Phone (USA) +1 212-348-5610
Whatsapp: +1 516-336-9307
WeChat: chembuyersguide
Chemical Search
 
























BLD Pharmatech Ltd.




Country: China

BLD Pharmatech Ltd.
488 Taoqiao Road, Building 5, 5F
HuiNan Town, Pudong New Area,
Shanghai 201203, China


Phone: +86-21-61629022
E-Mail:E-Mail this Supplier

Contact: Elva Cui

http://www.bldpharm.com

BLD Pharmatech Ltd.

Page: Home | 1 | 2 | 3 | 4 | 5 | 6 | 7 | 8 | 9 | 10 | 11 | 12 | 13 | 14 | 15 | 16 | 17 | 18 | 19 | 20 | 21 | 22 | 23 | 24 | 25 | 26 | 27 | 28 | 29 | 30 | 31 | 32 | 33 | 34 | 35 | 36 | 37 | 38 | 39 | 40 | 41 | 42 | 43 | 44 | 45 | 46 | 47 | 48 | 49 | 50 | 51 | 52 | 53 | 54 | 55 | 56 | 57 | 58 | 59 | 60 | 61 | 62 | 63 | 64 | 65 | 66 | 67 | 68 | 69 | 70 | 71 | 72 | 73 | 74 | 75 | 76 | 77 | 78 | 79 | 80 | 81 | 82 | 83 | 84 | 85 | 86 | 87 | 88 | 89 | 90 | 91 | 92 | 93 | 94 | 95 | 96 | 97 | 98 | 99 | 100 | 101 | 102 | 103 | 104 | 105 | 106 | 107 | 108 | 109 | 110 | 111 | 112 | 113 | 114 | 115 | 116 | 117 | 118 | 119 | 120 | 121 | 122 | 123 | 124 | 125 | 126 | 127 | 128 | 129 | 130 | 131 | 132 | 133 | 134 | 135 | 136 | 137 | 138 | 139 | 140 | 141 | 142 | 143 | 144 | 145 | 146 | 147 | 148 | 149 | 150 | 151 | 152 | 153 | 154 | 155 | 156 | 157 | 158 | 159 | 160 | 161 | 162 | 163 | 164 | 165 | 166 | 167 | 168 | 169 | 170 | 171 | 172 | 173 | 174 | 175 | 176 | 177 | 178 | 179 | 180 | 181 | 182 | 183 | 184 | 185 | 186 | 187 | 188 | 189 | 190 | 191 | 192 | 193 | 194 | 195 | 196 | 197 | 198 | 199 | 200 | 201 | 202 | 203 | 204 | 205 | 206 | 207 | 208 | 209 | 210 | 211 | 212 | 213 | 214 | 215 | 216 | 217 | 218 | 219 | 220 | 221 | 222 | 223 | 224 | 225 | 226 | 227 | 228 | 229 | 230 | 231 | 232 | 233 | 234 | 235 | 236 | 237 | 238 | 239 | 240 | 241 | 242 | 243 | 244 | 245 | 246 | 247 | 248 | 249 | 250 | 251 | 252 | 253 | 254 | 255 | 256 | 257 | 258 | 259 | 260 | 261 | 262 | 263 | 264 | 265 | 266 | 267 | 268 | 269 | 270 | 271 | 272 | 273 | 274 | 275 | 276 | 277 | 278 | 279 | 280 | 281 | 282 | 283 | 284 | 285 | 286 | 287 | 288 | 289 | 290 | 291 | 292 | 293 | 294 | 295 | 296 | 297 | 298 | 299 | 300 | 301 | 302 | 303 | 304 | 305 | 306 | 307 | 308 |
 


Product List

2,3-BIS(IODOMETHYL)PYRAZINE
CAS:1823363-44-5
Formula: ICC1=NC=CN=C1CI
95+%
BD272561
2,3-BIS(OCTADECYLOXY)PROPAN-1-OL
CAS:6076-38-6
Formula: OCC(OCCCCCCCCCCCCCCCCCC)COCCCCCCCCCCCCCCCCCC
95+%
BD53489
2,3-BIS(STEAROYLOXY)PROPYL (2-(TRIMETHYLAMMONIO)ETHYL) PHOSPHATE
CAS:4539-70-2
Formula: CCCCCCCCCCCCCCCCCC(OC(COP([O-])(OCC[N+](C)(C)C)=O)COC(CCCCCCCCCCCCCCCCC)=O)=O
97%
BD53422
2,3-BIS(TRIFLUOROMETHYL)-1,8-NAPHTHYRIDINE
CAS:1099597-87-1
Formula: FC(C1=CC2=CC=CN=C2N=C1C(F)(F)F)(F)F
97%
BD585215
MFCD11100524
2,3-BIS(TRIFLUOROMETHYL)-PYRAZINE
CAS:1186195-14-1
Formula: FC(C1=NC=CN=C1C(F)(F)F)(F)F
95+%
BD307135
MFCD11226566
2,3-BIS(TRIFLUOROMETHYL)ANILINE
CAS:3822-20-6
Formula: NC1=CC=CC(C(F)(F)F)=C1C(F)(F)F
95+%
BD267119
MFCD16619412
2,3-BIS(TRIFLUOROMETHYL)PYRIDINE
CAS:1644-68-4
Formula: FC(F)(F)C1=CC=CN=C1C(F)(F)F
95%
BD65309
MFCD03093763
2,3-BIS(TRIFLUOROMETHYL)THIENO[3,4-B][1,4]DIOXINE-5,7-DICARBOXYLIC ACID
CAS:887268-15-7
Formula: O=C(C1=C2C(OC(C(F)(F)F)=C(C(F)(F)F)O2)=C(C(O)=O)S1)O
97%
BD495857
MFCD04972685
2,3-BIS-(4-PYRIDYL)BUTANE
CAS:655-47-0
Formula: CC(C1=CC=NC=C1)C(C2=CC=NC=C2)C
95+%
BD324007
MFCD06637444
2,3-DEHYDROKIEVITONE
CAS:74161-25-4
Formula: O=C1C(C2=CC=C(O)C=C2O)=COC3=C(C/C=C(C)\C)C(O)=CC(O)=C13
95+%
BD298510
2,3-DI(3',4'-METHYLENEDIOXYBENZYL)-2-BUTEN-4-OLIDE
CAS:137809-97-3
Formula: O=C1OCC(CC2=CC=C(OCO3)C3=C2)=C1CC4=CC=C(OCO5)C5=C4
95+%
BD299111
2,3-DI(FURAN-2-YL)QUINOXALINE-6-CARBOXYLIC ACID
CAS:90846-59-6
Formula: O=C(C1=CC=C2N=C(C3=CC=CO3)C(C4=CC=CO4)=NC2=C1)O
97%
BD495350
MFCD00999683
2,3-DI(PYRIDIN-2-YL)PYRAZINE
CAS:25005-96-3
Formula: C1(C2=NC=CC=C2)=NC=CN=C1C3=NC=CC=C3
97%
BD65294
2,3-DI(PYRIDIN-4-YL)OXIRANE
CAS:74431-40-6
Formula: C1(C2=CC=NC=C2)OC1C3=CC=NC=C3
95+%
BD282749
2,3-DIALLYLMALEIC ACID COMPOUND WITH DIALLYL MALEATE (1:1)
CAS:999-21-3
Formula: O=C(OCC=C)/C=C\C(OCC=C)=O.O=C(O)/C(CC=C)=C(CC=C)\C(O)=O
97%
BD42157
2,3-DIAMINO-5-BROMO-6-(TRIFLUOROMETHYL)PYRIMIDIN-4(3H)-ONE
CAS:95095-46-8
Formula: O=C1N(N)C(N)=NC(C(F)(F)F)=C1Br
97%
BD65327
2,3-DIAMINO-5-BROMOBENZOIC ACID DIHYDROCHLORIDE
CAS:58580-09-9
Formula: O=C(O)C1=CC(Br)=CC(N)=C1N.[H]Cl.[H]Cl
95+%
BD290716
MFCD27978533
2,3-DIAMINO-5-FLUOROBENZOIC ACID
CAS:177960-38-2
Formula: O=C(O)C1=CC(F)=CC(N)=C1N
97%
BD285936
MFCD12197351
2,3-DIAMINO-5-FLUOROBENZONITRILE
CAS:912445-00-2
Formula: N#CC1=CC(F)=CC(N)=C1N
97%
BD449599
MFCD15527572
2,3-DIAMINO-5-METHYLBENZAMIDE
CAS:N/A
Formula: O=C(C1C(N)=C(N)C=C(C)C=1)N
95%
BD00811319
2,3-DIAMINO-5-METHYLBENZOIC ACID
CAS:N/A
Formula: O=C(C1C(N)=C(N)C=C(C)C=1)O
95%
BD00755602
2,3-DIAMINO-5-METHYLPYRIDINE
CAS:24638-29-7
Formula: NC1=NC=C(C=C1N)C
97%
BD157661
MFCD03940651
2,3-DIAMINO-5-NITROBENZOIC ACID
CAS:98279-87-9
Formula: O=C(O)C1=CC([N+]([O-])=O)=CC(N)=C1N
95+%
BD261530
MFCD19440774
2,3-DIAMINO-6-(TRIFLUOROMETHYL)PYRIMIDIN-4(3H)-ONE
CAS:95095-71-9
Formula: O=C1N(N)C(N)=NC(C(F)(F)F)=C1
97%
BD65331
2,3-DIAMINO-6-CHLOROBENZOIC ACID
CAS:855470-73-4
Formula: O=C(O)C1=C(Cl)C=CC(N)=C1N
97%
BD469059
2,3-DIAMINO-6-CHLOROBENZONITRILE
CAS:548457-80-3
Formula: N#CC1=C(Cl)C=CC(N)=C1N
95+%
BD294419
2,3-DIAMINO-6-METHYLPYRIMIDIN-4(3H)-ONE
CAS:35523-64-9
Formula: O=C1N(N)C(N)=NC(C)=C1
95+%
BD331387
MFCD00474034
2,3-DIAMINO-N,N-DIMETHYLBENZENESULFONAMIDE
CAS:1378255-41-4
Formula: O=S(C1=CC=CC(N)=C1N)(N(C)C)=O
97%
BD614756
2,3-DIAMINOBENZAMIDE
CAS:711007-44-2
Formula: O=C(N)C1=CC=CC(N)=C1N
95%
BD115397
MFCD09029906
2,3-DIAMINOBENZAMIDE DIHYDROCHLORIDE
CAS:266993-72-0
Formula: O=C(N)C1=CC=CC(N)=C1N.[H]Cl.[H]Cl
95+%
BD220650
2,3-DIAMINOBENZENESULFONAMIDE
CAS:1378259-06-3
Formula: O=S(C1=CC=CC(N)=C1N)(N)=O
97%
BD614766
2,3-DIAMINOBENZOIC ACID
CAS:603-81-6
Formula: NC1=C(N)C(=CC=C1)C(O)=O
95+%
BD17220
MFCD00137818
2,3-DIAMINOBENZONITRILE
CAS:73629-43-3
Formula: N#CC1=CC=CC(N)=C1N
97%
BD161155
MFCD18072544
2,3-DIAMINOBENZONITRILE HYDROCHLORIDE
CAS:1881328-68-2
Formula: N#CC1=CC=CC(N)=C1N.[H]Cl
96%
BD457778
MFCD29043324
2,3-DIAMINOBUTANOIC ACID
CAS:2643-66-5
Formula: CC(N)C(N)C(O)=O
95+%
BD32949
MFCD09836087
2,3-DIAMINONAPHTHALENE
CAS:771-97-1
Formula: NC1=CC2=C(C=CC=C2)C=C1N
97%
BD11775
MFCD00004116
2,3-DIAMINOPHENOL
CAS:59649-56-8
Formula: OC1=CC=CC(N)=C1N
97%
BD10012
2,3-DIAMINOPHENOL DIHYDROCHLORIDE
CAS:193629-25-3
Formula: Cl.Cl.NC1=CC=CC(O)=C1N
95+%
BD228226
MFCD22375674
2,3-DIAMINOPROPANOIC ACID
CAS:515-94-6
Formula: O=C(O)C(N)CN
98%
BD39091
2,3-DIAMINOPROPANOIC ACID HYDROBROMIDE
CAS:18635-45-5
Formula: O=C(O)C(N)CN.Br
98%
BD126270
MFCD00012883
2,3-DIAMINOPROPANOIC ACID HYDROCHLORIDE
CAS:54897-59-5
Formula: O=C(O)C(N)CN.[H]Cl
97%
BD39092
MFCD00012884
2,3-DIAMINOPYRAZINE
CAS:13134-31-1
Formula: C1=CN=C(N)C(=N1)N
97%
BD65998
MFCD07778385
2,3-DIAMINOPYRIDINE
CAS:452-58-4
Formula: C1=C(C(=NC=C1)N)N
97%
BD7903
MFCD00006319
2,3-DIAMINOPYRIMIDIN-4(3H)-ONE
CAS:35523-63-8
Formula: O=C1N(N)C(N)=NC=C1
95+%
BD271108
2,3-DIBROMO-1,3-BIS(4-FLUOROPHENYL)PROPAN-1-ONE
CAS:497959-30-5
Formula: O=C(C1=CC=C(F)C=C1)C(Br)C(Br)C2=CC=C(F)C=C2
97%
BD492879
2,3-DIBROMO-1,4-DIFLUOROBENZENE
CAS:179737-33-8
Formula: FC1=CC=C(F)C(Br)=C1Br
95+%
BD288862
MFCD12922620
2,3-DIBROMO-1,4-DIMETHOXYBENZENE
CAS:5030-61-5
Formula: COC1=CC=C(OC)C(Br)=C1Br
98%
BD258077
MFCD11519213
2,3-DIBROMO-1,4-DIPHENYLNAPHTHALENE
CAS:127257-79-8
Formula: BrC1=C(Br)C(C2=CC=CC=C2)=C3C=CC=CC3=C1C4=CC=CC=C4
95+%
BD328711
MFCD28404637
2,3-DIBROMO-1,8-NAPHTHYRIDINE
CAS:52626-31-0
Formula: BrC1=CC2=CC=CN=C2N=C1Br
97%
BD625568
2,3-DIBROMO-1-(3,4-DICHLOROPHENYL)-3-PHENYLPROPAN-1-ONE
CAS:81394-21-0
Formula: O=C(C1=CC=C(Cl)C(Cl)=C1)C(Br)C(Br)C2=CC=CC=C2
95+%
BD284061
2,3-DIBROMO-1-CHLORO-5-FLUORO-4-METHYLBENZENE
CAS:1365969-01-2
Formula: CC1=C(F)C=C(Cl)C(Br)=C1Br
97%
BD592439
MFCD21602111
2,3-DIBROMO-1-PROPANOL
CAS:96-13-9
Formula: OCC(Br)CBr
95%
BD65354
MFCD00004699
2,3-DIBROMO-1H-PYRROLO[2,3-C]PYRIDINE
CAS:1220039-83-7
Formula: BrC1=C(Br)NC2=C1C=CN=C2
96%
BD00819427
2,3-DIBROMO-3-(4-CHLOROPHENYL)PROPANOIC ACID
CAS:24653-99-4
Formula: O=C(O)C(Br)C(Br)C1=CC=C(Cl)C=C1
95+%
BD65357
MFCD00043569
2,3-DIBROMO-3-PHENYLPROPANOIC ACID
CAS:6286-30-2
Formula: O=C(O)C(Br)C(Br)C1=CC=CC=C1
98%
BD65359
MFCD00004208
2,3-DIBROMO-4,5,6,7-TETRAHYDROBENZO[B]THIOPHENE
CAS:1785762-03-9
Formula: BrC1=C(Br)SC2=C1CCCC2
97%
BD593512
MFCD25368884
2,3-DIBROMO-4,5,6-TRIFLUOROPHENOL
CAS:19758-04-4
Formula: OC1=C(F)C(F)=C(F)C(Br)=C1Br
95+%
BD285198
2,3-DIBROMO-4,5-DIMETHOXYBENZALDEHYDE
CAS:70625-29-5
Formula: O=CC1=CC(OC)=C(OC)C(Br)=C1Br
97%
BD583904
2,3-DIBROMO-4,5-DIMETHYLPYRIDINE
CAS:117846-57-8
Formula: CC1=CN=C(Br)C(Br)=C1C
95+%
BD237910
MFCD20926790
2,3-DIBROMO-4,6-DIFLUOROANILINE
CAS:1263376-56-2
Formula: NC1=C(F)C=C(F)C(Br)=C1Br
95+%
BD366464
MFCD18089341
2,3-DIBROMO-4,6-DIMETHYLPYRIDINE
CAS:610261-10-4
Formula: CC1=CC(C)=C(Br)C(Br)=N1
95+%
BD334772
MFCD06253865
2,3-DIBROMO-4-(BROMOMETHYL)PYRIDINE
CAS:N/A
Formula: BrCC1C=CN=C(Br)C=1Br
95%
BD00726704
n/a
2,3-DIBROMO-4-(CHLOROMETHYL)PYRIDINE
CAS:1227606-31-6
Formula: ClCC1=C(Br)C(Br)=NC=C1
97%
BD751212
2,3-DIBROMO-4-(DIFLUOROMETHOXY)PYRIDINE
CAS:1806293-77-5
Formula: FC(F)OC1=C(Br)C(Br)=NC=C1
95+%
BD413969
MFCD28784213
2,3-DIBROMO-4-(TRIFLUOROMETHYL)PYRIDINE
CAS:1099598-01-2
Formula: FC(C1=C(Br)C(Br)=NC=C1)(F)F
95%
BD194606
MFCD11100541
2,3-DIBROMO-4-CHLOROPYRIDINE
CAS:1379300-99-8
Formula: BrC1=C(Cl)C=CN=C1Br
95+%
BD371805
MFCD15071472
2,3-DIBROMO-4-HYDROXY-5-METHOXYBENZALDEHYDE
CAS:2973-75-3
Formula: O=CC1=CC(OC)=C(O)C(Br)=C1Br
95+%
BD5808
MFCD00016978
2,3-DIBROMO-4-IODOPYRIDINE
CAS:1353056-43-5
Formula: IC1=C(Br)C(Br)=NC=C1
95+%
BD284447
2,3-DIBROMO-4-METHOXYPYRIDINE
CAS:96245-98-6
Formula: COC1=C(Br)C(Br)=NC=C1
95+%
BD432982
MFCD18255779
2,3-DIBROMO-4-METHYLPYRIDINE
CAS:871483-22-6
Formula: CC1=C(Br)C(Br)=NC=C1
97%
BD42224
MFCD09753264
2,3-DIBROMO-4-METHYLTHIOPHENE
CAS:125257-38-7
Formula: CC1=CSC(Br)=C1Br
95+%
BD164122
MFCD13181590
2,3-DIBROMO-4-OXOBUT-2-ENOIC ACID
CAS:21577-50-4
Formula: O=C(O)/C(Br)=C(Br)/C=O
95+%
BD158260
MFCD00063745
2,3-DIBROMO-5,6,7,8-TETRAHYDROIMIDAZO[1,2-A]PYRIDINE
CAS:156817-73-1
Formula: BrC1=C(Br)N=C2CCCCN21
97%
BD260083
2,3-DIBROMO-5,6-DIFLUOROANILINE
CAS:1435806-67-9
Formula: NC1=C(F)C(F)=CC(Br)=C1Br
95+%
BD329936
MFCD24539376
2,3-DIBROMO-5,6-DIFLUOROBENZALDEHYDE
CAS:1263377-81-6
Formula: O=CC1=C(F)C(F)=CC(Br)=C1Br
97%
BD478875
MFCD18379857
2,3-DIBROMO-5,6-DIFLUOROBENZOIC ACID
CAS:1263377-48-5
Formula: O=C(O)C1=C(F)C(F)=CC(Br)=C1Br
95+%
BD356959
MFCD18379856
2,3-DIBROMO-5,6-DIMETHOXYBENZALDEHYDE
CAS:875001-44-8
Formula: O=CC1=C(OC)C(OC)=CC(Br)=C1Br
95+%
BD232417
2,3-DIBROMO-5,6-DIMETHYLPYRIDINE
CAS:117846-56-7
Formula: CC1=C(C)N=C(Br)C(Br)=C1
95+%
BD234994
MFCD13688994
2,3-DIBROMO-5-(BROMOMETHYL)PYRIDINE
CAS:1003859-12-8
Formula: BrCC1=CN=C(Br)C(Br)=C1
95+%
BD284429
2,3-DIBROMO-5-(DIETHOXYMETHYL)FURAN
CAS:4828-13-1
Formula: CCOC(C1=CC(Br)=C(Br)O1)OCC
95%
BD168392
MFCD11977256
2,3-DIBROMO-5-(TRIFLUOROMETHYL)PYRIDINE
CAS:79623-38-4
Formula: FC(F)(F)C1=CN=C(Br)C(Br)=C1
98%
BD165170
MFCD10687233
2,3-DIBROMO-5-CHLOROBENZONITRILE
CAS:1160574-35-5
Formula: N#CC1=CC(Cl)=CC(Br)=C1Br
97%
BD589015
MFCD11846070
2,3-DIBROMO-5-CHLOROPYRIDINE
CAS:137628-17-2
Formula: BrC1=NC=C(C=C1Br)Cl
98%
BD31850
MFCD08687254
2,3-DIBROMO-5-CHLOROTHIOPHENE
CAS:60404-19-5
Formula: ClC1=CC(Br)=C(Br)S1
95%
BD00800395
2,3-DIBROMO-5-FLUOROCHLOROBENZENE
CAS:1000577-62-7
Formula: FC1=CC(Br)=C(Br)C(Cl)=C1
96%
BD306933
MFCD09878108
2,3-DIBROMO-5-FLUOROPYRIDINE
CAS:878207-82-0
Formula: FC1=CN=C(Br)C(Br)=C1
98%
BD65364
MFCD08532501
2,3-DIBROMO-5-IODO-4,6-DIMETHYLPYRIDINE
CAS:1823961-40-5
Formula: CC1=C(I)C(C)=C(Br)C(Br)=N1
95+%
BD267334
2,3-DIBROMO-5-IODOPYRIDINE
CAS:923957-52-2
Formula: BrC1=CC(I)=CN=C1Br
95+%
BD237538
MFCD13185518
2,3-DIBROMO-5-METHOXYANILINE
CAS:96558-71-3
Formula: NC1=CC(OC)=CC(Br)=C1Br
97%
BD561740
2,3-DIBROMO-5-METHOXYNITROBENZENE
CAS:10172-36-8
Formula: COC1=CC(Br)=C(Br)C([N+]([O-])=O)=C1
95+%
BD322305
MFCD00094478
2,3-DIBROMO-5-METHYLANILINE
CAS:96558-69-9
Formula: NC1=CC(C)=CC(Br)=C1Br
97%
BD471583
MFCD18089298
2,3-DIBROMO-5-METHYLPYRIDINE
CAS:29232-39-1
Formula: C1=C(C(=NC=C1C)Br)Br
98%
BD33080
MFCD04112574
2,3-DIBROMO-5-NITROANISOLE
CAS:95970-20-0
Formula: COC1=CC([N+]([O-])=O)=CC(Br)=C1Br
95+%
BD324561
MFCD11846080
2,3-DIBROMO-5-NITROPYRIDINE
CAS:15862-36-9
Formula: O=[N+](C1=CN=C(Br)C(Br)=C1)[O-]
95+%
BD42675
MFCD00233994
2,3-DIBROMO-5-NITROTOLUENE
CAS:73557-64-9
Formula: CC1=CC([N+]([O-])=O)=CC(Br)=C1Br
95+%
BD324141
MFCD11846021
2,3-DIBROMO-6,7-DICHLORO-1,2,3,4-TETRAHYDROQUINOXALINE
CAS:239095-84-2
Formula: ClC1=CC2=C(C=C1Cl)NC(Br)C(Br)N2
95+%
BD258275
MFCD13248632
2,3-DIBROMO-6-(BROMOMETHYL)NAPHTHALENE
CAS:132112-62-0
Formula: BrCC1=CC2=CC(Br)=C(Br)C=C2C=C1
97%
BD753152
2,3-DIBROMO-6-(CHLOROMETHYL)NAPHTHALENE
CAS:N/A
Formula: ClCC1=CC2=CC(Br)=C(Br)C=C2C=C1
97%
BD751458
2,3-DIBROMO-6-(DIFLUOROMETHYL)PYRIDINE
CAS:1806784-70-2
Formula: FC(C1=CC=C(Br)C(Br)=N1)F
97%
BD485661
MFCD25476733
2,3-DIBROMO-6-(TRIFLUOROMETHYL)PYRIDINE
CAS:1159512-35-2
Formula: FC(C1=CC=C(Br)C(Br)=N1)(F)F
97%
BD168962
MFCD11226614
2,3-DIBROMO-6-CHLOROPYRIDINE
CAS:885952-16-9
Formula: ClC1=CC=C(Br)C(Br)=N1
97%
BD65368
MFCD06798229
2,3-DIBROMO-6-ETHYLPYRIDINE
CAS:N/A
Formula: CCC1=CC=C(Br)C(Br)=N1
97%
BD00805395
n/a
2,3-DIBROMO-6-FLUORO-5-IODOBENZOIC ACID
CAS:1160573-40-9
Formula: O=C(O)C1=C(F)C(I)=CC(Br)=C1Br
97%
BD588996
MFCD11845978
2,3-DIBROMO-6-HYDROXY-5-METHOXYBENZALDEHYDE
CAS:20035-42-1
Formula: O=CC1=C(O)C(OC)=CC(Br)=C1Br
97%
BD494560
MFCD00046151
2,3-DIBROMO-6-HYDROXY-5-METHOXYBENZOIC ACID
CAS:35093-66-4
Formula: O=C(O)C1=C(O)C(OC)=CC(Br)=C1Br
97%
BD624915
2,3-DIBROMO-6-METHOXY-1H-PYRROLO[2,3-B]PYRIDINE
CAS:N/A
Formula: COC1=CC=C2C(NC(Br)=C2Br)=N1
97%
BD759671
2,3-DIBROMO-6-METHOXYPYRIDINE
CAS:909720-21-4
Formula: COC1=CC=C(Br)C(Br)=N1
97+%
BD237110
MFCD21648443
2,3-DIBROMO-6-PICOLINE
CAS:261373-04-0
Formula: CC1=CC=C(Br)C(Br)=N1
97%
BD19776
MFCD03095214
2,3-DIBROMO-N-METHYLMALEIMIDE
CAS:3005-27-4
Formula: O=C(N1C)C(Br)=C(Br)C1=O
95+%
BD65377
2,3-DIBROMOANILINE
CAS:608-22-0
Formula: NC1=CC=CC(Br)=C1Br
98%
BD327521
MFCD13185488
2,3-DIBROMOANTHRACENE-9,10-DIONE
CAS:633-68-1
Formula: O=C1C2=C(C=CC=C2)C(C3=CC(Br)=C(Br)C=C13)=O
95+%
BD246829
MFCD16038227
2,3-DIBROMOBENZALDEHYDE
CAS:61563-26-6
Formula: O=CC1=CC=CC(Br)=C1Br
98%
BD217769
MFCD11520724
2,3-DIBROMOBENZO[B]THIOPHENE
CAS:6287-82-7
Formula: BrC1=C(Br)SC2=CC=CC=C21
98%
BD232869
MFCD06798119
2,3-DIBROMOBENZOIC ACID
CAS:603-78-1
Formula: O=C(O)C1=CC=CC(Br)=C1Br
98%
BD208729
MFCD11520726
2,3-DIBROMOBUTANE
CAS:5408-86-6
Formula: CC(Br)C(Br)C
99%
BD65372
MFCD00000146
2,3-DIBROMOBUTANE-1,4-DIOL
CAS:20163-90-0
Formula: OCC(Br)C(Br)CO
95+%
BD227590
MFCD00011549
2,3-DIBROMOIMIDAZO[1,2-A]PYRIDINE
CAS:1333222-44-8
Formula: BrC1=C(Br)N=C2C=CC=CN21
95+%
BD252529
MFCD18909500
2,3-DIBROMOISONICOTINALDEHYDE
CAS:1227561-62-7
Formula: O=CC1=CC=NC(Br)=C1Br
95+%
BD356973
MFCD16606475
2,3-DIBROMOISONICOTINAMIDE
CAS:N/A
Formula: O=C(N)C1=CC=NC(Br)=C1Br
97%
BD754075
2,3-DIBROMOISONICOTINIC ACID
CAS:1020056-98-7
Formula: O=C(O)C1=CC=NC(Br)=C1Br
97%
BD168770
MFCD09997708
2,3-DIBROMOISONICOTINONITRILE
CAS:1399482-25-7
Formula: N#CC1C(Br)=C(Br)N=CC=1
95+%
BD00753630
n/a
2,3-DIBROMONAPHTHALENE
CAS:13214-70-5
Formula: BrC1=C(Br)C=C2C=CC=CC2=C1
98%
BD12494
MFCD00021589
2,3-DIBROMOPHENOL
CAS:57383-80-9
Formula: OC1=CC=CC(Br)=C1Br
96%
BD65381
MFCD08166474
2,3-DIBROMOPROPANAMIDE
CAS:15102-42-8
Formula: O=C(N)C(Br)CBr
98%
BD65384
MFCD00031484
2,3-DIBROMOPROPIONIC ACID
CAS:600-05-5
Formula: O=C(O)C(Br)CBr
97%
BD21703
MFCD00004212
2,3-DIBROMOPROPYL ACRYLATE
CAS:19660-16-3
Formula: C=CC(OCC(Br)CBr)=O
95%
BD65388
MFCD00059461
2,3-DIBROMOPROPYLAMINE HYDROBROMIDE
CAS:6963-32-2
Formula: NCC(Br)CBr.[H]Br
95+%
BD254087
2,3-DIBROMOPYRAZINE
CAS:95538-03-7
Formula: BrC1=NC=CN=C1Br
95%
BD160086
MFCD02684897
2,3-DIBROMOPYRIDINE
CAS:13534-89-9
Formula: C1=CC=NC(=C1Br)Br
98%
BD9517
MFCD00234014
2,3-DIBROMOPYRIDINE 1-OXIDE
CAS:89167-27-1
Formula: BrC1C=CC=[N+]([O-])C=1Br
95%
BD00771242
2,3-DIBROMOQUINOLINE
CAS:13721-00-1
Formula: BrC2=NC1=CC=CC=C1C=C2Br
98%
BD65392
MFCD00234472
2,3-DIBROMOSUCCINIC ACID
CAS:526-78-3
Formula: O=C(O)C(Br)C(Br)C(O)=O
95+%
BD21230
MFCD00004209
2,3-DIBROMOTETRAHYDRO-2H-PYRAN
CAS:56660-59-4
Formula: BrC1C(Br)OCCC1
95+%
BD251978
MFCD19105072
2,3-DIBROMOTHIOPHENE
CAS:3140-93-0
Formula: C1=CSC(=C1Br)Br
98%
BD9372
MFCD00005418
2,3-DICHLORO-1-METHYL-4-(TRIFLUOROMETHYL)BENZENE
CAS:115571-58-9
Formula: FC(C1=CC=C(C)C(Cl)=C1Cl)(F)F
95+%
BD10875
MFCD06658274
2,3-DICHLORO-1-METHYL-5-NITRO-4-(TRIFLUOROMETHYL)BENZENE
CAS:887267-46-1
Formula: FC(C1=C([N+]([O-])=O)C=C(C)C(Cl)=C1Cl)(F)F
95+%
BD258078
MFCD06658255
2,3-DICHLORO-1-NITRO-4-(TRIFLUOROMETHYL)BENZENE
CAS:1803801-74-2
Formula: FC(F)(F)C1=CC=C([N+]([O-])=O)C(Cl)=C1Cl
95%
BD489036
MFCD28787159
2,3-DICHLORO-1-PROPANOL
CAS:616-23-9
Formula: OCC(Cl)CCl
98%
BD65402
MFCD00040446
2,3-DICHLORO-1H-INDOLE
CAS:101495-59-4
Formula: ClC1=C(Cl)NC2=C1C=CC=C2
95+%
BD242129
MFCD18449890
2,3-DICHLORO-2'-MORPHOLINOMETHYL BENZOPHENONE
CAS:898750-98-6
Formula: O=C(C1=CC=CC=C1CN2CCOCC2)C3=CC=CC(Cl)=C3Cl
95+%
BD309982
MFCD03842441
2,3-DICHLORO-2'-PIPERIDINOMETHYL BENZOPHENONE
CAS:898773-65-4
Formula: O=C(C1=CC=CC=C1CN2CCCCC2)C3=CC=CC(Cl)=C3Cl
95+%
BD311903
MFCD03842498
2,3-DICHLORO-2'-PYRROLIDINOMETHYL BENZOPHENONE
CAS:898774-93-1
Formula: O=C(C1=CC=CC=C1CN2CCCC2)C3=CC=CC(Cl)=C3Cl
95+%
BD311995
MFCD03842555
2,3-DICHLORO-2'-THIOMORPHOLINOMETHYL BENZOPHENONE
CAS:898782-26-8
Formula: O=C(C1=CC=CC=C1CN2CCSCC2)C3=CC=CC(Cl)=C3Cl
95+%
BD312679
MFCD03842782
2,3-DICHLORO-3'-(1,3-DIOXOLAN-2-YL)BENZOPHENONE
CAS:898759-49-4
Formula: O=C(C1=CC=CC(C2OCCO2)=C1)C3=CC=CC(Cl)=C3Cl
95+%
BD310671
MFCD07699984
2,3-DICHLORO-3'-MORPHOLINOMETHYL BENZOPHENONE
CAS:898792-16-0
Formula: O=C(C1=CC=CC(CN2CCOCC2)=C1)C3=CC=CC(Cl)=C3Cl
95+%
BD313600
MFCD03841932
2,3-DICHLORO-3'-PIPERIDINOMETHYL BENZOPHENONE
CAS:898793-48-1
Formula: O=C(C1=CC=CC(CN2CCCCC2)=C1)C3=CC=CC(Cl)=C3Cl
95+%
BD313732
MFCD03841989
2,3-DICHLORO-3'-PYRROLIDINOMETHYL BENZOPHENONE
CAS:898770-76-8
Formula: O=C(C1=CC=CC(CN2CCCC2)=C1)C3=CC=CC(Cl)=C3Cl
95+%
BD311688
MFCD03842046
2,3-DICHLORO-3'-THIOMORPHOLINOMETHYL BENZOPHENONE
CAS:898787-78-5
Formula: O=C(C1=CC=CC(CN2CCSCC2)=C1)C3=CC=CC(Cl)=C3Cl
95+%
BD313186
MFCD03842271
2,3-DICHLORO-4'-(1,3-DIOXOLAN-2-YL)BENZOPHENONE
CAS:898760-66-2
Formula: O=C(C1=CC=C(C2OCCO2)C=C1)C3=CC=CC(Cl)=C3Cl
95+%
BD310768
MFCD07700035
2,3-DICHLORO-4'-MORPHOLINOMETHYL BENZOPHENONE
CAS:898770-55-3
Formula: O=C(C1=CC=C(CN2CCOCC2)C=C1)C3=CC=CC(Cl)=C3Cl
95+%
BD311667
MFCD03841420
2,3-DICHLORO-4'-PIPERIDINOMETHYL BENZOPHENONE
CAS:898775-53-6
Formula: O=C(C1=CC=C(CN2CCCCC2)C=C1)C3=CC=CC(Cl)=C3Cl
95+%
BD312051
MFCD03841477
2,3-DICHLORO-4'-PYRROLIDINOMETHYL BENZOPHENONE
CAS:898776-79-9
Formula: O=C(C1=CC=C(CN2CCCC2)C=C1)C3=CC=CC(Cl)=C3Cl
95+%
BD312171
MFCD03841534
2,3-DICHLORO-4'-THIOMORPHOLINOMETHYL BENZOPHENONE
CAS:898783-10-3
Formula: O=C(C1=CC=C(CN2CCSCC2)C=C1)C3=CC=CC(Cl)=C3Cl
95+%
BD312755
MFCD03841761
2,3-DICHLORO-4,5-DIFLUOROBENZONITRILE
CAS:112062-59-6
Formula: N#CC1=CC(F)=C(F)C(Cl)=C1Cl
95+%
BD257977
MFCD16661202
2,3-DICHLORO-4,5-DIMETHYLPYRIDINE
CAS:N/A
Formula: CC1C(C)=C(Cl)C(Cl)=NC=1
95%
BD00756346
2,3-DICHLORO-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PYRIDINE
CAS:1073353-78-2
Formula: CC1(C)OB(OC1(C)C)C1=C(Cl)C(Cl)=NC=C1
97%
BD236032
MFCD06798257
2,3-DICHLORO-4-(CHLOROMETHYL)PYRIDINE
CAS:329794-26-5
Formula: ClCC1=C(Cl)C(Cl)=NC=C1
95+%
BD207679
2,3-DICHLORO-4-(DIFLUOROMETHYL)PYRIDINE
CAS:1257071-85-4
Formula: FC(C1=C(Cl)C(Cl)=NC=C1)F
97%
BD465717
MFCD22418352
2,3-DICHLORO-4-(ETHYLSULFONYL)BENZOIC ACID
CAS:105917-76-8
Formula: CCS(=O)(=O)C1=C(Cl)C(Cl)=C(C=C1)C(O)=O
95%
BD200458
MFCD01935963
2,3-DICHLORO-4-(TRIFLUOROMETHYL)PYRIDINE
CAS:89719-93-7
Formula: FC(F)(F)C1=C(Cl)C(Cl)=NC=C1
98%
BD206420
MFCD14525481
2,3-DICHLORO-4-FLUOROANILINE
CAS:36556-52-2
Formula: NC1=CC=C(F)C(Cl)=C1Cl
95+%
BD65409
MFCD08706409
2,3-DICHLORO-4-FLUOROBENZOIC ACID
CAS:154257-76-8
Formula: ClC1=C(C(=O)O)C=CC(=C1Cl)F
98%
BD65410
MFCD09835200
2,3-DICHLORO-4-FLUORONITROBENZENE
CAS:36556-51-1
Formula: FC1=CC=C([N+]([O-])=O)C(Cl)=C1Cl
98%
BD65411
2,3-DICHLORO-4-HYDROXY-5-METHOXYBENZOIC ACID
CAS:108544-97-4
Formula: O=C(O)C1=C(Cl)C(Cl)=C(O)C(OC)=C1
97%
BD101658
2,3-DICHLORO-4-HYDROXYANISOLE
CAS:39542-65-9
Formula: COC1=CC=C(O)C(Cl)=C1Cl
95+%
BD357003
MFCD00155161
2,3-DICHLORO-4-HYDROXYBENZALDEHYDE
CAS:16861-22-6
Formula: OC1=C(Cl)C(Cl)=C(C=O)C=C1
96%
BD4153
MFCD07775189
2,3-DICHLORO-4-IODO-5-(TRIFLUOROMETHYL)PYRIDINE
CAS:1160474-55-4
Formula: FC(C1=CN=C(Cl)C(Cl)=C1I)(F)F
95+%
BD201215
2,3-DICHLORO-4-IODO-6-(TRIFLUOROMETHYL)PYRIDINE
CAS:1824318-20-8
Formula: FC(C1=CC(I)=C(Cl)C(Cl)=N1)(F)F
95+%
BD287470
2,3-DICHLORO-4-IODOFURO[2,3-C]PYRIDIN-7-AMINE
CAS:1326713-71-6
Formula: NC1=NC=C(I)C2=C1OC(Cl)=C2Cl
95+%
BD304451
n/a
2,3-DICHLORO-4-IODOPYRIDINE
CAS:889865-45-6
Formula: IC1=C(Cl)C(Cl)=NC=C1
95+%
BD196720
MFCD11857737
2,3-DICHLORO-4-METHOXYBENZALDEHYDE
CAS:41827-86-5
Formula: COC1=C(Cl)C(Cl)=C(C=O)C=C1
95+%
BD219498
2,3-DICHLORO-4-METHOXYPYRIDINE
CAS:1033203-57-4
Formula: COC1=C(Cl)C(Cl)=NC=C1
97%
BD468358
MFCD11100692
2,3-DICHLORO-4-METHYL-5-(TRIFLUOROMETHYL)PYRIDINE
CAS:431942-49-3
Formula: FC(C1=CN=C(Cl)C(Cl)=C1C)(F)F
95+%
BD270234
2,3-DICHLORO-4-METHYLANILINE
CAS:80026-12-6
Formula: NC1=CC=C(C)C(Cl)=C1Cl
95+%
BD281763
MFCD20690792
2,3-DICHLORO-4-METHYLPYRIDINE
CAS:191419-07-5
Formula: CC1=C(Cl)C(Cl)=NC=C1
98%
BD149709
MFCD09839231
2,3-DICHLORO-4-NITROANILINE
CAS:69951-03-7
Formula: NC1=C(Cl)C(Cl)=C(C=C1)[N+]([O-])=O
95+%
BD217277
MFCD11226295
2,3-DICHLORO-4-NITROANISOLE
CAS:105630-54-4
Formula: COC1=CC=C([N+]([O-])=O)C(Cl)=C1Cl
95+%
BD357081
MFCD26395222
2,3-DICHLORO-4-NITROPHENOL
CAS:59384-57-5
Formula: OC1=CC=C([N+]([O-])=O)C(Cl)=C1Cl
95+%
BD161761
MFCD12024417
2,3-DICHLORO-4-NITROPYRIDINE
CAS:1360438-45-4
Formula: O=[N+](C1=C(Cl)C(Cl)=NC=C1)[O-]
97%
BD465347
MFCD17168551
2,3-DICHLORO-4-THIOCYANATOANILINE
CAS:7494-03-3
Formula: NC1=CC=C(SC#N)C(Cl)=C1Cl
95%
BD450739
MFCD11556361
2,3-DICHLORO-5,6-DIFLUOROBENZOIC ACID
CAS:1263376-91-5
Formula: O=C(O)C1=C(F)C(F)=CC(Cl)=C1Cl
97%
BD590083
MFCD18379854
2,3-DICHLORO-5,6-DIMETHYLPYRAZINE
CAS:32493-79-1
Formula: CC1=NC(Cl)=C(Cl)N=C1C
97%
BD222192
2,3-DICHLORO-5,8-DIHYDROXYNAPHTHALENE-1,4-DIONE
CAS:14918-69-5
Formula: O=C(C1=C2C(O)=CC=C1O)C(Cl)=C(Cl)C2=O
97%
BD65418
MFCD00075261
2,3-DICHLORO-5-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PYRIDINE
CAS:741709-64-8
Formula: CC1(C)C(C)(C)OB(C2=CN=C(Cl)C(Cl)=C2)O1
95+%
BD241987
MFCD08063093
2,3-DICHLORO-5-(6-CHLOROOXAZOLO[5,4-B]PYRIDIN-2-YL)ANILINE
CAS:1354755-43-3
Formula: NC1=CC(C2=NC3=CC(Cl)=CN=C3O2)=CC(Cl)=C1Cl
97%
BD612872
2,3-DICHLORO-5-(CHLOROMETHYL)PYRIDINE
CAS:54127-31-0
Formula: ClCC1=CN=C(Cl)C(Cl)=C1
95+%
BD249038
MFCD00125365
2,3-DICHLORO-5-(CHLOROSULFONYL)BENZOIC ACID
CAS:53552-95-7
Formula: O=C(O)C1=CC(S(=O)(Cl)=O)=CC(Cl)=C1Cl
95+%
BD65414
MFCD09835179
2,3-DICHLORO-5-(DIFLUOROMETHYL)PYRIDINE
CAS:71690-06-7
Formula: FC(C1=CN=C(Cl)C(Cl)=C1)F
95+%
BD232256
2,3-DICHLORO-5-(METHYLTHIO)PYRAZINE
CAS:1174517-48-6
Formula: CSC1=CN=C(Cl)C(Cl)=N1
98%
BD301058
2,3-DICHLORO-5-(PYRROLIDIN-2-YL)PYRIDINE
CAS:1270382-21-2
Formula: ClC1=CC(C2NCCC2)=CN=C1Cl
97%
BD609208
2,3-DICHLORO-5-(TRICHLOROMETHYL)PYRIDINE
CAS:69045-83-6
Formula: ClC1=CC(=CN=C1Cl)C(Cl)(Cl)Cl
95+%
BD60577
MFCD03701543
2,3-DICHLORO-5-(TRIFLUOROMETHYL)BENZOIC ACID
CAS:25922-42-3
Formula: O=C(O)C1=CC(C(F)(F)F)=CC(Cl)=C1Cl
95+%
BD270142
2,3-DICHLORO-5-(TRIFLUOROMETHYL)ISONICOTINAMIDE
CAS:1198475-46-5
Formula: O=C(N)C1=C(C(F)(F)F)C=NC(Cl)=C1Cl
95+%
BD207669
2,3-DICHLORO-5-(TRIFLUOROMETHYL)ISONICOTINIC ACID
CAS:1135283-33-8
Formula: O=C(O)C1=C(C(F)(F)F)C=NC(Cl)=C1Cl
95+%
BD200836
2,3-DICHLORO-5-(TRIFLUOROMETHYL)ISONICOTINONITRILE
CAS:1198475-29-4
Formula: N#CC1=C(C(F)(F)F)C=NC(Cl)=C1Cl
95+%
BD207670
2,3-DICHLORO-5-(TRIFLUOROMETHYL)PYRAZINE
CAS:1238230-17-5
Formula: FC(C1=CN=C(Cl)C(Cl)=N1)(F)F
97%
BD689482
2,3-DICHLORO-5-(TRIFLUOROMETHYL)PYRIDIN-4-AMINE
CAS:431942-80-2
Formula: NC1=C(Cl)C(Cl)=NC=C1C(F)(F)F
95+%
BD207647
2,3-DICHLORO-5-(TRIFLUOROMETHYL)PYRIDINE
CAS:69045-84-7
Formula: C1=C(C(F)(F)F)C=NC(=C1Cl)Cl
98%
BD3080
MFCD00042243
2,3-DICHLORO-5-ETHOXYPYRIDINE
CAS:1345471-27-3
Formula: CCOC1=CN=C(Cl)C(Cl)=C1
98%
BD241643
2,3-DICHLORO-5-FLUOROBENZOIC ACID
CAS:1160573-70-5
Formula: O=C(O)C1=CC(F)=CC(Cl)=C1Cl
97%
BD496179
MFCD11845992
2,3-DICHLORO-5-FLUOROBENZONITRILE
CAS:1349715-92-9
Formula: N#CC1=CC(F)=CC(Cl)=C1Cl
97%
BD465812
MFCD19381657
2,3-DICHLORO-5-FLUOROPYRIDINE
CAS:185985-40-4
Formula: FC1=CN=C(Cl)C(Cl)=C1
98%
BD160398
2,3-DICHLORO-5-FORMYLPYRIDINE
CAS:71690-05-6
Formula: ClC1=NC=C(C=C1Cl)C=O
95+%
BD34721
MFCD08448226
2,3-DICHLORO-5-IODOPYRAZINE
CAS:1816294-11-7
Formula: IC1=CN=C(Cl)C(Cl)=N1
97%
BD689483
2,3-DICHLORO-5-IODOPYRIDINE
CAS:97966-01-3
Formula: ClC1=CC(I)=CN=C1Cl
95+%
BD65421
MFCD09835220
2,3-DICHLORO-5-METHOXYPYRIDINE
CAS:885168-12-7
Formula: COC1=CN=C(Cl)C(Cl)=C1
98%
BD36779
MFCD08277295
2,3-DICHLORO-5-METHYLANILINE
CAS:13711-29-0
Formula: NC1=CC(C)=CC(Cl)=C1Cl
95+%
BD281761
MFCD15527228
2,3-DICHLORO-5-METHYLPYRAZINE
CAS:32493-78-0
Formula: CC1=CN=C(Cl)C(Cl)=N1
95+%
BD248705
n/a
2,3-DICHLORO-5-METHYLPYRIDINE
CAS:59782-90-0
Formula: CC1=CN=C(Cl)C(Cl)=C1
98%
BD222737
MFCD08704667
2,3-DICHLORO-5-NITROANISOLE
CAS:1351862-12-8
Formula: COC1=CC([N+]([O-])=O)=CC(Cl)=C1Cl
95+%
BD395027
MFCD28250237
2,3-DICHLORO-5-NITROBENZOIC ACID
CAS:13300-61-3
Formula: O=C(O)C1=CC([N+]([O-])=O)=CC(Cl)=C1Cl
95+%
BD323110
MFCD12173031
2,3-DICHLORO-5-NITROBENZONITRILE
CAS:61188-15-6
Formula: N#CC1=CC([N+]([O-])=O)=CC(Cl)=C1Cl
95+%
BD323951
MFCD28126798
2,3-DICHLORO-5-NITRONAPHTHALENE-1,4-DIONE
CAS:22360-86-7
Formula: O=C(C1=C2C=CC=C1[N+]([O-])=O)C(Cl)=C(Cl)C2=O
97%
BD65422
MFCD00192929
2,3-DICHLORO-5-NITROPHENOL
CAS:1806356-80-8
Formula: OC1=CC([N+]([O-])=O)=CC(Cl)=C1Cl
97%
BD449904
MFCD28787278
2,3-DICHLORO-5-NITROPYRIDINE
CAS:22353-40-8
Formula: ClC1=NC=C(C=C1Cl)[N+](=O)[O-]
98%
BD32725
MFCD03840432
2,3-DICHLORO-5H-PYRROLO[3,4-B]PYRAZINE-5,7(6H)-DIONE
CAS:213549-73-6
Formula: O=C1NC(C2=NC(Cl)=C(Cl)N=C21)=O
95+%
BD303627
2,3-DICHLORO-6,7-DIFLUOROQUINOXALINE
CAS:91895-30-6
Formula: FC1=C(F)C=C2N=C(Cl)C(Cl)=NC2=C1
97%
BD448389
MFCD18533623
2,3-DICHLORO-6,7-DIMETHOXYQUINOXALINE
CAS:1790-91-6
Formula: COC1=C(OC)C=C2N=C(Cl)C(Cl)=NC2=C1
95+%
BD12667
MFCD04038941
2,3-DICHLORO-6,7-DIMETHYLQUINOXALINE
CAS:63810-80-0
Formula: CC1=C(C)C=C2N=C(Cl)C(Cl)=NC2=C1
97%
BD65427
MFCD00772734
2,3-DICHLORO-6,8-DIMETHYLQUINOLINE
CAS:1447949-09-8
Formula: CC1=C2N=C(Cl)C(Cl)=CC2=CC(C)=C1
97%
BD617571
2,3-DICHLORO-6-(CHLOROMETHYL)PYRIDINE
CAS:1227574-47-1
Formula: ClCC1N=C(Cl)C(Cl)=CC=1
95+%
BD00769764
n/a
2,3-DICHLORO-6-(TRICHLOROMETHYL)PYRIDINE
CAS:51492-01-4
Formula: ClC1=C(Cl)N=C(C=C1)C(Cl)(Cl)Cl
95+%
BD233366
MFCD18969733
2,3-DICHLORO-6-(TRIFLUOROMETHOXY)QUINOXALINE
CAS:1253522-03-0
Formula: FC(F)(F)OC1=CC=C2N=C(Cl)C(Cl)=NC2=C1
98%
BD248706
MFCD09842521
2,3-DICHLORO-6-(TRIFLUOROMETHYL)ANILINE
CAS:1017777-92-2
Formula: NC1=C(C(F)(F)F)C=CC(Cl)=C1Cl
95+%
BD306960
MFCD09832277
2,3-DICHLORO-6-(TRIFLUOROMETHYL)BENZALDEHYDE
CAS:186517-27-1
Formula: O=CC1=C(C(F)(F)F)C=CC(Cl)=C1Cl
97%
BD217770
2,3-DICHLORO-6-(TRIFLUOROMETHYL)BENZAMIDE
CAS:186517-38-4
Formula: O=C(N)C1=C(C(F)(F)F)C=CC(Cl)=C1Cl
95+%
BD320080
MFCD06660272
2,3-DICHLORO-6-(TRIFLUOROMETHYL)BENZOIC ACID
CAS:25922-43-4
Formula: O=C(O)C1=C(C(F)(F)F)C=CC(Cl)=C1Cl
97%
BD217771
2,3-DICHLORO-6-(TRIFLUOROMETHYL)BENZONITRILE
CAS:186517-39-5
Formula: N#CC1=C(C(F)(F)F)C=CC(Cl)=C1Cl
95+%
BD320552
MFCD09832276
2,3-DICHLORO-6-(TRIFLUOROMETHYL)BENZOYL CHLORIDE
CAS:886501-87-7
Formula: O=C(Cl)C1=C(C(F)(F)F)C=CC(Cl)=C1Cl
95+%
BD320079
MFCD06660271
2,3-DICHLORO-6-(TRIFLUOROMETHYL)ISONICOTINIC ACID
CAS:1824096-23-2
Formula: O=C(O)C1=CC(C(F)(F)F)=NC(Cl)=C1Cl
95+%
BD287469
2,3-DICHLORO-6-(TRIFLUOROMETHYL)PYRIDINE
CAS:89719-90-4
Formula: FC(F)(F)C1=CC=C(Cl)C(Cl)=N1
97%
BD168832
MFCD02083501
2,3-DICHLORO-6-(TRIFLUOROMETHYL)QUINOLINE
CAS:1447961-68-3
Formula: FC(C1=CC=C2N=C(Cl)C(Cl)=CC2=C1)(F)F
97%
BD617717
2,3-DICHLORO-6-(TRIFLUOROMETHYL)QUINOXALINE
CAS:55686-95-8
Formula: FC(C1=CC=C2N=C(Cl)C(Cl)=NC2=C1)(F)F
95+%
BD248707
MFCD09842520
2,3-DICHLORO-6-ETHYLPYRIDINE
CAS:2203487-12-9
Formula: CCC1=CC=C(Cl)C(Cl)=N1
97%
BD00807015
MFCD31414674
2,3-DICHLORO-6-FLUOROANILINE
CAS:1017777-51-3
Formula: NC1=C(F)C=CC(Cl)=C1Cl
95+%
BD320542
MFCD09832261
2,3-DICHLORO-6-FLUOROBENZALDEHYDE
CAS:95399-95-4
Formula: O=CC1=C(F)C=CC(Cl)=C1Cl
95+%
BD208396
MFCD04115870
2,3-DICHLORO-6-FLUOROBENZAMIDE
CAS:886497-63-8
Formula: O=C(N)C1=C(F)C=CC(Cl)=C1Cl
95+%
BD319670
MFCD04115877
2,3-DICHLORO-6-FLUOROBENZOIC ACID
CAS:32890-91-8
Formula: O=C(O)C1=C(F)C=CC(Cl)=C1Cl
95+%
BD65429
MFCD00090506
2,3-DICHLORO-6-FLUOROBENZONITRILE
CAS:79544-26-6
Formula: N#CC1=C(F)C=CC(Cl)=C1Cl
95+%
BD309188
MFCD04115878
2,3-DICHLORO-6-FLUOROBENZOYL CHLORIDE
CAS:886497-44-5
Formula: O=C(Cl)C1=C(F)C=CC(Cl)=C1Cl
95+%
BD321979
MFCD04115871
2,3-DICHLORO-6-FLUOROPHENOL
CAS:886497-60-5
Formula: OC1=C(F)C=CC(Cl)=C1Cl
95+%
BD309513
MFCD04115876
2,3-DICHLORO-6-FLUOROQUINOLINE
CAS:1447949-04-3
Formula: FC1=CC=C2N=C(Cl)C(Cl)=CC2=C1
97%
BD617569
2,3-DICHLORO-6-HYDROXYPYRIDINE
CAS:24525-63-1
Formula: OC1=CC=C(Cl)C(Cl)=N1
95+%
BD357027
MFCD16610775
2,3-DICHLORO-6-IODOQUINOLINE
CAS:1447959-18-3
Formula: IC1=CC=C2N=C(Cl)C(Cl)=CC2=C1
97%
BD617663
2,3-DICHLORO-6-IODOQUINOXALINE
CAS:1245647-89-5
Formula: IC1=CC=C2N=C(Cl)C(Cl)=NC2=C1
95+%
BD163884
2,3-DICHLORO-6-ISOPROPYL-5,6,7,8-TETRAHYDRO-1,6-NAPHTHYRIDINE
CAS:1708401-30-2
Formula: CC(N1CC2=C(N=C(Cl)C(Cl)=C2)CC1)C
97%
BD622400
2,3-DICHLORO-6-METHOXYPYRIDINE
CAS:83732-68-7
Formula: COC1=CC=C(Cl)C(Cl)=N1
97%
BD222436
MFCD08669402
2,3-DICHLORO-6-METHOXYQUINOXALINE
CAS:39267-04-4
Formula: COC1=CC2=C(C=C1)N=C(Cl)C(Cl)=N2
98%
BD167653
MFCD00461063
2,3-DICHLORO-6-METHYL-5,6,7,8-TETRAHYDRO-1,6-NAPHTHYRIDINE
CAS:1707727-91-0
Formula: CN1CC2=C(N=C(Cl)C(Cl)=C2)CC1
97%
BD621579
2,3-DICHLORO-6-METHYL-5-(TRIFLUOROMETHYL)ANILINE
CAS:1287218-11-4
Formula: NC1=C(C)C(C(F)(F)F)=CC(Cl)=C1Cl
95+%
BD282779
MFCD18089177
2,3-DICHLORO-6-METHYLANILINE
CAS:62077-27-4
Formula: NC1=C(C)C=CC(Cl)=C1Cl
95+%
BD281759
MFCD11878133
2,3-DICHLORO-6-METHYLPYRIDINE
CAS:54957-86-7
Formula: CC1=CC=C(Cl)C(Cl)=N1
98%
BD65436
MFCD09839232
2,3-DICHLORO-6-METHYLQUINOXALINE
CAS:39267-05-5
Formula: CC1=CC2=C(C=C1)N=C(Cl)C(Cl)=N2
98%
BD65431
MFCD00270819
2,3-DICHLORO-6-NITROANILINE
CAS:65078-77-5
Formula: NC1=C([N+]([O-])=O)C=CC(Cl)=C1Cl
97%
BD334931
MFCD00110529
2,3-DICHLORO-6-NITROBENZALDEHYDE
CAS:75618-41-6
Formula: O=CC1=C([N+]([O-])=O)C=CC(Cl)=C1Cl
97%
BD465303
MFCD06090840
2,3-DICHLORO-6-NITROBENZOIC ACID
CAS:13300-62-4
Formula: O=C(O)C1=C([N+]([O-])=O)C=CC(Cl)=C1Cl
95+%
BD65432
MFCD06208396
2,3-DICHLORO-6-NITROBENZONITRILE
CAS:2112-22-3
Formula: ClC1=C(C#N)C(=CC=C1Cl)[N+](=O)[O-]
97%
BD10120
MFCD00728596
2,3-DICHLORO-6-NITRONAPHTHALENE-1,4-DIONE
CAS:29284-76-2
Formula: O=C(C1=C2C=CC([N+]([O-])=O)=C1)C(Cl)=C(Cl)C2=O
95+%
BD434040
MFCD02093466
2,3-DICHLORO-6-NITROPHENOL
CAS:28165-60-8
Formula: OC1=C([N+]([O-])=O)C=CC(Cl)=C1Cl
95+%
BD298092
MFCD08458821
2,3-DICHLORO-6-PHENYLQUINOXALINE
CAS:1420794-75-7
Formula: ClC1=NC2=CC(C3=CC=CC=C3)=CC=C2N=C1Cl
97%
BD616381
2,3-DICHLORO-7-HYDROXY-4-METHYL-1H-INDEN-1-ONE
CAS:75376-47-5
Formula: O=C1C(Cl)=C(Cl)C2=C1C(O)=CC=C2C
97%
BD604761
MFCD26099175
2,3-DICHLORO-N'-HYDROXYBENZIMIDAMIDE
CAS:261761-55-1
Formula: NC(=NO)C1=CC=CC(Cl)=C1Cl
95+%
BD10427
MFCD01567248
2,3-DICHLORO-N,N-DIMETHYLBENZAMIDE
CAS:90526-00-4
Formula: O=C(N(C)C)C1=CC=CC(Cl)=C1Cl
98%
BD00765254
2,3-DICHLORO-N,N-DIMETHYLQUINOXALINE-6-SULFONAMIDE
CAS:2347-47-9
Formula: O=S(C1=CC=C2N=C(Cl)C(Cl)=NC2=C1)(N(C)C)=O
97%
BD671820
2,3-DICHLORO-N-CYCLOPROPYL-N-(PIPERIDIN-3-YLMETHYL)BENZENESULFONAMIDE HYDROCHLORIDE
CAS:1417793-95-3
Formula: O=S(C1=CC=CC(Cl)=C1Cl)(N(C2CC2)CC3CNCCC3)=O.[H]Cl
95+%
BD288363
MFCD22631630
2,3-DICHLORO-N-CYCLOPROPYLBENZAMIDE
CAS:876937-44-9
Formula: O=C(NC1CC1)C2=CC=CC(Cl)=C2Cl
95%
BD00812106
2,3-DICHLORO-N-ETHYL-N-(PYRROLIDIN-2-YLMETHYL)BENZENESULFONAMIDE HYDROCHLORIDE
CAS:1417794-52-5
Formula: O=S(C1=CC=CC(Cl)=C1Cl)(N(CC)CC2NCCC2)=O.[H]Cl
95+%
BD288248
MFCD22631712
2,3-DICHLORO-N-ETHYLANILINE
CAS:49850-15-9
Formula: CCNC1=CC=CC(Cl)=C1Cl
96%
BD28854
MFCD06658421
2,3-DICHLORO-N-METHYLANILINE
CAS:42265-79-2
Formula: CNC1=CC=CC(Cl)=C1Cl
95+%
BD228262
2,3-DICHLORO-N-METHYLANILINE HYDROCHLORIDE
CAS:1187386-16-8
Formula: CNC1=CC=CC(Cl)=C1Cl.[H]Cl
96%
BD255849
MFCD12912804
2,3-DICHLORO-N-METHYLBENZAMIDE
CAS:39959-96-1
Formula: O=C(NC)C1=CC=CC(Cl)=C1Cl
98%
BD00780410
2,3-DICHLOROACETOPHENONE
CAS:21886-56-6
Formula: ClCC(=O)C1=CC(Cl)=CC=C1
98%
BD217021
MFCD07783975
2,3-DICHLOROANTHRACEN-9(10H)-ONE
CAS:52075-62-4
Formula: O=C1C2=C(C=CC=C2)CC3=CC(Cl)=C(Cl)C=C13
95+%
BD283894
2,3-DICHLOROBENZALDEHYDE
CAS:6334-18-5
Formula: O=CC1=CC=CC(Cl)=C1Cl
98%
BD17205
MFCD00010127
2,3-DICHLOROBENZALDEHYDE OXIME
CAS:4414-54-4
Formula: O/N=C/C1=CC=CC(Cl)=C1Cl
97%
BD4327
2,3-DICHLOROBENZAMIDE
CAS:5980-24-5
Formula: O=C(N)C1=CC=CC(Cl)=C1Cl
98%
BD4328
MFCD00173938
2,3-DICHLOROBENZENESULFONAMIDE
CAS:82967-94-0
Formula: O=S(C1=CC=CC(Cl)=C1Cl)(N)=O
97%
BD193601
MFCD00464303
2,3-DICHLOROBENZENESULFONYL CHLORIDE
CAS:82417-45-6
Formula: O=S(C1=CC=CC(Cl)=C1Cl)(Cl)=O
98%
BD3146
MFCD00051844
2,3-DICHLOROBENZIMIDAMIDE
CAS:769061-91-8
Formula: N=C(N)C1=CC=CC(Cl)=C1Cl
95+%
BD285282
MFCD09745493
2,3-DICHLOROBENZIMIDAMIDE HYDROCHLORIDE
CAS:55154-87-5
Formula: N=C(N)C1=CC=CC(Cl)=C1Cl.[H]Cl
98%
BD29024
MFCD04114463
2,3-DICHLOROBENZO[F]QUINOXALINE
CAS:26907-93-7
Formula: ClC1=NC2=CC=C(C=CC=C3)C3=C2N=C1Cl
97%
BD00796716
2,3-DICHLOROBENZOHYDRAZIDE
CAS:438197-19-4
Formula: O=C(NN)C1=CC=CC(Cl)=C1Cl
95+%
BD172174
MFCD02612553
2,3-DICHLOROBENZOIC ACID
CAS:50-45-3
Formula: O=C(O)C1=CC=CC(Cl)=C1Cl
98%
BD4154
MFCD00002413
2,3-DICHLOROBENZONITRILE
CAS:6574-97-6
Formula: C1=CC=C(C(=C1C#N)Cl)Cl
98%
BD4036
MFCD00016372
2,3-DICHLOROBENZOTHIOAMIDE
CAS:84863-83-2
Formula: NC(C1=CC=CC(Cl)=C1Cl)=S
95+%
BD4340
MFCD00221163
2,3-DICHLOROBENZOYL CYANIDE
CAS:77668-42-9
Formula: O=C(C#N)C1=CC=CC(Cl)=C1Cl
95+%
BD5558
MFCD00792559
2,3-DICHLOROBENZYLAMINE
CAS:39226-95-4
Formula: NCC1=CC=CC(Cl)=C1Cl
98%
BD65458
MFCD00047927
2,3-DICHLOROBUTANE
CAS:7581-97-7
Formula: CC(Cl)C(Cl)C
95%
BD306396
MFCD00000866
2,3-DICHLOROFURO[2,3-C]PYRIDIN-7-AMINE
CAS:1326713-70-5
Formula: NC1=NC=CC2=C1OC(Cl)=C2Cl
97%
BD447236
MFCD24644550
2,3-DICHLOROFURO[3,4-B]PYRAZINE-5,7-DIONE
CAS:144692-85-3
Formula: O=C1OC(C2=NC(Cl)=C(Cl)N=C21)=O
95+%
BD303016
n/a
2,3-DICHLOROISONICOTINALDEHYDE
CAS:884495-41-4
Formula: O=CC1=CC=NC(Cl)=C1Cl
97%
BD36778
MFCD08277282
2,3-DICHLOROISONICOTINAMIDE
CAS:1192263-98-1
Formula: O=C(N)C1=CC=NC(Cl)=C1Cl
95%
BD202222
MFCD13193095
2,3-DICHLOROISONICOTINIC ACID
CAS:184416-84-0
Formula: O=C(O)C1=CC=NC(Cl)=C1Cl
98%
BD65492
MFCD01861977
2,3-DICHLOROISONICOTINONITRILE
CAS:N/A
Formula: N#CC1=CC=NC(Cl)=C1Cl
95+%
BD202223
MFCD13193096
2,3-DICHLOROISONICOTINOYL CHLORIDE
CAS:1325559-23-6
Formula: O=C(Cl)C1=CC=NC(Cl)=C1Cl
95%
BD00796707
2,3-DICHLOROMALEIC ANHYDRIDE
CAS:1122-17-4
Formula: O=C(C(Cl)=C1Cl)OC1=O
97%
BD124351
MFCD00005520
2,3-DICHLOROPHENOXYACETIC ACID
CAS:2976-74-1
Formula: OC(=O)COC1=CC=CC(Cl)=C1Cl
97%
BD65476
MFCD00004299
2,3-DICHLOROPHENOXYACETIC ACID HYDRAZIDE
CAS:153860-25-4
Formula: O=C(NN)COC1=CC=CC(Cl)=C1Cl
98%
BD307395
MFCD00245649
2,3-DICHLOROPHENYLACETIC ACID
CAS:10236-60-9
Formula: O=C(O)CC1=CC=CC(Cl)=C1Cl
98%
BD65479
MFCD01861393
2,3-DICHLOROPHENYLBORONIC ACID
CAS:151169-74-3
Formula: OB(C1=CC=CC(Cl)=C1Cl)O
98%
BD3305
MFCD01075703
2,3-DICHLOROPHENYLMETHYLSULFONE
CAS:106418-92-2
Formula: O=S(C)(C1=CC=CC(Cl)=C1Cl)=O
95+%
BD322402
MFCD03789181
2,3-DICHLOROPHENYLSULFONYLETHANOL
CAS:688763-03-3
Formula: OCCS(=O)(C1=CC=CC(Cl)=C1Cl)=O
95+%
BD324063
MFCD03789218
2,3-DICHLOROPROPANAMIDE
CAS:19433-84-2
Formula: O=C(N)C(Cl)CCl
98%
BD65483
MFCD00040311
2,3-DICHLOROPROPANENITRILE
CAS:2601-89-0
Formula: ClCC(Cl)C#N
94%
BD2065
MFCD00013809
2,3-DICHLOROPYRAZINE
CAS:4858-85-9
Formula: ClC1=NC=CN=C1Cl
97%
BD9377
MFCD00040964
2,3-DICHLOROPYRIDIN-4-AMINE
CAS:184416-83-9
Formula: NC1=C(Cl)C(Cl)=NC=C1
98%
BD196501
MFCD01646113
2,3-DICHLOROPYRIDIN-4-OL
CAS:1174047-06-3
Formula: OC1=C(Cl)C(Cl)=NC=C1
95+%
BD316835
n/a
2,3-DICHLOROPYRIDINE
CAS:2402-77-9
Formula: C1=C(C(=NC=C1)Cl)Cl
98%
BD17170
MFCD00006229
2,3-DICHLOROPYRIDINE-4-BORONIC ACID
CAS:951677-39-7
Formula: OB(O)C1=C(Cl)C(Cl)=NC=C1
95+%
BD42673
MFCD04038756
2,3-DICHLOROPYRIDINE-5-BORONIC ACID
CAS:1072944-15-0
Formula: OB(O)C1=CN=C(Cl)C(Cl)=C1
97%
BD36783
MFCD08277308
2,3-DICHLOROPYRIDINE1-OXIDE
CAS:53976-65-1
Formula: [O-][N+]1=CC=CC(Cl)=C1Cl
95%
BD65490
MFCD09910259
2,3-DICHLOROPYRIDO[1,2-A]PYRIMIDIN-4-ONE
CAS:117890-82-1
Formula: O=C1C(Cl)=C(Cl)N=C2N1C=CC=C2
96%
BD325040
MFCD25953923
2,3-DICHLOROPYRIDO[2,3-B]PYRAZINE
CAS:25710-18-3
Formula: ClC1=NC2=C(N=CC=C2)N=C1Cl
95+%
BD65494
MFCD09031107
2,3-DICHLOROPYRIDO[2,3-D]PYRIDAZIN-5(6H)-ONE
CAS:1447958-79-3
Formula: O=C1C2=CC(Cl)=C(Cl)N=C2C=NN1
97%
BD617638
2,3-DICHLOROPYRIDO[3,4-B]PYRAZINE
CAS:35251-99-1
Formula: ClC1=NC2=CN=CC=C2N=C1Cl
97%
BD447237
MFCD19374272
2,3-DICHLOROQUINOLINE
CAS:613-18-3
Formula: ClC1=CC2=CC=CC=C2N=C1Cl
95%
BD224734
2,3-DICHLOROQUINOXALINE
CAS:2213-63-0
Formula: ClC1=NC2=CC=CC=C2N=C1Cl
98%
BD65495
MFCD00006720
2,3-DICHLOROQUINOXALINE-5-CARBOXYLIC ACID
CAS:933726-33-1
Formula: O=C(C1=C2N=C(Cl)C(Cl)=NC2=CC=C1)O
95+%
BD256414
MFCD22571787
2,3-DICHLOROQUINOXALINE-6-CARBONYL CHLORIDE
CAS:17880-88-5
Formula: O=C(Cl)C1=CC=C2N=C(Cl)C(Cl)=NC2=C1
95+%
BD65398
MFCD08436439
2,3-DICHLOROQUINOXALINE-6-SULFONYL CHLORIDE
CAS:2149-05-5
Formula: O=S(C1=CC=C2N=C(Cl)C(Cl)=NC2=C1)(Cl)=O
BD00773153
2,3-DICHLOROQUINOXALINE-6-SULFONYL FLUORIDE
CAS:1955519-63-7
Formula: O=S(C1=CC=C2N=C(Cl)C(Cl)=NC2=C1)(F)=O
BD00785519
2,3-DICHLOROTHIOPHENE
CAS:17249-79-5
Formula: ClC1=C(Cl)C=CS1
95%
BD65498
MFCD00043890
2,3-DICHLOROTHIOPHENE-5-SULFONAMIDE
CAS:256353-34-1
Formula: NS(=O)(=O)C1=CC(Cl)=C(Cl)S1
95+%
BD9385
MFCD00177161
2,3-DICHLOROTOLUENE
CAS:32768-54-0
Formula: CC1=C(Cl)C(Cl)=CC=C1
98%
BD65502
MFCD00000546
2,3-DIETHYL-5-METHYLPYRAZINE
CAS:18138-04-0
Formula: CC1=CN=C(CC)C(CC)=N1
97%
BD11387
MFCD00009635
2,3-DIETHYLPYRAZINE
CAS:15707-24-1
Formula: CCC1=NC=CN=C1CC
95+%
BD65523
MFCD00006151
2,3-DIETHYLQUINOXALINE-6-CARBOXYLIC ACID
CAS:694506-87-1
Formula: O=C(C1=CC=C2N=C(CC)C(CC)=NC2=C1)O
97%
BD554539
MFCD03450169
2,3-DIETHYLSUCCINIC ACID
CAS:1186-79-4
Formula: O=C(O)C(CC)C(CC)C(O)=O
95+%
BD65524
MFCD02258550
2,3-DIFLUORO-1,4-DIIODOBENZENE
CAS:501433-06-3
Formula: IC1=CC=C(I)C(F)=C1F
95%
BD308237
MFCD22273735
2,3-DIFLUORO-1-IODO-4-METHOXYBENZENE
CAS:156499-64-8
Formula: COC1=C(C(=C(C=C1)I)F)F
95+%
BD160457
MFCD12913391
2,3-DIFLUORO-1-IODO-4-METHYLBENZENE
CAS:914100-41-7
Formula: CC1=C(F)C(F)=C(I)C=C1
95+%
BD160058
MFCD16619369
2,3-DIFLUORO-1-METHOXY-4-((TRANS-4-PROPYLCYCLOHEXYL)METHOXY)BENZENE
CAS:1373116-00-7
Formula: CCC[C@H]1CC[C@H](COC2=CC=C(OC)C(F)=C2F)CC1
95+%
BD322185
2,3-DIFLUORO-1-METHOXY-4-METHYLBENZENE
CAS:261763-32-0
Formula: CC1=CC=C(OC)C(F)=C1F
95+%
BD182851
MFCD01631321
2,3-DIFLUORO-1-METHOXY-4-PENTYLBENZENE
CAS:134364-71-9
Formula: CCCCCC1=CC=C(OC)C(F)=C1F
95+%
BD320443
MFCD09258680
2,3-DIFLUORO-1-METHYL-4-(TRANS-4-PROPYLCYCLOHEXYL)BENZENE
CAS:1374975-29-7
Formula: CCC[C@H]1CC[C@H](C2=CC=C(C)C(F)=C2F)CC1
97%
BD628628
2,3-DIFLUORO-1-METHYL-4-NITROBENZENE
CAS:932373-72-3
Formula: O=[N+](C1=CC=C(C)C(F)=C1F)[O-]
98%
BD215258
MFCD21603708
2,3-DIFLUORO-4'-PROPYL-1,1'-BIPHENYL
CAS:126163-02-8
Formula: CCCC1=CC=C(C2=CC=CC(F)=C2F)C=C1
95+%
BD160448
MFCD14584458
2,3-DIFLUORO-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PHENOL
CAS:1029439-85-7
Formula: OC1=CC=C(B2OC(C)(C)C(C)(C)O2)C(F)=C1F
95+%
BD283598
MFCD22414554
2,3-DIFLUORO-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PYRIDINE
CAS:N/A
Formula: FC(C(F)=NC=C1)=C1B(OC(C)2C)OC2(C)C
97%
BD439321
MFCD18712643
2,3-DIFLUORO-4-(METHOXYCARBONYL)PHENYLBORONIC ACID
CAS:1402238-29-2
Formula: OB(C1=CC=C(C(OC)=O)C(F)=C1F)O
98%
BD326423
MFCD18434428
2,3-DIFLUORO-4-(N-HEXYLOXY)PHENYLBORONIC ACID
CAS:121219-20-3
Formula: FC1=C(C=CC(=C1F)OCCCCCC)B(O)O
98%
BD7905
MFCD06656273
2,3-DIFLUORO-4-(TRIBUTYLSTANNYL)PYRIDINE
CAS:1245816-05-0
Formula: CCCC[Sn](C1=C(F)C(F)=NC=C1)(CCCC)CCCC
95+%
BD306556
MFCD10699151
2,3-DIFLUORO-4-(TRIFLUOROMETHYL)ANILINE
CAS:123950-46-9
Formula: NC1=CC=C(C(F)(F)F)C(F)=C1F
98%
BD4239
MFCD00236206
2,3-DIFLUORO-4-(TRIFLUOROMETHYL)BENZALDEHYDE
CAS:134099-20-0
Formula: O=CC1=CC=C(C(F)(F)F)C(F)=C1F
95%
BD0020
MFCD00236254
2,3-DIFLUORO-4-(TRIFLUOROMETHYL)BENZOIC ACID
CAS:237424-17-8
Formula: O=C(O)C1=CC=C(C(F)(F)F)C(F)=C1F
98%
BD65527
MFCD00236256
2,3-DIFLUORO-4-(TRIFLUOROMETHYL)BENZONITRILE
CAS:240122-24-1
Formula: N#CC1=CC=C(C(F)(F)F)C(F)=C1F
98%
BD257978
MFCD00236258
2,3-DIFLUORO-4-(TRIFLUOROMETHYL)BENZYL BROMIDE
CAS:213203-85-1
Formula: FC(C1=CC=C(C(F)=C1F)CBr)(F)F
98%
BD00803710
2,3-DIFLUORO-4-(TRIFLUOROMETHYL)BENZYLAMINE
CAS:581813-21-0
Formula: NCC1=CC=C(C(F)(F)F)C(F)=C1F
95%
BD00803043
2,3-DIFLUORO-4-(TRIFLUOROMETHYL)PHENOL
CAS:116640-12-1
Formula: OC1=CC=C(C(F)(F)F)C(F)=C1F
95%
BD65528
MFCD00236266
2,3-DIFLUORO-4-BROMONITROBENZENE
CAS:1003708-24-4
Formula: FC1=C(C=CC(=C1F)Br)[N+](=O)[O-]
98%
BD161308
MFCD09839215
2,3-DIFLUORO-4-CHLOROPYRIDINE
CAS:851178-99-9
Formula: FC1=NC=CC(Cl)=C1F
95%
BD95644
MFCD09031173
2,3-DIFLUORO-4-HYDROXYBENZALDEHYDE
CAS:676500-39-3
Formula: O=CC1=CC=C(O)C(F)=C1F
97%
BD65532
MFCD08235194
2,3-DIFLUORO-4-HYDROXYBENZOIC ACID
CAS:175968-39-5
Formula: OC(=O)C1=C(F)C(F)=C(O)C=C1
98%
BD18905
MFCD01321116
2,3-DIFLUORO-4-HYDROXYBENZONITRILE
CAS:126162-38-7
Formula: FC1=C(C#N)C=CC(=C1F)O
98%
BD41239
MFCD00269596
2,3-DIFLUORO-4-IODOANILINE
CAS:1026989-94-5
Formula: NC1=CC=C(I)C(F)=C1F
95+%
BD322345
MFCD21602052
2,3-DIFLUORO-4-IODOBENZALDEHYDE
CAS:885590-99-8
Formula: O=CC1=CC=C(I)C(F)=C1F
97%
BD215201
2,3-DIFLUORO-4-IODOBENZOIC ACID
CAS:501433-05-2
Formula: O=C(O)C1=CC=C(I)C(F)=C1F
97%
BD98061
MFCD07368123
2,3-DIFLUORO-4-IODOBENZONITRILE
CAS:943830-91-9
Formula: N#CC1=CC=C(I)C(F)=C1F
95+%
BD423582
MFCD28014018
2,3-DIFLUORO-4-IODOPHENOL
CAS:144292-40-0
Formula: OC1=CC=C(I)C(F)=C1F
97%
BD41292
2,3-DIFLUORO-4-IODOPYRIDINE
CAS:851386-34-0
Formula: IC1=C(F)C(F)=NC=C1
98%
BD65536
MFCD09909609
2,3-DIFLUORO-4-METHOXY-DL-PHENYLALANINE
CAS:1256482-63-9
Formula: NC(CC1=CC=C(OC)C(F)=C1F)C(O)=O
95+%
BD314654
MFCD09832370
2,3-DIFLUORO-4-METHOXYANILINE
CAS:155020-51-2
Formula: NC1=CC=C(OC)C(F)=C1F
98%
BD115423
MFCD04115986
2,3-DIFLUORO-4-METHOXYBENZALDEHYDE
CAS:256417-11-5
Formula: O=CC1=CC=C(OC)C(F)=C1F
98%
BD65537
MFCD04115981
2,3-DIFLUORO-4-METHOXYBENZAMIDE
CAS:886500-67-0
Formula: O=C(N)C1=CC=C(OC)C(F)=C1F
98%
BD261945
MFCD04115983
2,3-DIFLUORO-4-METHOXYBENZOIC ACID
CAS:329014-60-0
Formula: COC1=C(F)C(F)=C(C=C1)C(O)=O
98%
BD65538
MFCD03428569
2,3-DIFLUORO-4-METHOXYBENZONITRILE
CAS:256417-12-6
Formula: COC1=C(F)C(F)=C(C=C1)C#N
95%
BD65540
MFCD03428596
2,3-DIFLUORO-4-METHOXYBENZOYL CHLORIDE
CAS:849632-69-5
Formula: O=C(Cl)C1=CC=C(OC)C(F)=C1F
95%
BD319689
MFCD04115982
2,3-DIFLUORO-4-METHOXYBENZYL BROMIDE
CAS:689254-23-7
Formula: COC1=CC=C(C(F)=C1F)CBr
95+%
BD308602
MFCD04115985
2,3-DIFLUORO-4-METHOXYBENZYLAMINE
CAS:886500-75-0
Formula: NCC1=CC=C(OC)C(F)=C1F
95+%
BD309535
MFCD04115987
2,3-DIFLUORO-4-METHOXYPHENOL
CAS:261763-29-5
Formula: OC1=CC=C(OC)C(F)=C1F
98%
BD65541
MFCD01631505
2,3-DIFLUORO-4-METHYLANILINE
CAS:886503-79-3
Formula: NC1=CC=C(C)C(F)=C1F
96%
BD215219
MFCD06660321
2,3-DIFLUORO-4-METHYLANILINE HYDROCHLORIDE
CAS:1820740-00-8
Formula: NC1=CC=C(C)C(F)=C1F.[H]Cl
97%
BD461709
MFCD28369581
2,3-DIFLUORO-4-METHYLBENZALDEHYDE
CAS:245536-50-9
Formula: O=CC1=CC=C(C)C(F)=C1F
98%
BD5916
MFCD01631644
2,3-DIFLUORO-4-METHYLBENZAMIDE
CAS:261763-35-3
Formula: O=C(N)C1=CC=C(C)C(F)=C1F
95+%
BD65543
MFCD01631633
2,3-DIFLUORO-4-METHYLBENZENE-1-SULFONYL CHLORIDE
CAS:1698682-03-9
Formula: O=S(C1=CC=C(C)C(F)=C1F)(Cl)=O
97%
BD452765
MFCD28054217
2,3-DIFLUORO-4-METHYLBENZOIC ACID
CAS:261763-37-5
Formula: CC1=C(F)C(F)=C(C=C1)C(O)=O
96%
BD65544
MFCD01631643
2,3-DIFLUORO-4-METHYLBENZONITRILE
CAS:508203-48-3
Formula: N#CC1=CC=C(C)C(F)=C1F
98%
BD286676
MFCD06660243
2,3-DIFLUORO-4-METHYLBENZOYL CHLORIDE
CAS:261763-38-6
Formula: O=C(Cl)C1=CC=C(C)C(F)=C1F
95+%
BD65545
MFCD01631645
2,3-DIFLUORO-4-METHYLPHENOL
CAS:261763-45-5
Formula: OC1=CC=C(C)C(F)=C1F
95%
BD182854
MFCD01631651
2,3-DIFLUORO-4-NITROANILINE
CAS:1781140-23-5
Formula: NC1=CC=C([N+]([O-])=O)C(F)=C1F
95+%
BD376060
MFCD26960577
2,3-DIFLUORO-4-NITROANISOLE
CAS:66684-59-1
Formula: COC1=CC=C([N+]([O-])=O)C(F)=C1F
97%
BD41935
2,3-DIFLUORO-4-NITROBENZOIC ACID
CAS:1806370-35-3
Formula: O=C(O)C1=CC=C([N+]([O-])=O)C(F)=C1F
98%
BD435408
MFCD27922146
2,3-DIFLUORO-4-NITROPHENOL
CAS:123173-60-4
Formula: OC1=C(F)C(F)=C(C=C1)[N+]([O-])=O
95+%
BD236546
MFCD13185572
2,3-DIFLUORO-4-PENTYLPHENOL
CAS:887582-85-6
Formula: OC1=CC=C(CCCCC)C(F)=C1F
95+%
BD320442
MFCD09258677
2,3-DIFLUORO-4-PIPERIDINOPHENYLBORONIC ACID
CAS:1443380-15-1
Formula: OB(C1=CC=C(N2CCCCC2)C(F)=C1F)O
98%
BD326642
MFCD20441791
2,3-DIFLUORO-4-PROPOXYBENZONITRILE
CAS:1174005-85-6
Formula: CCCOC1=C(F)C(F)=C(C=C1)C#N
95+%
BD233201
MFCD11519049
2,3-DIFLUORO-5-(1-METHYL-1H-PYRAZOL-4-YL)PYRIDINE
CAS:1151801-90-9
Formula: CN1N=CC(C2=CN=C(F)C(F)=C2)=C1
97%
BD763482
2,3-DIFLUORO-5-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)ANILINE
CAS:1701449-93-5
Formula: NC1=CC(B2OC(C)(C)C(C)(C)O2)=CC(F)=C1F
96%
BD321561
MFCD18434474
2,3-DIFLUORO-5-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PHENOL
CAS:1220219-43-1
Formula: OC1=CC(B2OC(C)(C)C(C)(C)O2)=CC(F)=C1F
98%
BD303818
MFCD16996287
2,3-DIFLUORO-5-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PYRIDINE
CAS:1154579-82-4
Formula: CC1(C)C(C)(C)OB(C2=CN=C(F)C(F)=C2)O1
98%
BD164539
MFCD08063095
2,3-DIFLUORO-5-(TRIFLUOROMETHYL)PYRIDINE
CAS:89402-42-6
Formula: FC(C1=CN=C(F)C(F)=C1)(F)F
98%
BD65548
MFCD04972837
2,3-DIFLUORO-5-FORMYLPHENYLBORONIC ACID
CAS:N/A
Formula: OB(C1=CC(C=O)=CC(F)=C1F)O
96%
BD00787318
2,3-DIFLUORO-5-HYDROXYBENZOIC ACID
CAS:749230-51-1
Formula: O=C(O)C1=CC(O)=CC(F)=C1F
97%
BD280264
MFCD08704572
2,3-DIFLUORO-5-IODOBENZOIC ACID
CAS:333780-74-8
Formula: O=C(O)C1=CC(I)=CC(F)=C1F
96%
BD327174
MFCD16875978
2,3-DIFLUORO-5-IODOPYRIDINE
CAS:851386-35-1
Formula: IC1=CN=C(F)C(F)=C1
95+%
BD104308
MFCD09909610
2,3-DIFLUORO-5-ISOPROPOXYPHENYLBORONIC ACID, PINACOL ESTER
CAS:2096331-33-6
Formula: CC(OC1=CC(F)=C(F)C(B2OC(C)(C)C(C)(C)O2)=C1)C
95%
BD00781714
2,3-DIFLUORO-5-METHOXY-4-METHYLBENZOIC ACID
CAS:1706446-21-0
Formula: O=C(O)C1=CC(OC)=C(C)C(F)=C1F
95%
BD751114
MFCD27986839
2,3-DIFLUORO-5-METHOXYPHENYLBORONIC ACID, PINACOL ESTER
CAS:2096330-29-7
Formula: COC1=CC(F)=C(F)C(B2OC(C)(C)C(C)(C)O2)=C1
98%
BD00744238
2,3-DIFLUORO-5-METHYLBENZOIC ACID
CAS:1003709-96-3
Formula: CC1=CC(C(O)=O)=C(F)C(F)=C1
95+%
BD160395
2,3-DIFLUORO-5-METHYLBENZONITRILE
CAS:1003712-18-2
Formula: N#CC1=CC(C)=CC(F)=C1F
95+%
BD160396
MFCD09996953
2,3-DIFLUORO-5-METHYLPHENYLBORONIC ACID
CAS:934247-79-7
Formula: OB(C1=CC(C)=CC(F)=C1F)O
98%
BD328088
MFCD22573057
2,3-DIFLUORO-5-NITROBENZALDEHYDE
CAS:679840-20-1
Formula: O=CC1=CC([N+]([O-])=O)=CC(F)=C1F
95+%
BD265036
MFCD11847621
2,3-DIFLUORO-5-NITROBENZAMIDE
CAS:1806388-74-8
Formula: O=C(N)C1=CC([N+]([O-])=O)=CC(F)=C1F
95+%
BD265039
2,3-DIFLUORO-5-NITROBENZOIC ACID
CAS:942035-31-6
Formula: O=C(O)C1=CC([N+]([O-])=O)=CC(F)=C1F
95+%
BD264715
MFCD09859890
2,3-DIFLUORO-5-NITROBENZONITRILE
CAS:1247885-40-0
Formula: N#CC1=CC([N+]([O-])=O)=CC(F)=C1F
97%
BD249268
2,3-DIFLUORO-5-NITROPHENOL
CAS:1119455-04-7
Formula: OC1=CC([N+]([O-])=O)=CC(F)=C1F
96%
BD257964
MFCD12026384
2,3-DIFLUORO-5-NITROPHENYL ETHYL CARBONATE
CAS:1235492-42-8
Formula: O=C(OC1=CC([N+]([O-])=O)=CC(F)=C1F)OCC
97%
BD586347
2,3-DIFLUORO-5-NITROPHENYLBORONIC ACID PINACOL ESTER
CAS:N/A
Formula: O=[N+](C1=CC(F)=C(F)C(B2OC(C)(C)C(C)(C)O2)=C1)[O-]
98%
BD00803130
2,3-DIFLUORO-5-NITROPYRIDINE
CAS:954219-68-2
Formula: O=[N+](C1=CN=C(F)C(F)=C1)[O-]
98%
BD215482
2,3-DIFLUORO-6-(TRIFLUOROMETHYL)BENZONITRILE
CAS:186517-05-5
Formula: N#CC1=C(C(F)(F)F)C=CC(F)=C1F
95+%
BD10778
2,3-DIFLUORO-6-HYDROXYBENZALDEHYDE
CAS:187543-89-1
Formula: O=CC1=C(O)C=CC(F)=C1F
95+%
BD258097
MFCD08275282
2,3-DIFLUORO-6-HYDROXYBENZOIC ACID
CAS:749230-47-5
Formula: O=C(O)C1=C(O)C=CC(F)=C1F
95+%
BD65553
MFCD07368161
2,3-DIFLUORO-6-IODOBENZALDEHYDE
CAS:887586-24-5
Formula: O=CC1=C(I)C=CC(F)=C1F
97%
BD473624
MFCD07368117
2,3-DIFLUORO-6-IODOBENZOIC ACID
CAS:333780-75-9
Formula: O=C(O)C1=C(I)C=CC(F)=C1F
95+%
BD65554
MFCD07368093
2,3-DIFLUORO-6-METHOXYANILINE
CAS:886501-51-5
Formula: NC1=C(OC)C=CC(F)=C1F
95+%
BD309542
MFCD00278762
2,3-DIFLUORO-6-METHOXYANILINE HYDROCHLORIDE
CAS:1332581-65-3
Formula: NC1=C(OC)C=CC(F)=C1F.[H]Cl
95+%
BD259125
2,3-DIFLUORO-6-METHOXYBENZALDEHYDE
CAS:187543-87-9
Formula: O=CC1=C(OC)C=CC(F)=C1F
97%
BD5918
MFCD02093968
2,3-DIFLUORO-6-METHOXYBENZAMIDE
CAS:886501-57-1
Formula: O=C(N)C1=C(OC)C=CC(F)=C1F
97%
BD465337
MFCD04116017
2,3-DIFLUORO-6-METHOXYBENZENE-1-SULFONYL CHLORIDE
CAS:1208074-96-7
Formula: O=S(C1=C(OC)C=CC(F)=C1F)(Cl)=O
95+%
BD320928
MFCD12922651
2,3-DIFLUORO-6-METHOXYBENZOIC ACID
CAS:773873-26-0
Formula: COC1=CC=C(F)C(F)=C1C(O)=O
98%
BD65539
MFCD04116018
2,3-DIFLUORO-6-METHOXYBENZONITRILE
CAS:221202-34-2
Formula: N#CC1=C(OC)C=CC(F)=C1F
95%
BD65556
MFCD04116019
2,3-DIFLUORO-6-METHOXYBENZYLAMINE
CAS:886501-77-5
Formula: NCC1=C(OC)C=CC(F)=C1F
95+%
BD309543
MFCD04116022
2,3-DIFLUORO-6-METHOXYPHENOL
CAS:186306-70-7
Formula: OC1=C(OC)C=CC(F)=C1F
95+%
BD293336
MFCD04116024
2,3-DIFLUORO-6-METHOXYPHENYLBORONIC ACID
CAS:957061-21-1
Formula: OB(C1=C(OC)C=CC(F)=C1F)O
98%
BD7909
MFCD03095116
2,3-DIFLUORO-6-METHYLBENZALDEHYDE
CAS:949026-74-8
Formula: O=CC1=C(C)C=CC(F)=C1F
95%
BD751581
n/a
2,3-DIFLUORO-6-METHYLBENZOIC ACID
CAS:1378671-01-2
Formula: O=C(O)C1=C(C)C=CC(F)=C1F
97%
BD490405
MFCD16250152
2,3-DIFLUORO-6-METHYLBENZONITRILE
CAS:1807183-03-4
Formula: N#CC1=C(C)C=CC(F)=C1F
97%
BD451379
MFCD28790314
2,3-DIFLUORO-6-METHYLPYRIDINE
CAS:1227579-04-5
Formula: CC1=CC=C(F)C(F)=N1
98%
BD215320
2,3-DIFLUORO-6-NITRO-N-PHENYLANILINE
CAS:1393178-31-8
Formula: O=[N+](C1=C(C(F)=C(F)C=C1)NC2=CC=CC=C2)[O-]
98%
BD326290
MFCD24448833
2,3-DIFLUORO-6-NITRO-N-PROPYLANILINE
CAS:1250052-21-1
Formula: CCCNC1=C([N+]([O-])=O)C=CC(F)=C1F
98%
BD361080
MFCD16787122
2,3-DIFLUORO-6-NITROANILINE
CAS:211693-73-1
Formula: NC1=C([N+]([O-])=O)C=CC(F)=C1F
97%
BD160411
MFCD00233313
2,3-DIFLUORO-6-NITROBENZONITRILE
CAS:157647-01-3
Formula: N#CC1=C([N+]([O-])=O)C=CC(F)=C1F
95+%
BD303867
MFCD28505040
2,3-DIFLUORO-6-NITROPHENOL
CAS:82419-26-9
Formula: OC1=C([N+]([O-])=O)C=CC(F)=C1F
98%
BD22743
MFCD00042255
2,3-DIFLUORO-6-NITROTOLUENE
CAS:914348-35-9
Formula: CC1=C([N+]([O-])=O)C=CC(F)=C1F
95+%
BD162606
MFCD08706407
2,3-DIFLUORO-6-PIVALAMIDOBENZOIC ACID
CAS:874784-13-1
Formula: O=C(O)C1=C(NC(C(C)(C)C)=O)C=CC(F)=C1F
97%
BD583523
MFCD04035654
2,3-DIFLUORO-BENZAMIDINE HYDROCHLORIDE
CAS:1138036-26-6
Formula: N=C(N)C1=CC=CC(F)=C1F.[H]Cl
98%
BD00803588
2,3-DIFLUORO-L-HOMOPHENYLALANINE
CAS:1260616-60-1
Formula: N[C@@H](CCC1=CC=CC(F)=C1F)C(O)=O
95%
BD00792914
2,3-DIFLUORO-N'-HYDROXYBENZIMIDAMIDE
CAS:885957-13-1
Formula: N/C(C1=CC=CC(F)=C1F)=N\O
97%
BD492888
2,3-DIFLUORO-N-HYDROXY-6-(TRIFLUOROMETHYL)BENZIMIDAMIDE
CAS:180410-47-3
Formula: N=C(NO)C1=C(C(F)(F)F)C=CC(F)=C1F
95+%
BD227210
2,3-DIFLUORO-N-METHYL-6-NITROANILINE
CAS:170432-54-9
Formula: O=[N+](C1=C(C(F)=C(F)C=C1)NC)[O-]
97%
BD326859
MFCD16787128
2,3-DIFLUORO-N-METHYLANILINE
CAS:470458-54-9
Formula: CNC1=CC=CC(F)=C1F
95+%
BD320759
MFCD11617244
2,3-DIFLUORO-N-METHYLBENZAMIDE
CAS:1250397-72-8
Formula: O=C(NC)C1=CC=CC(F)=C1F
95%
BD457046
MFCD16836083
2,3-DIFLUOROANILINE
CAS:4519-40-8
Formula: NC1=CC=CC(F)=C1F
98%
BD9908
MFCD00010298
2,3-DIFLUOROANISOLE
CAS:134364-69-5
Formula: C1=CC=C(C(=C1OC)F)F
98%
BD65564
MFCD01631562
2,3-DIFLUOROBENZALDEHYDE
CAS:2646-91-5
Formula: C1=CC=C(C(=C1F)F)C=O
97%
BD10283
MFCD00010292
2,3-DIFLUOROBENZAMIDE
CAS:18355-75-4
Formula: O=C(N)C1=CC=CC(F)=C1F
97%
BD4401
MFCD00061137
2,3-DIFLUOROBENZENE-1,4-DIOL
CAS:124728-90-1
Formula: OC1=CC=C(O)C(F)=C1F
97%
BD65582
MFCD04038791
2,3-DIFLUOROBENZENE-1-SULFONYL CHLORIDE
CAS:210532-24-4
Formula: O=S(C1=CC=CC(F)=C1F)(Cl)=O
97%
BD490980
MFCD12785666
2,3-DIFLUOROBENZOHYDRAZIDE
CAS:387358-53-4
Formula: O=C(NN)C1=CC=CC(F)=C1F
95+%
BD351431
MFCD02183536
2,3-DIFLUOROBENZOIC ACID
CAS:4519-39-5
Formula: O=C(O)C1=CC=CC(F)=C1F
97%
BD4215
MFCD00010267
2,3-DIFLUOROBENZONITRILE
CAS:21524-39-0
Formula: N#CC1=CC=CC(F)=C1F
96%
BD10201
MFCD00009976
2,3-DIFLUOROBENZYL ALCOHOL
CAS:75853-18-8
Formula: FC1=C(F)C(CO)=CC=C1
97%
BD4627
MFCD00010312
2,3-DIFLUOROBENZYL BROMIDE
CAS:113211-94-2
Formula: FC1=C(C(CBr)=CC=C1)F
98%
BD30265
MFCD00042488
2,3-DIFLUOROBENZYLAMINE HCL
CAS:1214350-73-8
Formula: NCC1=CC=CC(F)=C1F.[H]Cl
95%
BD325159
MFCD13185548
2,3-DIFLUOROETHOXYBENZENE
CAS:121219-07-6
Formula: FC1=C(F)C(OCC)=CC=C1
98%
BD65581
MFCD07368737
2,3-DIFLUOROISONICOTINALDEHYDE
CAS:1227502-65-9
Formula: O=CC1=CC=NC(F)=C1F
95+%
BD208252
2,3-DIFLUOROISONICOTINIC ACID
CAS:851386-31-7
Formula: FC1=NC=CC(=C1F)C(=O)O
96%
BD159944
MFCD09031174
2,3-DIFLUOROISONICOTINONITRILE
CAS:1210041-67-0
Formula: N#CC1=CC=NC(F)=C1F
95+%
BD292961
n/a
2,3-DIFLUORONITROBENZENE
CAS:6921-22-8
Formula: C1=CC=C(F)C(=C1[N+]([O-])=O)F
98%
BD9778
MFCD00456802
2,3-DIFLUOROPHENOL
CAS:6418-38-8
Formula: C1=CC=C(C(=C1O)F)F
98%
BD3267
MFCD00010262
2,3-DIFLUOROPHENYL ETHYL CARBONATE
CAS:1235492-41-7
Formula: O=C(OC1=CC=CC(F)=C1F)OCC
97%
BD586346
2,3-DIFLUOROPHENYLBORONIC ACID
CAS:121219-16-7
Formula: C1=CC=C(F)C(=C1B(O)O)F
97%
BD9872
MFCD01863170
2,3-DIFLUOROPYRIDIN-4-OL
CAS:1227579-00-1
Formula: OC1=C(F)C(F)=NC=C1
95+%
BD234659
MFCD16610798
2,3-DIFLUOROPYRIDINE
CAS:1513-66-2
Formula: FC1=CC=CN=C1F
96%
BD32039
MFCD04114143
2,3-DIFLUOROSTYRENE
CAS:1080636-91-4
Formula: C=CC1=CC=CC(F)=C1F
97%
BD00761211
2,3-DIHEXYLTHIENO[3,4-B]PYRAZINE
CAS:146058-82-4
Formula: CCCCCCC1=NC2=CSC=C2N=C1CCCCCC
95+%
BD236785
MFCD20926265
2,3-DIHYDRAZINYLQUINOXALINE
CAS:73029-86-4
Formula: NNC1=NC2=CC=CC=C2N=C1NN
BD00746036
2,3-DIHYDRO-[1,4]DIOXINO[2,3-B]PYRIDIN-7-AMINE
CAS:1261365-47-2
Formula: NC1=CN=C(OCCO2)C2=C1
95+%
BD314706
MFCD18374085
2,3-DIHYDRO-[1,4]DIOXINO[2,3-B]PYRIDIN-7-OL
CAS:1261365-65-4
Formula: OC1=CN=C(OCCO2)C2=C1
95+%
BD230385
MFCD18374083
2,3-DIHYDRO-[1,4]DIOXINO[2,3-B]PYRIDIN-8-AMINE
CAS:1246088-52-7
Formula: NC1=C2C(OCCO2)=NC=C1
95+%
BD314597
MFCD17171322
2,3-DIHYDRO-[1,4]DIOXINO[2,3-B]PYRIDIN-8-OL
CAS:1246088-43-6
Formula: OC1=C2C(OCCO2)=NC=C1
95+%
BD230382
MFCD17171314
2,3-DIHYDRO-[1,4]DIOXINO[2,3-B]PYRIDINE-6-CARBALDEHYDE
CAS:615568-24-6
Formula: O=CC1=CC=C2C(OCCO2)=N1
97%
BD161555
MFCD12755733
2,3-DIHYDRO-[1,4]DIOXINO[2,3-B]PYRIDINE-6-CARBOXYLIC ACID
CAS:1095276-23-5
Formula: O=C(C1=CC=C2C(OCCO2)=N1)O
97%
BD564408
2,3-DIHYDRO-[1,4]DIOXINO[2,3-B]PYRIDINE-7-CARBALDEHYDE
CAS:95849-26-6
Formula: O=CC1=CN=C(OCCO2)C2=C1
96%
BD160924
MFCD12755734
2,3-DIHYDRO-[1,4]DIOXINO[2,3-B]PYRIDINE-7-CARBONITRILE
CAS:1261365-28-9
Formula: N#CC1=CN=C(OCCO2)C2=C1
95+%
BD314696
MFCD18374084
2,3-DIHYDRO-[1,4]DIOXINO[2,3-B]PYRIDINE-7-CARBOXYLIC ACID
CAS:1256818-31-1
Formula: O=C(C1=CN=C(OCCO2)C2=C1)O
95+%
BD219027
MFCD18250788
2,3-DIHYDRO-[1,4]DIOXINO[2,3-B]PYRIDINE-8-CARBONITRILE
CAS:1246088-54-9
Formula: N#CC1=C2C(OCCO2)=NC=C1
95+%
BD314599
MFCD17171315
2,3-DIHYDRO-[1,4]DIOXINO[2,3-B]PYRIDINE-8-CARBOXYLIC ACID
CAS:1228665-94-8
Formula: O=C(C1=C2C(OCCO2)=NC=C1)O
95+%
BD230384
MFCD16628209
2,3-DIHYDRO-[1,4]DIOXINO[2,3-C]PYRIDINE-7-CARBALDEHYDE
CAS:443955-90-6
Formula: O=CC1=CC2=C(OCCO2)C=N1
97%
BD160925
MFCD09907902
2,3-DIHYDRO-[1,4]DIOXINO[2,3-C]PYRIDINE-7-CARBOXYLIC ACID
CAS:527681-13-6
Formula: O=C(C1=CC2=C(OCCO2)C=N1)O
97%
BD625570
2,3-DIHYDRO-[1,4]DIOXINO[2,3-F]ISOQUINOLIN-7(8H)-ONE
CAS:630423-49-3
Formula: O=C1NC=CC2=C1C=CC3=C2OCCO3
95+%
BD334849
MFCD22043863
2,3-DIHYDRO-[1,4]DITHIINO[2,3-C]FURAN-5,7-DIONE
CAS:10489-75-5
Formula: O=C1C2=C(SCCS2)C(O1)=O
98%
BD3295
MFCD00223990
2,3-DIHYDRO-1,1,3-TRIMETHYL-2-METHYLENE-1H-BENZO[E]INDOLE
CAS:344928-74-1
Formula: C=C1N(C)C2=C(C3=CC=CC=C3C=C2)C1(C)C
98% GC)
BD00765409
2,3-DIHYDRO-1,3-METHANONAPHTHALEN-4(1H)-ONE
CAS:69584-47-0
Formula: O=C1C2CC(C2)C3=C1C=CC=C3
95%
BD444106
MFCD24692444
2,3-DIHYDRO-1,4-BENZODIOXINE-6-CARBOXYLIC ACID
CAS:4442-54-0
Formula: O=C(C1=CC=C(OCCO2)C2=C1)O
98%
BD28752
MFCD00463509
2,3-DIHYDRO-1,4-DIOXINO[2,3-B]PYRIDINE
CAS:129421-32-5
Formula: C12=NC=CC=C1OCCO2
97%
BD65621
MFCD09743547
2,3-DIHYDRO-1,8-NAPHTHYRIDIN-4(1H)-ONE
CAS:676515-33-6
Formula: O=C1CCNC2=C1C=CC=N2
95+%
BD225898
MFCD09834135
2,3-DIHYDRO-1-BENZOFURAN-5-PROPANOIC ACID
CAS:215057-28-6
Formula: O=C(O)CCC1=CC=C(OCC2)C2=C1
95%
BD65716
MFCD03102298
2,3-DIHYDRO-1-BENZOFURAN-5-SULFONOYLCHLORIDE
CAS:115010-11-2
Formula: O=S(C1=CC=C(OCC2)C2=C1)(Cl)=O
96%
BD65629
MFCD02677703
2,3-DIHYDRO-1-OXO-1H-INDENE-5-CARBONITRILE
CAS:25724-79-2
Formula: C1=C(C=C2C(=C1)C(CC2)=O)C#N
98%
BD41510
MFCD08234685
2,3-DIHYDRO-12,13-DIHYDROXYEUPARIN
CAS:135531-75-8
Formula: CC(C1=C(O)C=C(OC(C(C)(O)CO)C2)C2=C1)=O
95+%
BD298917
2,3-DIHYDRO-1H-BENZO[B]AZEPINE
CAS:3749-12-0
Formula: C12=CC=CC=C1C=CCCN2
95+%
BD331465
MFCD19217754
2,3-DIHYDRO-1H-BENZO[D]IMIDAZO[1,2-A]IMIDAZOLE
CAS:24134-26-7
Formula: C12=NC3=CC=CC=C3N1CCN2
98%
BD58732
MFCD00805823
2,3-DIHYDRO-1H-BENZO[D]IMIDAZOLE
CAS:4746-67-2
Formula: C12=CC=CC=C1NCN2
95+%
BD65637
MFCD08234618
2,3-DIHYDRO-1H-BENZO[D]PYRROLO[1,2-A]IMIDAZOL-1-ONE
CAS:19950-82-4
Formula: O=C1CCC2=NC3=CC=CC=C3N21
95+%
BD253886
2,3-DIHYDRO-1H-BENZO[DE]ISOQUINOLINE
CAS:22817-26-1
Formula: C1NCC2=C3C1=CC=CC3=CC=C2
97%
BD13811
MFCD01075706
2,3-DIHYDRO-1H-BENZO[E]INDOL-1-ONE
CAS:914656-73-8
Formula: O=C1C2C3C(C=CC=2NC1)=CC=CC=3
95+%
BD00709222
n/a
2,3-DIHYDRO-1H-BENZO[E]INDOLE
CAS:5811-00-7
Formula: C12C3C(=CC=CC=3)C=CC=1NCC2
95+%
BD00758937
n/a
2,3-DIHYDRO-1H-BENZO[E]PYRROLO[1,2-A][1,4]DIAZEPINE-5,11(10H,11AH)-DIONE
CAS:18877-34-4
Formula: O=C(N1C2CCC1)C3=CC=CC=C3NC2=O
95+%
BD398884
MFCD00835301
2,3-DIHYDRO-1H-CARBAZOL-4(9H)-ONE
CAS:15128-52-6
Formula: O=C1CCCC(N2)=C1C3=C2C=CC=C3
97%
BD13819
MFCD00173749
2,3-DIHYDRO-1H-CYCLOBUTA[B]INDOLE
CAS:55982-89-3
Formula: C1(N2)=C(CC1)C3=C2C=CC=C3
97%
BD754991
2,3-DIHYDRO-1H-CYCLOPENTA[A]NAPHTHALEN-1-ONE
CAS:6342-87-6
Formula: O=C1CCC2=CC=C3C=CC=CC3=C21
95+%
BD65636
MFCD00466286
2,3-DIHYDRO-1H-CYCLOPENTA[B]NAPHTHALEN-1-ONE
CAS:109341-49-3
Formula: O=C1CCC2=C1C=C3C=CC=CC3=C2
95+%
BD262587
2,3-DIHYDRO-1H-CYCLOPENTA[B]QUINOLIN-9-AMINE
CAS:18528-78-4
Formula: NC1=C(CCC2)C2=NC3=CC=CC=C13
97%
BD32373
2,3-DIHYDRO-1H-CYCLOPENTA[B]QUINOLINE
CAS:5661-06-3
Formula: C1CC2=CC3=CC=CC=C3N=C2C1
95+%
BD233373
MFCD18448962
2,3-DIHYDRO-1H-CYCLOPENTA[B]QUINOLINE-9-CARBOXYLIC ACID
CAS:5447-47-2
Formula: OC(=O)C1=C2C=CC=CC2=NC2=C1CCC2
95+%
BD65640
MFCD00454417
2,3-DIHYDRO-1H-IMIDAZO[1,2-A]IMIDAZOLE
CAS:67139-08-6
Formula: C12=NC=CN1CCN2
95+%
BD291690
MFCD09864159
2,3-DIHYDRO-1H-IMIDAZO[1,2-B]PYRAZOLE-6-CARBOXYLIC ACID
CAS:1515221-05-2
Formula: O=C(C1=NN2C(NCC2)=C1)O
97%
BD00823166
MFCD23701534
2,3-DIHYDRO-1H-IMIDAZO[1,2-B]PYRAZOLE-6-CARBOXYLIC ACID HYDROCHLORIDE
CAS:2089319-45-7
Formula: O=C(C1=NN2C(NCC2)=C1)O.[H]Cl
95+%
BD00729140
2,3-DIHYDRO-1H-INDEN-1-AMINE
CAS:34698-41-4
Formula: NC1CCC2=CC=CC=C12
98%
BD6787
MFCD00003799
2,3-DIHYDRO-1H-INDEN-1-AMINE HYDROCHLORIDE
CAS:70146-15-5
Formula: NC1CCC2=C1C=CC=C2.[H]Cl
95+%
BD34680
MFCD00054294
2,3-DIHYDRO-1H-INDEN-1-OL
CAS:6351-10-6
Formula: OC1CCC2=C1C=CC=C2
98%
BD59073
2,3-DIHYDRO-1H-INDEN-1-ONE OXIME
CAS:3349-60-8
Formula: O/N=C1CCC2=C\1C=CC=C2
95+%
BD41605
MFCD00082974
2,3-DIHYDRO-1H-INDEN-1-YL ACETATE
CAS:26452-98-2
Formula: O=C(OC1CCC2=C1C=CC=C2)C
95+%
BD434028
MFCD00053467
2,3-DIHYDRO-1H-INDEN-2-OL
CAS:4254-29-9
Formula: OC1CC2=C(C=CC=C2)C1
97%
BD75937
MFCD00003800
2,3-DIHYDRO-1H-INDEN-2-YL ACETATE
CAS:4254-31-3
Formula: CC(OC1CC2=C(C=CC=C2)C1)=O
95+%
BD246056
MFCD12756081
2,3-DIHYDRO-1H-INDEN-2-YL METHANESULFONATE
CAS:777-72-0
Formula: CS(=O)(OC1CC2=C(C=CC=C2)C1)=O
97%
BD177216
2,3-DIHYDRO-1H-INDEN-4-AMINE
CAS:32202-61-2
Formula: NC1=C2CCCC2=CC=C1
95+%
BD94136
MFCD00082598
2,3-DIHYDRO-1H-INDEN-5-AMINE SULFATE
CAS:77802-47-2
Formula: NC1=CC2=C(CCC2)C=C1.O=S(O)(O)=O
95+%
BD243623
2,3-DIHYDRO-1H-INDEN-5-OL
CAS:1470-94-6
Formula: OC1=CC2=C(CCC2)C=C1
99%
BD104291
MFCD00003802
2,3-DIHYDRO-1H-INDENE-1,2-DIOL
CAS:4370-02-9
Formula: OC1C(O)C2=C(C=CC=C2)C1
98%
BD599558
MFCD00053469
2,3-DIHYDRO-1H-INDENE-1,3-DICARBOXYLIC ACID
CAS:69718-74-7
Formula: O=C(C1CC(C(O)=O)C2=C1C=CC=C2)O
95+%
BD258800
2,3-DIHYDRO-1H-INDENE-1,5-DIOL
CAS:38005-82-2
Formula: OC1CCC2=CC(O)=CC=C12
95+%
BD229242
MFCD15144621
2,3-DIHYDRO-1H-INDENE-1-CARBONITRILE
CAS:26452-97-1
Formula: N#CC1CCC2=C1C=CC=C2
95+%
BD167916
2,3-DIHYDRO-1H-INDENE-1-CARBOXAMIDE
CAS:33695-57-7
Formula: O=C(C1CCC2=C1C=CC=C2)N
95+%
BD291974
MFCD00157628
2,3-DIHYDRO-1H-INDENE-2-CARBALDEHYDE
CAS:37414-44-1
Formula: O=CC1CC2=C(C=CC=C2)C1
96%
BD280786
MFCD14155842
2,3-DIHYDRO-1H-INDENE-2-CARBONITRILE
CAS:26453-01-0
Formula: N#CC1CC2=C(C=CC=C2)C1
95+%
BD211170
2,3-DIHYDRO-1H-INDENE-2-CARBOXYLIC ACID
CAS:25177-85-9
Formula: OC(=O)C1CC2=CC=CC=C2C1
95+%
BD0051
MFCD00085095
2,3-DIHYDRO-1H-INDENE-4-CARBONITRILE
CAS:15115-63-6
Formula: N#CC1=CC=CC2=C1CCC2
95+%
BD259732
2,3-DIHYDRO-1H-INDENE-4-CARBOXYLIC ACID
CAS:4044-54-6
Formula: OC(=O)C1=C2CCCC2=CC=C1
95+%
BD227705
MFCD13196143
2,3-DIHYDRO-1H-INDENE-5-CARBONITRILE
CAS:69975-67-3
Formula: N#CC1=CC2=C(CCC2)C=C1
95+%
BD351213
MFCD09991848
2,3-DIHYDRO-1H-INDENE-5-SULFONAMIDE
CAS:35203-93-1
Formula: O=S(C1=CC2=C(CCC2)C=C1)(N)=O
97%
BD556044
MFCD00021245
2,3-DIHYDRO-1H-INDENE-5-SULFONYL CHLORIDE
CAS:52205-85-3
Formula: O=S(C1=CC2=C(CCC2)C=C1)(Cl)=O
95%
BD134530
MFCD05237217
2,3-DIHYDRO-1H-ISOINDOL-1-YLMETHANOL HYDROCHLORIDE
CAS:1965309-67-4
Formula: OCC1NCC2=C1C=CC=C2.[H]Cl
97%
BD00816097
2,3-DIHYDRO-1H-ISOINDOLE-1-CARBOXYLIC ACID
CAS:66938-02-1
Formula: OC(=O)C1NCC2=CC=CC=C12
95%
BD29376
MFCD01318494
2,3-DIHYDRO-1H-ISOINDOLE-5-SULFONIC ACID AMIDE HYDROCHLORIDE
CAS:N/A
Formula: O=S(C1=CC2=C(CNC2)C=C1)(N)=O.[H]Cl
97%
BD00805258
2,3-DIHYDRO-1H-PYRANO[3,2-F]QUINOLIN-1-ONE
CAS:5252-47-1
Formula: O=C1CCOC2=CC=C3N=CC=CC3=C21
97%
BD628740
2,3-DIHYDRO-1H-PYRIDO[2,3-B][1,4]OXAZINE
CAS:1112193-37-9
Formula: C12=NC=CC=C1NCCO2
95%
BD206257
MFCD08692103
2,3-DIHYDRO-1H-PYRIDO[3,4-B][1,4]OXAZINE
CAS:194022-45-2
Formula: C1(C=NC=C2)=C2NCCO1
96%
BD206328
MFCD13176662
2,3-DIHYDRO-1H-PYRIDO[3,4-B][1,4]OXAZINE-8-CARBALDEHYDE
CAS:1203499-38-0
Formula: O=CC1=CN=CC2=C1NCCO2
95+%
BD207618
2,3-DIHYDRO-1H-PYRIDO[3,4-B][1,4]OXAZINE-8-CARBONITRILE
CAS:1228666-02-1
Formula: N#CC1=CN=CC2=C1NCCO2
95+%
BD314482
MFCD15530319
2,3-DIHYDRO-1H-PYRIDO[3,4-B][1,4]OXAZINE-8-CARBOXYLIC ACID
CAS:1228665-92-6
Formula: O=C(C1=CN=CC2=C1NCCO2)O
95+%
BD314474
MFCD15530320
2,3-DIHYDRO-1H-PYRROLIZIN-1-ONE
CAS:17266-64-7
Formula: O=C1C2=CC=CN2CC1
95+%
BD58957
2,3-DIHYDRO-1H-PYRROLIZINE-1,7-DICARBOXYLIC ACID
CAS:66635-69-6
Formula: OC(=O)C1CCN2C=CC(C(O)=O)=C12
95+%
BD34560
MFCD09701965
2,3-DIHYDRO-1H-PYRROLIZINE-5-CARBALDEHYDE
CAS:6225-59-8
Formula: O=CC1=CC=C2CCCN12
95+%
BD238428
MFCD12923838
2,3-DIHYDRO-1H-PYRROLIZINE-7-CARBOXYLIC ACID
CAS:116515-48-1
Formula: O=C(C1=C(CCC2)N2C=C1)O
97%
BD520314
2,3-DIHYDRO-1H-PYRROLO[1,2-A]INDOL-1-ONE
CAS:1421-17-6
Formula: O=C1CCN2C1=CC3=C2C=CC=C3
95+%
BD247334
MFCD11110457
2,3-DIHYDRO-1H-PYRROLO[2,3-B]PYRIDIN-5-AMINE
CAS:102000-79-3
Formula: NC1=CN=C(NCC2)C2=C1
97%
BD518420
2,3-DIHYDRO-1H-PYRROLO[2,3-B]PYRIDINE
CAS:10592-27-5
Formula: C12=NC=CC=C1CCN2
98%
BD65659
MFCD06659751
2,3-DIHYDRO-1H-PYRROLO[2,3-B]PYRIDINE-2-CARBOXYLIC ACID
CAS:1616337-50-8
Formula: O=C(C1CC2=CC=CN=C2N1)O
97%
BD682313
2,3-DIHYDRO-1H-PYRROLO[2,3-B]PYRIDINE-2-CARBOXYLIC ACID HYDROCHLORIDE
CAS:1779413-71-6
Formula: O=C(C1CC2=CC=CN=C2N1)O.[H]Cl
95+%
BD00721815
n/a
2,3-DIHYDRO-1H-PYRROLO[2,3-B]PYRIDINE-4-CARBONITRILE
CAS:1354454-97-9
Formula: N#CC1=C2C(NCC2)=NC=C1
BD00760741
2,3-DIHYDRO-1H-PYRROLO[2,3-B]PYRIDINE-4-CARBOXYLIC ACID
CAS:1529055-75-1
Formula: O=C(C1=C2C(NCC2)=NC=C1)O
97%
BD00770570
2,3-DIHYDRO-1H-PYRROLO[2,3-B]PYRIDINE-5-CARBONITRILE
CAS:267413-07-0
Formula: N#CC1=CN=C(NCC2)C2=C1
97%
BD65660
2,3-DIHYDRO-1H-PYRROLO[2,3-C]PYRIDINE
CAS:760919-39-9
Formula: C1(NCC2)=C2C=CN=C1
98%
BD167680
MFCD09907942
2,3-DIHYDRO-1H-PYRROLO[2,3-C]PYRIDINE DIHYDROCHLORIDE
CAS:1432681-13-4
Formula: [H]Cl.[H]Cl.C1(NCC2)=C2C=CN=C1
97%
BD587135
2,3-DIHYDRO-1H-PYRROLO[2,3-C]PYRIDINE HYDROCHLORIDE
CAS:1610028-39-1
Formula: [H]Cl.C1(NCC2)=C2C=CN=C1
95+%
BD260274
MFCD18917090
2,3-DIHYDRO-1H-PYRROLO[2,3-C]PYRIDINE-4-CARBONITRILE
CAS:1578263-91-8
Formula: N#CC1=CN=CC2=C1CCN2
97%
BD00806783
2,3-DIHYDRO-1H-PYRROLO[2,3-C]PYRIDINE-7-CARBONITRILE
CAS:1338219-66-1
Formula: N#CC1=NC=CC2=C1NCC2
97%
BD00798044
2,3-DIHYDRO-1H-PYRROLO[3,2-B]PYRIDINE
CAS:1211540-79-2
Formula: C12=NC=CC=C1NCC2
97%
BD246514
MFCD18256419
2,3-DIHYDRO-1H-PYRROLO[3,2-B]PYRIDINE DIHYDROCHLORIDE
CAS:1443981-64-3
Formula: [H]Cl.[H]Cl.C12CCNC1=CC=CN=2
95+%
BD00756018
n/a
2,3-DIHYDRO-1H-PYRROLO[3,2-B]PYRIDINE HYDROCHLORIDE
CAS:1956306-76-5
Formula: [H]Cl.C12=NC=CC=C1NCC2
97%
BD260273
2,3-DIHYDRO-1H-PYRROLO[3,2-C]PYRIDIN-6(5H)-ONE
CAS:66751-33-5
Formula: O=C1C=C(NCC2)C2=CN1
95+%
BD218997
MFCD00984899
2,3-DIHYDRO-1H-PYRROLO[3,2-C]PYRIDINE
CAS:23596-28-3
Formula: C12=C(NCC2)C=CN=C1
95%
BD239421
2,3-DIHYDRO-1H-PYRROLO[3,2-C]PYRIDINE HYDROCHLORIDE
CAS:5912-19-6
Formula: C12=C(NCC2)C=CN=C1.[H]Cl
96%
BD285211
MFCD18384264
2,3-DIHYDRO-1H-PYRROLO[3,2-C]PYRIDINE-4-CARBONITRILE
CAS:1578263-89-4
Formula: N#CC1=NC=CC2=C1CCN2
97%
BD443083
MFCD28405362
2,3-DIHYDRO-1H-PYRROLO[3,2-C]PYRIDINE-4-CARBOXYLIC ACID
CAS:2169469-30-9
Formula: O=C(C1=NC=CC2=C1CCN2)O
97%
BD00791843
2,3-DIHYDRO-1H-PYRROLO[3,4-C]PYRIDIN-1-ONE
CAS:5655-00-5
Formula: O=C1NCC2=C1C=CN=C2
95+%
BD292366
MFCD13175880
2,3-DIHYDRO-1H-PYRROLO[3,4-C]PYRIDINE
CAS:496-13-9
Formula: C1(CNC2)=C2C=CN=C1
95+%
BD65661
MFCD06858479
2,3-DIHYDRO-1H-PYRROLO[3,4-C]PYRIDINE DIHYDROCHLORIDE
CAS:6000-50-6
Formula: C1(CNC2)=C2C=CN=C1.[H]Cl.[H]Cl
97%
BD159935
MFCD15144657
2,3-DIHYDRO-1H-PYRROLO[3,4-C]PYRIDINE HYDROCHLORIDE
CAS:651558-58-6
Formula: Cl.C1NCC2=C1C=CN=C2
97%
BD29320
MFCD08273906
2,3-DIHYDRO-1H-PYRROLO[3,4-C]PYRIDINE HYDROCHLORIDE(1:X)
CAS:1255306-33-2
Formula: [H]Cl.C1(CNC2)=C2C=CN=C1
95%
BD755726
2,3-DIHYDRO-1H-SPIRO[ISOQUINOLINE-4,4'-PIPERIDINE]
CAS:1145670-30-9
Formula: C12=C(CNCC23CCNCC3)C=CC=C1
95+%
BD251455
MFCD13195371
2,3-DIHYDRO-1H-SPIRO[ISOQUINOLINE-4,4'-PIPERIDINE] DIHYDROCHLORIDE
CAS:1588441-25-1
Formula: [H]Cl.[H]Cl.C12=C(CNCC23CCNCC3)C=CC=C1
95+%
BD254005
2,3-DIHYDRO-3-METHYL-1,2-BENZISOTHIAZOLE 1,1-DIOXIDE
CAS:84108-98-5
Formula: CC(C1=CC=CC=C12)NS2(=O)=O
97+%
BD273422
2,3-DIHYDRO-3-OXO-1H-INDENE-4-CARBONITRILE
CAS:215362-26-8
Formula: N#CC1=CC=CC(CC2)=C1C2=O
95+%
BD41454
MFCD11035917
2,3-DIHYDRO-3A-METHOXYNIMBOLIDE
CAS:1607828-35-2
Formula: C[C@@]12[C@@](O[C@@]3([H])C2=C([C@H](C4=COC=C4)C3)C)([H])[C@@](O5)([H])[C@]6([H])[C@](C)(C(C[C@@H](O
95+%
BD299862
2,3-DIHYDRO-4-IODOINDEN-1-ONE
CAS:60899-33-4
Formula: O=C1CCC2=C1C=CC=C2I
95+%
BD41852
MFCD09744083
2,3-DIHYDRO-4-NITROBENZOFURAN
CAS:1001756-96-2
Formula: O=[N+](C1=C2CCOC2=CC=C1)[O-]
95+%
BD314012
MFCD21641999
2,3-DIHYDRO-4H-PYRAN-4-ONE
CAS:84302-42-1
Formula: O=C1CCOC=C1
95+%
BD227507
2,3-DIHYDRO-5-OXO-(1H,5H)-BENZO[IJ]-QUINOLIZINE-6-CARBOXALDEHYDE
CAS:386715-48-6
Formula: O=CC1=CC2=C3N(C1=O)CCCC3=CC=C2
95+%
BD315593
MFCD01567808
2,3-DIHYDRO-7-IODOINDEN-1-ONE
CAS:628732-02-5
Formula: IC1=C2C(=O)CCC2=CC=C1
95+%
BD41887
2,3-DIHYDRO-BENZOFURAN-5-CARBOXYLIC ACID METHYLAMIDE
CAS:633317-73-4
Formula: O=C(C1=CC=C(OCC2)C2=C1)NC
95+%
BD323977
MFCD00114392
2,3-DIHYDRO-INDOLE-1,6-DICARBOXYLIC ACID 1-TERT-BUTYL ESTER 6-METHYL ESTER
CAS:928771-49-7
Formula: O=C(N1CCC2=C1C=C(C(OC)=O)C=C2)OC(C)(C)C
97%
BD00801982
2,3-DIHYDROACRIDIN-4(1H)-ONE
CAS:49568-10-7
Formula: O=C1CCCC2=CC3=CC=CC=C3N=C12
95+%
BD235183
2,3-DIHYDROAMENTOFLAVONE 7,4'-DIMETHYL ETHER
CAS:873999-88-3
Formula: O=C1C[C@@H](C2=CC=C(OC)C(C3=C4C(C(C=C(C5=CC=C(O)C=C5)O4)=O)=C(O)C=C3O)=C2)OC6=CC(OC)=CC(O)=C16
95+%
BD299650
MFCD28016489
2,3-DIHYDROBENZO[B][1,4]DIOXIN-2-OL
CAS:5770-59-2
Formula: OC1COC2=CC=CC=C2O1
95+%
BD427496
MFCD00972012
2,3-DIHYDROBENZO[B][1,4]DIOXIN-5-AMINE HYDROCHLORIDE
CAS:16081-46-2
Formula: Cl.NC1=CC=CC2=C1OCCO2
95+%
BD159876
MFCD08056380
2,3-DIHYDROBENZO[B][1,4]DIOXIN-5-OL
CAS:10288-36-5
Formula: C2=CC=C1OCCOC1=C2O
97%
BD158261
MFCD02103729
2,3-DIHYDROBENZO[B][1,4]DIOXIN-6-AMINE
CAS:22013-33-8
Formula: NC1=CC=C2OCCOC2=C1
98%
BD41465
MFCD00006824
2,3-DIHYDROBENZO[B][1,4]DIOXIN-6-AMINE HYDROCHLORIDE
CAS:801316-07-4
Formula: Cl.NC1=CC2=C(OCCO2)C=C1
95+%
BD234282
MFCD07282613
2,3-DIHYDROBENZO[B][1,4]DIOXINE
CAS:493-09-4
Formula: C1COC2=C(O1)C=CC=C2
98%
BD33777
MFCD00006821
2,3-DIHYDROBENZO[B][1,4]DIOXINE-2-CARBALDEHYDE
CAS:64179-67-5
Formula: O=CC1COC2=C(O1)C=CC=C2
97%
BD29304
MFCD02656553
2,3-DIHYDROBENZO[B][1,4]DIOXINE-2-CARBOHYDRAZIDE
CAS:90557-92-9
Formula: O=C(C1OC2=CC=CC=C2OC1)NN
97%
BD65604
2,3-DIHYDROBENZO[B][1,4]DIOXINE-2-CARBONITRILE
CAS:1008-92-0
Formula: N#CC1COC2=CC=CC=C2O1
95%
BD65605
MFCD00068066
2,3-DIHYDROBENZO[B][1,4]DIOXINE-2-CARBONYL CHLORIDE
CAS:3663-81-8
Formula: O=C(Cl)C1OC2=CC=CC=C2OC1
97%
BD65606
2,3-DIHYDROBENZO[B][1,4]DIOXINE-2-CARBOXIMIDAMIDE HYDROCHLORIDE
CAS:85084-36-2
Formula: N=C(C1OC2=CC=CC=C2OC1)N.[H]Cl
95%
BD65608
2,3-DIHYDROBENZO[B][1,4]DIOXINE-2-CARBOXYLIC ACID
CAS:3663-80-7
Formula: O=C(C1OC2=CC=CC=C2OC1)O
98%
BD54403
MFCD00084888
2,3-DIHYDROBENZO[B][1,4]DIOXINE-2-SULFONYL CHLORIDE
CAS:499770-80-8
Formula: O=S(C1COC2=CC=CC=C2O1)(Cl)=O
95+%
BD160216
2,3-DIHYDROBENZO[B][1,4]DIOXINE-5-CARBALDEHYDE
CAS:29668-43-7
Formula: O=CC1=C2C(OCCO2)=CC=C1
95%
BD65609
MFCD00239451
2,3-DIHYDROBENZO[B][1,4]DIOXINE-5-CARBONITRILE
CAS:148703-14-4
Formula: N#CC1=C2C(OCCO2)=CC=C1
98%
BD65610
2,3-DIHYDROBENZO[B][1,4]DIOXINE-5-CARBOXAMIDE
CAS:349550-81-8
Formula: NC(=O)C1=CC=CC2=C1OCCO2
95+%
BD65613
MFCD11053918
2,3-DIHYDROBENZO[B][1,4]DIOXINE-5-CARBOXYLIC ACID
CAS:4442-53-9
Formula: O=C(C1=C2C(OCCO2)=CC=C1)O
97%
BD7637
MFCD00239415
2,3-DIHYDROBENZO[B][1,4]DIOXINE-6,7-DIAMINE
CAS:81927-47-1
Formula: NC1=CC(OCCO2)=C2C=C1N
97%
BD53126
2,3-DIHYDROBENZO[B][1,4]DIOXINE-6-CARBALDEHYDE
CAS:29668-44-8
Formula: O=CC1=CC=C2OCCOC2=C1
98%
BD7620
MFCD00010092
2,3-DIHYDROBENZO[B][1,4]DIOXINE-6-CARBALDEHYDE OXIME
CAS:31127-39-6
Formula: O/N=C/C1=CC=C2OCCOC2=C1
98%
BD252174
2,3-DIHYDROBENZO[B][1,4]DIOXINE-6-CARBOHYDRAZIDE
CAS:98953-13-0
Formula: O=C(C1=CC=C(OCCO2)C2=C1)NN
97%
BD65614
2,3-DIHYDROBENZO[B][1,4]DIOXINE-6-CARBONITRILE
CAS:19102-07-9
Formula: N#CC1=CC2=C(OCCO2)C=C1
97%
BD65615
MFCD00221462
2,3-DIHYDROBENZO[B][1,4]DIOXINE-6-CARBOTHIOAMIDE
CAS:337508-71-1
Formula: S=C(C1=CC=C2OCCOC2=C1)N
95+%
BD65617
MFCD02682020
2,3-DIHYDROBENZO[B][1,4]DIOXINE-6-CARBOXAMIDE
CAS:299169-62-3
Formula: NC(=O)C1=CC2=C(OCCO2)C=C1
98%
BD234262
MFCD00462966
2,3-DIHYDROBENZO[B][1,4]DIOXINE-6-CARBOXAMIDE HYDROCHLORIDE
CAS:90563-91-0
Formula: Cl.NC(=O)C1=CC2=C(OCCO2)C=C1
95+%
BD234291
2,3-DIHYDROBENZO[B][1,4]DIOXINE-6-SULFONAMIDE
CAS:90222-81-4
Formula: O=S(C1=CC=C(OCCO2)C2=C1)(N)=O
97%
BD65705
2,3-DIHYDROBENZO[B][1,4]DIOXINE-6-SULFONYL CHLORIDE
CAS:63758-12-3
Formula: ClS(=O)(=O)C1=CC=C2OCCOC2=C1
98%
BD6119
MFCD02677681
2,3-DIHYDROBENZO[B][1,4]OXAZEPIN-4(5H)-ONE
CAS:704-48-3
Formula: O=C1NC2=CC=CC=C2OCC1
95+%
BD167022
MFCD09832136
2,3-DIHYDROBENZO[B]FURAN
CAS:496-16-2
Formula: C1=CC=CC2=C1CCO2
98%
BD6377
MFCD00005855
2,3-DIHYDROBENZO[B]FURAN-5-CARBALDEHYDE
CAS:55745-70-5
Formula: C1=C(C=O)C=CC2=C1CCO2
97%
BD7612
MFCD00068058
2,3-DIHYDROBENZO[B]FURAN-5-CARBALDEHYDE OXIME
CAS:882287-07-2
Formula: O/N=C/C1=CC=C2OCCC2=C1
95+%
BD324359
MFCD00113320
2,3-DIHYDROBENZO[B]FURAN-5-CARBOXYLICACID
CAS:76429-73-7
Formula: O=C(C1=CC=C(OCC2)C2=C1)O
98%
BD7622
MFCD00085012
2,3-DIHYDROBENZO[B]OXEPIN-4(5H)-ONE
CAS:21503-01-5
Formula: O=C1CCOC2=CC=CC=C2C1
95+%
BD330890
MFCD15527458
2,3-DIHYDROBENZO[B]OXEPINE
CAS:14949-49-6
Formula: C12=CC=CC=C1C=CCCO2
95+%
BD252530
2,3-DIHYDROBENZO[B]THIOPHENE-2-CARBOXYLIC ACID
CAS:27916-82-1
Formula: O=C(C1CC2=CC=CC=C2S1)O
95+%
BD279309
2,3-DIHYDROBENZO[B]THIOPHENE-3-CARBOXYLIC ACID
CAS:19156-56-0
Formula: O=C(C1C2=CC=CC=C2SC1)O
97%
BD624113
2,3-DIHYDROBENZO[D]IMIDAZO[2,1-B]THIAZOL-6-AMINE
CAS:78291-99-3
Formula: NC1=CC=C(SC2=NCCN23)C3=C1
95+%
BD65721
MFCD00044717
2,3-DIHYDROBENZO[D]ISOTHIAZOLE 1,1-DIOXIDE
CAS:936-16-3
Formula: O=S1(NCC2=CC=CC=C21)=O
96%
BD65593
MFCD03426201
2,3-DIHYDROBENZOFURAN-2-CARBALDEHYDE
CAS:36054-77-0
Formula: O=CC1OC2=CC=CC=C2C1
97%
BD624975
2,3-DIHYDROBENZOFURAN-2-CARBOHYDRAZIDE
CAS:176179-03-6
Formula: O=C(C1OC2=CC=CC=C2C1)NN
97%
BD623471
2,3-DIHYDROBENZOFURAN-2-CARBOXYLIC ACID
CAS:1914-60-9
Formula: O=C(C1OC2=CC=CC=C2C1)O
97%
BD7621
MFCD03086168
2,3-DIHYDROBENZOFURAN-3-AMINE
CAS:109926-35-4
Formula: NC1COC2=CC=CC=C12
95+%
BD27197
2,3-DIHYDROBENZOFURAN-3-AMINE HYDROCHLORIDE
CAS:860689-81-2
Formula: NC1COC2=CC=CC=C12.[H]Cl
96%
BD40425
2,3-DIHYDROBENZOFURAN-3-CARBONITRILE
CAS:1341144-16-8
Formula: N#CC1COC2=CC=CC=C12
97%
BD610623
2,3-DIHYDROBENZOFURAN-3-CARBOXYLIC ACID
CAS:39891-55-9
Formula: OC(=O)C1COC2=CC=CC=C12
95+%
BD84652
MFCD08669486
2,3-DIHYDROBENZOFURAN-4-AMINE
CAS:61090-37-7
Formula: NC1=C2CCOC2=CC=C1
97%
BD65682
2,3-DIHYDROBENZOFURAN-4-AMINE 4-METHYLBENZENESULFONATE
CAS:76093-73-7
Formula: NC1=C2CCOC2=CC=C1.OS(=O)(C3=CC=C(C)C=C3)=O
97%
BD498086
MFCD20921815
2,3-DIHYDROBENZOFURAN-4-CARBALDEHYDE
CAS:209256-42-8
Formula: O=CC1=C2CCOC2=CC=C1
95%
BD65683
MFCD03426203
2,3-DIHYDROBENZOFURAN-4-CARBOXYLIC ACID
CAS:209256-40-6
Formula: OC(=O)C1=C2CCOC2=CC=C1
97%
BD65713
MFCD10000604
2,3-DIHYDROBENZOFURAN-4-OL
CAS:144822-82-2
Formula: OC1=C2CCOC2=CC=C1
97%
BD225517
2,3-DIHYDROBENZOFURAN-5-AMINE
CAS:42933-43-7
Formula: NC1=CC=C2OCCC2=C1
97%
BD224105
MFCD03617969
2,3-DIHYDROBENZOFURAN-5-AMINE HCL
CAS:1093403-66-7
Formula: NC1=CC=C(OCC2)C2=C1.[H]Cl
98%
BD316395
MFCD09971390
2,3-DIHYDROBENZOFURAN-5-BORONIC ACID
CAS:227305-69-3
Formula: C1=C2C(=CC=C1B(O)O)OCC2
96%
BD6440
MFCD02681979
2,3-DIHYDROBENZOFURAN-5-CARBONITRILE
CAS:84944-75-2
Formula: N#CC1=CC=C(OCC2)C2=C1
95+%
BD264736
MFCD00817052
2,3-DIHYDROBENZOFURAN-5-CARBONYL CHLORIDE
CAS:55745-71-6
Formula: O=C(Cl)C1=CC=C(OCC2)C2=C1
97%
BD7391
MFCD02677696
2,3-DIHYDROBENZOFURAN-5-CARBOXAMIDE
CAS:262847-54-1
Formula: O=C(C1=CC=C(OCC2)C2=C1)N
98%
BD264735
MFCD00114406
2,3-DIHYDROBENZOFURAN-5-OL
CAS:40492-52-2
Formula: OC1=CC=C2OCCC2=C1
97%
BD65715
MFCD09029838
2,3-DIHYDROBENZOFURAN-5-SULFONAMIDE
CAS:112894-47-0
Formula: O=S(C1=CC=C(OCC2)C2=C1)(N)=O
95+%
BD65628
MFCD03069322
2,3-DIHYDROBENZOFURAN-6-AMINE
CAS:57786-34-2
Formula: NC1=CC=C2CCOC2=C1
95+%
BD211771
2,3-DIHYDROBENZOFURAN-6-CARBALDEHYDE
CAS:55745-96-5
Formula: O=CC1=CC=C2CCOC2=C1
95+%
BD256775
2,3-DIHYDROBENZOFURAN-6-CARBONITRILE
CAS:1112184-64-1
Formula: N#CC1=CC=C2CCOC2=C1
97%
BD585974
MFCD18374754
2,3-DIHYDROBENZOFURAN-6-CARBOXAMIDE
CAS:1379329-12-0
Formula: O=C(C1=CC=C2CCOC2=C1)N
97%
BD586974
2,3-DIHYDROBENZOFURAN-6-CARBOXYLIC ACID
CAS:301836-57-7
Formula: OC(=O)C1=CC=C2CCOC2=C1
97%
BD65717
MFCD10000605
2,3-DIHYDROBENZOFURAN-6-OL
CAS:23681-89-2
Formula: OC1=CC=C2CCOC2=C1
95%
BD227274
MFCD18378253
2,3-DIHYDROBENZOFURAN-6-SULFONYL CHLORIDE
CAS:724446-31-5
Formula: O=S(C1=CC=C2CCOC2=C1)(Cl)=O
97%
BD636493
2,3-DIHYDROBENZOFURAN-7-AMINE
CAS:13414-56-7
Formula: NC1=C(OCC2)C2=CC=C1
95%
BD240888
MFCD11109313
2,3-DIHYDROBENZOFURAN-7-AMINE HYDROCHLORIDE
CAS:1414958-92-1
Formula: NC1=C(OCC2)C2=CC=C1.[H]Cl
96%
BD753742
2,3-DIHYDROBENZOFURAN-7-CARBALDEHYDE
CAS:196799-45-8
Formula: O=CC1=C(OCC2)C2=CC=C1
98%
BD7611
2,3-DIHYDROBENZOFURAN-7-CARBONITRILE
CAS:134401-94-8
Formula: N#CC1=C(OCC2)C2=CC=C1
97%
BD610756
2,3-DIHYDROBENZOFURAN-7-CARBOXAMIDE
CAS:134401-97-1
Formula: O=C(C1=C(OCC2)C2=CC=C1)N
95+%
BD329083
MFCD18822721
2,3-DIHYDROBENZOFURAN-7-CARBOXYLIC ACID
CAS:35700-40-4
Formula: O=C(C1=C(OCC2)C2=CC=C1)O
97%
BD7623
MFCD00671526
2,3-DIHYDROBENZOFURAN-7-METHANOL
CAS:151155-53-2
Formula: OCC1=C(OCC2)C2=CC=C1
97%
BD6657
2,3-DIHYDROBENZOFURAN-7-OL
CAS:879093-09-1
Formula: OC1=C(OCC2)C2=CC=C1
95+%
BD271579
2,3-DIHYDROBENZOFURANYL-5-ACETIC ACID
CAS:69999-16-2
Formula: O=C(O)CC1=CC=C(OCC2)C2=C1
97%
BD65719
MFCD01941301
2,3-DIHYDROFURO[2,3-B]PYRIDIN-3-OL
CAS:144186-57-2
Formula: OC1COC2=NC=CC=C12
95+%
BD216442
MFCD18836698
2,3-DIHYDROFURO[2,3-C]PYRIDIN-3-OL
CAS:106531-53-7
Formula: OC1COC2=C1C=CN=C2
96%
BD519012
2,3-DIHYDROFURO[2,3-C]PYRIDIN-7-AMINE
CAS:494767-14-5
Formula: NC1=NC=CC2=C1OCC2
97%
BD537161
n/a
2,3-DIHYDROFURO[3,2-B]PYRIDINE
CAS:95837-09-5
Formula: C12=NC=CC=C1OCC2
95+%
BD267970
2,3-DIHYDROFURO[3,2-B]PYRIDINE-5-CARBONITRILE
CAS:193605-61-7
Formula: N#CC1=NC2=C(OCC2)C=C1
97%
BD528134
2,3-DIHYDROHEVEAFLAVONE
CAS:110382-42-8
Formula: O=C1C[C@@H](C2=CC=C(O)C(C3=C4C(C(C=C(C5=CC=C(OC)C=C5)O4)=O)=C(O)C=C3OC)=C2)OC6=CC(OC)=CC(O)=C16
95+%
BD299649
MFCD26406137
2,3-DIHYDROHINOKIFLAVONE
CAS:34292-87-0
Formula: O=C1C[C@@H](C2=CC=C(OC3=C(O)C=C4C(C(C=C(C5=CC=C(O)C=C5)O4)=O)=C3O)C=C2)OC6=CC(O)=CC(O)=C16
95+%
BD299081
2,3-DIHYDROIMIDAZO[1,2-A]PYRIDIN-5(1H)-ONE
CAS:1000981-77-0
Formula: O=C1C=CC=C2N1CCN2
95+%
BD216100
MFCD10699459
2,3-DIHYDROIMIDAZO[1,2-A]PYRIDIN-5(1H)-ONE HYDROCHLORIDE
CAS:1332581-57-3
Formula: O=C1C=CC=C2N1CCN2.[H]Cl
95+%
BD259122
2,3-DIHYDROIMIDAZO[1,2-B]ISOQUINOLIN-5(1H)-ONE
CAS:25113-57-9
Formula: O=C1N2C(NCC2)=CC3=C1C=CC=C3
97%
BD624408
2,3-DIHYDROIMIDAZO[1,2-C]PYRIMIDINE-5,7(1H,6H)-DIONE
CAS:21418-79-1
Formula: O=C1N2C(NCC2)=CC(N1)=O
95+%
BD330881
MFCD20666518
2,3-DIHYDROIMIDAZO[1,2-C]QUINAZOLIN-5(6H)-ONE
CAS:38767-52-1
Formula: O=C1NC2=C(C=CC=C2)C3=NCCN13
95+%
BD320981
MFCD15201962
2,3-DIHYDROIMIDAZO[2,1-B]THIAZOLE-6-CARBALDEHYDE
CAS:157459-71-7
Formula: O=CC1=CN2C(SCC2)=N1
97%
BD196483
2,3-DIHYDROISOGINKGETIN
CAS:828923-27-9
Formula: O=C1C[C@@H](C2=CC=C(OC)C(C3=C4C(C(C=C(C5=CC=C(OC)C=C5)O4)=O)=C(O)C=C3O)=C2)OC6=CC(O)=CC(O)=C16
95+%
BD298847
2,3-DIHYDROISOQUINOLINE-1,4-DIONE
CAS:31053-30-2
Formula: O=C1NCC(C2=C1C=CC=C2)=O
97%
BD286027
MFCD13179340
2,3-DIHYDROPHENANTHREN-4(1H)-ONE
CAS:778-48-3
Formula: O=C1CCCC2=C1C3=C(C=C2)C=CC=C3
98%
BD15276
MFCD00028857
2,3-DIHYDROPHTHALAZINE-1,4-DIONE
CAS:1445-69-8
Formula: O=C1NNC(C2=C1C=CC=C2)=O
98%
BD147919
MFCD00006888
2,3-DIHYDROPODOCARPUSFLAVONE A
CAS:852875-96-8
Formula: O=C1C[C@@H](C2=CC=C(O)C(C3=C4C(C(C=C(C5=CC=C(OC)C=C5)O4)=O)=C(O)C=C3O)=C2)OC6=CC(O)=CC(O)=C16
95+%
BD299353
2,3-DIHYDROPYRAZOLO[5,1-B]OXAZOL-6-AMINE
CAS:1512258-62-6
Formula: NC1=NN2C(OCC2)=C1
97%
BD593248
MFCD27995759
2,3-DIHYDROPYRAZOLO[5,1-B]OXAZOLE-6-CARBOXYLIC ACID
CAS:1239722-75-8
Formula: O=C(C1=NN2C(OCC2)=C1)O
97%
BD505414
MFCD16547294
2,3-DIHYDROPYRAZOLO[5,1-B]OXAZOLE-7-CARBOXYLIC ACID
CAS:1286755-21-2
Formula: O=C(C1=C2OCCN2N=C1)O
95%
BD505432
MFCD27995919
2,3-DIHYDROPYRIDO[3,4-D]PYRIDAZINE-1,4-DIONE
CAS:31384-08-4
Formula: O=C(NN1)C2=C(C=NC=C2)C1=O
95+%
BD167395
MFCD02936656
2,3-DIHYDROPYRROLO[1,2-C]PYRIMIDINE-1,4-DIONE
CAS:223432-94-8
Formula: O=C1N2C(C(CN1)=O)=CC=C2
95+%
BD255732
MFCD12923987
2,3-DIHYDROQUINOLIN-4(1H)-ONE
CAS:4295-36-7
Formula: O=C1CCNC2=C1C=CC=C2
96%
BD28718
MFCD00666394
2,3-DIHYDROQUINOLIN-4(1H)-ONE HYDROCHLORIDE
CAS:71412-22-1
Formula: Cl[H].O=C1CCNC2=C1C=CC=C2
95+%
BD218336
MFCD11052533
2,3-DIHYDROQUINOXALINE-6-CARBOXYLIC ACID
CAS:33139-05-8
Formula: O=C(C1=CC2=NCCN=C2C=C1)O
95+%
BD222158
2,3-DIHYDROSCIADOPITYSIN
CAS:34421-19-7
Formula: O=C1C[C@@H](C2=CC=C(OC)C(C3=C4C(C(C=C(C5=CC=C(OC)C=C5)O4)=O)=C(O)C=C3O)=C2)OC6=CC(OC)=CC(O)=C16
95+%
BD298538
2,3-DIHYDROSPIRO[INDENE-1,4'-PIPERIDIN]-2-OL HYDROCHLORIDE
CAS:231938-19-5
Formula: OC1C2(CCNCC2)C3=C(C=CC=C3)C1.[H]Cl
97%
BD587475
2,3-DIHYDROSPIRO[INDENE-1,4'-PIPERIDINE]
CAS:428-38-6
Formula: C12=C(C3(CCNCC3)CC2)C=CC=C1
95+%
BD65726
MFCD08705803
2,3-DIHYDROSPIRO[INDENE-1,4'-PIPERIDINE] HYDROCHLORIDE
CAS:96651-85-3
Formula: Cl.C1CC2(CCNCC2)C2=CC=CC=C12
97%
BD208032
MFCD08461061
2,3-DIHYDROSPIRO[INDENE-1,4'-PIPERIDINE]-3-CARBOXYLIC ACID HYDROCHLORIDE
CAS:936138-16-8
Formula: O=C(C1CC2(CCNCC2)C3=C1C=CC=C3)O.[H]Cl
95+%
BD248614
MFCD13176594
2,3-DIHYDROTHIENO[3,4-B][1,4]DIOXINE
CAS:126213-50-1
Formula: C12=CSC=C1OCCO2
98%
BD3548
MFCD02093622
2,3-DIHYDROTHIENO[3,4-B][1,4]DIOXINE-2-CARBOXYLIC ACID
CAS:955373-67-8
Formula: OC(=O)C1COC2=CSC=C2O1
95+%
BD234423
MFCD18827465
2,3-DIHYDROTHIENO[3,4-B][1,4]DIOXINE-5,7-DICARBALDEHYDE
CAS:211235-87-9
Formula: O=CC1=C2C(OCCO2)=C(C=O)S1
95+%
BD65727
MFCD01651767
2,3-DIHYDROTHIENO[3,4-B][1,4]DIOXINE-5-CARBALDEHYDE
CAS:204905-77-1
Formula: O=CC1=C2C(OCCO2)=CS1
97%
BD65728
2,3-DIHYDROTHIENO[3,4-B][1,4]DIOXINE-5-CARBOXYLIC ACID
CAS:260063-21-6
Formula: O=C(C1=C2C(OCCO2)=CS1)O
95+%
BD183736
2,3-DIHYDROTHIENO[3,4-B][1,4]DITHIINE
CAS:158962-92-6
Formula: C1CSC2=CSC=C2S1
95+%
BD236721
2,3-DIHYDROTHIOPHENE 1,1-DIOXIDE
CAS:1192-16-1
Formula: O=S1(CCC=C1)=O
96%
BD306506
MFCD00195935
2,3-DIHYDROXY-12-OLEANEN-28-OIC ACID
CAS:26563-68-8
Formula: CC1(C)C(O)C(O)C[C@]2(C)[C@@]3([H])CC=C4[C@@]5([H])CC(C)(C)CC[C@@](C(O)=O)5CC[C@](C)4[C@@](C)3CCC12
95+%
BD235834
MFCD09752402
2,3-DIHYDROXY-2-METHYLPROPANOIC ACID
CAS:21620-60-0
Formula: O=C(O)C(C)(O)CO
97%
BD628909
2,3-DIHYDROXY-3-(4-HYDROXYPHENYL)PROPANOIC ACID
CAS:100201-57-8
Formula: OC(C(O)C1=CC=C(O)C=C1)C(O)=O
95+%
BD239201
MFCD19440994
2,3-DIHYDROXY-3-(5-NITRO-1H-BENZO[D]IMIDAZOL-2-YL)PROPANOIC ACID
CAS:521298-32-8
Formula: O=C(O)C(O)C(O)C1=NC2=CC([N+]([O-])=O)=CC=C2N1
97%
BD596564
MFCD03357067
2,3-DIHYDROXY-4-(MORPHOLINOMETHYL)BENZALDEHYDE
CAS:N/A
Formula: O=CC1=CC=C(CN2CCOCC2)C(O)=C1O
97%
BD763852
2,3-DIHYDROXY-4-METHOXYBENZALDEHYDE
CAS:4055-69-0
Formula: O=CC1=CC=C(OC)C(O)=C1O
95+%
BD65731
MFCD00016589
2,3-DIHYDROXY-4-METHOXYBENZOIC ACID
CAS:3934-81-4
Formula: O=C(O)C1=CC=C(OC)C(O)=C1O
97%
BD11152
2,3-DIHYDROXY-5-ISOPROPYLCYCLOHEPTA-2,4,6-TRIENONE
CAS:29346-20-1
Formula: O=C1C(O)=C(O)C=C(C(C)C)C=C1
95+%
BD253908
2,3-DIHYDROXY-5-METHYLBENZOIC ACID
CAS:6049-93-0
Formula: O=C(O)C1=CC(C)=CC(O)=C1O
95+%
BD167569
MFCD06739466
2,3-DIHYDROXY-5-NITROBENZALDEHYDE
CAS:52924-54-6
Formula: O=CC1=CC([N+]([O-])=O)=CC(O)=C1O
98%
BD305124
n/a
2,3-DIHYDROXY-6,7-DIMETHYL-4-PROPYL-1-NAPHTHOIC ACID
CAS:213971-33-6
Formula: O=C(O)C1=C2C=C(C)C(C)=CC2=C(CCC)C(O)=C1O
97%
BD444575
2,3-DIHYDROXY-6-METHOXYBENZOIC ACID
CAS:148460-90-6
Formula: O=C(O)C1=C(OC)C=CC(O)=C1O
95+%
BD281637
MFCD20654864
2,3-DIHYDROXY-N,N,N-TRIMETHYLPROPAN-1-AMINIUM CHLORIDE
CAS:34004-36-9
Formula: C[N+](C)(C)CC(O)CO.[Cl-]
95%
BD628631
n/a
2,3-DIHYDROXYBENZALDEHYDE
CAS:24677-78-9
Formula: O=CC1=CC=CC(O)=C1O
97+%
BD65737
MFCD00003324
2,3-DIHYDROXYBENZOIC ACID
CAS:303-38-8
Formula: O=C(O)C1=CC=CC(O)=C1O
98%
BD4706
MFCD00002446
2,3-DIHYDROXYBENZONITRILE
CAS:67984-81-0
Formula: N#CC1=CC=CC(O)=C1O
98%
BD65740
MFCD02261930
2,3-DIHYDROXYFURO[3,4-B]PYRAZINE-5,7-DIONE
CAS:58084-26-7
Formula: O=C1OC(C2=NC(O)=C(O)N=C21)=O
95+%
BD248708
2,3-DIHYDROXYNAPHTHALENE
CAS:92-44-4
Formula: OC1=C(O)C=C2C=CC=CC2=C1
98%
BD42107
MFCD00004073
2,3-DIHYDROXYNAPHTHALENE-1,4-DICARBALDEHYDE
CAS:103860-60-2
Formula: O=CC1=C2C=CC=CC2=C(C=O)C(O)=C1O
97%
BD65743
2,3-DIHYDROXYNAPHTHALENE-1,4-DIONE
CAS:605-37-8
Formula: O=C1C(O)=C(O)C(C2=C1C=CC=C2)=O
97%
BD555917
MFCD00019554
2,3-DIHYDROXYPROPANOIC ACID(20% IN WATER)
CAS:473-81-4
Formula: O=C(O)C(O)CO
20% in water
BD126516
MFCD00065927
2,3-DIHYDROXYPROPYL 2-((8-(TRIFLUOROMETHYL)QUINOLIN-4-YL)AMINO)BENZOATE
CAS:23779-99-9
Formula: O=C(OCC(O)CO)C1=CC=CC=C1NC2=CC=NC3=C(C(F)(F)F)C=CC=C23
95+%
BD130421
2,3-DIHYDROXYPROPYL 2-HYDROXYBENZOATE
CAS:6170-45-2
Formula: OC1=CC=CC=C1C(OCC(O)CO)=O
97%
BD596810
MFCD01082530
2,3-DIHYDROXYPROPYL 5-HYDROXYDECANOATE
CAS:26446-31-1
Formula: CCCCCC(O)CCCC(OCC(CO)O)=O
97%
BD132181
2,3-DIHYDROXYPROPYL ACETATE
CAS:26446-35-5
Formula: OC(CO)COC(C)=O
95+%
BD140292
MFCD00036185
2,3-DIHYDROXYPROPYL BENZOATE
CAS:3376-59-8
Formula: O=C(OCC(O)CO)C1=CC=CC=C1
95+%
BD290590
MFCD01084321
2,3-DIHYDROXYPROPYL DECANOATE
CAS:2277-23-8
Formula: CCCCCCCCCC(OCC(O)CO)=O
95+%
BD140299
MFCD00056656
2,3-DIHYDROXYPROPYL DODECANOATE
CAS:142-18-7
Formula: CCCCCCCCCCCC(=O)OCC(O)CO
95+%
BD140319
MFCD00037815
2,3-DIHYDROXYPROPYL OLEATE
CAS:111-03-5
Formula: CCCCCCCC/C=C\CCCCCCCC(OCC(O)CO)=O
95+%
BD140334
MFCD00042735
2,3-DIHYDROXYPYRIDINE
CAS:16867-04-2
Formula: OC1=C(O)N=CC=C1
97%
BD9583
MFCD00006271
2,3-DIHYDROXYPYRIDINE HYDROCHLORIDE
CAS:175292-03-2
Formula: OC1=CC=CN=C1O.[H]Cl
95%
BD00782009
2,3-DIHYDROXYSUCCINAMIDE
CAS:6051-30-5
Formula: O=C(N)C(O)C(O)C(N)=O
95+%
BD406396
MFCD00047885
2,3-DIHYDROXYSUCCINIC ACID
CAS:526-83-0
Formula: O=C(O)C(O)C(O)C(O)=O
95+%
BD294206
2,3-DIHYDROXYTEREPHTHALALDEHYDE
CAS:148063-59-6
Formula: O=CC1=CC=C(C=O)C(O)=C1O
95+%
BD222965
n/a
2,3-DIHYDROXYTEREPHTHALIC ACID
CAS:19829-72-2
Formula: O=C(O)C1=CC=C(C(O)=O)C(O)=C1O
97%
BD168732
MFCD02181105
2,3-DIIODO-5-(TRIFLUOROMETHYL)PYRIDINE
CAS:1227599-67-8
Formula: FC(C1=CN=C(I)C(I)=C1)(F)F
95+%
BD296768
MFCD16610880
2,3-DIIODO-5-METHYL-1-(PHENYLSULFONYL)-1H-PYRROLO[2,3-B]PYRIDINE
CAS:1246088-65-2
Formula: O=S(N1C(I)=C(I)C2=CC(C)=CN=C21)(C3=CC=CC=C3)=O
95+%
BD314609
MFCD17171337
2,3-DIIODOPYRAZINE
CAS:58139-07-4
Formula: IC1=NC=CN=C1I
97%
BD626367
MFCD29047082
2,3-DIIODOPYRIDINE
CAS:83674-70-8
Formula: IC1=CC=CN=C1I
95+%
BD29696
MFCD06658996
2,3-DIMERCAPTOSUCCINIC ACID
CAS:2418-14-6
Formula: O=C(O)C(S)C(S)C(O)=O
97%
BD125237
2,3-DIMETHOXY-1-NAPHTHALDEHYDE
CAS:56252-09-6
Formula: O=CC1=C2C=CC=CC2=CC(OC)=C1OC
95+%
BD320191
MFCD06798095
2,3-DIMETHOXY-11H-INDENO[1,2-B]QUINOLINE-10-CARBOXYLIC ACID
CAS:154869-00-8
Formula: O=C(C1=C(CC2=C3C=C(OC)C(OC)=C2)C3=NC4=CC=CC=C14)O
97%
BD507707
MFCD11982924
2,3-DIMETHOXY-2,3-DIMETHYLBUTANE
CAS:6091-59-4
Formula: CC(C)(OC)C(C)(OC)C
97%
BD00815307
2,3-DIMETHOXY-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)-5-(TRIFLUOROMETHYL)PYRIDINE
CAS:1357387-31-5
Formula: FC(C1=CN=C(OC)C(OC)=C1B2OC(C)(C)C(C)(C)O2)(F)F
95+%
BD321859
MFCD18374096
2,3-DIMETHOXY-5-((TRIMETHYLSILYL)ETHYNYL)PYRIDINE
CAS:1171919-88-2
Formula: C[Si](C#CC1=CN=C(OC)C(OC)=C1)(C)C
95+%
BD202035
2,3-DIMETHOXY-5-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)BENZONITRILE
CAS:1701449-79-7
Formula: N#CC1=CC(B2OC(C)(C)C(C)(C)O2)=CC(OC)=C1OC
98%
BD321629
MFCD24448812
2,3-DIMETHOXY-5-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PYRIDINE
CAS:1083168-92-6
Formula: COC1=CC(B(OC2(C)C)OC2(C)C)=CN=C1OC
98%
BD168740
MFCD11857651
2,3-DIMETHOXY-5-(TRIFLUOROMETHYL)PYRIDINE
CAS:124432-61-7
Formula: FC(C1=CN=C(OC)C(OC)=C1)(F)F
95+%
BD314577
MFCD16610902
2,3-DIMETHOXY-5-(TRIMETHYLSILYL)PYRIDINE
CAS:1131335-75-5
Formula: C[Si](C1=CN=C(OC)C(OC)=C1)(C)C
97%
BD196329
MFCD11857652
2,3-DIMETHOXY-5-METHYLBENZENE-1,4-DIOL
CAS:3066-90-8
Formula: OC1=CC(C)=C(O)C(OC)=C1OC
98%
BD6926
MFCD00017161
2,3-DIMETHOXY-5-METHYLCYCLOHEXA-2,5-DIENE-1,4-DIONE
CAS:605-94-7
Formula: O=C1C(OC)=C(OC)C(C(C)=C1)=O
97%
BD21729
MFCD00001595
2,3-DIMETHOXY-5-METHYLPYRIDINE
CAS:1227579-16-9
Formula: CC1=CN=C(OC)C(OC)=C1
97%
BD466219
MFCD16610895
2,3-DIMETHOXY-5-NITROBENZALDEHYDE
CAS:6324-49-8
Formula: O=CC1=CC([N+]([O-])=O)=CC(OC)=C1OC
95+%
BD255774
MFCD03196814
2,3-DIMETHOXY-5-NITROPHENOL
CAS:32905-09-2
Formula: OC1=CC([N+]([O-])=O)=CC(OC)=C1OC
95+%
BD245119
2,3-DIMETHOXY-5-NITROPYRIDINE
CAS:507473-22-5
Formula: O=[N+](C1=CN=C(OC)C(OC)=C1)[O-]
95+%
BD334503
MFCD00956003
2,3-DIMETHOXY-5-SULFAMOYLBENZOIC ACID
CAS:66644-80-2
Formula: O=C(O)C1=CC(S(=O)(N)=O)=CC(OC)=C1OC
98%
BD6867
MFCD01317561
2,3-DIMETHOXY-6,7-DIMETHYL-1-PROPYLNAPHTHALENE
CAS:213971-41-6
Formula: CCCC1=C2C=C(C)C(C)=CC2=CC(OC)=C1OC
97%
BD444576
2,3-DIMETHOXY-6,7-DIMETHYL-4-PROPYL-1-NAPHTHALDEHYDE
CAS:213971-66-5
Formula: O=CC1=C2C=C(C)C(C)=CC2=C(CCC)C(OC)=C1OC
97%
BD444577
2,3-DIMETHOXY-6,7-DIMETHYL-4-PROPYL-1-NAPHTHOIC ACID
CAS:213971-46-1
Formula: O=C(O)C1=C2C=C(C)C(C)=CC2=C(CCC)C(OC)=C1OC
97%
BD444578
2,3-DIMETHOXY-6,7-DIMETHYLNAPHTHALENE
CAS:4676-58-8
Formula: CC1=CC2=CC(OC)=C(OC)C=C2C=C1C
95+%
BD268299
2,3-DIMETHOXY-6,7-DIMETHYLQUINOXALINE
CAS:130064-16-3
Formula: CC1=C(C)C=C2N=C(OC)C(OC)=NC2=C1
95+%
BD282468
2,3-DIMETHOXY-6-((TRIMETHYLSILYL)ETHYNYL)PYRIDINE
CAS:1171919-83-7
Formula: C[Si](C#CC1=CC=C(OC)C(OC)=N1)(C)C
95+%
BD202033
2,3-DIMETHOXY-6-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PYRIDINE
CAS:1131335-62-0
Formula: CC1(C)C(C)(C)OB(C2=CC=C(OC)C(OC)=N2)O1
95+%
BD196325
MFCD11857650
2,3-DIMETHOXY-6-(TRIMETHYLSILYL)PYRIDINE
CAS:1131335-54-0
Formula: C[Si](C1=CC=C(OC)C(OC)=N1)(C)C
97%
BD196324
2,3-DIMETHOXY-6-METHYLPYRIDINE
CAS:861019-58-1
Formula: CC1=CC=C(OC)C(OC)=N1
97%
BD196692
2,3-DIMETHOXY-6-NITROBENZALDEHYDE
CAS:2531-63-7
Formula: O=CC1=C([N+]([O-])=O)C=CC(OC)=C1OC
97%
BD494556
MFCD00450063
2,3-DIMETHOXY-6-NITROPYRIDINE
CAS:79491-44-4
Formula: O=[N+](C1=CC=C(OC)C(OC)=N1)[O-]
96%
BD230239
2,3-DIMETHOXY-BENZAMIDINE HYDROCHLORIDE
CAS:1170449-53-2
Formula: N=C(N)C1=CC=CC(OC)=C1OC.[H]Cl
98%
BD00788963
2,3-DIMETHOXYANILINE
CAS:6299-67-8
Formula: NC1=CC=CC(OC)=C1OC
98%
BD29269
MFCD00180769
2,3-DIMETHOXYBENZALDEHYDE
CAS:86-51-1
Formula: C1=CC=C(C(=C1C=O)OC)OC
97%
BD35168
MFCD00003309
2,3-DIMETHOXYBENZAMIDE
CAS:1521-39-7
Formula: O=C(N)C1=CC=CC(OC)=C1OC
95+%
BD11300
MFCD00017571
2,3-DIMETHOXYBENZENEBORONIC ACID
CAS:40972-86-9
Formula: OB(C1=CC=CC(OC)=C1OC)O
98%
BD5275
MFCD02683112
2,3-DIMETHOXYBENZIMIDAMIDE
CAS:144650-01-1
Formula: N=C(N)C1=CC=CC(OC)=C1OC
97%
BD65772
MFCD05662974
2,3-DIMETHOXYBENZOHYDRAZIDE
CAS:321195-74-8
Formula: O=C(NN)C1=CC=CC(OC)=C1OC
95+%
BD171818
MFCD03422933
2,3-DIMETHOXYBENZOIC ACID
CAS:1521-38-6
Formula: C1=CC=C(C(=C1OC)OC)C(O)=O
97%
BD6712
MFCD00002432
2,3-DIMETHOXYBENZONITRILE
CAS:5653-62-3
Formula: N#CC1=CC=CC(OC)=C1OC
98%
BD7782
MFCD00001784
2,3-DIMETHOXYBENZOTHIOAMIDE
CAS:145736-64-7
Formula: NC(C1=CC=CC(OC)=C1OC)=S
97%
BD11294
2,3-DIMETHOXYBENZOTRIFLUORIDE
CAS:1261673-36-2
Formula: FC(F)(F)C1=CC=CC(OC)=C1OC
95+%
BD322970
MFCD18395736
2,3-DIMETHOXYCYCLOHEXA-2,5-DIENE-1,4-DIONE
CAS:3117-02-0
Formula: O=C(C=C1)C(OC)=C(OC)C1=O
95%
BD33153
MFCD00016366
2,3-DIMETHOXYISONICOTINIC ACID
CAS:944906-83-6
Formula: O=C(O)C1=CC=NC(OC)=C1OC
97%
BD763943
2,3-DIMETHOXYNAPHTHALENE
CAS:10103-06-7
Formula: COC1=CC2=C(C=CC=C2)C=C1OC
98+%
BD225457
MFCD05664308
2,3-DIMETHOXYPHENOL
CAS:5150-42-5
Formula: OC1=CC=CC(OC)=C1OC
98%
BD65787
MFCD00008366
2,3-DIMETHOXYPYRAZINE
CAS:68468-30-4
Formula: COC1=NC=CN=C1OC
95+%
BD248709
2,3-DIMETHOXYPYRIDIN-4-OL
CAS:123631-83-4
Formula: COC1=C(O)C=CN=C1OC
96%
BD447917
MFCD11044352
2,3-DIMETHOXYPYRIDINE
CAS:52605-97-7
Formula: COC1=CC=CN=C1OC
97%
BD21224
MFCD03095043
2,3-DIMETHOXYQUINOXALINE
CAS:6333-43-3
Formula: COC1=NC2=CC=CC=C2N=C1OC
97%
BD34436
MFCD00068701
2,3-DIMETHOXYTOLUENE
CAS:4463-33-6
Formula: CC1=C(OC)C(OC)=CC=C1
95%
BD65793
MFCD00008379
2,3-DIMETHYL 7-AZABICYCLO[2.2.1]HEPTANE-2,3-DICARBOXYLATE
CAS:1393477-05-8
Formula: O=C(C1C(N2)CCC2C1C(OC)=O)OC
BD00785082
2,3-DIMETHYL-1,2,3,4-TETRAHYDROQUINOXALINE
CAS:13311-77-8
Formula: CC1C(C)NC2=C(C=CC=C2)N1
97%
BD590572
2,3-DIMETHYL-1,3,8-TRIAZASPIRO[4.5]DEC-1-EN-4-ONE HYDROCHLORIDE
CAS:1774899-05-6
Formula: O=C1N(C)C(C)=NC12CCNCC2.[H]Cl
97%
BD513813
MFCD27995826
2,3-DIMETHYL-1,4-DIOXO-1,2,3,4-TETRAHYDROPHTHALAZINE-6-CARBOXYLIC ACID
CAS:64377-78-2
Formula: O=C(C1=CC2=C(C(N(C)N(C)C2=O)=O)C=C1)O
97%
BD509989
MFCD09063058
2,3-DIMETHYL-1H-INDOL-5-AMINE
CAS:16712-58-6
Formula: NC1=CC2=C(NC(C)=C2C)C=C1
95+%
BD188070
MFCD00086324
2,3-DIMETHYL-1H-INDOLE
CAS:91-55-4
Formula: CC1=C(C)C2=C(N1)C=CC=C2
97%
BD0083
MFCD00005617
2,3-DIMETHYL-1H-INDOLE-5-CARBALDEHYDE
CAS:66258-21-7
Formula: O=CC1=CC2=C(NC(C)=C2C)C=C1
97%
BD177218
MFCD12028463
2,3-DIMETHYL-1H-INDOLE-5-CARBOHYDRAZIDE
CAS:5094-42-8
Formula: O=C(C1=CC2=C(NC(C)=C2C)C=C1)NN
97%
BD183143
MFCD00458820
2,3-DIMETHYL-1H-INDOLE-5-CARBOXYLIC ACID
CAS:14844-73-6
Formula: O=C(C1=CC2=C(NC(C)=C2C)C=C1)O
95+%
BD65805
MFCD00464053
2,3-DIMETHYL-1H-INDOLE-6-CARBOXYLIC ACID
CAS:103986-06-7
Formula: O=C(C1=CC2=C(C=C1)C(C)=C(C)N2)O
97%
BD183672
2,3-DIMETHYL-1H-INDOLE-7-CARBALDEHYDE
CAS:103987-28-6
Formula: O=CC1=CC=CC2=C1NC(C)=C2C
95+%
BD275309
2,3-DIMETHYL-1H-INDOLE-7-CARBONITRILE
CAS:103503-07-7
Formula: N#CC1=CC=CC2=C1NC(C)=C2C
97%
BD605890
2,3-DIMETHYL-1H-INDOLE-7-CARBOXYLIC ACID
CAS:103986-07-8
Formula: O=C(C1=CC=CC2=C1NC(C)=C2C)O
95+%
BD196257
MFCD00090259
2,3-DIMETHYL-1H-PYRROLO[2,3-C]PYRIDINE
CAS:25796-97-8
Formula: CC1=C(C)C2=C(N1)C=NC=C2
95+%
BD241365
2,3-DIMETHYL-1H-PYRROLO[3,2-C]PYRIDINE
CAS:14623-27-9
Formula: CC1=C(C)C2=C(N1)C=CN=C2
95+%
BD241377
2,3-DIMETHYL-2'-METHOXYBENZOPHENONE
CAS:750633-49-9
Formula: O=C(C1=CC=CC=C1OC)C2=CC=CC(C)=C2C
95+%
BD309060
MFCD01311509
2,3-DIMETHYL-2'-MORPHOLINOMETHYL BENZOPHENONE
CAS:898750-44-2
Formula: O=C(C1=CC=CC=C1CN2CCOCC2)C3=CC=CC(C)=C3C
95+%
BD309947
MFCD03842423
2,3-DIMETHYL-2'-PIPERIDINOMETHYL BENZOPHENONE
CAS:898773-21-2
Formula: O=C(C1=CC=CC=C1CN2CCCCC2)C3=CC=CC(C)=C3C
95+%
BD311876
MFCD03842480
2,3-DIMETHYL-2'-PYRROLIDINOMETHYL BENZOPHENONE
CAS:898774-57-7
Formula: O=C(C1=CC=CC=C1CN2CCCC2)C3=CC=CC(C)=C3C
95+%
BD311960
MFCD03842537
2,3-DIMETHYL-2'-THIOMORPHOLINOMETHYL BENZOPHENONE
CAS:898781-82-3
Formula: O=C(C1=CC=CC=C1CN2CCSCC2)C3=CC=CC(C)=C3C
95+%
BD312647
MFCD03842764
2,3-DIMETHYL-2,3-BUTANEDIAMINE DIHYDROCHLORIDE
CAS:75804-28-3
Formula: CC(N)(C)C(N)(C)C.[H]Cl.[H]Cl
98%
BD306395
n/a
2,3-DIMETHYL-2,3-DIHYDROBENZOFURAN-2-CARBOXYLIC ACID
CAS:856180-66-0
Formula: O=C(C1(C)OC2=CC=CC=C2C1C)O
95+%
BD284505
2,3-DIMETHYL-2-((TRIMETHYLSILYL)OXY)BUTANENITRILE
CAS:883726-88-3
Formula: CC(C)C(O[Si](C)(C)C)(C)C#N
95+%
BD244278
MFCD16786524
2,3-DIMETHYL-2H-1,4-THIAZINE-6-CARBOXAMIDE
CAS:1956322-75-0
Formula: O=C(C1=CN=C(C)C(C)S1)N
97%
BD571761
n/a
2,3-DIMETHYL-2H-INDAZOL-4-AMINE
CAS:1782433-66-2
Formula: NC1=CC=CC2=NN(C)C(C)=C12
97%
BD00802665
2,3-DIMETHYL-2H-INDAZOL-5-AMINE
CAS:221681-94-3
Formula: NC1=CC2=C(C)N(C)N=C2C=C1
95+%
BD295251
MFCD17015994
2,3-DIMETHYL-2H-INDAZOL-6-AMINE
CAS:444731-72-0
Formula: NC1=CC2=NN(C)C(C)=C2C=C1
97%
BD231751
MFCD09258896
2,3-DIMETHYL-2H-INDAZOL-6-AMINE HYDROCHLORIDE
CAS:635702-60-2
Formula: Cl.CN1N=C2C=C(N)C=CC2=C1C
97%
BD236376
MFCD09258896
2,3-DIMETHYL-2H-INDAZOL-7-AMINE
CAS:1783625-55-7
Formula: NC1=CC=CC2=C(C)N(C)N=C12
97%
BD00821740
2,3-DIMETHYL-2H-INDAZOLE
CAS:50407-18-6
Formula: CC1=C2C=CC=CC2=NN1C
97%
BD587750
2,3-DIMETHYL-2H-INDAZOLE-4-CARBONITRILE
CAS:1341034-60-3
Formula: N#CC1=CC=CC2=NN(C)C(C)=C12
95+%
BD336374
MFCD28991775
2,3-DIMETHYL-2H-INDAZOLE-5-CARBALDEHYDE
CAS:1234615-83-8
Formula: O=CC1=CC2=C(C)N(C)N=C2C=C1
95+%
BD333779
MFCD17015998
2,3-DIMETHYL-2H-INDAZOLE-5-CARBONITRILE
CAS:1234616-59-1
Formula: CC1=C2C=C(C#N)C=CC2=NN1C
95+%
BD333801
MFCD17015999
2,3-DIMETHYL-2H-INDAZOLE-5-CARBOXYLIC ACID
CAS:1234615-82-7
Formula: O=C(C1=CC2=C(C)N(C)N=C2C=C1)O
95%
BD333778
MFCD17015996
2,3-DIMETHYL-2H-INDAZOLE-6-CARBALDEHYDE
CAS:1234615-85-0
Formula: O=CC1=CC2=NN(C)C(C)=C2C=C1
97%
BD333781
MFCD17015993
2,3-DIMETHYL-2H-INDAZOLE-6-CARBONITRILE
CAS:1234615-89-4
Formula: CC1=C2C=CC(C#N)=CC2=NN1C
95+%
BD333783
MFCD17015991
2,3-DIMETHYL-2H-INDAZOLE-6-CARBOXYLIC ACID
CAS:1234616-78-4
Formula: O=C(C1=CC2=NN(C)C(C)=C2C=C1)O
95+%
BD300280
2,3-DIMETHYL-2H-INDAZOLE-7-CARBONITRILE
CAS:1341038-80-9
Formula: N#CC1=CC=CC2=C(C)N(C)N=C12
97%
BD570233
2,3-DIMETHYL-2H-INDAZOLE-7-CARBOXYLIC ACID
CAS:1785136-38-0
Formula: O=C(C1=CC=CC2=C(C)N(C)N=C12)O
BD00777349
2,3-DIMETHYL-2H-PYRAZOLO[4,3-D]PYRIMIDIN-7-AMINE
CAS:51222-25-4
Formula: NC1=NC=NC2=C(C)N(C)N=C21
97%
BD625519
2,3-DIMETHYL-3'-(1,3-DIOXOLAN-2-YL)BENZOPHENONE
CAS:898779-30-1
Formula: O=C(C1=CC=CC(C2OCCO2)=C1)C3=CC=CC(C)=C3C
95+%
BD312405
MFCD07699966
2,3-DIMETHYL-3'-METHOXYBENZOPHENONE
CAS:750633-69-3
Formula: O=C(C1=CC=CC(OC)=C1)C2=CC=CC(C)=C2C
95+%
BD309078
MFCD01311541
2,3-DIMETHYL-3'-MORPHOLINOMETHYL BENZOPHENONE
CAS:898765-53-2
Formula: O=C(C1=CC=CC(CN2CCOCC2)=C1)C3=CC=CC(C)=C3C
95+%
BD311186
MFCD03841914
2,3-DIMETHYL-3'-PIPERIDINOMETHYL BENZOPHENONE
CAS:898793-08-3
Formula: O=C(C1=CC=CC(CN2CCCCC2)=C1)C3=CC=CC(C)=C3C
95+%
BD313692
MFCD03841971
2,3-DIMETHYL-3'-PYRROLIDINOMETHYL BENZOPHENONE
CAS:898770-34-8
Formula: O=C(C1=CC=CC(CN2CCCC2)=C1)C3=CC=CC(C)=C3C
95+%
BD311646
MFCD03842028
2,3-DIMETHYL-3'-THIOMORPHOLINOMETHYL BENZOPHENONE
CAS:898763-11-6
Formula: O=C(C1=CC=CC(CN2CCSCC2)=C1)C3=CC=CC(C)=C3C
95+%
BD310945
MFCD03842253
2,3-DIMETHYL-3H-IMIDAZO[4,5-B]PYRIDIN-7-AMINE
CAS:1512124-64-9
Formula: NC1=C2C(N(C)C(C)=N2)=NC=C1
95+%
BD266458
2,3-DIMETHYL-3H-IMIDAZO[4,5-B]PYRIDINE
CAS:41231-05-4
Formula: CN1C(C)=NC2=CC=CN=C21
95+%
BD266886
2,3-DIMETHYL-3H-IMIDAZO[4,5-C]PYRIDINE
CAS:52538-09-7
Formula: CN1C(C)=NC2=C1C=NC=C2
95%
BD587769
MFCD18256902
2,3-DIMETHYL-4'-(1,3-DIOXOLAN-2-YL)BENZOPHENONE
CAS:898760-16-2
Formula: O=C(C1=CC=C(C2OCCO2)C=C1)C3=CC=CC(C)=C3C
95+%
BD310736
MFCD07700017
2,3-DIMETHYL-4'-METHOXYBENZOPHENONE
CAS:134994-51-7
Formula: O=C(C1=CC=C(OC)C=C1)C2=CC=CC(C)=C2C
95+%
BD307286
MFCD01311571
2,3-DIMETHYL-4'-MORPHOLINOMETHYL BENZOPHENONE
CAS:898770-02-0
Formula: O=C(C1=CC=C(CN2CCOCC2)C=C1)C3=CC=CC(C)=C3C
95+%
BD311614
MFCD03841402
2,3-DIMETHYL-4'-PIPERIDINOMETHYL BENZOPHENONE
CAS:898771-46-5
Formula: O=C(C1=CC=C(CN2CCCCC2)C=C1)C3=CC=CC(C)=C3C
95+%
BD311757
MFCD03841459
2,3-DIMETHYL-4'-PYRROLIDINOMETHYL BENZOPHENONE
CAS:898776-41-5
Formula: O=C(C1=CC=C(CN2CCCC2)C=C1)C3=CC=CC(C)=C3C
95+%
BD312137
MFCD03841516
2,3-DIMETHYL-4'-THIOMORPHOLINOMETHYL BENZOPHENONE
CAS:898782-71-3
Formula: O=C(C1=CC=C(CN2CCSCC2)C=C1)C3=CC=CC(C)=C3C
95+%
BD312716
MFCD03841743
2,3-DIMETHYL-4,5,6,7-TETRAHYDRO-3H-IMIDAZO[4,5-C]PYRIDINE
CAS:933725-60-1
Formula: CN1C(C)=NC2=C1CNCC2
95+%
BD303546
MFCD19688041
2,3-DIMETHYL-4,5,6,7-TETRAHYDROPYRAZOLO[1,5-A]PYRIMIDINE
CAS:4879-22-5
Formula: CC1=C2NCCCN2N=C1C
95+%
BD271021
2,3-DIMETHYL-4-((TRIFLUOROMETHYL)THIO)PHENOL
CAS:129644-70-8
Formula: OC1=CC=C(SC(F)(F)F)C(C)=C1C
95+%
BD7725
MFCD07777170
2,3-DIMETHYL-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)-2H-INDAZOLE
CAS:1310383-43-7
Formula: CC1(C)C(C)(C)OB(C2=CC=CC3=NN(C)C(C)=C23)O1
95+%
BD306616
n/a
2,3-DIMETHYL-4-(PYRROLIDIN-1-YL)BENZALDEHYDE
CAS:879047-56-0
Formula: O=CC1=CC=C(N2CCCC2)C(C)=C1C
97%
BD604881
MFCD07403408
2,3-DIMETHYL-4-FLUORONITROBENZENE
CAS:1736-87-4
Formula: FC1=CC=C([N+]([O-])=O)C(C)=C1C
98%
BD11131
MFCD05663712
2,3-DIMETHYL-4-NITROPHENOL
CAS:19499-93-5
Formula: OC1=CC=C([N+]([O-])=O)C(C)=C1C
97%
BD6531
2,3-DIMETHYL-4-NITROPYRIDINE
CAS:68707-69-7
Formula: O=[N+](C1=C(C)C(C)=NC=C1)[O-]
95+%
BD65833
MFCD04972002
2,3-DIMETHYL-4-OXO-4,5-DIHYDROFURO[3,2-C]PYRIDINE-7-CARBONITRILE
CAS:1956336-00-7
Formula: N#CC1=CNC(C2=C1OC(C)=C2C)=O
97%
BD444579
2,3-DIMETHYL-4-OXO-4,5-DIHYDROFURO[3,2-C]PYRIDINE-7-CARBOXAMIDE
CAS:1956384-77-2
Formula: O=C(C1=CNC(C2=C1OC(C)=C2C)=O)N
97%
BD444580
2,3-DIMETHYL-4-OXO-4,5-DIHYDROFURO[3,2-C]PYRIDINE-7-CARBOXYLIC ACID
CAS:1956321-41-7
Formula: O=C(C1=CNC(C2=C1OC(C)=C2C)=O)O
97%
BD444581
2,3-DIMETHYL-4-THIOCYANATOANILINE
CAS:23530-64-5
Formula: NC1=CC=C(SC#N)C(C)=C1C
98%
BD327041
MFCD11855820
2,3-DIMETHYL-5,6,7,8-TETRAHYDROIMIDAZO[1,2-A]PYRAZINE
CAS:1250515-54-8
Formula: CC1=C(C)N=C2CNCCN21
97%
BD608468
2,3-DIMETHYL-5,6,7,8-TETRAHYDROIMIDAZO[1,2-A]PYRIDIN-8-AMINE
CAS:1483092-87-0
Formula: NC1C2=NC(C)=C(C)N2CCC1
97%
BD617941
2,3-DIMETHYL-5,6,7,8-TETRAHYDROIMIDAZO[1,2-A]PYRIDINE-5-CARBOXYLIC ACID
CAS:1544437-41-3
Formula: O=C(C1CCCC2=NC(C)=C(C)N12)O
97%
BD618379
2,3-DIMETHYL-5,6,7,8-TETRAHYDROIMIDAZO[1,2-A]PYRIDINE-6-CARBOXYLIC ACID
CAS:1369149-70-1
Formula: O=C(C1CCC2=NC(C)=C(C)N2C1)O
97%
BD614592
2,3-DIMETHYL-5,6,7,8-TETRAHYDROIMIDAZO[1,2-A]PYRIDINE-7-CARBOXYLIC ACID
CAS:1369088-08-3
Formula: O=C(C1CC2=NC(C)=C(C)N2CC1)O
97%
BD614589
2,3-DIMETHYL-5,6,7,8-TETRAHYDROIMIDAZO[1,2-A]PYRIDINE-8-CARBOXYLIC ACID
CAS:1779123-34-0
Formula: O=C(C1C2=NC(C)=C(C)N2CCC1)O
97%
BD623675
2,3-DIMETHYL-5,6,7,8-TETRAHYDROPYRIDO[4,3-D]PYRIMIDIN-4(3H)-ONE
CAS:1333945-87-1
Formula: O=C1C(CNCC2)=C2N=C(C)N1C
97%
BD610446
2,3-DIMETHYL-5-(2-METHYLBUTYL)PYRAZINE
CAS:75492-01-2
Formula: CCC(C)CC1=CN=C(C)C(C)=N1
95+%
BD247539
MFCD08457806
2,3-DIMETHYL-5-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)-1H-INDOLE
CAS:1279710-70-1
Formula: CC1(C)C(C)(C)OB(C2=CC3=C(NC(C)=C3C)C=C2)O1
95+%
BD211385
2,3-DIMETHYL-5-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)-2H-INDAZOLE
CAS:1310405-33-4
Formula: CC1(C)C(C)(C)OB(C2=CC3=C(C)N(C)N=C3C=C2)O1
95+%
BD328847
MFCD12028665
2,3-DIMETHYL-5-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PYRIDINE
CAS:741709-65-9
Formula: CC1(C)C(C)(C)OB(C2=CN=C(C)C(C)=C2)O1
98%
BD273742
2,3-DIMETHYL-5-(TRIFLUOROMETHYL)-1H-INDOLE
CAS:81558-19-2
Formula: FC(C1=CC2=C(NC(C)=C2C)C=C1)(F)F
95+%
BD286413
MFCD09259266
2,3-DIMETHYL-5-NITRO-1H-INDOLE
CAS:21296-94-6
Formula: O=[N+](C1=CC2=C(NC(C)=C2C)C=C1)[O-]
95+%
BD11790
MFCD00022708
2,3-DIMETHYL-5-NITRO-2,3-DIHYDROPHTHALAZINE-1,4-DIONE
CAS:858243-19-3
Formula: O=C1N(C)N(C)C(C2=C1C=CC=C2[N+]([O-])=O)=O
97%
BD509431
MFCD07658430
2,3-DIMETHYL-5-NITRO-2H-INDAZOLE
CAS:1588440-92-9
Formula: O=[N+](C1=CC2=C(C)N(C)N=C2C=C1)[O-]
97%
BD250204
2,3-DIMETHYL-5-NITROANILINE
CAS:109508-62-5
Formula: NC1=CC([N+]([O-])=O)=CC(C)=C1C
95%
BD245217
2,3-DIMETHYL-5-NITROPYRIDINE
CAS:89244-47-3
Formula: O=[N+](C1=CN=C(C)C(C)=C1)[O-]
95+%
BD248710
MFCD15527534
2,3-DIMETHYL-5-OXO-5H-THIAZOLO[3,2-A]PYRIMIDINE-6-CARBOXYLIC ACID
CAS:79932-56-2
Formula: O=C(C1=CN=C(SC(C)=C2C)N2C1=O)O
95+%
BD243920
MFCD08753752
2,3-DIMETHYL-5-PHENYLBENZO[D]OXAZOL-3-IUM METHYL SULFATE
CAS:159505-46-1
Formula: C[N+]1=C(C)OC2=CC=C(C3=CC=CC=C3)C=C12.O=S(OC)([O-])=O
95+%
BD299985
MFCD03940241
2,3-DIMETHYL-5H-PYRROLO[2,3-B]PYRAZINE
CAS:1057077-09-4
Formula: CC1=C(C)N=C2C(NC=C2)=N1
97%
BD753681
2,3-DIMETHYL-6-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)-2H-INDAZOLE
CAS:1300582-62-0
Formula: CC1(C)C(C)(C)OB(C2=CC3=NN(C)C(C)=C3C=C2)O1
95+%
BD328804
MFCD12028669
2,3-DIMETHYL-6-(TRIFLUOROMETHYL)-3H-IMIDAZO[4,5-B]PYRIDINE
CAS:1956356-14-1
Formula: FC(C1=CN=C(N(C)C(C)=N2)C2=C1)(F)F
95+%
BD337523
MFCD08692120
2,3-DIMETHYL-6-(TRIFLUOROMETHYL)IMIDAZO[2,1-B]THIAZOLE-5-CARBALDEHYDE
CAS:1557970-01-0
Formula: O=CC1=C(C(F)(F)F)N=C2SC(C)=C(C)N21
95+%
BD264931
2,3-DIMETHYL-6-(TRIFLUOROMETHYL)IMIDAZO[2,1-B]THIAZOLE-5-CARBONITRILE
CAS:1823510-43-5
Formula: N#CC1=C(C(F)(F)F)N=C2SC(C)=C(C)N21
95+%
BD264930
2,3-DIMETHYL-6-(TRIFLUOROMETHYL)IMIDAZO[2,1-B]THIAZOLE-5-CARBOXAMIDE
CAS:1956324-18-7
Formula: O=C(C1=C(C(F)(F)F)N=C2SC(C)=C(C)N21)N
95+%
BD264929
2,3-DIMETHYL-6-(TRIFLUOROMETHYL)IMIDAZO[2,1-B]THIAZOLE-5-CARBOXYLIC ACID
CAS:1181329-20-3
Formula: O=C(C1=C(C(F)(F)F)N=C2SC(C)=C(C)N21)O
95+%
BD264550
2,3-DIMETHYL-6-(TRIFLUOROMETHYL)QUINOLIN-4-AMINE
CAS:1708159-64-1
Formula: NC1=C(C)C(C)=NC2=CC=C(C(F)(F)F)C=C12
97%
BD621878
2,3-DIMETHYL-6-(TRIFLUOROMETHYL)QUINOLIN-4-OL
CAS:217074-30-1
Formula: OC1=C(C)C(C)=NC2=CC=C(C(F)(F)F)C=C12
97%
BD624243
2,3-DIMETHYL-6-HYDROXYMETHYL-2H-INDAZOLE
CAS:1234616-80-8
Formula: OCC1=CC2=NN(C)C(C)=C2C=C1
95+%
BD314545
MFCD17015990
2,3-DIMETHYL-6-NITRO-2H-INDAZOLE
CAS:444731-73-1
Formula: CN1N=C2C=C(C=CC2=C1C)[N+]([O-])=O
97%
BD161906
MFCD10703326
2,3-DIMETHYL-6-NITROANILINE
CAS:59146-96-2
Formula: NC1=C([N+]([O-])=O)C=CC(C)=C1C
98%
BD5192
MFCD00010148
2,3-DIMETHYL-6-NITROPYRIDINE
CAS:65169-48-4
Formula: O=[N+](C1=CC=C(C)C(C)=N1)[O-]
95+%
BD254815
MFCD18802552
2,3-DIMETHYL-6-NITROQUINOXALINE
CAS:2942-03-2
Formula: O=[N+](C1=CC=C2N=C(C)C(C)=NC2=C1)[O-]
95+%
BD182350
2,3-DIMETHYL-6-PHENOXYQUINOLIN-4(1H)-ONE
CAS:217074-36-7
Formula: O=C1C(C)=C(C)NC2=C1C=C(OC3=CC=CC=C3)C=C2
97%
BD624244
2,3-DIMETHYL-7-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)-2H-INDAZOLE
CAS:1315335-64-8
Formula: CC1(C)C(C)(C)OB(C2=CC=CC3=C(C)N(C)N=C23)O1
95+%
BD306630
n/a
2,3-DIMETHYL-7-(TRIFLUOROMETHYL)QUINOLIN-4-AMINE
CAS:1707586-72-8
Formula: NC1=C(C)C(C)=NC2=CC(C(F)(F)F)=CC=C12
97%
BD621267
2,3-DIMETHYL-7-(TRIFLUOROMETHYL)QUINOLIN-4-OL
CAS:1708371-36-1
Formula: OC1=C(C)C(C)=NC2=CC(C(F)(F)F)=CC=C12
97%
BD622340
2,3-DIMETHYL-7-AZAINDOLE
CAS:10299-69-1
Formula: CC1=C(C)NC2=C1C=CC=N2
95+%
BD291378
MFCD00513469
2,3-DIMETHYL-7-NITRO-1H-INDOLE
CAS:41018-86-4
Formula: O=[N+](C1=CC=CC2=C1NC(C)=C2C)[O-]
95%
BD0043
MFCD00022710
2,3-DIMETHYL-L-PHENYLALANINE
CAS:259726-55-1
Formula: N[C@@H](CC1=CC=CC(C)=C1C)C(O)=O
95%
BD00786623
2,3-DIMETHYL-N-(PYRROLIDIN-2-YLMETHYL)ANILINE DIOXALATE
CAS:1177271-44-1
Formula: CC1=C(C)C(NCC2NCCC2)=CC=C1.O=C(O)C(O)=O.O=C(O)C(O)=O
95+%
BD321469
MFCD09832444
2,3-DIMETHYLANILINE HYDROCHLORIDE
CAS:5417-45-8
Formula: NC1=CC=CC(C)=C1C.[H]Cl
97%
BD5290
MFCD00054332
2,3-DIMETHYLANTHRACENE
CAS:613-06-9
Formula: CC1=C(C)C=C2C=C3C=CC=CC3=CC2=C1
97%
BD65857
MFCD00154982
2,3-DIMETHYLANTHRACENE-9,10-DIONE
CAS:6531-35-7
Formula: O=C(C1=C2C=CC=C1)C3=CC(C)=C(C)C=C3C2=O
95%
BD65858
2,3-DIMETHYLAZETIDINE
CAS:777888-15-0
Formula: CC1C(C)NC1
BD00801171
2,3-DIMETHYLAZETIDINE HYDROCHLORIDE
CAS:1820619-67-7
Formula: CC1C(C)NC1.[H]Cl
BD00753068
2,3-DIMETHYLBENZALDEHYDE
CAS:5779-93-1
Formula: CC1=C(C=O)C=CC=C1C
95+%
BD11236
MFCD00798004
2,3-DIMETHYLBENZAMIDE
CAS:5580-34-7
Formula: O=C(N)C1=CC=CC(C)=C1C
95+%
BD6802
MFCD00017570
2,3-DIMETHYLBENZENE-1,4-DIAMINE
CAS:5306-96-7
Formula: NC1=CC=C(N)C(C)=C1C
95+%
BD334567
MFCD00058687
2,3-DIMETHYLBENZENEACETIC ACID
CAS:30981-98-7
Formula: O=C(O)CC1=CC=CC(C)=C1C
97%
BD12020
2,3-DIMETHYLBENZO[4,5]IMIDAZO[1,2-A]PYRIMIDIN-4(1H)-ONE
CAS:877798-45-3
Formula: O=C1C(C)=C(C)NC2=NC3=CC=CC=C3N21
97%
BD508228
MFCD05703538
2,3-DIMETHYLBENZOFURAN
CAS:3782-00-1
Formula: CC1=C(C)C2=C(O1)C=CC=C2
95+%
BD65864
MFCD00078708
2,3-DIMETHYLBENZOHYDRAZIDE
CAS:219783-74-1
Formula: O=C(NN)C1=CC=CC(C)=C1C
95+%
BD278813
2,3-DIMETHYLBENZOIC ACID
CAS:603-79-2
Formula: C1=CC=C(C(=C1C(O)=O)C)C
97%
BD6658
MFCD00002479
2,3-DIMETHYLBENZONITRILE
CAS:5724-56-1
Formula: N#CC1=CC=CC(C)=C1C
98%
BD11681
MFCD00019744
2,3-DIMETHYLBENZYLAMINE
CAS:51586-20-0
Formula: NCC1=CC=CC(C)=C1C
98%
BD33891
MFCD00052680
2,3-DIMETHYLBUTAN-2-AMINE
CAS:4358-75-2
Formula: CC(N)(C)C(C)C
95+%
BD224675
2,3-DIMETHYLBUTANE-2,3-DIOL
CAS:76-09-5
Formula: CC(O)(C)C(O)(C)C
98%
BD65808
MFCD00004462
2,3-DIMETHYLBUTANOIC ACID
CAS:14287-61-7
Formula: CC(C)C(C)C(O)=O
95+%
BD64769
MFCD00045888
2,3-DIMETHYLCYCLOHEXA-2,5-DIENE-1,4-DIONE
CAS:526-86-3
Formula: O=C1C(C)=C(C)C(C=C1)=O
95+%
BD304650
MFCD01663149
2,3-DIMETHYLCYCLOHEXANOL
CAS:1502-24-5
Formula: OC1C(C)C(C)CCC1
98%
BD265891
MFCD00001444
2,3-DIMETHYLFURO[3,2-C]PYRIDIN-4(5H)-ONE
CAS:170996-75-5
Formula: O=C1C2=C(OC(C)=C2C)C=CN1
97%
BD447239
MFCD04122069
2,3-DIMETHYLHYDROQUINONE
CAS:608-43-5
Formula: OC1=CC=C(O)C(C)=C1C
98%
BD34273
MFCD00009997
2,3-DIMETHYLIMIDAZO[1,2-A]PYRIDIN-8-AMINE
CAS:119858-51-4
Formula: NC1=CC=CN2C1=NC(C)=C2C
95+%
BD292408
2,3-DIMETHYLIMIDAZO[1,2-C]PYRIMIDIN-5(6H)-ONE
CAS:35536-41-5
Formula: O=C1N2C(C=CN1)=NC(C)=C2C
95+%
BD271031
2,3-DIMETHYLINDOLINE
CAS:22120-50-9
Formula: CC1C(C)NC2=C1C=CC=C2
97%
BD65881
MFCD00005707
2,3-DIMETHYLINDOLIZINE-1-CARBALDEHYDE
CAS:25365-68-8
Formula: O=CC1=C2C=CC=CN2C(C)=C1C
97%
BD00787864
2,3-DIMETHYLISONICOTINALDEHYDE
CAS:867141-55-7
Formula: O=CC1=CC=NC(C)=C1C
95+%
BD168052
MFCD11044199
2,3-DIMETHYLISONICOTINAMIDE
CAS:N/A
Formula: O=C(N)C1=CC=NC(C)=C1C
95+%
BD00773982
2,3-DIMETHYLISONICOTINIC ACID
CAS:4328-85-2
Formula: O=C(O)C1=CC=NC(C)=C1C
97%
BD535750
2,3-DIMETHYLISONICOTINONITRILE
CAS:131895-50-6
Formula: N#CC1=CC=NC(C)=C1C
97%
BD521951
2,3-DIMETHYLNAPHTHALENE
CAS:581-40-8
Formula: CC1=C(C)C=C2C=CC=CC2=C1
97%
BD13846
2,3-DIMETHYLPHENETHYL ETHYL OXALATE
CAS:1443335-44-1
Formula: O=C(OCCC1=CC=CC(C)=C1C)C(OCC)=O
97%
BD512454
MFCD15145511
2,3-DIMETHYLPHENYLBORONIC ACID
CAS:183158-34-1
Formula: OB(C1=CC=CC(C)=C1C)O
98%
BD5257
MFCD01863524
2,3-DIMETHYLPYRAZINE
CAS:5910-89-4
Formula: C1=CN=C(C(=N1)C)C
98%
BD10008
MFCD00006144
2,3-DIMETHYLPYRAZOLO[1,5-A]PYRIMIDIN-7(1H)-ONE
CAS:1822715-83-2
Formula: O=C1C=CN=C2N1NC(C)=C2C
97%
BD00790872
2,3-DIMETHYLPYRAZOLO[1,5-A]PYRIMIDIN-7(4H)-ONE
CAS:5148-32-3
Formula: O=C1C=CNC2=C(C)C(C)=NN12
95+%
BD271032
2,3-DIMETHYLPYRAZOLO[1,5-A]PYRIMIDIN-7-OL
CAS:1246553-45-6
Formula: OC1=CC=NC2=C(C)C(C)=NN12
97%
BD586385
2,3-DIMETHYLPYRAZOLO[5,1-B]OXAZOLE-6-CARBOXYLIC ACID
CAS:1365940-87-9
Formula: O=C(C1=NN2C(OC(C)=C2C)=C1)O
97%
BD614404
2,3-DIMETHYLPYRIDIN-4-OL
CAS:68707-71-1
Formula: OC1=C(C)C(C)=NC=C1
95+%
BD335047
MFCD18384244
2,3-DIMETHYLPYRIDO[3,4-B]PYRAZINE
CAS:34154-05-7
Formula: CC1=NC2=CN=CC=C2N=C1C
97%
BD624846
2,3-DIMETHYLQUINOLIN-8-OL
CAS:116633-02-4
Formula: OC1=C2N=C(C)C(C)=CC2=CC=C1
97%
BD629291
2,3-DIMETHYLQUINOLINE
CAS:1721-89-7
Formula: CC1=CC2=CC=CC=C2N=C1C
95+%
BD65902
MFCD03085977
2,3-DIMETHYLQUINOXALIN-6-AMINE
CAS:7576-88-7
Formula: NC1=CC=C2N=C(C)C(C)=NC2=C1
95+%
BD65850
2,3-DIMETHYLQUINOXALINE
CAS:2379-55-7
Formula: CC1=NC2=CC=CC=C2N=C1C
95%
BD65903
MFCD00006728
2,3-DIMETHYLQUINOXALINE HYDRATE
CAS:1134741-00-6
Formula: CC1=NC2=CC=CC=C2N=C1C.[H]O[H]
BD00787351
2,3-DIMETHYLQUINOXALINE-6-CARBOXYLIC ACID
CAS:17635-26-6
Formula: O=C(C1=CC=C2N=C(C)C(C)=NC2=C1)O
95+%
BD65905
MFCD02575516
2,3-DIMETHYLSUCCINIC ACID
CAS:13545-04-5
Formula: CC(C(C)C(O)=O)C(O)=O
95%
BD65906
MFCD00002657
2,3-DIMETHYLTHIOPHENE
CAS:632-16-6
Formula: CC1=C(C)SC=C1
98%
BD34430
2,3-DINONYLNAPHTHALENE-1-SULFONIC ACID
CAS:25322-17-2
Formula: O=S(C1=C2C=CC=CC2=CC(CCCCCCCCC)=C1CCCCCCCCC)(O)=O
97%
BD125737
MFCD00014324
2,3-DIOXO-1,2,3,4-TETRAHYDROQUINOXALINE-5-CARBOXYLIC ACID
CAS:876715-75-2
Formula: O=C(C1=CC=CC(NC2=O)=C1NC2=O)O
95+%
BD250601
MFCD00778356
2,3-DIOXO-1,2,3,4-TETRAHYDROQUINOXALINE-6-SULFONAMIDE
CAS:153504-92-8
Formula: O=S(C1=CC2=C(NC(C(N2)=O)=O)C=C1)(N)=O
97%
BD00804743
2,3-DIOXO-1,2,3,4-TETRAHYDROQUINOXALINE-6-SULFONYL CHLORIDE
CAS:952-10-3
Formula: O=S(C1=CC2=C(NC(C(N2)=O)=O)C=C1)(Cl)=O
95+%
BD65924
2,3-DIOXO-2,3-DIHYDROANTHRACENE-1,4-DICARBOXYLIC ACID
CAS:27485-15-0
Formula: O=C1C(C(C(O)=O)=C2C=C3C=CC=CC3=CC2=C1C(O)=O)=O
98%
BD114468
2,3-DIOXOINDOLINE-4-CARBONITRILE
CAS:1165892-60-3
Formula: N#CC1=CC=CC(NC2=O)=C1C2=O
95+%
BD290229
2,3-DIOXOINDOLINE-4-CARBOXYLIC ACID
CAS:41704-95-4
Formula: O=C(C1=CC=CC(NC2=O)=C1C2=O)O
95+%
BD272026
MFCD16876980
2,3-DIOXOINDOLINE-5-CARBOXYLIC ACID
CAS:25128-32-9
Formula: O=C(C1=CC2=C(NC(C2=O)=O)C=C1)O
95%
BD65929
2,3-DIOXOINDOLINE-5-SULFONAMIDE
CAS:3456-82-4
Formula: O=S(C1=CC2=C(NC(C2=O)=O)C=C1)(N)=O
95%
BD768545
MFCD00720517
2,3-DIOXOINDOLINE-5-SULFONIC ACID
CAS:7313-70-4
Formula: O=S(C1=CC2=C(NC(C2=O)=O)C=C1)(O)=O
95+%
BD218469
MFCD18449603
2,3-DIOXOINDOLINE-5-SULFONYL CHLORIDE
CAS:132898-96-5
Formula: O=S(C1=CC2=C(NC(C2=O)=O)C=C1)(Cl)=O
95%
BD254417
n/a
2,3-DIOXOINDOLINE-6-CARBOXYLIC ACID
CAS:101870-10-4
Formula: O=C(C1=CC(NC2=O)=C(C=C1)C2=O)O
95+%
BD272025
MFCD17676217
2,3-DIOXOINDOLINE-7-CARBONITRILE
CAS:925211-08-1
Formula: N#CC1=CC=CC2=C1NC(C2=O)=O
95+%
BD208556
MFCD09812140
2,3-DIOXOINDOLINE-7-CARBOXYLIC ACID
CAS:25128-35-2
Formula: O=C(C1=CC=CC2=C1NC(C2=O)=O)O
96%
BD11476
MFCD00612492
2,3-DIPHENYL-1,4,8-TRIAZASPIRO[4.5]DECA-1,3-DIENE
CAS:1049676-93-8
Formula: C1(C2=CC=CC=C2)=NC3(CCNCC3)N=C1C4=CC=CC=C4
97%
BD496490
MFCD11052319
2,3-DIPHENYL-1H-INDOLE
CAS:3469-20-3
Formula: C(N1)(C2=CC=CC=C2)=C(C3=CC=CC=C3)C4=C1C=CC=C4
97%
BD1144
MFCD00022698
2,3-DIPHENYL-1H-PYRROLO[2,3-C]PYRIDINE
CAS:25797-08-4
Formula: C1(NC(C2=CC=CC=C2)=C3C4=CC=CC=C4)=C3C=CN=C1
95+%
BD271389
2,3-DIPHENYL-4-(PIPERIDIN-1-YLMETHYL)PYRIDINE
CAS:1956369-91-7
Formula: C1(C2=CC=CC=C2)=NC=CC(CN3CCCCC3)=C1C4=CC=CC=C4
95+%
BD280934
2,3-DIPHENYL-5-(THIOPHEN-2-YL)-2H-TETRAZOL-3-IUM CHLORIDE
CAS:38800-20-3
Formula: [N+]1(C2=CC=CC=C2)=NC(C3=CC=CS3)=NN1C4=CC=CC=C4.[Cl-]
97%
BD65936
2,3-DIPHENYLACRYLIC ACID
CAS:91-48-5
Formula: O=C(O)/C(C1=CC=CC=C1)=C/C2=CC=CC=C2
98%
BD35415
2,3-DIPHENYLBUTANE-2,3-DIOL
CAS:1636-34-6
Formula: CC(O)(C1=CC=CC=C1)C(O)(C2=CC=CC=C2)C
95+%
BD65935
2,3-DIPHENYLCYCLOPROP-2-ENECARBOXYLIC ACID
CAS:17825-58-0
Formula: O=C(C1C(C2=CC=CC=C2)=C1C3=CC=CC=C3)O
95+%
BD318980
MFCD00157043
2,3-DIPHENYLIMIDAZO[1,2-A]PYRIDINE
CAS:85102-26-7
Formula: C12=NC(C3=CC=CC=C3)=C(C4=CC=CC=C4)N1C=CC=C2
97%
BD437468
MFCD00772532
2,3-DIPHENYLPROPANOIC ACID
CAS:3333-15-1
Formula: O=C(O)C(C1=CC=CC=C1)CC2=CC=CC=C2
98%
BD65950
MFCD00044405
2,3-DIPHENYLPYRAZINE
CAS:1588-89-2
Formula: C1(C2=CC=CC=C2)=NC=CN=C1C3=CC=CC=C3
97%
BD65952
MFCD00053000
2,3-DIPHENYLPYRIDINE
CAS:33421-53-3
Formula: C1(C2=CC=CC=C2)=NC=CC=C1C3=CC=CC=C3
95+%
BD65953
MFCD03413656
2,3-DIPHENYLQUINOXALINE
CAS:1684-14-6
Formula: C1(C2=CC=CC=C2)=NC3=CC=CC=C3N=C1C4=CC=CC=C4
98%
BD65955
MFCD00014659
2,3-DIPHENYLQUINOXALINE-6-CARBOXYLIC ACID
CAS:32387-96-5
Formula: O=C(C1=CC=C2N=C(C3=CC=CC=C3)C(C4=CC=CC=C4)=NC2=C1)O
95+%
BD65957
MFCD00555042
2,3-DIPHENYLSUCCINIC ACID
CAS:7584-72-7
Formula: O=C(O)C(C1=CC=CC=C1)C(C2=CC=CC=C2)C(O)=O
97%
BD65958
2,3-EPOXY-1-(1-ETHOXYETHOXY)PROPANE
CAS:4416-85-7
Formula: CC(OCC)OCC1CO1
95+%
BD306797
n/a
2,3-LUTIDINE
CAS:583-61-9
Formula: CC1=NC=CC=C1C
97%
BD65970
MFCD00009605
2,3-O-ISOPROPYLIDENE-D-RIBOFURANOSE
CAS:4099-88-1
Formula: OC1[C@@H]([C@@H]([C@@H](CO)O1)O2)OC2(C)C
97%
BD65990
MFCD01075718
2,3-PYRAZINECARBOXYLIC ANHYDRIDE
CAS:4744-50-7
Formula: O=C1OC(=O)C2=C1N=CC=N2
98%
BD3092
MFCD00179418
2,3-PYRIDINEDICARBOXIMIDE
CAS:4664-00-0
Formula: O=C1NC(C2=NC=CC=C21)=O
97%
BD28790
MFCD00023018
2,3-PYRIDINEDICARBOXYLICANHYDRIDE
CAS:699-98-9
Formula: O=C(O2)C1=NC=CC=C1C2=O
95+%
BD22266
MFCD00005915
2,3-QUINOLINEDICARBOXYLIC ACID
CAS:643-38-9
Formula: O=C(C1=NC2=CC=CC=C2C=C1C(O)=O)O
97%
BD13606
MFCD00071756
2,3-THIOPHENEDICARBOXALDEHYDE
CAS:932-41-2
Formula: O=CC1=C(C=O)C=CS1
98%
BD66011
2,4',6-TRICHLORO-1,1'-BIPHENYL
CAS:38444-77-8
Formula: ClC1=C(C2=CC=C(Cl)C=C2)C(Cl)=CC=C1
95+%
BD305793
n/a
2,4'-DIBROMO-5-METHOXYBENZOPHENONE
CAS:890098-03-0
Formula: O=C(C1=CC=C(Br)C=C1)C2=CC(OC)=CC=C2Br
95+%
BD309590
MFCD00672037
2,4'-DICHLORO-1,1'-BIPHENYL
CAS:34883-43-7
Formula: ClC1=CC=C(C2=CC=CC=C2Cl)C=C1
95+%
BD66769
2,4'-DICHLORO-3'-METHYLBENZOPHENONE
CAS:74617-45-1
Formula: O=C(C1=CC=C(Cl)C(C)=C1)C2=CC=CC=C2Cl
95+%
BD309025
MFCD09801508
2,4'-DIFLUORO-[1,1'-BIPHENYL]-3-CARBOXYLIC ACID
CAS:1214332-32-7
Formula: O=C(C1=C(F)C(C2=CC=C(F)C=C2)=CC=C1)O
96%
BD240180
MFCD14699217
2,4'-DIFLUORO-[1,1'-BIPHENYL]-4-CARBOXYLIC ACID
CAS:1214332-34-9
Formula: O=C(C1=CC=C(C2=CC=C(F)C=C2)C(F)=C1)O
95%
BD243098
MFCD14699226
2,4'-DIFLUORO-[1,1'-BIPHENYL]-4-OL
CAS:349665-92-5
Formula: FC1=CC=C(C=C1)C2=C(C=C(C=C2)O)F
97%
BD240357
MFCD14699562
2,4'-DIFLUORO-3'-METHYL-[1,1'-BIPHENYL]-4-CARBOXYLIC ACID
CAS:1261926-23-1
Formula: FC1=C(C=CC(=C1)C(=O)O)C2=CC(=C(C=C2)F)C
96%
BD240177
MFCD16509414
2,4'-DIFLUORO-3-ISOPROPOXY-[1,1'-BIPHENYL]-4-CARBALDEHYDE
CAS:1956335-19-5
Formula: O=CC1=CC=C(C2=CC=C(F)C=C2)C(F)=C1OC(C)C
97%
BD438804
MFCD28404869
2,4'-DIMETHYLBIPHENYL
CAS:611-61-0
Formula: CC1=CC=C(C2=CC=CC=C2C)C=C1
95+%
BD317607
MFCD15042185
2,4,4'-TRICHLORO-1,1'-BIPHENYL
CAS:7012-37-5
Formula: ClC1=CC=C(C2=CC=C(Cl)C=C2Cl)C=C1
97%
BD66021
2,4,4,4-TETRACHLOROBUT-2-ENAL
CAS:19429-51-7
Formula: ClC(C=O)=CC(Cl)(Cl)Cl
95+%
BD233984
2,4,4,5,5-PENTAMETHYL-1,3,2-DIOXABOROLANE
CAS:94242-85-0
Formula: CC1(C)C(C)(C)OB(C)O1
98%
BD232917
MFCD09027082
2,4,4,6-TETRABROMO-2,5-CYCLOHEXADIENONE
CAS:20244-61-5
Formula: BrC1=CC(Br)(Br)C=C(Br)C1=O
97%
BD66017
MFCD00001589
2,4,4,6-TETRAMETHYL-5,6-DIHYDRO-4H-1,3-OXAZINE
CAS:26939-18-4
Formula: CC1CC(C)(C)N=C(C)O1
95%
BD66019
MFCD00014605
2,4,4-TRIFLUORO-2-(TRIFLUOROMETHYL)-4H-BENZO[D][1,3]DIOXINE
CAS:25857-80-1
Formula: FC(C1(F)OC2=CC=CC=C2C(F)(F)O1)(F)F
97%
BD495879
MFCD08275304
2,4,4-TRIHYDROXYBENZOPHENONE
CAS:1470-79-7
Formula: OC1=CC=C(C(C2=C(O)C=C(O)C=C2)=O)C=C1
98%
BD66023
2,4,4-TRIMETHOXYBUTAN-1-AMINE
CAS:1370360-21-6
Formula: NCC(OC)CC(OC)OC
95+%
BD306691
n/a
2,4,4-TRIMETHYL-1,2,3,4-TETRAHYDROISOQUINOLIN-7-AMINE
CAS:745778-71-6
Formula: NC1C=CC2C(CN(CC=2C=1)C)(C)C
95+%
BD00760481
n/a
2,4,4-TRIMETHYL-1,2,3,4-TETRAHYDROISOQUINOLINE
CAS:1110704-58-9
Formula: CC1(C)CN(C)CC2=C1C=CC=C2
95%
BD297435
MFCD27991314
2,4,4-TRIMETHYL-N-((2-(PYRROLIDIN-1-YL)PYRIMIDIN-5-YL)METHYL)PENTAN-2-AMINE
CAS:1279217-20-7
Formula: CC(C)(C)CC(NCC1=CN=C(N2CCCC2)N=C1)(C)C
97%
BD609431
2,4,4-TRIMETHYLPENTAN-1-OL
CAS:16325-63-6
Formula: CC(C)(C)CC(C)CO
95+%
BD66026