 77 | 78 | 79 | 80 | 81 | 82 | 83 | 84 | 85 | 86 | 87 | 88 | 89 | 90 | 91 | 92 | 93 | 94 | 95 | 96 | 97 | 98 | 99 | 100 | 101 | 102 | 103 | 104 | 105 | 106 | 107 | 108 | 109 | 110 | 111 | 112 | 113 | 114 | 115 | 116 | 117 | 118 | 119 | 120 | 121 | 122 | 123 | 124 | 125 | 126 | 127 | 128 | 129 | 130 | 131 | 132 | 133 | 134 | 135 | 136 | 137 | 138 | 139 | 140 | 141 | 142 | 143 | 144 | 145 | 146 | 147 | 148 | 149 | 150 | 151 | 152 | 153 | 154 | 155 | 156 | 157 | 158 | 159 | 160 | 161 | 162 | 163 | 164 | 165 | 166 | 167 | 168 | 169 | 170 | 171 | 172 | 173 | 174 | 175 | 176 | 177 | 178 | 179 | 180 | 181 | 182 | 183 | 184 | 185 | 186 | 187 | 188 | 189 | 190 | 191 | 192 | 193 | 194 | 195 | 196 | 197 | 198 | 199 | 200 | 201 | 202 | 203 | 204 | 205 | 206 | 207 | 208 | 209 | 210 | 211 | 212 | 213 | 214 | 215 | 216 | 217 | 218 | 219 | 220 | 221 | 222 | 223 | 224 | 225 | 226 | 227 | 228 | 229 | 230 | 231 | 232 | 233 | 234 | 235 | 236 | 237 | 238 | 239 | 240 | 241 | 242 | 243 | 244 | 245 | 246 | 247 | 248 | 249 | 250 | 251 | 252 | 253 | 254 | 255 | 256 | 257 | 258 | 259 | 260 | 261 | 262 | 263 | 264 | 265 | 266 | 267 | 268 | 269 | 270 | 271 | 272 | 273 | 274 | 275 | 276 | 277 | 278 | 279 | 280 | 281 | 282 | 283 | 284 |
 


Product List

2,5-DIBROMOPYRIDIN-3-OL
CAS:857429-79-9
Formula: OC1=CC(Br)=CN=C1Br
BD196690
97%
MFCD09959722
2,5-DIBROMOPYRIDIN-4-AMINE
CAS:221241-37-8
Formula: NC1=CC(Br)=NC=C1Br
BD261277
95+%
MFCD13185831
2,5-DIBROMOPYRIDIN-4-OL
CAS:1033203-55-2
Formula: OC1=CC(Br)=NC=C1Br
BD324715
95+%
MFCD11100682
2,5-DIBROMOPYRIDINE
CAS:624-28-2
Formula: BrC1=CN=C(Br)C=C1
BD7925
98%
MFCD00006221
2,5-DIBROMOPYRIDINE-3,4-DIAMINE
CAS:221241-11-8
Formula: NC1=C(N)C(Br)=NC=C1Br
BD238859
98%
MFCD15526814
2,5-DIBROMOPYRIMIDINE
CAS:32779-37-6
Formula: BrC1=NC=C(C=N1)Br
BD20238
98%
MFCD08275684
2,5-DIBROMOTEREPHTALIC ACID
CAS:13731-82-3
Formula: C1=C(Br)C(=CC(=C1C(O)=O)Br)C(O)=O
BD5593
98%
MFCD00204593
2,5-DIBROMOTEREPHTHALALDEHYDE
CAS:63525-48-4
Formula: BrC1=CC(C=O)=C(Br)C=C1C=O
BD164199
97%
MFCD11521314
2,5-DIBROMOTEREPHTHALONITRILE
CAS:18870-11-6
Formula: N#CC1=CC(Br)=C(C#N)C=C1Br
BD164140
95+%
MFCD03426731
2,5-DIBROMOTHIAZOLE
CAS:4175-78-4
Formula: C1=C(SC(=N1)Br)Br
BD41682
97%
MFCD00016891
2,5-DIBROMOTHIAZOLE-4-CARBOXYLIC ACID
CAS:943735-44-2
Formula: O=C(C1=C(Br)SC(Br)=N1)O
BD67473
95+%
MFCD10001381
2,5-DIBROMOTHIENO[2,3-B]THIOPHENE
CAS:25121-86-2
Formula: BrC(S1)=CC2=C1SC(Br)=C2
BD582569
97%
MFCD18451757
2,5-DIBROMOTHIOPHENE
CAS:3141-27-3
Formula: C1=C(Br)SC(=C1)Br
BD9373
98%
MFCD00005420
2,5-DIBROMOTHIOPHENE 1,1-DIOXIDE
CAS:89088-95-9
Formula: BrC1=CC=C(Br)S1(=O)=O
BD322189
95+%
2,5-DIBROMOTHIOPHENE-3,4-DICARBALDEHYDE
CAS:57308-96-0
Formula: O=CC1=C(Br)SC(Br)=C1C=O
BD281561
95+%
2,5-DIBROMOTHIOPHENE-3,4-DICARBOXYLIC ACID
CAS:190723-12-7
Formula: O=C(C1=C(Br)SC(Br)=C1C(O)=O)O
BD268496
95%
MFCD08695787
2,5-DIBROMOTHIOPHENE-3-CARBALDEHYDE
CAS:1193-69-7
Formula: O=CC1=C(Br)SC(Br)=C1
BD225526
95+%
MFCD03426905
2,5-DIBROMOTHIOPHENE-3-CARBONITRILE
CAS:18792-01-3
Formula: N#CC1=C(Br)SC(Br)=C1
BD264534
95+%
MFCD22578679
2,5-DIBROMOTHIOPHENE-3-CARBOXAMIDE
CAS:857979-62-5
Formula: O=C(C1=C(Br)SC(Br)=C1)N
BD264537
95+%
MFCD18801039
2,5-DIBROMOTHIOPHENE-3-CARBOXYLIC ACID
CAS:7311-70-8
Formula: O=C(C1=C(Br)SC(Br)=C1)O
BD212051
97%
MFCD08445656
2,5-DICHLORO(1,3-DIOXOLAN-2-YLMETHYL) BENZENE
CAS:898759-15-4
Formula: ClC1=CC=C(Cl)C(CC2OCCO2)=C1
BD310639
95+%
MFCD04117652
2,5-DICHLORO-1,6-NAPHTHYRIDINE
CAS:23616-35-5
Formula: ClC1=C2C=CC(Cl)=NC2=CC=N1
BD55086
97%
2,5-DICHLORO-1,8-NAPHTHYRIDINE
CAS:91870-15-4
Formula: ClC1=CC=C2C(Cl)=CC=NC2=N1
BD238371
95+%
MFCD13181698
2,5-DICHLORO-1-FLUORO-3-METHYLBENZENE
CAS:1242339-87-2
Formula: CC1=C(Cl)C(F)=CC(Cl)=C1
BD282772
95+%
MFCD16817664
2,5-DICHLORO-1-METHYL-3,6-DIHYDROPYRIDIN-4(1H)-ONE
CAS:1624262-49-2
Formula: O=C1CC(Cl)N(C)CC1Cl
BD289449
95+%
2,5-DICHLORO-1-METHYLPYRIDIN-4(1H)-ONE
CAS:1449008-17-6
Formula: O=C1C=C(Cl)N(C)C=C1Cl
BD297755
95+%
MFCD24848705
2,5-DICHLORO-1-NITRO-3-(TRIFLUOROMETHYL)BENZENE
CAS:98373-83-2
Formula: FC(C1=C(Cl)C([N+]([O-])=O)=CC(Cl)=C1)(F)F
BD208104
95+%
2,5-DICHLORO-1H-IMIDAZO[4,5-B]PYRIDINE
CAS:438190-90-0
Formula: ClC1=CC=C2C(N=C(Cl)N2)=N1
BD158277
95+%
MFCD11518936
2,5-DICHLORO-1H-INDOLE-3-CARBALDEHYDE
CAS:535924-87-9
Formula: O=CC1=C(Cl)NC2=C1C=C(Cl)C=C2
BD263665
95+%
MFCD05178178
2,5-DICHLORO-1H-PYRROLO[3,2-B]PYRIDINE
CAS:1000342-87-9
Formula: ClC1=CC=C(NC(Cl)=C2)C2=N1
BD301463
95+%
2,5-DICHLORO-2'-MORPHOLINOMETHYL BENZOPHENONE
CAS:898751-05-8
Formula: O=C(C1=CC=CC=C1CN2CCOCC2)C3=CC(Cl)=CC=C3Cl
BD309987
95+%
MFCD03842443
2,5-DICHLORO-2'-PIPERIDINOMETHYL BENZOPHENONE
CAS:898773-69-8
Formula: O=C(C1=CC=CC=C1CN2CCCCC2)C3=CC(Cl)=CC=C3Cl
BD311905
95+%
MFCD03842500
2,5-DICHLORO-2'-PYRROLIDINOMETHYL BENZOPHENONE
CAS:898774-97-5
Formula: O=C(C1=CC=CC=C1CN2CCCC2)C3=CC(Cl)=CC=C3Cl
BD311999
95+%
MFCD03842557
2,5-DICHLORO-2'-THIOMORPHOLINOMETHYL BENZOPHENONE
CAS:898782-32-6
Formula: O=C(C1=CC=CC=C1CN2CCSCC2)C3=CC(Cl)=CC=C3Cl
BD312683
95+%
MFCD03842784
2,5-DICHLORO-2,5-DIMETHYLHEXANE
CAS:6223-78-5
Formula: CC(C)(Cl)CCC(C)(Cl)C
BD67488
98%
MFCD00126854
2,5-DICHLORO-3'-(1,3-DIOXOLAN-2-YL) BENZOPHENONE
CAS:898759-55-2
Formula: O=C(C1=CC=CC(C2OCCO2)=C1)C3=CC(Cl)=CC=C3Cl
BD310677
95+%
MFCD07699986
2,5-DICHLORO-3'-MORPHOLINOMETHYL BENZOPHENONE
CAS:898792-22-8
Formula: O=C(C1=CC=CC(CN2CCOCC2)=C1)C3=CC(Cl)=CC=C3Cl
BD313606
95+%
MFCD03841934
2,5-DICHLORO-3'-PIPERIDINOMETHYL BENZOPHENONE
CAS:898793-52-7
Formula: O=C(C1=CC=CC(CN2CCCCC2)=C1)C3=CC(Cl)=CC=C3Cl
BD313736
95+%
MFCD03841991
2,5-DICHLORO-3'-PYRROLIDINOMETHYL BENZOPHENONE
CAS:898770-80-4
Formula: O=C(C1=CC=CC(CN2CCCC2)=C1)C3=CC(Cl)=CC=C3Cl
BD311692
95+%
MFCD03842048
2,5-DICHLORO-3'-THIOMORPHOLINOMETHYL BENZOPHENONE
CAS:898787-84-3
Formula: O=C(C1=CC=CC(CN2CCSCC2)=C1)C3=CC(Cl)=CC=C3Cl
BD313191
95+%
MFCD03842273
2,5-DICHLORO-3,6-DIFLUOROBENZALDEHYDE
CAS:1263376-60-8
Formula: O=CC1=C(F)C(Cl)=CC(F)=C1Cl
BD590068
97%
MFCD18379847
2,5-DICHLORO-3,6-DIFLUOROBENZOIC ACID
CAS:1263376-11-9
Formula: O=C(O)C1=C(F)C(Cl)=CC(F)=C1Cl
BD590048
97%
MFCD18379846
2,5-DICHLORO-3,6-DIMETHYLANILINE
CAS:81742-11-2
Formula: NC1=C(C)C(Cl)=CC(C)=C1Cl
BD262701
95+%
MFCD20696073
2,5-DICHLORO-3,6-DIMETHYLPYRIDINE
CAS:125014-98-4
Formula: CC1=C(Cl)C=C(C)C(Cl)=N1
BD284501
95+%
2,5-DICHLORO-3-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL) PYRIDINE
CAS:1073371-98-8
Formula: CC1(C)OB(OC1(C)C)C1=CC(Cl)=CN=C1Cl
BD236040
95+%
MFCD08063094
2,5-DICHLORO-3-(DIFLUOROMETHYL)PYRIDINE
CAS:71701-93-4
Formula: FC(F)C1=CC(Cl)=CN=C1Cl
BD238789
95+%
MFCD18384828
2,5-DICHLORO-3-(DIMETHOXYMETHYL) PYRIDINE
CAS:1299607-61-6
Formula: COC(C1=CC(Cl)=CN=C1Cl)OC
BD602798
97%
MFCD18803499
2,5-DICHLORO-3-(METHOXYMETHYL) PYRIDINE
CAS:1386986-05-5
Formula: COCC1=CC(Cl)=CN=C1Cl
BD448747
97%
MFCD23163276
2,5-DICHLORO-3-(METHYLTHIO)PYRIDINE
CAS:1416713-50-2
Formula: CSC1=CC(Cl)=CN=C1Cl
BD329709
95+%
MFCD22689783
2,5-DICHLORO-3-(TRIFLUOROMETHYL)ANILINE
CAS:103995-81-9
Formula: NC1=CC(Cl)=CC(C(F)(F)F)=C1Cl
BD479815
97%
MFCD27986858
2,5-DICHLORO-3-(TRIFLUOROMETHYL)BENZOIC ACID
CAS:871254-76-1
Formula: O=C(O)C1=CC(Cl)=CC(C(F)(F)F)=C1Cl
BD270143
95+%
2,5-DICHLORO-3-(TRIFLUOROMETHYL)PYRIDINE
CAS:70158-59-7
Formula: FC(C1=CC(Cl)=CN=C1Cl)(F)F
BD196659
97%
MFCD00042244
2,5-DICHLORO-3-FLUORO-4-IODOPYRIDINE
CAS:514798-04-0
Formula: IC1=C(F)C(Cl)=NC=C1Cl
BD334527
95+%
MFCD20925318
2,5-DICHLORO-3-FLUOROBENZALDEHYDE
CAS:1553716-42-9
Formula: O=CC1=CC(Cl)=CC(F)=C1Cl
BD593283
97%
MFCD22414486
2,5-DICHLORO-3-FLUOROBENZOIC ACID
CAS:501008-42-0
Formula: OC(=O)C1=C(Cl)C(F)=CC(Cl)=C1
BD236855
95+%
MFCD13250174
2,5-DICHLORO-3-FLUOROISONICOTINALDEHYDE
CAS:1936591-33-1
Formula: O=CC1=C(Cl)C=NC(Cl)=C1F
BD442921
97%
MFCD28405283
2,5-DICHLORO-3-FLUOROISONICOTINIC ACID
CAS:514798-00-6
Formula: O=C(O)C1=C(Cl)C=NC(Cl)=C1F
BD334526
95+%
MFCD20921504
2,5-DICHLORO-3-FLUOROPYRIDINE
CAS:103999-77-5
Formula: FC1=CC(Cl)=CN=C1Cl
BD167751
98%
MFCD10699709
2,5-DICHLORO-3-HYDROXY-6-METHOXYBENZOIC ACID
CAS:7600-50-2
Formula: O=C(O)C1=C(OC)C(Cl)=CC(O)=C1Cl
BD83045
95+%
2,5-DICHLORO-3-METHOXY-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL) PYRIDINE
CAS:1357387-36-0
Formula: CC1(C)C(C)(C)OB(C2=C(OC)C(Cl)=NC=C2Cl)O1
BD321860
95+%
MFCD20487033
2,5-DICHLORO-3-METHOXY-6-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL) PYRIDINE
CAS:1357387-52-0
Formula: CC1(C)C(C)(C)OB(C2=C(Cl)C=C(OC)C(Cl)=N2)O1
BD321862
95+%
MFCD18803488
2,5-DICHLORO-3-METHOXYISONICOTINALDEHYDE
CAS:1305324-89-3
Formula: O=CC1=C(Cl)C=NC(Cl)=C1OC
BD602841
97%
MFCD20487035
2,5-DICHLORO-3-METHOXYISONICOTINIC ACID
CAS:1305324-55-3
Formula: O=C(O)C1=C(Cl)C=NC(Cl)=C1OC
BD602820
97%
MFCD20487034
2,5-DICHLORO-3-METHOXYPYRAZINE
CAS:36398-43-3
Formula: COC1=NC(Cl)=CN=C1Cl
BD587626
97%
2,5-DICHLORO-3-METHOXYPYRIDINE
CAS:1214366-19-4
Formula: COC1=CC(Cl)=CN=C1Cl
BD242414
95+%
MFCD13185540
2,5-DICHLORO-3-METHYLANILINE
CAS:1379291-18-5
Formula: NC1=CC(Cl)=CC(C)=C1Cl
BD281762
95+%
MFCD20700007
2,5-DICHLORO-3-METHYLBENZALDEHYDE
CAS:1160573-34-1
Formula: O=CC1=CC(Cl)=CC(C)=C1Cl
BD463399
97%
MFCD11846003
2,5-DICHLORO-3-METHYLBENZOIC ACID
CAS:1160573-37-4
Formula: O=C(O)C1=CC(Cl)=CC(C)=C1Cl
BD484245
97%
MFCD11846004
2,5-DICHLORO-3-METHYLPYRAZINE
CAS:107378-41-6
Formula: CC1=NC(Cl)=CN=C1Cl
BD298118
95+%
MFCD15144441
2,5-DICHLORO-3-METHYLPYRIDINE
CAS:59782-88-6
Formula: CC1=CC(Cl)=CN=C1Cl
BD21688
98%
MFCD03840754
2,5-DICHLORO-3-NITROBENZOIC ACID
CAS:88-86-8
Formula: O=C(O)C1=CC(Cl)=CC([N+]([O-])=O)=C1Cl
BD22999
95+%
MFCD00014691
2,5-DICHLORO-3-NITROPYRIDIN-4-AMINE
CAS:405230-91-3
Formula: NC1=C([N+]([O-])=O)C(Cl)=NC=C1Cl
BD248718
95+%
MFCD18909332
2,5-DICHLORO-3-NITROPYRIDINE
CAS:21427-62-3
Formula: ClC1=NC=C(C=C1[N+](=O)[O-])Cl
BD19366
95%
MFCD06658963
2,5-DICHLORO-3-PHENYLQUINOXALINE
CAS:N/A
Formula: ClC1C=CC=C2C=1N=C(C(=N2)Cl)C1C=CC=CC=1
BD00731038
95%
2,5-DICHLORO-4'-(1,3-DIOXOLAN-2-YL) BENZOPHENONE
CAS:898760-70-8
Formula: O=C(C1=CC=C(C2OCCO2)C=C1)C3=CC(Cl)=CC=C3Cl
BD310770
95+%
MFCD07700037
2,5-DICHLORO-4'-MORPHOLINOMETHYL BENZOPHENONE
CAS:898770-59-7
Formula: O=C(C1=CC=C(CN2CCOCC2)C=C1)C3=CC(Cl)=CC=C3Cl
BD311671
95+%
MFCD03841422
2,5-DICHLORO-4'-PIPERIDINOMETHYL BENZOPHENONE
CAS:898775-57-0
Formula: O=C(C1=CC=C(CN2CCCCC2)C=C1)C3=CC(Cl)=CC=C3Cl
BD312055
95+%
MFCD03841479
2,5-DICHLORO-4'-PYRROLIDINOMETHYL BENZOPHENONE
CAS:898776-83-5
Formula: O=C(C1=CC=C(CN2CCCC2)C=C1)C3=CC(Cl)=CC=C3Cl
BD312175
95+%
MFCD03841536
2,5-DICHLORO-4'-THIOMORPHOLINOMETHYL BENZOPHENONE
CAS:898783-14-7
Formula: O=C(C1=CC=C(CN2CCSCC2)C=C1)C3=CC(Cl)=CC=C3Cl
BD312759
95+%
MFCD03841763
2,5-DICHLORO-4,6-DIIODOPYRIDIN-3-OL
CAS:1261365-34-7
Formula: OC1=C(I)C(Cl)=C(I)N=C1Cl
BD314698
95+%
MFCD18374111
2,5-DICHLORO-4,6-DIMETHYLNICOTINIC ACID
CAS:142266-66-8
Formula: O=C(O)C1=C(Cl)N=C(C)C(Cl)=C1C
BD238231
95+%
MFCD02932725
2,5-DICHLORO-4,6-DIMETHYLNICOTINONITRILE
CAS:91591-63-8
Formula: CC1=C(C(=NC(=C1Cl)C)Cl)C#N
BD67504
98%
MFCD00052631
2,5-DICHLORO-4,6-DIMETHYLPYRIMIDINE
CAS:19573-83-2
Formula: CC1=C(Cl)C(C)=NC(Cl)=N1
BD271316
95+%
MFCD25960625
2,5-DICHLORO-4-(1,1,2,3,3,3-HEXAFLUOROPROPOXY) ANILINE
CAS:103015-84-5
Formula: NC1=CC(Cl)=C(OC(F)(F)C(F)C(F)(F)F)C=C1Cl
BD232773
95+%
MFCD17170052
2,5-DICHLORO-4-(1H-PYRROL-1-YL)ANILINE
CAS:175135-55-4
Formula: NC1=CC(Cl)=C(N2C=CC=C2)C=C1Cl
BD67501
95+%
2,5-DICHLORO-4-(3-METHYL-5-OXO-4,5-DIHYDRO-1H-PYRAZOL-1-YL) BENZENESULFONIC ACID
CAS:84-57-1
Formula: O=S(C1=CC(Cl)=C(N2N=C(C)CC2=O)C=C1Cl)(O)=O
BD12668
95+%
MFCD00035706
2,5-DICHLORO-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL) PYRIDINE
CAS:1073353-98-6
Formula: CC1(C)OB(OC1(C)C)C1=CC(Cl)=NC=C1Cl
BD236033
95+%
MFCD06798256
2,5-DICHLORO-4-(4-METHOXYPHENOXY) PYRIMIDINE
CAS:358978-09-3
Formula: COC1=CC=C(OC2=NC(Cl)=NC=C2Cl)C=C1
BD281680
95+%
MFCD22715650
2,5-DICHLORO-4-(DIFLUOROMETHOXY) ANILINE
CAS:1804421-14-4
Formula: NC1=CC(Cl)=C(OC(F)F)C=C1Cl
BD462165
97%
MFCD28785183
2,5-DICHLORO-4-(DIFLUOROMETHYL)PYRIDINE
CAS:1374659-30-9
Formula: FC(C1=CC(Cl)=NC=C1Cl)F
BD304296
95+%
MFCD22199291
2,5-DICHLORO-4-AMINOPHENOL
CAS:50392-39-7
Formula: ClC1=C(C=C(C(=C1)N)Cl)O
BD21055
96%
MFCD09743861
2,5-DICHLORO-4-CYCLOPROPOXYPYRIMIDINE
CAS:1823893-30-6
Formula: ClC1=CN=C(Cl)N=C1OC2CC2
BD440320
97%
MFCD26406915
2,5-DICHLORO-4-ETHOXYPYRIMIDINE
CAS:1351762-11-2
Formula: CCOC1=NC(Cl)=NC=C1Cl
BD329131
95+%
MFCD23161540
2,5-DICHLORO-4-FLUOROANILINE
CAS:2729-37-5
Formula: NC1=CC(Cl)=C(F)C=C1Cl
BD479843
97%
MFCD06808808
2,5-DICHLORO-4-FLUOROBENZENETHIOL
CAS:1349718-28-0
Formula: SC1=CC(Cl)=C(F)C=C1Cl
BD459971
97%
MFCD20233377
2,5-DICHLORO-4-FLUOROPYRIDINE
CAS:1214350-63-6
Formula: FC1=CC(Cl)=NC=C1Cl
BD455301
97%
MFCD13185533
2,5-DICHLORO-4-IODO-3-METHOXYPYRIDINE
CAS:1299607-34-3
Formula: COC1=C(I)C(Cl)=CN=C1Cl
BD602787
97%
MFCD18803486
2,5-DICHLORO-4-IODOPYRIDINE
CAS:796851-03-1
Formula: IC1=CC(Cl)=NC=C1Cl
BD160294
98%
MFCD13185538
2,5-DICHLORO-4-ISOPROPOXYANILINE
CAS:478399-40-5
Formula: NC1=CC(Cl)=C(OC(C)C)C=C1Cl
BD284439
95+%
2,5-DICHLORO-4-ISOPROPOXYBENZALDEHYDE
CAS:1707584-13-1
Formula: O=CC1=CC(Cl)=C(OC(C)C)C=C1Cl
BD621198
97%
2,5-DICHLORO-4-ISOPROPOXYBENZOIC ACID
CAS:1431727-75-1
Formula: O=C(O)C1=CC(Cl)=C(OC(C)C)C=C1Cl
BD616890
97%
2,5-DICHLORO-4-ISOPROPOXYPYRIMIDINE
CAS:1351762-13-4
Formula: CC(OC1=NC(Cl)=NC=C1Cl)C
BD440321
97%
MFCD23737398
2,5-DICHLORO-4-METHOXYANILINE
CAS:101251-23-4
Formula: NC1=CC(Cl)=C(OC)C=C1Cl
BD473252
97%
MFCD16606083
2,5-DICHLORO-4-METHOXYBENZOIC ACID
CAS:2500-03-0
Formula: O=C(O)C1=CC(Cl)=C(OC)C=C1Cl
BD517161
95%
MFCD00214270
2,5-DICHLORO-4-METHOXYPYRIDINE
CAS:1122090-95-2
Formula: COC1=CC(Cl)=NC=C1Cl
BD225293
95+%
MFCD13185541
2,5-DICHLORO-4-METHOXYPYRIMIDINE
CAS:5750-74-3
Formula: COC1=C(Cl)C=NC(Cl)=N1
BD234943
95+%
MFCD11858598
2,5-DICHLORO-4-METHYL-1H-BENZO[D]IMIDAZOLE
CAS:N/A
BD00788974
2,5-DICHLORO-4-METHYLANILINE
CAS:88434-66-6
Formula: NC1=CC(Cl)=C(C)C=C1Cl
BD281758
95+%
MFCD20690650
2,5-DICHLORO-4-METHYLBENZOIC ACID
CAS:21460-88-8
Formula: O=C(O)C1=CC(Cl)=C(C)C=C1Cl
BD449862
97%
MFCD24479896
2,5-DICHLORO-4-METHYLPYRIDINE
CAS:886365-00-0
Formula: CC1=CC(Cl)=NC=C1Cl
BD167413
97%
MFCD07375099
2,5-DICHLORO-4-METHYLPYRIMIDINE
CAS:1192064-63-3
Formula: ClC1=NC=C(C(=N1)C)Cl
BD161373
97%
MFCD13193656
2,5-DICHLORO-4-METHYLTHIOPHENE-3-CARBALDEHYDE
CAS:210098-00-3
Formula: O=CC1=C(Cl)SC(Cl)=C1C
BD281528
95+%
MFCD24685978
2,5-DICHLORO-4-NITROANILINE
CAS:6627-34-5
Formula: NC1=CC(Cl)=C([N+]([O-])=O)C=C1Cl
BD9826
97%
MFCD00025157
2,5-DICHLORO-4-NITROPHENOL
CAS:5847-57-4
Formula: OC1=C(Cl)C=C(C(Cl)=C1)[N+]([O-])=O
BD237518
95+%
MFCD08689866
2,5-DICHLORO-6-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL) QUINAZOLINE
CAS:N/A
Formula: ClC1=C(B2OC(C)(C)C(C)(C)O2)C=CC3=C1C=NC(Cl)=N3
BD443283
97%
MFCD28405536
2,5-DICHLORO-6-(HYDROXYMETHYL) -4-IODOPYRIDIN-3-OL
CAS:1261365-52-9
Formula: OC1=C(I)C(Cl)=C(CO)N=C1Cl
BD314710
95+%
MFCD18374112
2,5-DICHLORO-6-(HYDROXYMETHYL) PYRIDIN-3-OL
CAS:1261365-99-4
Formula: OC1=CC(Cl)=C(CO)N=C1Cl
BD314741
95+%
MFCD18374106
2,5-DICHLORO-6-(TRIFLUOROMETHYL)PYRIMIDIN-4-AMINE
CAS:84737-30-4
Formula: NC1=NC(Cl)=NC(C(F)(F)F)=C1Cl
BD264835
95+%
2,5-DICHLORO-6-CYCLOPROPYLNICOTINONITRILE
CAS:1135283-17-8
Formula: N#CC1=C(Cl)N=C(C2CC2)C(Cl)=C1
BD200935
95+%
MFCD11840988
2,5-DICHLORO-6-FLUORO-1H-BENZO[D]IMIDAZOLE
CAS:142356-65-8
Formula: FC1=C(Cl)C=C2N=C(Cl)NC2=C1
BD497766
97%
MFCD12963758
2,5-DICHLORO-6-IODO-3-METHOXYPYRIDINE
CAS:1261365-95-0
Formula: COC1=CC(Cl)=C(I)N=C1Cl
BD314738
95+%
MFCD18374115
2,5-DICHLORO-6-IODONICOTINALDEHYDE
CAS:1299607-54-7
Formula: O=CC1=C(Cl)N=C(I)C(Cl)=C1
BD582096
97%
MFCD18803498
2,5-DICHLORO-6-IODOPYRIDIN-3-OL
CAS:1261365-62-1
Formula: OC1=CC(Cl)=C(I)N=C1Cl
BD314715
95+%
MFCD18374107
2,5-DICHLORO-6-METHOXY-4-METHYLNICOTINONITRILE
CAS:886047-45-6
Formula: N#CC1=C(Cl)N=C(OC)C(Cl)=C1C
BD163380
97%
2,5-DICHLORO-6-METHYL-3-NITROPYRIDINE
CAS:1624260-64-5
Formula: O=[N+](C1=CC(Cl)=C(C)N=C1Cl)[O-]
BD289543
95+%
MFCD26792314
2,5-DICHLORO-7-METHOXYQUINAZOLIN-4(3H)-ONE
CAS:601516-86-3
Formula: OC1=C2C(Cl)=CC(OC)=CC2=NC(Cl)=N1
BD633793
97%
2,5-DICHLORO-7H-PYRROLO[2,3-D]PYRIMIDINE
CAS:N/A
Formula: ClC1C2C(=NC(=NC=2)Cl)NC=1
BD00721591
95%
n/a
2,5-DICHLORO-8-METHOXYQUINAZOLINE
CAS:953040-09-0
Formula: COC1=CC=C(Cl)C2=CN=C(Cl)N=C12
BD633833
97%
2,5-DICHLORO-8-METHYLQUINOLINE-4-CARBOXYLIC ACID
CAS:1267302-08-8
Formula: O=C(C1=CC(Cl)=NC2=C(C)C=CC(Cl)=C12)O
BD608975
97%
2,5-DICHLORO-N,N-DIMETHYLBENZENESULFONAMIDE
CAS:88522-19-4
Formula: O=S(C1=CC(Cl)=CC=C1Cl)(N(C)C)=O
BD324364
95+%
MFCD01211994
2,5-DICHLORO-N-(2-(ISOPROPYLSULFONYL)PHENYL)PYRIMIDIN-4-AMINE
CAS:761440-16-8
Formula: CC(C)S(=O)(=O)C1=C(NC2=C(Cl)C=NC(Cl)=N2)C=CC=C1
BD237827
98%
MFCD12827956
2,5-DICHLORO-N-(5-METHYL-1H-PYRAZOL-3-YL)PYRIMIDIN-4-AMINE
CAS:543712-81-8
Formula: CC1=CC(NC2=NC(Cl)=NC=C2Cl)=NN1
BD316941
97%
n/a
2,5-DICHLORO-N-(PYRROLIDIN-2-YLMETHYL)ANILINE OXALATE
CAS:1177285-53-8
Formula: ClC1=CC=C(Cl)C(NCC2NCCC2)=C1.O=C(O)C(O)=O
BD321425
95+%
MFCD08277114
2,5-DICHLORO-N-ETHYLANILINE
CAS:42265-81-6
Formula: CCNC1=CC(Cl)=CC=C1Cl
BD28700
95+%
MFCD06658423
2,5-DICHLORO-N-METHOXY-N-METHYLISONICOTINAMIDE
CAS:864674-17-9
Formula: O=C(N(OC)C)C1=C(Cl)C=NC(Cl)=C1
BD448918
97%
MFCD15526781
2,5-DICHLORO-N-METHYLANILINE HYDROCHLORIDE
CAS:1193389-58-0
Formula: CNC1=CC(Cl)=CC=C1Cl.[H]Cl
BD230524
95+%
2,5-DICHLORO-N-METHYLBENZENESULFONAMIDE
CAS:6326-15-4
Formula: O=S(C1=CC(Cl)=CC=C1Cl)(NC)=O
BD323976
95+%
MFCD01211993
2,5-DICHLORO-N-METHYLPYRIMIDIN-4-AMINE
CAS:940927-35-5
Formula: CNC1=NC(Cl)=NC=C1Cl
BD246616
95+%
2,5-DICHLORO-P-XYLENE
CAS:1124-05-6
Formula: CC1=CC(Cl)=C(C)C=C1Cl
BD41185
98%
MFCD00000610
2,5-DICHLOROBENZALDEHYDE
CAS:6361-23-5
Formula: C1=C(C(=CC=C1Cl)Cl)C=O
BD34447
95%
MFCD00156140
2,5-DICHLOROBENZAMIDE
CAS:5980-26-7
Formula: O=C(N)C1=CC(Cl)=CC=C1Cl
BD227240
97%
MFCD00017609
2,5-DICHLOROBENZENE-1,3-DISULFONYL DICHLORIDE
CAS:111228-71-8
Formula: O=S(C1=CC(Cl)=CC(S(=O)(Cl)=O)=C1Cl)(Cl)=O
BD267689
95+%
MFCD00625741
2,5-DICHLOROBENZENE-1,4-DIAMINE
CAS:20103-09-7
Formula: NC1=CC(Cl)=C(N)C=C1Cl
BD218887
98%
MFCD00007902
2,5-DICHLOROBENZENE-1-SULFONYL CHLORIDE
CAS:5402-73-3
Formula: ClC1=CC(=C(Cl)C=C1)S(Cl)(=O)=O
BD3148
98%
MFCD00007429
2,5-DICHLOROBENZENESULFONAMIDE
CAS:7720-45-8
Formula: O=S(C1=CC(Cl)=CC=C1Cl)(N)=O
BD67517
97%
2,5-DICHLOROBENZENESULFONOHYDRAZIDE
CAS:6775-66-2
Formula: O=S(C1=CC(Cl)=CC=C1Cl)(NN)=O
BD177231
95+%
MFCD00159279
2,5-DICHLOROBENZOHYDRAZIDE
CAS:67487-35-8
Formula: O=C(NN)C1=CC(Cl)=CC=C1Cl
BD4549
97%
2,5-DICHLOROBENZOIC ACID
CAS:50-79-3
Formula: C1=C(Cl)C=CC(=C1C(O)=O)Cl
BD4157
98%
MFCD00002416
2,5-DICHLOROBENZOOXAZOLE
CAS:3621-81-6
Formula: ClC1=NC2=C(O1)C=CC(=C2)Cl
BD20439
98%
MFCD09264312
2,5-DICHLOROBENZOTHIAZOLE
CAS:2941-48-2
Formula: ClC1=CC=C(SC(Cl)=N2)C2=C1
BD157724
97%
MFCD00044024
2,5-DICHLOROBENZYL CYANIDE
CAS:3218-50-6
Formula: ClC1=CC=C(Cl)C(CC#N)=C1
BD33202
98%
MFCD02671209
2,5-DICHLOROCYCLOHEXA-2,5-DIENE-1,4-DIONE
CAS:615-93-0
Formula: O=C1C(Cl)=CC(C(Cl)=C1)=O
BD3082
95+%
MFCD00041736
2,5-DICHLOROISONICOTINALDEHYDE
CAS:102645-33-0
Formula: O=CC1=C(Cl)C=NC(Cl)=C1
BD17316
97%
MFCD06410679
2,5-DICHLOROISONICOTINAMIDE
CAS:1221791-56-5
Formula: O=C(N)C1=C(Cl)C=NC(Cl)=C1
BD207847
95+%
2,5-DICHLOROISONICOTINIC ACID
CAS:88912-26-9
Formula: O=C(O)C1=C(Cl)C=NC(Cl)=C1
BD23000
98%
MFCD00466640
2,5-DICHLOROISONICOTINONITRILE
CAS:102645-35-2
Formula: ClC1=NC=C(Cl)C(=C1)C#N
BD207848
95+%
MFCD13185482
2,5-DICHLORONICOTINAMIDE
CAS:75291-86-0
Formula: O=C(N)C1=C(Cl)N=CC(Cl)=C1
BD67540
97%
MFCD00204159
2,5-DICHLORONICOTINIC ACID
CAS:59782-85-3
Formula: ClC1=C(C(=O)O)C=C(C=N1)Cl
BD21687
97%
MFCD01861979
2,5-DICHLORONICOTINONITRILE
CAS:126954-66-3
Formula: N#CC1=C(Cl)N=CC(Cl)=C1
BD206300
97%
MFCD13185481
2,5-DICHLORONICOTINOYL CHLORIDE
CAS:78686-87-0
Formula: O=C(Cl)C1=C(Cl)N=CC(Cl)=C1
BD67559
95+%
MFCD00210149
2,5-DICHLOROPENTAN-1-AMINE HYDROCHLORIDE
CAS:62922-45-6
Formula: NCC(Cl)CCCCl.[H]Cl
BD67544
95+%
MFCD00012877
2,5-DICHLOROPHENYLBORONIC ACID
CAS:135145-90-3
Formula: OB(O)C1=C(Cl)C=CC(Cl)=C1
BD9870
98%
MFCD01863182
2,5-DICHLOROPHENYLHYDRAZINE
CAS:305-15-7
Formula: NNC1=C(Cl)C=CC(Cl)=C1
BD3463
98%
MFCD00007576
2,5-DICHLOROPHENYLSULFONYLETHANOL
CAS:107737-91-7
Formula: OCCS(=O)(C1=CC(Cl)=CC=C1Cl)=O
BD322410
95+%
MFCD03789220
2,5-DICHLOROPYRAZINE
CAS:19745-07-4
Formula: C1=NC(=CN=C1Cl)Cl
BD32490
97+%
MFCD04117886
2,5-DICHLOROPYRIDIN-3-OL
CAS:53335-73-2
Formula: OC1=CC(Cl)=CN=C1Cl
BD297241
95+%
MFCD13185537
2,5-DICHLOROPYRIDIN-4-AMINE
CAS:405230-82-2
Formula: NC1=CC(Cl)=NC=C1Cl
BD231155
98%
MFCD11044256
2,5-DICHLOROPYRIDIN-4-OL
CAS:847664-65-7
Formula: OC1=CC(Cl)=NC=C1Cl
BD67507
97%
MFCD01861982
2,5-DICHLOROPYRIDINE
CAS:16110-09-1
Formula: C1=CC(=NC=C1Cl)Cl
BD18681
98%
MFCD00006239
2,5-DICHLOROPYRIDINE-3,4-DIAMINE
CAS:405230-94-6
Formula: NC1=C(N)C(Cl)=CN=C1Cl
BD248719
95+%
MFCD19690311
2,5-DICHLOROPYRIDINE-3-BORONIC ACID
CAS:536693-97-7
Formula: OB(O)C1=CC(Cl)=CN=C1Cl
BD28978
95+%
MFCD06659486
2,5-DICHLOROPYRIDINE-3-METHANOL
CAS:558465-93-3
Formula: OCC1=CC(Cl)=CN=C1Cl
BD21461
95+%
MFCD06659487
2,5-DICHLOROPYRIDINE-3-SULFONYL CHLORIDE
CAS:1208081-36-0
Formula: O=S(C1=CC(Cl)=CN=C1Cl)(Cl)=O
BD497644
97%
MFCD15142815
2,5-DICHLOROPYRIDINE-4-BORONIC ACID
CAS:847664-64-6
Formula: OB(C1=CC(Cl)=NC=C1Cl)O
BD35093
98%
MFCD06798254
2,5-DICHLOROPYRIDO[2,3-D]PYRIDAZINE
CAS:1447959-04-7
Formula: ClC1=NN=CC2=NC(Cl)=CC=C21
BD617655
97%
2,5-DICHLOROPYRIDO[3,4-B]PYRAZINE
CAS:1600511-80-5
Formula: ClC1=C(N=CC(Cl)=N2)C2=CC=N1
BD436974
97%
MFCD28670261
2,5-DICHLOROPYRIMIDIN-4-AMINE
CAS:89180-51-8
Formula: NC1=C(Cl)C=NC(Cl)=N1
BD174327
95%
MFCD13191633
2,5-DICHLOROPYRIMIDINE
CAS:22536-67-0
Formula: ClC1=NC=C(C=N1)Cl
BD40845
98%
MFCD00673131
2,5-DICHLOROPYRIMIDINE-4-CARBOXYLIC ACID
CAS:1240594-41-5
Formula: O=C(C1=NC(Cl)=NC=C1Cl)O
BD284182
95+%
2,5-DICHLOROQUINAZOLIN-4(3H)-ONE
CAS:1107694-73-4
Formula: O=C1NC(Cl)=NC2=C1C(Cl)=CC=C2
BD225304
95+%
2,5-DICHLOROQUINAZOLIN-4-AMINE
CAS:1107695-06-6
Formula: NC1=C2C(Cl)=CC=CC2=NC(Cl)=N1
BD213154
97%
2,5-DICHLOROQUINAZOLINE
CAS:445041-29-2
Formula: ClC1=NC2=CC=CC(Cl)=C2C=N1
BD167293
95+%
MFCD17215769
2,5-DICHLOROQUINOLIN-8-AMINE
CAS:1935574-21-2
Formula: NC1=C2N=C(Cl)C=CC2=C(Cl)C=C1
BD443203
97%
MFCD28405456
2,5-DICHLOROQUINOLINE
CAS:59412-12-3
Formula: ClC1=C2C=CC(Cl)=NC2=CC=C1
BD247469
95%
MFCD00832074
2,5-DICHLOROQUINOLINE-3-CARBALDEHYDE
CAS:1064137-50-3
Formula: O=CC1=CC2=C(Cl)C=CC=C2N=C1Cl
BD337727
95+%
MFCD22370818
2,5-DICHLOROQUINOXALINE
CAS:55687-05-3
Formula: ClC1=NC2=C(N=C1)C(Cl)=CC=C2
BD226752
97%
MFCD11846477
2,5-DICHLOROTEREPHTHALIC ACID
CAS:13799-90-1
Formula: OC(=O)C1=CC(Cl)=C(C=C1Cl)C(O)=O
BD5611
97%
MFCD00058982
2,5-DICHLOROTEREPHTHALONITRILE
CAS:1897-43-4
Formula: N#CC1=CC(Cl)=C(C#N)C=C1Cl
BD67566
97%
MFCD00059584
2,5-DICHLOROTHIAZOLE-4-CARBALDEHYDE
CAS:929910-36-1
Formula: O=CC1=C(Cl)SC(Cl)=N1
BD260443
95+%
2,5-DICHLOROTHIAZOLE-4-CARBONITRILE
CAS:127426-26-0
Formula: N#CC1=C(Cl)SC(Cl)=N1
BD250535
98%
2,5-DICHLOROTHIAZOLE-4-CARBOXAMIDE
CAS:127426-27-1
Formula: O=C(C1=C(Cl)SC(Cl)=N1)N
BD260024
95+%
2,5-DICHLOROTHIAZOLE-4-CARBOXYLIC ACID
CAS:127426-30-6
Formula: ClC1=NC(=C(S1)Cl)C(=O)O
BD159329
95%
MFCD16615251
2,5-DICHLOROTHIAZOLO[5,4-D]THIAZOLE
CAS:50616-95-0
Formula: ClC(S1)=NC2=C1N=C(Cl)S2
BD492940
97%
2,5-DICHLOROTHIOBENZAMIDE
CAS:69622-81-7
Formula: NC(C1=CC(Cl)=CC=C1Cl)=S
BD308607
95+%
MFCD09025686
2,5-DICHLOROTHIOPHENE-3,4-DICARBALDEHYDE
CAS:55581-76-5
Formula: O=CC1=C(Cl)SC(Cl)=C1C=O
BD281531
95+%
2,5-DICHLOROTHIOPHENE-3-CARBALDEHYDE
CAS:61200-60-0
Formula: ClC1=C(C=C(S1)Cl)C=O
BD67569
98%
MFCD01571097
2,5-DICHLOROTHIOPHENE-3-CARBOXYLIC ACID
CAS:36157-41-2
Formula: O=C(C1=C(Cl)SC(Cl)=C1)O
BD2515
97%
MFCD00082908
2,5-DICHLOROTHIOPHENE-3-SULFONAMIDE
CAS:53595-68-9
Formula: NS(=O)(=O)C1=C(Cl)SC(Cl)=C1
BD9386
95+%
MFCD00767573
2,5-DICHLOROTHIOPHENE-3-SULFONYL CHLORIDE
CAS:56946-83-9
Formula: O=S(C1=C(Cl)SC(Cl)=C1)(Cl)=O
BD21531
95+%
MFCD00051665
2,5-DIETHOXY-4-(P-TOLYLTHIO)ANILINE
CAS:68400-48-6
Formula: NC1=CC(OCC)=C(SC2=CC=C(C)C=C2)C=C1OCC
BD16739
95+%
MFCD00129825
2,5-DIETHOXY-4-MORPHOLINOANILINE DIHYDROCHLORIDE
CAS:136334-84-4
Formula: NC1=CC(OCC)=C(N2CCOCC2)C=C1OCC.[H]Cl.[H]Cl
BD67588
95+%
2,5-DIETHOXY-4-NITROANILINE
CAS:56185-25-2
Formula: NC1=CC(OCC)=C([N+]([O-])=O)C=C1OCC
BD625685
97%
2,5-DIETHOXYANILINE
CAS:94-85-9
Formula: NC1=CC(OCC)=CC=C1OCC
BD67590
95+%
MFCD00015144
2,5-DIETHOXYBENZALDEHYDE
CAS:4686-98-0
Formula: O=CC1=CC(OCC)=CC=C1OCC
BD67591
97%
MFCD02093696
2,5-DIETHOXYBENZENETHIOL
CAS:29236-93-9
Formula: SC1=CC(OCC)=CC=C1OCC
BD492941
97%
2,5-DIETHOXYPYRAZINE
CAS:38629-25-3
Formula: CCOC1=CN=C(OCC)C=N1
BD264820
95+%
2,5-DIETHOXYTETRAHYDROFURAN
CAS:3320-90-9
Formula: N/A
BD67594
95%
n/a
2,5-DIETHYL-1H-PYRROLE
CAS:766-95-0
Formula: CCC1=CC=C(CC)N1
BD235014
95+%
MFCD18427143
2,5-DIETHYL-3,6-DIMETHYLPYRAZINE
CAS:18903-30-5
Formula: CCC1=NC(C)=C(CC)N=C1C
BD238949
95+%
MFCD18449287
2,5-DIETHYL-6-METHYLTHIENO[2,3-D]PYRIMIDINE-4-THIOL
CAS:917747-85-4
Formula: SC1=C(C(CC)=C(C)S2)C2=NC(CC)=N1
BD598868
97%
MFCD08898752
2,5-DIETHYLPYRAZINE
CAS:13238-84-1
Formula: CCC1=CN=C(CC)C=N1
BD67598
95+%
MFCD06657570
2,5-DIETHYLTHIOPHENE
CAS:5069-23-8
Formula: CCC1=CC=C(CC)S1
BD246239
95+%
MFCD11656329
2,5-DIETHYNYLANILINE
CAS:137000-70-5
Formula: NC1=CC(C#C)=CC=C1C#C
BD241343
95+%
2,5-DIFLUORO-1-METHOXY-3-NITROBENZENE
CAS:1803826-15-4
Formula: COC1=CC(F)=CC([N+]([O-])=O)=C1F
BD482617
95%
MFCD28790589
2,5-DIFLUORO-3-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL) ANILINE
CAS:1269233-00-2
Formula: NC1=CC(F)=CC(B2OC(C)(C)C(C)(C)O2)=C1F
BD334275
95+%
MFCD22189455
2,5-DIFLUORO-3-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL) PYRIDINE
CAS:1256358-86-7
Formula: CC1(C)OB(OC1(C)C)C1=CC(F)=CN=C1F
BD236214
95+%
MFCD17926496
2,5-DIFLUORO-3-(TRIFLUOROMETHYL)ANILINE
CAS:1682-26-4
Formula: NC1=CC(F)=CC(C(F)(F)F)=C1F
BD323366
95+%
MFCD20695812
2,5-DIFLUORO-3-IODOPYRIDINE
CAS:1214377-11-3
Formula: IC1=CC(F)=CN=C1F
BD751431
97%
2,5-DIFLUORO-3-METHYLBENZOIC ACID
CAS:1003710-01-7
Formula: O=C(O)C1=CC(F)=CC(C)=C1F
BD160403
97%
MFCD09835286
2,5-DIFLUORO-3-METHYLBENZONITRILE
CAS:1003712-20-6
Formula: N#CC1=CC(F)=CC(C)=C1F
BD160404
98%
MFCD09996954
2,5-DIFLUORO-3-NITROBENZALDEHYDE
CAS:1803824-20-5
Formula: O=CC1=CC(F)=CC([N+]([O-])=O)=C1F
BD266448
95+%
2,5-DIFLUORO-3-NITROBENZAMIDE
CAS:1701869-33-1
Formula: O=C(N)C1=CC(F)=CC([N+]([O-])=O)=C1F
BD266432
95+%
2,5-DIFLUORO-3-NITROBENZOIC ACID
CAS:741721-49-3
Formula: O=C(O)C1=CC(F)=CC([N+]([O-])=O)=C1F
BD266741
97%
MFCD11848537
2,5-DIFLUORO-3-NITROBENZONITRILE
CAS:1690818-46-2
Formula: N#CC1=CC(F)=CC([N+]([O-])=O)=C1F
BD266433
95+%
2,5-DIFLUORO-3-NITROBENZOTRIFLUORIDE
CAS:2837-22-1
Formula: FC(F)(F)C1=CC(F)=CC([N+]([O-])=O)=C1F
BD323566
95+%
MFCD22375209
2,5-DIFLUORO-3-NITROPYRIDINE
CAS:179558-82-8
Formula: O=[N+](C1=CC(F)=CN=C1F)[O-]
BD286600
97%
2,5-DIFLUORO-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL) PYRIDINE
CAS:1622217-35-9
Formula: CC1(C)C(C)(C)OB(C2=CC(F)=NC=C2F)O1
BD326805
95+%
MFCD18712644
2,5-DIFLUORO-4-(METHYLSULFONYL)ANILINE
CAS:1147557-75-2
Formula: NC1=CC(F)=C(S(=O)(C)=O)C=C1F
BD283501
95+%
MFCD20259003
2,5-DIFLUORO-4-(TRIFLUOROMETHYL)BENZOIC ACID
CAS:261945-05-5
Formula: O=C(O)C1=CC(F)=C(C(F)(F)F)C=C1F
BD257998
95+%
MFCD01631618
2,5-DIFLUORO-4-FORMYLBENZONITRILE
CAS:433940-02-4
Formula: O=CC1=CC(F)=C(C#N)C=C1F
BD334359
95+%
MFCD16876871
2,5-DIFLUORO-4-HYDRAZINYLBENZONITRILE
CAS:129946-63-0
Formula: NNC1=CC(F)=C(C=C1F)C#N
BD67601
95+%
MFCD04972812
2,5-DIFLUORO-4-HYDROXYBENZALDEHYDE
CAS:918523-99-6
Formula: O=CC1=CC(F)=C(O)C=C1F
BD67602
98%
MFCD04112521
2,5-DIFLUORO-4-IODOANILINE
CAS:155906-13-1
Formula: NC1=CC(F)=C(I)C=C1F
BD286650
98%
MFCD07774188
2,5-DIFLUORO-4-IODOPYRIDINE
CAS:1017793-20-2
Formula: FC1=CN=C(F)C=C1I
BD213074
98%
MFCD11040606
2,5-DIFLUORO-4-METHOXYANILINE
CAS:394223-61-1
Formula: NC1=CC(F)=C(OC)C=C1F
BD215272
95+%
MFCD18394891
2,5-DIFLUORO-4-METHOXYBENZALDEHYDE
CAS:879093-08-0
Formula: O=CC1=CC(F)=C(OC)C=C1F
BD67603
98%
MFCD06246882
2,5-DIFLUORO-4-METHOXYBENZENE-1-SULFONYL CHLORIDE
CAS:1208075-47-1
Formula: O=S(C1=CC(F)=C(OC)C=C1F)(Cl)=O
BD496225
97%
MFCD12026236
2,5-DIFLUORO-4-METHOXYBENZENESULFONAMIDE
CAS:1208075-55-1
Formula: O=S(C1=CC(F)=C(OC)C=C1F)(N)=O
BD481649
97%
MFCD12026276
2,5-DIFLUORO-4-METHOXYBENZOIC ACID
CAS:1060739-01-6
Formula: COC1=CC(F)=C(C=C1F)C(O)=O
BD237703
97%
MFCD11847151
2,5-DIFLUORO-4-METHOXYPHENOL
CAS:1024068-86-7
Formula: OC1=CC(F)=C(OC)C=C1F
BD472934
95%
MFCD06246893
2,5-DIFLUORO-4-METHYLANILINE
CAS:878285-14-4
Formula: CC1=CC(F)=C(N)C=C1F
BD215220
95+%
MFCD11519027
2,5-DIFLUORO-4-METHYLBENZOIC ACID
CAS:103877-80-1
Formula: O=C(O)C1=CC(F)=C(C)C=C1F
BD29991
97%
MFCD08063230
2,5-DIFLUORO-4-METHYLBENZONITRILE
CAS:1003708-66-4
Formula: N#CC1=CC(F)=C(C)C=C1F
BD160405
95+%
2,5-DIFLUORO-4-NITROANILINE
CAS:1542-36-5
Formula: NC1=CC(F)=C([N+]([O-])=O)C=C1F
BD233203
95+%
MFCD11519059
2,5-DIFLUORO-4-NITROBENZALDEHYDE
CAS:1160474-72-5
Formula: O=CC1=CC(F)=C([N+]([O-])=O)C=C1F
BD201227
95+%
n/a
2,5-DIFLUORO-4-NITROBENZOIC ACID
CAS:116465-48-6
Formula: O=C(O)C1=CC(F)=C([N+]([O-])=O)C=C1F
BD17666
95%
MFCD03425705
2,5-DIFLUORO-4-NITROBENZONITRILE
CAS:172921-32-3
Formula: N#CC1=CC(F)=C([N+]([O-])=O)C=C1F
BD297146
95+%
MFCD13185567
2,5-DIFLUORO-4-THIOCYANATOANILINE
CAS:1150339-43-7
Formula: NC1=CC(F)=C(SC#N)C=C1F
BD304503
95+%
n/a
2,5-DIFLUORO-4-THIOCYANATOANILINE, HCL
CAS:1150114-25-2
Formula: NC1=CC(F)=C(SC#N)C=C1F.[H]Cl
BD324939
95+%
MFCD11855821
2,5-DIFLUORO-N-HYDROXYBENZIMIDAMIDE
CAS:885957-32-4
Formula: N=C(NO)C1=CC(F)=CC=C1F
BD294232
95+%
2,5-DIFLUORO-N-METHOXY-N-METHYLNICOTINAMIDE
CAS:1263316-53-5
Formula: O=C(N(OC)C)C1=C(F)N=CC(F)=C1
BD751357
97%
2,5-DIFLUORO-PHENOXYACETONITRILE
CAS:857279-52-8
Formula: N#CCOC1=CC(F)=CC=C1F
BD324297
95+%
MFCD09475444
2,5-DIFLUORO-PYRIDINE-4-CARBALDEHYDE
CAS:1227602-08-5
Formula: O=CC1=CC(F)=NC=C1F
BD322670
95+%
MFCD12756646
2,5-DIFLUOROANILINE
CAS:367-30-6
Formula: C1=C(F)C=CC(=C1N)F
BD9909
98%
MFCD00007651
2,5-DIFLUOROBENZALDEHYDE
CAS:2646-90-4
Formula: C1=CC(=C(C=C1F)C=O)F
BD4213
97+%
MFCD00010327
2,5-DIFLUOROBENZAMIDE
CAS:85118-03-2
Formula: O=C(N)C1=CC(F)=CC=C1F
BD291135
97%
2,5-DIFLUOROBENZENESULFONAMIDE
CAS:120022-63-1
Formula: NS(=O)(=O)C1=C(F)C=CC(F)=C1
BD3386
98%
MFCD00798115
2,5-DIFLUOROBENZOHYDRAZIDE
CAS:265644-03-9
Formula: NNC(=O)C1=C(F)C=CC(F)=C1
BD236820
95+%
MFCD02183537
2,5-DIFLUOROBENZOIC ACID
CAS:2991-28-8
Formula: O=C(O)C1=CC(F)=CC=C1F
BD10285
98%
MFCD00002410
2,5-DIFLUOROBENZONITRILE
CAS:64248-64-2
Formula: FC1=CC(C#N)=C(F)C=C1
BD10202
98%
MFCD00001777
2,5-DIFLUOROBENZOTHIOHYDRAZIDE 2,2,2-TRIFLUOROACETATE
CAS:1956363-93-1
Formula: NNC(C1=CC(F)=CC=C1F)=S.O=C(O)C(F)(F)F
BD337448
95+%
MFCD28991777
2,5-DIFLUOROBENZOYL CHLORIDE
CAS:35730-09-7
Formula: O=C(Cl)C1=CC(F)=CC=C1F
BD33376
95+%
MFCD00009929
2,5-DIFLUOROBENZYL CARBAMIMIDOTHIOATE HYDROBROMIDE
CAS:1197237-07-2
Formula: N=C(SCC1=CC(F)=CC=C1F)N.[H]Br
BD568183
97%
2,5-DIFLUOROISONICOTINIC ACID
CAS:851386-39-5
Formula: O=C(O)C1=C(F)C=NC(F)=C1
BD168817
95+%
MFCD09031179
2,5-DIFLUOROISONICOTINONITRILE
CAS:1214331-33-5
Formula: N#CC1=C(F)C=NC(F)=C1
BD261899
95+%
MFCD12756649
2,5-DIFLUORONICOTINALDEHYDE
CAS:1227602-25-6
Formula: O=CC1=C(F)N=CC(F)=C1
BD236766
95+%
MFCD16606480
2,5-DIFLUORONICOTINAMIDE
CAS:1934952-86-9
Formula: O=C(N)C1=C(F)N=CC(F)=C1
BD465824
97%
2,5-DIFLUORONICOTINIC ACID
CAS:851386-43-1
Formula: O=C(O)C1=C(F)N=CC(F)=C1
BD67645
95+%
2,5-DIFLUORONICOTINONITRILE
CAS:1214350-46-5
Formula: N#CC1=C(F)N=CC(F)=C1
BD460998
97%
2,5-DIFLUORONITROBENZENE
CAS:364-74-9
Formula: C1=C(F)C=CC(=C1[N+](=O)[O-])F
BD67632
95+%
MFCD00007054
2,5-DIFLUOROPHENYLACETYL CHLORIDE
CAS:157033-23-3
Formula: O=C(Cl)CC1=CC(F)=CC=C1F
BD323338
95+%
MFCD03424719
2,5-DIFLUOROPHENYLHYDRAZINE
CAS:97108-50-4
Formula: NNC1=C(F)C=CC(F)=C1
BD3490
98%
MFCD00013384
2,5-DIFLUOROPYRIDIN-3-AMINE
CAS:1214349-97-9
Formula: NC1=CC(F)=CN=C1F
BD751379
97%
2,5-DIFLUOROPYRIDIN-4-AMINE
CAS:189281-61-6
Formula: NC1=CC(F)=NC=C1F
BD279588
95+%
MFCD18261573
2,5-DIHEXYL-3,6-DI(THIOPHEN-2-YL)PYRROLO[3,4-C]PYRROLE-1,4(2H,5H)-DIONE
CAS:852435-01-9
Formula: O=C1N(CCCCCC)C(C2=CC=CS2)=C3C1=C(C4=CC=CS4)N(CCCCCC)C3=O
BD254709
95+%
2,5-DIHYDRO-1-(4-NITROPHENYL)-5-OXO-1H-1,2,4-TRIAZOLE-3-CARBOXYLIC ACID
CAS:854738-30-0
Formula: O=C(C1=NC(N(C2=CC=C([N+]([O-])=O)C=C2)N1)=O)O
BD324291
95+%
MFCD09877953
2,5-DIHYDRO-1H-PYRROLE HYDROCHLORIDE
CAS:63468-63-3
Formula: [H]Cl.N1CC=CC1
BD158278
97%
MFCD09991892
2,5-DIHYDRO-1H-PYRROLE-2-CARBOXYLIC ACID
CAS:3395-35-5
Formula: O=C(C1NCC=C1)O
BD81649
95+%
MFCD00005214
2,5-DIHYDRO-1H-PYRROLE-3-CARBOXYLIC ACID
CAS:72519-12-1
Formula: O=C(C1=CCNC1)O
BD636622
96%
2,5-DIHYDRO-5-OXO-1-PHENYL-1H-1,2,4-TRIAZOLE-3-CARBOXYLIC ACID PHENYLAMIDE
CAS:32589-62-1
Formula: O=C(C1=NC(N(C2=CC=CC=C2)N1)=O)NC3=CC=CC=C3
BD323641
95+%
MFCD09877895
2,5-DIHYDROFURAN-2-CARBOXYLIC ACID
CAS:22694-55-9
Formula: O=C(C1OCC=C1)O
BD32738
97%
MFCD07784085
2,5-DIHYDROTHIOPHENE-3-CARBALDEHYDE
CAS:113772-16-0
Formula: O=CC1=CCSC1
BD67654
95+%
MFCD06375933
2,5-DIHYDROTHIOPHENE-3-SULFONYL CHLORIDE 1,1-DIOXIDE
CAS:112161-61-2
Formula: O=S(C(C1)=CCS1(=O)=O)(Cl)=O
BD183680
95+%
2,5-DIHYDROXY-3,6-DIMETHOXYBENZOIC ACID
CAS:6212-41-5
Formula: O=C(O)C1=C(OC)C(O)=CC(OC)=C1O
BD281653
95+%
MFCD24482687
2,5-DIHYDROXY-3-METHOXYBENZOIC ACID
CAS:5981-38-4
Formula: O=C(O)C1=CC(O)=CC(OC)=C1O
BD281635
95+%
MFCD20639612
2,5-DIHYDROXY-3-TRIDECYLCYCLOHEXA-2,5-DIENE-1,4-DIONE
CAS:573-40-0
Formula: O=C(C(O)=C1)C(CCCCCCCCCCCCC)=C(O)C1=O
BD1107
97%
MFCD00075883
2,5-DIHYDROXY-N-(2-HYDROXYETHYL) BENZAMIDE
CAS:61969-53-7
Formula: O=C(NCCO)C1=CC(O)=CC=C1O
BD67664
97%
2,5-DIHYDROXYBENZALDEHYDE
CAS:1194-98-5
Formula: O=CC1=CC(O)=CC=C1O
BD4701
98%
MFCD00003333
2,5-DIHYDROXYBENZOHYDRAZIDE
CAS:15791-90-9
Formula: O=C(NN)C1=CC(O)=CC=C1O
BD171361
95+%
MFCD01921944
2,5-DIHYDROXYBENZONITRILE
CAS:4640-29-3
Formula: N#CC1=CC(O)=CC=C1O
BD490275
97%
MFCD00797121
2,5-DIHYDROXYCYCLOHEXA-2,5-DIENE-1,4-DIONE
CAS:615-94-1
Formula: O=C(C(O)=C1)C=C(O)C1=O
BD67656
95+%
MFCD00001598
2,5-DIHYDROXYNAPHTHALENE-1,4-DIONE
CAS:4923-55-1
Formula: O=C1C(O)=CC(C2=C1C=CC=C2O)=O
BD295061
95+%
n/a
2,5-DIHYDROXYPHENYL(DIPHENYL)PHOSPHINE OXIDE
CAS:13291-46-8
Formula: OC1=CC=C(O)C(P(C2=CC=CC=C2)(C3=CC=CC=C3)=O)=C1
BD322175
95+%
2,5-DIHYDROXYTEREPHTHALALDEHYDE
CAS:1951-36-6
Formula: O=CC1=CC(O)=C(C=O)C=C1O
BD222966
95+%
2,5-DIHYDROXYTEREPHTHALIC ACID
CAS:610-92-4
Formula: O=C(O)C1=CC(O)=C(C(O)=O)C=C1O
BD6030
98%
MFCD00132933
2,5-DIIODO-1-METHYLIMIDAZOLE
CAS:86026-81-5
Formula: CN1C(I)=CN=C1I
BD29753
95+%
MFCD02179540
2,5-DIIODO-3-(TRIFLUOROMETHYL)PYRIDINE
CAS:1806353-75-2
Formula: FC(C1=CC(I)=CN=C1I)(F)F
BD466744
97%
MFCD28792769
2,5-DIIODO-3-METHOXYPYRIDINE
CAS:1138444-33-3
Formula: COC1=CC(I)=CN=C1I
BD196363
97%
MFCD11857704
2,5-DIIODO-4-METHYL-1H-IMIDAZOLE
CAS:149510-85-0
Formula: CC1=C(I)NC(I)=N1
BD41309
95%
2,5-DIIODOBENZENE-1,4-DIOL
CAS:13064-64-7
Formula: OC1=CC(I)=C(O)C=C1I
BD328828
95+%
MFCD09910095
2,5-DIIODOBENZOHYDRAZIDE
CAS:1023444-89-4
Formula: O=C(NN)C1=CC(I)=CC=C1I
BD601677
97%
MFCD03425684
2,5-DIIODOBENZOIC ACID
CAS:14192-12-2
Formula: OC(=O)C1=C(I)C=CC(I)=C1
BD67672
98%
MFCD00045801
2,5-DIIODOPYRAZINE
CAS:1093418-77-9
Formula: IC1=CN=C(I)C=N1
BD332776
95+%
MFCD23143964
2,5-DIIODOPYRIDIN-3-OL
CAS:1142191-68-1
Formula: OC1=CC(I)=CN=C1I
BD196367
97%
MFCD11857702
2,5-DIIODOPYRIDINE
CAS:116195-81-4
Formula: IC1=CN=C(I)C=C1
BD17661
98%
MFCD00234028
2,5-DIIODOTHIOPHENE
CAS:625-88-7
Formula: IC1=CC=C(I)S1
BD2192
98%
MFCD00014525
2,5-DIISOPROPYLPYRAZINE
CAS:24294-83-5
Formula: CC(C1=CN=C(C(C)C)C=N1)C
BD331018
95+%
MFCD18449282
2,5-DIMETHOXY-1,3-DIMETHYLBENZENE
CAS:14538-50-2
Formula: CC1=C(OC)C(C)=CC(OC)=C1
BD258079
95+%
MFCD07780697
2,5-DIMETHOXY-2,5-DIHYDROFURAN-2-CARBOXAMIDE
CAS:1706452-97-2
Formula: O=C(C1(OC)OC(OC)C=C1)N
BD619776
97%
2,5-DIMETHOXY-3-METHYLPYRIDINE
CAS:1330754-04-5
Formula: CC1=CC(OC)=CN=C1OC
BD563733
97%
MFCD19981664
2,5-DIMETHOXY-3-NITROBENZOIC ACID
CAS:17894-26-7
Formula: O=C(O)C1=CC(OC)=CC([N+]([O-])=O)=C1OC
BD67683
95+%
MFCD00017022
2,5-DIMETHOXY-3-NITROPYRIDINE
CAS:1804518-04-4
Formula: O=[N+](C1=CC(OC)=CN=C1OC)[O-]
BD475051
97%
MFCD28793715
2,5-DIMETHOXY-4-(PIPERIDIN-1-YL)BENZALDEHYDE
CAS:886501-97-9
Formula: O=CC1=CC(OC)=C(N2CCCCC2)C=C1OC
BD598411
97%
MFCD06740051
2,5-DIMETHOXY-4-(PYRROLIDIN-1-YL)BENZALDEHYDE
CAS:692775-87-4
Formula: O=CC1=CC(OC)=C(N2CCCC2)C=C1OC
BD496657
97%
MFCD03995331
2,5-DIMETHOXY-4-METHYLBENZALDEHYDE
CAS:4925-88-6
Formula: COC1=CC(C=O)=C(OC)C=C1C
BD235089
98%
MFCD02253192
2,5-DIMETHOXY-4-MORPHOLINOBENZALDEHYDE
CAS:154519-07-0
Formula: O=CC1=CC(OC)=C(N2CCOCC2)C=C1OC
BD554658
97%
MFCD06740113
2,5-DIMETHOXY-4-NITROANILINE
CAS:6313-37-7
Formula: NC1=CC(OC)=C([N+]([O-])=O)C=C1OC
BD29279
97%
MFCD00007361
2,5-DIMETHOXY-4-NITROBENZALDEHYDE
CAS:1207-59-6
Formula: O=CC1=CC(OC)=C([N+]([O-])=O)C=C1OC
BD556068
97%
MFCD22054475
2,5-DIMETHOXY-N-(THIOPHEN-2-YLMETHYL)ANILINE
CAS:1021029-10-6
Formula: COC1=CC=C(OC)C(NCC2=CC=CS2)=C1
BD601671
97%
MFCD10687632
2,5-DIMETHOXYBENZALDEHYDE
CAS:93-02-7
Formula: O=CC1=CC(OC)=CC=C1OC
BD35450
98%
MFCD00003314
2,5-DIMETHOXYBENZENESULFONAMIDE
CAS:19116-90-6
Formula: O=S(C1=CC(OC)=CC=C1OC)(N)=O
BD5341
95+%
MFCD00833415
2,5-DIMETHOXYBENZENESULFONOHYDRAZIDE
CAS:19116-91-7
Formula: O=S(C1=CC(OC)=CC=C1OC)(NN)=O
BD177232
97%
MFCD03423368
2,5-DIMETHOXYBENZENETHIOL
CAS:1483-27-8
Formula: SC1=CC(OC)=CC=C1OC
BD67735
95+%
MFCD00052738
2,5-DIMETHOXYBENZOHYDRAZIDE
CAS:17894-25-6
Formula: O=C(NN)C1=CC(OC)=CC=C1OC
BD11326
95+%
MFCD00017049
2,5-DIMETHOXYBENZOIC ACID
CAS:2785-98-0
Formula: C1=C(OC)C=CC(=C1C(O)=O)OC
BD6715
98%
MFCD00002436
2,5-DIMETHOXYBENZONITRILE
CAS:5312-97-0
Formula: COC1=CC(C#N)=C(OC)C=C1
BD67708
98%
MFCD00016375
2,5-DIMETHOXYBENZOTHIOAMIDE
CAS:351065-79-7
Formula: NC(C1=CC(OC)=CC=C1OC)=S
BD11296
97%
2,5-DIMETHOXYBENZYL 3-METHYLBUTANOATE
CAS:876665-00-8
Formula: COC1=CC(COC(=O)CC(C)C)=C(OC)C=C1
BD234387
97%
2,5-DIMETHOXYCYCLOHEXA-2,5-DIENE-1,4-DIONE
CAS:3117-03-1
Formula: O=C(C(OC)=C1)C=C(OC)C1=O
BD67681
97%
2,5-DIMETHOXYPHENETHYL ACETATE
CAS:1159550-36-3
Formula: CC(OCCC1=CC(OC)=CC=C1OC)=O
BD588830
97%
2,5-DIMETHOXYPHENETHYL ETHYL OXALATE
CAS:1443314-39-3
Formula: O=C(OCCC1=CC(OC)=CC=C1OC)C(OCC)=O
BD512156
97%
MFCD15145495
2,5-DIMETHOXYPHENOL
CAS:18113-18-3
Formula: COC1=C(C=C(C=C1)OC)O
BD67723
97%
MFCD00094237
2,5-DIMETHOXYPHENYL ACETATE
CAS:27257-06-3
Formula: CC(OC1=CC(OC)=CC=C1OC)=O
BD112112
95+%
MFCD09032517
2,5-DIMETHOXYPYRAZINE
CAS:117856-61-8
Formula: COC1=CN=C(OC)C=N1
BD264819
95+%
MFCD18411892
2,5-DIMETHOXYPYRIDIN-3-AMINE
CAS:1211595-19-5
Formula: NC1=CC(OC)=CN=C1OC
BD325146
95+%
MFCD09038237
2,5-DIMETHOXYPYRIDINE
CAS:867267-24-1
Formula: COC1=CN=C(OC)C=C1
BD00761618
95+%
MFCD12546620
2,5-DIMETHOXYPYRIMIDIN-4(3H)-ONE
CAS:370103-23-4
Formula: O=C1NC(OC)=NC=C1OC
BD248646
98%
MFCD20480733
2,5-DIMETHOXYPYRIMIDIN-4-AMINE
CAS:6960-17-4
Formula: NC1=NC(OC)=NC=C1OC
BD262485
95+%
MFCD20486065
2,5-DIMETHOXYPYRIMIDINE
CAS:16290-94-1
Formula: COC1=CN=C(OC)N=C1
BD210669
95+%
MFCD18411893
2,5-DIMETHOXYTEREPHTHALALDEHYDE
CAS:7310-97-6
Formula: O=CC1=CC(OC)=C(C=O)C=C1OC
BD67731
97%
n/a
2,5-DIMETHOXYTETRAHYDROFURAN-3,4-DIOL
CAS:201464-10-0
Formula: COC1C(O)C(O)C(OC)O1
BD81975
97%
2,5-DIMETHOXYTETRAHYDROFURAN-3-CARBALDEHYDE,MIXTURE OF ISOMERS
CAS:50634-05-4
Formula: O=CC1C(OC)OC(OC)C1
BD3874
90%
MFCD00010283
2,5-DIMETHOXYTHIOPHENE
CAS:58386-20-2
Formula: COC1=CC=C(OC)S1
BD289451
95+%
MFCD01096545
2,5-DIMETHYL 3-NITROTHIOPHENE-2,5-DICARBOXYLATE
CAS:858840-42-3
Formula: O=C(C1=C([N+]([O-])=O)C=C(C(OC)=O)S1)OC
BD327844
95+%
MFCD22381980
2,5-DIMETHYL-[1,2,4]TRIAZOLO[1,5-A]PYRIMIDIN-7(4H)-ONE
CAS:89852-99-3
Formula: O=C1C=C(C)NC2=NC(C)=NN12
BD447053
97%
MFCD04114018
2,5-DIMETHYL-[1,2,4]TRIAZOLO[1,5-A]PYRIMIDIN-7-OL
CAS:51596-06-6
Formula: OC1=CC(C)=NC2=NC(C)=NN12
BD625534
97%
2,5-DIMETHYL-1,3,4-OXADIAZOLE
CAS:13148-65-7
Formula: CC1=NN=C(C)O1
BD216434
95%
MFCD00483011
2,5-DIMETHYL-1,3,4-THIADIAZOLE
CAS:27464-82-0
Formula: CC1=NN=C(C)S1
BD67747
95+%
MFCD00020722
2,5-DIMETHYL-1,4-DITHIANE-2,5-DIOL
CAS:55704-78-4
Formula: OC1(C)SCC(O)(C)SC1
BD67658
95+%
MFCD00010121
2,5-DIMETHYL-1-((4-METHYLTHIAZOL-2-YL)METHYL)-1H-PYRROLE-3-CARBALDEHYDE
CAS:1248059-28-0
Formula: O=CC1=C(C)N(CC2=NC(C)=CS2)C(C)=C1
BD608385
97%
2,5-DIMETHYL-1-((TETRAHYDROFURAN-2-YL)METHYL)-1H-PYRROLE-3-CARBALDEHYDE
CAS:790263-33-1
Formula: O=CC1=C(C)N(CC2OCCC2)C(C)=C1
BD58951
95+%
MFCD04321849
2,5-DIMETHYL-1-(1,3-DIOXOLAN-2-YLMETHYL) BENZENE
CAS:898759-36-9
Formula: CC1=CC=C(C)C(CC2OCCO2)=C1
BD310658
95+%
MFCD04117665
2,5-DIMETHYL-1-(2-MORPHOLINOETHYL)-1H-PYRROLE-3-CARBALDEHYDE
CAS:887694-84-0
Formula: O=CC1=C(C)N(CCN2CCOCC2)C(C)=C1
BD555320
97%
MFCD07400631
2,5-DIMETHYL-1-(3-(TRIFLUOROMETHYL)PHENYL)-1H-PYRROLE
CAS:570-04-7
Formula: FC(C1=CC(N2C(C)=CC=C2C)=CC=C1)(F)F
BD67741
97%
MFCD03228549
2,5-DIMETHYL-1-(3-(TRIFLUOROMETHYL)PHENYL)-1H-PYRROLE-3-CARBALDEHYDE
CAS:207233-99-6
Formula: O=CC1=C(C)N(C2=CC=CC(C(F)(F)F)=C2)C(C)=C1
BD67739
95+%
MFCD00192093
2,5-DIMETHYL-1-(3-METHYLPYRIDIN-2-YL)-1H-PYRROLE-3-CARBALDEHYDE
CAS:142230-98-6
Formula: O=CC1=C(C)N(C2=NC=CC=C2C)C(C)=C1
BD302389
95+%
MFCD07643249
2,5-DIMETHYL-1-(3-NITROPHENYL)-1H-PYRROLE
CAS:32570-23-3
Formula: CC1=CC=C(C)N1C2=CC=CC([N+]([O-])=O)=C2
BD50702
95+%
MFCD00033567
2,5-DIMETHYL-1-(3-PHENYLPROPYL)PIPERAZINE
CAS:63474-82-8
Formula: CC1NCC(C)N(CCCC2=CC=CC=C2)C1
BD233800
95+%
MFCD19288056
2,5-DIMETHYL-1-(4-(TRIFLUOROMETHYL)PHENYL)-1H-PYRROLE
CAS:570-05-8
Formula: FC(C1=CC=C(N2C(C)=CC=C2C)C=C1)(F)F
BD1451
97%
2,5-DIMETHYL-1-(4-METHYLPYRIDIN-2-YL)-1H-PYRROLE-3-CARBALDEHYDE
CAS:445428-51-3
Formula: O=CC1=C(C)N(C2=NC=CC(C)=C2)C(C)=C1
BD183786
95+%
2,5-DIMETHYL-1-(4-NITROPHENYL)-1H-PYRROLE
CAS:5044-22-4
Formula: O=[N+](C1=CC=C(N2C(C)=CC=C2C)C=C1)[O-]
BD67744
95+%
MFCD00085038
2,5-DIMETHYL-1-(4H-1,2,4-TRIAZOL-4-YL)-1H-PYRROLE-3-CARBALDEHYDE
CAS:453557-49-8
Formula: O=CC1=C(C)N(N2C=NN=C2)C(C)=C1
BD196602
95+%
2,5-DIMETHYL-1-(5-METHYLPYRIDIN-2-YL)-1H-PYRROLE-3-CARBALDEHYDE
CAS:876717-21-4
Formula: O=CC1=C(C)N(C2=NC=C(C)C=C2)C(C)=C1
BD598002
97%
MFCD07643248
2,5-DIMETHYL-1-(7-METHYL-2,3-DIHYDROBENZO[B][1,4]DIOXIN-6-YL) -1H-PYRROLE-3-CARBALDEHYDE
CAS:879045-05-3
Formula: O=CC1=C(C)N(C2=C(C)C=C(OCCO3)C3=C2)C(C)=C1
BD604879
97%
MFCD07402329
2,5-DIMETHYL-1-(M-TOLYL)-1H-PYRROLE-3-CARBOXYLIC ACID
CAS:749219-01-0
Formula: O=C(C1=C(C)N(C2=CC=CC(C)=C2)C(C)=C1)O
BD566667
97%
MFCD03658004
2,5-DIMETHYL-1-(O-TOLYL)-1H-PYRROLE-3-CARBALDEHYDE
CAS:119673-47-1
Formula: CC1=C(C=C([N]1C2=C(C=CC=C2)C)C)C=O
BD67759
95+%
MFCD02212920
2,5-DIMETHYL-1-(O-TOLYL)-1H-PYRROLE-3-CARBOXYLIC ACID
CAS:500728-34-7
Formula: O=C(C1=C(C)N(C2=CC=CC=C2C)C(C)=C1)O
BD566474
97%
MFCD03988001
2,5-DIMETHYL-1-(P-TOLYL)-1H-PYRROLE
CAS:32411-27-1
Formula: CC1=CC=C(N2C(C)=CC=C2C)C=C1
BD67745
95+%
MFCD01552283
2,5-DIMETHYL-1-(P-TOLYL)-1H-PYRROLE-3-CARBALDEHYDE
CAS:327060-71-9
Formula: O=CC1=C(C)N(C2=CC=C(C)C=C2)C(C)=C1
BD67766
97%
2,5-DIMETHYL-1-(PHENYLSULFONYL)-1H-PYRROLO[2,3-B]PYRIDINE
CAS:1227270-58-7
Formula: CC1=CC2=C(N(S(=O)(C3=CC=CC=C3)=O)C(C)=C2)N=C1
BD333703
95+%
MFCD16875841
2,5-DIMETHYL-1-(PYRIDIN-2-YL)-1H-PYRROLE-3-CARBALDEHYDE
CAS:32570-90-4
Formula: O=CC1=C(C)N(C2=NC=CC=C2)C(C)=C1
BD554529
97%
MFCD04218024
2,5-DIMETHYL-1-(PYRIDIN-3-YL)-1H-PYRROLE-3-CARBALDEHYDE
CAS:35711-47-8
Formula: O=CC1=C(C)N(C2=CC=CN=C2)C(C)=C1
BD183423
95+%
2,5-DIMETHYL-1-(PYRIDIN-3-YLMETHYL)-1H-PYRROLE-3-CARBALDEHYDE
CAS:878424-30-7
Formula: O=CC1=C(C)N(CC2=CC=CN=C2)C(C)=C1
BD183902
95+%
2,5-DIMETHYL-1-(PYRIDIN-4-YL)-1H-PYRROLE-3-CARBALDEHYDE
CAS:431980-51-7
Formula: O=CC1=C(C)N(C2=CC=NC=C2)C(C)=C1
BD447240
97%
MFCD03085916
2,5-DIMETHYL-1-(THIAZOL-2-YL)-1H-PYRROLE-3-CARBALDEHYDE
CAS:142230-96-4
Formula: O=CC1=C(C)N(C2=NC=CS2)C(C)=C1
BD554679
97%
MFCD06655933
2,5-DIMETHYL-1-PHENETHYL-1H-PYRROLE-3-CARBALDEHYDE
CAS:18870-81-0
Formula: O=CC1=C(C)N(CCC2=CC=CC=C2)C(C)=C1
BD187276
97%
MFCD07186523
2,5-DIMETHYL-1-PHENYL-1H-PYRROLE
CAS:83-24-9
Formula: CC1=CC=C(C)N1C2=CC=CC=C2
BD67762
97%
2,5-DIMETHYL-1-PHENYL-1H-PYRROLE-3-CARBALDEHYDE
CAS:83-18-1
Formula: O=CC1=C(C)N(C2=CC=CC=C2)C(C)=C1
BD67763
95+%
MFCD00051494
2,5-DIMETHYL-1-PHENYL-1H-PYRROLE-3-CARBOXAMIDE
CAS:1266376-84-4
Formula: O=C(C1=C(C)N(C2=CC=CC=C2)C(C)=C1)N
BD608923
97%
2,5-DIMETHYL-1-PHENYL-1H-PYRROLE-3-CARBOXYLIC ACID
CAS:3807-56-5
Formula: O=C(C1=C(C)N(C2=CC=CC=C2)C(C)=C1)O
BD67761
95+%
2,5-DIMETHYL-1-PROPYL-1H-PYRROLE-3-CARBALDEHYDE
CAS:18870-75-2
Formula: O=CC1=C(C)N(CCC)C(C)=C1
BD67765
95+%
2,5-DIMETHYL-1H-BENZO[D]IMIDAZOLE
CAS:1792-41-2
Formula: CC1=CC=C2C(N=C(C)N2)=C1
BD67755
95+%
MFCD00125906
2,5-DIMETHYL-1H-INDOLE
CAS:1196-79-8
Formula: C1=C([NH]C2=CC=C(C=C12)C)C
BD0084
98%
MFCD00005621
2,5-DIMETHYL-1H-INDOLE-3-CARBALDEHYDE
CAS:61364-25-8
Formula: O=CC1=C(C)NC2=C1C=C(C)C=C2
BD172597
95+%
MFCD06800613
2,5-DIMETHYL-1H-PYRAZOL-3(2H)-ONE
CAS:3201-29-4
Formula: O=C1N(C)NC(C)=C1
BD517958
97%
MFCD09953250
2,5-DIMETHYL-1H-PYRROLE-3,4-DICARBALDEHYDE
CAS:56139-74-3
Formula: O=CC1=C(C)NC(C)=C1C=O
BD323890
95+%
MFCD02660558
2,5-DIMETHYL-1H-PYRROLE-3-CARBALDEHYDE
CAS:2199-63-5
Formula: O=CC1=C(C)NC(C)=C1
BD67757
95+%
2,5-DIMETHYL-1H-PYRROLE-3-CARBONITRILE
CAS:26187-29-1
Formula: CC1=CC(C#N)=C(C)N1
BD231884
95+%
MFCD12923809
2,5-DIMETHYL-1H-PYRROLE-3-CARBOXYLIC ACID
CAS:57338-76-8
Formula: O=C(C1=C(C)NC(C)=C1)O
BD5073
97%
MFCD00203874
2,5-DIMETHYL-1H-PYRROLO[2,3-B]PYRIDINE
CAS:1190314-46-5
Formula: CC1=CC2=C(NC(C)=C2)N=C1
BD333261
95+%
MFCD12962786
2,5-DIMETHYL-1H-PYRROLO[3,2-B]PYRIDINE
CAS:854018-76-1
Formula: CC1=CC=C(NC(C)=C2)C2=N1
BD335526
95+%
MFCD12963003
2,5-DIMETHYL-2'-METHOXYBENZOPHENONE
CAS:750633-51-3
Formula: O=C(C1=CC=CC=C1OC)C2=CC(C)=CC=C2C
BD309062
95+%
MFCD01311511
2,5-DIMETHYL-2'-MORPHOLINOMETHYL BENZOPHENONE
CAS:898750-50-0
Formula: O=C(C1=CC=CC=C1CN2CCOCC2)C3=CC(C)=CC=C3C
BD309951
95+%
MFCD03842425
2,5-DIMETHYL-2'-PIPERIDINOMETHYL BENZOPHENONE
CAS:898773-27-8
Formula: O=C(C1=CC=CC=C1CN2CCCCC2)C3=CC(C)=CC=C3C
BD311880
95+%
MFCD03842482
2,5-DIMETHYL-2'-PYRROLIDINOMETHYL BENZOPHENONE
CAS:898774-61-3
Formula: O=C(C1=CC=CC=C1CN2CCCC2)C3=CC(C)=CC=C3C
BD311964
95+%
MFCD03842539
2,5-DIMETHYL-2'-THIOMORPHOLINOMETHYL BENZOPHENONE
CAS:898781-86-7
Formula: O=C(C1=CC=CC=C1CN2CCSCC2)C3=CC(C)=CC=C3C
BD312651
95+%
MFCD03842766
2,5-DIMETHYL-2,3-DIHYDROBENZOFURAN-7-CARBOXYLIC ACID
CAS:31457-02-0
Formula: O=C(C1=C(OC(C)C2)C2=CC(C)=C1)O
BD442692
97%
MFCD20653549
2,5-DIMETHYL-2,5-DIAZABICYCLO[4.2.0]OCT-1(6)-ENE-7,8-DIONE
CAS:64186-72-7
Formula: O=C1C(C2=C1N(C)CCN2C)=O
BD54708
97%
2,5-DIMETHYL-2,5-HEXANEDIOL
CAS:110-03-2
Formula: CC(C)(O)CCC(C)(C)O
BD17502
98%
MFCD00004473
2,5-DIMETHYL-2H-INDAZOLE
CAS:1195697-22-3
Formula: CC1=CC2=CN(C)N=C2C=C1
BD489641
97%
2,5-DIMETHYL-3'-(1,3-DIOXOLAN-2-YL) BENZOPHENONE
CAS:898779-36-7
Formula: O=C(C1=CC=CC(C2OCCO2)=C1)C3=CC(C)=CC=C3C
BD312411
95+%
MFCD07699968
2,5-DIMETHYL-3'-METHOXYBENZOPHENONE
CAS:750633-71-7
Formula: O=C(C1=CC=CC(OC)=C1)C2=CC(C)=CC=C2C
BD309080
95+%
MFCD01311543
2,5-DIMETHYL-3'-MORPHOLINOMETHYL BENZOPHENONE
CAS:898765-59-8
Formula: O=C(C1=CC=CC(CN2CCOCC2)=C1)C3=CC(C)=CC=C3C
BD311192
95+%
MFCD03841916
2,5-DIMETHYL-3'-PIPERIDINOMETHYL BENZOPHENONE
CAS:898793-14-1
Formula: O=C(C1=CC=CC(CN2CCCCC2)=C1)C3=CC(C)=CC=C3C
BD313698
95+%
MFCD03841973
2,5-DIMETHYL-3'-PYRROLIDINOMETHYL BENZOPHENONE
CAS:898770-40-6
Formula: O=C(C1=CC=CC(CN2CCCC2)=C1)C3=CC(C)=CC=C3C
BD311652
95+%
MFCD03842030
2,5-DIMETHYL-3'-THIOMORPHOLINOMETHYL BENZOPHENONE
CAS:898763-16-1
Formula: O=C(C1=CC=CC(CN2CCSCC2)=C1)C3=CC(C)=CC=C3C
BD310950
95+%
MFCD03842255
2,5-DIMETHYL-3-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL) PYRIDINE
CAS:1309980-12-8
Formula: CC1(C)C(C)(C)OB(C2=CC(C)=CN=C2C)O1
BD244906
95+%
MFCD17012671
2,5-DIMETHYL-3-(4-(TRIFLUOROMETHYL)BENZYL)THIOPHENE
CAS:1006037-09-7
Formula: CC1=CC(CC2=CC=C(C(F)(F)F)C=C2)=C(C)S1
BD332281
95+%
MFCD17926241
2,5-DIMETHYL-3-(METHYLSULFONYL)BENZENE-1-SULFONYL CHLORIDE
CAS:1258639-68-7
Formula: O=S(=O)(Cl)C1C(C)=C(S(=O)(C)=O)C=C(C)C=1
BD00776313
95%
MFCD17977050
2,5-DIMETHYL-3-(PIPERAZIN-1-YL)PYRAZINE
CAS:59215-42-8
Formula: CC1=CN=C(C)C(N2CCNCC2)=N1
BD157781
95+%
MFCD05182224
2,5-DIMETHYL-3-(TRIFLUOROMETHYL)PHENOL
CAS:1806451-09-1
Formula: FC(F)(F)C1=CC(C)=CC(O)=C1C
BD486766
97%
MFCD28794739
2,5-DIMETHYL-3-NITROANILINE
CAS:62564-50-5
Formula: NC1=CC(C)=CC([N+]([O-])=O)=C1C
BD70674
95+%
MFCD08062504
2,5-DIMETHYL-3-NITROBENZALDEHYDE
CAS:69022-52-2
Formula: O=CC1=CC(C)=CC([N+]([O-])=O)=C1C
BD262075
95+%
MFCD18909277
2,5-DIMETHYL-3-NITROBENZOIC ACID
CAS:27022-97-5
Formula: CC1=CC(C(O)=O)=C(C)C(=C1)[N+]([O-])=O
BD168352
95+%
2,5-DIMETHYL-3-NITROPHENOL
CAS:65151-57-7
Formula: OC1=CC(C)=CC([N+]([O-])=O)=C1C
BD261484
95+%
MFCD11007935
2,5-DIMETHYL-3-PHENYLPYRAZOLO[1,5-A]PYRIMIDIN-7-OL
CAS:331739-47-0
Formula: OC1=CC(C)=NC2=C(C3=CC=CC=C3)C(C)=NN12
BD624780
97%
2,5-DIMETHYL-3-PHENYLPYRAZOLO[1,5-A]PYRIMIDINE
CAS:1781423-38-8
Formula: CC1=NC2=C(C3=CC=CC=C3)C(C)=NN2C=C1
BD593494
97%
MFCD27978267
2,5-DIMETHYL-4'-(1,3-DIOXOLAN-2-YL) BENZOPHENONE
CAS:898760-22-0
Formula: O=C(C1=CC=C(C2OCCO2)C=C1)C3=CC(C)=CC=C3C
BD310740
95+%
MFCD07700019
2,5-DIMETHYL-4'-MORPHOLINOMETHYL BENZOPHENONE
CAS:898770-08-6
Formula: O=C(C1=CC=C(CN2CCOCC2)C=C1)C3=CC(C)=CC=C3C
BD311620
95+%
MFCD03841404
2,5-DIMETHYL-4'-PIPERIDINOMETHYL BENZOPHENONE
CAS:898775-05-8
Formula: O=C(C1=CC=C(CN2CCCCC2)C=C1)C3=CC(C)=CC=C3C
BD312007
95+%
MFCD03841461
2,5-DIMETHYL-4'-PYRROLIDINOMETHYL BENZOPHENONE
CAS:898776-47-1
Formula: O=C(C1=CC=C(CN2CCCC2)C=C1)C3=CC(C)=CC=C3C
BD312143
95+%
MFCD03841518
2,5-DIMETHYL-4'-THIOMORPHOLINOMETHYL BENZOPHENONE
CAS:898782-75-7
Formula: O=C(C1=CC=C(CN2CCSCC2)C=C1)C3=CC(C)=CC=C3C
BD312720
95+%
MFCD03841745
2,5-DIMETHYL-4,5,6,7-TETRAHYDRO-2H-PYRAZOLO[3,4-B]PYRIDIN-3-OL
CAS:1707568-46-4
Formula: OC1=C(CC(C)CN2)C2=NN1C
BD620995
97%
2,5-DIMETHYL-4,5,6,7-TETRAHYDROOXAZOLO[4,5-C]PYRIDINE
CAS:1017781-98-4
Formula: CN1CCC(OC(C)=N2)=C2C1
BD283216
95+%
MFCD09997826
2,5-DIMETHYL-4-(4-(TRIFLUOROMETHYL)BENZYL)THIOPHENE-3-CARBOXYLIC ACID
CAS:1006037-08-6
Formula: O=C(C1=C(C)SC(C)=C1CC2=CC=C(C(F)(F)F)C=C2)O
BD332280
95+%
MFCD17926253
2,5-DIMETHYL-4-(4-METHYLPIPERAZIN-1-YL)THIENO[2,3-D]PYRIMIDINE-6-CARBOXYLIC ACID
CAS:421565-56-2
Formula: O=C(C1=C(C)C2=C(N3CCN(C)CC3)N=C(C)N=C2S1)O
BD196593
95+%
MFCD03030508
2,5-DIMETHYL-4-(N-(THIOPHEN-2-YLMETHYL)SULFAMOYL)FURAN-3-CARBOXYLIC ACID
CAS:306936-40-3
Formula: O=C(C1=C(C)OC(C)=C1S(=O)(NCC2=CC=CS2)=O)O
BD0815
95+%
MFCD02180782
2,5-DIMETHYL-4-(PYRROLIDIN-1-YL)BENZALDEHYDE
CAS:708280-61-9
Formula: O=CC1=CC(C)=C(N2CCCC2)C=C1C
BD597181
97%
MFCD05992707
2,5-DIMETHYL-4-IODOPHENOL
CAS:114971-53-8
Formula: OC1=CC(C)=C(I)C=C1C
BD11183
98%
MFCD00219922
2,5-DIMETHYL-4-METHOXYPHENYLBORONIC ACID
CAS:246023-54-1
Formula: COC1=CC(C)=C(C=C1C)B(O)O
BD161530
97%
MFCD06801676
2,5-DIMETHYL-4-NITROANILINE
CAS:3460-29-5
Formula: NC1=CC(C)=C([N+]([O-])=O)C=C1C
BD67797
96%
MFCD00025207
2,5-DIMETHYL-4-NITROBENZO[D]THIAZOLE
CAS:650635-66-8
Formula: O=[N+](C1=C2N=C(C)SC2=CC=C1C)[O-]
BD289539
96%
MFCD18826462
2,5-DIMETHYL-4-NITROBENZOIC ACID
CAS:6954-70-7
Formula: O=C(O)C1=CC(C)=C([N+]([O-])=O)C=C1C
BD475283
97%
MFCD00086153
2,5-DIMETHYL-4-NITROBENZONITRILE
CAS:73713-69-6
Formula: N#CC1=CC(C)=C([N+]([O-])=O)C=C1C
BD283303
95+%
MFCD00024285
2,5-DIMETHYL-4-NITROPHENOL
CAS:3139-05-7
Formula: CC1=CC(O)=C(C)C=C1[N+]([O-])=O
BD220094
95+%
MFCD07357405
2,5-DIMETHYL-4-NITROPYRIDINE
CAS:22282-82-2
Formula: O=[N+](C1=CC(C)=NC=C1C)[O-]
BD267393
95+%
MFCD26520944
2,5-DIMETHYL-4-OXO-1,4-DIHYDROTHIENO[2,3-D]PYRIMIDINE-6-CARBOXYLIC ACID
CAS:146628-89-9
Formula: O=C(C(S1)=C(C)C2=C1NC(C)=NC2=O)O
BD279427
95+%
2,5-DIMETHYL-4-OXO-4,5-DIHYDROFURAN-3-YL ACETATE
CAS:4166-20-5
Formula: CC(OC1=C(C)OC(C)C1=O)=O
BD10658
97%
MFCD00799462
2,5-DIMETHYL-4-PHENYLFURAN-3-CARBOXYLIC ACID
CAS:104794-30-1
Formula: O=C(O)C1=C(C)OC(C)=C1C2=CC=CC=C2
BD508766
97%
MFCD00684731
2,5-DIMETHYL-4-PHENYLTHIAZOLE
CAS:19968-59-3
Formula: CC1=C(C2=CC=CC=C2)N=C(C)S1
BD319197
95+%
MFCD01021040
2,5-DIMETHYL-6-NITROBENZO[D]THIAZOLE
CAS:686747-49-9
Formula: CC1=NC2=C(S1)C=C(C(C)=C2)[N+]([O-])=O
BD237076
95+%
MFCD18826463
2,5-DIMETHYL-7-(TRIFLUOROMETHYL)-4,5,6,7-TETRAHYDROPYRAZOLO[1,5-A]PYRIMIDINE
CAS:869945-59-5
Formula: FC(C1CC(C)NC2=CC(C)=NN12)(F)F
BD494734
97%
MFCD04969225
2,5-DIMETHYL-N-(2-PHENOXYETHYL) ANILINE
CAS:356086-80-1
Formula: CC1=CC=C(C)C(NCCOC2=CC=CC=C2)=C1
BD595735
97%
MFCD02603499
2,5-DIMETHYL-N-(3-(TRIFLUOROMETHYL)PHENYL)ANILINE
CAS:949161-10-8
Formula: FC(C1=CC(NC2=CC(C)=CC=C2C)=CC=C1)(F)F
BD252542
95+%
MFCD18207284
2,5-DIMETHYL-N-(O-TOLYL)ANILINE
CAS:949161-06-2
Formula: CC1=CC=CC=C1NC2=CC(C)=CC=C2C
BD252543
95+%
MFCD18207279
2,5-DIMETHYL-N-(P-TOLYL)ANILINE
CAS:34160-15-1
Formula: CC1=CC=C(NC2=CC(C)=CC=C2C)C=C1
BD252545
95+%
MFCD18207294
2,5-DIMETHYL-N-PHENYLANILINE
CAS:32446-14-3
Formula: CC1=CC=C(C)C(NC2=CC=CC=C2)=C1
BD252544
95+%
MFCD18207295
2,5-DIMETHYLANILINE HYDROCHLORIDE
CAS:51786-53-9
Formula: NC1=CC(C)=CC=C1C.[H]Cl
BD240604
95+%
2,5-DIMETHYLBENZALDEHYDE
CAS:5779-94-2
Formula: O=CC1=CC(C)=CC=C1C
BD6653
95+%
MFCD00003342
2,5-DIMETHYLBENZAMIDE
CAS:5692-34-2
Formula: O=C(N)C1=CC(C)=CC=C1C
BD308380
95+%
MFCD06093542
2,5-DIMETHYLBENZENE-1,3-DIOL
CAS:488-87-9
Formula: CC1=CC(O)=C(C)C(O)=C1
BD10652
95+%
MFCD00134473
2,5-DIMETHYLBENZENE-1,4-DIAMINE
CAS:6393-01-7
Formula: CC1=CC(N)=C(C)C=C1N
BD5350
95+%
MFCD00052675
2,5-DIMETHYLBENZENE-1-SULFONYL CHLORIDE
CAS:19040-62-1
Formula: O=S(C1=CC(C)=CC=C1C)(Cl)=O
BD41412
98%
MFCD00024875
2,5-DIMETHYLBENZENESULFONAMIDE
CAS:6292-58-6
Formula: O=S(C1=CC(C)=CC=C1C)(N)=O
BD115572
97%
2,5-DIMETHYLBENZENESULFONIC ACID
CAS:609-54-1
Formula: O=S(C1=CC(C)=CC=C1C)(O)=O
BD149569
98%
MFCD00151010
2,5-DIMETHYLBENZENESULFONOHYDRAZIDE
CAS:38045-54-4
Formula: O=S(C1=CC(C)=CC=C1C)(NN)=O
BD67810
97%
2,5-DIMETHYLBENZENETHIOL
CAS:4001-61-0
Formula: SC1=CC(C)=CC=C1C
BD33563
95+%
MFCD00010020
2,5-DIMETHYLBENZO[D]OXAZOLE
CAS:5676-58-4
Formula: CC1=NC2=C(O1)C=CC(C)=C2
BD11694
95%
MFCD00005773
2,5-DIMETHYLBENZO[D]THIAZOL-4-AMINE
CAS:650635-67-9
Formula: NC1=C2N=C(C)SC2=CC=C1C
BD542031
95%
2,5-DIMETHYLBENZO[D]THIAZOL-6-AMINE
CAS:686747-14-8
Formula: CC1=NC2=C(S1)C=C(N)C(C)=C2
BD237075
96%
MFCD18822299
2,5-DIMETHYLBENZO[D]THIAZOL-6-OL
CAS:90563-67-0
Formula: OC1=C(C)C=C2N=C(C)SC2=C1
BD752335
97%
2,5-DIMETHYLBENZO[D]THIAZOLE
CAS:95-26-1
Formula: CC1=CC=C(SC(C)=N2)C2=C1
BD67816
97%
2,5-DIMETHYLBENZOIC ACID
CAS:610-72-0
Formula: C1=C(C)C=CC(=C1C(O)=O)C
BD6660
98%
MFCD00002482
2,5-DIMETHYLBENZONITRILE
CAS:13730-09-1
Formula: CC1=CC(C#N)=C(C)C=C1
BD11682
97%
MFCD00001793
2,5-DIMETHYLBROMOBENZENE
CAS:553-94-6
Formula: C1=C(C(=CC=C1C)C)Br
BD72296
98%
MFCD00000074
2,5-DIMETHYLCHROMAN-4-ONE
CAS:69687-87-2
Formula: N/A
BD298919
95+%
2,5-DIMETHYLCYCLOHEXANOL
CAS:3809-32-3
Formula: OC1C(C)CCC(C)C1
BD67826
95+%
MFCD00001504
2,5-DIMETHYLCYCLOPENTANAMINE HYDROCHLORIDE
CAS:1375472-17-5
Formula: NC1C(C)CCC1C.[H]Cl
BD683287
97%
2,5-DIMETHYLDIHYDRO-2H-PYRAN-4(3H)-ONE
CAS:66109-81-7
Formula: O=C1CC(C)OCC1C
BD270093
95+%
2,5-DIMETHYLFURAN-3(2H)-ONE
CAS:14400-67-0
Formula: O=C1C(C)OC(C)=C1
BD67777
95+%
MFCD00052571
2,5-DIMETHYLFURAN-3,4-DICARBOXYLIC ACID
CAS:14597-13-8
Formula: O=C(C1=C(C)OC(C)=C1C(O)=O)O
BD617814
97%
2,5-DIMETHYLFURAN-3-CARBOHYDRAZIDE
CAS:159881-93-3
Formula: O=C(C1=C(C)OC(C)=C1)NN
BD274392
95+%
MFCD18252913
2,5-DIMETHYLFURAN-3-CARBONYL CHLORIDE
CAS:50990-93-7
Formula: O=C(Cl)C1=C(C)OC(C)=C1
BD67829
95+%
MFCD00221073
2,5-DIMETHYLFURAN-3-CARBOXYLIC ACID
CAS:636-44-2
Formula: O=C(C1=C(C)OC(C)=C1)O
BD29292
95+%
MFCD00082181
2,5-DIMETHYLFURAN-3-SULFONYL CHLORIDE
CAS:166964-26-7
Formula: CC1=CC(=C(C)O1)S(Cl)(=O)=O
BD67781
95+%
MFCD04115370
2,5-DIMETHYLFURAN-3-THIOL
CAS:55764-23-3
Formula: SC1=C(C)OC(C)=C1
BD67830
95+%
2,5-DIMETHYLFURO[2,3-D]PYRIMIDIN-4-AMINE
CAS:1369247-36-8
Formula: NC1=C2C(OC=C2C)=NC(C)=N1
BD442664
97%
MFCD22068844
2,5-DIMETHYLHEX-3-YNE-2,5-DIOL
CAS:142-30-3
Formula: CC(O)(C)C#CC(O)(C)C
BD18307
98%
MFCD00004468
2,5-DIMETHYLHEXANEDIOIC ACID
CAS:4454-18-6
Formula: O=C(O)C(C)CCC(C)C(O)=O
BD67833
98%
MFCD00020410
2,5-DIMETHYLIMIDAZO[1,2-A]PYRIDIN-3-AMINE
CAS:82199-92-6
Formula: NC1N2C(C=CC=C2C)=NC=1C
BD00780303
95+%
n/a
2,5-DIMETHYLIMIDAZO[1,2-A]PYRIDINE-3-CARBOXYLIC ACID
CAS:81438-50-8
Formula: O=C(C1=C(C)N=C2C=CC=C(C)N21)O
BD561748
97%
2,5-DIMETHYLISONICOTINONITRILE
CAS:7584-10-3
Formula: N#CC1=C(C)C=NC(C)=C1
BD248721
95+%
MFCD13175868
2,5-DIMETHYLISOQUINOLIN-1(2H)-ONE
CAS:N/A
Formula: O=C1N(C)C=CC2=C1C=CC=C2C
BD751309
97%
2,5-DIMETHYLMORPHOLINE
CAS:106-56-9
Formula: CC1COC(C)CN1
BD232588
95+%
MFCD09971504
2,5-DIMETHYLNICOTINALDEHYDE
CAS:1211522-52-9
Formula: O=CC1=C(C)N=CC(C)=C1
BD268535
95+%
MFCD17012149
2,5-DIMETHYLNICOTINONITRILE
CAS:63820-75-7
Formula: N#CC1=C(C)N=CC(C)=C1
BD270175
95+%
MFCD13176003
2,5-DIMETHYLOXAZOLE
CAS:23012-11-5
Formula: CC1=CN=C(C)O1
BD225794
95+%
2,5-DIMETHYLOXAZOLE-4-CARBALDEHYDE
CAS:92901-88-7
Formula: O=CC1=C(C)OC(C)=N1
BD67748
95+%
MFCD03923827
2,5-DIMETHYLOXAZOLE-4-CARBONYL CHLORIDE
CAS:197719-27-0
Formula: O=C(Cl)C1=C(C)OC(C)=N1
BD27940
97%
2,5-DIMETHYLOXAZOLE-4-CARBOXYLIC ACID
CAS:23000-14-8
Formula: O=C(C1=C(C)OC(C)=N1)O
BD67750
95+%
MFCD03011595
2,5-DIMETHYLPHENYL ACETATE
CAS:877-48-5
Formula: CC(OC1=CC(C)=CC=C1C)=O
BD67842
95+%
MFCD03357477
2,5-DIMETHYLPHENYLACETYL CHLORIDE
CAS:55312-97-5
Formula: O=C(Cl)CC1=CC(C)=CC=C1C
BD306335
95+%
MFCD12024950
2,5-DIMETHYLPHENYLBORONIC ACID
CAS:85199-06-0
Formula: C1=C(C=CC(=C1B(O)O)C)C
BD5259
97%
MFCD01863525
2,5-DIMETHYLPHENYLHYDRAZINE HYDROCHLORIDE
CAS:56737-78-1
Formula: NNC1=CC(C)=CC=C1C.[H]Cl
BD5368
95+%
MFCD00013382
2,5-DIMETHYLPIPERAZINE
CAS:106-55-8
Formula: CC1NCC(C)NC1
BD67851
97%
MFCD00005955
2,5-DIMETHYLPYRAZINE
CAS:123-32-0
Formula: C1=NC(=CN=C1C)C
BD3685
97%
MFCD00006147
2,5-DIMETHYLPYRAZOLIDIN-3-ONE
CAS:54945-11-8
Formula: O=C1CC(C)NN1C
BD54155
97%
2,5-DIMETHYLPYRAZOLO[1,5-A]PYRIMIDIN-7(4H)-ONE
CAS:98488-10-9
Formula: O=C1C=C(C)NC2=CC(C)=NN12
BD67853
97%
2,5-DIMETHYLPYRAZOLO[1,5-A]PYRIMIDIN-7-AMINE
CAS:2369-89-3
Formula: NC1=CC(C)=NC2=CC(C)=NN12
BD278299
95+%
2,5-DIMETHYLPYRAZOLO[1,5-A]PYRIMIDIN-7-OL
CAS:27166-46-7
Formula: OC1=CC(C)=NC2=CC(C)=NN12
BD389410
95+%
MFCD08729601
2,5-DIMETHYLPYRAZOLO[1,5-A]PYRIMIDINE-7-CARBOXYLIC ACID
CAS:1011355-87-5
Formula: O=C(C1=CC(C)=NC2=CC(C)=NN12)O
BD177234
95+%
MFCD09471033
2,5-DIMETHYLPYRIDIN-3-AMINE
CAS:89943-02-2
Formula: NC1=CC(C)=CN=C1C
BD243970
95+%
2,5-DIMETHYLPYRIDIN-4-AMINE
CAS:22279-89-6
Formula: NC1=CC(C)=NC=C1C
BD248722
98%
MFCD00235163
2,5-DIMETHYLPYRIDIN-4-OL
CAS:22279-59-0
Formula: CC1=CN=C(C)C=C1O
BD216457
95+%
MFCD13175268
2,5-DIMETHYLPYRIMIDIN-4(1H)-ONE
CAS:3059-71-0
Formula: O=C1N=C(C)NC=C1C
BD260622
95+%
2,5-DIMETHYLPYRIMIDIN-4-AMINE
CAS:73-70-1
Formula: NC1=NC(C)=NC=C1C
BD249680
97%
MFCD09909809
2,5-DIMETHYLPYRIMIDINE
CAS:22868-76-4
Formula: CC1=CN=C(C)N=C1
BD149831
95+%
MFCD16036322
2,5-DIMETHYLQUINAZOLIN-4(1H)-ONE
CAS:147006-56-2
Formula: O=C1N=C(C)NC2=C1C(C)=CC=C2
BD259939
95+%
2,5-DIMETHYLQUINOLIN-8-OL
CAS:10522-43-7
Formula: OC1=C2N=C(C)C=CC2=C(C)C=C1
BD225823
95+%
2,5-DIMETHYLQUINOLINE
CAS:26190-82-9
Formula: CC1=NC2=CC=CC(C)=C2C=C1
BD233340
95+%
MFCD11108670
2,5-DIMETHYLTEREPHTHALIC ACID
CAS:6051-66-7
Formula: CC1=CC(C(O)=O)=C(C)C=C1C(O)=O
BD11847
97%
MFCD00020292
2,5-DIMETHYLTEREPHTHALONITRILE
CAS:39095-25-5
Formula: N#CC1=CC(C)=C(C#N)C=C1C
BD67862
97%
2,5-DIMETHYLTETRAHYDROFURAN-3-THIOL
CAS:26486-21-5
BD246234
95+%
2,5-DIMETHYLTHIAZOLE
CAS:4175-66-0
Formula: C1=C(C)SC(=N1)C
BD9620
98%
MFCD00130120
2,5-DIMETHYLTHIAZOLE-4-CARBOXYLIC ACID
CAS:113366-73-7
Formula: O=C(C1=C(C)SC(C)=N1)O
BD229152
95+%
MFCD09881001
2,5-DIMETHYLTHIOPHENE
CAS:638-02-8
Formula: CC1=CC=C(C)S1
BD67865
97%
2,5-DIMETHYLTHIOPHENE-3-CARBALDEHYDE
CAS:26421-44-3
Formula: O=CC1=C(C)SC(C)=C1
BD10578
97%
MFCD03426895
2,5-DIMETHYLTHIOPHENE-3-CARBONITRILE
CAS:31883-38-2
Formula: N#CC1=C(C)SC(C)=C1
BD624698
97%
2,5-DIMETHYLTHIOPHENE-3-CARBOXYLIC ACID
CAS:26421-32-9
Formula: O=C(C1=C(C)SC(C)=C1)O
BD10573
95+%
MFCD01860238
2,5-DIMETHYLTHIOPHENE-3-SULFONYL CHLORIDE
CAS:97272-04-3
Formula: CC1=CC(=C(C)S1)S(Cl)(=O)=O
BD67787
95+%
MFCD03086201
2,5-DIOCTYL-3,6-DI(THIOPHEN-2-YL)PYRROLO[3,4-C]PYRROLE-1,4(2H,5H)-DIONE
CAS:1057401-08-7
Formula: O=C1N(CCCCCCCC)C(C2=CC=CS2)=C3C1=C(C4=CC=CS4)N(CCCCCCCC)C3=O
BD254708
95+%
2,5-DIOXA-8-AZASPIRO[3.5]NONANE
CAS:1184185-17-8
Formula: C1OCC12OCCNC2
BD248146
95+%
MFCD11520356
2,5-DIOXA-8-AZASPIRO[3.5]NONANE HYDROCHLORIDE
CAS:1394840-20-0
Formula: [H]Cl.C1OCC12OCCNC2
BD210911
95+%
2,5-DIOXA-8-AZASPIRO[3.5]NONANE OXALATE(2:1)
CAS:1845713-71-4
Formula: O=C(O)C(O)=O.C1OCC12OCCNC2.C3OCC34OCCNC4
BD628053
97%
MFCD28166324
2,5-DIOXO-1,2,5,6,7,8-HEXAHYDROQUINOLINE-3-CARBOXYLIC ACID
CAS:106551-76-2
Formula: O=C(C1=CC2=C(NC1=O)CCCC2=O)O
BD67877
95+%
MFCD03423969
2,5-DIOXO-1-(4-(PYRIDIN-2-YLDISULFANYL)BUTANOYLOXY)PYRROLIDINE-3-SULFONIC ACID
CAS:1628113-16-5
Formula: O=S(C(C1)C(N(OC(CCCSSC2=NC=CC=C2)=O)C1=O)=O)(O)=O
BD338623
95+%
2,5-DIOXO-1-(4-(PYRIDIN-2-YLDISULFANYL)PENTANOYLOXY)PYRROLIDINE-3-SULFONIC ACID
CAS:452072-27-4
Formula: O=S(C(C1)C(N(OC(CCC(SSC2=NC=CC=C2)C)=O)C1=O)=O)(O)=O
BD338631
95+%
2,5-DIOXO-2,3,4,5-TETRAHYDRO-1H-BENZO[E][1,4]DIAZEPINE-8-CARBOXYLIC ACID
CAS:195985-12-7
Formula: O=C(O)C1=CC=C2C(NC(CNC2=O)=O)=C1
BD0418
97%
MFCD00798180
2,5-DIOXO-7-(M-TOLYL)-1,2,5,6,7,8-HEXAHYDROQUINOLINE-3-CARBOXYLIC ACID
CAS:945202-24-4
Formula: O=C(C1=CC2=C(NC1=O)CC(C3=CC=CC(C)=C3)CC2=O)O
BD508103
97%
MFCD09785547
2,5-DIOXO-7-(P-TOLYL)-1,2,5,6,7,8-HEXAHYDROQUINOLINE-3-CARBOXYLIC ACID
CAS:924834-92-4
Formula: O=C(C1=CC2=C(NC1=O)CC(C3=CC=C(C)C=C3)CC2=O)O
BD320484
95+%
MFCD09439077
2,5-DIOXO-PYRROLIDINE-3-CARBOXYLIC ACID
CAS:96905-69-0
Formula: O=C(C(C1)C(NC1=O)=O)O
BD324568
95+%
MFCD16039577
2,5-DIOXO-PYRROLIDINE-3-CARBOXYLIC ACID ETHYL ESTER
CAS:96905-68-9
Formula: O=C(C(C1)C(NC1=O)=O)OCC
BD324567
95+%
MFCD16039578
2,5-DIOXOPYRROLIDIN-1-YL ((3R,3AS,6AR)-HEXAHYDROFURO[2,3-B]FURAN-3-YL) CARBONATE
CAS:253265-97-3
Formula: O=C(ON1C(CCC1=O)=O)O[C@@H]2[C@@]3([H])[C@@](OCC3)([H])OC2
BD234419
95+%
2,5-DIOXOPYRROLIDIN-1-YL (2,2,2-TRICHLOROETHYL) CARBONATE
CAS:66065-85-8
Formula: ClC(Cl)(Cl)COC(=O)ON1C(=O)CCC1=O
BD235215
95+%
MFCD00075216
2,5-DIOXOPYRROLIDIN-1-YL (2-(METHYLSULFONYL)ETHYL) CARBONATE
CAS:57903-15-8
Formula: O=C(OCCS(=O)(C)=O)ON1C(CCC1=O)=O
BD140474
97%
MFCD00043142
2,5-DIOXOPYRROLIDIN-1-YL (2-(TRIMETHYLSILYL)ETHYL) CARBONATE
CAS:78269-85-9
Formula: C[Si](C)(C)CCOC(=O)ON1C(=O)CCC1=O
BD227516
97%
MFCD02683467
2,5-DIOXOPYRROLIDIN-1-YL [1,1'-BIPHENYL]-4-CARBOXYLATE
CAS:299969-20-3
Formula: O=C(C1=CC=C(C2=CC=CC=C2)C=C1)ON3C(CCC3=O)=O
BD624586
97%
n/a
2,5-DIOXOPYRROLIDIN-1-YL 1-((4-FLUOROPHENYL)SULFONYL)PIPERIDINE-4-CARBOXYLATE
CAS:1352517-05-5
Formula: O=C(C1CCN(S(=O)(C2=CC=C(F)C=C2)=O)CC1)ON3C(CCC3=O)=O
BD611930
97%
2,5-DIOXOPYRROLIDIN-1-YL 1-((4-METHOXYPHENYL) SULFONYL)PIPERIDINE-4-CARBOXYLATE
CAS:903853-23-6
Formula: O=C(CC1)N(OC(C2CCN(S(=O)(C3=CC=C(OC)C=C3)=O)CC2)=O)C1=O
BD507757
97%
MFCD08289822
2,5-DIOXOPYRROLIDIN-1-YL 1-(1,3-DIOXOISOINDOLIN-2-YLOXY) -3,6,9,12-TETRAOXAPENTADECAN-15-OATE
CAS:1415328-95-8
Formula: O=C(ON1C(CCC1=O)=O)CCOCCOCCOCCOCCON(C(C2=C3C=CC=C2)=O)C3=O
BD338605
95+%
2,5-DIOXOPYRROLIDIN-1-YL 1-(2,5-DIOXO-2H-PYRROL-1(5H) -YL)-3,6,9,12,15,18-HEXAOXAHENICOSAN-21-OATE
CAS:1599472-25-9
Formula: O=C(ON1C(CCC1=O)=O)CCOCCOCCOCCOCCOCCOCCN2C(C=CC2=O)=O
BD338617
95+%
2,5-DIOXOPYRROLIDIN-1-YL 1-(TRIFLUOROMETHYL)CYCLOBUTANECARBOXYLATE
CAS:1820739-93-2
Formula: O=C(C1(C(F)(F)F)CCC1)ON2C(CCC2=O)=O
BD455696
97%
MFCD09951811
2,5-DIOXOPYRROLIDIN-1-YL 1-[(4-FORMYLPHENYL)FORMAMIDO]-3,6,9,12-TETRAOXAPENTADECAN-15-OATE
CAS:1353011-74-1
Formula: O=C(ON1C(CCC1=O)=O)CCOCCOCCOCCOCCNC(C2=CC=C(C=O)C=C2)=O
BD338603
95+%
2,5-DIOXOPYRROLIDIN-1-YL 1-BROMO-2-OXO-6,9,12,15-TETRAOXA-3-AZAOCTADECAN-18-OATE
CAS:1260139-70-5
Formula: O=C(ON1C(CCC1=O)=O)CCOCCOCCOCCOCCNC(CBr)=O
BD338584
95+%
2,5-DIOXOPYRROLIDIN-1-YL 1-CHLORO-2-OXO-6,9,12,15-TETRAOXA-3-AZAOCTADECAN-18-OATE
CAS:1353011-95-6
Formula: O=C(ON1C(CCC1=O)=O)CCOCCOCCOCCOCCNC(CCl)=O
BD321593
95+%
MFCD20926381
2,5-DIOXOPYRROLIDIN-1-YL 11-(2,5-DIOXO-2,5-DIHYDRO-1H-PYRROL-1-YL) UNDECANOATE
CAS:87981-04-2
Formula: O=C(ON1C(CCC1=O)=O)CCCCCCCCCCN2C(C=CC2=O)=O
BD145689
95+%
MFCD00467873
2,5-DIOXOPYRROLIDIN-1-YL 19-(2,5-DIOXO-2H-PYRROL-1(5H) -YL)-17-OXO-4,7,10,13-TETRAOXA-16-AZANONADECAN-1-OATE
CAS:756525-99-2
Formula: O=C(ON1C(CCC1=O)=O)CCOCCOCCOCCOCCNC(CCN2C(C=CC2=O)=O)=O
BD338647
95+%
2,5-DIOXOPYRROLIDIN-1-YL 1H-INDOLE-4-CARBOXYLATE
CAS:1707737-27-6
Formula: O=C(C1=CC=CC2=C1C=CN2)ON3C(CCC3=O)=O
BD621670
97%
2,5-DIOXOPYRROLIDIN-1-YL 2,4-DIMETHOXYBENZOATE
CAS:1638612-98-2
Formula: O=C(ON1C(CCC1=O)=O)C2=CC=C(OC)C=C2OC
BD618785
97%
2,5-DIOXOPYRROLIDIN-1-YL 2,5,8,11,14,17,20-HEPTAOXATRICOSAN-23-OATE
CAS:874208-92-1
Formula: COCCOCCOCCOCCOCCOCCOCCC(ON1C(CCC1=O)=O)=O
BD446644
97%
2,5-DIOXOPYRROLIDIN-1-YL 2,5,8,11,14-PENTAOXAHEPTADECAN-17-OATE
CAS:874208-94-3
Formula: COCCOCCOCCOCCOCCC(ON1C(CCC1=O)=O)=O
BD446358
97%
2,5-DIOXOPYRROLIDIN-1-YL 2,5,8,11-TETRAOXATETRADECAN-14-OATE
CAS:622405-78-1
Formula: COCCOCCOCCOCCC(ON1C(CCC1=O)=O)=O
BD306356
95+%
n/a
2,5-DIOXOPYRROLIDIN-1-YL 2,6-DIMETHYLQUINOLINE-4-CARBOXYLATE
CAS:569355-30-2
Formula: CC1=CC2=C(C=C1)N=C(C)C=C2C(=O)ON1C(=O)CCC1=O
BD236870
95+%
MFCD16875520
2,5-DIOXOPYRROLIDIN-1-YL 2-(((BENZYLOXY) CARBONYL)AMINO)PROPANOATE
CAS:73488-77-4
Formula: CC(C(ON1C(CCC1=O)=O)=O)NC(OCC2=CC=CC=C2)=O
BD156945
97%
MFCD00189303
2,5-DIOXOPYRROLIDIN-1-YL 2-(((TERT-BUTOXYCARBONYL) AMINO)OXY)ACETATE
CAS:80366-85-4
Formula: O=C(ON1C(CCC1=O)=O)CONC(OC(C)(C)C)=O
BD517434
97%
2,5-DIOXOPYRROLIDIN-1-YL 2-((TERT-BUTOXYCARBONYL) AMINO)-4-METHYLPENTANOATE
CAS:74124-83-7
Formula: CC(C)CC(C(ON1C(CCC1=O)=O)=O)NC(OC(C)(C)C)=O
BD448219
97%
MFCD00836326
2,5-DIOXOPYRROLIDIN-1-YL 2-(2-(((BENZYLOXY) CARBONYL)AMINO)ACETAMIDO)ACETATE
CAS:32943-08-1
Formula: O=C(ON1C(CCC1=O)=O)CNC(CNC(OCC2=CC=CC=C2)=O)=O
BD157066
97%
MFCD00191098
2,5-DIOXOPYRROLIDIN-1-YL 2-(2-(TERT-BUTOXYCARBONYL) HYDRAZINYL)ISONICOTINATE
CAS:870776-18-4
Formula: O=C(C1C=C(NNC(=O)OC(C)(C)C)N=CC=1)ON1C(=O)CCC1=O
BD00737011
95+%
n/a
2,5-DIOXOPYRROLIDIN-1-YL 2-(2-(TERT-BUTOXYCARBONYL) HYDRAZINYL)NICOTINATE
CAS:N/A
Formula: O=C(C1C=CC=NC=1NNC(=O)OC(C)(C)C)ON1C(=O)CCC1=O
BD00725688
95%
2,5-DIOXOPYRROLIDIN-1-YL 2-(3-HYDROXY-3-METHYLBUT-1-YN-1-YL) BENZOATE
CAS:886493-65-8
Formula: O=C(ON1C(CCC1=O)=O)C2=CC=CC=C2C#CC(C)(O)C
BD598160
97%
MFCD06740157
2,5-DIOXOPYRROLIDIN-1-YL 2-(4-NITROPHENYL)ACETATE
CAS:68123-33-1
Formula: O=C(ON1C(CCC1=O)=O)CC2=CC=C([N+]([O-])=O)C=C2
BD145691
97%
MFCD00047124
2,5-DIOXOPYRROLIDIN-1-YL 2-(7-METHOXY-2-OXO-2H-CHROMEN-4-YL) ACETATE
CAS:359436-89-8
Formula: O=C1OC2=C(C=CC(OC)=C2)C(CC(ON3C(CCC3=O)=O)=O)=C1
BD601441
97%
2,5-DIOXOPYRROLIDIN-1-YL 2-(ACETYLTHIO)ACETATE
CAS:76931-93-6
Formula: O=C(ON1C(CCC1=O)=O)CSC(C)=O
BD150866
95+%
MFCD00036891
2,5-DIOXOPYRROLIDIN-1-YL 2-(CYCLOOCT-2-YNYLOXY) ACETATE
CAS:1425803-45-7
Formula: O=C(ON1C(CCC1=O)=O)COC2C#CCCCCC2
BD338609
95+%
2,5-DIOXOPYRROLIDIN-1-YL 2-BROMOACETATE
CAS:42014-51-7
Formula: BrCC(=O)ON1C(=O)CCC1=O
BD118758
95+%
MFCD00058571
2,5-DIOXOPYRROLIDIN-1-YL 2-CYANOACETATE
CAS:56657-76-2
Formula: O=C(ON1C(CCC1=O)=O)CC#N
BD157830
95+%
MFCD00798802
2,5-DIOXOPYRROLIDIN-1-YL 2-ETHOXYBENZOATE
CAS:1401320-15-7
Formula: O=C(ON1C(CCC1=O)=O)C2=CC=CC=C2OCC
BD615455
97%
2,5-DIOXOPYRROLIDIN-1-YL 2-IODOACETATE
CAS:39028-27-8
Formula: O=C(ON1C(CCC1=O)=O)CI
BD134753
95+%
MFCD00058451
2,5-DIOXOPYRROLIDIN-1-YL 2-IODOBENZOATE
CAS:153969-44-9
Formula: O=C(ON1C(CCC1=O)=O)C2=CC=CC=C2I
BD618345
97%
2,5-DIOXOPYRROLIDIN-1-YL 2-METHOXYACETATE
CAS:161742-67-2
Formula: O=C(CC1)N(OC(COC)=O)C1=O
BD330271
95+%
MFCD22193834
2,5-DIOXOPYRROLIDIN-1-YL 2-METHYLBENZOATE
CAS:110920-14-4
Formula: O=C(ON1C(CCC1=O)=O)C2=CC=CC=C2C
BD606514
97%
2,5-DIOXOPYRROLIDIN-1-YL 2-PHENYLBUTANOATE
CAS:152683-20-0
Formula: CCC(C1=CC=CC=C1)C(ON2C(CCC2=O)=O)=O
BD618284
97%
2,5-DIOXOPYRROLIDIN-1-YL 3,5-DICHLOROBENZOATE
CAS:143558-02-5
Formula: O=C(ON1C(CCC1=O)=O)C2=CC(Cl)=CC(Cl)=C2
BD617014
97%
2,5-DIOXOPYRROLIDIN-1-YL 3-(((BENZYLOXY) CARBONYL)AMINO)BENZOATE
CAS:129666-48-4
Formula: O=C(ON1C(CCC1=O)=O)C2=CC=CC(NC(OCC3=CC=CC=C3)=O)=C2
BD156768
97%
2,5-DIOXOPYRROLIDIN-1-YL 3-(2,5-DIOXO-2,5-DIHYDRO-1H-PYRROL-1-YL) BENZOATE
CAS:58626-38-3
Formula: O=C(ON1C(CCC1=O)=O)C2=CC=CC(N3C(C=CC3=O)=O)=C2
BD87625
95+%
MFCD00005514
2,5-DIOXOPYRROLIDIN-1-YL 3-(2-(2-(4-FORMYLBENZAMIDO)ETHOXY)ETHOXY)PROPANOATE
CAS:1807521-07-8
Formula: O=C(ON1C(CCC1=O)=O)CCOCCOCCNC(C2=CC=C(C=O)C=C2)=O
BD625962
97%
2,5-DIOXOPYRROLIDIN-1-YL 3-(2-(2-METHOXYETHOXY) ETHOXY)PROPANOATE
CAS:876746-59-7
Formula: O=C(CC1)N(OC(CCOCCOCCOC)=O)C1=O
BD446435
97%
2,5-DIOXOPYRROLIDIN-1-YL 3-(2-BROMOACETAMIDO)PROPANOATE
CAS:57159-62-3
Formula: O=C(ON1C(CCC1=O)=O)CCNC(CBr)=O
BD170769
97%
MFCD01863457
2,5-DIOXOPYRROLIDIN-1-YL 3-(4-HYDROXYPHENYL) PROPANOATE
CAS:34071-95-9
Formula: O=C(ON1C(CCC1=O)=O)CCC2=CC=C(O)C=C2
BD20320
95+%
MFCD00005515
2,5-DIOXOPYRROLIDIN-1-YL 3-(4-OXO-3,4-DIHYDROQUINAZOLIN-2-YL) -4-((4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)BENZYL)OXY)BENZOATE
CAS:N/A
Formula: O=C(ON1C(CCC1=O)=O)C2=CC=C(OCC3=CC=C(B4OC(C)(C)C(C)(C)O4)C=C3)C(C(N5)=NC6=C(C=CC=C6)C5=O)=C2
BD00732369
95%
n/a
2,5-DIOXOPYRROLIDIN-1-YL 3-(PYRIDIN-2-YLDISULFANYL)BUTANOATE
CAS:107348-47-0
Formula: CC(SSC1=NC=CC=C1)CC(ON2C(CCC2=O)=O)=O
BD337735
95+%
MFCD28398150
2,5-DIOXOPYRROLIDIN-1-YL 3-(TRITYLTHIO)PROPANOATE
CAS:129431-12-5
Formula: O=C(ON1C(CCC1=O)=O)CCSC(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4
BD251996
95+%
2,5-DIOXOPYRROLIDIN-1-YL 3-METHOXYPROPANOATE
CAS:1027371-75-0
Formula: O=C(ON1C(CCC1=O)=O)CCOC
BD446611
97%
2,5-DIOXOPYRROLIDIN-1-YL 3-OXOCYCLOBUTANECARBOXYLATE
CAS:939412-81-4
Formula: O=C(C1CC(C1)=O)ON2C(CCC2=O)=O
BD447032
97%
MFCD23378924
2,5-DIOXOPYRROLIDIN-1-YL 4,7,10,13-TETRAOXAHEXADEC-15-YN-1-OATE
CAS:1428629-70-2
Formula: C#CCOCCOCCOCCOCCC(ON1C(CCC1=O)=O)=O
BD338610
95+%
2,5-DIOXOPYRROLIDIN-1-YL 4-((2,5-DIOXO-2,5-DIHYDRO-1H-PYRROL-1-YL) METHYL)CYCLOHEXANECARBOXYLATE
CAS:64987-85-5
Formula: O=C(C1CCC(CN2C(C=CC2=O)=O)CC1)ON3C(CCC3=O)=O
BD151232
97%
MFCD00009634
2,5-DIOXOPYRROLIDIN-1-YL 4-((3-(DIMETHYLCARBAMOYL)PYRIDIN-4-YL)DISULFANYL)PENTANOATE
CAS:663599-10-8
Formula: CC(SSC1=C(C(N(C)C)=O)C=NC=C1)CCC(ON2C(CCC2=O)=O)=O
BD338642
95+%
2,5-DIOXOPYRROLIDIN-1-YL 4-((5-NITROPYRIDIN-2-YL)DISULFANYL)PENTANOATE
CAS:663598-61-6
Formula: CC(SSC1=NC=C([N+]([O-])=O)C=C1)CCC(ON2C(CCC2=O)=O)=O
BD338634
95+%
2,5-DIOXOPYRROLIDIN-1-YL 4-(2-IODOACETAMIDO)BENZOATE
CAS:72252-96-1
Formula: O=C(ON1C(CCC1=O)=O)C2=CC=C(NC(CI)=O)C=C2
BD145694
95+%
2,5-DIOXOPYRROLIDIN-1-YL 4-(5-((3AS,4S,6AR)-2-OXOHEXAHYDRO-1H-THIENO[3,4-D]IMIDAZOL-4-YL)PENTANAMIDO)BUTANOATE
CAS:258289-54-2
Formula: O=C(ON1C(CCC1=O)=O)CCCNC(CCCC[C@@H]2SC[C@]([C@]2([H])N3)([H])NC3=O)=O
BD289625
95+%
2,5-DIOXOPYRROLIDIN-1-YL 4-(TERT-BUTYL)BENZOATE
CAS:141537-23-7
Formula: O=C(ON1C(CCC1=O)=O)C2=CC=C(C(C)(C)C)C=C2
BD615694
97%
2,5-DIOXOPYRROLIDIN-1-YL 4-(VINYLSULFONYL) BENZOATE
CAS:343934-41-8
Formula: O=C(ON1C(CCC1=O)=O)C2=CC=C(S(=O)(C=C)=O)C=C2
BD170740
95+%
MFCD16876289
2,5-DIOXOPYRROLIDIN-1-YL 4-BENZOYLBENZOATE
CAS:91990-88-4
Formula: O=C(ON1C(CCC1=O)=O)C2=CC=C(C(C3=CC=CC=C3)=O)C=C2
BD94379
97%
2,5-DIOXOPYRROLIDIN-1-YL 4-CYANO-4-(((ETHYLTHIO)CARBONOTHIOYL)THIO)PENTANOATE
CAS:1195771-65-3
Formula: CC(SC(SCC)=S)(C#N)CCC(ON1C(CCC1=O)=O)=O
BD571782
97%
n/a
2,5-DIOXOPYRROLIDIN-1-YL 4-FLUOROBENZOATE
CAS:66134-67-6
Formula: FC1=CC=C(C=C1)C(=O)ON1C(=O)CCC1=O
BD236504
95+%
MFCD00587232
2,5-DIOXOPYRROLIDIN-1-YL 4-FORMYLBENZOATE
CAS:60444-78-2
Formula: O=C(ON1C(CCC1=O)=O)C2=CC=C(C=O)C=C2
BD152075
95+%
MFCD00133733
2,5-DIOXOPYRROLIDIN-1-YL 4-IODOBENZOATE
CAS:39028-25-6
Formula: O=C(ON1C(CCC1=O)=O)C2=CC=C(I)C=C2
BD331516
95+%
MFCD24387072
2,5-DIOXOPYRROLIDIN-1-YL 4-METHOXYBENZOATE
CAS:30364-57-9
Formula: O=C(ON1C(CCC1=O)=O)C2=CC=C(OC)C=C2
BD624615
97%
2,5-DIOXOPYRROLIDIN-1-YL 4-METHYL-4-((5-NITROPYRIDIN-2-YL)DISULFANYL)PENTANOATE
CAS:663598-98-9
Formula: CC(SSC1=NC=C([N+]([O-])=O)C=C1)(C)CCC(ON2C(CCC2=O)=O)=O
BD338638
95+%
2,5-DIOXOPYRROLIDIN-1-YL 4-METHYL-4-(PYRIDIN-2-YLDISULFANYL)PENTANOATE
CAS:890409-85-5
Formula: CC(SSC1=NC=CC=C1)(C)CCC(ON2C(CCC2=O)=O)=O
BD338489
95+%
MFCD20230415
2,5-DIOXOPYRROLIDIN-1-YL 4-NITROBENZOATE
CAS:30364-58-0
Formula: O=C(ON1C(CCC1=O)=O)C2=CC=C([N+]([O-])=O)C=C2
BD624616
97%
2,5-DIOXOPYRROLIDIN-1-YL 5-ETHYL-3-METHYLBENZOFURAN-2-CARBOXYLATE
CAS:1269534-09-9
Formula: O=C(C1=C(C)C2=CC(CC)=CC=C2O1)ON3C(CCC3=O)=O
BD609160
97%
2,5-DIOXOPYRROLIDIN-1-YL 6-((((9H-FLUOREN-9-YL)METHOXY)CARBONYL)AMINO)HEXANOATE
CAS:125697-63-4
Formula: O=C(ON1C(CCC1=O)=O)CCCCCNC(OCC2C3=C(C4=C2C=CC=C4)C=CC=C3)=O
BD239728
95+%
MFCD03788086
2,5-DIOXOPYRROLIDIN-1-YL 6-((2,4-DINITROPHENYL)AMINO)HEXANOATE
CAS:82321-04-8
Formula: O=C(ON1C(CCC1=O)=O)CCCCCNC2=CC=C([N+]([O-])=O)C=C2[N+]([O-])=O
BD450103
97%
MFCD00191630
2,5-DIOXOPYRROLIDIN-1-YL 6-((4-AZIDO-2-NITROPHENYL)AMINO)HEXANOATE
CAS:64309-05-3
Formula: O=[N+](C1=C(C=CC(N=[N+]=[N-])=C1)NCCCCCC(ON(C(CC2)=O)C2=O)=O)[O-]
BD150829
97%
MFCD00049058
2,5-DIOXOPYRROLIDIN-1-YL 6-(2,2,2-TRIFLUOROACETAMIDO)HEXANOATE
CAS:117032-51-6
Formula: O=C(ON1C(CCC1=O)=O)CCCCCNC(C(F)(F)F)=O
BD316834
95+%
n/a
2,5-DIOXOPYRROLIDIN-1-YL 6-(2-(PROPAN-2-YLIDENE)HYDRAZINYL)NICOTINATE
CAS:362522-50-7
Formula: O=C(ON1C(CCC1=O)=O)C2=CN=C(NN=C(C)C)C=C2
BD629279
97%
2,5-DIOXOPYRROLIDIN-1-YL 6-(2-(TERT-BUTOXYCARBONYL) HYDRAZINYL)NICOTINATE
CAS:133081-26-2
Formula: CC(C)(C)OC(=O)NNC1=NC=C(C=C1)C(=O)ON1C(=O)CCC1=O
BD152076
95+%
MFCD03788694
2,5-DIOXOPYRROLIDIN-1-YL 6-(2-(TERT-BUTOXYCARBONYL) HYDRAZINYL)PICOLINATE
CAS:N/A
Formula: O=C(C1C=CC=C(NNC(=O)OC(C)(C)C)N=1)ON1C(=O)CCC1=O
BD00750029
95%
2,5-DIOXOPYRROLIDIN-1-YL 6-(5-((3AS,4S,6AR)-2-OXOHEXAHYDRO-1H-THIENO[3,4-D]IMIDAZOL-4-YL)PENTANAMIDO)HEXANOATE
CAS:72040-63-2
Formula: O=C(ON1C(CCC1=O)=O)CCCCCNC(CCCC[C@@H]2SC[C@]([C@]2([H])N3)([H])NC3=O)=O
BD116735
95+%
MFCD00065502
2,5-DIOXOPYRROLIDIN-1-YL 7-(2,5-DIOXO-2,5-DIHYDRO-1H-PYRROL-1-YL) HEPTANOATE
CAS:724721-93-1
Formula: O=C(ON1C(CCC1=O)=O)CCCCCCN2C(C=CC2=O)=O
BD290553
95+%
2,5-DIOXOPYRROLIDIN-1-YL 7-(DIETHYLAMINO)-2-OXO-2H-CHROMENE-3-CARBOXYLATE
CAS:139346-57-9
Formula: O=C(C(C1=O)=CC2=C(O1)C=C(N(CC)CC)C=C2)ON3C(CCC3=O)=O
BD110553
95+%
MFCD00467585
2,5-DIOXOPYRROLIDIN-1-YL 7-HYDROXY-2-OXO-2H-CHROMENE-3-CARBOXYLATE
CAS:134471-24-2
Formula: OC1=CC=C2C=C(C(=O)ON3C(=O)CCC3=O)C(=O)OC2=C1
BD110692
95+%
MFCD00037568
2,5-DIOXOPYRROLIDIN-1-YL 7-METHOXY-2-OXO-2H-CHROMENE-3-CARBOXYLATE
CAS:150321-92-9
Formula: COC1=CC=C2C=C(C(=O)ON3C(=O)CCC3=O)C(=O)OC2=C1
BD145692
95+%
MFCD00467593
2,5-DIOXOPYRROLIDIN-1-YL ACETATE
CAS:14464-29-0
Formula: CC(=O)ON1C(=O)CCC1=O
BD152077
98%
MFCD00037916
2,5-DIOXOPYRROLIDIN-1-YL ACRYLATE
CAS:38862-24-7
Formula: C=CC(ON1C(CCC1=O)=O)=O
BD4868
97%
MFCD00078261
2,5-DIOXOPYRROLIDIN-1-YL DODECANOATE
CAS:14565-47-0
Formula: CCCCCCCCCCCC(ON1C(CCC1=O)=O)=O
BD571135
97%
MFCD00050401
2,5-DIOXOPYRROLIDIN-1-YL METHYL PHTHALATE
CAS:438470-19-0
Formula: COC(=O)C1=CC=CC=C1C(=O)ON1C(=O)CCC1=O
BD228253
95+%
MFCD05865192
2,5-DIOXOPYRROLIDIN-1-YL METHYLCARBAMATE
CAS:18342-66-0
Formula: CNC(=O)ON1C(=O)CCC1=O
BD145695
97%
MFCD00800292
2,5-DIOXOPYRROLIDIN-1-YL OCTANOATE
CAS:14464-30-3
Formula: CCCCCCCC(ON1C(CCC1=O)=O)=O
BD119865
97%
MFCD00050404
2,5-DIOXOPYRROLIDIN-1-YL PALMITATE
CAS:14464-31-4
Formula: CCCCCCCCCCCCCCCC(ON1C(CCC1=O)=O)=O
BD145693
95+%
2,5-DIOXOPYRROLIDIN-1-YL QUINOLIN-2-YLCARBAMATE
CAS:N/A
Formula: O=C(NC1C=CC2C(=CC=CC=2)N=1)ON1C(=O)CCC1=O
BD00744531
95%
n/a
2,5-DIOXOPYRROLIDIN-1-YL QUINOLIN-3-YLCARBAMATE
CAS:148757-95-3
Formula: O=C(NC1C=NC2C(=CC=CC=2)C=1)ON1C(=O)CCC1=O
BD00725051
95+%
n/a
2,5-DIOXOPYRROLIDIN-1-YL QUINOLIN-4-YLCARBAMATE
CAS:N/A
Formula: O=C(NC1C2C(=CC=CC=2)N=CC=1)ON1C(=O)CCC1=O
BD00738443
95%
n/a
2,5-DIOXOPYRROLIDIN-1-YL QUINOLIN-5-YLCARBAMATE
CAS:148757-98-6
Formula: O=C(ON1C(CCC1=O)=O)NC2=C3C=CC=NC3=CC=C2
BD752843
97%
2,5-DIOXOPYRROLIDIN-1-YL QUINOLIN-6-YLCARBAMATE
CAS:148757-94-2
Formula: O=C(ON1C(CCC1=O)=O)NC2=CC=C3N=CC=CC3=C2
BD289369
95+%
2,5-DIOXOPYRROLIDIN-1-YL QUINOLIN-7-YLCARBAMATE
CAS:N/A
Formula: O=C(ON1C(CCC1=O)=O)NC2=CC=C3C=CC=NC3=C2
BD751464
97%
2,5-DIOXOPYRROLIDIN-1-YL QUINOLIN-8-YLCARBAMATE
CAS:N/A
Formula: O=C(ON1C(CCC1=O)=O)NC2=C3N=CC=CC3=CC=C2
BD751465
97%
2,5-DIOXOPYRROLIDIN-1-YL TETRADECANOATE
CAS:69888-86-4
Formula: CCCCCCCCCCCCCC(ON1C(CCC1=O)=O)=O
BD293772
95+%
2,5-DIOXOPYRROLIDIN-1-YL TETRAHYDRO-2H-PYRAN-4-CARBOXYLATE
CAS:1369515-33-2
Formula: O=C(C1CCOCC1)ON2C(CCC2=O)=O
BD306690
95+%
MFCD25562901
2,5-DIPHENETHYL-1H-PYRROLE-3-CARBONITRILE
CAS:857420-96-3
Formula: N#CC1=C(CCC2=CC=CC=C2)NC(CCC3=CC=CC=C3)=C1
BD269134
95+%
2,5-DIPHENYL-1,3,4-OXADIAZOLE
CAS:725-12-2
Formula: C1(C2=CC=CC=C2)=NN=C(C3=CC=CC=C3)O1
BD67879
95+%
MFCD00003102
2,5-DIPHENYL-1H-IMIDAZOLE
CAS:670-83-7
Formula: N1C=C(N=C1C1=CC=CC=C1)C1=CC=CC=C1
BD67215
98%
MFCD07772899
2,5-DIPHENYL-1H-PYRROLE
CAS:838-40-4
Formula: C1(C2=CC=CC=C2)=CC=C(C3=CC=CC=C3)N1
BD319160
95+%
MFCD00767151
2,5-DIPHENYL-1H-PYRROLE-3-CARBONITRILE
CAS:67421-66-3
Formula: N#CC1=C(C2=CC=CC=C2)NC(C3=CC=CC=C3)=C1
BD269129
95+%
MFCD00767152
2,5-DIPHENYLFURAN
CAS:955-83-9
Formula: C1(C2=CC=CC=C2)=CC=C(C3=CC=CC=C3)O1
BD16251
97%
MFCD00037353
2,5-DIPHENYLOXAZOLE
CAS:92-71-7
Formula: C1(C2=CC=CC=C2)=NC=C(C3=CC=CC=C3)O1
BD67887
95+%
MFCD00005306
2,5-DIPHENYLPYRAZOLO[1,5-A]PYRIMIDIN-7-AMINE
CAS:310422-25-4
Formula: NC1=CC(C2=CC=CC=C2)=NC3=CC(C4=CC=CC=C4)=NN13
BD594144
97%
MFCD01053019
2,5-DIPHENYLPYRAZOLO[1,5-A]PYRIMIDIN-7-OL
CAS:331968-09-3
Formula: OC1=CC(C2=CC=CC=C2)=NC3=CC(C4=CC=CC=C4)=NN13
BD594434
97%
MFCD00634656
2,5-DIPHENYLPYRIDINE
CAS:15827-72-2
Formula: C1(C2=CC=CC=C2)=NC=C(C3=CC=CC=C3)C=C1
BD67889
95+%
MFCD00444961
2,5-DIPHENYLTHIAZOL-4-OL
CAS:59484-42-3
Formula: OC1=C(C2=CC=CC=C2)SC(C3=CC=CC=C3)=N1
BD67880
95+%
MFCD00895725
2,5-DIPHENYLTHIOPHENE
CAS:1445-78-9
Formula: C1(C2=CC=CC=C2)=CC=C(C3=CC=CC=C3)S1
BD8604
95+%
MFCD00626285
2,5-DITERT-BUTYL-1H-INDOLE
CAS:900640-46-2
Formula: CC(C1=CC2=C(NC(C(C)(C)C)=C2)C=C1)(C)C
BD328014
95+%
MFCD05224491
2,5-DITERT-BUTYL-1H-INDOLE-3-CARBALDEHYDE
CAS:590347-37-8
Formula: O=CC1=C(C(C)(C)C)NC2=C1C=C(C(C)(C)C)C=C2
BD327500
95+%
MFCD05180762
2,5-DITHIOCYANATOTHIOPHENE
CAS:34099-59-7
Formula: N#CSC1=CC=C(SC#N)S1
BD508537
97%
MFCD20441363
2,5-DITHIOXO-3-(P-TOLYL)-2,3,5,6-TETRAHYDROTHIAZOLO[4,5-D]PYRIMIDIN-7(4H)-ONE
CAS:1325304-08-2
Formula: O=C(N1)C(SC(N2C3=CC=C(C)C=C3)=S)=C2NC1=S
BD610240
97%
2,5-PYRIDINEDICARBOXYLIC ACID
CAS:100-26-5
Formula: OC(=O)C1=CN=C(C=C1)C(O)=O
BD17209
97%
MFCD00006297
2,6 DIFLUORO 3-HYDROXY BENZOIC ACID
CAS:749230-32-8
Formula: OC(=O)C1=C(F)C(O)=CC=C1F
BD212677
97%
MFCD08275286
2,6,10,10-TETRAMETHYL-1-OXASPIRO[4.5]DEC-6-ENE
CAS:36431-72-8
Formula: CC1(C)CCC=C(C)C21CCC(C)O2
BD130161
95+%
MFCD00085214
2,6,10,15,19,23-HEXAMETHYLTETRACOSANE
CAS:111-01-3
Formula: CC(C)CCCC(C)CCCC(C)CCCCC(C)CCCC(C)CCCC(C)C
BD151864
97%
MFCD00008953
2,6,16-KAURANETRIOL
CAS:41530-90-9
Formula: CC1(C)CC(O)C[C@]2(C)[C@]3([H])[C@]4(C[C@@]([C@H](CC3)C4)(O)C)CC(O)[C@@]12[H]
BD235867
95+%
2,6,16-KAURANETRIOL 2-O-BETA-D-ALLOPYRANOSIDE
CAS:195735-16-1
BD235811
95+%
2,6,6-TRIMETHYL-6,7-DIHYDRO-1H-INDOL-4(5H)-ONE
CAS:69595-03-5
Formula: CC1=CC2=C(CC(C)(C)CC2=O)N1
BD238129
95+%
MFCD00129627
2,6,6-TRIMETHYLBICYCLO[3.1.1]HEPTAN-3-AMINE
CAS:69460-11-3
Formula: NC1CC2CC(C1C)C2(C)C
BD42903
97%
2,6,6-TRIMETHYLBICYCLO[3.1.1]HEPTANE
CAS:473-55-2
Formula: CC1(C)C2CCC(C)C1C2
BD148089
97%
MFCD00078047
2,6,6-TRIMETHYLCYCLOHEPTA-2,4-DIENONE
CAS:503-93-5
Formula: O=C1C(C)=CC=CC(C)(C)C1
BD67936
97%
MFCD00182537
2,6,6-TRIMETHYLCYCLOHEX-1-ENECARBALDEHYDE
CAS:432-25-7
Formula: CC1(C)CCCC(C)=C1C=O
BD116490
97%
2,6,6-TRIMETHYLCYCLOHEX-2-ENE-1,4-DIONE
CAS:1125-21-9
Formula: O=C1C(C)=CC(CC1(C)C)=O
BD67937
95+%
MFCD00043119
2,6,7-TRICHLORO-3-(TRIFLUOROMETHYL)QUINOXALINE
CAS:281209-13-0
Formula: FC(C1=NC2=CC(Cl)=C(Cl)C=C2N=C1Cl)(F)F
BD258159
95+%
MFCD09801052
2,6,7-TRICHLOROIMIDAZO[1,2-A]PYRIDINE
CAS:131773-47-2
Formula: ClC1=CC2=NC(Cl)=CN2C=C1Cl
BD67941
95+%
2,6,7-TRICHLOROQUINAZOLIN-4(3H)-ONE
CAS:N/A
Formula: O=C1NC(Cl)=NC2=C1C=C(Cl)C(Cl)=C2
BD753091
97%
2,6,7-TRICHLOROQUINAZOLIN-4-AMINE
CAS:N/A
Formula: NC1=C2C=C(Cl)C(Cl)=CC2=NC(Cl)=N1
BD753092
97%
2,6,7-TRICHLOROQUINAZOLINE
CAS:N/A
Formula: ClC1=CC2=NC(Cl)=NC=C2C=C1Cl
BD752034
97%
2,6,7-TRICHLOROQUINOLINE-3-CARBALDEHYDE
CAS:281208-97-7
Formula: ClC1=CC2=C(C=C1Cl)N=C(Cl)C(C=O)=C2
BD235639
95+%
MFCD06202346
2,6,7-TRICHLOROQUINOXALINE
CAS:41213-31-4
Formula: ClC1=C(Cl)C=C2N=CC(Cl)=NC2=C1
BD250030
97%
MFCD11519427
2,6,7-TRIMETHYLQUINOLINE
CAS:72681-37-9
Formula: CC1=C(C)C=C2C=CC(C)=NC2=C1
BD348727
95+%
MFCD08437588
2,6,8-TRICHLORO-7H-PURINE
CAS:2562-52-9
Formula: ClC1=NC2=NC(Cl)=NC(Cl)=C2N1
BD248723
95+%
MFCD00067308
2,6,8-TRIMETHYL-1-(2-OXOPROPYL) QUINOLIN-4(1H)-ONE
CAS:1209876-74-3
Formula: O=C1C=C(C)N(CC(C)=O)C2=C1C=C(C)C=C2C
BD607494
97%
2,6,8-TRIMETHYLQUINOLINE
CAS:2243-90-5
Formula: CC1=C2N=C(C)C=CC2=CC(C)=C1
BD587471
97%
2,6,8-TRIMETHYLQUINOLINE-3-CARBOXYLIC ACID
CAS:876721-02-7
Formula: O=C(C1=CC2=CC(C)=CC(C)=C2N=C1C)O
BD183895
97%
2,6,8-TRIMETHYLQUINOLINE-4-CARBOXYLIC ACID
CAS:93189-20-9
Formula: O=C(C1=CC(C)=NC2=C(C)C=C(C)C=C12)O
BD173413
95+%
2,6-BIS(((BENZYLOXY) CARBONYL)AMINO)HEXANOIC ACID
CAS:55592-85-3
Formula: O=C(O)C(NC(OCC1=CC=CC=C1)=O)CCCCNC(OCC2=CC=CC=C2)=O
BD156953
97%
MFCD00069644
2,6-BIS((2-HYDROXYETHYL) AMINO)-4-METHYLNICOTINONITRILE
CAS:38841-88-2
Formula: N#CC1=C(C)C=C(NCCO)N=C1NCCO
BD651730
97%
2,6-BIS((3-METHOXYPROPYL) AMINO)-4-METHYLNICOTINONITRILE
CAS:51560-72-6
Formula: N#CC1=C(C)C=C(NCCCOC)N=C1NCCCOC
BD86283
97%
2,6-BIS((3AR,8AS)-8,8A-DIHYDRO-3AH-INDENO[1,2-D]OXAZOL-2-YL)PYRIDINE
CAS:357209-32-6
Formula: C1[C@@H]2OC(=N[C@@H]2C2=CC=CC=C12)C1=CC=CC(=N1)C1=N[C@H]2[C@H](CC3=CC=CC=C23)O1
BD214228
95+%
MFCD09265074
2,6-BIS((3AS,8AR)-8,8A-DIHYDRO-3AH-INDENO[1,2-D]OXAZOL-2-YL)PYRIDINE
CAS:185346-09-2
Formula: C1[C@H]2OC(=N[C@H]2C2=CC=CC=C12)C1=CC=CC(=N1)C1=N[C@@H]2[C@@H](CC3=CC=CC=C23)O1
BD214220
98%
MFCD05861599
2,6-BIS((4,6-DIMETHOXYPYRIMIDIN-2-YL) OXY)BENZOIC ACID
CAS:125401-75-4
Formula: COC1=CC(OC)=NC(OC2=CC=CC(OC3=NC(OC)=CC(OC)=N3)=C2C(O)=O)=N1
BD67982
97%
MFCD02071313
2,6-BIS((BIS(PYRIDIN-2-YLMETHYL)AMINO)METHYL)-4-METHYLPHENOL
CAS:80528-41-2
Formula: OC1=C(CN(CC2=NC=CC=C2)CC3=NC=CC=C3)C=C(C)C=C1CN(CC4=NC=CC=C4)CC5=NC=CC=C5
BD405444
95+%
MFCD16652516
2,6-BIS((DI-TERT-BUTYLPHOSPHINO)METHYL)PYRIDINE
CAS:338800-13-8
Formula: CC(P(CC1=CC=CC(CP(C(C)(C)C)C(C)(C)C)=N1)C(C)(C)C)(C)C
BD244499
95+%
MFCD10565623
2,6-BIS((DIMETHYLAMINO)METHYL)-4-(PENTAN-2-YL)PHENOL
CAS:924868-91-7
Formula: OC1=C(CN(C)C)C=C(C(CCC)C)C=C1CN(C)C
BD201048
95+%
2,6-BIS((DIMETHYLAMINO)METHYL)-4-ETHYLPHENOL
CAS:36805-45-5
Formula: OC1=C(CN(C)C)C=C(CC)C=C1CN(C)C
BD200971
95+%
2,6-BIS((DIMETHYLAMINO)METHYL)PYRIDIN-3-OL
CAS:2168-17-4
Formula: OC1=CC=C(CN(C)C)N=C1CN(C)C
BD350831
95+%
MFCD00030824
2,6-BIS((PHENYLSULFONYL)OXY)-1,4-PHENYLENE DIACETATE
CAS:20032-31-9
Formula: O=S(OC1=C(OC(C)=O)C(OS(=O)(C2=CC=CC=C2)=O)=CC(OC(C)=O)=C1)(C3=CC=CC=C3)=O
BD227412
95+%
2,6-BIS((R)-4-(TERT-BUTYL)-4,5-DIHYDROOXAZOL-2-YL)PYRIDINE
CAS:185346-17-2
Formula: CC([C@H]1N=C(C2=CC=CC(C3=N[C@H](C(C)(C)C)CO3)=N2)OC1)(C)C
BD67984
97%
2,6-BIS((R)-4-BENZYL-4,5-DIHYDROOXAZOL-2-YL)PYRIDINE
CAS:365215-38-9
Formula: C1(C2=N[C@H](CC3=CC=CC=C3)CO2)=NC(C4=N[C@H](CC5=CC=CC=C5)CO4)=CC=C1
BD233638
95+%
2,6-BIS((R)-4-ISOPROPYL-4,5-DIHYDROOXAZOL-2-YL)PYRIDINE
CAS:131864-67-0
Formula: CC([C@H]1N=C(C2=CC=CC(C3=N[C@H](C(C)C)CO3)=N2)OC1)C
BD8908
97%
MFCD01321334
2,6-BIS((R)-4-ISOPROPYL-5,5-DIPHENYL-4,5-DIHYDROOXAZOL-2-YL)PYRIDINE
CAS:828918-24-7
BD214231
95+%
2,6-BIS((R)-4-PHENYL-4,5-DIHYDROOXAZOL-2-YL)PYRIDINE
CAS:128249-70-7
Formula: [C@@H]1(N=C(OC1)C2=NC(=CC=C2)C4=N[C@H](C3=CC=CC=C3)CO4)C5=CC=CC=C5
BD43012
98%
MFCD01863585
2,6-BIS((S)-4-(TERT-BUTYL)-4,5-DIHYDROOXAZOL-2-YL)PYRIDINE
CAS:118949-63-6
Formula: CC(C)(C)[C@H]1COC(=N1)C1=CC=CC(=N1)C1=N[C@H](CO1)C(C)(C)C
BD42680
95+%
MFCD07368372
2,6-BIS((S)-4-ISOPROPYL-4,5-DIHYDROOXAZOL-2-YL)PYRIDINE
CAS:118949-61-4
Formula: CC(C)[C@H]1COC(=N1)C1=CC=CC(=N1)C1=N[C@H](CO1)C(C)C
BD214217
95+%
MFCD00191815
2,6-BIS((S)-4-ISOPROPYL-5,5-DIPHENYL-4,5-DIHYDROOXAZOL-2-YL)PYRIDINE
CAS:162213-03-8
BD214219
95+%
2,6-BIS((S)-4-PHENYL-4,5-DIHYDROOXAZOL-2-YL)PYRIDINE
CAS:174500-20-0
Formula: [C@H]1(N=C(OC1)C2=CC=CC(=N2)C4=N[C@@H](C3=CC=CC=C3)CO4)C5=CC=CC=C5
BD27775
95+%
MFCD01863586
2,6-BIS(1,1-DIMETHYLETHYL)-N,N-DIMETHYL-4-PYRIDINAMINE
CAS:38222-90-1
Formula: CN(C)C1=CC(C(C)(C)C)=NC(C(C)(C)C)=C1
BD305791
95+%
n/a
2,6-BIS(1,3-DIOXOISOINDOLIN-2-YL) HEXANOIC ACID
CAS:43018-26-4
Formula: O=C(O)C(N(C(C1=C2C=CC=C1)=O)C2=O)CCCCN(C(C3=C4C=CC=C3)=O)C4=O
BD562955
97%
2,6-BIS(1-METHYL-1H-BENZO[D]IMIDAZOL-2-YL)PYRIDIN-4-OL
CAS:533928-74-4
Formula: OC1=CC(C2=NC3=CC=CC=C3N2C)=NC(C4=NC5=CC=CC=C5N4C)=C1
BD232860
95+%
2,6-BIS(1-METHYL-1H-BENZO[D]IMIDAZOL-2-YL)PYRIDINE
CAS:112362-30-8
Formula: CN1C(C2=CC=CC(C3=NC4=CC=CC=C4N3C)=N2)=NC5=CC=CC=C15
BD232840
95+%
2,6-BIS(1H-2-IMIDAZOLYL)PYRIDINE
CAS:151674-75-8
Formula: C1(C2=NC=CN2)=NC(C3=NC=CN3)=CC=C1
BD323311
95+%
MFCD08668015
2,6-BIS(1H-BENZO[D]IMIDAZOL-1-YL)PYRIDINE
CAS:1030366-99-4
Formula: C1(N2C=NC3=CC=CC=C23)=NC(N4C=NC5=CC=CC=C45)=CC=C1
BD262404
98%
2,6-BIS(1H-BENZO[D]IMIDAZOL-2-YL)PYRIDINE
CAS:28020-73-7
Formula: C1(C2=NC3=CC=CC=C3N2)=NC(C4=NC5=CC=CC=C5N4)=CC=C1
BD67952
98%
MFCD00134500
2,6-BIS(2,2,2-TRIFLUOROETHOXY) BENZONITRILE
CAS:93624-57-8
Formula: N#CC1=C(OCC(F)(F)F)C=CC=C1OCC(F)(F)F
BD67950
97%
2,6-BIS(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL) BENZO[1,2-B:4,5-B']DITHIOPHENE
CAS:861398-06-3
Formula: CC1(C)C(C)(C)OB(C2=CC3=C(C=C(C=C(B4OC(C)(C)C(C)(C)O4)S5)C5=C3)S2)O1
BD331733
95+%
2,6-BIS(4,5-DIHYDROOXAZOL-2-YL) PYRIDINE
CAS:165125-95-1
Formula: C1(C2=NCCO2)=NC(C3=NCCO3)=CC=C1
BD293022
95+%
MFCD28145681
2,6-BIS(4-FLUOROBENZYLIDENE)CYCLOHEXANONE
CAS:62085-74-9
Formula: O=C1/C(CCC/C1=C\C2=CC=C(F)C=C2)=C/C3=CC=C(F)C=C3
BD67958
97%
2,6-BIS(4-METHOXYPHENYL) -3,5-DIMETHYLPIPERIDIN-4-ONE
CAS:151454-11-4
Formula: O=C1C(C)C(C2=CC=C(OC)C=C2)NC(C3=CC=C(OC)C=C3)C1C
BD268638
95+%
MFCD01126398
2,6-BIS(BENZO[D]OXAZOL-2-YL) PYRIDINE
CAS:33858-36-5
Formula: O1C2=C(C=CC=C2)N=C1C1=CC=CC(=N1)C1=NC2=C(O1)C=CC=C2
BD216982
95+%
MFCD05241117
2,6-BIS(BENZYLOXY) -3-BROMOPYRIDINE
CAS:16727-47-2
Formula: BrC1=CC=C(OCC2=CC=CC=C2)N=C1OCC3=CC=CC=C3
BD229843
95+%
2,6-BIS(BENZYLOXY) PYRIDIN-4-AMINE
CAS:23827-19-2
Formula: NC1=CC(OCC2=CC=CC=C2)=NC(OCC3=CC=CC=C3)=C1
BD252546
95+%
MFCD20257886
2,6-BIS(BENZYLOXY) PYRIDINE
CAS:16727-46-1
Formula: C1(OCC2=CC=CC=C2)=NC(OCC3=CC=CC=C3)=CC=C1
BD229838
95+%
2,6-BIS(CHLOROMETHYL)NAPHTHALENE
CAS:93036-77-2
Formula: ClCC1=CC2=CC=C(CCl)C=C2C=C1
BD765928
97%
2,6-BIS(CHLOROMETHYL)PYRIDINE HYDROCHLORIDE
CAS:55422-79-2
Formula: ClCC1=CC=CC(CCl)=N1.[H]Cl
BD33146
95+%
MFCD00142844
2,6-BIS(DIMETHYLAMINO)-5-FORMYL-4-METHYLNICOTINONITRILE
CAS:57959-35-0
Formula: N#CC1=C(N(C)C)N=C(N(C)C)C(C=O)=C1C
BD283839
95+%
2,6-BIS(DIMETHYLAMINO)PYRIMIDINE-4-CARBOXYLIC ACID HYDRATE
CAS:386715-39-5
Formula: O=C(C1=NC(N(C)C)=NC(N(C)C)=C1)O.[H]O[H]
BD320223
95+%
MFCD07366474
2,6-BIS(DIPHENYLAMINO)ANTHRACENE-9,10-DIONE
CAS:868850-50-4
Formula: O=C1C2=C(C=C(N(C3=CC=CC=C3)C4=CC=CC=C4)C=C2)C(C5=CC=C(N(C6=CC=CC=C6)C7=CC=CC=C7)C=C15)=O
BD417777
95+%
MFCD20040460
2,6-BIS(DIPHENYLPHOSPHINO)PYRIDINE
CAS:64741-27-1
Formula: C1(P(C2=CC=CC=C2)C3=CC=CC=C3)=NC(P(C4=CC=CC=C4)C5=CC=CC=C5)=CC=C1
BD245067
95+%
MFCD04039760
2,6-BIS(DODECYLOXY) BENZALDEHYDE
CAS:1198467-57-0
Formula: O=CC1=C(OCCCCCCCCCCCC)C=CC=C1OCCCCCCCCCCCC
BD283681
97%
2,6-BIS(FLUOROMETHYL)MORPHOLINE HYDROCHLORIDE
CAS:1454650-20-4
Formula: FCC1OC(CF)CNC1.[H]Cl
BD441071
97%
MFCD27922437
2,6-BIS(METHOXYMETHYL) PYRIMIDIN-4-AMINE
CAS:1250358-31-6
Formula: NC1=NC(OC)=NC(OC)=C1C
BD283113
95+%
MFCD16707671
2,6-BIS(METHYLTHIO)BENZALDEHYDE
CAS:918882-53-8
Formula: O=CC1=C(SC)C=CC=C1SC
BD561749
97%
2,6-BIS(OCTYLOXY) BENZALDEHYDE
CAS:1175455-04-5
Formula: O=CC1=C(OCCCCCCCC)C=CC=C1OCCCCCCCC
BD759598
95%
MFCD30471372
2,6-BIS(TRIBUTYLSTANNYL)PYRIDINE
CAS:163630-07-7
Formula: CCCC[Sn](C1=CC=CC([Sn](CCCC)(CCCC)CCCC)=N1)(CCCC)CCCC
BD289616
95+%
MFCD01114685
2,6-BIS(TRIFLUOROMETHYL)ANILINE
CAS:313-13-3
Formula: NC1=C(C=CC=C1C(F)(F)F)C(F)(F)F
BD67972
95+%
MFCD01313162
2,6-BIS(TRIFLUOROMETHYL)BENZOIC ACID
CAS:24821-22-5
Formula: OC(=O)C1=C(C=CC=C1C(F)(F)F)C(F)(F)F
BD11453
98%
MFCD00000376
2,6-BIS(TRIFLUOROMETHYL)NAPHTHALENE
CAS:50318-10-0
Formula: FC(C1=CC2=CC=C(C(F)(F)F)C=C2C=C1)(F)F
BD451343
97%
MFCD00525619
2,6-BIS(TRIFLUOROMETHYL)PHENOL
CAS:46377-35-9
Formula: OC1=C(C(F)(F)F)C=CC=C1C(F)(F)F
BD160743
95+%
MFCD00045072
2,6-BIS(TRIFLUOROMETHYL)PYRIMIDIN-4-OL
CAS:884-30-0
Formula: OC1=NC(C(F)(F)F)=NC(C(F)(F)F)=C1
BD221207
95+%
MFCD08436595
2,6-BIS(TRIFLUOROMETHYL)QUINAZOLIN-4(3H)-ONE
CAS:1352933-90-4
Formula: O=C1NC(C(F)(F)F)=NC2=C1C=C(C(F)(F)F)C=C2
BD752275
97%
2,6-BIS(TRIFLUOROMETHYL)QUINAZOLIN-4-AMINE
CAS:N/A
Formula: NC1=C2C=C(C(F)(F)F)C=CC2=NC(C(F)(F)F)=N1
BD753147
97%
2,6-BIS(TRIFLUOROMETHYL)QUINOLIN-4-OL
CAS:35877-04-4
Formula: OC1=CC(=NC2=C1C=C(C=C2)C(F)(F)F)C(F)(F)F
BD13542
95+%
MFCD00276581
2,6-BIS(TRIFLUOROMETHYL)QUINOLINE-4-CARBONITRILE
CAS:206559-70-8
Formula: N#CC1=CC(C(F)(F)F)=NC2=CC=C(C(F)(F)F)C=C12
BD427398
95+%
MFCD12197307
2,6-BIS(TRIFLUOROMETHYL)QUINOLINE-4-CARBOXAMIDE
CAS:1185292-83-4
Formula: O=C(C1=CC(C(F)(F)F)=NC2=CC=C(C(F)(F)F)C=C12)N
BD626232
97%
MFCD12197306
2,6-BIS[[(R)-2-[HYDROXY(DIPHENYL)METHYL]-1-PYRROLIDINYL]METHYL]-4-METHYLPHENOL
CAS:877395-58-9
Formula: N/A
BD338463
95+%
MFCD08276885
2,6-BIS[3-(9H-CARBAZOL-9-YL)PHENYL]PYRIDINE
CAS:1013405-24-7
Formula: C1(C2=CC=CC(N3C4=C(C5=C3C=CC=C5)C=CC=C4)=C2)=NC(C6=CC=CC(N7C8=C(C9=C7C=CC=C9)C=CC=C8)=C6)=CC=C1
BD306095
95+%
MFCD20275106
2,6-DI(1-PYRAZOLYL)PYRIDINE
CAS:123640-38-0
Formula: C1(N2N=CC=C2)=NC(N3N=CC=C3)=CC=C1
BD322153
95+%
2,6-DI(1H-1,2,4-TRIAZOL-1-YL)PYRIDINE
CAS:39242-18-7
Formula: C1(N2N=CN=C2)=NC(N3N=CN=C3)=CC=C1
BD262405
98%
2,6-DI(1H-IMIDAZOL-1-YL)PYRIDINE
CAS:39242-17-6
Formula: C1(N2C=CN=C2)=NC(N3C=CN=C3)=CC=C1
BD262403
98%
2,6-DI(9H-CARBAZOL-9-YL)PYRIDINE
CAS:168127-49-9
Formula: C1(N2C3=C(C4=C2C=CC=C4)C=CC=C3)=NC(N5C6=C(C7=C5C=CC=C7)C=CC=C6)=CC=C1
BD627648
97%
n/a
2,6-DI(PENTAN-3-YL)ANILINE
CAS:948587-90-4
Formula: CCC(CC)C1=CC=CC(C(CC)CC)=C1N
BD236947
95+%
2,6-DI(THIOPHEN-2-YL)DITHIENO[3,2-B:2',3'-D]THIOPHENE
CAS:910788-24-8
Formula: C1(C=C(C2=CC=CS2)S3)=C3C4=C(C=C(C5=CC=CS5)S4)S1
BD262674
95+%
MFCD11215198
2,6-DI-O-METHYL-SS-CYCLODEXTRIN
CAS:51166-71-3
Formula: N/A
BD297838
95+%
MFCD00011616
2,6-DI-P-TOLYL-4,4'-BIPYRIDINE
CAS:16208-89-2
Formula: CC1=CC=C(C2=CC(C3=CC=NC=C3)=CC(C4=CC=C(C)C=C4)=N2)C=C1
BD763446
97%
2,6-DI-P-TOLYLPYRIDINE
CAS:14435-88-2
Formula: CC1=CC=C(C2=CC=CC(C3=CC=C(C)C=C3)=N2)C=C1
BD67969
97%
MFCD00006282
2,6-DI-SEC-BUTYLPHENOL
CAS:5510-99-6
Formula: OC1=C(C(C)CC)C=CC=C1C(C)CC
BD328386
95+%
MFCD00009330
2,6-DI-TERT-BUTYL-4-(DIPHENYLAMINO)PHENOL
CAS:10419-65-5
Formula: OC1=C(C(C)(C)C)C=C(N(C2=CC=CC=C2)C3=CC=CC=C3)C=C1C(C)(C)C
BD284302
95+%
2,6-DI-TERT-BUTYL-4-(HYDROXYMETHYL) PHENOL
CAS:88-26-6
Formula: OC1=C(C(C)(C)C)C=C(CO)C=C1C(C)(C)C
BD22967
97%
MFCD00017254
2,6-DI-TERT-BUTYL-4-ETHYLIDENECYCLOHEXA-2,5-DIENONE
CAS:6738-27-8
Formula: CC=C(C=C1C(C)(C)C)C=C(C(C)(C)C)C1=O
BD490983
97%
n/a
2,6-DI-TERT-BUTYL-4-METHOXYPHENOL
CAS:489-01-0
Formula: OC1=C(C(C)(C)C)C=C(OC)C=C1C(C)(C)C
BD68550
95+%
MFCD00008824
2,6-DI-TERT-BUTYL-4-METHYLCYCLOHEXANOL
CAS:163119-16-2
Formula: CC1CC(C(O)C(C1)C(C)(C)C)C(C)(C)C
BD227574
97%
MFCD00278493
2,6-DI-TERT-BUTYL-4-METHYLCYCLOHEXANONE
CAS:23790-39-8
Formula: O=C1C(C(C)(C)C)CC(C)CC1C(C)(C)C
BD712140
97%
2,6-DI-TERT-BUTYL-4-METHYLPHENOL
CAS:128-37-0
Formula: CC1=CC(=C(O)C(=C1)C(C)(C)C)C(C)(C)C
BD17931
98%
MFCD00011644
2,6-DI-TERT-BUTYL-4-METHYLPYRIDINE
CAS:38222-83-2
Formula: CC1=CC(C(C)(C)C)=NC(C(C)(C)C)=C1
BD33484
98%
MFCD00006305
2,6-DI-TERT-BUTYL-4-NITROPHENOL
CAS:728-40-5
Formula: OC1=C(C(C)(C)C)C=C([N+]([O-])=O)C=C1C(C)(C)C
BD305953
97%
n/a
2,6-DI-TERT-BUTYL-4-VINYLPHENOL
CAS:19263-36-6
Formula: OC1=C(C(C)(C)C)C=C(C=C)C=C1C(C)(C)C
BD636961
95%
2,6-DI-TERT-BUTYLANTHRACENE
CAS:62375-58-0
Formula: CC(C1=CC2=CC3=CC=C(C(C)(C)C)C=C3C=C2C=C1)(C)C
BD34367
95+%
MFCD00407977
2,6-DI-TERT-BUTYLCYCLOHEXA-2,5-DIENE-1,4-DIONE
CAS:719-22-2
Formula: O=C1C(C(C)(C)C)=CC(C=C1C(C)(C)C)=O
BD15605
98%
MFCD00001601
2,6-DI-TERT-BUTYLISONICOTINIC ACID
CAS:191478-92-9
Formula: O=C(O)C1=CC(C(C)(C)C)=NC(C(C)(C)C)=C1
BD281826
95+%
MFCD06496458
2,6-DI-TERT-BUTYLNAPHTHALENE
CAS:3905-64-4
Formula: CC(C1=CC2=CC=C(C(C)(C)C)C=C2C=C1)(C)C
BD67948
97%
2,6-DI-TERT-BUTYLPHENOL
CAS:128-39-2
Formula: OC1=C(C(C)(C)C)C=CC=C1C(C)(C)C
BD17932
98%
MFCD00008820
2,6-DI-TERT-BUTYLPYRIDINE
CAS:585-48-8
Formula: CC(C)(C)C1=CC=CC(=N1)C(C)(C)C
BD34179
98%
MFCD00006306
2,6-DIACETAMIDOHEXANOIC ACID
CAS:35436-74-9
Formula: O=C(O)C(NC(C)=O)CCCCNC(C)=O
BD331386
95+%
MFCD00048197
2,6-DIACETYLPYRIDINE
CAS:1129-30-2
Formula: O=C(C1=CC=CC(C(C)=O)=N1)C
BD30251
97%
MFCD00006304
2,6-DIALLYL-4-METHYL-1,2,3,6-TETRAHYDROPYRIDINE
CAS:436088-93-6
Formula: CC1=CC(CC=C)NC(CC=C)C1
BD67999
97%
2,6-DIAMINO-3,5-DIFLUOROPYRIDINE
CAS:247069-27-8
Formula: FC1=C(N)N=C(N)C(F)=C1
BD68001
98%
MFCD03412208
2,6-DIAMINO-3H-IMIDAZO[4,5-G]QUINAZOLIN-8(7H)-ONE
CAS:1001242-71-2
Formula: OC1=C2C=C(N=C(N)N3)C3=CC2=NC(N)=N1
BD633818
97%
2,6-DIAMINO-4-(1-METHYL-1H-PYRROL-2-YL)-4H-THIOPYRAN-3,5-DICARBONITRILE
CAS:933838-32-5
Formula: N#CC1=C(N)SC(N)=C(C#N)C1C2=CC=CN2C
BD508943
97%
MFCD00854966
2,6-DIAMINO-4-(2,3,4-TRIMETHOXYPHENYL) -4H-THIOPYRAN-3,5-DICARBONITRILE
CAS:333759-74-3
Formula: N#CC1=C(N)SC(N)=C(C#N)C1C2=CC=C(OC)C(OC)=C2OC
BD508945
97%
MFCD01450896
2,6-DIAMINO-4-(2-BUTOXYPHENYL) -4H-THIOPYRAN-3,5-DICARBONITRILE
CAS:337496-64-7
Formula: N#CC1=C(N)SC(N)=C(C#N)C1C2=CC=CC=C2OCCCC
BD595500
97%
MFCD02046731
2,6-DIAMINO-4-(3,4-DIMETHOXYPHENYL) -4H-THIOPYRAN-3,5-DICARBONITRILE
CAS:127118-64-3
Formula: N#CC1=C(N)SC(N)=C(C#N)C1C2=CC=C(OC)C(OC)=C2
BD508944
97%
MFCD00404952
2,6-DIAMINO-4-(4-CHLOROPHENYL)-4H-THIOPYRAN-3,5-DICARBONITRILE
CAS:102423-75-6
Formula: N#CC1=C(N)SC(N)=C(C#N)C1C2=CC=C(Cl)C=C2
BD166336
95+%
MFCD00228040
2,6-DIAMINO-4-(4-FLUOROPHENYL)-4H-THIOPYRAN-3,5-DICARBONITRILE
CAS:125240-16-6
Formula: N#CC1=C(N)SC(N)=C(C#N)C1C2=CC=C(F)C=C2
BD166337
97%
MFCD00430028
2,6-DIAMINO-4-(4-ISOPROPYLPHENYL)-4H-THIOPYRAN-3,5-DICARBONITRILE
CAS:303066-28-6
Formula: N#CC1=C(N)SC(N)=C(C#N)C1C2=CC=C(C(C)C)C=C2
BD508949
97%
MFCD00715806
2,6-DIAMINO-4-(4-METHOXYPHENYL) -4H-THIOPYRAN-3,5-DICARBONITRILE
CAS:102423-74-5
Formula: N#CC1=C(N)SC(N)=C(C#N)C1C2=CC=C(OC)C=C2
BD341834
95+%
MFCD00428438
2,6-DIAMINO-4-(6-CHLOROBENZO[D][1,3]DIOXOL-5-YL) -4H-THIOPYRAN-3,5-DICARBONITRILE
CAS:299168-59-5
Formula: N#CC1=C(N)SC(N)=C(C#N)C1C2=C(Cl)C=C(OCO3)C3=C2
BD593998
97%
MFCD02045989
2,6-DIAMINO-4-(FURAN-2-YL)-4H-THIOPYRAN-3,5-DICARBONITRILE
CAS:123518-02-5
Formula: N#CC1=C(N)SC(N)=C(C#N)C1C2=CC=CO2
BD508941
97%
MFCD00446172
2,6-DIAMINO-4-(O-TOLYL)-4H-THIOPYRAN-3,5-DICARBONITRILE
CAS:202405-84-3
Formula: N#CC1=C(N)SC(N)=C(C#N)C1C2=CC=CC=C2C
BD508948
97%
MFCD00742421
2,6-DIAMINO-4-(P-TOLYL)-4H-THIOPYRAN-3,5-DICARBONITRILE
CAS:127118-56-3
Formula: N#CC1=C(N)SC(N)=C(C#N)C1C2=CC=C(C)C=C2
BD508946
97%
MFCD00716390
2,6-DIAMINO-4-(PYRIDIN-3-YL)-4H-THIOPYRAN-3,5-DICARBONITRILE
CAS:125219-61-6
Formula: N#CC1=C(N)SC(N)=C(C#N)C1C2=CC=CN=C2
BD508947
97%
MFCD00446174
2,6-DIAMINO-4-(PYRROLIDIN-1-YL)PYRIMIDINE 1-OXIDE
CAS:55921-65-8
Formula: NC1=[N+]([O-])C(N)=NC(N2CCCC2)=C1
BD627878
97%
MFCD22041981
2,6-DIAMINO-4-(THIOPHEN-2-YL)-4H-THIOPYRAN-3,5-DICARBONITRILE
CAS:127118-65-4
Formula: N#CC1=C(N)SC(N)=C(C#N)C1C2=CC=CS2
BD508942
97%
MFCD00446173
2,6-DIAMINO-4-CYCLOPROPYL-4H-THIOPYRAN-3,5-DICARBONITRILE
CAS:931252-55-0
Formula: N#CC1=C(N)SC(N)=C(C#N)C1C2CC2
BD508940
97%
MFCD09668263
2,6-DIAMINO-4-HYDROXYQUINAZOLINE
CAS:53745-23-6
Formula: OC1=C2C=C(N)C=CC2=NC(N)=N1
BD323863
95+%
MFCD06411663
2,6-DIAMINO-4-ISOPROPYL-4H-THIOPYRAN-3,5-DICARBONITRILE
CAS:180537-84-2
Formula: N#CC1=C(N)SC(N)=C(C#N)C1C(C)C
BD508939
97%
MFCD00449775
2,6-DIAMINO-4-METHYLNICOTINONITRILE
CAS:38841-52-0
Formula: CC1=C(C#N)C(N)=NC(N)=C1
BD233357
95+%
MFCD00963851
2,6-DIAMINO-4-PHENYL-4H-THIOPYRAN-3,5-DICARBONITRILE
CAS:102434-73-1
Formula: N#CC1=C(N)SC(N)=C(C#N)C1C2=CC=CC=C2
BD166339
97%
MFCD00228002
2,6-DIAMINO-5,6,7,8-TETRAHYDROQUINAZOLIN-4(3H)-ONE
CAS:102077-48-5
Formula: O=C1NC(N)=NC2=C1CC(N)CC2
BD332383
95+%
MFCD20704468
2,6-DIAMINO-5-(2,2-DIETHOXYETHYL) PYRIMIDIN-4-OL
CAS:63026-85-7
Formula: OC1=NC(N)=NC(N)=C1CC(OCC)OCC
BD334839
95+%
MFCD00223566
2,6-DIAMINO-5-BROMOPYRIMIDIN-4(1H)-ONE
CAS:6312-72-7
Formula: NC1=NC(=O)C(Br)=C(N)N1
BD102624
97%
MFCD00023262
2,6-DIAMINO-5-CHLORONICOTINIC ACID
CAS:465513-33-1
Formula: O=C(O)C1=C(N)N=C(N)C(Cl)=C1
BD556148
97%
MFCD20656749
2,6-DIAMINO-5-CHLOROPYRIMIDIN-4-OL
CAS:71552-22-2
Formula: OC1=NC(N)=NC(N)=C1Cl
BD370224
95+%
MFCD22196157
2,6-DIAMINO-5-CHLOROQUINAZOLIN-4(3H)-ONE
CAS:143745-30-6
Formula: OC1=C2C(Cl)=C(N)C=CC2=NC(N)=N1
BD633817
97%
2,6-DIAMINO-5-HYDROXYHEXANOIC ACID HYDROCHLORIDE
CAS:13204-98-3
Formula: O=C(O)C(N)CCC(O)CN.[H]Cl
BD31752
95+%
n/a
2,6-DIAMINO-5-NITROPYRIMIDIN-4-OL
CAS:3346-23-4
Formula: O=[N+](C1=C(O)N=C(N)N=C1N)[O-]
BD66517
97%
MFCD01365774
2,6-DIAMINO-5-THIOCYANATOPYRIMIDIN-4(3H)-ONE
CAS:22288-75-1
Formula: O=C1NC(N)=NC(N)=C1SC#N
BD234912
95+%
MFCD09840405
2,6-DIAMINO-9H-PURINE-8-THIOL
CAS:462066-71-3
Formula: SC1=NC2=C(N)N=C(N)N=C2N1
BD68012
97%
2,6-DIAMINOANTHRACENE-9,10-DIONE
CAS:131-14-6
Formula: NC1=CC2=C(C=C1)C(=O)C1=C(C=CC(N)=C1)C2=O
BD17998
98%
MFCD00001234
2,6-DIAMINOBENZOIC ACID
CAS:102000-59-9
Formula: O=C(O)C1=C(N)C=CC=C1N
BD270148
95+%
MFCD01661065
2,6-DIAMINOHEPTANEDIOIC ACID
CAS:583-93-7
Formula: NC(CCCC(N)C(O)=O)C(O)=O
BD34175
97%
MFCD00002637
2,6-DIAMINOHEXAN-1-OL
CAS:25441-01-4
Formula: OCC(N)CCCCN
BD752205
97%
MFCD24495167
2,6-DIAMINOHEXAN-1-OL HYDROCHLORIDE
CAS:N/A
Formula: OCC(N)CCCCN.[H]Cl
BD753825
97%
2,6-DIAMINOHEXANOIC ACID DIHYDROCHLORIDE
CAS:617-68-5
Formula: NC(CCCCN)C(O)=O.[H]Cl.[H]Cl
BD126557
95+%
MFCD00037587
2,6-DIAMINOHEXANOIC ACID HYDRATE
CAS:885701-25-7
Formula: NC(CCCCN)C(O)=O.[H]O[H]
BD583569
97%
MFCD00151036
2,6-DIAMINOISONICOTINAMIDE
CAS:98135-36-5
Formula: O=C(C1C=C(N)N=C(N)C=1)N
BD00753511
95+%
n/a
2,6-DIAMINOISONICOTINIC ACID
CAS:6313-56-0
Formula: O=C(O)C1=CC(N)=NC(N)=C1
BD262527
97%
MFCD12828291
2,6-DIAMINOISONICOTINONITRILE
CAS:1158785-01-3
Formula: N#CC1C=C(N)N=C(N)C=1
BD00750281
95+%
n/a
2,6-DIAMINONICOTINAMIDE
CAS:69925-29-7
Formula: O=C(C1=CC=C(N)N=C1N)N
BD651848
97%
2,6-DIAMINONICOTINIC ACID
CAS:175155-53-0
Formula: O=C(O)C1=C(N)N=C(N)C=C1
BD285868
95+%
MFCD13188956
2,6-DIAMINONICOTINIC ACID HYDROCHLORIDE
CAS:N/A
Formula: O=C(C1C=CC(N)=NC=1N)O.[H]Cl
BD00759811
95%
2,6-DIAMINONICOTINONITRILE
CAS:99761-27-0
Formula: N#CC1=C(N)N=C(N)C=C1
BD553748
97%
2,6-DIAMINOPHENOL
CAS:22440-82-0
Formula: OC1=C(N)C=CC=C1N
BD252547
95+%
MFCD00462574
2,6-DIAMINOPHENOL DIHYDROCHLORIDE
CAS:403986-18-5
Formula: OC1=C(N)C=CC=C1N.[H]Cl.[H]Cl
BD296941
95+%
2,6-DIAMINOPHENOL HYDROCHLORIDE
CAS:1808091-49-7
Formula: OC1=C(N)C=CC=C1N.[H]Cl
BD302661
95+%
n/a
2,6-DIAMINOPYRIMIDIN-4(1H)-ONE
CAS:56-06-4
Formula: O=C1N=C(N)NC(N)=C1
BD00752686
96%
MFCD00043013
2,6-DIAMINOPYRIMIDIN-4-OL
CAS:100643-27-4
Formula: OC1=CC(N)=NC(N)=N1
BD2314
97%
MFCD00006098
2,6-DIAMINOPYRIMIDINE-4(1H)-THIONE
CAS:56-08-6
Formula: NC1=NC(N)=CC(=S)N1
BD2322
95+%
MFCD00006099
2,6-DIAMINOPYRIMIDINE-4-THIOL SULFATE
CAS:307496-37-3
Formula: SC1=CC(N)=NC(N)=N1.O=S(O)(O)=O
BD66525
97%
MFCD01863745
2,6-DIAZASPIRO[3.3]HEPTANE
CAS:174-77-6
Formula: C1NCC12CNC2
BD215903
95+%
MFCD11849044
2,6-DIAZASPIRO[3.3]HEPTANE DIHYDROCHLORIDE
CAS:1184963-68-5
Formula: C1NCC12CNC2.Cl.Cl
BD257556
95+%
2,6-DIAZASPIRO[3.3]HEPTANE HYDROCHLORIDE
CAS:1557591-41-9
Formula: [H]Cl.C1NCC12CNC2
BD215905
95+%
MFCD11878485
2,6-DIAZASPIRO[3.4]OCTAN-5-ONE
CAS:1203797-62-9
Formula: O=C(NCC1)C21CNC2
BD246909
95+%
MFCD22372536
2,6-DIAZASPIRO[3.4]OCTAN-7-ONE
CAS:1211515-65-9
Formula: O=C(C1)NCC21CNC2
BD246911
95+%
MFCD21364482
2,6-DIAZASPIRO[3.4]OCTAN-7-ONE HYDROCHLORIDE
CAS:1956355-12-6
Formula: O=C(C1)NCC21CNC2.[H]Cl
BD256685
95+%
n/a
2,6-DIAZASPIRO[3.4]OCTAN-7-ONE OXALATE
CAS:1588440-97-4
Formula: O=C(C1)NCC21CNC2.O=C(O)C(O)=O
BD263504
95+%
2,6-DIAZASPIRO[3.4]OCTANE
CAS:136098-13-0
Formula: C1NCC12CNCC2
BD254673
95+%
MFCD16877057
2,6-DIAZASPIRO[3.4]OCTANE DIHYDROCHLORIDE
CAS:1630906-93-2
Formula: [H]Cl.[H]Cl.C1NCC12CNCC2
BD301754
95+%
2,6-DIAZASPIRO[3.5]NONAN-1-ONE
CAS:1422062-20-1
Formula: O=C1NCC12CNCCC2
BD570582
97%
MFCD23378266
2,6-DIAZASPIRO[3.5]NONANE
CAS:885482-15-5
Formula: C1NCC12CNCCC2
BD254672
95+%
MFCD13193040
2,6-DIAZASPIRO[3.5]NONANE DIHYDROCHLORIDE
CAS:1334499-63-6
Formula: [H]Cl.[H]Cl.C1NCC12CNCCC2
BD328993
95+%
MFCD20261445
2,6-DIAZASPIRO[4.5]DECANE
CAS:35731-28-3
Formula: C1NCCC12NCCCC2
BD254667
97%
MFCD21090354
2,6-DIBENZHYDRYL-2,6-DIAZASPIRO[3.3]HEPTANE
CAS:913814-37-6
Formula: N1(C(C2=CC=CC=C2)C3=CC=CC=C3)CC4(CN(C(C5=CC=CC=C5)C6=CC=CC=C6)C4)C1
BD246160
95+%
MFCD13180718
2,6-DIBENZYLIDENECYCLOHEXANONE
CAS:897-78-9
Formula: O=C1/C(CCC/C1=C\C2=CC=CC=C2)=C/C3=CC=CC=C3
BD68022
97%
2,6-DIBROMO-[1,2,4]TRIAZOLO[1,5-A]PYRIDINE
CAS:1401624-81-4
Formula: BrC1=CN2C(C=C1)=NC(Br)=N2
BD329597
95+%
MFCD26131653
2,6-DIBROMO-1,4-PHENYLENEDIAMINE
CAS:29213-03-4
Formula: NC1=C(Br)C=C(N)C=C1Br
BD306260
95+%
n/a
2,6-DIBROMO-1,5-DIMETHOXYNAPHTHALENE
CAS:91394-96-6
Formula: COC1=C(Br)C=CC2=C(OC)C(Br)=CC=C12
BD68026
98%
MFCD06656533
2,6-DIBROMO-1,5-NAPHTHYRIDINE
CAS:42309-15-9
Formula: BrC1=CC=C2N=C(Br)C=CC2=N1
BD629309
97%
2,6-DIBROMO-1,8-NAPHTHYRIDINE
CAS:72754-04-2
Formula: BrC1=CC2=CC=C(Br)N=C2N=C1
BD238357
95+%
MFCD13189448
2,6-DIBROMO-1-METHYLPYRIDIN-4(1H)-ONE
CAS:N/A
Formula: O=C1C=C(Br)N(C)C(Br)=C1
BD753197
97%
2,6-DIBROMO-3,4-DIFLUOROANILINE
CAS:1000574-69-5
Formula: NC1=C(Br)C=C(F)C(F)=C1Br
BD496124
97%
MFCD09878204
2,6-DIBROMO-3,4-DIHYDRONAPHTHALEN-1(2H)-ONE
CAS:99657-23-5
Formula: O=C1C(Br)CCC2=C1C=CC(Br)=C2
BD267761
95+%
MFCD15526783
2,6-DIBROMO-3,4-DIMETHYLANILINE
CAS:80948-77-2
Formula: NC1=C(Br)C=C(C)C(C)=C1Br
BD324204
95+%
MFCD08062433
2,6-DIBROMO-3,5-DICHLORO-4-FLUOROANILINE
CAS:1160573-76-1
Formula: NC1=C(Br)C(Cl)=C(F)C(Cl)=C1Br
BD322521
95+%
MFCD11845855
2,6-DIBROMO-3,5-DIFLUOROBENZONITRILE
CAS:1803778-30-4
Formula: N#CC1=C(Br)C(F)=CC(F)=C1Br
BD00725616
95%
n/a
2,6-DIBROMO-3,5-DIFLUOROISONICOTINIC ACID
CAS:325461-60-7
Formula: O=C(O)C1=C(F)C(Br)=NC(Br)=C1F
BD68028
97%
MFCD03411655
2,6-DIBROMO-3,5-DIFLUOROPYRIDINE
CAS:210169-13-4
Formula: FC1=CC(F)=C(Br)N=C1Br
BD216455
95+%
MFCD21603841
2,6-DIBROMO-3,5-DIHYDROXYBENZOIC ACID
CAS:79200-80-9
Formula: O=C(O)C1=C(Br)C(O)=CC(O)=C1Br
BD68029
95+%
MFCD01108707
2,6-DIBROMO-3,5-DIMETHYLPYRIDINE
CAS:117846-58-9
Formula: CC1=C(Br)N=C(Br)C(C)=C1
BD216420
97%
2,6-DIBROMO-3-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL) PYRIDINE
CAS:N/A
Formula: BrC1=CC=C(B2OC(C)(C)C(C)(C)O2)C(Br)=N1
BD438427
97%
MFCD18910596
2,6-DIBROMO-3-(BROMOMETHYL)-5-CHLOROPYRIDINE
CAS:55304-79-5
Formula: ClC1=C(Br)N=C(Br)C(CBr)=C1
BD284466
95+%
2,6-DIBROMO-3-(TRIFLUOROMETHYL)PYRIDINE
CAS:55304-87-5
Formula: FC(C1=CC=C(Br)N=C1Br)(F)F
BD268304
95+%
2,6-DIBROMO-3-CHLORO-4-FLUOROANILINE
CAS:175135-09-8
Formula: NC1=C(Br)C(Cl)=C(F)C=C1Br
BD3096
97%
MFCD00042199
2,6-DIBROMO-3-CHLORO-4-METHYLANILINE
CAS:84483-22-7
Formula: NC1=C(Br)C=C(C)C(Cl)=C1Br
BD10401
97%
MFCD00051580
2,6-DIBROMO-3-CHLORO-5-(CHLOROMETHYL)PYRIDINE
CAS:1823897-35-3
Formula: ClCC1=C(Br)N=C(Br)C(Cl)=C1
BD284401
95+%
2,6-DIBROMO-3-CHLOROPYRIDIN-4-AMINE
CAS:1384213-52-8
Formula: NC1=C(Cl)C(Br)=NC(Br)=C1
BD752258
97%
2,6-DIBROMO-3-CHLOROPYRIDINE
CAS:55304-77-3
Formula: ClC1=CC=C(Br)N=C1Br
BD633534
95%
n/a
2,6-DIBROMO-3-FLUORO-4-METHYLANILINE
CAS:1000576-48-6
Formula: NC1=C(Br)C=C(C)C(F)=C1Br
BD567099
97%
2,6-DIBROMO-3-FLUOROANILINE
CAS:1691609-18-3
Formula: NC1=C(Br)C=CC(F)=C1Br
BD460334
97%
MFCD28784571
2,6-DIBROMO-3-FLUOROBENZOIC ACID
CAS:1806327-84-3
Formula: O=C(O)C1=C(Br)C=CC(F)=C1Br
BD481607
97%
MFCD28784652
2,6-DIBROMO-3-FLUOROPYRIDINE
CAS:41404-59-5
Formula: FC1=CC=C(Br)N=C1Br
BD230319
95+%
MFCD13185513
2,6-DIBROMO-3-HYDROXYPYRIDINE
CAS:6602-33-1
Formula: OC1=CC=C(Br)N=C1Br
BD68030
95+%
2,6-DIBROMO-3-IODOPYRIDIN-4-AMINE
CAS:N/A
Formula: NC1=C(I)C(Br)=NC(Br)=C1
BD751749
97%
2,6-DIBROMO-3-IODOPYRIDINE
CAS:1032582-80-1
Formula: BrC1=CC=C(I)C(Br)=N1
BD207540
95+%
MFCD13185520
2,6-DIBROMO-3-METHOXY-5-NITROPYRIDINE
CAS:79491-46-6
Formula: O=[N+](C1=C(Br)N=C(Br)C(OC)=C1)[O-]
BD248724
97%
MFCD18632733
2,6-DIBROMO-3-METHOXY-N-METHYLANILINE
CAS:808736-58-5
Formula: CNC1=C(Br)C=CC(OC)=C1Br
BD284075
95+%
2,6-DIBROMO-3-METHOXYPYRIDINE
CAS:79491-45-5
Formula: COC1=CC=C(Br)N=C1Br
BD248725
97%
2,6-DIBROMO-3-METHYL-4-NITROPHENOL
CAS:14401-03-7
Formula: CC1=C(C=C(Br)C(O)=C1Br)[N+]([O-])=O
BD4293
95+%
MFCD04038152
2,6-DIBROMO-3-METHYLBENZOIC ACID
CAS:N/A
Formula: O=C(C1C(Br)=C(C)C=CC=1Br)O
BD00760805
95%
2,6-DIBROMO-3-METHYLPYRIDINE
CAS:887571-15-5
Formula: CC1=CC=C(Br)N=C1Br
BD68033
97%
MFCD03840755
2,6-DIBROMO-3-NITROPYRIDIN-4-AMINE
CAS:848470-14-4
Formula: NC1=C([N+]([O-])=O)C(Br)=NC(Br)=C1
BD226364
95+%
MFCD11044253
2,6-DIBROMO-3-NITROPYRIDINE
CAS:55304-80-8
Formula: BrC1=NC(=CC=C1[N+](=O)[O-])Br
BD21422
97%
MFCD00233995
2,6-DIBROMO-3-PYRIDINECARBOXYLIC ACID
CAS:55304-85-3
Formula: O=C(C1=CC=C(Br)N=C1Br)O
BD168801
97%
MFCD11846496
2,6-DIBROMO-4,4-BIS(2-ETHYLHEXYL) -4H-CYCLOPENTA[1,2-B:5,4-B']DITHIOPHENE
CAS:365547-21-3
Formula: CCCCC(CC)CC1(CC(CC)CCCC)C2=C(C3=C1C=C(Br)S3)SC(Br)=C2
BD247418
95+%
MFCD16619302
2,6-DIBROMO-4,4-BIS(2-ETHYLHEXYL) -4H-SILOLO[3,2-B:4,5-B']DITHIOPHENE
CAS:1089687-05-7
Formula: CCCCC(CC)C[Si]1(CC(CC)CCCC)C2=C(C3=C1C=C(Br)S3)SC(Br)=C2
BD293915
97%
MFCD16621138
2,6-DIBROMO-4,4-DIHEXYL-4H-CYCLOPENTA[1,2-B:5,4-B']DITHIOPHENE
CAS:528570-55-0
Formula: CCCCCCC1(CCCCCC)C2=C(C3=C1C=C(Br)S3)SC(Br)=C2
BD254693
95+%
MFCD16619321
2,6-DIBROMO-4,4-DIHEXYL-4H-SILOLO[3,2-B:4,5-B']DITHIOPHENE
CAS:188690-66-6
Formula: CCCCCC[Si]1(CCCCCC)C2=C(C3=C1C=C(Br)S3)SC(Br)=C2
BD254694
95+%
MFCD16621085
2,6-DIBROMO-4,4-DIOCTYL-4H-SILOLO[3,2-B:4,5-B']DITHIOPHENE
CAS:1160106-14-8
Formula: CCCCCCCC[Si]1(CCCCCCCC)C2=C(C3=C1C=C(Br)S3)SC(Br)=C2
BD247421
95+%
2,6-DIBROMO-4,8-BIS((2-BUTYLOCTYL)OXY)BENZO[1,2-B:4,5-B']DITHIOPHENE
CAS:1336893-15-2
Formula: CCCCCCC(CCCC)COC1=C2C(C=C(Br)S2)=C(OCC(CCCC)CCCCCC)C3=C1C=C(Br)S3
BD633431
97%
2,6-DIBROMO-4,8-BIS((2-ETHYLHEXYL) OXY)BENZO[1,2-B:4,5-B']DITHIOPHENE
CAS:1226782-13-3
Formula: CCCCC(CC)COC1=C2C(C=C(Br)S2)=C(OCC(CC)CCCC)C3=C1C=C(Br)S3
BD247399
95+%
MFCD17018552
2,6-DIBROMO-4,8-BIS(OCTYLOXY) BENZO[1,2-B:4,5-B']DITHIOPHENE
CAS:1294515-75-5
Formula: CCCCCCCCOC1=C2C(C=C(Br)S2)=C(OCCCCCCCC)C3=C1C=C(Br)S3
BD262609
95+%
2,6-DIBROMO-4,8-DIHEXYLBENZO[1,2-B:4,5-B']DITHIOPHENE
CAS:359017-65-5
Formula: CCCCCCC1=C2C(C=C(Br)S2)=C(CCCCCC)C3=C1C=C(Br)S3
BD254696
95+%
MFCD16619301
2,6-DIBROMO-4-((TRIFLUOROMETHYL)SULFONYL)PHENOL
CAS:432-79-1
Formula: OC1=C(Br)C=C(S(=O)(C(F)(F)F)=O)C=C1Br
BD492951
97%
2,6-DIBROMO-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL) PYRIDINE
CAS:1192037-24-3
Formula: CC1(C)C(C)(C)OB(C2=CC(Br)=NC(Br)=C2)O1
BD247274
95+%
MFCD12923190
2,6-DIBROMO-4-(DIFLUOROMETHOXY) ANILINE
CAS:1000575-08-5
Formula: NC1=C(Br)C=C(OC(F)F)C=C1Br
BD477463
97%
MFCD09878211
2,6-DIBROMO-4-(DIFLUOROMETHOXY) PYRIDINE
CAS:1214326-08-5
Formula: FC(F)OC1=CC(Br)=NC(Br)=C1
BD469352
97%
MFCD14698410
2,6-DIBROMO-4-(DIFLUOROMETHYL)PYRIDIN-3-OL
CAS:1806805-35-5
Formula: OC1=C(C(F)F)C=C(Br)N=C1Br
BD464623
97%
MFCD25486093
2,6-DIBROMO-4-(HYDROXYMETHYL) PHENOL
CAS:2316-62-3
Formula: OC1=C(Br)C=C(CO)C=C1Br
BD624329
97%
2,6-DIBROMO-4-(METHYLSULFONYL)ANILINE
CAS:26595-53-9
Formula: NC1=C(Br)C=C(S(=O)(C)=O)C=C1Br
BD496105
97%
MFCD09800838
2,6-DIBROMO-4-(TERT-BUTYL)ANILINE
CAS:10546-67-5
Formula: NC1=C(Br)C=C(C(C)(C)C)C=C1Br
BD257953
97%
MFCD06657952
2,6-DIBROMO-4-(TERT-BUTYL)PHENOL
CAS:98-22-6
Formula: OC1=C(Br)C=C(C(C)(C)C)C=C1Br
BD68056
95+%
MFCD00152389
2,6-DIBROMO-4-(TRIFLUOROMETHOXY) ANILINE
CAS:88149-49-9
Formula: BrC1=C(N)C(=CC(=C1)OC(F)(F)F)Br
BD10232
98%
MFCD00153113
2,6-DIBROMO-4-(TRIFLUOROMETHOXY) PHENOL
CAS:914635-67-9
Formula: OC1=C(Br)C=C(OC(F)(F)F)C=C1Br
BD257974
95+%
MFCD08059524
2,6-DIBROMO-4-(TRIFLUOROMETHYL)ANILINE
CAS:72678-19-4
Formula: NC1=C(Br)C=C(C(F)(F)F)C=C1Br
BD10231
95+%
MFCD00068181
2,6-DIBROMO-4-(TRIFLUOROMETHYL)NICOTINONITRILE
CAS:1416373-32-4
Formula: N#CC1=C(Br)N=C(Br)C=C1C(F)(F)F
BD218619
95+%
2,6-DIBROMO-4-(TRIFLUOROMETHYL)PYRIDINE
CAS:1000152-84-0
Formula: FC(C1=CC(Br)=NC(Br)=C1)(F)F
BD258715
95+%
MFCD22682722
2,6-DIBROMO-4-BUTYLANILINE
CAS:10546-66-4
Formula: NC1=C(Br)C=C(CCCC)C=C1Br
BD230512
95+%
2,6-DIBROMO-4-CHLORO-3,5-DIMETHYLPHENOL
CAS:175204-32-7
Formula: OC1=C(Br)C(C)=C(Cl)C(C)=C1Br
BD68038
97%
MFCD00219924
2,6-DIBROMO-4-CHLORO-3-FLUOROANILINE
CAS:1160574-58-2
Formula: NC1=C(Br)C=C(Cl)C(F)=C1Br
BD496172
97%
MFCD11845909
2,6-DIBROMO-4-CHLOROANILINE
CAS:874-17-9
Formula: NC1=C(Br)C=C(Cl)C=C1Br
BD95672
98%
MFCD00051750
2,6-DIBROMO-4-CHLOROPHENOL
CAS:5324-13-0
Formula: OC1=C(Br)C=C(Cl)C=C1Br
BD68039
98%
MFCD00029751
2,6-DIBROMO-4-CHLOROPYRIDINE
CAS:1196156-59-8
Formula: ClC1=CC(Br)=NC(Br)=C1
BD230339
95+%
2,6-DIBROMO-4-CYANOPHENYL OCTANOATE
CAS:1689-99-2
Formula: CCCCCCCC(OC1=C(Br)C=C(C#N)C=C1Br)=O
BD18808
95+%
MFCD00055484
2,6-DIBROMO-4-CYCLOHEXYLANILINE
CAS:175135-11-2
Formula: NC1=C(Br)C=C(C2CCCCC2)C=C1Br
BD68040
95+%
2,6-DIBROMO-4-CYCLOPENTYLTHIAZOLO[5,4-B]PYRIDIN-5(4H)-ONE
CAS:1956380-01-0
Formula: O=C1C(Br)=CC2=C(SC(Br)=N2)N1C3CCCC3
BD444583
97%
2,6-DIBROMO-4-ETHOXYPYRIDINE
CAS:52311-44-1
Formula: CCOC1=CC(Br)=NC(Br)=C1
BD260608
95+%
2,6-DIBROMO-4-ETHYLANILINE
CAS:10546-63-1
Formula: NC1=C(Br)C=C(CC)C=C1Br
BD318921
95+%
MFCD00031418
2,6-DIBROMO-4-FLUORO-3-METHYLANILINE
CAS:1000576-72-6
Formula: NC1=C(Br)C=C(F)C(C)=C1Br
BD496091
97%
MFCD09800776
2,6-DIBROMO-4-FLUOROANILINE
CAS:344-18-3
Formula: NC1=C(Br)C=C(F)C=C1Br
BD9799
98%
MFCD00041445
2,6-DIBROMO-4-FLUOROBENZALDEHYDE
CAS:938467-02-8
Formula: O=CC1=C(Br)C=C(F)C=C1Br
BD337166
95+%
MFCD13186760
2,6-DIBROMO-4-FLUOROBENZONITRILE
CAS:404928-18-3
Formula: N#CC1=C(Br)C=C(F)C=C1Br
BD476928
97%
MFCD24387472
2,6-DIBROMO-4-FLUOROPHENOL
CAS:344-20-7
Formula: OC1=C(Br)C=C(F)C=C1Br
BD9739
98%
MFCD00002317
2,6-DIBROMO-4-FLUOROPYRIDINE
CAS:1214344-15-6
Formula: FC1=CC(Br)=NC(Br)=C1
BD294363
95+%
n/a
2,6-DIBROMO-4-FORMYLPHENYL ACETATE
CAS:74849-10-8
Formula: CC(OC1=C(Br)C=C(C=O)C=C1Br)=O
BD510038
97%
MFCD12030631
2,6-DIBROMO-4-HYDROXYBENZONITRILE
CAS:74283-33-3
Formula: N#CC1=C(Br)C=C(O)C=C1Br
BD257980
95+%
n/a
2,6-DIBROMO-4-IODOPYRIDIN-3-OL
CAS:478148-75-3
Formula: OC1=C(I)C=C(Br)N=C1Br
BD315655
95+%
MFCD21648228
2,6-DIBROMO-4-IODOPYRIDINE
CAS:1160184-14-4
Formula: IC1=CC(Br)=NC(Br)=C1
BD249044
96%
MFCD13185521
2,6-DIBROMO-4-ISOPROPYLANILINE
CAS:10546-65-3
Formula: NC1=C(Br)C=C(C(C)C)C=C1Br
BD11270
97%
MFCD00015475
2,6-DIBROMO-4-METHOXYANILINE
CAS:95970-05-1
Formula: NC1=C(Br)C=C(OC)C=C1Br
BD259473
98%
MFCD06654495
2,6-DIBROMO-4-METHOXYBENZALDEHYDE
CAS:856766-94-4
Formula: O=CC1=C(Br)C=C(OC)C=C1Br
BD691905
97%
2,6-DIBROMO-4-METHOXYBENZONITRILE
CAS:74746-06-8
Formula: N#CC1C(Br)=CC(OC)=CC=1Br
BD00753506
95+%
n/a
2,6-DIBROMO-4-METHOXYPHENOL
CAS:2423-74-7
Formula: OC1=C(Br)C=C(OC)C=C1Br
BD634924
97%
MFCD12755175
2,6-DIBROMO-4-METHOXYPYRIDINE
CAS:117873-72-0
Formula: COC1=CC(Br)=NC(Br)=C1
BD208279
98%
MFCD11036227
2,6-DIBROMO-4-METHYL-3-NITROANILINE
CAS:117824-54-1
Formula: NC1=C(Br)C=C(C)C([N+]([O-])=O)=C1Br
BD320477
95+%
MFCD09260847
2,6-DIBROMO-4-METHYL-3-NITROPYRIDINE
CAS:593671-26-2
Formula: CC1=C(C(Br)=NC(Br)=C1)[N+]([O-])=O
BD241520
95+%
2,6-DIBROMO-4-METHYLANILINE
CAS:6968-24-7
Formula: C1=C(C)C=C(C(=C1Br)N)Br
BD10488
95+%
MFCD00007641
2,6-DIBROMO-4-METHYLBENZALDEHYDE
CAS:88174-23-6
Formula: O=CC1=C(Br)C=C(C)C=C1Br
BD217786
95+%
2,6-DIBROMO-4-METHYLNICOTINONITRILE
CAS:38824-75-8
Formula: N#CC1=C(Br)N=C(Br)C=C1C
BD284545
95+%
2,6-DIBROMO-4-METHYLPHENOL
CAS:2432-14-6
Formula: CC1=CC(Br)=C(O)C(Br)=C1
BD68049
98%
MFCD00002154
2,6-DIBROMO-4-METHYLPYRIDIN-3-AMINE
CAS:126354-83-4
Formula: NC1=C(C)C=C(Br)N=C1Br
BD229343
97%
2,6-DIBROMO-4-METHYLPYRIDINE
CAS:73112-16-0
Formula: CC1=CC(Br)=NC(Br)=C1
BD159333
98%
MFCD11036225
2,6-DIBROMO-4-NITROANILINE
CAS:827-94-1
Formula: NC1=C(Br)C=C(C=C1Br)[N+]([O-])=O
BD22766
97%
MFCD00007639
2,6-DIBROMO-4-NITROPHENOL
CAS:99-28-5
Formula: OC1=C(Br)C=C([N+]([O-])=O)C=C1Br
BD42147
97%
MFCD00007334
2,6-DIBROMO-4-NITROPYRIDINE
CAS:175422-04-5
Formula: BrC1=NC(=CC(=C1)[N+](=O)[O-])Br
BD32306
97+%
MFCD07369947
2,6-DIBROMO-4-NITROPYRIDINE OXIDE
CAS:98027-81-7
Formula: N/A
BD161616
95+%
n/a
2,6-DIBROMO-4-OCTYL-4H-DITHIENO[3,2-B:2',3'-D]PYRROLE
CAS:1346688-54-7
Formula: CCCCCCCCN1C(C=C(Br)S2)=C2C3=C1C=C(Br)S3
BD262616
95+%
2,6-DIBROMO-4-TRIFLUOROMETHYLPHENOL
CAS:35852-57-4
Formula: OC1=C(Br)C=C(C(F)(F)F)C=C1Br
BD323689
95+%
MFCD09261146
2,6-DIBROMO-4H-CYCLOPENTA[1,2-B:5,4-B']DITHIOPHEN-4-ONE
CAS:636588-79-9
Formula: O=C1C2=C(C3=C1C=C(Br)S3)SC(Br)=C2
BD233945
95+%
2,6-DIBROMO-4H-CYCLOPENTA[1,2-B:5,4-B']DITHIOPHENE
CAS:258527-25-2
Formula: BrC1=CC2=C(C3=C(C2)C=C(Br)S3)S1
BD247417
95+%
2,6-DIBROMO-5-CHLORONICOTINIC ACID
CAS:55304-86-4
Formula: O=C(O)C1=C(Br)N=C(Br)C(Cl)=C1
BD248726
95+%
2,6-DIBROMO-5-ETHOXYPYRIDIN-3-AMINE
CAS:1000018-10-9
Formula: NC1=CC(OCC)=C(Br)N=C1Br
BD40995
95%
MFCD09864810
2,6-DIBROMO-5-IODOPYRIDIN-3-OL
CAS:1105675-63-5
Formula: OC1=CC(I)=C(Br)N=C1Br
BD197104
95+%
MFCD11857620
2,6-DIBROMO-5-METHOXYPYRIDIN-3-AMINE
CAS:79491-47-7
Formula: NC1=CC(OC)=C(Br)N=C1Br
BD257907
95+%
2,6-DIBROMO-5-METHYL-[1,2,4]TRIAZOLO[1,5-A]PYRIDINE
CAS:1823367-14-1
Formula: CC1=C(Br)C=CC2=NC(Br)=NN12
BD440322
97%
MFCD26406916
2,6-DIBROMO-5-METHYLPYRIDIN-3-AMINE
CAS:126325-51-7
Formula: NC1=CC(C)=C(Br)N=C1Br
BD586560
95%
MFCD01570844
2,6-DIBROMO-7H-PURINE
CAS:1196-41-4
Formula: BrC1=NC2=C(N=CN2)C(Br)=N1
BD233153
95+%
MFCD00056909
2,6-DIBROMO-9,10-BIS(4-(TERT-BUTYL)PHENYL)ANTHRACENE
CAS:1187763-68-3
Formula: CC(C1=CC=C(C2=C3C=C(Br)C=CC3=C(C4=CC=C(C(C)(C)C)C=C4)C5=CC(Br)=CC=C25)C=C1)(C)C
BD292575
95+%
2,6-DIBROMO-9,10-DI(NAPHTHALEN-1-YL)ANTHRACENE
CAS:914306-89-1
Formula: BrC1=CC2=C(C3=C4C=CC=CC4=CC=C3)C5=CC=C(Br)C=C5C(C6=C7C=CC=CC7=CC=C6)=C2C=C1
BD246840
95+%
MFCD16660915
2,6-DIBROMO-9,10-DI(NAPHTHALEN-2-YL)ANTHRACENE
CAS:561064-15-1
Formula: BrC1=CC2=C(C3=CC=C4C=CC=CC4=C3)C5=CC=C(Br)C=C5C(C6=CC=C7C=CC=CC7=C6)=C2C=C1
BD246841
95+%
MFCD16660916
2,6-DIBROMO-9,10-DIHYDROANTHRACENE
CAS:1065644-53-2
Formula: BrC1=CC(CC2=CC=C(Br)C=C2C3)=C3C=C1
BD291101
95+%
2,6-DIBROMO-9,9-DIMETHYL-9H-FLUORENE
CAS:925889-85-6
Formula: CC1(C)C2=C(C3=C1C=CC(Br)=C3)C=CC(Br)=C2
BD36846
97%
MFCD09025330
2,6-DIBROMO-9H-FLUORENE
CAS:858800-80-3
Formula: BrC1=CC2=C(CC3=C2C=CC(Br)=C3)C=C1
BD335561
95+%
MFCD26959809
2,6-DIBROMOANILINE
CAS:608-30-0
Formula: NC1=C(Br)C=CC=C1Br
BD34272
98%
MFCD00007638
2,6-DIBROMOANTHRACENE
CAS:186517-01-1
Formula: BrC1=CC2=CC3=CC=C(Br)C=C3C=C2C=C1
BD216862
97%
2,6-DIBROMOANTHRACENE-9,10-DIONE
CAS:633-70-5
Formula: O=C1C2=C(C=C(Br)C=C2)C(C3=CC=C(Br)C=C13)=O
BD68061
96%
MFCD08276344
2,6-DIBROMOBENZALDEHYDE
CAS:67713-23-9
Formula: O=CC1=C(Br)C=CC=C1Br
BD68062
98%
MFCD11040410
2,6-DIBROMOBENZAMIDE
CAS:96237-91-1
Formula: O=C(C1C(Br)=CC=CC=1Br)N
BD00757512
95+%
n/a
2,6-DIBROMOBENZO[1,2-B:4,5-B']DITHIOPHENE
CAS:909280-97-3
Formula: BrC1=CC2=C(C=C(C=C(Br)S3)C3=C2)S1
BD262688
95+%
MFCD22124718
2,6-DIBROMOBENZOIC ACID
CAS:601-84-3
Formula: OC(=O)C1=C(Br)C=CC=C1Br
BD173598
98%
2,6-DIBROMOBENZONITRILE
CAS:6575-12-8
Formula: N#CC1=C(Br)C=CC=C1Br
BD158279
95+%
2,6-DIBROMOBENZYL ACETATE
CAS:1147858-83-0
Formula: CC(OCC1=C(Br)C=CC=C1Br)=O
BD244224
95+%
MFCD20482187
2,6-DIBROMODITHIENO[3,2-B:2',3'-D]THIOPHENE
CAS:67061-69-2
Formula: BrC1=CC2=C(S1)C1=C(S2)C=C(Br)S1
BD235044
97%
MFCD11215199
2,6-DIBROMOHEXANOIC ACID
CAS:13137-43-4
Formula: OC(=O)C(Br)CCCCBr
BD68064
95+%
MFCD00046517
2,6-DIBROMOIMIDAZO[1,2-A]PYRIDINE
CAS:851916-83-1
Formula: BrC1=CN2C(C=C1)=NC(Br)=C2
BD264189
95+%
MFCD11976189
2,6-DIBROMOIMIDAZO[1,2-B]PYRIDAZINE
CAS:1105714-53-1
Formula: BrC1=NN2C(C=C1)=NC(Br)=C2
BD264167
95+%
MFCD12828166
2,6-DIBROMOISONICOTINALDEHYDE
CAS:316800-46-1
Formula: O=CC1=CC(Br)=NC(Br)=C1
BD20180
95+%
MFCD06410666
2,6-DIBROMOISONICOTINIC ACID
CAS:2016-99-1
Formula: BrC1=NC(=CC(=C1)C(=O)O)Br
BD19222
96%
MFCD09743987
2,6-DIBROMOISONICOTINONITRILE
CAS:408352-58-9
Formula: N#CC1=CC(Br)=NC(Br)=C1
BD282979
95+%
n/a
2,6-DIBROMONAPHTHALENE
CAS:13720-06-4
Formula: BrC1=CC2=C(C=C1)C=C(Br)C=C2
BD41266
98%
MFCD01026462
2,6-DIBROMONAPHTHALENE-1,5-DIOL
CAS:84-59-3
Formula: OC1=C2C=CC(Br)=C(O)C2=CC=C1Br
BD12496
95+%
MFCD00021473
2,6-DIBROMONICOTINALDEHYDE
CAS:55304-83-1
Formula: BrC1=CC=C(C=O)C(Br)=N1
BD68072
95+%
MFCD10574710
2,6-DIBROMONICOTINAMIDE
CAS:1379303-54-4
Formula: O=C(N)C1=C(Br)N=C(Br)C=C1
BD260503
95+%
MFCD18904518
2,6-DIBROMONICOTINOHYDRAZIDE
CAS:1260790-20-2
Formula: O=C(NN)C1=C(Br)N=C(Br)C=C1
BD267226
95+%
2,6-DIBROMONICOTINONITRILE
CAS:53367-52-5
Formula: N#CC1C=CC(Br)=NC=1Br
BD00727060
95+%
n/a
2,6-DIBROMOPHENOL
CAS:608-33-3
Formula: C1=CC=C(C(=C1Br)O)Br
BD21742
98%
MFCD00002152
2,6-DIBROMOPYRAZINE
CAS:23229-25-6
Formula: BrC1=CN=CC(Br)=N1
BD158280
97%
MFCD09834804
2,6-DIBROMOPYRIDIN-3-AMINE
CAS:39856-57-0
Formula: NC1=CC=C(Br)N=C1Br
BD9538
97%
MFCD00128862
2,6-DIBROMOPYRIDIN-4-AMINE
CAS:39771-34-1
Formula: NC1=CC(Br)=NC(Br)=C1
BD161539
97%
MFCD00234047
2,6-DIBROMOPYRIDIN-4-OL
CAS:220616-68-2
Formula: OC1=CC(Br)=NC(Br)=C1
BD248727
95+%
MFCD13185517
2,6-DIBROMOPYRIDINE
CAS:626-05-1
Formula: BrC1=CC=CC(Br)=N1
BD7929
97%
MFCD00006223
2,6-DIBROMOPYRIDINE-3,4-DIAMINE
CAS:1121583-59-2
Formula: NC1=C(N)C=C(Br)N=C1Br
BD161731
97%
MFCD18072577
2,6-DIBROMOQUINAZOLINE
CAS:161425-75-8
Formula: BrC2=NC1=CC=C(C=C1C=N2)Br
BD158281
97%
MFCD04114090
2,6-DIBROMOQUINOLINE
CAS:77514-31-9
Formula: BrC1=CC=C2N=C(Br)C=CC2=C1
BD250080
95+%
MFCD09261124
2,6-DIBROMOQUINOXALINE
CAS:175858-10-3
Formula: BrC1=CC=C2N=C(Br)C=NC2=C1
BD160327
95+%
MFCD12406104
2,6-DIBROMOTOLUENE
CAS:69321-60-4
Formula: C1=CC=C(C(=C1Br)C)Br
BD4489
97%
MFCD00013524
2,6-DICHLORO-1,3-BENZOTHIAZOLE
CAS:3622-23-9
Formula: C1=CC(=CC2=C1N=C(S2)Cl)Cl
BD20441
97%
MFCD00044101
2,6-DICHLORO-1,5-NAPHTHYRIDINE
CAS:27017-66-9
Formula: ClC1=CC=C2N=C(Cl)C=CC2=N1
BD234696
95+%
MFCD03931483
2,6-DICHLORO-1,7-NAPHTHYRIDINE
CAS:93493-69-7
Formula: ClC1=NC=C2N=C(Cl)C=CC2=C1
BD55133
95+%
MFCD11044727
2,6-DICHLORO-1,8-NAPHTHYRIDINE
CAS:1260898-43-8
Formula: ClC1=CN=C2N=C(Cl)C=CC2=C1
BD218242
95+%
MFCD13189448
2,6-DICHLORO-1,8-NAPHTHYRIDINE-3-CARBONITRILE
CAS:1330583-69-1
Formula: N#CC1=CC2=CC(Cl)=CN=C2N=C1Cl
BD603086
97%
MFCD19982797
2,6-DICHLORO-1-FLUOROPYRIDIN-1-IUM TETRAFLUOROBORATE
CAS:140623-89-8
Formula: F[N+]1=C(Cl)C=CC=C1Cl.F[B-](F)(F)F
BD58359
95+%
2,6-DICHLORO-1H-BENZO[D]IMIDAZOLE
CAS:4887-95-0
Formula: ClC1=CC=C2C(NC(Cl)=N2)=C1
BD67521
95+%
MFCD00091850
2,6-DICHLORO-3,4-DIMETHYLPHENOL
CAS:1570-67-8
Formula: OC1=C(Cl)C=C(C)C(C)=C1Cl
BD389363
95+%
MFCD16622257
2,6-DICHLORO-3,5-DIFLUOROPHENOL
CAS:63418-08-6
Formula: OC1=C(Cl)C(F)=CC(F)=C1Cl
BD68088
95+%
MFCD03424471
2,6-DICHLORO-3,5-DIMETHOXYANILINE
CAS:872509-56-3
Formula: NC1=C(Cl)C(OC)=CC(OC)=C1Cl
BD290441
98%
MFCD21648506
2,6-DICHLORO-3-(1,3-DIOXOLAN-2-YL) PYRIDINE
CAS:1485111-20-3
Formula: ClC1=CC=C(C2OCCO2)C(Cl)=N1
BD330068
95+%
MFCD28400800
2,6-DICHLORO-3-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL) PYRIDINE
CAS:1073371-78-4
Formula: ClC1=CC=C(B(OC2(C)C)OC2(C)C)C(Cl)=N1
BD161512
95+%
MFCD06798261
2,6-DICHLORO-3-(CHLOROMETHYL)-5-FLUORO-4-METHYLPYRIDINE
CAS:N/A
Formula: CC1C(F)=C(Cl)N=C(Cl)C=1CCl
BD00721298
95%
2,6-DICHLORO-3-(CHLOROMETHYL)PYRIDINE
CAS:41789-37-1
Formula: ClCC1=CC=C(Cl)N=C1Cl
BD68081
95+%
MFCD07368052
2,6-DICHLORO-3-(CHLOROSULFONYL)BENZOIC ACID
CAS:53553-05-2
Formula: O=C(O)C1=C(Cl)C=CC(S(=O)(Cl)=O)=C1Cl
BD68089
97%
2,6-DICHLORO-3-(DIFLUOROMETHYL)-5-FLUOROPYRIDINE
CAS:1374659-39-8
Formula: FC1=C(Cl)N=C(Cl)C(C(F)F)=C1
BD455374
97%
MFCD22199308
2,6-DICHLORO-3-(DIFLUOROMETHYL)ISONICOTINIC ACID
CAS:1805238-73-6
Formula: O=C(C1=C(C(F)F)C(Cl)=NC(Cl)=C1)O
BD469067
95%
MFCD25487230
2,6-DICHLORO-3-(DIFLUOROMETHYL)PYRIDIN-4-OL
CAS:1805327-37-0
Formula: OC1=C(C(F)F)C(Cl)=NC(Cl)=C1
BD459120
97%
MFCD25486870
2,6-DICHLORO-3-(METHOXYMETHYL) PYRIDINE
CAS:1330763-31-9
Formula: COCC1=CC=C(Cl)N=C1Cl
BD336230
95+%
MFCD20230576
2,6-DICHLORO-3-(METHYLSULFONYL)PYRIDINE
CAS:1820647-64-0
Formula: O=S(C1=CC=C(Cl)N=C1Cl)(C)=O
BD482243
97%
MFCD26940378