Phone (USA) +1 212-348-5610
Whatsapp: +1 516-336-9307
WeChat: chembuyersguide
Chemical Search
 


























BLD Pharmatech Ltd.




Country: China

BLD Pharmatech Ltd.
488 Taoqiao Road, Building 5, 5F
HuiNan Town, Pudong New Area,
Shanghai 201203, China


Phone: +86-21-61629022
E-Mail:E-Mail this Supplier

Contact: Elva Cui

http://www.bldpharm.com

BLD Pharmatech Ltd.

Page: Home | 1 | 2 | 3 | 4 | 5 | 6 | 7 | 8 | 9 | 10 | 11 | 12 | 13 | 14 | 15 | 16 | 17 | 18 | 19 | 20 | 21 | 22 | 23 | 24 | 25 | 26 | 27 | 28 | 29 | 30 | 31 | 32 | 33 | 34 | 35 | 36 | 37 | 38 | 39 | 40 | 41 | 42 | 43 | 44 | 45 | 46 | 47 | 48 | 49 | 50 | 51 | 52 | 53 | 54 | 55 | 56 | 57 | 58 | 59 | 60 | 61 | 62 | 63 | 64 | 65 | 66 | 67 | 68 | 69 | 70 | 71 | 72 | 73 | 74 | 75 | 76 | 77 | 78 | 79 | 80 | 81 | 82 | 83 | 84 | 85 | 86 | 87 | 88 | 89 | 90 | 91 | 92 | 93 | 94 | 95 | 96 | 97 | 98 | 99 | 100 | 101 | 102 | 103 | 104 | 105 | 106 | 107 | 108 | 109 | 110 | 111 | 112 | 113 | 114 | 115 | 116 | 117 | 118 | 119 | 120 | 121 | 122 | 123 | 124 | 125 | 126 | 127 | 128 | 129 | 130 | 131 | 132 | 133 | 134 | 135 | 136 | 137 | 138 | 139 | 140 | 141 | 142 | 143 | 144 | 145 | 146 | 147 | 148 | 149 | 150 | 151 | 152 | 153 | 154 | 155 | 156 | 157 | 158 | 159 | 160 | 161 | 162 | 163 | 164 | 165 | 166 | 167 | 168 | 169 | 170 | 171 | 172 | 173 | 174 | 175 | 176 | 177 | 178 | 179 | 180 | 181 | 182 | 183 | 184 | 185 | 186 | 187 | 188 | 189 | 190 | 191 | 192 | 193 | 194 | 195 | 196 | 197 | 198 | 199 | 200 | 201 | 202 | 203 | 204 | 205 | 206 | 207 | 208 | 209 | 210 | 211 | 212 | 213 | 214 | 215 | 216 | 217 | 218 | 219 | 220 | 221 | 222 | 223 | 224 | 225 | 226 | 227 | 228 | 229 | 230 | 231 | 232 | 233 | 234 | 235 | 236 | 237 | 238 | 239 | 240 | 241 | 242 | 243 | 244 | 245 | 246 | 247 | 248 | 249 | 250 | 251 | 252 | 253 | 254 | 255 | 256 | 257 | 258 | 259 | 260 | 261 | 262 | 263 | 264 | 265 | 266 | 267 | 268 | 269 | 270 | 271 | 272 | 273 | 274 | 275 | 276 | 277 | 278 | 279 | 280 | 281 | 282 | 283 | 284 |
 


Product List

2,6-DICHLORO-3-(TRICHLOROMETHYL)PYRIDINE
CAS:55366-30-8
Formula: ClC1=CC=C(C(Cl)=N1)C(Cl)(Cl)Cl
BD68083
95+%
MFCD00185759
2,6-DICHLORO-3-(TRIFLUOROMETHYL)ANILINE
CAS:6656-72-0
Formula: NC1=C(Cl)C=CC(C(F)(F)F)=C1Cl
BD308560
95+%
MFCD11226279
2,6-DICHLORO-3-(TRIFLUOROMETHYL)BENZALDEHYDE
CAS:134741-65-4
Formula: O=CC1=C(Cl)C=CC(C(F)(F)F)=C1Cl
BD254345
95+%
2,6-DICHLORO-3-(TRIFLUOROMETHYL)BENZAMIDE
CAS:53012-81-0
Formula: O=C(N)C1=C(Cl)C=CC(C(F)(F)F)=C1Cl
BD321941
95+%
MFCD11519346
2,6-DICHLORO-3-(TRIFLUOROMETHYL)BENZOIC ACID
CAS:25922-41-2
Formula: O=C(O)C1=C(Cl)C=CC(C(F)(F)F)=C1Cl
BD5557
97%
MFCD09743917
2,6-DICHLORO-3-(TRIFLUOROMETHYL)BENZONITRILE
CAS:1092461-02-3
Formula: N#CC1=C(Cl)C=CC(C(F)(F)F)=C1Cl
BD314149
95+%
MFCD11519347
2,6-DICHLORO-3-(TRIFLUOROMETHYL)BENZOYL CHLORIDE
CAS:53012-82-1
Formula: O=C(Cl)C1=C(Cl)C=CC(C(F)(F)F)=C1Cl
BD321942
95+%
MFCD11519345
2,6-DICHLORO-3-(TRIFLUOROMETHYL)PYRIDINE
CAS:55304-75-1
Formula: FC(C1=CC=C(Cl)N=C1Cl)(F)F
BD21421
95+%
MFCD00042245
2,6-DICHLORO-3-BROMOPYRIDINE
CAS:866755-20-6
Formula: BrC1=CC=C(N=C1Cl)Cl
BD35172
97%
MFCD06798231
2,6-DICHLORO-3-CYCLOPROPYLPYRIDINE
CAS:1211529-21-3
Formula: ClC1=CC=C(C2CC2)C(Cl)=N1
BD252548
95+%
MFCD18254123
2,6-DICHLORO-3-FLUORO-5-(TRIFLUOROMETHYL)PYRIDINE
CAS:1099598-11-4
Formula: FC(C1=C(Cl)N=C(Cl)C(F)=C1)(F)F
BD194621
95+%
MFCD11100554
2,6-DICHLORO-3-FLUOROBENZOIC ACID
CAS:178813-78-0
Formula: O=C(O)C1=C(Cl)C=CC(F)=C1Cl
BD4068
97%
MFCD06658165
2,6-DICHLORO-3-FLUOROPHENOL
CAS:1803854-58-1
Formula: OC1=C(Cl)C=CC(F)=C1Cl
BD454885
97%
MFCD28786273
2,6-DICHLORO-3-FLUOROPYRIDINE
CAS:52208-50-1
Formula: ClC1=NC(=CC=C1F)Cl
BD68092
96%
MFCD09907815
2,6-DICHLORO-3-FORMYLPYRIDINE
CAS:55304-73-9
Formula: ClC1=NC(=CC=C1C=O)Cl
BD34076
98%
MFCD07369746
2,6-DICHLORO-3-HYDRAZINYLPYRIDINE
CAS:1035173-57-9
Formula: NNC1=CC=C(Cl)N=C1Cl
BD605891
97%
2,6-DICHLORO-3-HYDROXYISONICOTINALDEHYDE
CAS:185423-26-1
Formula: O=CC1=CC(Cl)=NC(Cl)=C1O
BD19015
95+%
MFCD06410675
2,6-DICHLORO-3-HYDROXYISONICOTINIC ACID
CAS:185422-96-2
Formula: OC(=O)C1=C(O)C(Cl)=NC(Cl)=C1
BD68094
98%
MFCD03411718
2,6-DICHLORO-3-IODO-4-(TRIFLUOROMETHYL)PYRIDINE
CAS:1186405-02-6
Formula: FC(C1=C(I)C(Cl)=NC(Cl)=C1)(F)F
BD202107
95+%
2,6-DICHLORO-3-IODOPYRIDINE
CAS:148493-37-2
Formula: IC1=CC=C(Cl)N=C1Cl
BD9510
98%
MFCD03094686
2,6-DICHLORO-3-METHOXYANILINE
CAS:55285-43-3
Formula: NC1=C(Cl)C=CC(OC)=C1Cl
BD271725
95+%
MFCD20694612
2,6-DICHLORO-3-METHOXYBENZOIC ACID
CAS:32890-93-0
Formula: COC1=CC=C(Cl)C(C(O)=O)=C1Cl
BD228242
98%
2,6-DICHLORO-3-METHOXYPYRIDINE
CAS:1214340-74-5
Formula: COC1=CC=C(Cl)N=C1Cl
BD333566
95+%
MFCD13185542
2,6-DICHLORO-3-METHYL-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL) PYRIDINE
CAS:1010101-08-2
Formula: CC1(C)C(C)(C)OB(C2=C(C)C(Cl)=NC(Cl)=C2)O1
BD324618
95+%
MFCD11617878
2,6-DICHLORO-3-METHYL-4-NITROPYRIDINE
CAS:N/A
Formula: O=[N+](C1=C(C)C(Cl)=NC(Cl)=C1)[O-]
BD751254
97%
2,6-DICHLORO-3-METHYL-4-NITROPYRIDINE 1-OXIDE
CAS:N/A
Formula: O=[N+]([O-])C1C(C)=C(Cl)[N+]([O-])=C(Cl)C=1
BD00769892
95%
n/a
2,6-DICHLORO-3-METHYL-5-NITROPYRIDINE
CAS:58596-88-6
Formula: O=[N+](C1=C(Cl)N=C(Cl)C(C)=C1)[O-]
BD211950
95+%
2,6-DICHLORO-3-METHYLANILINE
CAS:64063-37-2
Formula: NC1=C(Cl)C=CC(C)=C1Cl
BD4753
98%
MFCD00007676
2,6-DICHLORO-3-METHYLBENZOIC ACID
CAS:58671-77-5
Formula: O=C(O)C1=C(Cl)C=CC(C)=C1Cl
BD227701
95+%
2,6-DICHLORO-3-METHYLISONICOTINALDEHYDE
CAS:N/A
Formula: O=CC1C(C)=C(Cl)N=C(Cl)C=1
BD00766457
95%
2,6-DICHLORO-3-METHYLISONICOTINAMIDE
CAS:N/A
Formula: O=C(C1C(C)=C(Cl)N=C(Cl)C=1)N
BD00738005
95%
2,6-DICHLORO-3-METHYLISONICOTINIC ACID
CAS:1256835-40-1
Formula: O=C(O)C1=CC(Cl)=NC(Cl)=C1C
BD295895
95+%
2,6-DICHLORO-3-METHYLISONICOTINONITRILE
CAS:N/A
Formula: N#CC1C(C)=C(Cl)N=C(Cl)C=1
BD00731482
95%
2,6-DICHLORO-3-METHYLPHENOL
CAS:13481-70-4
Formula: OC1=C(Cl)C=CC(C)=C1Cl
BD467170
97%
MFCD08061909
2,6-DICHLORO-3-METHYLPYRIDIN-4-AMINE
CAS:N/A
Formula: NC1=C(C)C(Cl)=NC(Cl)=C1
BD753282
97%
2,6-DICHLORO-3-METHYLPYRIDINE
CAS:58584-94-4
Formula: CC1=CC=C(Cl)N=C1Cl
BD21616
98%
MFCD00137847
2,6-DICHLORO-3-NITROANILINE
CAS:13785-48-3
Formula: NC1=C(Cl)C=CC([N+]([O-])=O)=C1Cl
BD262060
95+%
MFCD11110683
2,6-DICHLORO-3-NITROBENZALDEHYDE
CAS:5866-97-7
Formula: C1=CC(=C(C(=C1Cl)C=O)Cl)[N+](=O)[O-]
BD4043
95+%
MFCD00090332
2,6-DICHLORO-3-NITROBENZENESULFONAMIDE
CAS:89281-19-6
Formula: O=S(C1=C(Cl)C=CC([N+]([O-])=O)=C1Cl)(N)=O
BD464971
97%
MFCD17014706
2,6-DICHLORO-3-NITROBENZENESULFONIC ACID
CAS:276702-52-4
Formula: OS(=O)(=O)C1=C(Cl)C(=CC=C1Cl)[N+]([O-])=O
BD234926
95+%
2,6-DICHLORO-3-NITROBENZOIC ACID
CAS:55775-97-8
Formula: O=C(O)C1=C(Cl)C=CC([N+]([O-])=O)=C1Cl
BD161275
98%
MFCD00075422
2,6-DICHLORO-3-NITROBENZONITRILE
CAS:5866-98-8
Formula: N#CC1=C(Cl)C=CC([N+]([O-])=O)=C1Cl
BD68101
98%
MFCD00051513
2,6-DICHLORO-3-NITROPYRIDIN-4-AMINE
CAS:2897-43-0
Formula: C1=C(Cl)N=C(Cl)C(=C1N)[N+]([O-])=O
BD68099
97+%
MFCD03265754
2,6-DICHLORO-3-NITROPYRIDINE
CAS:16013-85-7
Formula: C1=C(C(=NC(=C1)Cl)Cl)[N+](=O)[O-]
BD7930
98%
MFCD00006234
2,6-DICHLORO-3-PHENYLPYRIDINE
CAS:18700-11-3
Formula: ClC1=CC=C(C2=CC=CC=C2)C(Cl)=N1
BD246652
95+%
MFCD00234689
2,6-DICHLORO-3-PHENYLQUINOXALINE
CAS:76672-25-8
Formula: ClC1=CC=C2N=C(Cl)C(C3=CC=CC=C3)=NC2=C1
BD269200
95+%
2,6-DICHLORO-3H-PYRIMIDIN-4-ONE
CAS:120977-94-8
Formula: ClC1=NC(=CC(N1)=O)Cl
BD216245
95+%
MFCD00955562
2,6-DICHLORO-4,8-DI(PIPERIDIN-1-YL)PYRIMIDO[5,4-D]PYRIMIDINE
CAS:7139-02-8
Formula: ClC1=NC2=C(N=C(Cl)N=C2N2CCCCC2)C(=N1)N1CCCCC1
BD234860
97%
MFCD07779463
2,6-DICHLORO-4-((TRIFLUOROMETHYL)THIO)ANILINE
CAS:99479-65-9
Formula: NC1=C(Cl)C=C(SC(F)(F)F)C=C1Cl
BD68145
95+%
MFCD04972800
2,6-DICHLORO-4-((TRIFLUOROMETHYL)THIO)PHENOL
CAS:102794-04-7
Formula: OC1=C(Cl)C=C(SC(F)(F)F)C=C1Cl
BD4033
97%
MFCD04972801
2,6-DICHLORO-4-(1-(OXETAN-3-YL) PIPERIDIN-4-YL)PYRIDINE
CAS:1496582-60-5
Formula: ClC1=CC(C2CCN(C3COC3)CC2)=CC(Cl)=N1
BD442233
97%
MFCD28133681
2,6-DICHLORO-4-(1-PYRROLYL)PYRIMIDINE
CAS:321328-97-6
Formula: ClC1=CC(N2C=CC=C2)=NC(Cl)=N1
BD160322
95+%
MFCD11846489
2,6-DICHLORO-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL) ANILINE
CAS:1371630-51-1
Formula: NC1=C(Cl)C=C(B2OC(C)(C)C(C)(C)O2)C=C1Cl
BD315019
95+%
MFCD23380454
2,6-DICHLORO-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL) PHENOL
CAS:1003298-87-0
Formula: OC1=C(Cl)C=C(B2OC(C)(C)C(C)(C)O2)C=C1Cl
BD266292
95+%
2,6-DICHLORO-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL) PYRIDINE
CAS:408492-27-3
Formula: CC1(C)C(C)(C)OB(C2=CC(Cl)=NC(Cl)=C2)O1
BD226529
98%
2,6-DICHLORO-4-(6-CHLOROOXAZOLO[5,4-B]PYRIDIN-2-YL) ANILINE
CAS:1354750-87-0
Formula: NC1=C(Cl)C=C(C2=NC3=CC(Cl)=CN=C3O2)C=C1Cl
BD612861
97%
2,6-DICHLORO-4-(CHLOROMETHYL)-3-METHYLPYRIDINE
CAS:N/A
Formula: CC1C(Cl)=NC(Cl)=CC=1CCl
BD00759117
95%
2,6-DICHLORO-4-(CHLOROMETHYL)NICOTINONITRILE
CAS:1248784-79-3
Formula: N#CC1=C(Cl)N=C(Cl)C=C1CCl
BD284517
95+%
2,6-DICHLORO-4-(CHLOROMETHYL)PYRIDINE
CAS:101990-72-1
BD68105
2,6-DICHLORO-4-(CHLOROMETHYL)PYRIDINE HYDROCHLORIDE
CAS:223407-50-9
Formula: ClCC1=CC(Cl)=NC(Cl)=C1.[H]Cl
BD475314
97%
2,6-DICHLORO-4-(DIFLUOROMETHOXY) ANILINE
CAS:154807-46-2
Formula: NC1=C(Cl)C=C(OC(F)F)C=C1Cl
BD330192
95+%
MFCD21602867
2,6-DICHLORO-4-(DIFLUOROMETHYL)NICOTINONITRILE
CAS:960293-93-0
Formula: N#CC1=C(Cl)N=C(Cl)C=C1C(F)F
BD284518
95+%
2,6-DICHLORO-4-(DIFLUOROMETHYL)PYRIDIN-3-OL
CAS:1805332-81-3
Formula: OC1=C(C(F)F)C=C(Cl)N=C1Cl
BD467929
97%
MFCD25486872
2,6-DICHLORO-4-(DIFLUOROMETHYL)PYRIDINE
CAS:1201675-01-5
Formula: FC(C1=CC(Cl)=NC(Cl)=C1)F
BD555977
97%
MFCD16658727
2,6-DICHLORO-4-(DIMETHYLAMINO)NICOTINALDEHYDE
CAS:1823371-33-0
Formula: O=CC1=C(Cl)N=C(Cl)C=C1N(C)C
BD265654
95+%
2,6-DICHLORO-4-(HYDROXYMETHYL) PHENOL
CAS:22002-17-1
Formula: OC1=C(Cl)C=C(CO)C=C1Cl
BD476583
97%
2,6-DICHLORO-4-(METHYLSULFONYL)ANILINE
CAS:80866-96-2
Formula: NC1=C(Cl)C=C(S(=O)(C)=O)C=C1Cl
BD182618
95+%
MFCD00007678
2,6-DICHLORO-4-(METHYLSULFONYL)PHENOL
CAS:20951-05-7
Formula: OC1=C(Cl)C=C(S(=O)(C)=O)C=C1Cl
BD68106
95+%
MFCD00216500
2,6-DICHLORO-4-(O-TOLYL)NICOTINONITRILE
CAS:873443-66-4
Formula: N#CC1=C(C2=CC=CC=C2C)C=C(Cl)N=C1Cl
BD651488
97%
2,6-DICHLORO-4-(PIPERIDIN-1-YLCARBONYL)PYRIDINE
CAS:287196-80-9
Formula: C1CCN(CC1)C(C2=CC(=NC(=C2)Cl)Cl)=O
BD44007
95+%
MFCD01764510
2,6-DICHLORO-4-(PIPERIDIN-4-YL)PYRIDINE HYDROCHLORIDE
CAS:1956326-74-1
Formula: ClC1=CC(C2CCNCC2)=CC(Cl)=N1.[H]Cl
BD442232
97%
MFCD28133680
2,6-DICHLORO-4-(TERT-PENTYL)PHENOL
CAS:75908-77-9
Formula: OC1=C(Cl)C=C(C(C)(C)CC)C=C1Cl
BD68107
97%
2,6-DICHLORO-4-(TETRAHYDRO-2H-PYRAN-4-YL)PYRIDINE
CAS:1496582-11-6
Formula: ClC1=CC(C2CCOCC2)=CC(Cl)=N1
BD330085
95+%
MFCD28133682
2,6-DICHLORO-4-(TRIFLUOROMETHOXY) ANILINE
CAS:99479-66-0
Formula: NC1=C(Cl)C=C(OC(F)(F)F)C=C1Cl
BD10262
95+%
MFCD00190128
2,6-DICHLORO-4-(TRIFLUOROMETHOXY) BENZALDEHYDE
CAS:118754-54-4
Formula: O=CC1=C(Cl)C=C(OC(F)(F)F)C=C1Cl
BD68109
97%
MFCD06660298
2,6-DICHLORO-4-(TRIFLUOROMETHOXY) BENZONITRILE
CAS:1822673-40-4
Formula: N#CC1=C(Cl)C=C(OC(F)(F)F)C=C1Cl
BD438965
97%
MFCD22581446
2,6-DICHLORO-4-(TRIFLUOROMETHYL)ANILINE
CAS:24279-39-8
Formula: C1=C(C=C(C(=C1Cl)N)Cl)C(F)(F)F
BD10261
98%
MFCD00052918
2,6-DICHLORO-4-(TRIFLUOROMETHYL)BENZALDEHYDE
CAS:118754-52-2
Formula: O=CC1=C(Cl)C=C(C(F)(F)F)C=C1Cl
BD254344
95+%
2,6-DICHLORO-4-(TRIFLUOROMETHYL)BENZENE-1-SULFONYL CHLORIDE
CAS:175205-76-2
Formula: FC(F)(F)C1=CC(Cl)=C(C(Cl)=C1)S(Cl)(=O)=O
BD3989
98%
MFCD00220929
2,6-DICHLORO-4-(TRIFLUOROMETHYL)BENZOIC ACID
CAS:189338-32-7
Formula: O=C(O)C1=C(Cl)C=C(C(F)(F)F)C=C1Cl
BD217790
97%
MFCD01934568
2,6-DICHLORO-4-(TRIFLUOROMETHYL)NICOTINALDEHYDE
CAS:914636-56-9
Formula: O=CC1=C(Cl)N=C(Cl)C=C1C(F)(F)F
BD238801
95+%
MFCD08056286
2,6-DICHLORO-4-(TRIFLUOROMETHYL)NICOTINAMIDE
CAS:158063-67-3
Formula: O=C(N)C1=C(Cl)N=C(Cl)C=C1C(F)(F)F
BD4030
95+%
MFCD00173903
2,6-DICHLORO-4-(TRIFLUOROMETHYL)NICOTINIC ACID
CAS:503437-19-2
Formula: O=C(O)C1=C(Cl)N=C(Cl)C=C1C(F)(F)F
BD68144
95+%
MFCD06208180
2,6-DICHLORO-4-(TRIFLUOROMETHYL)NICOTINONITRILE
CAS:13600-42-5
Formula: N#CC1=C(Cl)N=C(Cl)C=C1C(F)(F)F
BD5109
98%
MFCD00084977
2,6-DICHLORO-4-(TRIFLUOROMETHYL)PYRIDIN-3-AMINE
CAS:175277-67-5
Formula: NC1=C(C(F)(F)F)C=C(Cl)N=C1Cl
BD768660
98%
MFCD00173957
2,6-DICHLORO-4-(TRIFLUOROMETHYL)PYRIDINE
CAS:39890-98-7
Formula: C1=C(C=C(Cl)N=C1Cl)C(F)(F)F
BD68120
98%
MFCD00042246
2,6-DICHLORO-4-CYANOBENZOIC ACID
CAS:1258298-05-3
Formula: O=C(O)C1=C(Cl)C=C(C#N)C=C1Cl
BD218174
97%
2,6-DICHLORO-4-CYANOPHENYL BENZOATE
CAS:3861-44-7
Formula: O=C(OC1=C(Cl)C=C(C#N)C=C1Cl)C2=CC=CC=C2
BD625109
97%
2,6-DICHLORO-4-ETHOXYPYRIDINE
CAS:894804-42-3
Formula: CCOC1=CC(Cl)=NC(Cl)=C1
BD241818
98%
2,6-DICHLORO-4-ETHYLNICOTINIC ACID
CAS:62774-91-8
Formula: O=C(O)C1=C(Cl)N=C(Cl)C=C1CC
BD248728
95+%
2,6-DICHLORO-4-ETHYLNICOTINONITRILE
CAS:52338-11-1
Formula: N#CC1=C(Cl)N=C(Cl)C=C1CC
BD248729
95+%
2,6-DICHLORO-4-FLUOROBENZALDEHYDE
CAS:1182709-86-9
Formula: FC1=CC(Cl)=C(C=O)C(Cl)=C1
BD224422
95+%
2,6-DICHLORO-4-FLUOROBENZENESULFONYL CHLORIDE
CAS:88972-04-7
Formula: O=S(C1=C(Cl)C=C(F)C=C1Cl)(Cl)=O
BD324397
95+%
MFCD16817657
2,6-DICHLORO-4-FLUOROBENZENETHIOL
CAS:38366-83-5
Formula: SC1=C(Cl)C=C(F)C=C1Cl
BD469112
97%
MFCD16817658
2,6-DICHLORO-4-FLUOROBENZOIC ACID
CAS:232275-55-7
Formula: OC(=O)C1=C(Cl)C=C(F)C=C1Cl
BD241148
95+%
2,6-DICHLORO-4-FLUOROPHENOL
CAS:392-71-2
Formula: OC1=C(Cl)C=C(F)C=C1Cl
BD9759
95+%
MFCD00010675
2,6-DICHLORO-4-HYDROXYBENZALDEHYDE
CAS:60964-09-2
Formula: OC1=CC(Cl)=C(C=O)C(Cl)=C1
BD29217
95%
MFCD06797919
2,6-DICHLORO-4-HYDROXYBENZOIC ACID
CAS:4641-38-7
Formula: O=C(O)C1=C(Cl)C=C(O)C=C1Cl
BD257894
95+%
2,6-DICHLORO-4-HYDROXYMETHYLBENZALDEHYDE
CAS:616195-96-1
Formula: O=CC1=C(Cl)C=C(CO)C=C1Cl
BD323958
95+%
MFCD18904376
2,6-DICHLORO-4-HYDROXYPYRIDINE
CAS:17228-74-9
Formula: ClC1=NC(=CC(=C1)O)Cl
BD18855
98%
MFCD00955619
2,6-DICHLORO-4-IODOANILINE
CAS:697-89-2
Formula: NC1=C(Cl)C=C(I)C=C1Cl
BD68131
95+%
MFCD01670182
2,6-DICHLORO-4-IODOBENZAMIDE
CAS:N/A
Formula: O=C(C1C(Cl)=CC(I)=CC=1Cl)N
BD00734971
95%
2,6-DICHLORO-4-IODOBENZOIC ACID
CAS:1258298-01-9
Formula: O=C(O)C1=C(Cl)C=C(I)C=C1Cl
BD289755
98%
MFCD22690836
2,6-DICHLORO-4-IODONICOTINIC ACID
CAS:343781-55-5
Formula: O=C(C1=C(I)C=C(Cl)N=C1Cl)O
BD450111
97%
MFCD16658922
2,6-DICHLORO-4-IODOPHENOL
CAS:34074-22-1
Formula: OC1=C(Cl)C=C(I)C=C1Cl
BD220268
98%
MFCD00466446
2,6-DICHLORO-4-IODOPYRIDINE
CAS:98027-84-0
Formula: ClC1=NC(=CC(=C1)I)Cl
BD60597
98%
MFCD07368400
2,6-DICHLORO-4-ISOPROPYLNICOTINONITRILE
CAS:503843-54-7
Formula: N#CC1=C(Cl)N=C(Cl)C=C1C(C)C
BD625494
97%
2,6-DICHLORO-4-METHOXYBENZALDEHYDE
CAS:82772-93-8
Formula: O=CC1=C(Cl)C=C(OC)C=C1Cl
BD254340
95+%
MFCD12024958
2,6-DICHLORO-4-METHOXYBENZONITRILE
CAS:30482-87-2
Formula: N#CC1=C(Cl)C=C(OC)C=C1Cl
BD284578
95+%
MFCD24539384
2,6-DICHLORO-4-METHOXYPYRIDINE
CAS:17228-75-0
Formula: COC1=CC(Cl)=NC(Cl)=C1
BD167625
98%
MFCD00955755
2,6-DICHLORO-4-METHYL-3-NITROPYRIDINE
CAS:60010-03-9
Formula: O=[N+](C1=C(C)C=C(Cl)N=C1Cl)[O-]
BD68133
98%
2,6-DICHLORO-4-METHYLANILINE
CAS:56461-98-4
Formula: NC1=C(Cl)C=C(C)C=C1Cl
BD217791
98%
MFCD00190134
2,6-DICHLORO-4-METHYLBENZALDEHYDE
CAS:116070-31-6
Formula: O=CC1=C(Cl)C=C(C)C=C1Cl
BD40966
95+%
2,6-DICHLORO-4-METHYLNICOTINALDEHYDE
CAS:91591-70-7
Formula: CC1=CC(Cl)=NC(Cl)=C1C=O
BD220654
95+%
2,6-DICHLORO-4-METHYLNICOTINAMIDE
CAS:38841-54-2
Formula: O=C(N)C1=C(Cl)N=C(Cl)C=C1C
BD68135
95+%
MFCD00052636
2,6-DICHLORO-4-METHYLNICOTINIC ACID
CAS:62774-90-7
Formula: ClC1=NC(=CC(=C1C(=O)O)C)Cl
BD68134
97+%
MFCD02932724
2,6-DICHLORO-4-METHYLPHENOL
CAS:2432-12-4
Formula: CC1=CC(Cl)=C(O)C(Cl)=C1
BD36855
95+%
MFCD00134679
2,6-DICHLORO-4-METHYLPYRIDIN-3-AMINE
CAS:129432-25-3
Formula: NC1=C(C)C=C(Cl)N=C1Cl
BD162487
98%
2,6-DICHLORO-4-METHYLPYRIDINE
CAS:39621-00-6
Formula: CC1=CC(Cl)=NC(Cl)=C1
BD68143
98%
MFCD09264302
2,6-DICHLORO-4-METHYLQUINAZOLINE
CAS:1260798-81-9
Formula: CC1=C2C=C(Cl)C=CC2=NC(Cl)=N1
BD263954
95+%
MFCD13193409
2,6-DICHLORO-4-METHYLQUINOLINE
CAS:90723-71-0
Formula: CC1=CC(Cl)=NC2=CC=C(Cl)C=C12
BD160572
95+%
MFCD01316208
2,6-DICHLORO-4-NITROPYRIDINE
CAS:25194-01-8
Formula: O=[N+](C1=CC(Cl)=NC(Cl)=C1)[O-]
BD60598
97%
MFCD05670545
2,6-DICHLORO-4-PHENYLPYRIDINE
CAS:25297-51-2
Formula: ClC1=CC(C2=CC=CC=C2)=CC(Cl)=N1
BD68142
95+%
MFCD09030072
2,6-DICHLORO-4-PHENYLQUINAZOLINE
CAS:5185-54-6
Formula: ClC1=CC2=C(C3=CC=CC=C3)N=C(Cl)N=C2C=C1
BD183149
95+%
MFCD00563519
2,6-DICHLORO-4-PROPYLNICOTINONITRILE
CAS:52338-17-7
Formula: N#CC1=C(Cl)N=C(Cl)C=C1CCC
BD284510
95+%
MFCD23098026
2,6-DICHLORO-4-PYRIMIDINEPROPANOIC ACID
CAS:212650-39-0
Formula: O=C(O)CCC1=NC(Cl)=NC(Cl)=C1
BD239606
95+%
MFCD22682800
2,6-DICHLORO-4-TRIFLUOROMETHYLBENZENE SULFONAMIDE
CAS:259683-79-9
Formula: O=S(C1=C(Cl)C=C(C(F)(F)F)C=C1Cl)(N)=O
BD323546
95+%
MFCD00728630
2,6-DICHLORO-5-(TRIFLUOROMETHYL)NICOTINONITRILE
CAS:1319804-30-2
Formula: N#CC1=C(Cl)N=C(Cl)C(C(F)(F)F)=C1
BD284528
95+%
n/a
2,6-DICHLORO-5-CYCLOPROPYLNICOTINONITRILE
CAS:1319804-29-9
Formula: N#CC1=C(Cl)N=C(Cl)C(C2CC2)=C1
BD284508
95+%
2,6-DICHLORO-5-ETHYLPYRIMIDIN-4-AMINE
CAS:81316-68-9
Formula: NC1=NC(Cl)=NC(Cl)=C1CC
BD261233
95+%
MFCD11977464
2,6-DICHLORO-5-FLUORO-4-IODONICOTINONITRILE
CAS:905587-20-4
Formula: N#CC1=C(I)C(F)=C(Cl)N=C1Cl
BD00771873
97%
n/a
2,6-DICHLORO-5-FLUORO-4-METHYLNICOTINALDEHYDE
CAS:N/A
Formula: O=CC1C(C)=C(F)C(Cl)=NC=1Cl
BD00731307
95%
2,6-DICHLORO-5-FLUORO-4-METHYLNICOTINAMIDE
CAS:N/A
Formula: O=C(C1C(C)=C(F)C(Cl)=NC=1Cl)N
BD00734562
95%
2,6-DICHLORO-5-FLUORO-4-METHYLNICOTINIC ACID
CAS:132195-42-7
Formula: O=C(O)C1=C(Cl)N=C(Cl)C(F)=C1C
BD260748
95+%
2,6-DICHLORO-5-FLUORO-4-METHYLNICOTINONITRILE
CAS:N/A
Formula: N#CC1C(C)=C(F)C(Cl)=NC=1Cl
BD00742572
95%
2,6-DICHLORO-5-FLUORO-N-ISOPROPYLNICOTINAMIDE
CAS:680217-86-1
Formula: O=C(NC(C)C)C1=C(Cl)N=C(Cl)C(F)=C1
BD11665
97%
2,6-DICHLORO-5-FLUORONICOTINAMIDE
CAS:113237-20-0
Formula: O=C(N)C1=C(Cl)N=C(Cl)C(F)=C1
BD218277
98%
2,6-DICHLORO-5-FLUORONICOTINONITRILE
CAS:82671-02-1
Formula: N#CC1=C(Cl)N=C(Cl)C(F)=C1
BD10040
98%
MFCD01863289
2,6-DICHLORO-5-FLUORONICOTINOYL CHLORIDE
CAS:96568-02-4
Formula: O=C(Cl)C1=C(Cl)N=C(Cl)C(F)=C1
BD68148
97%
MFCD01863240
2,6-DICHLORO-5-FLUOROPYRIDIN-3-AMINE
CAS:152840-65-8
Formula: NC1=CC(F)=C(Cl)N=C1Cl
BD215246
98%
MFCD11044255
2,6-DICHLORO-5-FLUOROPYRIDIN-3-AMINE HYDROCHLORIDE
CAS:1416351-81-9
Formula: NC1=CC(F)=C(Cl)N=C1Cl.[H]Cl
BD225887
95+%
2,6-DICHLORO-5-FLUOROPYRIDINE-3-CARBOXYLIC ACID
CAS:82671-06-5
Formula: O=C(C1=CC(F)=C(Cl)N=C1Cl)O
BD9725
98%
MFCD00799517
2,6-DICHLORO-5-IODONICOTINONITRILE
CAS:1353087-61-2
Formula: N#CC1=C(Cl)N=C(Cl)C(I)=C1
BD284547
95+%
2,6-DICHLORO-5-METHOXYNICOTINONITRILE
CAS:2089381-34-8
Formula: N#CC1=C(Cl)N=C(Cl)C(OC)=C1
BD763924
97%
2,6-DICHLORO-5-METHOXYPYRIMIDINE-4-CARBOXYLIC ACID
CAS:1936241-21-2
Formula: O=C(C1=NC(Cl)=NC(Cl)=C1OC)O
BD443671
97%
MFCD28400799
2,6-DICHLORO-5-METHYL-1H-BENZO[D]IMIDAZOLE
CAS:683240-82-6
Formula: CC1=C(Cl)C=C(NC(Cl)=N2)C2=C1
BD335032
95+%
MFCD24566022
2,6-DICHLORO-5-METHYLPYRIDIN-3-AMINE
CAS:58596-89-7
Formula: NC1=CC(C)=C(Cl)N=C1Cl
BD248730
95+%
MFCD20697565
2,6-DICHLORO-5-NITROPYRIMIDIN-4-AMINE
CAS:31221-68-8
Formula: NC1=NC(Cl)=NC(Cl)=C1[N+]([O-])=O
BD255775
95+%
MFCD16657246
2,6-DICHLORO-5-NITROQUINOLINE
CAS:1209246-34-3
Formula: O=[N+](C1=C2C=CC(Cl)=NC2=CC=C1Cl)[O-]
BD158537
96%
MFCD12406121
2,6-DICHLORO-5-PHENYLNICOTINONITRILE
CAS:10177-06-7
Formula: N#CC1=C(Cl)N=C(Cl)C(C2=CC=CC=C2)=C1
BD284534
95+%
MFCD00235086
2,6-DICHLORO-5-PROPYLNICOTINONITRILE
CAS:1299492-97-9
Formula: N#CC1=C(Cl)N=C(Cl)C(CCC)=C1
BD284516
95+%
MFCD25957674
2,6-DICHLORO-7-METHYLPURINE
CAS:2273-93-0
Formula: CN1C=NC2=NC(Cl)=NC(Cl)=C12
BD3233
97%
MFCD00039690
2,6-DICHLORO-7-METHYLQUINOXALINE
CAS:39267-03-3
Formula: CC1=C(Cl)C=C2N=CC(Cl)=NC2=C1
BD269185
95+%
2,6-DICHLORO-8,9-DIMETHYL-9H-PURINE
CAS:1474018-06-8
Formula: CN1C(C)=NC2=C(Cl)N=C(Cl)N=C12
BD445951
97%
MFCD28501974
2,6-DICHLORO-8-METHYL-9H-PURINE
CAS:57476-37-6
Formula: CC1=NC2=C(N1)N=C(Cl)N=C2Cl
BD228222
95+%
MFCD17016015
2,6-DICHLORO-9-(TETRAHYDRO-2H-PYRAN-2-YL)-9H-PURINE
CAS:20419-68-5
Formula: ClC1=C2N=CN(C3CCCCO3)C2=NC(Cl)=N1
BD68151
95+%
2,6-DICHLORO-9-ISOPROPYL-8-METHYL-9H-PURINE
CAS:1313026-86-6
Formula: CC(N1C(C)=NC2=C(Cl)N=C(Cl)N=C12)C
BD295243
95+%
MFCD18432767
2,6-DICHLORO-9-ISOPROPYL-9H-PURINE
CAS:203436-45-7
Formula: CC(N1C=NC2=C(Cl)N=C(Cl)N=C12)C
BD244442
97%
MFCD11047295
2,6-DICHLORO-9-METHYL-9H-PURINE
CAS:2382-10-7
Formula: CN1C=NC2=C(Cl)N=C(Cl)N=C12
BD162223
97+%
2,6-DICHLORO-ISONICOTINIC ACID ETHYL ESTER
CAS:1604-14-4
Formula: O=C(OCC)C1=CC(Cl)=NC(Cl)=C1
BD307432
95+%
MFCD00235122
2,6-DICHLORO-N,N-DIETHYLANILINE
CAS:67888-72-6
Formula: CCN(CC)C1=C(Cl)C=CC=C1Cl
BD335021
95+%
MFCD16620285
2,6-DICHLORO-N,N-DIETHYLPYRIMIDIN-4-AMINE
CAS:78418-15-2
Formula: CCN(CC)C1=NC(Cl)=NC(Cl)=C1
BD68192
95+%
MFCD09746260
2,6-DICHLORO-N,N-DIMETHYLPYRIDIN-4-AMINE
CAS:175461-34-4
Formula: CN(C)C1=CC(Cl)=NC(Cl)=C1
BD261900
98%
MFCD09031039
2,6-DICHLORO-N,N-DIMETHYLPYRIMIDIN-4-AMINE
CAS:117077-93-7
Formula: CN(C)C1=NC(Cl)=NC(Cl)=C1
BD252550
95+%
MFCD09746252
2,6-DICHLORO-N-((3-CHLORO-5-(TRIFLUOROMETHYL)PYRIDIN-2-YL)METHYL)BENZAMIDE
CAS:239110-15-7
Formula: O=C(NCC1=NC=C(C(F)(F)F)C=C1Cl)C2=C(Cl)C=CC=C2Cl
BD130514
95+%
MFCD09751509
2,6-DICHLORO-N-(1-METHYL-1H-IMIDAZOL-4-YL)PYRIMIDIN-4-AMINE
CAS:1208893-80-4
Formula: CN1C=C(NC2=NC(Cl)=NC(Cl)=C2)N=C1
BD244306
95+%
MFCD20229094
2,6-DICHLORO-N-(2-METHOXYETHYL) PYRIMIDIN-4-AMINE
CAS:879609-73-1
Formula: COCCNC1=NC(Cl)=NC(Cl)=C1
BD252549
95+%
MFCD20228012
2,6-DICHLORO-N-(CYCLOPENTA-1,3-DIEN-1-YL)-N-METHYLPYRIMIDIN-4-AMINE
CAS:1332531-17-5
Formula: CN(C1=CC=CC1)C2=NC(Cl)=NC(Cl)=C2
BD603102
97%
MFCD19982832
2,6-DICHLORO-N-(PYRIDIN-4-YL)BENZAMIDE
CAS:113204-35-6
Formula: O=C(NC1=CC=NC=C1)C2=C(Cl)C=CC=C2Cl
BD289675
95+%
MFCD01195760
2,6-DICHLORO-N-ETHYLPYRIMIDIN-4-AMINE
CAS:70958-39-3
Formula: CCNC1=NC(Cl)=NC(Cl)=C1
BD252551
95+%
MFCD11520483
2,6-DICHLORO-N-HYDROXYBENZIMIDOYL CHLORIDE
CAS:6579-27-7
Formula: Cl/C(C1=C(Cl)C=CC=C1Cl)=N\O
BD10264
97%
2,6-DICHLORO-N-ISOBUTYLPYRIMIDIN-4-AMINE
CAS:72063-78-6
Formula: CC(C)CNC1=NC(Cl)=NC(Cl)=C1
BD252552
95+%
MFCD20226414
2,6-DICHLORO-N-ISOPROPYLPYRIMIDIN-4-AMINE
CAS:30297-43-9
Formula: CC(NC1=NC(Cl)=NC(Cl)=C1)C
BD252553
95+%
MFCD11520485
2,6-DICHLORO-N-METHOXY-N-METHYLISONICOTINAMIDE
CAS:848498-98-6
Formula: O=C(N(OC)C)C1=CC(Cl)=NC(Cl)=C1
BD271327
95+%
MFCD11847257
2,6-DICHLORO-N-METHOXY-N-METHYLNICOTINAMIDE
CAS:873936-98-2
Formula: O=C(N(OC)C)C1=C(Cl)N=C(Cl)C=C1
BD449549
97%
MFCD11847422
2,6-DICHLORO-N-METHYL-3-NITROPYRIDIN-4-AMINE
CAS:887147-20-8
Formula: O=[N+](C1=C(NC)C=C(Cl)N=C1Cl)[O-]
BD248731
95+%
2,6-DICHLORO-N-METHYL-N-PHENYLPYRIMIDIN-4-AMINE
CAS:91064-29-8
Formula: CN(C1=CC=CC=C1)C2=NC(Cl)=NC(Cl)=C2
BD252554
95+%
MFCD02183492
2,6-DICHLORO-N-METHYLANILINE
CAS:56462-00-1
Formula: CNC1=C(Cl)C=CC=C1Cl
BD318915
95+%
MFCD00028479
2,6-DICHLORO-N-METHYLPYRIDIN-4-AMINE
CAS:175461-33-3
Formula: CNC1=CC(Cl)=NC(Cl)=C1
BD237935
97+%
MFCD12024871
2,6-DICHLORO-N-METHYLPYRIMIDIN-4-AMINE
CAS:32998-03-1
Formula: CNC1=NC(Cl)=NC(Cl)=C1
BD252555
95+%
MFCD11520482
2,6-DICHLORO-N-PHENYLANILINE
CAS:15307-93-4
Formula: ClC1=CC=CC(Cl)=C1NC1=CC=CC=C1
BD68178
98%
MFCD00269648
2,6-DICHLORO-N-PHENYLISONICOTINAMIDE
CAS:287174-84-9
Formula: O=C(C1=CC(Cl)=NC(Cl)=C1)NC2=CC=CC=C2
BD584493
97%
MFCD00125185
2,6-DICHLORO-N-PHENYLPYRIMIDIN-4-AMINE
CAS:28230-47-9
Formula: ClC1=CC(NC2=CC=CC=C2)=NC(Cl)=N1
BD44008
95+%
MFCD09756977
2,6-DICHLORO-N1-((TETRAHYDROFURAN-2-YL)METHYL)BENZENE-1,4-DIAMINE
CAS:1690654-29-5
Formula: NC1=CC(Cl)=C(NCC2OCCC2)C(Cl)=C1
BD618842
97%
2,6-DICHLORO-N1-(2-(DIETHYLAMINO)ETHYL)BENZENE-1,4-DIAMINE
CAS:1708255-07-5
Formula: NC1=CC(Cl)=C(NCCN(CC)CC)C(Cl)=C1
BD622094
97%
2,6-DICHLORO-N1-(2-(DIMETHYLAMINO)ETHYL)BENZENE-1,4-DIAMINE
CAS:1695170-50-3
Formula: NC1=CC(Cl)=C(NCCN(C)C)C(Cl)=C1
BD618871
97%
2,6-DICHLORO-N1-(2-(PYRIDIN-2-YL)ETHYL)BENZENE-1,4-DIAMINE
CAS:1708436-23-0
Formula: NC1=CC(Cl)=C(NCCC2=NC=CC=C2)C(Cl)=C1
BD622503
97%
2,6-DICHLORO-N1-(2-MORPHOLINOETHYL)BENZENE-1,4-DIAMINE
CAS:1707746-83-5
Formula: NC1=CC(Cl)=C(NCCN2CCOCC2)C(Cl)=C1
BD621678
97%
2,6-DICHLORO-N1-(3-(DIMETHYLAMINO)PROPYL)BENZENE-1,4-DIAMINE
CAS:1693685-57-2
Formula: NC1=CC(Cl)=C(NCCCN(C)C)C(Cl)=C1
BD618861
97%
2,6-DICHLORO-N1-(3-ETHOXYPROPYL) BENZENE-1,4-DIAMINE
CAS:1692140-34-3
Formula: NC1=CC(Cl)=C(NCCCOCC)C(Cl)=C1
BD618851
97%
2,6-DICHLORO-N1-(3-METHOXYPROPYL) BENZENE-1,4-DIAMINE
CAS:1695751-20-2
Formula: NC1=CC(Cl)=C(NCCCOC)C(Cl)=C1
BD618877
97%
2,6-DICHLORO-N1-CYCLOPROPYLBENZENE-1,4-DIAMINE
CAS:1697584-78-3
Formula: NC1=CC(Cl)=C(NC2CC2)C(Cl)=C1
BD618889
97%
2,6-DICHLORO-N1-PROPYLBENZENE-1,4-DIAMINE
CAS:1700397-85-8
Formula: NC1=CC(Cl)=C(NCCC)C(Cl)=C1
BD618920
97%
2,6-DICHLORO-N4-METHYLPYRIDINE-3,4-DIAMINE
CAS:914942-86-2
Formula: NC1=C(NC)C=C(Cl)N=C1Cl
BD250843
95+%
MFCD22551530
2,6-DICHLOROBENZALDEHYDE OXIME
CAS:25185-95-9
Formula: ClC1=C(C(Cl)=CC=C1)/C=N/O
BD19688
95+%
MFCD00013938
2,6-DICHLOROBENZAMIDE
CAS:2008-58-4
Formula: O=C(N)C1=C(Cl)C=CC=C1Cl
BD19210
95+%
MFCD00007975
2,6-DICHLOROBENZENE-1,4-DIAMINE
CAS:609-20-1
Formula: NC1=C(Cl)C=C(N)C=C1Cl
BD3464
97%
MFCD00025369
2,6-DICHLOROBENZENE-1,4-DIOL
CAS:20103-10-0
Formula: OC1=C(Cl)C=C(O)C=C1Cl
BD68079
97%
2,6-DICHLOROBENZENESULFONAMIDE
CAS:10290-98-9
Formula: O=S(C1=C(Cl)C=CC=C1Cl)(N)=O
BD306989
95+%
MFCD03093819
2,6-DICHLOROBENZIMIDAMIDE
CAS:3797-84-0
Formula: N=C(N)C1=C(Cl)C=CC=C1Cl
BD28555
95+%
MFCD05662972
2,6-DICHLOROBENZIMIDAMIDE HYDROCHLORIDE
CAS:3797-81-7
Formula: N=C(N)C1=C(Cl)C=CC=C1Cl.[H]Cl
BD285692
97%
MFCD04114466
2,6-DICHLOROBENZOIC ACID
CAS:50-30-6
Formula: O=C(O)C1=C(Cl)C=CC=C1Cl
BD4158
98%
MFCD00002418
2,6-DICHLOROBENZONITRILE
CAS:1194-65-6
Formula: N#CC1=C(Cl)C=CC=C1Cl
BD4038
98%
MFCD00001781
2,6-DICHLOROBENZOTHIOAMIDE
CAS:1918-13-4
Formula: NC(C1=C(Cl)C=CC=C1Cl)=S
BD68245
95+%
MFCD00053523
2,6-DICHLOROBENZOXAZOLE
CAS:3621-82-7
Formula: ClC1=CC=C2N=C(Cl)OC2=C1
BD10172
98%
MFCD07368635
2,6-DICHLOROBENZOYL CHLORIDE
CAS:4659-45-4
Formula: O=C(Cl)C1=C(Cl)C=CC=C1Cl
BD33720
95+%
MFCD00000662
2,6-DICHLOROBENZYL 1-(2,6-DICHLOROBENZYL)AZETIDINE-3-CARBOXYLATE
CAS:1353959-32-6
Formula: O=C(C1CN(CC2=C(Cl)C=CC=C2Cl)C1)OCC3=C(Cl)C=CC=C3Cl
BD288196
95+%
MFCD21098447
2,6-DICHLOROCYCLOHEXA-2,5-DIENE-1,4-DIONE
CAS:697-91-6
Formula: O=C(C=C1Cl)C=C(Cl)C1=O
BD68078
97%
2,6-DICHLOROIMIDAZO[1,2-A]PYRIDINE
CAS:112581-60-9
Formula: ClC1=CN2C(C=C1)=NC(Cl)=C2
BD68180
97%
MFCD08236842
2,6-DICHLOROIMIDAZO[1,2-B]PYRIDAZINE
CAS:112581-77-8
Formula: ClC1=C[N]2C(=N1)C=CC(=N2)Cl
BD68181
95+%
MFCD11044765
2,6-DICHLOROIMIDAZO[2,1-B]THIAZOLE
CAS:135718-53-5
Formula: ClC1=CN2C(SC(Cl)=C2)=N1
BD258469
95+%
MFCD09878678
2,6-DICHLOROINDOPHENOL SODIUM SALT
CAS:620-45-1
Formula: O=C1C(Cl)=C/C(C=C1Cl)=N/C2=CC=C(C=C2)[O-].[Na+]
BD68207
95+%
MFCD00150014
2,6-DICHLOROISONICOTINALDEHYDE
CAS:113293-70-2
Formula: ClC1=CC(C=O)=CC(Cl)=N1
BD17601
98%
MFCD00124816
2,6-DICHLOROISONICOTINAMIDE
CAS:89281-13-0
Formula: O=C(N)C1=CC(Cl)=NC(Cl)=C1
BD68184
95+%
MFCD00052640
2,6-DICHLOROISONICOTINIC ACID
CAS:5398-44-7
Formula: O=C(O)C1=CC(Cl)=NC(Cl)=C1
BD3139
97+%
MFCD00234147
2,6-DICHLOROISONICOTINIMIDAMIDE HYDROCHLORIDE
CAS:175204-59-8
Formula: N=C(N)C1=CC(Cl)=NC(Cl)=C1.[H]Cl
BD68236
95+%
2,6-DICHLOROISONICOTINOHYDRAZIDE
CAS:57803-51-7
Formula: O=C(NN)C1=CC(Cl)=NC(Cl)=C1
BD68186
97%
2,6-DICHLOROISONICOTINONITRILE
CAS:32710-65-9
Formula: ClC1=CC(=CC(Cl)=N1)C#N
BD3081
98%
MFCD00173784
2,6-DICHLORONAPHTHALENE
CAS:2065-70-5
Formula: ClC1=CC2=C(C=C1)C=C(Cl)C=C2
BD68193
95+%
MFCD01861450
2,6-DICHLORONICOTINAMIDE
CAS:62068-78-4
Formula: NC(=O)C1=CC=C(Cl)N=C1Cl
BD238698
97%
MFCD03230010
2,6-DICHLORONICOTINIC ACID
CAS:38496-18-3
Formula: O=C(O)C1=C(Cl)N=C(Cl)C=C1
BD7932
98%
MFCD00075583
2,6-DICHLOROPHENETHYL ALCOHOL
CAS:30595-79-0
Formula: ClC1=C(C(Cl)=CC=C1)CCO
BD68201
98%
MFCD00800674
2,6-DICHLOROPHENYLACETIC ACID
CAS:6575-24-2
Formula: O=C(O)CC1=C(Cl)C=CC=C1Cl
BD5855
98%
MFCD00004320
2,6-DICHLOROPHENYLSULFONYLETHANOL
CAS:688763-07-7
Formula: OCCS(=O)(C1=C(Cl)C=CC=C1Cl)=O
BD324064
95+%
MFCD03789221
2,6-DICHLOROPIPERIDINE-3-CARBOXYLIC ACID
CAS:1936188-08-7
Formula: O=C(C1C(Cl)NC(Cl)CC1)O
BD438807
97%
MFCD28404871
2,6-DICHLOROPURINE
CAS:5451-40-1
Formula: C2=NC1=C(C(=NC(=N1)Cl)Cl)[NH]2
BD7935
98%
MFCD07357405
2,6-DICHLOROPYRAZINE
CAS:4774-14-5
Formula: ClC1=CN=CC(Cl)=N1
BD9379
98%
MFCD00006125
2,6-DICHLOROPYRIDIN-3-OL
CAS:52764-11-1
Formula: OC1=CC=C(Cl)N=C1Cl
BD245445
98%
MFCD11044319
2,6-DICHLOROPYRIDIN-3-YLBORONIC ACID
CAS:148493-34-9
Formula: C1=C(N=C(C(=C1)B(O)O)Cl)Cl
BD2578
97%
MFCD03094989
2,6-DICHLOROPYRIDIN-4(1H)-ONE
CAS:253435-44-8
Formula: O=C1C=C(Cl)NC(Cl)=C1
BD260607
95+%
2,6-DICHLOROPYRIDIN-4-AMINE
CAS:2587-02-2
Formula: ClC1=CC(N)=CC(Cl)=N1
BD2591
98%
MFCD00052832
2,6-DICHLOROPYRIDINE
CAS:2402-78-0
Formula: ClC1=CC=CC(Cl)=N1
BD32816
97%
MFCD00006244
2,6-DICHLOROPYRIDINE-3,4-DIAMINE
CAS:101079-63-4
Formula: NC1=C(N)C=C(Cl)N=C1Cl
BD158733
98%
MFCD10697689
2,6-DICHLOROPYRIDINE-3,4-DICARBOXYLIC ACID
CAS:1935433-61-6
Formula: O=C(C1=C(C(O)=O)C=C(Cl)N=C1Cl)O
BD445498
97%
MFCD29035248
2,6-DICHLOROPYRIDINE-3,5-DICARBALDEHYDE
CAS:81319-42-8
Formula: ClC1=NC(Cl)=C(C=O)C=C1C=O
BD237833
95+%
2,6-DICHLOROPYRIDINE-3,5-DICARBONITRILE
CAS:151229-84-4
Formula: N#CC1=CC(C#N)=C(Cl)N=C1Cl
BD248732
95+%
MFCD03272798
2,6-DICHLOROPYRIDINE-3,5-DICARBOXYLIC ACID
CAS:58584-82-0
Formula: O=C(C1=CC(C(O)=O)=C(Cl)N=C1Cl)O
BD280162
95+%
MFCD00834966
2,6-DICHLOROPYRIDINE-3-CARBONITRILE
CAS:40381-90-6
Formula: ClC1=NC(=CC=C1C#N)Cl
BD33592
97%
MFCD03411341
2,6-DICHLOROPYRIDINE-3-SULFONAMIDE
CAS:1078627-77-6
Formula: O=S(C1=CC=C(Cl)N=C1Cl)(N)=O
BD505248
97%
MFCD15142801
2,6-DICHLOROPYRIDINE-4-CARBOTHIOAMIDE
CAS:175204-46-3
Formula: S=C(C1=CC(Cl)=NC(Cl)=C1)N
BD68234
97%
2,6-DICHLOROPYRIDINE-4-METHANOL
CAS:101990-69-6
Formula: ClC1=NC(=CC(=C1)CO)Cl
BD215430
97%
MFCD00052638
2,6-DICHLOROPYRIDINE-4-METHYLAMINE
CAS:88579-63-9
Formula: NCC1=CC(Cl)=NC(Cl)=C1
BD68237
95+%
MFCD06212867
2,6-DICHLOROPYRIDINE-4-SULFONYL CHLORIDE
CAS:N/A
Formula: O=S(=O)(Cl)C1C=C(Cl)N=C(Cl)C=1
BD00745762
95%
2,6-DICHLOROPYRIDINE-4-THIOL
CAS:33256-13-2
Formula: SC1=CC(Cl)=NC(Cl)=C1
BD248733
95+%
2,6-DICHLOROPYRIDO[2,3-B]PYRAZINE
CAS:N/A
Formula: ClC1N=C2N=CC(=NC2=CC=1)Cl
BD00760443
95%
2,6-DICHLOROPYRIMIDINE-4,5-DIAMINE
CAS:130838-36-7
Formula: NC1=NC(Cl)=NC(Cl)=C1N
BD292261
95+%
2,6-DICHLOROPYRIMIDINE-4-CARBONITRILE
CAS:26293-93-6
Formula: N#CC1=NC(Cl)=NC(Cl)=C1
BD161617
98%
MFCD16988336
2,6-DICHLOROPYRIMIDINE-4-CARBONYL CHLORIDE
CAS:26830-94-4
Formula: O=C(Cl)C1=NC(Cl)=NC(Cl)=C1
BD68238
95+%
MFCD08444236
2,6-DICHLOROPYRIMIDINE-4-CARBOXAMIDE
CAS:98136-42-6
Formula: O=C(C1=NC(Cl)=NC(Cl)=C1)N
BD219997
97%
MFCD09881209
2,6-DICHLOROPYRIMIDINE-4-CARBOXYLIC ACID
CAS:16492-28-7
Formula: OC(=O)C1=CC(Cl)=NC(Cl)=N1
BD212733
97%
MFCD02933142
2,6-DICHLOROQUINAZOLIN-4(3H)-ONE
CAS:20197-87-9
Formula: O=C1NC(Cl)=NC2=C1C=C(Cl)C=C2
BD162023
95+%
2,6-DICHLOROQUINAZOLIN-4-AMINE
CAS:N/A
Formula: NC1N=C(Cl)N=C2C=1C=C(C=C2)Cl
BD00751823
95%
n/a
2,6-DICHLOROQUINAZOLINE
CAS:67092-18-6
Formula: ClC1=CC2=CN=C(Cl)N=C2C=C1
BD263123
95+%
MFCD15527159
2,6-DICHLOROQUINOLIN-5-AMINE
CAS:607380-28-9
Formula: ClC2=NC1=C(C(=C(C=C1)Cl)N)C=C2
BD68239
95+%
MFCD09835367
2,6-DICHLOROQUINOLINE
CAS:1810-72-6
Formula: ClC1=CC=C2N=C(Cl)C=CC2=C1
BD68240
97%
MFCD03427194
2,6-DICHLOROQUINOLINE-3-CARBALDEHYDE
CAS:73568-41-9
Formula: O=CC1=CC2=CC(Cl)=CC=C2N=C1Cl
BD68241
95+%
MFCD06202347
2,6-DICHLOROQUINOLINE-3-CARBOXYLIC ACID
CAS:1017378-98-1
Formula: O=C(C1=CC2=CC(Cl)=CC=C2N=C1Cl)O
BD605477
97%
2,6-DICHLOROQUINOXALINE
CAS:18671-97-1
Formula: ClC1=CC=C2N=C(Cl)C=NC2=C1
BD10821
98%
MFCD00839695
2,6-DICYANO-1-FLUOROPYRIDIN-1-IUM TRIFLUOROMETHANESULFONATE
CAS:135182-99-9
Formula: F[N+]1=C(C#N)C=CC=C1C#N.O=S(C(F)(F)F)([O-])=O
BD270069
95+%
2,6-DIETHOXYBENZOIC ACID
CAS:82935-36-2
Formula: O=C(O)C1=C(OCC)C=CC=C1OCC
BD398757
95+%
MFCD00156982
2,6-DIETHOXYISONICOTINIC ACID
CAS:5397-75-1
Formula: O=C(O)C1=CC(OCC)=NC(OCC)=C1
BD269652
95+%
2,6-DIETHOXYPYRAZINE
CAS:33870-85-8
Formula: CCOC1=CN=CC(OCC)=N1
BD264821
95+%
MFCD15144517
2,6-DIETHOXYPYRIDIN-4-AMINE
CAS:183296-01-7
Formula: NC1=CC(OCC)=NC(OCC)=C1
BD252556
95+%
MFCD20257885
2,6-DIETHYL-3-NITROANILINE
CAS:103392-86-5
Formula: NC1=C(CC)C=CC([N+]([O-])=O)=C1CC
BD284797
95+%
MFCD24539377
2,6-DIETHYL-4-METHYLANILINE
CAS:24544-08-9
Formula: CCC1=CC(C)=CC(CC)=C1N
BD19627
98%
MFCD00035950
2,6-DIETHYL-5-THIOXO-5,6-DIHYDRO-2H-PYRAZOLO[4,3-D]PYRIMIDIN-7(4H)-ONE
CAS:828299-89-4
Formula: O=C(N1CC)C2=NN(CC)C=C2NC1=S
BD549739
97%
2,6-DIETHYLANILINE
CAS:579-66-8
Formula: NC1=C(CC)C=CC=C1CC
BD68252
98%
MFCD00007753
2,6-DIETHYLANILINE HYDROCHLORIDE
CAS:71477-82-2
Formula: NC1=C(CC)C=CC=C1CC.[H]Cl
BD324107
95+%
MFCD19982483
2,6-DIETHYLBENZOIC ACID
CAS:78114-07-5
Formula: O=C(O)C1=C(CC)C=CC=C1CC
BD597489
97%
MFCD09260802
2,6-DIETHYLISONICOTINONITRILE
CAS:37581-44-5
Formula: N#CC1=CC(CC)=NC(CC)=C1
BD271102
95+%
2,6-DIETHYLPHENOL
CAS:1006-59-3
Formula: OC1=C(CC)C=CC=C1CC
BD68254
98%
MFCD01707589
2,6-DIETHYLPYRIDIN-4-OL
CAS:1115035-61-4
Formula: OC1=CC(CC)=NC(CC)=C1
BD248734
95+%
MFCD17011769
2,6-DIFLUORO-3,5-BIS(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL) PYRIDINE
CAS:1218789-90-2
Formula: CC1(C)C(C)(C)OB(C2=C(F)N=C(F)C(B3OC(C)(C)C(C)(C)O3)=C2)O1
BD230282
95+%
2,6-DIFLUORO-3,5-DIIODOPYRIDINE
CAS:685517-77-5
Formula: IC1=C(F)N=C(F)C(I)=C1
BD336475
95+%
MFCD12756678
2,6-DIFLUORO-3,5-DIMETHOXYANILINE
CAS:651734-54-2
Formula: NC1=C(F)C(OC)=CC(OC)=C1F
BD304761
97%
MFCD12973804
2,6-DIFLUORO-3,5-DIMETHOXYBENZALDEHYDE
CAS:1890954-24-1
Formula: O=CC1=C(F)C(OC)=CC(OC)=C1F
BD436858
97%
MFCD29058863
2,6-DIFLUORO-3,5-DIMETHOXYBENZOIC ACID
CAS:651734-56-4
Formula: O=C(O)C1=C(F)C(OC)=CC(OC)=C1F
BD334934
95+%
MFCD24448610
2,6-DIFLUORO-3-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL) PYRIDINE
CAS:1072945-00-6
Formula: CC1(C)OB(OC1(C)C)C1=CC=C(F)N=C1F
BD236007
97%
MFCD09037475
2,6-DIFLUORO-3-(METHOXYMETHOXY) BENZAMIDE
CAS:1384476-82-7
Formula: O=C(N)C1=C(F)C=CC(OCOC)=C1F
BD448364
97%
MFCD24645484
2,6-DIFLUORO-3-(METHOXYMETHOXY) BENZOIC ACID
CAS:1190603-51-0
Formula: O=C(O)C1=C(F)C=CC(OCOC)=C1F
BD316838
95+%
n/a
2,6-DIFLUORO-3-(PROPYLSULFONAMIDO)BENZOIC ACID
CAS:1103234-56-5
Formula: O=C(O)C1=C(F)C=CC(NS(=O)(CCC)=O)=C1F
BD226199
97%
MFCD18157658
2,6-DIFLUORO-3-(PROPYLSULFONYL)BENZOIC ACID
CAS:1152501-92-2
Formula: O=C(O)C1=C(F)C=CC(S(=O)(CCC)=O)=C1F
BD247206
95+%
MFCD11103057
2,6-DIFLUORO-3-(PYRIDIN-2-YL)BENZONITRILE
CAS:883106-18-1
Formula: N#CC1=C(F)C=CC(C2=NC=CC=C2)=C1F
BD251552
95+%
2,6-DIFLUORO-3-(TRIFLUOROMETHYL)BENZOIC ACID
CAS:1048921-49-8
Formula: O=C(O)C1=C(F)C=CC(C(F)(F)F)=C1F
BD284847
95+%
MFCD03412249
2,6-DIFLUORO-3-CYANOPYRIDINE
CAS:869557-17-5
Formula: N#CC1=CC=C(F)N=C1F
BD212633
95+%
2,6-DIFLUORO-3-ETHOXYPHENYLBORONIC ACID
CAS:849062-00-6
Formula: OB(C1=C(F)C=CC(OCC)=C1F)O
BD68258
95+%
MFCD07369735
2,6-DIFLUORO-3-HYDROXYBENZALDEHYDE
CAS:152434-88-3
Formula: O=CC1=C(F)C=CC(O)=C1F
BD217796
95+%
MFCD08275284
2,6-DIFLUORO-3-HYDROXYBENZAMIDE
CAS:951122-37-5
Formula: O=C(N)C1=C(F)C=CC(O)=C1F
BD286829
95+%
2,6-DIFLUORO-3-HYDROXYBENZONITRILE
CAS:946796-26-5
Formula: N#CC1=C(F)C=CC(O)=C1F
BD256725
95+%
2,6-DIFLUORO-3-IODOBENZALDEHYDE
CAS:1160573-18-1
Formula: O=CC1=C(F)C=CC(I)=C1F
BD487844
97%
MFCD11845973
2,6-DIFLUORO-3-IODOBENZOIC ACID
CAS:229178-74-9
Formula: O=C(O)C1=C(F)C=CC(I)=C1F
BD68259
98%
2,6-DIFLUORO-3-IODOBENZONITRILE
CAS:1447606-20-3
Formula: N#CC1=C(F)C=CC(I)=C1F
BD439845
97%
MFCD25542085
2,6-DIFLUORO-3-IODOPYRIDINE
CAS:685517-67-3
Formula: IC1=CC=C(F)N=C1F
BD217997
95+%
2,6-DIFLUORO-3-METHOXYANILINE
CAS:144851-62-7
Formula: NC1=C(F)C=CC(OC)=C1F
BD229240
95+%
2,6-DIFLUORO-3-METHOXYBENZALDEHYDE
CAS:149949-30-4
Formula: O=CC1=C(F)C=CC(OC)=C1F
BD68260
97%
MFCD04115899
2,6-DIFLUORO-3-METHOXYBENZAMIDE
CAS:886498-26-6
Formula: O=C(N)C1=C(F)C=CC(OC)=C1F
BD319671
95+%
MFCD04115900
2,6-DIFLUORO-3-METHOXYBENZOIC ACID
CAS:886498-30-2
Formula: O=C(O)C1=C(F)C=CC(OC)=C1F
BD257999
98%
MFCD04115901
2,6-DIFLUORO-3-METHOXYBENZONITRILE
CAS:886498-35-7
Formula: N#CC1=C(F)C=CC(OC)=C1F
BD309520
95+%
MFCD04115902
2,6-DIFLUORO-3-METHOXYBENZOYL CHLORIDE
CAS:886498-40-4
Formula: O=C(Cl)C1=C(F)C=CC(OC)=C1F
BD319672
95+%
MFCD04115903
2,6-DIFLUORO-3-METHOXYBENZYL BROMIDE
CAS:886498-55-1
Formula: COC1=C(F)C(CBr)=C(F)C=C1
BD309521
95+%
MFCD04115906
2,6-DIFLUORO-3-METHOXYPHENOL
CAS:886498-60-8
Formula: OC1=C(F)C=CC(OC)=C1F
BD257973
95+%
MFCD04115907
2,6-DIFLUORO-3-METHOXYPHENYLACETIC ACID
CAS:886498-65-3
Formula: O=C(O)CC1=C(F)C=CC(OC)=C1F
BD309522
95+%
MFCD04115908
2,6-DIFLUORO-3-METHOXYPHENYLBORONIC ACID
CAS:870779-02-5
Formula: OB(C1=C(F)C=CC(OC)=C1F)O
BD68261
98%
MFCD06657880
2,6-DIFLUORO-3-METHYLANILINE
CAS:144851-63-8
Formula: NC1=C(F)C=CC(C)=C1F
BD286773
95+%
2,6-DIFLUORO-3-METHYLBENZALDEHYDE
CAS:261763-34-2
Formula: O=CC1=C(F)C=CC(C)=C1F
BD182322
95+%
MFCD01631333
2,6-DIFLUORO-3-METHYLBENZAMIDE
CAS:261763-36-4
Formula: O=C(N)C1=C(F)C=CC(C)=C1F
BD182877
97%
2,6-DIFLUORO-3-METHYLBENZOIC ACID
CAS:32890-88-3
Formula: O=C(O)C1=C(F)C=CC(C)=C1F
BD68263
95+%
MFCD01631332
2,6-DIFLUORO-3-METHYLBENZONITRILE
CAS:886502-09-6
Formula: N#CC1=C(F)C=CC(C)=C1F
BD220370
97%
MFCD06660181
2,6-DIFLUORO-3-METHYLBENZOYL CHLORIDE
CAS:261763-39-7
Formula: O=C(Cl)C1=C(F)C=CC(C)=C1F
BD68264
95+%
MFCD01631334
2,6-DIFLUORO-3-METHYLPHENOL
CAS:261763-46-6
Formula: OC1=C(F)C=CC(C)=C1F
BD182879
95+%
MFCD01631340
2,6-DIFLUORO-3-METHYLPHENYLBORONIC ACID
CAS:1586045-40-0
Formula: OB(C1=C(F)C=CC(C)=C1F)O
BD326773
95+%
MFCD09265479
2,6-DIFLUORO-3-NITROANILINE
CAS:25892-09-5
Formula: NC1=C(F)C=CC([N+]([O-])=O)=C1F
BD217283
97%
2,6-DIFLUORO-3-NITROBENZALDEHYDE
CAS:606966-11-4
Formula: O=CC1=C(F)C=CC([N+]([O-])=O)=C1F
BD166341
97%
2,6-DIFLUORO-3-NITROBENZAMIDE
CAS:124169-54-6
Formula: O=C(N)C1=C(F)C=CC([N+]([O-])=O)=C1F
BD479089
97%
MFCD00120281
2,6-DIFLUORO-3-NITROBENZOIC ACID
CAS:83141-10-0
Formula: O=C(O)C1=C(F)C=CC([N+]([O-])=O)=C1F
BD68267
96%
MFCD00119291
2,6-DIFLUORO-3-NITROBENZONITRILE
CAS:143879-77-0
Formula: N#CC1=C(F)C=CC([N+]([O-])=O)=C1F
BD3999
98%
MFCD00042254
2,6-DIFLUORO-3-NITROBENZOYL CHLORIDE
CAS:260552-98-5
Formula: O=C(Cl)C1=C(F)C=CC([N+]([O-])=O)=C1F
BD307750
95+%
MFCD01571122
2,6-DIFLUORO-3-NITROPYRIDIN-4-AMINE
CAS:60186-20-1
Formula: NC1=C([N+]([O-])=O)C(F)=NC(F)=C1
BD248735
95+%
MFCD19690092
2,6-DIFLUORO-3-NITROPYRIDINE
CAS:58602-02-1
Formula: O=[N+](C1=CC=C(F)N=C1F)[O-]
BD230298
97%
2,6-DIFLUORO-3-PENTAFLUOROETHYL-PYRIDINE
CAS:1204234-54-7
Formula: FC(C1=CC=C(F)N=C1F)(F)C(F)(F)F
BD322642
95+%
MFCD23382209
2,6-DIFLUORO-3-TRIFLUOROMETHYLPYRIDINE
CAS:58584-98-8
Formula: FC(C1=CC=C(F)N=C1F)(F)F
BD308412
95+%
MFCD12546949
2,6-DIFLUORO-4-(1H-PYRAZOL-3-YL)PHENOL
CAS:1803574-06-2
Formula: OC1=C(F)C=C(C2=NNC=C2)C=C1F
BD437084
97%
MFCD29058992
2,6-DIFLUORO-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL) ANILINE
CAS:939968-08-8
Formula: NC1=C(F)C=C(B2OC(C)(C)C(C)(C)O2)C=C1F
BD336798
95+%
MFCD16996398
2,6-DIFLUORO-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL) BENZALDEHYDE
CAS:N/A
Formula: O=CC1=C(F)C=C(B2OC(C)(C)C(C)(C)O2)C=C1F
BD466672
97%
MFCD17215216
2,6-DIFLUORO-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL) BENZOIC ACID
CAS:1008119-07-0
Formula: CC1(C)OB(OC1(C)C)C1=CC(F)=C(C(O)=O)C(F)=C1
BD217800
98%
MFCD16996277
2,6-DIFLUORO-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL) BENZONITRILE
CAS:1003298-73-4
Formula: N#CC1=C(F)C=C(B2OC(C)(C)C(C)(C)O2)C=C1F
BD245280
97%
MFCD22419275
2,6-DIFLUORO-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL) PHENOL
CAS:1029439-83-5
Formula: OC1=C(F)C=C(B2OC(C)(C)C(C)(C)O2)C=C1F
BD490933
97%
MFCD16996286
2,6-DIFLUORO-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL) PYRIDINE
CAS:1204333-58-3
Formula: CC1(C)C(C)(C)OB(C2=CC(F)=NC(F)=C2)O1
BD232565
95+%
MFCD12913987
2,6-DIFLUORO-4-(METHYLSULFONYL)ANILINE
CAS:1147557-74-1
Formula: NC1=C(F)C=C(S(=O)(C)=O)C=C1F
BD337776
95+%
MFCD24642337
2,6-DIFLUORO-4-(TRIFLUOROMETHYL)ANILINE
CAS:123950-45-8
Formula: NC1=C(F)C=C(C(F)(F)F)C=C1F
BD469852
95%
MFCD20545747
2,6-DIFLUORO-4-(TRIFLUOROMETHYL)BENZALDEHYDE
CAS:134099-34-6
Formula: O=CC1=C(F)C=C(C(F)(F)F)C=C1F
BD294597
95+%
2,6-DIFLUORO-4-FORMYLBENZOIC ACID
CAS:1242070-98-9
Formula: O=C(O)C1=C(F)C=C(C=O)C=C1F
BD217558
95+%
2,6-DIFLUORO-4-FORMYLBENZONITRILE
CAS:433939-88-9
Formula: FC1=C(C#N)C(=CC(=C1)C=O)F
BD96570
98%
MFCD09263470
2,6-DIFLUORO-4-HYDRAZINYLPYRIDINE
CAS:837364-94-0
Formula: NNC1=CC(F)=NC(F)=C1
BD295482
97%
MFCD08436095
2,6-DIFLUORO-4-HYDROXYBENZALDEHYDE
CAS:532967-21-8
Formula: O=CC1=C(F)C=C(O)C=C1F
BD161921
98%
MFCD07772042
2,6-DIFLUORO-4-HYDROXYBENZAMIDE
CAS:1261825-32-4
Formula: O=C(N)C1=C(F)C=C(O)C=C1F
BD264625
95+%
MFCD18204748
2,6-DIFLUORO-4-HYDROXYBENZOHYDRAZIDE
CAS:1314928-16-9
Formula: O=C(NN)C1=C(F)C=C(O)C=C1F
BD264626
95+%
MFCD18204749
2,6-DIFLUORO-4-HYDROXYBENZOIC ACID
CAS:214917-68-7
Formula: O=C(O)C1=C(F)C=C(O)C=C1F
BD10287
95%
MFCD03094500
2,6-DIFLUORO-4-HYDROXYBENZONITRILE
CAS:123843-57-2
Formula: OC1=CC(F)=C(C#N)C(F)=C1
BD10203
98%
MFCD03094499
2,6-DIFLUORO-4-HYDROXYBENZYL ALCOHOL
CAS:438049-36-6
Formula: FC1=C(CO)C(=CC(=C1)O)F
BD209379
95%
MFCD11040173
2,6-DIFLUORO-4-IODOANILINE
CAS:141743-49-9
Formula: NC1=C(F)C=C(I)C=C1F
BD68272
97%
MFCD07774189
2,6-DIFLUORO-4-IODOBENZALDEHYDE
CAS:1160573-10-3
Formula: O=CC1=C(F)C=C(I)C=C1F
BD297276
97%
MFCD11845966
2,6-DIFLUORO-4-IODOBENZOIC ACID
CAS:1160575-07-4
Formula: O=C(O)C1=C(F)C=C(I)C=C1F
BD294598
95+%
2,6-DIFLUORO-4-IODOPHENOL
CAS:950858-06-7
Formula: OC1=C(F)C=C(I)C=C1F
BD313967
95+%
MFCD09907951
2,6-DIFLUORO-4-IODOPYRIDINE
CAS:685517-71-9
Formula: IC1=CC(F)=NC(F)=C1
BD222957
97%
n/a
2,6-DIFLUORO-4-METHOXYANILINE
CAS:151414-47-0
Formula: FC1=C(N)C(=CC(=C1)OC)F
BD159691
98%
MFCD04115922
2,6-DIFLUORO-4-METHOXYBENZALDEHYDE
CAS:256417-10-4
Formula: O=CC1=C(F)C=C(OC)C=C1F
BD5921
98%
MFCD04114368
2,6-DIFLUORO-4-METHOXYBENZAMIDE
CAS:125369-57-5
Formula: O=C(N)C1=C(F)C=C(OC)C=C1F
BD264622
95+%
MFCD03094497
2,6-DIFLUORO-4-METHOXYBENZOIC ACID
CAS:123843-65-2
Formula: O=C(O)C1=C(F)C=C(OC)C=C1F
BD68275
95+%
MFCD02949623
2,6-DIFLUORO-4-METHOXYPHENOL
CAS:886498-93-7
Formula: OC1=C(F)C=C(OC)C=C1F
BD309523
95+%
MFCD04115926
2,6-DIFLUORO-4-METHOXYPHENYLACETIC ACID
CAS:886498-98-2
Formula: FC1=C(C(=CC(=C1)OC)F)CC(=O)O
BD35321
97%
MFCD04115927
2,6-DIFLUORO-4-METHOXYPHENYLBORONIC ACID
CAS:406482-20-0
Formula: FC1=C(C(=CC(=C1)OC)F)B(O)O
BD161540
97+%
MFCD05664299
2,6-DIFLUORO-4-METHYLANILINE
CAS:1379028-84-8
Formula: CC1=CC(F)=C(N)C(F)=C1
BD213061
97%
2,6-DIFLUORO-4-METHYLBENZALDEHYDE
CAS:1201597-22-9
Formula: CC1=CC(F)=C(C=O)C(F)=C1
BD241092
95+%
2,6-DIFLUORO-4-METHYLBENZOIC ACID
CAS:1201597-23-0
Formula: CC1=CC(F)=C(C(O)=O)C(F)=C1
BD215290
98%
2,6-DIFLUORO-4-METHYLBENZONITRILE
CAS:1803792-98-4
Formula: N#CC1=C(F)C=C(C)C=C1F
BD486720
97%
MFCD28790316
2,6-DIFLUORO-4-METHYLPYRIDINE
CAS:885267-39-0
Formula: CC1=CC(F)=NC(F)=C1
BD481183
97%
MFCD13175503
2,6-DIFLUORO-4-MORPHOLINOBENZONITRILE
CAS:840481-30-3
Formula: N#CC1=C(F)C=C(N2CCOCC2)C=C1F
BD408260
95+%
MFCD19442761
2,6-DIFLUORO-4-NITROANILINE
CAS:23156-27-6
Formula: NC1=C(F)C=C(C=C1F)[N+]([O-])=O
BD68280
97%
MFCD03094274
2,6-DIFLUORO-4-NITROPHENOL
CAS:658-07-1
Formula: FC1=C(C(=CC(=C1)[N+](=O)[O-])F)O
BD22056
97%
MFCD07366521
2,6-DIFLUORO-4-PROPYLPHENOL
CAS:183244-98-6
Formula: OC1=C(F)C=C(CCC)C=C1F
BD330600
95+%
MFCD24727965
2,6-DIFLUORO-N,N-DIMETHYLBENZAMIDE
CAS:81652-57-5
Formula: O=C(N(C)C)C1=C(F)C=CC=C1F
BD327765
95+%
MFCD20356572
2,6-DIFLUORO-N-(2-NITROPHENYL)ANILINE
CAS:1033225-43-2
Formula: O=[N+](C1=CC=CC=C1NC2=C(F)C=CC=C2F)[O-]
BD231735
95+%
MFCD11865240
2,6-DIFLUORO-N-(4-(4-METHYL-1,2,5,6-TETRAHYDROPYRIDIN-3-YL)PHENYL)BENZAMIDE
CAS:1108684-91-8
Formula: O=C(NC1=CC=C(C2=C(C)CCNC2)C=C1)C3=C(F)C=CC=C3F
BD267118
95+%
MFCD16621149
2,6-DIFLUORO-N-(4-(4-METHYLPYRIDIN-3-YL)PHENYL)BENZAMIDE
CAS:1108684-81-6
Formula: O=C(NC1=CC=C(C2=C(C)C=CN=C2)C=C1)C3=C(F)C=CC=C3F
BD267117
95+%
MFCD16621147
2,6-DIFLUORO-N-(4-IODOPHENYL)BENZAMIDE
CAS:418801-29-3
Formula: O=C(NC1=CC=C(I)C=C1)C2=C(F)C=CC=C2F
BD267121
95+%
MFCD01469870
2,6-DIFLUORO-N-(OXIRAN-2-YLMETHYL) BENZAMIDE
CAS:1437457-78-7
Formula: O=C(NCC1OC1)C2=C(F)C=CC=C2F
BD617210
97%
2,6-DIFLUORO-N-(PIPERIDIN-4-YL)BENZAMIDE HYDROCHLORIDE
CAS:1016497-11-2
Formula: O=C(NC1CCNCC1)C2=C(F)C=CC=C2F.[H]Cl
BD569740
97%
2,6-DIFLUORO-N-HYDROXYBENZIMIDAMIDE
CAS:296766-98-8
Formula: N=C(NO)C1=C(F)C=CC=C1F
BD68311
97%
2,6-DIFLUORO-N-METHOXY-N-METHYLBENZAMIDE
CAS:937601-82-6
Formula: CON(C)C(=O)C1=C(F)C=CC=C1F
BD201459
95+%
MFCD08689758
2,6-DIFLUORO-N-METHYLANILINE
CAS:55847-14-8
Formula: CNC1=C(F)C=CC=C1F
BD243956
95+%
MFCD11178054
2,6-DIFLUORO-PHENOXYACETONITRILE
CAS:18062-97-0
Formula: N#CCOC1=C(F)C=CC=C1F
BD323403
95+%
MFCD09475445
2,6-DIFLUOROANILINE
CAS:5509-65-9
Formula: C1=CC=C(C(=C1F)N)F
BD9910
98%
MFCD00007655
2,6-DIFLUOROBENZALDEHYDE
CAS:437-81-0
Formula: C1=CC=C(C(=C1F)C=O)F
BD10284
98%
MFCD00010293
2,6-DIFLUOROBENZALDEHYDE OXIME
CAS:19064-16-5
Formula: FC1=C(C(F)=CC=C1)/C=N/O
BD68290
95+%
MFCD01764489
2,6-DIFLUOROBENZAMIDE
CAS:18063-03-1
Formula: O=C(N)C1=C(F)C=CC=C1F
BD10359
97%
MFCD00007972
2,6-DIFLUOROBENZENESULFONAMIDE
CAS:60230-37-7
Formula: O=S(C1=C(F)C=CC=C1F)(N)=O
BD68294
97%
MFCD00729101
2,6-DIFLUOROBENZIMIDAMIDE
CAS:762229-49-2
Formula: N=C(N)C1=C(F)C=CC=C1F
BD68292
95+%
MFCD05662968
2,6-DIFLUOROBENZIMIDAMIDE HYDROCHLORIDE
CAS:304867-43-4
Formula: N=C(N)C1=C(F)C=CC=C1F.[H]Cl
BD25046
95+%
MFCD04114427
2,6-DIFLUOROBENZOHYDRAZIDE
CAS:172935-91-0
Formula: O=C(NN)C1=C(F)C=CC=C1F
BD183085
97%
MFCD00119406
2,6-DIFLUOROBENZOIC ACID
CAS:385-00-2
Formula: O=C(O)C1=C(F)C=CC=C1F
BD7938
97%
MFCD00002411
2,6-DIFLUOROBENZONITRILE
CAS:1897-52-5
Formula: N#CC1=C(F)C=CC=C1F
BD19076
98%
MFCD00001778
2,6-DIFLUOROBENZYLAMINE
CAS:69385-30-4
Formula: NCC1=C(F)C=CC=C1F
BD10507
97%
MFCD00010144
2,6-DIFLUOROCINNAMIC ACID
CAS:152152-09-5
Formula: O=C(O)/C=C/C1=C(F)C=CC=C1F
BD68308
95+%
MFCD00010319
2,6-DIFLUOROISONICOTINIC ACID
CAS:88912-23-6
Formula: O=C(O)C1=CC(F)=NC(F)=C1
BD68282
97%
MFCD09864665
2,6-DIFLUORONICOTINALDEHYDE
CAS:155601-65-3
Formula: FC1=NC(=CC=C1C=O)F
BD68313
95+%
MFCD08277633
2,6-DIFLUORONICOTINIC ACID
CAS:171178-50-0
Formula: O=C(O)C1=C(F)N=C(F)C=C1
BD18837
95%
MFCD08064047
2,6-DIFLUOROPHENOL
CAS:28177-48-2
Formula: OC1=C(F)C=CC=C1F
BD3268
98%
MFCD00002158
2,6-DIFLUOROPHENYLACETIC ACID
CAS:85068-28-6
Formula: O=C(O)CC1=C(F)C=CC=C1F
BD5922
98%
MFCD00010001
2,6-DIFLUOROPHENYLACETYL CHLORIDE
CAS:116622-90-3
Formula: O=C(Cl)CC1=C(F)C=CC=C1F
BD322551
95+%
MFCD03424718
2,6-DIFLUOROPHENYLBORONIC ACID
CAS:162101-25-9
Formula: OB(C1=C(F)C=CC=C1F)O
BD9875
98%
MFCD00792436
2,6-DIFLUOROPHENYLHYDRAZINE HYDROCHLORIDE
CAS:502496-26-6
Formula: Cl.NNC1=C(F)C=CC=C1F
BD9959
96%
MFCD03094169
2,6-DIFLUOROPYRAZINE
CAS:33873-09-5
Formula: FC1N=C(F)C=NC=1
BD00757740
95+%
n/a
2,6-DIFLUOROPYRIDIN-3-AMINE
CAS:108118-69-0
Formula: NC1=CC=C(F)N=C1F
BD00753889
97%
MFCD13185331
2,6-DIFLUOROPYRIDIN-3-OL
CAS:209328-85-8
Formula: OC1=CC=C(F)N=C1F
BD217797
95+%
2,6-DIFLUOROPYRIDIN-4-AMINE
CAS:63489-58-7
Formula: NC1=CC(F)=NC(F)=C1
BD233377
97%
MFCD08436089
2,6-DIFLUOROPYRIDIN-4-OL
CAS:197717-50-3
Formula: OC1=CC(F)=NC(F)=C1
BD491153
97%
2,6-DIFLUOROPYRIDINE-3,4-DIAMINE
CAS:60186-25-6
Formula: NC1=C(N)C=C(F)N=C1F
BD248736
95+%
MFCD18384657
2,6-DIFLUOROPYRIDINE-3-BORONIC ACID
CAS:136466-94-9
Formula: OB(C1=CC=C(F)N=C1F)O
BD2579
98%
MFCD03788245
2,6-DIFLUOROPYRIMIDIN-4-AMINE
CAS:675-12-7
Formula: NC1=CC(F)=NC(F)=N1
BD9395
98%
MFCD00457061
2,6-DIFLUOROTEREPHTHALONITRILE
CAS:510772-86-8
Formula: N#CC1=C(F)C=C(C#N)C=C1F
BD489828
97%
2,6-DIFORMYLISONICOTINONITRILE
CAS:1393550-72-5
Formula: N#CC1=CC(C=O)=NC(C=O)=C1
BD304481
95+%
MFCD22545036
2,6-DIHYDROXY-3,4-DIMETHYLPYRIDINE
CAS:84540-47-6
Formula: CC1=C(C)C(O)=NC(O)=C1
BD10604
98%
MFCD05662686
2,6-DIHYDROXY-3-CYANOPYRIDINE
CAS:35441-10-2
Formula: N#CC1=CC=C(O)N=C1O
BD167510
95+%
MFCD11558977
2,6-DIHYDROXY-3-NITROBENZONITRILE
CAS:233585-04-1
Formula: N#CC1=C(O)C=CC([N+]([O-])=O)=C1O
BD4263
97%
2,6-DIHYDROXY-4-(TRIFLUOROMETHYL)NICOTINONITRILE
CAS:3335-46-4
Formula: N#CC1=C(O)N=C(O)C=C1C(F)(F)F
BD86258
95%
MFCD06200911
2,6-DIHYDROXY-4-METHYLBENZOIC ACID
CAS:480-67-1
Formula: CC1=CC(O)=C(C(O)=O)C(O)=C1
BD11150
95+%
MFCD00184686
2,6-DIHYDROXY-5-METHOXYPYRIMIDINE-4-CARBOXYLIC ACID
CAS:6944-35-0
Formula: O=C(C1=NC(O)=NC(O)=C1OC)O
BD279763
95+%
2,6-DIHYDROXYANTHRACENE-9,10-DIONE
CAS:84-60-6
Formula: O=C1C2=C(C=C(O)C=C2)C(C3=CC=C(O)C=C13)=O
BD68345
97%
2,6-DIHYDROXYBENZALDEHYDE
CAS:387-46-2
Formula: O=CC1=C(O)C=CC=C1O
BD220378
98%
MFCD08061915
2,6-DIHYDROXYBENZAMIDE
CAS:3147-50-0
Formula: O=C(N)C1=C(O)C=CC=C1O
BD4851
95+%
2,6-DIHYDROXYBENZOIC ACID
CAS:303-07-1
Formula: C1=C(C(=C(C=C1)O)C(O)=O)O
BD20083
97%
MFCD00002462
2,6-DIHYDROXYPYRIDINE-4-CARBOXAMIDE
CAS:14533-64-3
Formula: O=C(C1=CC(O)=NC(O)=C1)N
BD216108
95+%
2,6-DIHYDROXYPYRROLO[3,4-F]ISOINDOLE-1,3,5,7(2H,6H)-TETRAONE
CAS:57583-53-6
Formula: O=C1N(O)C(C2=C1C=C3C(C(N(O)C3=O)=O)=C2)=O
BD306338
95+%
n/a
2,6-DIIODO-3,5-DIMETHOXYPYRIDINE
CAS:1131335-49-3
Formula: COC1=C(I)N=C(I)C(OC)=C1
BD196323
97%
MFCD11857638
2,6-DIIODO-3-METHOXYPYRIDINE
CAS:437709-98-3
Formula: COC1=CC=C(I)N=C1I
BD196598
97%
MFCD11857683
2,6-DIIODO-4-(TRIFLUOROMETHYL)ANILINE
CAS:214400-66-5
Formula: NC1=C(I)C=C(C(F)(F)F)C=C1I
BD238984
95+%
MFCD11847372
2,6-DIIODO-4-(TRIFLUOROMETHYL)PHENOL
CAS:169255-50-9
Formula: OC1=C(I)C=C(C(F)(F)F)C=C1I
BD307485
95+%
MFCD20486163
2,6-DIIODO-4-(TRIFLUOROMETHYL)PYRIDINE
CAS:100366-76-5
Formula: FC(C1=CC(I)=NC(I)=C1)(F)F
BD270750
95+%
2,6-DIIODO-4-NITROANILINE
CAS:5398-27-6
Formula: NC1=C(I)C=C([N+]([O-])=O)C=C1I
BD3281
95+%
MFCD00007683
2,6-DIIODO-4-NITROPHENOL
CAS:305-85-1
Formula: OC1=C(I)C=C([N+]([O-])=O)C=C1I
BD3194
95+%
MFCD00007335
2,6-DIIODO-5-METHOXYPYRIDIN-3-OL
CAS:1087659-27-5
Formula: OC1=CC(OC)=C(I)N=C1I
BD196295
97%
MFCD11857637
2,6-DIIODO-7H-PURINE
CAS:98027-95-3
Formula: IC1=C2NC=NC2=NC(I)=N1
BD68360
95+%
MFCD09907813
2,6-DIIODOPYRAZINE
CAS:58138-79-7
Formula: IC1=NC(=CN=C1)I
BD159298
97%
MFCD09265492
2,6-DIIODOPYRIDIN-3-OL
CAS:14764-90-0
Formula: OC1=CC=C(I)N=C1I
BD196479
95+%
MFCD03265756
2,6-DIIODOPYRIDINE
CAS:53710-17-1
Formula: C1=CC=C(I)N=C1I
BD28979
95+%
MFCD07366728
2,6-DIISOPROPYL-4-NITROANILINE
CAS:163704-72-1
Formula: NC1=C(C(C)C)C=C([N+]([O-])=O)C=C1C(C)C
BD14222
95+%
MFCD03426208
2,6-DIISOPROPYL-4-PHENOXYANILINE
CAS:80058-85-1
Formula: NC1=C(C(C)C)C=C(OC2=CC=CC=C2)C=C1C(C)C
BD99869
97%
2,6-DIISOPROPYL-N-(PYRIDIN-2-YLMETHYLENE)ANILINE
CAS:149810-35-5
Formula: CC(C1=C(/N=C/C2=NC=CC=C2)C(C(C)C)=CC=C1)C
BD698633
97%
2,6-DIISOPROPYLANILINE
CAS:24544-04-5
Formula: NC1=C(C(C)C)C=CC=C1C(C)C
BD32845
97%
MFCD00008887
2,6-DIISOPROPYLBENZOIC ACID
CAS:92035-95-5
Formula: O=C(O)C1=C(C(C)C)C=CC=C1C(C)C
BD306051
95+%
n/a
2,6-DIISOPROPYLCYCLOHEXA-2,5-DIENE-1,4-DIONE
CAS:1988-11-0
Formula: O=C1C(C(C)C)=CC(C=C1C(C)C)=O
BD230962
95+%
MFCD18379392
2,6-DIISOPROPYLNAPHTHALENE
CAS:24157-81-1
Formula: CC(C1=CC2=CC=C(C(C)C)C=C2C=C1)C
BD68365
97%
MFCD00021648
2,6-DIISOPROPYLPHENYLBORONIC ACID
CAS:363166-79-4
Formula: OB(C1=C(C(C)C)C=CC=C1C(C)C)O
BD239423
95+%
MFCD16876786
2,6-DIMETHOXY-1,4-BENZOQUINONE
CAS:530-55-2
Formula: O=C1C(OC)=CC(C=C1OC)=O
BD6411
95+%
MFCD00016368
2,6-DIMETHOXY-1-ACETONYLQUINOL
CAS:2215-96-5
Formula: CC(CC(C(OC)=C1)(O)C(OC)=CC1=O)=O
BD228578
95+%
2,6-DIMETHOXY-3-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL) PYRIDINE
CAS:214360-59-5
Formula: COC1=CC=C(B2OC(C)(C)C(C)(C)O2)C(OC)=N1
BD2824
95+%
MFCD03788240
2,6-DIMETHOXY-3-NITROBENZOIC ACID
CAS:55776-17-5
Formula: O=C(O)C1=C(OC)C=CC([N+]([O-])=O)=C1OC
BD68377
95+%
MFCD00017324
2,6-DIMETHOXY-3-NITROPYRIDINE
CAS:18677-41-3
Formula: COC1=CC=C(C(OC)=N1)[N+]([O-])=O
BD4987
95+%
MFCD00832858
2,6-DIMETHOXY-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL) PYRIDINE
CAS:1150561-54-8
Formula: CC1(C)C(C)(C)OB(C2=CC(OC)=NC(OC)=C2)O1
BD261680
95+%
MFCD11855988
2,6-DIMETHOXY-4-HYDROXYBENZALDEHYDE
CAS:22080-96-2
Formula: O=CC1=C(OC)C=C(O)C=C1OC
BD6717
98%
MFCD01407645
2,6-DIMETHOXY-4-METHYLANILINE
CAS:54812-41-8
Formula: NC1=C(OC)C=C(C)C=C1OC
BD260333
95+%
MFCD20691380
2,6-DIMETHOXY-4-METHYLPHENOL
CAS:6638-05-7
Formula: COC1=CC(C)=CC(OC)=C1O
BD68382
97%
MFCD00017289
2,6-DIMETHOXY-5-NITROPYRIDIN-3-AMINE
CAS:96859-47-1
Formula: NC1=CC([N+]([O-])=O)=C(OC)N=C1OC
BD286493
95+%
MFCD18432624
2,6-DIMETHOXYANILINE
CAS:2734-70-5
Formula: C1=CC=C(C(=C1OC)N)OC
BD28242
97%
MFCD00053934
2,6-DIMETHOXYANILINE HYDROCHLORIDE
CAS:375397-36-7
Formula: NC1=C(OC)C=CC=C1OC.[H]Cl
BD230589
95+%
2,6-DIMETHOXYANTHRACENE
CAS:36319-03-6
Formula: COC1=CC2=CC3=CC=C(OC)C=C3C=C2C=C1
BD435006
95+%
n/a
2,6-DIMETHOXYBENZALDEHYDE
CAS:3392-97-0
Formula: O=CC1=C(OC)C=CC=C1OC
BD33277
98%
MFCD00010862
2,6-DIMETHOXYBENZENE-1,4-DIOL
CAS:15233-65-5
Formula: COC1=C(O)C(OC)=CC(O)=C1
BD68393
95+%
MFCD00017160
2,6-DIMETHOXYBENZIMIDAMIDE HYDROCHLORIDE
CAS:1171047-31-6
Formula: N=C(N)C1=C(OC)C=CC=C1OC.[H]Cl
BD286982
97%
MFCD04114428
2,6-DIMETHOXYBENZOIC ACID
CAS:1466-76-8
Formula: O=C(O)C1=C(OC)C=CC=C1OC
BD6718
98%
MFCD00002437
2,6-DIMETHOXYBENZONITRILE
CAS:16932-49-3
Formula: COC1=CC=CC(OC)=C1C#N
BD7785
98%
MFCD00001788
2,6-DIMETHOXYISONICOTINALDEHYDE
CAS:52606-01-6
Formula: COC1=CC(C=O)=CC(OC)=N1
BD21225
95+%
MFCD06410685
2,6-DIMETHOXYISONICOTINAMIDE
CAS:N/A
Formula: O=C(C1C=C(OC)N=C(OC)C=1)N
BD00792239
95%
2,6-DIMETHOXYISONICOTINIC ACID
CAS:6274-82-4
Formula: COC1=CC(=CC(OC)=N1)C(O)=O
BD238003
98%
MFCD18257556
2,6-DIMETHOXYISONICOTINONITRILE
CAS:1261269-80-0
Formula: N#CC1=CC(OC)=NC(OC)=C1
BD586508
97%
2,6-DIMETHOXYNAPHTHALENE
CAS:5486-55-5
Formula: COC1=CC2=CC=C(OC)C=C2C=C1
BD68395
98%
MFCD00004063
2,6-DIMETHOXYNICOTINIC ACID
CAS:16727-43-8
Formula: COC1=CC=C(C(O)=O)C(OC)=N1
BD32206
97%
MFCD00075582
2,6-DIMETHOXYNICOTINOYL CHLORIDE
CAS:95383-48-5
Formula: O=C(Cl)C1=C(OC)N=C(OC)C=C1
BD553047
97%
2,6-DIMETHOXYPHENOL
CAS:91-10-1
Formula: COC1=CC=CC(OC)=C1O
BD68397
98%
MFCD00064434
2,6-DIMETHOXYPHENYLBORONIC ACID
CAS:23112-96-1
Formula: OB(C1=C(OC)C=CC=C1OC)O
BD5278
98%
MFCD01318987
2,6-DIMETHOXYPYRAZINE
CAS:4774-15-6
Formula: COC1=CN=CC(OC)=N1
BD68401
98%
MFCD00955843
2,6-DIMETHOXYPYRIDIN-3-AMINE HYDROCHLORIDE
CAS:80789-72-6
Formula: COC1=CC=C(N)C(OC)=N1.[H]Cl
BD3800
95+%
MFCD00012816
2,6-DIMETHOXYPYRIDIN-3-OL
CAS:885963-28-0
Formula: OC1=CC=C(OC)N=C1OC
BD370276
95+%
MFCD06858697
2,6-DIMETHOXYPYRIDIN-3-YLBORONIC ACID
CAS:221006-70-8
Formula: OB(C1=CC=C(OC)N=C1OC)O
BD3772
97%
MFCD03788239
2,6-DIMETHOXYPYRIDINE
CAS:6231-18-1
Formula: COC1=CC=CC(OC)=N1
BD41869
98%
MFCD00006266
2,6-DIMETHOXYPYRIDINE-3,5-DIAMINE
CAS:85679-78-3
Formula: NC1=CC(N)=C(OC)N=C1OC
BD259498
95+%
MFCD09753474
2,6-DIMETHOXYPYRIDINE-3,5-DIAMINE HYDROCHLORIDE
CAS:169381-75-3
Formula: NC1=CC(N)=C(OC)N=C1OC.[H]Cl
BD233860
95+%
MFCD03939179
2,6-DIMETHOXYPYRIDINE-3,5-DIBORONIC ACID
CAS:1217501-25-1
Formula: OB(C1=CC(B(O)O)=C(OC)N=C1OC)O
BD325238
95+%
MFCD12756421
2,6-DIMETHOXYPYRIDINE-3-CARBOXALDEHYDE
CAS:58819-72-0
Formula: COC1=CC=C(C=O)C(OC)=N1
BD60602
98%
MFCD08064048
2,6-DIMETHOXYPYRIMIDINE-4-CARBONITRILE
CAS:N/A
Formula: N#CC1C=C(OC)N=C(OC)N=1
BD00771842
95%
2,6-DIMETHOXYPYRIMIDINE-4-CARBOXYLIC ACID
CAS:59864-30-1
Formula: O=C(C1=NC(OC)=NC(OC)=C1)O
BD10567
97%
MFCD01568105
2,6-DIMETHOXYQUINOLINE-3-CARBALDEHYDE
CAS:883549-54-0
Formula: O=CC1=CC2=CC(OC)=CC=C2N=C1OC
BD554692
97%
MFCD07364443
2,6-DIMETHYL 4-METHOXYPYRIDINE-2,6-DICARBOXYLATE
CAS:19872-93-6
Formula: O=C(C1=NC(C(OC)=O)=CC(OC)=C1)OC
BD326977
95+%
MFCD00957190
2,6-DIMETHYL(1,3-DIOXOLAN-2-YLMETHYL) BENZENE
CAS:898785-37-0
Formula: CC1=C(CC2OCCO2)C(C)=CC=C1
BD312967
95+%
MFCD08064184
2,6-DIMETHYL-[1,2,4]TRIAZOLO[1,5-A]PYRAZINE
CAS:N/A
Formula: CC1N=CC2=NC(=NN2C=1)C
BD00728613
95%
n/a
2,6-DIMETHYL-1,8-NAPHTHYRIDINE
CAS:14757-45-0
Formula: CC1=CN=C2N=C(C)C=CC2=C1
BD182214
97%
MFCD13563078
2,6-DIMETHYL-1-(1-(PHENYLTHIO)CYCLOPROPYL)CYCLOHEX-2-ENOL
CAS:1956334-14-7
Formula: CC1CCC=C(C)C1(O)C2(SC3=CC=CC=C3)CC2
BD441597
97%
MFCD27991658
2,6-DIMETHYL-1-(2-OXOPROPYL) QUINOLIN-4(1H)-ONE
CAS:1210792-62-3
Formula: O=C1C=C(C)N(CC(C)=O)C2=C1C=C(C)C=C2
BD607520
97%
2,6-DIMETHYL-1-(PIPERIDIN-2-YLMETHYL)PIPERIDINE
CAS:1005116-45-9
Formula: CC1CCCC(C)N1CC2NCCCC2
BD321375
95+%
MFCD06653469
2,6-DIMETHYL-1-PROPYL-1H-INDOLE-3-CARBALDEHYDE
CAS:1134334-36-3
Formula: O=CC1=C(C)N(CCC)C2=C1C=CC(C)=C2
BD177236
97%
MFCD12027449
2,6-DIMETHYL-1H-INDOLE
CAS:5649-36-5
Formula: CC1=CC2=C(C=C1)C=C(C)N2
BD218666
97%
MFCD04117975
2,6-DIMETHYL-1H-INDOLE 3-METHYLBENZOATE
CAS:1227267-30-2
Formula: CC1=CC2=C(C=C1)C=C(C)N2.CC3=CC=CC(C(O)=O)=C3
BD333693
95+%
MFCD16875998
2,6-DIMETHYL-1H-INDOLE-3-CARBALDEHYDE
CAS:728024-59-7
Formula: O=CC1=C(C)NC2=C1C=CC(C)=C2
BD172916
95+%
2,6-DIMETHYL-1H-INDOLE-3-CARBOXYLIC ACID
CAS:1227267-27-7
Formula: O=C(C1=C(C)NC2=C1C=CC(C)=C2)O
BD217059
95+%
MFCD16875909
2,6-DIMETHYL-1H-PYRROLO[2,3-B]PYRIDINE
CAS:1255099-47-8
Formula: CC1=CC=C2C(NC(C)=C2)=N1
BD247066
97%
MFCD17926420
2,6-DIMETHYL-1H-PYRROLO[3,2-C]PYRIDINE
CAS:1190315-37-7
Formula: CC1=CC(NC(C)=C2)=C2C=N1
BD333264
95+%
MFCD12963238
2,6-DIMETHYL-2'-METHOXYBENZOPHENONE
CAS:750633-52-4
Formula: O=C(C1=CC=CC=C1OC)C2=C(C)C=CC=C2C
BD309063
95+%
MFCD01311512
2,6-DIMETHYL-2'-MORPHOLINOMETHYL BENZOPHENONE
CAS:898750-53-3
Formula: O=C(C1=CC=CC=C1CN2CCOCC2)C3=C(C)C=CC=C3C
BD309953
95+%
MFCD03842426
2,6-DIMETHYL-2'-PIPERIDINOMETHYL BENZOPHENONE
CAS:898773-30-3
Formula: O=C(C1=CC=CC=C1CN2CCCCC2)C3=C(C)C=CC=C3C
BD311882
95+%
MFCD03842483
2,6-DIMETHYL-2'-PYRROLIDINOMETHYL BENZOPHENONE
CAS:898774-63-5
Formula: O=C(C1=CC=CC=C1CN2CCCC2)C3=C(C)C=CC=C3C
BD311966
95+%
MFCD03842540
2,6-DIMETHYL-2'-THIOMORPHOLINOMETHYL BENZOPHENONE
CAS:898781-88-9
Formula: O=C(C1=CC=CC=C1CN2CCSCC2)C3=C(C)C=CC=C3C
BD312653
95+%
MFCD03842767
2,6-DIMETHYL-2,5-HEPTADIEN-4-ONE
CAS:504-20-1
Formula: CC(=CC(C=C(C)C)=O)C
BD68417
98%
MFCD00008901
2,6-DIMETHYL-2H-BENZO[B][1,4]OXAZIN-3(4H)-ONE
CAS:17959-90-9
Formula: O=C1NC2=CC(C)=CC=C2OC1C
BD68418
95+%
MFCD01833988
2,6-DIMETHYL-3'-(1,3-DIOXOLAN-2-YL) BENZOPHENONE
CAS:898779-39-0
Formula: O=C(C1=CC=CC(C2OCCO2)=C1)C3=C(C)C=CC=C3C
BD312413
95+%
MFCD07699969
2,6-DIMETHYL-3'-METHOXYBENZOPHENONE
CAS:750633-72-8
Formula: O=C(C1=CC=CC(OC)=C1)C2=C(C)C=CC=C2C
BD309081
95+%
MFCD01311544
2,6-DIMETHYL-3'-MORPHOLINOMETHYL BENZOPHENONE
CAS:898765-62-3
Formula: O=C(C1=CC=CC(CN2CCOCC2)=C1)C3=C(C)C=CC=C3C
BD311195
95+%
MFCD03841917
2,6-DIMETHYL-3'-PIPERIDINOMETHYL BENZOPHENONE
CAS:898793-17-4
Formula: O=C(C1=CC=CC(CN2CCCCC2)=C1)C3=C(C)C=CC=C3C
BD313701
95+%
MFCD03841974
2,6-DIMETHYL-3'-PYRROLIDINOMETHYL BENZOPHENONE
CAS:898770-43-9
Formula: O=C(C1=CC=CC(CN2CCCC2)=C1)C3=C(C)C=CC=C3C
BD311655
95+%
MFCD03842031
2,6-DIMETHYL-3'-THIOMORPHOLINOMETHYL BENZOPHENONE
CAS:898763-19-4
Formula: O=C(C1=CC=CC(CN2CCSCC2)=C1)C3=C(C)C=CC=C3C
BD310953
95+%
MFCD03842256
2,6-DIMETHYL-3,4-DIHYDRO-2H-1,4-BENZOXAZINE
CAS:58959-93-6
Formula: CC1=CC=C(OC(C)CN2)C2=C1
BD327498
95+%
MFCD11603425
2,6-DIMETHYL-3,7-OCTADIENE-2,6-DIOL
CAS:51276-34-7
Formula: CC(O)(C)/C=C/CC(O)(C)C=C
BD235876
95+%
2,6-DIMETHYL-3-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL) PYRIDINE
CAS:693774-10-6
Formula: CC1=CC=C(B2OC(C)(C)C(C)(C)O2)C(C)=N1
BD213114
95+%
MFCD13195066
2,6-DIMETHYL-3-(METHYLSULFONYL)ANILINE
CAS:10311-40-7
Formula: NC1=C(C)C=CC(S(=O)(C)=O)=C1C
BD11382
95+%
MFCD04037921
2,6-DIMETHYL-3-(METHYLTHIO)-1H-PYRROLO[2,3-B]PYRIDINE
CAS:850785-43-2
Formula: CSC1=C(C)NC2=NC(C)=CC=C21
BD335503
95+%
MFCD17926421
2,6-DIMETHYL-3-(PYRROLIDIN-1-YL)ANILINE
CAS:1056963-14-4
Formula: CC1=CC=C(N2CCCC2)C(C)=C1N
BD332604
95+%
MFCD17926233
2,6-DIMETHYL-3-HYDROXYPYRIDINE
CAS:1122-43-6
Formula: OC1=CC=C(C)N=C1C
BD10596
98%
MFCD00228692
2,6-DIMETHYL-3-MORPHOLINOANILINE
CAS:1138341-41-9
Formula: CC1=CC=C(N2CCOCC2)C(C)=C1N
BD332927
95+%
MFCD17926234
2,6-DIMETHYL-3-NITROANILINE
CAS:67083-28-7
Formula: NC1=C(C)C=CC([N+]([O-])=O)=C1C
BD234739
97%
MFCD00156348
2,6-DIMETHYL-3-NITROBENZOIC ACID
CAS:6307-70-6
Formula: O=C(O)C1=C(C)C=CC([N+]([O-])=O)=C1C
BD457910
97%
MFCD09260790
2,6-DIMETHYL-3-NITROISONICOTINIC ACID
CAS:89977-02-6
Formula: O=C(O)C1=CC(C)=NC(C)=C1[N+]([O-])=O
BD249011
95+%
2,6-DIMETHYL-3-NITROPYRIDIN-4-AMINE
CAS:18232-98-9
Formula: NC1=C([N+]([O-])=O)C(C)=NC(C)=C1
BD254859
95+%
MFCD13186748
2,6-DIMETHYL-3-NITROPYRIDIN-4-OL
CAS:13603-45-7
Formula: OC1=C([N+]([O-])=O)C(C)=NC(C)=C1
BD230331
97%
2,6-DIMETHYL-3-O-METHYL-4-(2-METHYLBUTYRYL)PHLOROGLUCINOL
CAS:97761-91-6
Formula: N/A
BD298920
95+%
2,6-DIMETHYL-3-OXO-3,4-DIHYDRO-2H-BENZO[B][1,4]OXAZINE-7-SULFONYL CHLORIDE
CAS:1171749-11-3
Formula: O=S(=O)(Cl)C1C=C2OC(C(=O)NC2=CC=1C)C
BD00727401
95%
MFCD14281369
2,6-DIMETHYL-3-PHENYLPYRIMIDIN-4(3H)-ONE
CAS:32363-53-4
Formula: O=C1N(C2=CC=CC=C2)C(C)=NC(C)=C1
BD441598
97%
MFCD27991659
2,6-DIMETHYL-4'-(1,3-DIOXOLAN-2-YL) BENZOPHENONE
CAS:898760-25-3
Formula: O=C(C1=CC=C(C2OCCO2)C=C1)C3=C(C)C=CC=C3C
BD310742
95+%
MFCD07700020
2,6-DIMETHYL-4'-(TRIFLUOROMETHYL)-[1,1'-BIPHENYL]-4-OL
CAS:872258-58-7
Formula: OC1=CC(C)=C(C2=CC=C(C(F)(F)F)C=C2)C(C)=C1
BD249766
95+%
MFCD09907917
2,6-DIMETHYL-4'-METHOXYBENZOPHENONE
CAS:52629-41-1
Formula: O=C(C1=CC=C(OC)C=C1)C2=C(C)C=CC=C2C
BD308295
95+%
MFCD01311574
2,6-DIMETHYL-4'-MORPHOLINOMETHYL BENZOPHENONE
CAS:898770-11-1
Formula: O=C(C1=CC=C(CN2CCOCC2)C=C1)C3=C(C)C=CC=C3C
BD311623
95+%
MFCD03841405
2,6-DIMETHYL-4'-PIPERIDINOMETHYL BENZOPHENONE
CAS:898775-08-1
Formula: O=C(C1=CC=C(CN2CCCCC2)C=C1)C3=C(C)C=CC=C3C
BD312010
95+%
MFCD03841462
2,6-DIMETHYL-4'-PYRROLIDINOMETHYL BENZOPHENONE
CAS:898776-49-3
Formula: O=C(C1=CC=C(CN2CCCC2)C=C1)C3=C(C)C=CC=C3C
BD312145
95+%
MFCD03841519
2,6-DIMETHYL-4'-THIOMORPHOLINOMETHYL BENZOPHENONE
CAS:898782-77-9
Formula: O=C(C1=CC=C(CN2CCSCC2)C=C1)C3=C(C)C=CC=C3C
BD312722
95+%
MFCD03841746
2,6-DIMETHYL-4,5-DIHYDROPYRIDAZIN-3(2H)-ONE
CAS:39998-27-1
Formula: O=C1CCC(C)=NN1C
BD281470
95+%
MFCD00828685
2,6-DIMETHYL-4-(2-NITRO-4-(TRIFLUOROMETHYL)PHENYL)MORPHOLINE
CAS:405910-36-3
Formula: FC(C1=CC=C(N2CC(C)OC(C)C2)C([N+]([O-])=O)=C1)(F)F
BD495904
97%
MFCD02018696
2,6-DIMETHYL-4-(2-PYRROLIDINYLMETHYL)PYRIDINE
CAS:881041-84-5
Formula: CC1=CC(CC2NCCC2)=CC(C)=N1
BD327921
95+%
MFCD06653523
2,6-DIMETHYL-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL) ANILINE
CAS:1004761-68-5
Formula: NC1=C(C)C=C(B2OC(C)(C)C(C)(C)O2)C=C1C
BD229348
95+%
2,6-DIMETHYL-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL) BENZONITRILE
CAS:1111096-09-3
Formula: N#CC1=C(C)C=C(B2OC(C)(C)C(C)(C)O2)C=C1C
BD488024
97%
MFCD12405371
2,6-DIMETHYL-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL) PHENOL
CAS:269410-25-5
Formula: OC1=C(C)C=C(B2OC(C)(C)C(C)(C)O2)C=C1C
BD5627
95+%
MFCD02093724
2,6-DIMETHYL-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL) PYRIDINE
CAS:325142-95-8
Formula: CC1(C)C(C)(C)OB(C2=CC(C)=NC(C)=C2)O1
BD226550
95%
2,6-DIMETHYL-4-(4-NITROBENZYL)MORPHOLINE
CAS:415719-74-3
Formula: O=[N+](C1=CC=C(C=C1)CN2CC(C)OC(C)C2)[O-]
BD509409
97%
MFCD00978378
2,6-DIMETHYL-4-(4-NITROPHENYL)MORPHOLINE
CAS:N/A
Formula: O=[N+](C1=CC=C(N2CC(C)OC(C)C2)C=C1)[O-]
BD200760
95+%
2,6-DIMETHYL-4-(5-NITROPYRIDIN-2-YL)MORPHOLINE
CAS:260447-04-9
Formula: CC1CN(CC(C)O1)C1=NC=C(C=C1)[N+]([O-])=O
BD237763
97%
MFCD00118337
2,6-DIMETHYL-4-(METHYLTHIO)PHENOL
CAS:7379-49-9
Formula: OC1=C(C)C=C(SC)C=C1C
BD509999
97%
MFCD00020052
2,6-DIMETHYL-4-(MORPHOLINOMETHYL)PHENOL
CAS:21894-01-9
Formula: OC1=C(C)C=C(CN2CCOCC2)C=C1C
BD68431
97%
2,6-DIMETHYL-4-(NAPHTHALEN-1-YL)PYRIDINE-3,5-DICARBOXYLIC ACID
CAS:94301-28-7
Formula: O=C(C1=C(C2=C3C=CC=CC3=CC=C2)C(C(O)=O)=C(C)N=C1C)O
BD509782
97%
MFCD12972436
2,6-DIMETHYL-4-(PENTYLOXY) BENZALDEHYDE
CAS:1443349-67-4
Formula: O=CC1=C(C)C=C(OCCCCC)C=C1C
BD593129
97%
2,6-DIMETHYL-4-(PENTYLOXY) BENZENETHIOL
CAS:1443311-20-3
Formula: SC1=C(C)C=C(OCCCCC)C=C1C
BD592975
97%
2,6-DIMETHYL-4-(PIPERIDIN-4-YL)MORPHOLINE
CAS:436099-87-5
Formula: CC1OC(C)CN(C2CCNCC2)C1
BD68452
97%
2,6-DIMETHYL-4-(TETRAHYDRO-2H-PYRAN-4-YL)PYRIDINE
CAS:27328-13-8
Formula: CC1=CC(C2CCOCC2)=CC(C)=N1
BD593881
97%
MFCD06637462
2,6-DIMETHYL-4-(THIOPHEN-2-YL)PYRIDINE
CAS:50581-77-6
Formula: CC1=CC(C2=CC=CS2)=CC(C)=N1
BD629781
97%
2,6-DIMETHYL-4-FLUOROBENZOIC ACID
CAS:16633-50-4
Formula: O=C(O)C1=C(C)C=C(F)C=C1C
BD160462
98%
2,6-DIMETHYL-4-METHOXYBENZOIC ACID
CAS:37934-89-7
Formula: COC1=CC(C)=C(C(O)=O)C(C)=C1
BD161284
98%
MFCD01194287
2,6-DIMETHYL-4-NITROANILINE
CAS:16947-63-0
Formula: CC1=CC(=CC(C)=C1N)[N+]([O-])=O
BD69296
97%
MFCD02093072
2,6-DIMETHYL-4-NITROBENZOIC ACID
CAS:90564-17-3
Formula: O=C(O)C1=C(C)C=C([N+]([O-])=O)C=C1C
BD463965
97%
2,6-DIMETHYL-4-NITROPHENOL
CAS:2423-71-4
Formula: OC1=C(C)C=C([N+]([O-])=O)C=C1C
BD11205
98%
MFCD00007339
2,6-DIMETHYL-4-NITROPYRIDINE
CAS:4913-57-9
Formula: CC1=CC(=CC(C)=N1)[N+]([O-])=O
BD236956
97%
MFCD00234324
2,6-DIMETHYL-4-OXO-1,4-DIHYDROPYRIDINE-3-CARBOXYLIC ACID
CAS:52403-25-5
Formula: O=C(C1=C(C)NC(C)=CC1=O)O
BD279305
95+%
2,6-DIMETHYL-4-PHENYLPYRIDINE
CAS:3044-71-1
Formula: CC1=CC(C2=CC=CC=C2)=CC(C)=N1
BD629782
97%
2,6-DIMETHYL-4-PROPOXYBENZALDEHYDE
CAS:100256-36-8
Formula: O=CC1=C(C)C=C(OCCC)C=C1C
BD588106
97%
2,6-DIMETHYL-4-PROPOXYBENZOIC ACID
CAS:100256-91-5
Formula: O=C(O)C1=C(C)C=C(OCCC)C=C1C
BD588107
97%
2,6-DIMETHYL-4H-BENZO[D][1,3]OXAZIN-4-ONE
CAS:62175-49-9
Formula: O=C1OC(C)=NC2=CC=C(C)C=C12
BD212182
95+%
MFCD00115483
2,6-DIMETHYL-4H-PYRAN-4-ONE
CAS:1004-36-0
Formula: O=C1C=C(C)OC(C)=C1
BD68481
95%
MFCD00006579
2,6-DIMETHYL-4H-PYRIDO[1,2-A]PYRIMIDIN-4-ONE
CAS:16867-28-0
Formula: O=C1C=C(C)N=C2N1C(C)=CC=C2
BD336409
95+%
MFCD03369387
2,6-DIMETHYL-5-OXO-5,6-DIHYDRO-1,6-NAPHTHYRIDINE-3-CARBOXYLIC ACID
CAS:1432334-25-2
Formula: O=C(C1=CC2=C(N=C1C)C=CN(C)C2=O)O
BD617003
97%
2,6-DIMETHYL-7-OCTENE-2,3,6-TRIOL
CAS:73815-21-1
Formula: CC(O)(C)C(O)CCC(O)(C)C=C
BD235939
95+%
2,6-DIMETHYL-7-OXO-6,7-DIHYDRO-1H-PYRROLO[2,3-C]PYRIDINE-3-CARBOXYLIC ACID
CAS:1956327-94-8
Formula: O=C(C1=C(C)NC2=C1C=CN(C)C2=O)O
BD442985
97%
MFCD28405299
2,6-DIMETHYL-8-(PENTAN-3-YL)IMIDAZO[1,2-B]PYRIDAZINE
CAS:910552-63-5
Formula: CCC(C1=CC(C)=NN2C1=NC(C)=C2)CC
BD239036
95+%
MFCD12923363
2,6-DIMETHYL-9H-FLUOREN-9-ONE
CAS:21436-48-6
Formula: O=C1C2=C(C3=C1C=CC(C)=C3)C=CC(C)=C2
BD379890
95+%
MFCD28976614
2,6-DIMETHYL-N-(3-(TRIFLUOROMETHYL)PHENYL)ANILINE
CAS:949161-11-9
Formula: FC(C1=CC(NC2=C(C)C=CC=C2C)=CC=C1)(F)F
BD252557
95+%
MFCD18207282
2,6-DIMETHYL-N-(O-TOLYL)ANILINE
CAS:68014-57-3
Formula: CC1=CC=CC=C1NC2=C(C)C=CC=C2C
BD252558
95+%
MFCD18207291
2,6-DIMETHYL-N-(P-TOLYL)ANILINE
CAS:24542-61-8
Formula: CC1=CC=C(NC2=C(C)C=CC=C2C)C=C1
BD252559
95+%
MFCD18207297
2,6-DIMETHYLANILINE HYDROCHLORIDE
CAS:21436-98-6
Formula: NC1=C(C)C=CC=C1C.[H]Cl
BD68460
96%
MFCD00060213
2,6-DIMETHYLBENZALDEHYDE
CAS:1123-56-4
Formula: CC1=C(C=O)C(=CC=C1)C
BD6654
95%
MFCD00128003
2,6-DIMETHYLBENZAMIDE
CAS:55321-98-7
Formula: O=C(N)C1=C(C)C=CC=C1C
BD68463
97%
2,6-DIMETHYLBENZENE-1,4-DIAMINE
CAS:7218-02-2
Formula: CC1=CC(N)=CC(C)=C1N
BD233382
95+%
MFCD02752808
2,6-DIMETHYLBENZENE-1,4-DIAMINE DIHYDROCHLORIDE
CAS:56496-89-0
Formula: NC1=C(C)C=C(N)C=C1C.[H]Cl.[H]Cl
BD261059
95+%
MFCD18973468
2,6-DIMETHYLBENZENESULFONAMIDE
CAS:24010-56-8
Formula: O=S(C1=C(C)C=CC=C1C)(N)=O
BD530436
97%
2,6-DIMETHYLBENZO[1,2-D:4,5-D']BIS(THIAZOLE)
CAS:13399-12-7
Formula: CC1=NC(C=C(SC(C)=N2)C2=C3)=C3S1
BD370613
95+%
MFCD07161751
2,6-DIMETHYLBENZO[D]THIAZOL-5-AMINE
CAS:98953-72-1
Formula: NC1=C(C)C=C(SC(C)=N2)C2=C1
BD226165
97%
2,6-DIMETHYLBENZO[D]THIAZOLE
CAS:2941-71-1
Formula: CC1=NC2=C(S1)C=C(C)C=C2
BD236611
95+%
MFCD00022880
2,6-DIMETHYLBENZOIC ACID
CAS:632-46-2
Formula: O=C(O)C1=C(C)C=CC=C1C
BD11241
98%
MFCD00002483
2,6-DIMETHYLBENZONITRILE
CAS:6575-13-9
Formula: C1=C(C(=C(C=C1)C)C#N)C
BD7746
98%
MFCD00037166
2,6-DIMETHYLBENZOTRIFLUORIDE
CAS:41818-96-6
Formula: FC(F)(F)C1=C(C)C=CC=C1C
BD308110
95+%
MFCD14525527
2,6-DIMETHYLBENZOYL CHLORIDE
CAS:21900-37-8
Formula: O=C(Cl)C1=C(C)C=CC=C1C
BD307665
95+%
MFCD00052854
2,6-DIMETHYLBENZYLAMINE
CAS:74788-82-2
Formula: CC1=CC=CC(C)=C1CN
BD68474
98%
MFCD01310814
2,6-DIMETHYLBROMOBENZENE
CAS:576-22-7
Formula: C1=CC=C(C(=C1C)Br)C
BD41810
98%
MFCD00000075
2,6-DIMETHYLCYCLOHEXA-2,5-DIENE-1,4-DIONE
CAS:527-61-7
Formula: CC1=CC(=O)C=C(C)C1=O
BD6379
98%
MFCD00001605
2,6-DIMETHYLCYCLOHEXANOL
CAS:5337-72-4
Formula: OC1C(C)CCCC1C
BD68476
95+%
MFCD00001502
2,6-DIMETHYLHEPT-5-ENAL
CAS:106-72-9
Formula: C/C(C)=C/CCC(C)C=O
BD68454
95+%
MFCD00006981
2,6-DIMETHYLHEPTAN-2-OL
CAS:13254-34-7
Formula: CC(O)(C)CCCC(C)C
BD68419
98%
MFCD00072198
2,6-DIMETHYLHEPTAN-4-AMINE
CAS:65530-92-9
Formula: CC(C)CC(N)CC(C)C
BD227352
95+%
MFCD00048359
2,6-DIMETHYLHEPTAN-4-OL
CAS:108-82-7
Formula: CC(C)CC(O)CC(C)C
BD68435
85%
MFCD00008944
2,6-DIMETHYLHEPTANE-2,4-DIOL
CAS:73264-93-4
Formula: CC(O)(C)CC(O)CC(C)C
BD335210
95+%
MFCD28362046
2,6-DIMETHYLHYDROQUINONE
CAS:654-42-2
Formula: OC1=C(C)C=C(O)C=C1C
BD68483
97%
MFCD00016466
2,6-DIMETHYLIMIDAZO[1,2-A]PYRAZINE-3-CARBOXYLIC ACID
CAS:190381-50-1
Formula: O=C(C1=C(C)N=C2C=NC(C)=CN21)O
BD587403
97%
2,6-DIMETHYLIMIDAZO[1,2-A]PYRIDIN-3-AMINE
CAS:1216104-44-7
Formula: NC1=C(C)N=C2C=CC(C)=CN21
BD586286
97%
2,6-DIMETHYLIMIDAZO[1,2-A]PYRIDINE-3-CARBALDEHYDE
CAS:728864-60-6
Formula: O=CC1=C(C)N=C2C=CC(C)=CN21
BD0040
95+%
n/a
2,6-DIMETHYLIMIDAZO[1,2-A]PYRIDINE-3-CARBOXYLIC ACID
CAS:81438-52-0
Formula: O=C(C1=C(C)N=C2C=CC(C)=CN21)O
BD278614
95+%
2,6-DIMETHYLIMIDAZO[1,2-A]PYRIMIDINE-3-CARBOXYLIC ACID
CAS:1335052-44-2
Formula: O=C(C1=C(C)N=C2N=CC(C)=CN21)O
BD289794
95+%
MFCD20661163
2,6-DIMETHYLIMIDAZO[1,2-B]PYRIDAZIN-3-AMINE
CAS:1936272-20-6
Formula: NC1=C(C)N=C2C=CC(C)=NN21
BD755497
97%
2,6-DIMETHYLIMIDAZO[1,2-B]PYRIDAZINE
CAS:17412-39-4
Formula: CC1=NN2C(C=C1)=NC(C)=C2
BD68484
95+%
n/a
2,6-DIMETHYLIMIDAZO[1,2-C]PYRIMIDIN-5(6H)-ONE
CAS:57491-47-1
Formula: O=C1N2C(C=CN1C)=NC(C)=C2
BD271025
95+%
MFCD21336451
2,6-DIMETHYLISONICOTINALDEHYDE
CAS:18206-06-9
Formula: O=CC1=CC(C)=NC(C)=C1
BD68509
95+%
MFCD06410687
2,6-DIMETHYLISONICOTINAMIDE
CAS:113708-04-6
Formula: O=C(N)C1=CC(C)=NC(C)=C1
BD294308
95+%
2,6-DIMETHYLISONICOTINIC ACID
CAS:54221-93-1
Formula: CC1=CC(=CC(C)=N1)C(O)=O
BD68486
98%
MFCD03731176
2,6-DIMETHYLISONICOTINIC ACID HYDROCHLORIDE
CAS:857363-49-6
Formula: O=C(O)C1=CC(C)=NC(C)=C1.[H]Cl
BD219227
95+%
MFCD17171377
2,6-DIMETHYLISONICOTINIMIDAMIDE
CAS:913240-33-2
Formula: N=C(N)C1=CC(C)=NC(C)=C1
BD751699
97%
2,6-DIMETHYLISONICOTINIMIDAMIDE HYDROCHLORIDE
CAS:N/A
Formula: N=C(C1C=C(C)N=C(C)C=1)N.[H]Cl
BD00745948
95%
n/a
2,6-DIMETHYLISONICOTINONITRILE
CAS:39965-81-6
Formula: N#CC1=CC(C)=NC(C)=C1
BD68434
97%
2,6-DIMETHYLMORPHOLINE HYDROCHLORIDE
CAS:80567-00-6
Formula: CC1OC(C)CNC1.[H]Cl
BD283915
95+%
2,6-DIMETHYLNAPHTHALENE
CAS:581-42-0
Formula: CC1=CC2=CC=C(C)C=C2C=C1
BD68489
97%
MFCD00004120
2,6-DIMETHYLNICOTINIC ACID
CAS:5860-71-9
Formula: O=C(O)C1=C(C)N=C(C)C=C1
BD29157
95+%
MFCD06738677
2,6-DIMETHYLPHENYL 2-((3-CYANO-4,6-DIPHENYLPYRIDIN-2-YL)THIO)ACETATE
CAS:336173-47-8
Formula: O=C(OC1=C(C)C=CC=C1C)CSC2=NC(C3=CC=CC=C3)=CC(C4=CC=CC=C4)=C2C#N
BD595406
97%
MFCD01541880
2,6-DIMETHYLPHENYL 2-((5-(2-CHLOROPHENYL)-1,3,4-OXADIAZOL-2-YL)THIO)ACETATE
CAS:332126-69-9
Formula: O=C(OC1=C(C)C=CC=C1C)CSC2=NN=C(C3=CC=CC=C3Cl)O2
BD594589
97%
MFCD01817973
2,6-DIMETHYLPHENYLHYDRAZINE HYDROCHLORIDE
CAS:2538-61-6
Formula: [H+].C1=CC=C(C(=C1C)NN)C.[Cl-]
BD41506
97%
MFCD01861265
2,6-DIMETHYLPIPERAZINE
CAS:108-49-6
Formula: CC1CNCC(C)N1
BD3036
98%
MFCD07772435
2,6-DIMETHYLPIPERAZINE DIHYDROCHLORIDE
CAS:98618-52-1
Formula: CC1CNCC(C)N1.[H]Cl.[H]Cl
BD297637
95+%
MFCD12025404
2,6-DIMETHYLPIPERIDIN-4-OL
CAS:4733-70-4
Formula: OC1CC(C)NC(C)C1
BD68441
95+%
MFCD00771653
2,6-DIMETHYLPIPERIDIN-4-ONE
CAS:45717-87-1
Formula: O=C1CC(C)NC(C)C1
BD284960
95+%
MFCD08703343
2,6-DIMETHYLPIPERIDIN-4-ONE HYDROCHLORIDE
CAS:1005397-62-5
Formula: O=C1CC(C)NC(C)C1.[H]Cl
BD252560
95+%
MFCD11656348
2,6-DIMETHYLPIPERIDINE-4-CARBOXYLIC ACID
CAS:1330752-22-1
Formula: O=C(C1CC(C)NC(C)C1)O
BD291420
95+%
2,6-DIMETHYLPYRIDIN-3-AMINE
CAS:3430-33-9
Formula: NC1=CC=C(C)N=C1C
BD3778
98%
MFCD01646409
2,6-DIMETHYLPYRIDIN-3-YLBORONIC ACID
CAS:693774-55-9
Formula: CC1=CC=C(B(O)O)C(C)=N1
BD68507
95%
MFCD07437925
2,6-DIMETHYLPYRIDIN-4(1H)-ONE
CAS:7516-31-6
Formula: O=C1C=C(C)NC(C)=C1
BD219228
95+%
n/a
2,6-DIMETHYLPYRIDIN-4-AMINE
CAS:3512-80-9
Formula: NC1=CC(C)=NC(C)=C1
BD25053
97%
MFCD00130078
2,6-DIMETHYLPYRIDIN-4-OL
CAS:13603-44-6
Formula: CC1=CC(C=C(C)N1)=O
BD7940
95+%
MFCD00956021
2,6-DIMETHYLPYRIDINE-3,4-DIAMINE
CAS:3726-26-9
Formula: NC1=C(N)C=C(C)N=C1C
BD254860
95+%
MFCD13176241
2,6-DIMETHYLPYRIDINE-3,4-DICARBOXYLIC ACID
CAS:13602-84-1
Formula: O=C(C1=C(C(O)=O)C=C(C)N=C1C)O
BD614295
97%
2,6-DIMETHYLPYRIDINE-3-CARBALDEHYDE
CAS:650141-20-1
Formula: CC1=CC=C(C=O)C(C)=N1
BD29317
97%
MFCD03265780
2,6-DIMETHYLPYRIDINE-4-SULFONYL CHLORIDE
CAS:1025509-76-5
Formula: O=S(C1=CC(C)=NC(C)=C1)(Cl)=O
BD585149
97%
MFCD10700202
2,6-DIMETHYLPYRIMIDIN-4-AMINE
CAS:461-98-3
Formula: CC1=NC(C)=NC(N)=C1
BD20915
98%
MFCD00006106
2,6-DIMETHYLPYRIMIDIN-4-AMINE HYDROCHLORIDE
CAS:79091-25-1
Formula: NC1=NC(C)=NC(C)=C1.[H]Cl
BD280077
95+%
2,6-DIMETHYLPYRIMIDIN-4-OL
CAS:6622-92-0
Formula: CC1=NC(C)=NC(O)=C1
BD3692
98%
MFCD00006105
2,6-DIMETHYLPYRIMIDIN-4-YL ACETATE
CAS:1823935-40-5
Formula: CC(OC1=NC(C)=NC(C)=C1)=O
BD280078
95+%
2,6-DIMETHYLPYRIMIDINE-4-CARBALDEHYDE
CAS:1074-39-1
Formula: O=CC1=NC(C)=NC(C)=C1
BD268529
95+%
MFCD10696982
2,6-DIMETHYLPYRIMIDINE-4-CARBONITRILE
CAS:64571-35-3
Formula: N#CC1=NC(C)=NC(C)=C1
BD248874
95+%
MFCD16657332
2,6-DIMETHYLQUINAZOLIN-4(1H)-ONE
CAS:18731-19-6
Formula: O=C1N=C(C)NC2=C1C=C(C)C=C2
BD254083
98%
MFCD07787530
2,6-DIMETHYLQUINAZOLINE
CAS:16499-40-4
Formula: CC1=CC2=CN=C(C)N=C2C=C1
BD587317
97%
MFCD18448851
2,6-DIMETHYLQUINOLIN-4-OL
CAS:15644-82-3
Formula: OC1=CC(C)=NC2=CC=C(C)C=C12
BD32889
95+%
MFCD00272319
2,6-DIMETHYLQUINOLIN-5-AMINE
CAS:116632-59-8
Formula: NC1=C2C=CC(C)=NC2=CC=C1C
BD333062
95+%
MFCD00457007
2,6-DIMETHYLQUINOLIN-8-AMINE
CAS:30465-70-4
Formula: NC1=C2N=C(C)C=CC2=CC(C)=C1
BD624617
97%
2,6-DIMETHYLQUINOLINE
CAS:877-43-0
Formula: CC1=CC2=C(C=C1)N=C(C)C=C2
BD13006
98%
MFCD00006762
2,6-DIMETHYLQUINOLINE-3-CARBOXYLIC ACID
CAS:610261-45-5
Formula: O=C(C1=CC2=CC(C)=CC=C2N=C1C)O
BD183814
95+%
2,6-DIMETHYLQUINOLINE-4-CARBOHYDRAZIDE
CAS:613656-68-1
Formula: O=C(C1=CC(C)=NC2=CC=C(C)C=C12)NN
BD177237
95+%
MFCD03420427
2,6-DIMETHYLQUINOLINE-4-CARBOXYLIC ACID
CAS:104175-33-9
Formula: O=C(C1=CC(C)=NC2=CC=C(C)C=C12)O
BD68512
95+%
MFCD00487548
2,6-DIMETHYLTEREPHTHALIC ACID
CAS:80238-12-6
Formula: O=C(O)C1=C(C)C=C(C(O)=O)C=C1C
BD227439
96%
2,6-DIMETHYLTEREPHTHALONITRILE
CAS:95216-09-4
Formula: N#CC1=C(C)C=C(C#N)C=C1C
BD250829
95+%
MFCD20037433
2,6-DIMETHYLTETRAHYDRO-2H-PYRAN-4-OL
CAS:41866-70-0
Formula: OC1CC(C)OC(C)C1
BD254093
95+%
MFCD18089272
2,6-DIMETHYLTHIENO[3,2-D]PYRIMIDIN-4-AMINE
CAS:1017789-22-8
Formula: NC1=C2C(C=C(C)S2)=NC(C)=N1
BD320626
95+%
MFCD09991580
2,6-DIMORPHOLINOPYRIMIDINE-4-CARBOXYLIC ACID
CAS:450368-32-8
Formula: O=C(C1=NC(N2CCOCC2)=NC(N3CCOCC3)=C1)O
BD183121
97%
MFCD01765571
2,6-DINONYLNAPHTHALENE-1,5-DISULFONIC ACID
CAS:60223-95-2
Formula: O=S(C1=C2C=CC(CCCCCCCCC)=C(S(=O)(O)=O)C2=CC=C1CCCCCCCCC)(O)=O
BD125736
97%
2,6-DIOXA-9-AZASPIRO[4.5]DECANE
CAS:923277-59-2
Formula: C1OCCC12OCCNC2
BD282969
95+%
2,6-DIOXASPIRO[3.3]HEPTANE
CAS:174-79-8
Formula: C1OCC11COC1
BD236800
95+%
MFCD01730191
2,6-DIOXO-1,2,3,6-TETRAHYDROPYRIMIDINE-4-CARBALDEHYDE
CAS:36327-91-0
Formula: O=CC(NC1=O)=CC(N1)=O
BD2619
95+%
MFCD00466409
2,6-DIOXO-1,2,3,6-TETRAHYDROPYRIMIDINE-4-CARBALDEHYDE HYDRATE
CAS:1052405-08-9
Formula: O=CC(NC1=O)=CC(N1)=O.[H]O[H]
BD389513
95+%
MFCD03002359
2,6-DIOXO-1,2,3,6-TETRAHYDROPYRIMIDINE-4-CARBOXYLIC ACID HYDRATE
CAS:50887-69-9
Formula: O=C(N1)NC(C(O)=O)=CC1=O.[H]O[H]
BD21091
95+%
MFCD00149398
2,6-DIOXO-2,3-DIHYDRO-1H-PURINE-9(6H)-CARBOXYLIC ACID
CAS:71965-22-5
Formula: OC(=O)N1C=NC2=C1NC(=O)NC2=O
BD106046
95+%
2,6-DIOXO-3,6-DIHYDRO-2H-PYRAN-4-YL ACETATE
CAS:15997-62-3
Formula: CC(OC(CC1=O)=CC(O1)=O)=O
BD561820
97%
2,6-DIOXO-5-(PIPERIDIN-1-YLMETHYL)-1,2,3,6-TETRAHYDROPYRIMIDINE-4-CARBOXYLIC ACID
CAS:4116-21-6
Formula: O=C(C(NC1=O)=C(CN2CCCCC2)C(N1)=O)O
BD595969
97%
MFCD00563244
2,6-DIOXOPIPERIDINE-4-CARBOXYLIC ACID
CAS:6973-55-3
Formula: O=C(C(C1)CC(NC1=O)=O)O
BD303654
95+%
MFCD00154712
2,6-DIPHENETHYL-4H-PYRAN-4-ONE
CAS:56150-35-7
Formula: O=C1C=C(CCC2=CC=CC=C2)OC(CCC3=CC=CC=C3)=C1
BD269565
95+%
2,6-DIPHENYL-2H-PYRAN-4(3H)-ONE
CAS:126855-57-0
Formula: O=C1CC(C2=CC=CC=C2)OC(C3=CC=CC=C3)=C1
BD269575
95+%
2,6-DIPHENYLBENZO[1,2-B:4,5-B']DIFURAN
CAS:5379-77-1
Formula: C1(OC(C2=CC=CC=C2)=CC1=C3)=CC4=C3OC(C5=CC=CC=C5)=C4
BD331642
95+%
2,6-DIPHENYLDITHIENO[3,2-B:2',3'-D]THIOPHENE
CAS:881838-94-4
Formula: C1(C=C(C2=CC=CC=C2)S3)=C3C4=C(C=C(C5=CC=CC=C5)S4)S1
BD262671
95+%
2,6-DIPHENYLISONICOTINIC ACID
CAS:38947-57-8
Formula: O=C(O)C1=CC(C2=CC=CC=C2)=NC(C3=CC=CC=C3)=C1
BD60604
97%
2,6-DIPHENYLPIPERIDIN-4-ONE
CAS:5554-55-2
Formula: O=C1CC(C2=CC=CC=C2)NC(C3=CC=CC=C3)C1
BD349816
95+%
MFCD00229918
2,6-DIPHENYLPIPERIDIN-4-ONE HYDROCHLORIDE
CAS:56965-71-0
Formula: O=C1CC(C2=CC=CC=C2)NC(C3=CC=CC=C3)C1.[H]Cl
BD68540
97%
2,6-DIPHENYLPYRIDIN-3-AMINE
CAS:56568-39-9
Formula: NC1=CC=C(C2=CC=CC=C2)N=C1C3=CC=CC=C3
BD444584
97%
2,6-DIPHENYLPYRIDINE
CAS:3558-69-8
Formula: C1(C2=CC=CC=C2)=NC(C3=CC=CC=C3)=CC=C1
BD68542
95+%
MFCD00006284
2,6-DISTYRYL-4H-PYRAN-4-ONE
CAS:17173-83-0
Formula: O=C1C=C(/C=C/C2=CC=CC=C2)OC(/C=C/C3=CC=CC=C3)=C1
BD269564
95+%
MFCD00156429
2,6-DITOSYL-2,6-DIAZASPIRO[3.3]HEPTANE
CAS:13595-48-7
Formula: O=S(N(C1)CC21CN(S(=O)(C3=CC=C(C)C=C3)=O)C2)(C4=CC=C(C)C=C4)=O
BD626852
97%
n/a
2,6-NAPHTHYRIDIN-1(2H)-ONE
CAS:80935-77-9
Formula: O=C1NC=CC2=C1C=CN=C2
BD158284
95+%
MFCD06762736
2,6-NAPHTHYRIDIN-1(2H)-ONE HYDROBROMIDE
CAS:1182323-46-1
Formula: O=C1NC=CC2=C1C=CN=C2.[H]Br
BD297660
95+%
2,6-NAPHTHYRIDIN-1-AMINE
CAS:80935-81-5
Formula: NC1=NC=CC2=C1C=CN=C2
BD285767
95+%
MFCD11506145
2,6-NAPHTHYRIDIN-3-OL
CAS:1308285-72-4
Formula: OC1=CC2=C(C=N1)C=CN=C2
BD446393
97%
2,6-PYRIDINEDICARBOXALDEHYDE
CAS:5431-44-7
Formula: O=CC1=NC(C=O)=CC=C1
BD21339
98%
MFCD00010103
2,6-PYRIDINEDIMETHANOL
CAS:1195-59-1
Formula: OCC1=NC(CO)=CC=C1
BD5074
98%
MFCD00006351
2,7,7-TRIMETHYL-6,7-DIHYDRO-5H-PYRROLO[3,4-D]PYRIMIDINE
CAS:1823951-91-2
Formula: CC1(C)NCC2=CN=C(C)N=C21
BD440782
97%
MFCD27922239
2,7,8-TRIAMINO-4-(3-BROMO-4,5-DIMETHOXYPHENYL) -4H-CHROMENE-3-CARBONITRILE
CAS:475576-83-1
Formula: N#CC1=C(N)OC2=C(C=CC(N)=C2N)C1C3=CC(OC)=C(OC)C(Br)=C3
BD249561
95+%
2,7,8-TRIMETHYLQUINOLIN-4-OL
CAS:449199-19-3
Formula: OC1=CC(C)=NC2=C(C)C(C)=CC=C12
BD349985
95+%
MFCD02968777
2,7-BIS(2-(DIMETHYLAMINO)ETHYL)BENZO[LMN][3,8]PHENANTHROLINE-1,3,6,8(2H,7H)-TETRAONE
CAS:22291-04-9
Formula: O=C(N(CCN(C)C)C(C(C=C1)=C23)=O)C3=CC=C(C(N4CCN(C)C)=O)C2=C1C4=O
BD262636
95+%
2,7-BIS(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL) -1H-INDOLE
CAS:919119-72-5
Formula: CC1(C)C(C)(C)OB(C2=CC=CC3=C2NC(B4OC(C)(C)C(C)(C)O4)=C3)O1
BD332092
95+%
MFCD12405487
2,7-BIS(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL) TRIPHENYLENE
CAS:929103-40-2
Formula: CC1(C)C(C)(C)OB(C2=CC=C3C4=CC=C(B5OC(C)(C)C(C)(C)O5)C=C4C6=CC=CC=C6C3=C2)O1
BD585603
97%
2,7-BIS(4-BROMOPHENYL)-9-HEXYL-9H-CARBAZOLE
CAS:1884420-79-4
Formula: CCCCCCN1C2=C(C3=C1C=C(C4=CC=C(Br)C=C4)C=C3)C=CC(C5=CC=C(Br)C=C5)=C2
BD491386
97%
2,7-BIS(BROMOMETHYL)-9,9-DIHEXYL-9H-FLUORENE
CAS:187148-75-0
Formula: CCCCCCC1(CCCCCC)C2=C(C3=C1C=C(CBr)C=C3)C=CC(CBr)=C2
BD254716
95+%
MFCD07784372
2,7-BIS(TRIFLUOROMETHYL)PYRAZOLO[1,5-A]PYRIMIDIN-5(4H)-ONE
CAS:1245806-65-8
Formula: O=C1NC2=CC(C(F)(F)F)=NN2C(C(F)(F)F)=C1
BD608286
97%
2,7-BIS[N-(1-NAPHTHYL)ANILINO]-9,9'-SPIROBI[9H-FLUORENE]
CAS:932739-76-9
BD306434
95+%
MFCD12022428
2,7-DI(9H-CARBAZOL-9-YL)-9,9'-SPIROBI[FLUORENE]
CAS:924899-38-7
BD448998
97%
MFCD12022464
2,7-DI(PYREN-1-YL)-9,9'-SPIROBI[FLUORENE]
CAS:886456-80-0
BD449010
97%
MFCD12022456
2,7-DI(PYREN-1-YL)SPIRO[FLUORENE-9,9'-XANTHENE]
CAS:1160862-04-3
Formula: C1(C2(C3=C(OC4=C2C=CC=C4)C=CC=C3)C5=C6C=CC(C7=C(C8=C9%10)C=CC%10=CC=CC9=CC=C8C=C7)=C5)=C6C=CC(C%11=C
BD763436
97%
2,7-DI-TERT-BUTYL-9,9-DIMETHYL-9H-XANTHENE
CAS:130525-41-6
Formula: CC1(C)C2=C(OC3=C1C=C(C(C)(C)C)C=C3)C=CC(C(C)(C)C)=C2
BD68659
95+%
2,7-DI-TERT-BUTYLFLUORENE
CAS:58775-05-6
Formula: CC(C1=CC2=C(C=C1)C3=C(C=C(C(C)(C)C)C=C3)C2)(C)C
BD68660
98%
2,7-DI-TERT-BUTYLNAPHTHALENE
CAS:10275-58-8
Formula: CC(C1=CC2=CC(C(C)(C)C)=CC=C2C=C1)(C)C
BD68661
97%
2,7-DI-TERT-BUTYLPYRENE
CAS:24300-91-2
Formula: CC(C)(C)C1=CC2=C3C(C=CC4=CC(=CC(C=C2)=C34)C(C)(C)C)=C1
BD237182
97%
MFCD01013641
2,7-DIAMINO-2-PHENYLHEPTANOIC ACID DIHYDROCHLORIDE
CAS:1177328-53-8
Formula: O=C(O)C(C1=CC=CC=C1)(N)CCCCCN.[H]Cl.[H]Cl
BD321463
95+%
MFCD09832407
2,7-DIAMINO-4-(3,4-DIMETHOXYPHENYL) -4H-CHROMENE-3-CARBONITRILE
CAS:326919-67-9
Formula: N#CC1=C(N)OC2=C(C=CC(N)=C2)C1C3=CC=C(OC)C(OC)=C3
BD594295
97%
MFCD00715997
2,7-DIAMINO-4-(PYRIDIN-3-YL)-4H-CHROMENE-3-CARBONITRILE
CAS:314767-75-4
Formula: N#CC1=C(N)OC2=C(C=CC(N)=C2)C1C3=CC=CN=C3
BD594222
97%
MFCD00486656
2,7-DIAMINO-4-PHENYL-4H-CHROMENE-3-CARBONITRILE
CAS:111861-39-3
Formula: N#CC1=C(N)OC2=C(C=CC(N)=C2)C1C3=CC=CC=C3
BD185424
97%
MFCD00235202
2,7-DIAMINO-FLUORENE
CAS:525-64-4
Formula: NC1=CC=C2C(CC3=CC(N)=CC=C23)=C1
BD21218
97%
MFCD00001128
2,7-DIAZABICYCLO[4.2.0]OCTANE
CAS:51392-74-6
Formula: C12NCCCC1NC2
BD315679
95+%
MFCD19226952
2,7-DIAZASPIRO[3.5]NONAN-1-ONE
CAS:1147422-92-1
Formula: O=C1NCC12CCNCC2
BD280639
97%
2,7-DIAZASPIRO[3.5]NONAN-1-ONE HYDROCHLORIDE
CAS:1818847-63-0
Formula: O=C1NCC12CCNCC2.[H]Cl
BD281390
95+%
2,7-DIAZASPIRO[3.5]NONANE
CAS:136098-14-1
Formula: C1NCC12CCNCC2
BD254668
95+%
MFCD13193041
2,7-DIAZASPIRO[3.5]NONANE DIHYDROCHLORIDE
CAS:1334499-85-2
Formula: [H]Cl.[H]Cl.C1NCC12CCNCC2
BD329005
95+%
MFCD20261446
2,7-DIAZASPIRO[4.4]NONAN-1-ONE
CAS:1203796-97-7
Formula: O=C1NCCC12CNCC2
BD246908
95+%
MFCD22372537
2,7-DIAZASPIRO[4.4]NONAN-1-ONE HYDROCHLORIDE
CAS:1203682-17-0
Formula: O=C1NCCC12CNCC2.[H]Cl
BD253993
95+%
2,7-DIAZASPIRO[4.4]NONAN-3-ONE
CAS:1226550-00-0
Formula: O=C1NCC2(CNCC2)C1
BD246912
95+%
MFCD19226811
2,7-DIAZASPIRO[4.4]NONAN-3-ONE HYDROCHLORIDE
CAS:1393330-70-5
Formula: O=C1NCC2(CNCC2)C1.[H]Cl
BD301468
95+%
n/a
2,7-DIAZASPIRO[4.4]NONANE DIHYDROBROMIDE
CAS:77415-55-5
Formula: C1NCCC12CNCC2.[H]Br.[H]Br
BD288626
95+%
MFCD27964259
2,7-DIAZASPIRO[4.4]NONANE DIHYDROCHLORIDE
CAS:1394122-72-5
Formula: [H]Cl.[H]Cl.C1NCCC12CNCC2
BD571619
95%
MFCD10700113
2,7-DIAZASPIRO[4.4]NONANE HYDROCHLORIDE
CAS:N/A
Formula: [H]Cl.C1C2(CCNC2)CCN1
BD00790360
95%
2,7-DIAZASPIRO[4.4]NONANE-1,3,6,8-TETRAONE
CAS:77415-70-4
Formula: O=C1NC(CC12C(NC(C2)=O)=O)=O
BD219087
95+%
2,7-DIAZASPIRO[4.5]DECAN-1-ONE
CAS:887118-43-6
Formula: C1(C2(CCN1)CCCNC2)=O
BD162596
95+%
MFCD12406550
2,7-DIAZASPIRO[4.5]DECAN-1-ONE HYDROCHLORIDE
CAS:1187173-43-8
Formula: O=C1NCCC21CNCCC2.[H]Cl
BD163498
97%
MFCD08460858
2,7-DIAZASPIRO[4.5]DECAN-3-ONE
CAS:1158750-89-0
Formula: O=C1CC2(CN1)CCCNC2
BD235226
95+%
MFCD12406549
2,7-DIAZASPIRO[4.5]DECAN-3-ONE HYDROCHLORIDE
CAS:1385696-86-5
Formula: O=C1NCC2(CNCCC2)C1.Cl
BD279804
95+%
2,7-DIAZASPIRO[4.5]DECANE
CAS:40865-50-7
Formula: C1NCCC12CNCCC2
BD215911
95+%
MFCD13180577
2,7-DIAZASPIRO[4.5]DECANE DIHYDROCHLORIDE
CAS:1334499-87-4
Formula: [H]Cl.[H]Cl.C1NCCC12CNCCC2
BD329006
95+%
MFCD10700110
2,7-DIBENZYL-2,7-DIAZASPIRO[4.4]NONANE
CAS:77415-72-6
Formula: N1(CC2=CC=CC=C2)CC3(CN(CC4=CC=CC=C4)CC3)CC1
BD68604
95+%
MFCD06858480
2,7-DIBROMO-[1,2,4]TRIAZOLO[1,5-A]PYRIDINE
CAS:1380331-15-6
Formula: BrC1=CC2=NC(Br)=NN2C=C1
BD329422
95+%
MFCD22574163
2,7-DIBROMO-2',3',5',6'-TETRAHYDROSPIRO[FLUORENE-9,4'-PYRAN]
CAS:934269-17-7
Formula: BrC1=CC2=C(C=C1)C3=C(C=C(Br)C=C3)C24CCOCC4
BD242830
95+%
MFCD09800926
2,7-DIBROMO-2',7'-DI-TERT-BUTYL-9,9'-SPIROBI[FLUORENE]
CAS:439791-57-8
Formula: CC(C1=CC2=C(C=C1)C3=C(C42C5=C(C6=C4C=C(Br)C=C6)C=CC(Br)=C5)C=C(C(C)(C)C)C=C3)(C)C
BD334367
95+%
MFCD20921692
2,7-DIBROMO-3,4-DIHYDRONAPHTHALEN-1(2H)-ONE
CAS:148378-71-6
Formula: O=C1C(Br)CCC2=C1C=C(Br)C=C2
BD435985
97%
MFCD26521751
2,7-DIBROMO-3,6-DIMETHOXYNAPHTHALENE
CAS:105404-89-5
Formula: COC1=CC2=CC(OC)=C(Br)C=C2C=C1Br
BD68606
95+%
MFCD01851104
2,7-DIBROMO-3-METHYL-5H-PYRROLO[2,3-B]PYRAZINE
CAS:N/A
Formula: CC1N=C2NC=C(Br)C2=NC=1Br
BD00736823
95%
n/a
2,7-DIBROMO-4,4,9,9-TETRAKIS(4-HEXYLPHENYL) -4,9-DIHYDRO-S-INDACENO[1,2-B:5,6-B']DITHIOPHENE
CAS:1049034-71-0
Formula: CCCCCCC1=CC=C(C2(C3=CC(C4=C5C=C(S4)Br)=C(C(C6=CC=C(C=C6)CCCCCC)5C7=CC=C(C=C7)CCCCCC)C=C3C8=C2C=C(S8)
BD254723
95+%
2,7-DIBROMO-5,10-DIPHENYL-5,10-DIHYDROINDOLO[3,2-B]INDOLE
CAS:1919062-54-6
Formula: BrC1=CC(N2C3=CC=CC=C3)=C(C(N4C5=CC=CC=C5)=C2C6=C4C=C(Br)C=C6)C=C1
BD438469
97%
MFCD28291924
2,7-DIBROMO-5-(PHENYLSULFONYL)-5H-PYRROLO[2,3-B]PYRAZINE
CAS:N/A
Formula: O=S(N1C=C(Br)C2=NC(Br)=CN=C21)(C3=CC=CC=C3)=O
BD752320
97%
2,7-DIBROMO-5-METHYL-5H-PYRROLO[2,3-B]PYRAZINE
CAS:N/A
Formula: CN1C=C(Br)C2=NC(Br)=CN=C21
BD751443
97%
2,7-DIBROMO-5-TOSYL-5H-PYRROLO[2,3-B]PYRAZINE
CAS:N/A
Formula: O=S(=O)(C1C=CC(C)=CC=1)N1C2C(=NC(=CN=2)Br)C(Br)=C1
BD00782854
95%
n/a
2,7-DIBROMO-5H-PYRROLO[2,3-B]PYRAZINE
CAS:1209703-87-6
Formula: BrC1=CN=C2NC=C(Br)C2=N1
BD159021
95+%
MFCD11109803
2,7-DIBROMO-6-METHOXYBENZO[D]THIAZOLE
CAS:440123-48-8
Formula: COC1=CC=C2N=C(Br)SC2=C1Br
BD00777921
95%
n/a
2,7-DIBROMO-9,9'-SPIROBIFLUORENE
CAS:171408-84-7
Formula: BrC1=CC2=C(C=C1)C3=C(C=C(Br)C=C3)C24C5=C(C6=C4C=CC=C6)C=CC=C5
BD18842
98%
MFCD08704218
2,7-DIBROMO-9,9-BIS(2-ETHYLHEXYL) -9H-FLUORENE
CAS:188200-93-3
Formula: CCCCC(CC)CC1(CC(CC)CCCC)C2=C(C3=C1C=C(Br)C=C3)C=CC(Br)=C2
BD245816
95+%
MFCD03427217
2,7-DIBROMO-9,9-BIS(6-BROMOHEXYL) -9H-FLUORENE
CAS:570414-33-4
Formula: BrCCCCCCC1(CCCCCCBr)C2=C(C3=C1C=C(Br)C=C3)C=CC(Br)=C2
BD331657
95+%
MFCD09260450
2,7-DIBROMO-9,9-DI-P-TOLYL-9H-FLUORENE
CAS:357645-37-5
Formula: CC1=CC=C(C2(C3=CC=C(C)C=C3)C4=C(C5=C2C=C(Br)C=C5)C=CC(Br)=C4)C=C1
BD254678
95+%
MFCD16619300
2,7-DIBROMO-9,9-DIDECYL-9H-FLUORENE
CAS:175922-78-8
Formula: CCCCCCCCCCC1(CCCCCCCCCC)C2=C(C3=C1C=C(Br)C=C3)C=CC(Br)=C2
BD165621
97%
2,7-DIBROMO-9,9-DIDODECYL-9H-FLUORENE
CAS:286438-45-7
Formula: CCCCCCCCCCCCC1(CCCCCCCCCCCC)C2=C(C3=C1C=C(Br)C=C3)C=CC(Br)=C2
BD165631
97%
MFCD03427214
2,7-DIBROMO-9,9-DIFLUORO-9H-FLUORENE
CAS:1229603-71-7
Formula: FC1(F)C2=C(C3=C1C=C(Br)C=C3)C=CC(Br)=C2
BD280361
98%
2,7-DIBROMO-9,9-DIHEXYL-9H-FLUORENE
CAS:189367-54-2
Formula: CCCCCCC1(CCCCCC)C2=C(C3=C1C=C(Br)C=C3)C=CC(Br)=C2
BD19070
97%
MFCD03427215
2,7-DIBROMO-9,9-DIMETHYL-9,10-DIHYDROACRIDINE
CAS:1333316-35-0
Formula: CC1(C)C2=C(C=CC(Br)=C2)NC3=CC=C(Br)C=C13
BD627869
97%
n/a
2,7-DIBROMO-9,9-DIMETHYL-9H-FLUORENE
CAS:28320-32-3
Formula: CC1(C)C2=C(C3=C1C=C(Br)C=C3)C=CC(Br)=C2
BD111599
98%
MFCD00099471
2,7-DIBROMO-9,9-DIPHENYL-9H-FLUORENE
CAS:186259-63-2
Formula: BrC1=CC2=C(C=C1)C3=C(C=C(Br)C=C3)C2(C4=CC=CC=C4)C5=CC=CC=C5
BD68609
97%
2,7-DIBROMO-9,9-DIPROPYLFLUORENE
CAS:157771-56-7
Formula: CCCC1(CCC)C2=C(C3=C1C=C(Br)C=C3)C=CC(Br)=C2
BD306183
95+%
MFCD12024280
2,7-DIBROMO-9-(2-ETHYLHEXYL) -9H-CARBAZOLE
CAS:544436-46-6
Formula: CCCCC(CC)CN1C2=C(C3=C1C=C(Br)C=C3)C=CC(Br)=C2
BD247411
95+%
2,7-DIBROMO-9-(HEPTADECAN-9-YL)-9H-CARBAZOLE
CAS:955964-73-5
Formula: CCCCCCCCC(N1C2=C(C3=C1C=C(Br)C=C3)C=CC(Br)=C2)CCCCCCCC
BD247413
95+%
MFCD16619379
2,7-DIBROMO-9-HEXYL-9H-CARBAZOLE
CAS:654676-12-7
Formula: CCCCCCN1C2=C(C3=C1C=C(Br)C=C3)C=CC(Br)=C2
BD491250
97%
2,7-DIBROMO-9-OCTYL-9H-CARBAZOLE
CAS:726169-75-1
Formula: CCCCCCCCN1C2=C(C3=C1C=C(Br)C=C3)C=CC(Br)=C2
BD247407
95+%
2,7-DIBROMO-9-PHENYL-9H-CARBAZOLE
CAS:444796-09-2
Formula: BrC1=CC2=C(C=C1)C3=C(C=C(Br)C=C3)N2C4=CC=CC=C4
BD331621
97%
2,7-DIBROMO-9H-CARBAZOLE
CAS:136630-39-2
Formula: BrC1=CC2=C(C=C1)C3=C(C=C(Br)C=C3)N2
BD68612
98%
MFCD09033507
2,7-DIBROMO-9H-FLUOREN-9-ONE
CAS:14348-75-5
Formula: C3=C2C1=C(C=C(Br)C=C1)C(C2=CC(=C3)Br)=O
BD18340
98%
MFCD00010790
2,7-DIBROMO-9H-FLUORENE
CAS:16433-88-8
Formula: C1=C(Br)C=CC2=C1CC3=C2C=CC(=C3)Br
BD15028
97%
MFCD00019048
2,7-DIBROMOBENZO[D]THIAZOLE
CAS:1188090-10-9
Formula: BrC1C=CC=C2N=C(Br)SC=12
BD00750975
95+%
n/a
2,7-DIBROMONAPHTHALENE
CAS:58556-75-5
Formula: BrC2=CC1=CC(=CC=C1C=C2)Br
BD41823
98%
MFCD00238580
2,7-DIBROMOPHENANTHRENE
CAS:62325-30-8
Formula: BrC1=CC=C2C3=CC=C(Br)C=C3C=CC2=C1
BD68615
95+%
MFCD09909861
2,7-DIBROMOPHENANTHRENE-9,10-DIONE
CAS:84405-44-7
Formula: O=C1C2=C(C=CC(Br)=C2)C3=CC=C(Br)C=C3C1=O
BD68607
97%
MFCD03931078
2,7-DIBROMOPYRENE
CAS:102587-98-4
Formula: BrC1=CC2=CC=C3C=C(Br)C=C(C3=C24)C=CC4=C1
BD68616
95+%
MFCD09909862
2,7-DIBROMOQUINOLINE
CAS:1334405-59-2
Formula: BrC1=CC=C2C=CC(Br)=NC2=C1
BD216206
95+%
MFCD09261125
2,7-DIBROMOSPIRO[FLUORENE-9,9'-XANTHENE]
CAS:198142-65-3
Formula: BrC1=CC2=C(C=C1)C3=C(C=C(Br)C=C3)C24C5=C(OC6=C4C=CC=C6)C=CC=C5
BD626202
97%
2,7-DIBROMOTHIAZOLO[4,5-C]PYRIDINE
CAS:N/A
Formula: BrC1C2SC(=NC=2C=NC=1)Br
BD00732440
95%
n/a
2,7-DIBROMOTRIPHENYLENE
CAS:888041-37-0
Formula: BrC1=CC=C2C3=CC=C(Br)C=C3C4=CC=CC=C4C2=C1
BD290597
97%
MFCD22571695
2,7-DICHLORO-1,8-NAPHTHYRIDINE
CAS:55243-02-2
Formula: ClC1=CC=C2C=CC(Cl)=NC2=N1
BD68617
97%
MFCD08234796
2,7-DICHLORO-1-HEPTENE
CAS:485320-12-5
Formula: C=C(Cl)CCCCCCl
BD308184
95+%
MFCD00671829
2,7-DICHLORO-4,8-DIMETHYLQUINOLINE
CAS:326481-08-7
Formula: CC1=C2N=C(Cl)C=C(C)C2=CC=C1Cl
BD624730
97%
2,7-DICHLORO-4-METHYL-N-PHENYLQUINOLINE-6-SULFONAMIDE
CAS:1418265-69-6
Formula: O=S(C1=C(Cl)C=C2N=C(Cl)C=C(C)C2=C1)(NC3=CC=CC=C3)=O
BD616127
97%
2,7-DICHLORO-4-METHYLQUINOLINE
CAS:59666-16-9
Formula: CC1=CC(Cl)=NC2=CC(Cl)=CC=C12
BD274465
95+%
2,7-DICHLORO-4-METHYLQUINOLINE-6-SULFONAMIDE
CAS:1418265-71-0
Formula: O=S(C1=C(Cl)C=C2N=C(Cl)C=C(C)C2=C1)(N)=O
BD616128
97%
2,7-DICHLORO-5-((2-(TRIMETHYLSILYL)ETHOXY)METHYL)-5H-PYRROLO[2,3-B]PYRAZINE
CAS:N/A
Formula: C[Si](C)(C)CCOCN1C2C(=NC(=CN=2)Cl)C(Cl)=C1
BD00720646
95%
n/a
2,7-DICHLORO-5-(METHYLSULFONYL)-5H-PYRROLO[3,2-D]PYRIMIDINE
CAS:N/A
Formula: O=S(N1C=C(Cl)C2=NC(Cl)=NC=C21)(C)=O
BD753818
97%
2,7-DICHLORO-5-(TRIISOPROPYLSILYL) -5H-PYRROLO[2,3-B]PYRAZINE
CAS:N/A
Formula: CC(C)[Si](C(C)C)(C(C)C)N1C2C(=NC(=CN=2)Cl)C(Cl)=C1
BD00765921
95%
n/a
2,7-DICHLORO-5-METHYL-5H-PYRROLO[3,2-D]PYRIMIDINE
CAS:N/A
Formula: CN1C2C(=NC(=NC=2)Cl)C(Cl)=C1
BD00802988
95%
n/a
2,7-DICHLORO-5-TOSYL-5H-PYRROLO[2,3-B]PYRAZINE
CAS:N/A
Formula: O=S(N1C=C(Cl)C2=NC(Cl)=CN=C21)(C3=CC=C(C)C=C3)=O
BD752649
97%
2,7-DICHLORO-5-TRITYL-5H-PYRROLO[2,3-B]PYRAZINE
CAS:N/A
Formula: ClC1=CN(C(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4)C5=NC=C(Cl)N=C51
BD753617
97%
2,7-DICHLORO-5H-PYRROLO[2,3-B]PYRAZINE
CAS:N/A
Formula: ClC1C2C(=NC=C(N=2)Cl)NC=1
BD00751101
95%
n/a
2,7-DICHLORO-5H-PYRROLO[3,2-D]PYRIMIDINE
CAS:1934415-98-1
Formula: ClC1=CNC2=CN=C(Cl)N=C21
BD753732
97%
2,7-DICHLORO-6-FLUOROQUINAZOLIN-4(3H)-ONE
CAS:1227170-09-3
Formula: OC1=C2C=C(F)C(Cl)=CC2=NC(Cl)=N1
BD633788
97%
2,7-DICHLORO-6-FLUOROQUINAZOLINE
CAS:1512749-33-5
Formula: FC1=CC2=CN=C(Cl)N=C2C=C1Cl
BD633827
97%
2,7-DICHLORO-6-IODOQUINAZOLIN-4(3H)-ONE
CAS:540501-10-8
Formula: OC1=C2C=C(I)C(Cl)=CC2=NC(Cl)=N1
BD633789
97%
2,7-DICHLORO-6-METHOXYBENZO[D]THIAZOLE
CAS:1784096-83-8
Formula: COC1C(Cl)=C2C(N=C(S2)Cl)=CC=1
BD00753821
95+%
MFCD28968767
2,7-DICHLORO-6-METHYLQUINOXALINE
CAS:1163123-60-1
Formula: CC1=C(Cl)C=C2N=C(Cl)C=NC2=C1
BD269188
95+%
2,7-DICHLORO-8-METHYLQUINOLINE
CAS:1215205-97-2
Formula: CC1=C2N=C(Cl)C=CC2=CC=C1Cl
BD231303
95+%
MFCD15143625
2,7-DICHLORO-9H-FLUORENE
CAS:7012-16-0
Formula: ClC1=CC2=C(C=C1)C3=C(C=C(Cl)C=C3)C2
BD68621
97%
MFCD00032840
2,7-DICHLORO-ALPHA-[(DIBUTYLAMINO)METHYL]-9H-FLUORENE-4-METHANOL
CAS:69759-61-1
Formula: OC(CN(CCCC)CCCC)C1=CC(Cl)=CC(C2)=C1C3=C2C=C(Cl)C=C3
BD165241
97%
2,7-DICHLOROBENZO[D]OXAZOLE
CAS:86691-34-1
Formula: ClC1=C(OC(Cl)=N2)C2=CC=C1
BD216798
95+%
2,7-DICHLOROBENZO[D]THIAZOL-4-AMINE
CAS:70200-93-0
Formula: NC1=C2N=C(Cl)SC2=C(Cl)C=C1
BD269520
95+%
2,7-DICHLOROBENZO[D]THIAZOL-6-AMINE
CAS:70200-94-1
Formula: NC1=CC=C2N=C(Cl)SC2=C1Cl
BD269519
95+%
2,7-DICHLOROBENZO[D]THIAZOLE
CAS:2942-23-6
Formula: ClC1=NC2=C(S1)C(Cl)=CC=C2
BD237173
97%
MFCD09037778
2,7-DICHLORODIHYDROFLUORESCEIN DIACETATE
CAS:4091-99-0
Formula: O=C(O)C1=CC=CC=C1C2C3=C(OC4=C2C=C(Cl)C(OC(C)=O)=C4)C=C(OC(C)=O)C(Cl)=C3
BD221268
95+%
MFCD00128955
2,7-DICHLOROIMIDAZO[1,2-A]PYRIDINE
CAS:190074-50-1
Formula: ClC1=CN2C=CC(Cl)=CC2=N1
BD27899
95+%
MFCD06739216
2,7-DICHLOROPYRAZOLO[1,5-A]PYRIMIDINE
CAS:1211535-91-9
Formula: ClC1N2C(=CC(=N2)Cl)N=CC=1
BD00758793
95+%
n/a
2,7-DICHLOROPYRIDO[4,3-D]PYRIMIDIN-4(3H)-ONE
CAS:N/A
Formula: O=C1NC(Cl)=NC2C=C(Cl)N=CC1=2
BD00779486
95%
2,7-DICHLOROPYRIDO[4,3-D]PYRIMIDIN-4-AMINE
CAS:N/A
Formula: NC1N=C(Cl)N=C2C=C(Cl)N=CC=12
BD00762269
95%
2,7-DICHLOROPYRIDO[4,3-D]PYRIMIDIN-4-OL
CAS:N/A
Formula: OC1N=C(Cl)N=C2C=C(Cl)N=CC=12
BD00730442
95%
2,7-DICHLOROPYRIDO[4,3-D]PYRIMIDINE
CAS:N/A
Formula: ClC1N=CC2C(=NC(=NC=2)Cl)C=1
BD00768751
95%
2,7-DICHLOROQUINAZOLIN-4(3H)-ONE
CAS:20197-96-0
Formula: O=C1NC(Cl)=NC2=C1C=CC(Cl)=C2
BD224912
95+%
MFCD11520688
2,7-DICHLOROQUINAZOLIN-4-AMINE
CAS:111218-91-8
Formula: NC1=C2C=CC(Cl)=CC2=NC(Cl)=N1
BD245256
95+%
MFCD00563869
2,7-DICHLOROQUINAZOLINE
CAS:67092-19-7
Formula: ClC1=CC2=NC(Cl)=NC=C2C=C1
BD286480
95+%
MFCD15527158
2,7-DICHLOROQUINOLINE
CAS:613-77-4
Formula: ClC1=CC=C2C=CC(Cl)=NC2=C1
BD334783
95+%
MFCD00830402
2,7-DICHLOROQUINOLINE-3-CARBALDEHYDE
CAS:73568-33-9
Formula: O=CC1=CC2=CC=C(Cl)C=C2N=C1Cl
BD386750
95+%
MFCD06202348
2,7-DICHLOROQUINOXALINE
CAS:59489-31-5
Formula: ClC1=CC=C2N=CC(Cl)=NC2=C1
BD34237
95%
2,7-DICHLOROTHIAZOLO[4,5-C]PYRIDINE
CAS:N/A
Formula: ClC1C2SC(=NC=2C=NC=1)Cl
BD00713627
95%
n/a
2,7-DICHLOROTHIAZOLO[4,5-D]PYRIMIDIN-5-AMINE
CAS:1266572-32-0
Formula: NC1=NC(Cl)=C(SC(Cl)=N2)C2=N1
BD281275
95+%
2,7-DICHLOROTHIAZOLO[5,4-C]PYRIDINE
CAS:884860-61-1
Formula: ClC1=NC2=C(S1)C=NC=C2Cl
BD204360
95+%
MFCD13193435
2,7-DICHLOROTHIAZOLO[5,4-D]PYRIMIDINE
CAS:19602-61-0
Formula: ClC1=C2C(SC(Cl)=N2)=NC=N1
BD68627
95+%
MFCD09702028
2,7-DIDEACETOXYTAXININE J
CAS:115810-14-5
Formula: N/A
BD299324
95+%
2,7-DIHEXYLBENZO[LMN][3,8]PHENANTHROLINE-1,3,6,8(2H,7H)-TETRAONE
CAS:23536-15-4
Formula: O=C1C2=CC=C3C4=C(C(=O)N(CCCCCC)C3=O)C=CC(=C24)C(=O)N1CCCCCC
BD00687265
95+%
n/a
2,7-DIHYDROHOMOERYSOTRINE
CAS:51095-85-3
Formula: N/A
BD298790
95+%
2,7-DIHYDROXY-1-NAPHTHALDEHYDE
CAS:20258-95-1
Formula: O=CC1=C2C=C(O)C=CC2=CC=C1O
BD583887
97%
2,7-DIHYDROXY-2H-1,4-BENZOXAZIN-3(4H)-ONE
CAS:69804-59-7
Formula: O=C1NC2=CC=C(O)C=C2OC1O
BD235929
95+%
2,7-DIHYDROXY-9-FLUORENONE
CAS:42523-29-5
Formula: OC1=CC2=C(C=C1)C1=C(C=C(O)C=C1)C2=O
BD7941
98%
MFCD00037141
2,7-DIHYDROXYANTHRACENE-9,10-DIONE
CAS:572-93-0
Formula: O=C1C2C(=CC=C(C=2)O)C(=O)C2C=CC(=CC1=2)O
BD00739507
95+%
n/a
2,7-DIHYDROXYNAPHTHALENE
CAS:582-17-2
Formula: OC1=CC2=CC(O)=CC=C2C=C1
BD68634
97%
MFCD00004085
2,7-DIHYDROXYQUINOLINE
CAS:70500-72-0
Formula: OC2=NC1=CC(=CC=C1C=C2)O
BD30961
98%
MFCD07644575
2,7-DIIODO-9,9-DIMETHYL-9H-FLUORENE
CAS:144981-86-2
Formula: CC1(C)C2=CC(I)=CC=C2C2=CC=C(I)C=C12
BD238722
95+%
MFCD12827985
2,7-DIIODO-9H-FLUORENE
CAS:16218-28-3
Formula: IC1=CC=C2C(CC3=CC(I)=CC=C23)=C1
BD68637
95+%
MFCD00040153
2,7-DIIODOPHENANTHRENE-9,10-DIONE
CAS:16218-32-9
Formula: O=C1C2=C(C=CC(I)=C2)C3=CC=C(I)C=C3C1=O
BD68638
95+%
2,7-DIMETHOXY-1,4,5,8-TETRAHYDRONAPHTHALENE
CAS:1614-82-0
Formula: COC1=CCC2=C(C1)CC(OC)=CC2
BD32158
95+%
MFCD00269695
2,7-DIMETHOXY-1,5-NAPHTHYRIDINE
CAS:1003944-36-2
Formula: COC1=CN=C2C=CC(OC)=NC2=C1
BD245283
95+%
MFCD20925356
2,7-DIMETHOXY-1-NAPHTHAMIDE
CAS:1706453-95-3
Formula: O=C(C1=C2C=C(OC)C=CC2=CC=C1OC)N
BD619832
97%
2,7-DIMETHOXY-1-NAPHTHOIC ACID
CAS:17953-58-1
Formula: O=C(C1=C2C=C(OC)C=CC2=CC=C1OC)O
BD623949
97%
2,7-DIMETHOXY-1-NAPHTHONITRILE
CAS:16000-40-1
Formula: N#CC1=C2C=C(OC)C=CC2=CC=C1OC
BD618664
97%
2,7-DIMETHOXYNAPHTHALENE
CAS:3469-26-9
Formula: COC1=CC2=CC(OC)=CC=C2C=C1
BD68641
97%
MFCD00004064
2,7-DIMETHOXYQUINOLINE-3-CARBALDEHYDE
CAS:95395-23-6
Formula: O=CC1=CC2=CC=C(OC)C=C2N=C1OC
BD183646
95+%
MFCD06800600
2,7-DIMETHYL-[1,2,4]TRIAZOLO[1,5-A]PYRIMIDINE-6-CARBOXYLIC ACID
CAS:108129-01-7
Formula: O=C(C1=C(C)N2C(N=C1)=NC(C)=N2)O
BD196024
97%
MFCD09439067
2,7-DIMETHYL-1-PROPYL-1H-INDOLE-3-CARBALDEHYDE
CAS:1134334-37-4
Formula: O=CC1=C(C)N(CCC)C2=C1C=CC=C2C
BD177239
97%
MFCD12027451
2,7-DIMETHYL-1H-BENZO[D]IMIDAZOLE
CAS:23291-66-9
Formula: CC1=C2NC(C)=NC2=CC=C1
BD272277
95+%
2,7-DIMETHYL-1H-INDOLE
CAS:5621-13-6
Formula: CC1=CC=CC2=C1NC(C)=C2
BD282759
95+%
MFCD00022715
2,7-DIMETHYL-1H-INDOLE-3-CARBALDEHYDE
CAS:872505-78-7
Formula: O=CC1=C(C)NC2=C1C=CC=C2C
BD195153
97%
MFCD07643170
2,7-DIMETHYL-1H-PURIN-6(7H)-ONE
CAS:1713477-43-0
Formula: O=C1NC(C)=NC2=C1N(C)C=N2
BD623240
97%
2,7-DIMETHYL-2,4-DIHYDRO-1,4-BENZOXAZIN-3-ONE
CAS:114603-36-0
Formula: O=C1C(C)OC2=CC(C)=CC=C2N1
BD324936
95+%
MFCD15730334
2,7-DIMETHYL-2H-INDAZOLE
CAS:58706-35-7
Formula: CC1=CC=CC2=CN(C)N=C12
BD587851
97%
2,7-DIMETHYL-3,4-DIHYDRO-2H-1,4-BENZOXAZINE
CAS:58960-12-6
Formula: CC1=CC=C2NCC(C)OC2=C1
BD327499
95+%
MFCD11603429
2,7-DIMETHYL-5H-[1,3,4]THIADIAZOLO[3,2-A]PYRIMIDIN-5-ONE
CAS:41914-67-4
Formula: O=C1C=C(C)N=C2N1N=C(C)S2
BD625213
97%
2,7-DIMETHYL-6-NITROBENZO[D]THIAZOLE
CAS:72206-94-1
Formula: CC1=NC2=C(S1)C(C)=C(C=C2)[N+]([O-])=O
BD237080
95+%
MFCD18826468
2,7-DIMETHYL-9H-CARBAZOLE
CAS:18992-65-9
Formula: CC1=CC2=C(C=C1)C3=C(C=C(C)C=C3)N2
BD262630
98%
MFCD01851748
2,7-DIMETHYL-9H-FLUOREN-9-ONE
CAS:2840-49-5
Formula: O=C1C2=C(C3=C1C=C(C)C=C3)C=CC(C)=C2
BD303969
95+%
2,7-DIMETHYLIMIDAZO[1,2-A]PYRIDINE
CAS:3268-61-9
Formula: CC1=CC2=NC(C)=CN2C=C1
BD280831
95+%
MFCD07390342
2,7-DIMETHYLIMIDAZO[1,2-A]PYRIDINE-3-CARBALDEHYDE
CAS:820245-84-9
Formula: CC1=C(C=O)N2C=CC(C)=CC2=N1
BD0041
95+%
MFCD03788999
2,7-DIMETHYLIMIDAZO[1,2-A]PYRIDINE-3-CARBOXYLIC ACID
CAS:81438-53-1
Formula: O=C(C1=C(C)N=C2C=C(C)C=CN21)O
BD278639
97%
2,7-DIMETHYLIMIDAZO[1,2-A]PYRIDINE-3-SULFONYL CHLORIDE
CAS:1335052-39-5
Formula: O=S(C1=C(C)N=C2C=C(C)C=CN21)(Cl)=O
BD289793
95+%
MFCD26404012
2,7-DIMETHYLNAPHTHALENE
CAS:582-16-1
Formula: CC1=CC2=CC(C)=CC=C2C=C1
BD68649
97%
MFCD00004121
2,7-DIMETHYLOXAZOLO[4,5-C]PYRIDINE
CAS:1823921-82-9
Formula: CC1=CN=CC2=C1OC(C)=N2
BD260440
95+%
2,7-DIMETHYLPYRAZOLO[1,5-A]PYRIMIDINE-6-CARBOXYLIC ACID
CAS:175201-51-1
Formula: O=C(C1=C(C)N2C(N=C1)=CC(C)=N2)O
BD92967
97%
MFCD00067901
2,7-DIMETHYLPYRENE
CAS:15679-24-0
Formula: CC1=CC2=CC=C3C=C(C)C=C(C3=C24)C=CC4=C1
BD68652
95+%
MFCD02683750
2,7-DIMETHYLQUINAZOLIN-4(1H)-ONE
CAS:194473-09-1
Formula: O=C1N=C(C)NC2=C1C=CC(C)=C2
BD259936
95+%
2,7-DIMETHYLQUINOLIN-5-AMINE
CAS:1378259-69-8
Formula: NC1=C2C=CC(C)=NC2=CC(C)=C1
BD614793
97%
2,7-DIMETHYLQUINOLIN-8-AMINE
CAS:342412-19-5
Formula: NC1=C2N=C(C)C=CC2=CC=C1C
BD624850
97%
2,7-DIMETHYLQUINOLINE
CAS:93-37-8
Formula: CC1=CC2=C(C=C1)C=CC(C)=N2
BD0506
95+%
MFCD00006763
2,7-DIMETHYLQUINOLINE-4-CARBOXYLIC ACID
CAS:892674-22-5
Formula: O=C(C1=CC(C)=NC2=CC(C)=CC=C12)O
BD188391
95+%
2,7-DIOCTYLBENZO[B]BENZO[4,5]THIENO[2,3-D]THIOPHENE
CAS:583050-70-8
Formula: CCCCCCCCC1=CC=C(C2=C(C3=CC=C(CCCCCCCC)C=C3S2)S4)C4=C1
BD633430
97%
2,7-DIOXO-1,3-DIAZEPANE-4-CARBOXYLIC ACID
CAS:1009553-88-1
Formula: O=C(C(CC1)NC(NC1=O)=O)O
BD496167
97%
MFCD04240850
2,7-DIOXO-3-PHENYL-1,2,4,7-TETRAHYDROPYRAZOLO[1,5-A]PYRIMIDINE-6-CARBOXYLIC ACID
CAS:1374408-15-7
Formula: O=C(C(C(N1N2)=O)=CNC1=C(C3=CC=CC=C3)C2=O)O
BD614703
97%
2,7-DIPHENYLBENZO[B]BENZO[4,5]THIENO[2,3-D]THIOPHENE
CAS:900806-58-8
Formula: C1(C2=CC=C(C3=CC=CC=C3)C=C2S4)=C4C5=CC=C(C6=CC=CC=C6)C=C5S1
BD331741
95+%
2,7-NAPHTHYRIDIN-1(2H)-ONE
CAS:67988-50-5
Formula: O=C1NC=CC2=CC=NC=C12
BD240964
95+%
MFCD11877928
2,7-NAPHTHYRIDIN-1(2H)-ONE HYDROBROMIDE
CAS:950746-19-7
Formula: O=C1NC=CC2=CC=NC=C12.[H]Br
BD263765
95+%
MFCD12923102
2,7-NAPHTHYRIDIN-1-AMINE
CAS:27225-00-9
Formula: NC1=C2C=NC=CC2=CC=N1
BD210711
95+%
MFCD11506147
2,7-NAPHTHYRIDINE
CAS:253-45-2
Formula: C12=C(C=NC=C2)C=NC=C1
BD208559
95+%
MFCD00160700
2,7-NAPHTHYRIDINE-3-CARBOXYLIC ACID
CAS:250674-48-7
Formula: O=C(C1=CC2=C(C=N1)C=NC=C2)O
BD295281
95+%
MFCD17015928
2,7-NAPHTHYRIDINE-4-CARBALDEHYDE
CAS:10273-40-2
Formula: O=CC1=C2C=CN=CC2=CN=C1
BD216994
97%
MFCD15526648
2,8,9-TRIOXA-5-AZA-1-BORABICYCLO[3.3.3]UNDECANE
CAS:283-56-7
Formula: C1CN2CCOB(O1)OCC2
BD155166
97%
MFCD00003272
2,8-BIS(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL) DIBENZO[B,D]FURAN
CAS:1197989-83-5
Formula: CC1(C)C(C)(C)OB(C2=CC=C(OC3=CC=C(B4OC(C)(C)C(C)(C)O4)C=C35)C5=C2)O1
BD314350
95+%
MFCD28396385
2,8-BIS(9H-CARBAZOL-9-YL)DIBENZOTHIOPHENE
CAS:913738-04-2
Formula: C12=CC=C(N3C4=C(C5=C3C=CC=C5)C=CC=C4)C=C1C6=CC(N7C8=C(C9=C7C=CC=C9)C=CC=C8)=CC=C6S2
BD306430
95+%
MFCD28291905
2,8-BIS(TRIFLUOROMETHYL)-4-BROMOQUINOLINE
CAS:35853-45-3
Formula: FC(C1=C2N=C(C(F)(F)F)C=C(Br)C2=CC=C1)(F)F
BD33379
95+%
2,8-BIS(TRIFLUOROMETHYL)-4-VINYLQUINOLINE
CAS:1031928-53-6
Formula: C=CC1=CC(C(F)(F)F)=NC2=C(C(F)(F)F)C=CC=C12
BD332450
95+%
MFCD10703428
2,8-BIS(TRIFLUOROMETHYL)QUINOLIN-4-OL
CAS:35853-41-9
Formula: C1=CC=C(C2=C1C(=O)C=C(N2)C(F)(F)F)C(F)(F)F
BD13543
95%
MFCD00075091
2,8-BIS(TRIFLUOROMETHYL)QUINOLINE-4-CARBOXYLIC ACID
CAS:35853-50-0
Formula: O=C(C1=CC(C(F)(F)F)=NC2=C(C(F)(F)F)C=CC=C12)O
BD162100
98%
MFCD09840196
2,8-DIAMINO-9-(3,4-DIHYDROXY-5-(HYDROXYMETHYL) TETRAHYDROFURAN-2-YL)-1H-PURIN-6(9H)-ONE
CAS:3868-32-4
Formula: O=C1NC(N)=NC2=C1N=C(N)N2C3OC(CO)C(O)C3O
BD12235
97%
MFCD00036759
2,8-DIAMINONONANEDIOIC ACID
CAS:98951-66-7
Formula: NC(CCCCCC(N)C(O)=O)C(O)=O
BD35557
95+%
MFCD03006001
2,8-DIAZASPIRO[4.5]DECAN-1-ONE
CAS:546086-95-7
Formula: O=C1NCCC12CCNCC2
BD162554
95+%
MFCD12406551
2,8-DIAZASPIRO[4.5]DECAN-1-ONE HYDROCHLORIDE
CAS:832710-65-3
Formula: Cl.O=C1NCCC11CCNCC1
BD170251
97%
2,8-DIAZASPIRO[4.5]DECAN-3-ONE
CAS:561314-57-6
Formula: O=C1NCC2(CCNCC2)C1
BD213132
95+%
MFCD11044206
2,8-DIAZASPIRO[4.5]DECAN-3-ONE 2,2,2-TRIFLUOROACETATE
CAS:1242339-85-0
Formula: O=C1NCC2(CCNCC2)C1.O=C(O)C(F)(F)F
BD589734
97%
MFCD16039369
2,8-DIAZASPIRO[4.5]DECAN-3-ONE HYDROCHLORIDE
CAS:945892-88-6
Formula: O=C1NCC2(CCNCC2)C1.[H]Cl
BD320757
95+%
MFCD11520496
2,8-DIAZASPIRO[4.5]DECANE
CAS:176-67-0
Formula: C1NCCC12CCNCC2
BD215909
95+%
MFCD16877059
2,8-DIAZASPIRO[4.5]DECANE HYDROCHLORIDE
CAS:1159826-64-8
Formula: [H]Cl.C1NCCC12CCNCC2
BD215910
95+%
MFCD10700109
2,8-DIAZASPIRO[4.5]DECANE-1,3-DIONE
CAS:2079-25-6
Formula: O=C1NC(CC12CCNCC2)=O
BD315451
95+%
MFCD12198836
2,8-DIAZASPIRO[4.5]DECANE-1,3-DIONE HYDROCHLORIDE
CAS:2696-03-9
Formula: O=C1NC(CC12CCNCC2)=O.[H]Cl
BD301258
97%
2,8-DIAZASPIRO[5.5]UNDECAN-1-ONE HYDROCHLORIDE
CAS:1181265-43-9
Formula: O=C1NCCCC12CNCCC2.[H]Cl
BD564359
97%
2,8-DIAZASPIRO[5.5]UNDECANE
CAS:180-50-7
Formula: C1NCCCC12CNCCC2
BD249405
95+%
MFCD11043254
2,8-DIAZASPIRO[5.5]UNDECANE DIHYDROCHLORIDE
CAS:91188-28-2
Formula: [H]Cl.[H]Cl.C1NCCCC12CNCCC2
BD294365
95+%
2,8-DIAZASPIRO[5.5]UNDECANE-1,7-DIONE
CAS:84296-41-3
Formula: O=C1NCCCC12C(NCCC2)=O
BD246125
95+%
MFCD03410229
2,8-DIBROMO-[1,2,4]TRIAZOLO[1,5-A]PYRIDINE
CAS:1257705-07-9
Formula: BrC1=CC=CN2C1=NC(Br)=N2
BD567231
97%
2,8-DIBROMO-1,5-NAPHTHYRIDINE
CAS:1363380-58-8
Formula: BrC1=C2N=C(Br)C=CC2=NC=C1
BD301848
95+%
2,8-DIBROMO-4-(TRIFLUOROMETHYL)QUINOLINE-3-CARBOXYLIC ACID
CAS:663193-43-9
Formula: O=C(C1=C(C(F)(F)F)C2=CC=CC(Br)=C2N=C1Br)O
BD283755
95+%
2,8-DIBROMOCHRYSENE
CAS:50637-63-3
Formula: BrC1=CC2=CC=C3C4=CC=C(Br)C=C4C=CC3=C2C=C1
BD254298
95+%
2,8-DIBROMODIBENZO[B,D]FURAN
CAS:10016-52-1
Formula: BrC1=CC=C(OC2=CC=C(Br)C=C23)C3=C1
BD221955
97+%
MFCD00093683
2,8-DIBROMODIBENZO[B,D]THIOPHENE
CAS:31574-87-5
Formula: BrC1=CC=C2C(C3=CC(Br)=CC=C3S2)=C1
BD14328
97%
MFCD00092755
2,8-DIBROMOINDENO[1,2-B]FLUORENE-6,12-DIONE
CAS:853234-57-8
Formula: O=C1C2=C(C3=CC(C4=O)=C(C5=C4C=C(Br)C=C5)C=C31)C=CC(Br)=C2
BD331729
95+%
MFCD22571712
2,8-DIBROMOQUINOLINE
CAS:871507-79-8
Formula: BrC1=NC2=C(C=CC=C2Br)C=C1
BD234988
98%
MFCD09788633
2,8-DICHLORO-1,5-NAPHTHYRIDINE
CAS:28252-76-8
Formula: ClC1=C2N=C(Cl)C=CC2=NC=C1
BD301849
95+%
2,8-DICHLORO-1-OCTENE
CAS:485320-13-6
Formula: C=C(Cl)CCCCCCCl
BD308185
95+%
MFCD00671830
2,8-DICHLORO-4-METHYL-5-((TRIFLUOROMETHYL)SULFONYL)QUINOLINE
CAS:1447958-50-0
Formula: O=S(C1=C2C(C)=CC(Cl)=NC2=C(Cl)C=C1)(C(F)(F)F)=O
BD617637
97%
2,8-DICHLORO-4-METHYLQUINOLINE
CAS:815583-95-0
Formula: CC1=CC(Cl)=NC2=C(Cl)C=CC=C12
BD302998
95+%
MFCD12403125
2,8-DICHLORO-6,12-DIPHENYLDIBENZO[B,F][1,5]DIAZOCINE
CAS:3646-61-5
Formula: ClC1=CC=C2/N=C(C3=CC=CC=C3)\C4=CC(Cl)=CC=C4/N=C(C5=CC=CC=C5)\C2=C1
BD287619
95+%
2,8-DICHLORO-6-FLUOROQUINAZOLIN-4(3H)-ONE
CAS:1702815-68-6
Formula: O=C1NC(Cl)=NC2=C1C=C(F)C=C2Cl
BD751806
97%
2,8-DICHLORO-6-FLUOROQUINAZOLIN-4-AMINE
CAS:N/A
Formula: NC1=C2C=C(F)C=C(Cl)C2=NC(Cl)=N1
BD751805
97%
2,8-DICHLORO-6-FLUOROQUINAZOLINE
CAS:N/A
Formula: FC1=CC2=CN=C(Cl)N=C2C(Cl)=C1
BD752476
97%
2,8-DICHLORO-6-METHYLQUINOLIN-5-AMINE
CAS:1071675-48-3
Formula: NC1=C2C=CC(Cl)=NC2=C(Cl)C=C1C
BD629290
97%
2,8-DICHLORO-TRICYCLO[8.2.2.24,7]HEXADECA-4,6,10,12,13,15-HEXAENE
CAS:136002-57-8
Formula: ClC1C(C=C2)=CC=C2CC(Cl)C(C=C3)=CC=C3C1
BD315530
95+%
2,8-DICHLOROPYRIMIDO[5,4-D]PYRIMIDINE
CAS:189747-34-0
BD149864
95+%
MFCD09702010
2,8-DICHLOROQUINAZOLIN-4-AMINE
CAS:1107694-84-7
Formula: NC1=C2C=CC=C(Cl)C2=NC(Cl)=N1
BD246672
97%
MFCD11858259
2,8-DICHLOROQUINAZOLINE
CAS:67092-20-0
Formula: ClC1=NC2=C(Cl)C=CC=C2C=N1
BD167239
97%
MFCD13193682
2,8-DICHLOROQUINOLINE
CAS:4470-83-1
Formula: ClC1=C2N=C(Cl)C=CC2=CC=C1
BD68682
98%
MFCD00832077
2,8-DICHLOROQUINOLINE-3-CARBALDEHYDE
CAS:144918-96-7
Formula: O=CC1=CC2=CC=CC(Cl)=C2N=C1Cl
BD161521
97%
MFCD06202349
2,8-DICHLOROQUINOLINE-3-CARBOXYLIC ACID
CAS:1017172-90-5
Formula: O=C(C1=CC2=CC=CC(Cl)=C2N=C1Cl)O
BD605425
97%
2,8-DICHLOROQUINOXALINE
CAS:120258-69-7
Formula: ClC2=NC1=C(C=CC=C1N=C2)Cl
BD161320
98%
MFCD11846471
2,8-DIHYDROXYQUINOLINE
CAS:15450-76-7
Formula: C2=CC1=C(NC(C=C1)=O)C(=C2)O
BD11586
98%
MFCD00216696
2,8-DIIODODIBENZO[B,D]FURAN
CAS:5943-11-3
Formula: IC1=CC=C(OC2=CC=C(I)C=C23)C3=C1
BD387371
95+%
MFCD00094363
2,8-DIIODODIBENZOTHIOPHENE
CAS:105404-91-9
Formula: IC1=CC=C2C(C3=CC(I)=CC=C3S2)=C1
BD322099
95+%
2,8-DIMERCAPTO-7H-PURIN-6-OL
CAS:15986-32-0
Formula: OC1=C2NC(S)=NC2=NC(S)=N1
BD68683
95+%
MFCD00047144
2,8-DIMETHYL-[1,2,4]TRIAZOLO[1,5-A]PYRIDIN-6-AMINE
CAS:1417637-80-9
Formula: NC1=CN2C(C(C)=C1)=NC(C)=N2
BD300574
95+%
2,8-DIMETHYL-1,2,3,4-TETRAHYDROISOQUINOLINE
CAS:1789020-33-2
Formula: CC1=CC=CC2=C1CN(C)CC2
BD764266
97%
2,8-DIMETHYL-1-(2-OXOPROPYL) QUINOLIN-4(1H)-ONE
CAS:1209561-68-1
Formula: O=C1C=C(C)N(CC(C)=O)C2=C1C=CC=C2C
BD607486
97%
2,8-DIMETHYL-2,3,4,4A,5,9B-HEXAHYDRO-1H-PYRIDO[4,3-B]INDOLE
CAS:17411-19-7
Formula: CC1=CC2=C(NC3C2CN(C)CC3)C=C1
BD124288
95+%
2,8-DIMETHYL-2,3,4,4A,5,9B-HEXAHYDRO-1H-PYRIDO[4,3-B]INDOLE DIHYDROCHLORIDE
CAS:85202-17-1
Formula: CC1=CC2=C(NC3C2CN(C)CC3)C=C1.[H]Cl.[H]Cl
BD291860
95+%
MFCD20926413
2,8-DIMETHYL-2,3,4,5-TETRAHYDRO-1H-PYRIDO[4,3-B]INDOLE
CAS:19686-05-6
Formula: CC1=CC2=C(NC3=C2CN(C)CC3)C=C1
BD158285
95+%
MFCD00452533
2,8-DIMETHYL-4H-PYRIDO[1,2-A]PYRIMIDIN-4-ONE
CAS:30247-64-4
Formula: O=C1C=C(C)N=C2N1C=CC(C)=C2
BD594080
97%
2,8-DIMETHYL-5,6,7,8-TETRAHYDRO-[1,2,4]TRIAZOLO[1,5-A]PYRAZINE
CAS:1956379-10-4
Formula: CC1C2=NC(C)=NN2CCN1
BD443869
97%
MFCD29059169
2,8-DIMETHYL-5-(2-(6-METHYLPYRIDIN-3-YL)ETHYL)-2,3,4,5-TETRAHYDRO-1H-PYRIDO[4,3-B]INDOLE
CAS:3613-73-8
Formula: CC1=CC2=C(C=C1)N(C3=C2CN(CC3)C)CCC4=CN=C(C=C4)C
BD163963
97%
MFCD00387540
2,8-DIMETHYL-7,8-DIHYDRO-[1,2,4]TRIAZOLO[1,5-A]PYRAZIN-6(5H)-ONE
CAS:1956377-47-1
Formula: O=C1NC(C)C2=NC(C)=NN2C1
BD444585
97%
2,8-DIMETHYL-N-(O-TOLYL)-1,2,3,4-TETRAHYDROQUINOLIN-4-AMINE
CAS:54306-48-8
Formula: CC1=CC=CC=C1NC2CC(C)NC3=C2C=CC=C3C
BD508725
97%
MFCD00183925
2,8-DIMETHYLIMIDAZO[1,2-A]PYRIDINE-3-CARBALDEHYDE
CAS:820245-85-0
Formula: O=CC1=C(C)N=C2C(C)=CC=CN21
BD0042
95+%
MFCD03789000
2,8-DIMETHYLIMIDAZO[1,2-A]PYRIDINE-3-CARBOXYLIC ACID
CAS:874605-59-1
Formula: O=C(C1=C(C)N=C2C(C)=CC=CN21)O
BD68692
95+%
MFCD00269632
2,8-DIMETHYLNONANE-4,6-DIONE
CAS:7307-08-6
Formula: CC(C)CC(CC(CC(C)C)=O)=O
BD262151
97%
MFCD19301657
2,8-DIMETHYLQUINAZOLIN-4(1H)-ONE
CAS:172462-90-7
Formula: O=C1N=C(C)NC2=C1C=CC=C2C
BD259942
95+%
MFCD11110220
2,8-DIMETHYLQUINOLIN-4(1H)-ONE
CAS:52481-91-1
Formula: O=C1C=C(C)NC2=C1C=CC=C2C
BD68687
95+%
MFCD00100264
2,8-DIMETHYLQUINOLIN-4-OL
CAS:15644-80-1
Formula: OC1=CC(C)=NC2=C(C)C=CC=C12
BD13020
95+%
2,8-DIMETHYLQUINOLIN-5-AMINE
CAS:64485-52-5
Formula: NC1=C2C=CC(C)=NC2=C(C)C=C1
BD587910
97%
2,8-DIMETHYLQUINOLIN-6-AMINE
CAS:38549-43-8
Formula: NC1=CC(C)=C2N=C(C)C=CC2=C1
BD587650
97%
2,8-DIMETHYLQUINOLIN-7-AMINE
CAS:1379324-75-0
Formula: NC1=CC=C2C=CC(C)=NC2=C1C
BD586973
97%
2,8-DIMETHYLQUINOLIN-7-OL
CAS:1412256-52-0
Formula: OC1=CC=C2C=CC(C)=NC2=C1C
BD587063
97%
2,8-DIMETHYLQUINOLINE
CAS:1463-17-8
Formula: CC1=NC2=C(C=CC=C2C)C=C1
BD13007
97%
MFCD00010091
2,8-DIMETHYLQUINOLINE-3-CARBOXYLIC ACID
CAS:387361-10-6
Formula: O=C(C1=CC2=CC=CC(C)=C2N=C1C)O
BD183770
95+%
2,8-DIMETHYLQUINOLINE-4-CARBOHYDRAZIDE
CAS:590376-58-2
Formula: O=C(C1=CC(C)=NC2=C(C)C=CC=C12)NN
BD177241
97%
2,8-DIMETHYLQUINOLINE-4-CARBOXYLIC ACID
CAS:609822-00-6
Formula: O=C(C1=CC(C)=NC2=C(C)C=CC=C12)O
BD172588
95+%
2,8-DIMETHYLQUINOLINE-6-CARBOXAMIDE
CAS:1501405-66-8
Formula: O=C(C1=CC(C)=C2N=C(C)C=CC2=C1)N
BD587215
97%
2,8-DIMETHYLQUINOLINE-6-CARBOXYLIC ACID
CAS:1368259-21-5
Formula: O=C(C1=CC(C)=C2N=C(C)C=CC2=C1)O
BD586859
95%
2,8-DIOXA-5-AZASPIRO[3.5]NONANE OXALATE
CAS:1392804-64-6
Formula: O=C(O)C(O)=O.C1OCC12NCCOC2
BD301496
95+%
2,8-DIOXADISPIRO[3.1.3.1]DECANE
CAS:54368-44-4
Formula: C1OCC12CC3(C2)COC3
BD261249
95+%
MFCD18909993
2,9-BIS(2,4-DICHLOROPHENETHYL)ANTHRA[2,1,9-DEF:6,5,10-D'E'F']DIISOQUINOLINE-1,3,8,10(2H,9H)-TETRAONE
CAS:1956386-08-5
BD438462
97%
MFCD28291908
2,9-BIS(2,5-DI-TERT-BUTYLPHENYL)ANTHRA[2,1,9-DEF:6,5,10-D'E'F']DIISOQUINOLINE-1,3,8,10(2H,9H)-TETRAONE
CAS:83054-80-2
BD449000
97%
MFCD00010562
2,9-BIS(2,6-DICHLOROPHENETHYL)ANTHRA[2,1,9-DEF:6,5,10-D'E'F']DIISOQUINOLINE-1,3,8,10(2H,9H)-TETRAONE
CAS:1956334-49-8
BD438463
97%
MFCD28291909
2,9-BIS(2-(THIOPHEN-2-YL)ETHYL)ANTHRA[2,1,9-DEF:6,5,10-D'E'F']DIISOQUINOLINE-1,3,8,10(2H,9H)-TETRAONE
CAS:1559069-50-9
Formula: O=C(N1CCC2=CC=CS2)C(C3=C(C1=O)C=CC4=C53)=CC=C5C6=CC=C(C7=O)C8=C6C4=CC=C8C(N7CCC9=CC=CS9)=O
BD438485
97%
MFCD28291971
2,9-BIS(4-CHLOROPHENETHYL)ANTHRA[2,1,9-DEF:6,5,10-D'E'F']DIISOQUINOLINE-1,3,8,10(2H,9H)-TETRAONE
CAS:215726-51-5
BD449001
97%
MFCD23704417
2,9-BIS(4-METHOXYPHENETHYL) ANTHRA[2,1,9-DEF:6,5,10-D'E'F']DIISOQUINOLINE-1,3,8,10(2H,9H)-TETRAONE
CAS:119215-14-4
BD449018
97%
MFCD28291945
2,9-DI(PENTAN-3-YL)ANTHRA[2,1,9-DEF:6,5,10-D'E'F']DIISOQUINOLINE-1,3,8,10(2H,9H)-TETRAONE
CAS:110590-81-3
Formula: O=C1N(C(CC)CC)C(C2=CC=C(C3=CC=C4C(N(C(CC)CC)C(C5=CC=C6C3=C54)=O)=O)C7=C6C=CC1=C27)=O
BD68700
95+%
MFCD00799275
2,9-DI(PYRIDIN-2-YL)-1,10-PHENANTHROLINE
CAS:773883-32-2
Formula: C12=NC(C3=NC=CC=C3)=CC=C1C=CC4=CC=C(C5=NC=CC=C5)N=C24
BD262659
95+%
2,9-DI(TRIDECAN-7-YL)ANTHRA[2,1,9-DEF:6,5,10-D'E'F']DIISOQUINOLINE-1,3,8,10(2H,3AH,9H,12BH)-TETRAONE
CAS:N/A
Formula: O=C(C1C2=C3C=CC(C2=C4C=C1)C5=CC=C6C7=C5C4=CC=C7C(N(C(CCCCCC)CCCCCC)C6=O)=O)N(C(CCCCCC)CCCCCC)C3=O
BD00772952
97%
n/a
2,9-DI(TRIDECAN-7-YL)ANTHRA[2,1,9-DEF:6,5,10-D'E'F']DIISOQUINOLINE-1,3,8,10(2H,9H)-TETRAONE
CAS:110590-84-6
Formula: O=C1N(C(CCCCCC)CCCCCC)C(C2=CC=C(C3=CC=C4C(N(C(CCCCCC)CCCCCC)C(C5=CC=C6C3=C54)=O)=O)C7=C6C=CC1=C27)=O
BD141820
95+%
MFCD08702668
2,9-DI-SEC-BUTYLANTHRA[2,1,9-DEF:6,5,10-D'E'F']DIISOQUINOLINE-1,3,8,10(2H,9H)-TETRAONE
CAS:N/A
Formula: O=C1C2=C3C4=C(C=C2)C2C5=C6C(C(=O)N(C(=O)C6=CC=2)C(CC)C)=CC=C5C4=CC=C3C(=O)N1C(CC)C
BD00757434
95%
n/a
2,9-DIAZASPIRO[5.5]UNDECAN-1-ONE HYDROCHLORIDE
CAS:1187173-73-4
Formula: O=C1NCCCC12CCNCC2.[H]Cl
BD170422
95+%
MFCD08461145
2,9-DIAZASPIRO[6.6]TRIDECANE DIHYDROCHLORIDE
CAS:1160801-01-3
Formula: [H]Cl.[H]Cl.C1NCCCCC12CNCCCC2
BD351532
95+%
MFCD18381990
2,9-DIBROMO-1,10-PHENANTHROLINE
CAS:39069-02-8
Formula: BrC1=CC=C(C=CC2=CC=C(Br)N=C32)C3=N1
BD218337
97%
MFCD16038623
2,9-DIBUTYL-1,10-PHENANTHROLINE
CAS:85575-93-5
Formula: CCCCC1=CC=C(C=CC2=CC=C(CCCC)N=C32)C3=N1
BD68708
97%
2,9-DICHLORO-1,10-PHENANTHROLINE
CAS:29176-55-4
Formula: ClC1=CC=C(C=CC2=CC=C(Cl)N=C32)C3=N1
BD68702
95+%
MFCD02084186
2,9-DICHLORO-1-NONENE
CAS:485320-14-7
Formula: C=C(Cl)CCCCCCCCl
BD308186
95+%
MFCD00671831
2,9-DICHLORO-4,7-DIPHENYL-1,10-PHENANTHROLINE
CAS:1229012-68-3
Formula: ClC1=CC(C2=CC=CC=C2)=C(C=CC3=C(C4=CC=CC=C4)C=C(Cl)N=C53)C5=N1
BD333749
95+%
MFCD26398601
2,9-DIHEPTYLANTHRA[2,1,9-DEF:6,5,10-D'E'F']DIISOQUINOLINE-1,3,8,10(2H,9H)-TETRAONE
CAS:95689-91-1
Formula: O=C(C1=CC=C(C2=CC=C(C3=C2C4=CC=C3C(N5CCCCCCC)=O)C5=O)C6=C4C=CC(C7=O)=C16)N7CCCCCCC
BD141934
97%
MFCD00151604
2,9-DIMETHYL-1,10-PHENANTHROLINE
CAS:484-11-7
Formula: CC1=CC=C(C=CC2=CC=C(C)N=C32)C3=N1
BD144110
98%
2,9-DIMETHYL-1,10-PHENANTHROLINE HYDROCHLORIDE HYDRATE
CAS:303136-82-5
Formula: CC1=CC=C(C=CC2=CC=C(C)N=C32)C3=N1.[H]Cl.[H]O[H]
BD435002
95+%
MFCD00150062
2,9-DIMETHYL-4,7-DIPHENYL-1,10-PHENANTHROLINE
CAS:4733-39-5
Formula: CC1=CC(C2=CC=CC=C2)=C(C=CC3=C(C4=CC=CC=C4)C=C(C)N=C53)C5=N1
BD1789
98%
MFCD00004972
2,9-DIMETHYLANTHRA[2,1,9-DEF:6,5,10-D'E'F']DIISOQUINOLINE-1,3,8,10(2H,9H)-TETRAONE
CAS:5521-31-3
Formula: O=C1N(C(C2=CC=C(C3=C4C=CC1=C23)C5=CC=C6C(N(C(C7=CC=C4C5=C76)=O)C)=O)=O)C
BD142274
97%
MFCD00071975
2,9-DIMETHYLQUINOLINO[2,3-B]ACRIDINE-7,14(5H,12H)-DIONE
CAS:980-26-7
Formula: C3=C2C(C1=CC(=CC=C1NC2=CC4=C3NC5=C(C4=O)C=C(C)C=C5)C)=O
BD148031
95+%
MFCD00071968
2,9-DIPENTYLANTHRA[2,1,9-DEF:6,5,10-D'E'F']DIISOQUINOLINE-1,3,8,10(2H,9H)-TETRAONE
CAS:76372-75-3
Formula: O=C1N(C(C2=C3C(C4=CC=C31)=C(C5=CC=C6C7=C5C4=CC=C7C(N(C6=O)CCCCC)=O)C=C2)=O)CCCCC
BD140621
97%
MFCD08276855
2,9-DIPHENYLANTHRA[2,1,9-DEF:6,5,10-D'E'F']DIISOQUINOLINE-1,3,8,10(2H,9H)-TETRAONE
CAS:128-65-4
Formula: O=C1N(C2=CC=CC=C2)C(C3=CC=C(C4=CC=C5C(N(C6=CC=CC=C6)C(C7=CC=C8C4=C75)=O)=O)C9=C8C=CC1=C39)=O
BD142335
97%
2-((((1S,2R,5S)-2-ISOPROPYL-5-METHYLCYCLOHEXYL)OXY)CARBONYL)BENZOIC ACID
CAS:53623-42-0
Formula: O=C(O)C1=CC=CC=C1C(O[C@@H]2[C@@H](C(C)C)CC[C@H](C)C2)=O
BD140287
95+%
2-((((9H-FLUOREN-9-YL)METHOXY)CARBONYL)(2-(TERT-BUTOXY)ETHYL)AMINO)ACETIC ACID
CAS:141743-30-8
Formula: O=C(O)CN(C(OCC1C2=CC=CC=C2C3=CC=CC=C13)=O)CCOC(C)(C)C
BD130831
97%
2-((((9H-FLUOREN-9-YL)METHOXY)CARBONYL)(3-((TERT-BUTOXYCARBONYL)AMINO)PROPYL)AMINO)ACETIC ACID
CAS:143192-31-8
Formula: O=C(O)CN(C(OCC1C2=CC=CC=C2C3=CC=CC=C13)=O)CCCNC(OC(C)(C)C)=O
BD131351
97%
2-((((9H-FLUOREN-9-YL)METHOXY)CARBONYL)(4-((TERT-BUTOXYCARBONYL)AMINO)BUTYL)AMINO)ACETIC ACID
CAS:171856-09-0
Formula: O=C(O)CN(C(OCC1C2=C(C3=C1C=CC=C3)C=CC=C2)=O)CCCCNC(OC(C)(C)C)=O
BD131352
97%
2-((((9H-FLUOREN-9-YL)METHOXY)CARBONYL)(4-FLUOROPHENYL)AMINO)ACETIC ACID
CAS:678988-18-6
Formula: O=C(O)CN(C(OCC1C2=CC=CC=C2C3=CC=CC=C13)=O)C4=CC=C(F)C=C4
BD379715
95+%
MFCD01320845
2-((((9H-FLUOREN-9-YL)METHOXY)CARBONYL)(BENZYL)AMINO)ACETIC ACID
CAS:141743-13-7
Formula: O=C(O)CN(C(OCC1C2=C(C3=C1C=CC=C3)C=CC=C2)=O)CC4=CC=CC=C4
BD243110
95+%
MFCD04112686
2-((((9H-FLUOREN-9-YL)METHOXY)CARBONYL)(CYCLOPENT-2-EN-1-YL)AMINO)PROPANOIC ACID
CAS:1219148-79-4
Formula: CC(C(O)=O)N(C(OCC1C2=CC=CC=C2C3=CC=CC=C13)=O)C4C=CCC4
BD555678
97%
MFCD02682461
2-((((9H-FLUOREN-9-YL)METHOXY)CARBONYL)(METHYL)AMINO)-3-PHENYLPROPANOIC ACID
CAS:N/A
Formula: O=C(C(CC1C=CC=CC=1)N(C)C(=O)OCC1C2C=CC=CC=2C2C=CC=CC1=2)O
BD00748497
95%
2-((((9H-FLUOREN-9-YL)METHOXY)CARBONYL)(METHYL)AMINO)ACETIC ACID HYDRATE
CAS:212651-47-3
Formula: O.C(=O)(OCC2C1=CC=CC=C1C3=CC=CC=C23)N(C)CC(=O)O
BD215142
98%
MFCD00180724
2-((((9H-FLUOREN-9-YL)METHOXY)CARBONYL)(PROP-2-YN-1-YL)AMINO)ACETIC ACID
CAS:1033622-38-6
Formula: O=C(O)CN(C(OCC1C2=C(C3=C1C=CC=C3)C=CC=C2)=O)CC#C
BD389507
95+%
MFCD17976767
2-((((9H-FLUOREN-9-YL)METHOXY)CARBONYL)(PROPYL)AMINO)ACETIC ACID
CAS:1310680-42-2
Formula: O=C(O)CN(C(OCC1C2=CC=CC=C2C3=CC=CC=C13)=O)CCC
BD582120
97%
MFCD18328449
2-((((9H-FLUOREN-9-YL)METHOXY)CARBONYL)(THIOPHEN-2-YL)AMINO)ACETIC ACID
CAS:211682-11-0
Formula: O=C(O)CN(C(OCC1C2=CC=CC=C2C3=CC=CC=C13)=O)C4=CC=CS4
BD182280
95+%
MFCD08458753
2-((((9H-FLUOREN-9-YL)METHOXY)CARBONYL)AMINO)-1-(TERT-BUTOXYCARBONYL)PIPERIDINE-4-CARBOXYLIC ACID
CAS:1246738-31-7
Formula: O=C(C1CC(NC(OCC2C3=C(C4=C2C=CC=C4)C=CC=C3)=O)N(C(OC(C)(C)C)=O)CC1)O
BD589759
97%
MFCD17167329
2-((((9H-FLUOREN-9-YL)METHOXY)CARBONYL)AMINO)-2-((TERT-BUTOXYCARBONYL)AMINO)ACETIC ACID
CAS:176039-39-7
Formula: O=C(O)C(NC(OCC1C2=C(C3=C1C=CC=C3)C=CC=C2)=O)NC(OC(C)(C)C)=O
BD47958
97%
2-((((9H-FLUOREN-9-YL)METHOXY)CARBONYL)AMINO)-2-(1,1-DIOXIDOTETRAHYDRO-2H-THIOPYRAN-4-YL)ACETIC ACID
CAS:369402-98-2
Formula: O=C(O)C(NC(OCC1C2=C(C3=C1C=CC=C3)C=CC=C2)=O)C(CC4)CCS4(=O)=O
BD273411
95+%
2-((((9H-FLUOREN-9-YL)METHOXY)CARBONYL)AMINO)-2-(1-(TERT-BUTOXYCARBONYL)PIPERIDIN-4-YL)ACETIC ACID
CAS:313051-96-6
Formula: O=C(O)C(NC(OCC1C2=C(C3=C1C=CC=C3)C=CC=C2)=O)C4CCN(C(OC(C)(C)C)=O)CC4
BD273418
97%
n/a
2-((((9H-FLUOREN-9-YL)METHOXY)CARBONYL)AMINO)-2-(4-HYDROXYPHENYL)ACETIC ACID
CAS:879500-54-6
Formula: O=C(O)C(NC(OCC1C2=C(C3=C1C=CC=C3)C=CC=C2)=O)C4=CC=C(O)C=C4
BD35237
95+%
MFCD09841924
2-((((9H-FLUOREN-9-YL)METHOXY)CARBONYL)AMINO)-2-(BUT-3-EN-1-YL)HEX-5-ENOIC ACID
CAS:1311992-98-9
Formula: C=CCCC(CCC=C)(NC(OCC1C2=C(C3=C1C=CC=C3)C=CC=C2)=O)C(O)=O
BD290616
97%
2-((((9H-FLUOREN-9-YL)METHOXY)CARBONYL)AMINO)-2-(PENT-4-EN-1-YL)DEC-9-ENOIC ACID
CAS:1211504-14-1
Formula: OC(=O)C(CCCCCCC=C)(CCCC=C)NC(=O)OCC1C2=CC=CC=C2C2=CC=CC=C12
BD234532
95+%
MFCD14586314
2-((((9H-FLUOREN-9-YL)METHOXY)CARBONYL)AMINO)-2-(PENT-4-EN-1-YL)HEPT-6-ENOIC ACID
CAS:1068435-19-7
Formula: OC(=O)C(CCCC=C)(CCCC=C)NC(=O)OCC1C2=CC=CC=C2C2=CC=CC=C12
BD234521
95+%
MFCD12925762
2-((((9H-FLUOREN-9-YL)METHOXY)CARBONYL)AMINO)-2-ALLYLPENT-4-ENOIC ACID
CAS:1311992-97-8
Formula: C=CCC(CC=C)(NC(OCC1C2=C(C3=C1C=CC=C3)C=CC=C2)=O)C(O)=O
BD290615
95+%
2-((((9H-FLUOREN-9-YL)METHOXY)CARBONYL)AMINO)-2-BUTYLHEXANOIC ACID
CAS:218926-48-8
Formula: CCCCC(CCCC)(NC(OCC1C2=C(C3=C1C=CC=C3)C=CC=C2)=O)C(O)=O
BD332020
95+%
MFCD02092978
2-((((9H-FLUOREN-9-YL)METHOXY)CARBONYL)AMINO)-2-METHOXYACETIC ACID
CAS:156059-09-5
Formula: O=C(O)C(OC)NC(OCC1C2=CC=CC=C2C3=CC=CC=C13)=O
BD182227
95+%
MFCD05663764
2-((((9H-FLUOREN-9-YL)METHOXY)CARBONYL)AMINO)-2-METHYLHEPT-6-ENOIC ACID
CAS:1448775-45-8
Formula: C=CCCCC(C)(NC(OCC1C2=C(C3=C1C=CC=C3)C=CC=C2)=O)C(O)=O
BD587161
97%
2-((((9H-FLUOREN-9-YL)METHOXY)CARBONYL)AMINO)-2-PHENYLACETIC ACID
CAS:163883-97-4
Formula: O=C(O)C(NC(OCC1C2=C(C3=C1C=CC=C3)C=CC=C2)=O)C4=CC=CC=C4
BD17533
95+%
2-((((9H-FLUOREN-9-YL)METHOXY)CARBONYL)AMINO)-2-PROPYLPENTANOIC ACID
CAS:218926-47-7
Formula: CCCC(CCC)(NC(OCC1C2=C(C3=C1C=CC=C3)C=CC=C2)=O)C(O)=O
BD131093
97%
MFCD02092979
2-((((9H-FLUOREN-9-YL)METHOXY)CARBONYL)AMINO)-3,3-DIPHENYLPROPANOIC ACID
CAS:839719-72-1
Formula: O=C(O)C(NC(OCC1C2=C(C3=C1C=CC=C3)C=CC=C2)=O)C(C4=CC=CC=C4)C5=CC=CC=C5
BD207974
95+%
2-((((9H-FLUOREN-9-YL)METHOXY)CARBONYL)AMINO)-3,4,5-TRIMETHOXYBENZOIC ACID
CAS:1185303-03-0
Formula: O=C(O)C1=CC(OC)=C(OC)C(OC)=C1NC(OCC2C3=CC=CC=C3C4=CC=CC=C24)=O
BD555692
97%
MFCD02682244
2-((((9H-FLUOREN-9-YL)METHOXY)CARBONYL)AMINO)-3,5-DIMETHYLBENZOIC ACID
CAS:1185302-84-4
Formula: O=C(O)C1=CC(C)=CC(C)=C1NC(OCC2C3=CC=CC=C3C4=CC=CC=C24)=O
BD602300
97%
MFCD02682185
2-((((9H-FLUOREN-9-YL)METHOXY)CARBONYL)AMINO)-3-(1-(TERT-BUTOXYCARBONYL)PIPERIDIN-3-YL)PROPANOIC ACID
CAS:457060-97-8
Formula: O=C(O)C(NC(OCC1C2=C(C3=C1C=CC=C3)C=CC=C2)=O)CC4CN(C(OC(C)(C)C)=O)CCC4
BD273452
95+%
2-((((9H-FLUOREN-9-YL)METHOXY)CARBONYL)AMINO)-3-(1-(TERT-BUTOXYCARBONYL)PIPERIDIN-4-YL)PROPANOIC ACID
CAS:313052-02-7
BD143188
95+%
MFCD01860501
2-((((9H-FLUOREN-9-YL)METHOXY)CARBONYL)AMINO)-3-(1-METHYL-1H-INDOL-3-YL)PROPANOIC ACID
CAS:138775-51-6
Formula: O=C(O)C(NC(OCC1C2=C(C3=C1C=CC=C3)C=CC=C2)=O)CC4=CN(C)C5=C4C=CC=C5
BD246679
95+%
2-((((9H-FLUOREN-9-YL)METHOXY)CARBONYL)AMINO)-3-(1H-INDOL-4-YL)PROPANOIC ACID
CAS:1464091-37-9
Formula: O=C(O)C(NC(OCC1C2=CC=CC=C2C3=CC=CC=C13)=O)CC4=CC=CC5=C4C=CN5
BD437399
97%
MFCD26406715
2-((((9H-FLUOREN-9-YL)METHOXY)CARBONYL)AMINO)-3-(1H-PYRROLO[2,3-B]PYRIDIN-3-YL)PROPANOIC ACID
CAS:1219143-85-7
Formula: O=C(O)C(NC(OCC1C2=C(C3=C1C=CC=C3)C=CC=C2)=O)CC4=CNC5=NC=CC=C54
BD224493
95+%
MFCD02682351
2-((((9H-FLUOREN-9-YL)METHOXY)CARBONYL)AMINO)-3-(2-NITROPHENYL)PROPANOIC ACID
CAS:N/A
Formula: O=C(C(CC1C([N+](=O)[O-])=CC=CC=1)NC(=O)OCC1C2C=CC=CC=2C2C=CC=CC1=2)O
BD00750355
95%
2-((((9H-FLUOREN-9-YL)METHOXY)CARBONYL)AMINO)-3-(3-FLUORO-4-HYDROXYPHENYL)PROPANOIC ACID
CAS:1219389-96-4
Formula: OC(C=C1)=C(F)C=C1CC(C(O)=O)NC(OCC2C3=CC=CC=C3C4=CC=CC=C24)=O
BD555713
97%
MFCD02682269
2-((((9H-FLUOREN-9-YL)METHOXY)CARBONYL)AMINO)-3-(4-(TERT-BUTYL)PHENYL)PROPANOIC ACID
CAS:1236257-38-7
Formula: O=C(O)C(CC1=CC=C(C(C)(C)C)C=C1)NC(OCC2C3=CC=CC=C3C4=CC=CC=C24)=O
BD207976
95+%
2-((((9H-FLUOREN-9-YL)METHOXY)CARBONYL)AMINO)-3-(4-FLUOROPHENYL)PROPANOIC ACID
CAS:264276-42-8
Formula: O=C(O)C(NC(OCC1C2=C(C3=C1C=CC=C3)C=CC=C2)=O)CC4=CC=C(F)C=C4
BD131392
97%
MFCD00237667
2-((((9H-FLUOREN-9-YL)METHOXY)CARBONYL)AMINO)-3-(4-METHYL-1H-INDOL-3-YL)PROPANOIC ACID
CAS:1219279-39-6
Formula: O=C(O)C(CC1=CNC2=CC=CC(C)=C12)NC(OCC3C4=CC=CC=C4C5=CC=CC=C35)=O
BD555733
97%
MFCD09750499
2-((((9H-FLUOREN-9-YL)METHOXY)CARBONYL)AMINO)-3-(5-(BENZYLOXY)-1H-INDOL-3-YL)PROPANOIC ACID
CAS:1219348-47-6
Formula: O=C(O)C(CC1=CNC2=CC=C(OCC3=CC=CC=C3)C=C12)NC(OCC4C5=CC=CC=C5C6=CC=CC=C46)=O
BD555734
97%
MFCD02682353
2-((((9H-FLUOREN-9-YL)METHOXY)CARBONYL)AMINO)-3-(5-BROMO-1H-INDOL-3-YL)PROPANOIC ACID
CAS:925939-82-8
Formula: O=C(O)C(CC1=CNC2=CC=C(Br)C=C12)NC(OCC3C4=CC=CC=C4C5=CC=CC=C35)=O
BD555735
97%
MFCD02682357
2-((((9H-FLUOREN-9-YL)METHOXY)CARBONYL)AMINO)-3-(5-CHLORO-1H-INDOL-3-YL)PROPANOIC ACID
CAS:1219398-51-2
Formula: O=C(O)C(CC1=CNC2=CC=C(Cl)C=C12)NC(OCC3C4=CC=CC=C4C5=CC=CC=C35)=O
BD555736
97%
MFCD09750492
2-((((9H-FLUOREN-9-YL)METHOXY)CARBONYL)AMINO)-3-(5-METHOXY-1H-INDOL-3-YL)PROPANOIC ACID
CAS:138775-54-9
Formula: O=C(O)C(CC1=CNC2=CC=C(OC)C=C12)NC(OCC3C4=CC=CC=C4C5=CC=CC=C35)=O
BD555739
97%
MFCD02682367
2-((((9H-FLUOREN-9-YL)METHOXY)CARBONYL)AMINO)-3-(5-METHOXY-2-METHYL-1H-INDOL-3-YL)PROPANOIC ACID
CAS:1219357-78-4
Formula: O=C(O)C(CC1=C(C)NC2=CC=C(OC)C=C12)NC(OCC3C4=CC=CC=C4C5=CC=CC=C35)=O
BD555738
97%
MFCD02682365