Phone (USA) +1 212-348-5610
Whatsapp: +1 516-336-9307
WeChat: chembuyersguide
Chemical Search
 
























BLD Pharmatech Ltd.




Country: China

BLD Pharmatech Ltd.
488 Taoqiao Road, Building 5, 5F
HuiNan Town, Pudong New Area,
Shanghai 201203, China


Phone: +86-21-61629022
E-Mail:E-Mail this Supplier

Contact: Elva Cui

http://www.bldpharm.com

BLD Pharmatech Ltd.

Page: Home | 1 | 2 | 3 | 4 | 5 | 6 | 7 | 8 | 9 | 10 | 11 | 12 | 13 | 14 | 15 | 16 | 17 | 18 | 19 | 20 | 21 | 22 | 23 | 24 | 25 | 26 | 27 | 28 | 29 | 30 | 31 | 32 | 33 | 34 | 35 | 36 | 37 | 38 | 39 | 40 | 41 | 42 | 43 | 44 | 45 | 46 | 47 | 48 | 49 | 50 | 51 | 52 | 53 | 54 | 55 | 56 | 57 | 58 | 59 | 60 | 61 | 62 | 63 | 64 | 65 | 66 | 67 | 68 | 69 | 70 | 71 | 72 | 73 | 74 | 75 | 76 | 77 | 78 | 79 | 80 | 81 | 82 | 83 | 84 | 85 | 86 | 87 | 88 | 89 | 90 | 91 | 92 | 93 | 94 | 95 | 96 | 97 | 98 | 99 | 100 | 101 | 102 | 103 | 104 | 105 | 106 | 107 | 108 | 109 | 110 | 111 | 112 | 113 | 114 | 115 | 116 | 117 | 118 | 119 | 120 | 121 | 122 | 123 | 124 | 125 | 126 | 127 | 128 | 129 | 130 | 131 | 132 | 133 | 134 | 135 | 136 | 137 | 138 | 139 | 140 | 141 | 142 | 143 | 144 | 145 | 146 | 147 | 148 | 149 | 150 | 151 | 152 | 153 | 154 | 155 | 156 | 157 | 158 | 159 | 160 | 161 | 162 | 163 | 164 | 165 | 166 | 167 | 168 | 169 | 170 | 171 | 172 | 173 | 174 | 175 | 176 | 177 | 178 | 179 | 180 | 181 | 182 | 183 | 184 | 185 | 186 | 187 | 188 | 189 | 190 | 191 | 192 | 193 | 194 | 195 | 196 | 197 | 198 | 199 | 200 | 201 | 202 | 203 | 204 | 205 | 206 | 207 | 208 | 209 | 210 | 211 | 212 | 213 | 214 | 215 | 216 | 217 | 218 | 219 | 220 | 221 | 222 | 223 | 224 | 225 | 226 | 227 | 228 | 229 | 230 | 231 | 232 | 233 | 234 | 235 | 236 | 237 | 238 | 239 | 240 | 241 | 242 | 243 | 244 | 245 | 246 | 247 | 248 | 249 | 250 | 251 | 252 | 253 | 254 | 255 | 256 | 257 | 258 | 259 | 260 | 261 | 262 | 263 | 264 | 265 | 266 | 267 | 268 | 269 | 270 | 271 | 272 | 273 | 274 | 275 | 276 | 277 | 278 | 279 | 280 | 281 | 282 | 283 | 284 | 285 | 286 | 287 | 288 | 289 | 290 | 291 | 292 | 293 | 294 | 295 | 296 | 297 | 298 | 299 | 300 | 301 | 302 | 303 | 304 | 305 | 306 | 307 | 308 |
 


Product List

2,4-DICHLORO-7,7-DIMETHYL-5,7-DIHYDROFURO[3,4-D]PYRIMIDINE
CAS:1260088-72-9
Formula: CC1(C)OCC2=C(Cl)N=C(Cl)N=C21
97%
BD218612
2,4-DICHLORO-7,7-DIMETHYL-7,8-DIHYDROQUINOLIN-5(6H)-ONE
CAS:1630096-70-6
Formula: O=C1C2=C(N=C(Cl)C=C2Cl)CC(C)(C)C1
97%
BD603736
2,4-DICHLORO-7,8-DIFLUORO-6-METHYLQUINOLINE
CAS:1422496-23-8
Formula: CC1=C(F)C(F)=C2N=C(Cl)C=C(Cl)C2=C1
97%
BD440317
MFCD26406912
2,4-DICHLORO-7,8-DIHYDRO-5H-THIOPYRANO[4,3-D]PYRIMIDINE
CAS:181374-43-6
Formula: ClC1=C(CSCC2)C2=NC(Cl)=N1
95%
BD224377
MFCD11846185
2,4-DICHLORO-7,8-DIHYDRO-5H-THIOPYRANO[4,3-D]PYRIMIDINE 6,6-DIOXIDE
CAS:1187830-50-7
Formula: ClC1=C(CS2(=O)=O)C(CC2)=NC(Cl)=N1
97%
BD224378
MFCD12963841
2,4-DICHLORO-7,8-DIHYDRO-5H-THIOPYRANO[4,3-D]PYRIMIDINE 6-OXIDE
CAS:1312935-07-1
Formula: ClC1=C(CS2=O)C(CC2)=NC(Cl)=N1
95+%
BD264669
2,4-DICHLORO-7,8-DIHYDRO-6H-THIOPYRANO[3,2-D]PYRIMIDINE
CAS:87466-23-7
Formula: ClC1=C2C(CCCS2)=NC(Cl)=N1
95+%
BD162966
2,4-DICHLORO-7,8-DIHYDROPYRIDO[4,3-D]PYRIMIDIN-5(6H)-ONE
CAS:1393572-20-7
Formula: O=C1NCCC2=NC(Cl)=NC(Cl)=C21
95+%
BD266298
2,4-DICHLORO-7,8-DIHYDROQUINOLIN-5(6H)-ONE
CAS:1028330-50-8
Formula: O=C1C2=C(N=C(Cl)C=C2Cl)CCC1
97%
BD556273
MFCD18253894
2,4-DICHLORO-7,8-DIMETHOXYQUINOLINE
CAS:202824-49-5
Formula: COC1=C2N=C(Cl)C=C(Cl)C2=CC=C1OC
95+%
BD330772
MFCD26406913
2,4-DICHLORO-7-((2-(TRIMETHYLSILYL)ETHOXY)METHYL)-7H-PYRROLO[2,3-D]PYRIMIDINE
CAS:442847-52-1
Formula: C[Si](CCOCN1C=CC2=C(Cl)N=C(Cl)N=C21)(C)C
95+%
BD217309
MFCD08689864
2,4-DICHLORO-7-((2-(TRIMETHYLSILYL)ETHOXY)METHYL)-7H-PYRROLO[2,3-D]PYRIMIDINE-5-CARBOXYLIC ACID
CAS:950661-85-5
Formula: O=C(C1=CN(COCC[Si](C)(C)C)C2=NC(Cl)=NC(Cl)=C21)O
95+%
BD316200
MFCD17214387
2,4-DICHLORO-7-(2,4-DIFLUOROPHENYL)-6,7-DIHYDRO-5H-CYCLOPENTA[D]PYRIMIDINE
CAS:1263869-63-1
Formula: FC1=CC=C(C2CCC3=C(Cl)N=C(Cl)N=C32)C(F)=C1
97%
BD436655
MFCD21607366
2,4-DICHLORO-7-(2-FLUOROBENZYL)-7H-PYRROLO[2,3-D]PYRIMIDINE
CAS:1075205-27-4
Formula: FC1=CC=CC=C1CN2C=CC3=C(Cl)N=C(Cl)N=C32
95+%
BD284068
2,4-DICHLORO-7-(2-FLUOROETHYL)-7H-PYRROLO[2,3-D]PYRIMIDINE
CAS:1220517-99-6
Formula: FCCN1C=CC2=C(Cl)N=C(Cl)N=C21
95+%
BD283832
MFCD22575132
2,4-DICHLORO-7-(4-FLUOROPHENYL)-6,7-DIHYDRO-5H-CYCLOPENTA[D]PYRIMIDINE
CAS:1263868-30-9
Formula: FC1=CC=C(C2CCC3=C(Cl)N=C(Cl)N=C32)C=C1
97%
BD436654
MFCD21607365
2,4-DICHLORO-7-(4-FLUOROPHENYL)-7-METHYL-6,7-DIHYDRO-5H-CYCLOPENTA[D]PYRIMIDINE
CAS:1356010-00-8
Formula: CC1(C2=CC=C(F)C=C2)CCC3=C(Cl)N=C(Cl)N=C31
97%
BD436656
MFCD21607367
2,4-DICHLORO-7-(PHENYLSULFONYL)-7H-PYRROLO[2,3-D]PYRIMIDINE
CAS:1131992-22-7
Formula: O=S(N1C=CC2=C(Cl)N=C(Cl)N=C21)(C3=CC=CC=C3)=O
95+%
BD220883
2,4-DICHLORO-7-(PHENYLSULFONYL)-7H-PYRROLO[2,3-D]PYRIMIDINE-6-CARBOXYLIC ACID
CAS:1638768-44-1
Formula: O=C(C1=CC2=C(Cl)N=C(Cl)N=C2N1S(=O)(C3=CC=CC=C3)=O)O
97%
BD445790
MFCD27987429
2,4-DICHLORO-7-(TRIFLUOROMETHOXY)QUINAZOLINE
CAS:1160994-83-1
Formula: FC(F)(F)OC1=CC2=NC(Cl)=NC(Cl)=C2C=C1
95+%
BD163043
MFCD12400771
2,4-DICHLORO-7-(TRIFLUOROMETHYL)QUINAZOLINE
CAS:396-02-1
Formula: FC(C1=CC2=NC(Cl)=NC(Cl)=C2C=C1)(F)F
95+%
BD162895
MFCD09954878
2,4-DICHLORO-7-(TRIFLUOROMETHYL)THIENO[3,2-D]PYRIMIDINE
CAS:1442083-00-2
Formula: FC(C1=CSC2=C(Cl)N=C(Cl)N=C21)(F)F
BD00814131
2,4-DICHLORO-7-CYCLOPROPYL-7H-PYRROLO[2,3-D]PYRIMIDINE
CAS:1220518-04-6
Formula: ClC1=C2C(N(C3CC3)C=C2)=NC(Cl)=N1
95+%
BD283823
MFCD22575133
2,4-DICHLORO-7-FLUORO-5H-PYRROLO[3,2-D]PYRIMIDINE
CAS:1379307-68-2
Formula: FC1=CNC2=C(Cl)N=C(Cl)N=C21
95+%
BD266707
2,4-DICHLORO-7-FLUORO-6-METHOXYQUINAZOLINE
CAS:864292-37-5
Formula: COC1=CC2=C(Cl)N=C(Cl)N=C2C=C1F
95+%
BD300177
2,4-DICHLORO-7-FLUORO-6-NITROQUINAZOLINE
CAS:1007308-75-9
Formula: O=[N+](C1=CC2=C(Cl)N=C(Cl)N=C2C=C1F)[O-]
95+%
BD225307
2,4-DICHLORO-7-FLUORO-8-METHYLQUINAZOLINE
CAS:1039736-73-6
Formula: CC1=C(F)C=CC2=C(Cl)N=C(Cl)N=C12
95+%
BD270741
2,4-DICHLORO-7-FLUOROPYRIDO[4,3-D]PYRIMIDINE
CAS:N/A
Formula: FC1=CC2=NC(Cl)=NC(Cl)=C2C=N1
BD00791949
2,4-DICHLORO-7-FLUOROQUINAZOLINE
CAS:174566-15-5
Formula: FC1=CC2=NC(Cl)=NC(Cl)=C2C=C1
95%
BD66727
MFCD09954885
2,4-DICHLORO-7-IODO-5H-PYRROLO[3,2-D]PYRIMIDINE
CAS:928840-99-7
Formula: ClC1=NC2=C(NC=C2I)C(Cl)=N1
95%
BD221825
MFCD11109825
2,4-DICHLORO-7-IODOQUINAZOLINE
CAS:959237-34-4
Formula: IC1=CC2=NC(Cl)=NC(Cl)=C2C=C1
95+%
BD162996
2,4-DICHLORO-7-ISOPROPYL-7H-PYRROLO[2,3-D]PYRIMIDINE
CAS:1227635-12-2
Formula: CC(N1C=CC2=C(Cl)N=C(Cl)N=C21)C
95+%
BD314449
MFCD23106265
2,4-DICHLORO-7-METHOXY-3-NITROQUINOLINE
CAS:1447961-41-2
Formula: O=[N+](C1=C(Cl)C2=CC=C(OC)C=C2N=C1Cl)[O-]
97%
BD617702
2,4-DICHLORO-7-METHOXY-6-NITROQUINAZOLINE
CAS:N/A
Formula: O=[N+](C1=CC2=C(Cl)N=C(Cl)N=C2C=C1OC)[O-]
97%
BD753521
2,4-DICHLORO-7-METHOXY-8-METHYL-QUINOLINE
CAS:1108659-32-0
Formula: CC1=C2N=C(Cl)C=C(Cl)C2=CC=C1OC
97%
BD00790549
2,4-DICHLORO-7-METHOXYQUINAZOLINE
CAS:62484-31-5
Formula: ClC2=NC1=CC(=CC=C1C(=N2)Cl)OC
95+%
BD66729
MFCD09954881
2,4-DICHLORO-7-METHOXYQUINOLINE
CAS:55934-22-0
Formula: COC1=CC=C2C(Cl)=CC(Cl)=NC2=C1
95%
BD158272
MFCD09475797
2,4-DICHLORO-7-METHYL-5,7-DIHYDROFURO[3,4-D]PYRIMIDINE
CAS:1429309-52-3
Formula: CC1OCC2=C(Cl)N=C(Cl)N=C21
95+%
BD289880
MFCD22690768
2,4-DICHLORO-7-METHYL-7H-PYRROLO[2,3-D]PYRIMIDINE
CAS:90213-67-5
Formula: CN1C=CC2=C(Cl)N=C(Cl)N=C21
97%
BD219225
2,4-DICHLORO-7-METHYL-7H-PYRROLO[2,3-D]PYRIMIDINE-6-CARBOXYLIC ACID
CAS:1638760-84-5
Formula: O=C(C1=CC2=C(Cl)N=C(Cl)N=C2N1C)O
97%
BD445793
MFCD27987432
2,4-DICHLORO-7-METHYLPYRIDO[2,3-D]PYRIMIDINE
CAS:92350-63-5
Formula: CC1=NC2=NC(Cl)=NC(Cl)=C2C=C1
97%
BD449322
MFCD11044118
2,4-DICHLORO-7-METHYLPYRROLO[2,1-F][1,2,4]TRIAZINE
CAS:1613751-73-7
Formula: CC1=CC=C2C(Cl)=NC(Cl)=NN21
BD00807548
2,4-DICHLORO-7-METHYLQUINAZOLINE
CAS:25171-19-1
Formula: CC1=CC=C2C(Cl)=NC(Cl)=NC2=C1
97%
BD162864
MFCD11858254
2,4-DICHLORO-7-METHYLQUINOLINE
CAS:102878-19-3
Formula: CC1=CC=C2C(Cl)=CC(Cl)=NC2=C1
95%
BD585828
2,4-DICHLORO-7-METHYLTHIENO[3,2-D]PYRIMIDINE
CAS:35265-83-9
Formula: ClC1=NC2=C(C(=N1)Cl)SC=C2C
97+%
BD170944
MFCD08061253
2,4-DICHLORO-7-NITROQUINAZOLINE
CAS:129112-65-8
Formula: O=[N+](C1=CC2=NC(Cl)=NC(Cl)=C2C=C1)[O-]
95+%
BD219429
2,4-DICHLORO-7-NITROQUINOLINE
CAS:N/A
Formula: O=[N+](C1=CC=C2C(Cl)=CC(Cl)=NC2=C1)[O-]
97%
BD00781605
n/a
2,4-DICHLORO-7-PHENYL-6,7-DIHYDRO-5H-CYCLOPENTA[D]PYRIMIDINE
CAS:1263868-24-1
Formula: ClC1=C(CCC2C3=CC=CC=C3)C2=NC(Cl)=N1
95+%
BD334242
MFCD21607364
2,4-DICHLORO-7-TOSYL-7H-PYRROLO[2,3-D]PYRIMIDINE
CAS:934524-10-4
Formula: O=S(N1C=CC2=C(Cl)N=C(Cl)N=C21)(C3=CC=C(C)C=C3)=O
97+%
BD166283
MFCD13193624
2,4-DICHLORO-7H-PYRROLO[2,3-D]PYRIMIDINE
CAS:90213-66-4
Formula: ClC1=C2C(NC=C2)=NC(Cl)=N1
97%
BD29862
MFCD08059278
2,4-DICHLORO-7H-PYRROLO[2,3-D]PYRIMIDINE-5-CARBALDEHYDE
CAS:1638767-57-3
Formula: O=CC1=CNC2=NC(Cl)=NC(Cl)=C21
95+%
BD330376
MFCD26516404
2,4-DICHLORO-7H-PYRROLO[2,3-D]PYRIMIDINE-5-CARBONITRILE
CAS:1379367-43-7
Formula: N#CC1=CNC2=NC(Cl)=NC(Cl)=C21
95+%
BD300930
2,4-DICHLORO-7H-PYRROLO[2,3-D]PYRIMIDINE-5-CARBOXYLIC ACID
CAS:1638768-02-1
Formula: O=C(C1=CNC2=NC(Cl)=NC(Cl)=C21)O
97%
BD445796
MFCD27987438
2,4-DICHLORO-7H-PYRROLO[2,3-D]PYRIMIDINE-6-CARBOXYLIC ACID
CAS:1638760-72-1
Formula: O=C(C1=CC2=C(Cl)N=C(Cl)N=C2N1)O
97%
BD445647
MFCD25372087
2,4-DICHLORO-7H-PYRROLO[2,3-H]QUINAZOLINE
CAS:1186401-17-1
Formula: ClC1=C2C=CC(NC=C3)=C3C2=NC(Cl)=N1
97%
BD00748167
MFCD20482840
2,4-DICHLORO-8-(4-FLUOROPHENYL)-6-METHYL-5,6,7,8-TETRAHYDROPYRIDO[4,3-D]PYRIMIDINE
CAS:1263870-59-2
Formula: CN1CC(C2=CC=C(F)C=C2)C3=NC(Cl)=NC(Cl)=C3C1
97%
BD436657
MFCD21607368
2,4-DICHLORO-8-(4-FLUOROPHENYL)-7,8-DIHYDRO-5H-PYRANO[4,3-D]PYRIMIDINE
CAS:1263868-84-3
Formula: FC1=CC=C(C2COCC3=C(Cl)N=C(Cl)N=C32)C=C1
97%
BD436150
MFCD21607138
2,4-DICHLORO-8-(TRIFLUOROMETHOXY)QUINAZOLINE
CAS:959237-48-0
Formula: FC(F)(F)OC1=CC=CC2=C(Cl)N=C(Cl)N=C12
95+%
BD260957
2,4-DICHLORO-8-(TRIFLUOROMETHYL)QUINAZOLINE
CAS:959237-52-6
Formula: FC(C1=CC=CC2=C(Cl)N=C(Cl)N=C12)(F)F
97%
BD260063
MFCD09954877
2,4-DICHLORO-8-ETHOXY-3-NITROQUINOLINE
CAS:1447958-14-6
Formula: O=[N+](C1=C(Cl)C2=CC=CC(OCC)=C2N=C1Cl)[O-]
97%
BD617623
2,4-DICHLORO-8-ETHOXYQUINOLIN-3-AMINE
CAS:1447962-17-5
Formula: NC1=C(Cl)C2=CC=CC(OCC)=C2N=C1Cl
97%
BD617736
2,4-DICHLORO-8-FLUORO-6,7-DIMETHOXYQUINAZOLINE
CAS:1515883-85-8
Formula: COC1=C(F)C2=NC(Cl)=NC(Cl)=C2C=C1OC
97%
BD00803719
2,4-DICHLORO-8-FLUOROQUINAZOLINE
CAS:959237-64-0
Formula: FC1=CC=CC2=C(Cl)N=C(Cl)N=C12
95%
BD162997
2,4-DICHLORO-8-FLUOROQUINOLIN-3-AMINE
CAS:1447960-18-0
Formula: NC1=C(Cl)C2=CC=CC(F)=C2N=C1Cl
97%
BD617673
2,4-DICHLORO-8-FLUOROQUINOLINE
CAS:1422498-86-9
Formula: FC1=C2N=C(Cl)C=C(Cl)C2=CC=C1
97%
BD587088
MFCD22103408
2,4-DICHLORO-8-IODOQUINAZOLINE
CAS:959237-40-2
Formula: ClC1=NC2=C(I)C=CC=C2C(Cl)=N1
95+%
BD238490
MFCD09954873
2,4-DICHLORO-8-METHOXY-3-PHENYLQUINOLINE
CAS:274691-33-7
Formula: COC1=C2N=C(Cl)C(C3=CC=CC=C3)=C(Cl)C2=CC=C1
97%
BD492921
2,4-DICHLORO-8-METHOXY-7-METHYLQUINAZOLINE
CAS:956100-67-7
Formula: CC1=C(OC)C2=NC(Cl)=NC(Cl)=C2C=C1
97%
BD747871
2,4-DICHLORO-8-METHOXYQUINAZOLINE
CAS:61948-60-5
Formula: COC1=CC=CC2=C(Cl)N=C(Cl)N=C12
97%
BD66730
2,4-DICHLORO-8-METHOXYQUINOLINE
CAS:32608-29-0
Formula: COC1=C2N=C(Cl)C=C(Cl)C2=CC=C1
98%
BD33215
MFCD07644554
2,4-DICHLORO-8-METHYL-3-NITROQUINOLINE
CAS:1026839-46-2
Formula: O=[N+](C1=C(Cl)C2=CC=CC(C)=C2N=C1Cl)[O-]
97%
BD605844
2,4-DICHLORO-8-METHYLBENZO[B]THIENO[3,2-F][1,4]OXAZEPINE
CAS:1418130-87-6
Formula: CC1=CC=C2C(OC3=C(C=C(Cl)S3)C(Cl)=N2)=C1
97%
BD439485
MFCD23703293
2,4-DICHLORO-8-METHYLQUINAZOLINE
CAS:39576-83-5
Formula: CC1=CC=CC2=C(Cl)N=C(Cl)N=C12
97%
BD258788
MFCD11849266
2,4-DICHLORO-8-METHYLQUINOLIN-3-AMINE
CAS:1447960-14-6
Formula: NC1=C(Cl)C2=CC=CC(C)=C2N=C1Cl
97%
BD617670
2,4-DICHLORO-8-METHYLQUINOLINE
CAS:102878-20-6
Formula: CC1=C2N=C(Cl)C=C(Cl)C2=CC=C1
95+%
BD304940
MFCD01108969
2,4-DICHLORO-8-NITROQUINAZOLINE
CAS:174566-19-9
Formula: O=[N+](C1=CC=CC2=C(Cl)N=C(Cl)N=C12)[O-]
97%
BD587351
2,4-DICHLORO-8-NITROQUINOLINE
CAS:N/A
Formula: O=[N+](C1=C2N=C(Cl)C=C(Cl)C2=CC=C1)[O-]
97%
BD00784297
n/a
2,4-DICHLORO-8-PHENYL-7,8-DIHYDRO-5H-PYRANO[4,3-D]PYRIMIDINE
CAS:1263868-77-4
Formula: ClC1=C(COCC2C3=CC=CC=C3)C2=NC(Cl)=N1
97%
BD436149
MFCD21607137
2,4-DICHLORO-BENZENEPROPANAMINE
CAS:147498-88-2
Formula: NCCCC1=CC=C(Cl)C=C1Cl
95%
BD00802743
2,4-DICHLORO-D-PHENYLALANINE
CAS:114872-98-9
Formula: ClC1=C(C[C@@H](N)C(=O)O)C=CC(=C1)Cl
97%
BD17624
MFCD01860873
2,4-DICHLORO-N'-(2-CHLOROACETYL)BENZOHYDRAZIDE
CAS:184877-74-5
Formula: O=C(NNC(CCl)=O)C1=CC=C(Cl)C=C1Cl
95+%
BD201369
2,4-DICHLORO-N'-HYDROXYBENZIMIDAMIDE
CAS:22179-80-2
Formula: N/C(C1=CC=C(Cl)C=C1Cl)=N\O
97%
BD66776
MFCD00178762
2,4-DICHLORO-N,N-DIMETHYLPYRIMIDINE-5-CARBOXAMIDE
CAS:1160066-14-7
Formula: O=C(N(C)C)C1C(Cl)=NC(Cl)=NC=1
95%
BD00787693
2,4-DICHLORO-N-(2,6-DICHLOROPHENYL)PYRIMIDINE-5-CARBOXAMIDE
CAS:835633-83-5
Formula: O=C(C1=CN=C(Cl)N=C1Cl)NC2=C(Cl)C=CC=C2Cl
95+%
BD268634
MFCD26400049
2,4-DICHLORO-N-(2,6-DIMETHYLPHENYL)PYRIMIDINE-5-CARBOXAMIDE
CAS:835633-82-4
Formula: O=C(C1=CN=C(Cl)N=C1Cl)NC2=C(C)C=CC=C2C
95+%
BD268633
MFCD25953444
2,4-DICHLORO-N-(2-HYDROXYETHYL)BENZAMIDE
CAS:20656-08-0
Formula: O=C(NCCO)C1=CC=C(Cl)C=C1Cl
95%
BD11667
2,4-DICHLORO-N-(2-HYDROXYPROPYL)BENZAMIDE
CAS:947888-99-5
Formula: O=C(NCC(O)C)C1=CC=C(Cl)C=C1Cl
97%
BD273504
2,4-DICHLORO-N-(2-METHYLBENZYL)ANILINE
CAS:940367-72-6
Formula: CC1=CC=CC=C1CNC2=CC=C(Cl)C=C2Cl
97%
BD193886
MFCD10687636
2,4-DICHLORO-N-(4-(1-HYDROXYETHYL)PHENYL)BENZAMIDE
CAS:1156912-69-4
Formula: O=C(NC1=CC=C(C(O)C)C=C1)C2=CC=C(Cl)C=C2Cl
97%
BD606794
2,4-DICHLORO-N-(PIPERIDIN-2-YLMETHYL)BENZENESULFONAMIDE HYDROCHLORIDE
CAS:1353948-07-8
Formula: O=S(C1=CC=C(Cl)C=C1Cl)(NCC2NCCCC2)=O.[H]Cl
95+%
BD288631
MFCD21098951
2,4-DICHLORO-N-(PIPERIDIN-3-YL)BENZENESULFONAMIDE HYDROCHLORIDE
CAS:1353958-62-9
Formula: O=S(C1=CC=C(Cl)C=C1Cl)(NC2CNCCC2)=O.[H]Cl
95+%
BD288807
MFCD21098921
2,4-DICHLORO-N-(PYRIDIN-3-YL)BENZAMIDE
CAS:197800-84-3
Formula: O=C(NC1=CC=CN=C1)C2=CC=C(Cl)C=C2Cl
95+%
BD417298
MFCD00160434
2,4-DICHLORO-N-(PYRROLIDIN-2-YLMETHYL)ANILINE HYDROCHLORIDE
CAS:1177352-12-3
Formula: ClC1=CC=C(C(Cl)=C1)NCC2NCCC2.[H]Cl
97%
BD562626
2,4-DICHLORO-N-(PYRROLIDIN-2-YLMETHYL)BENZENESULFONAMIDE HYDROCHLORIDE
CAS:1353958-35-6
Formula: O=S(C1=CC=C(Cl)C=C1Cl)(NCC2NCCC2)=O.[H]Cl
95+%
BD288654
MFCD21098898
2,4-DICHLORO-N-[4-(2,4-DICHLOROBENZOYLOXY)-2-METHYLPHENYL]BENZAMIDE
CAS:1363166-08-8
Formula: O=C(NC1=CC=C(OC(C2=CC=C(Cl)C=C2Cl)=O)C=C1C)C3=CC=C(Cl)C=C3Cl
95+%
BD317326
MFCD21641332
2,4-DICHLORO-N-CYCLOPROPYL-N-(PIPERIDIN-4-YLMETHYL)BENZENESULFONAMIDE HYDROCHLORIDE
CAS:1353965-80-6
Formula: O=S(C1=CC=C(Cl)C=C1Cl)(N(C2CC2)CC3CCNCC3)=O.[H]Cl
95+%
BD289011
MFCD21098914
2,4-DICHLORO-N-CYCLOPROPYLPYRIMIDINE-5-CARBOXAMIDE
CAS:1017464-37-7
Formula: O=C(C1=CN=C(Cl)N=C1Cl)NC2CC2
97%
BD605533
2,4-DICHLORO-N-ETHYLANILINE
CAS:35113-89-4
Formula: CCNC1=CC=C(Cl)C=C1Cl
96%
BD28467
MFCD06658422
2,4-DICHLORO-N-HYDROXYBENZIMIDOYL CHLORIDE
CAS:29203-60-9
Formula: Cl/C(C1=CC=C(Cl)C=C1Cl)=N\O
97%
BD66777
2,4-DICHLORO-N-ISOPROPYL-N-(PYRROLIDIN-2-YLMETHYL)BENZENESULFONAMIDE
CAS:1353980-76-3
Formula: O=S(C1=CC=C(Cl)C=C1Cl)(N(C(C)C)CC2NCCC2)=O
95+%
BD289019
MFCD21098915
2,4-DICHLORO-N-METHOXY-N-METHYLBENZAMIDE
CAS:646528-36-1
Formula: CON(C)C(=O)C1=C(Cl)C=C(Cl)C=C1
95+%
BD201460
MFCD08689759
2,4-DICHLORO-N-METHYL-N-(PIPERIDIN-3-YL)BENZENESULFONAMIDE HYDROCHLORIDE
CAS:1353947-18-8
Formula: O=S(C1=CC=C(Cl)C=C1Cl)(N(C)C2CNCCC2)=O.[H]Cl
95+%
BD289036
MFCD21098943
2,4-DICHLORO-N-METHYLANILINE
CAS:35113-88-3
Formula: CNC1=CC=C(Cl)C=C1Cl
98%
BD142745
MFCD00052853
2,4-DICHLORO-N-METHYLBENZAMIDE
CAS:66896-64-8
Formula: O=C(NC)C1=CC=C(Cl)C=C1Cl
95+%
BD368215
MFCD00507353
2,4-DICHLORO-N-METHYLPYRIMIDINE-5-CARBOXAMIDE
CAS:39714-33-5
Formula: O=C(NC)C1C(Cl)=NC(Cl)=NC=1
95%
BD00760714
n/a
2,4-DICHLORO-N-NEOPENTYLANILINE
CAS:1040690-09-2
Formula: CC(C)(C)CNC1=CC=C(Cl)C=C1Cl
97%
BD193917
2,4-DICHLORO-N-PHENETHYLPYRIMIDINE-5-CARBOXAMIDE
CAS:927176-99-6
Formula: O=C(C1=CN=C(Cl)N=C1Cl)NCCC2=CC=CC=C2
95+%
BD268636
2,4-DICHLORO-PYRIMIDINE-5-CARBOXYLIC ACID-TERT-BUTYLAMIDE
CAS:389606-35-3
Formula: O=C(C1=CN=C(Cl)N=C1Cl)NC(C)(C)C
95+%
BD268632
2,4-DICHLOROBENZALDEHYDE
CAS:874-42-0
Formula: O=CC1=CC=C(Cl)C=C1Cl
98%
BD66742
MFCD00003305
2,4-DICHLOROBENZAMIDE
CAS:2447-79-2
Formula: O=C(N)C1=CC=C(Cl)C=C1Cl
95+%
BD4330
MFCD00007974
2,4-DICHLOROBENZENE-1,3-DIOL
CAS:16606-61-4
Formula: OC1=CC=C(Cl)C(O)=C1Cl
95+%
BD328596
MFCD13152136
2,4-DICHLOROBENZENEBUTANOIC ACID
CAS:66648-64-4
Formula: O=C(O)CCCC1=CC=C(Cl)C=C1Cl
95%
BD00799992
2,4-DICHLOROBENZENESULFONAMIDE
CAS:20532-15-4
Formula: O=S(C1=CC=C(Cl)C=C1Cl)(N)=O
97%
BD323462
MFCD03094617
2,4-DICHLOROBENZENESULFONYL CHLORIDE
CAS:16271-33-3
Formula: O=S(C1=CC=C(Cl)C=C1Cl)(Cl)=O
98%
BD3147
MFCD00052712
2,4-DICHLOROBENZENETHIOL
CAS:1122-41-4
Formula: SC1=CC=C(Cl)C=C1Cl
97%
BD66815
MFCD00041421
2,4-DICHLOROBENZIMIDAMIDE
CAS:63124-43-6
Formula: N=C(N)C1=CC=C(Cl)C=C1Cl
95+%
BD66745
MFCD09745492
2,4-DICHLOROBENZIMIDAMIDE HYDROCHLORIDE
CAS:154505-50-7
Formula: N=C(N)C1=CC=C(Cl)C=C1Cl.[H]Cl
98%
BD27628
MFCD04114461
2,4-DICHLOROBENZO[D]OXAZOLE
CAS:656836-87-2
Formula: ClC1=C2N=C(Cl)OC2=CC=C1
97%
BD459792
2,4-DICHLOROBENZO[G]QUINAZOLINE
CAS:33987-01-8
Formula: ClC1=C2C=C3C(C=CC=C3)=CC2=NC(Cl)=N1
95+%
BD294223
2,4-DICHLOROBENZOFURO[3,2-D]PYRIMIDINE
CAS:160199-95-1
Formula: ClC1=C(OC2=CC=CC=C23)C3=NC(Cl)=N1
97%
BD00792722
2,4-DICHLOROBENZOHYDRAZIDE
CAS:5814-06-2
Formula: O=C(NN)C1=CC=C(Cl)C=C1Cl
98%
BD4548
2,4-DICHLOROBENZOIC ACID
CAS:50-84-0
Formula: C1=CC(=CC(=C1C(O)=O)Cl)Cl
98%
BD21089
MFCD00002414
2,4-DICHLOROBENZONITRILE
CAS:6574-98-7
Formula: C1=CC(=CC(=C1C#N)Cl)Cl
96%
BD4037
MFCD00016373
2,4-DICHLOROBENZOTHIAZOLE
CAS:3622-30-8
Formula: C1=C(C2=C(C=C1)SC(=N2)Cl)Cl
95+%
BD20442
MFCD00127716
2,4-DICHLOROBENZOYLACETONITRILE
CAS:39528-61-5
Formula: N#CCC(C1=CC=C(Cl)C=C1Cl)=O
95+%
BD79171
MFCD02657976
2,4-DICHLOROBENZYL CARBAMIMIDOTHIOATE HYDROCHLORIDE
CAS:131916-62-6
Formula: NC(SCC1=CC=C(Cl)C=C1Cl)=N.[H]Cl
97%
BD590555
2,4-DICHLOROCINNAMIC ACID
CAS:1201-99-6
Formula: O=C(O)/C=C/C1=CC=C(Cl)C=C1Cl
97%
BD7236
2,4-DICHLOROFURO[2,3-D]PYRIMIDINE
CAS:1000577-84-3
Formula: ClC1=C2C(OC=C2)=NC(Cl)=N1
95+%
BD159768
MFCD09878674
2,4-DICHLOROFURO[3,2-D]PYRIMIDINE
CAS:956034-07-4
Formula: ClC1=NC2=C(C(=N1)Cl)OC=C2
97%
BD158273
MFCD11520866
2,4-DICHLOROFURO[3,4-D]PYRIMIDIN-7(5H)-ONE
CAS:15783-48-9
Formula: O=C1OCC2=C(Cl)N=C(Cl)N=C21
95%
BD238980
MFCD18072502
2,4-DICHLOROIMIDAZO[5,1-F][1,2,4]TRIAZINE
CAS:1086398-79-9
Formula: ClC1=NC(Cl)=NN2C1=CN=C2
97%
BD160302
MFCD11501352
2,4-DICHLOROISOPHTHALONITRILE
CAS:19846-21-0
Formula: N#CC1=CC=C(Cl)C(C#N)=C1Cl
95+%
BD284402
MFCD01656997
2,4-DICHLORONAPHTHALEN-1-AMINE
CAS:29242-87-3
Formula: NC1=C2C=CC=CC2=C(Cl)C=C1Cl
97%
BD748533
2,4-DICHLORONAPHTHALEN-1-OL
CAS:2050-76-2
Formula: OC1=C(Cl)C=C(Cl)C2=C1C=CC=C2
95%
BD66618
MFCD00003931
2,4-DICHLORONICOTINALDEHYDE
CAS:134031-24-6
Formula: ClC1=C(C=O)C(=CC=N1)Cl
98%
BD66802
MFCD07437909
2,4-DICHLORONICOTINAMIDE
CAS:70593-56-5
Formula: O=C(N)C1=C(Cl)N=CC=C1Cl
95+%
BD219930
2,4-DICHLORONICOTINC ACID
CAS:262423-77-8
Formula: C1=CN=C(C(=C1Cl)C(=O)O)Cl
98%
BD32940
MFCD06796292
2,4-DICHLORONICOTINONITRILE
CAS:180995-12-4
Formula: N#CC1=C(Cl)N=CC=C1Cl
98%
BD66629
MFCD09750302
2,4-DICHLOROPHENETHYL ALCOHOL
CAS:81156-68-5
Formula: ClC1=CC=C(C(Cl)=C1)CCO
98%
BD42039
MFCD00192010
2,4-DICHLOROPHENYL 4-PHENYL-5-(TRIFLUOROMETHYL)THIOPHENE-2-CARBOXYLATE
CAS:256348-21-7
Formula: O=C(C1=CC(C2=CC=CC=C2)=C(C(F)(F)F)S1)OC3=CC=C(Cl)C=C3Cl
95+%
BD258320
MFCD00110255
2,4-DICHLOROPHENYL BUTYRATE
CAS:41022-54-2
Formula: CCCC(OC1=CC=C(Cl)C=C1Cl)=O
97%
BD128071
MFCD01566538
2,4-DICHLOROPHENYL ETHYL CARBONATE
CAS:22876-28-4
Formula: O=C(OC1=CC=C(Cl)C=C1Cl)OCC
95+%
BD66789
2,4-DICHLOROPHENYL ETHYL SULFIDE
CAS:101080-66-4
Formula: CCSC1=CC=C(Cl)C=C1Cl
95+%
BD322296
MFCD25976514
2,4-DICHLOROPHENYLACETIC ACID
CAS:19719-28-9
Formula: C1=C(C(=CC=C1Cl)CC(O)=O)Cl
98%
BD10944
MFCD00004318
2,4-DICHLOROPHENYLACETYLENE
CAS:75717-77-0
Formula: C#CC1=CC=C(Cl)C=C1Cl
97+%
BD290925
MFCD11655752
2,4-DICHLOROPHENYLBORONIC ACID
CAS:68716-47-2
Formula: C1=CC(=CC(=C1B(O)O)Cl)Cl
98%
BD22193
MFCD00013930
2,4-DICHLOROPHENYLSULFONYLETHANOL
CAS:107737-90-6
Formula: OCCS(=O)(C1=CC=C(Cl)C=C1Cl)=O
95+%
BD322409
MFCD03789219
2,4-DICHLOROPHENYLTHIOETHANOL
CAS:73927-27-2
Formula: OCCSC1=CC=C(Cl)C=C1Cl
95+%
BD324142
MFCD01727971
2,4-DICHLOROPTERIDINE
CAS:98138-05-7
Formula: ClC1=C2N=CC=NC2=NC(Cl)=N1
95%
BD23305
MFCD09743914
2,4-DICHLOROPYRIDIN-3-OL
CAS:405141-76-6
Formula: OC1=C(Cl)C=CN=C1Cl
95+%
BD212863
MFCD14155863
2,4-DICHLOROPYRIDINE
CAS:26452-80-2
Formula: C1=C(C=C(N=C1)Cl)Cl
98%
BD2535
MFCD00955618
2,4-DICHLOROPYRIDINE-5-BORONIC ACID PINACOL ESTER
CAS:1622217-00-8
Formula: ClC1=CC(Cl)=NC=C1B2OC(C)(C)C(C)(C)O2
96%
BD00828040
2,4-DICHLOROPYRIDO[2,3-D]PYRIDAZIN-5(6H)-ONE
CAS:1390657-40-5
Formula: O=C1C2=C(Cl)C=C(Cl)N=C2C=NN1
95+%
BD329509
MFCD23163508
2,4-DICHLOROPYRIDO[2,3-D]PYRIMIDINE
CAS:126728-20-9
Formula: ClC1=NC2=C(C=CC=N2)C(Cl)=N1
98%
BD31684
MFCD07644627
2,4-DICHLOROPYRIDO[3',2':4,5]FURO[3,2-D]PYRIMIDINE
CAS:1268241-74-2
Formula: ClC1=C(OC2=NC=CC=C23)C3=NC(Cl)=N1
97%
BD748626
2,4-DICHLOROPYRIDO[3,2-D]PYRIMIDINE
CAS:39551-54-7
Formula: ClC1=NC2=C(C(=N1)Cl)N=CC=C2
97%
BD66804
MFCD11046863
2,4-DICHLOROPYRIDO[3,2-D]PYRIMIDINE-6-CARBALDEHYDE
CAS:1690866-69-3
Formula: O=CC1=NC2=C(Cl)N=C(Cl)N=C2C=C1
97%
BD436423
MFCD21607299
2,4-DICHLOROPYRIDO[3,2-D]PYRIMIDINE-6-CARBOXYLIC ACID
CAS:1363405-45-1
Formula: O=C(C1=NC2=C(Cl)N=C(Cl)N=C2C=C1)O
97%
BD436426
MFCD21607302
2,4-DICHLOROPYRIDO[3,4-D]PYRIMIDINE
CAS:908240-50-6
Formula: ClC1=NC2=C(C=CN=C2)C(Cl)=N1
96%
BD158274
MFCD10699461
2,4-DICHLOROPYRIMIDIN-5-OL
CAS:1395037-19-0
Formula: OC1=CN=C(Cl)N=C1Cl
97%
BD587040
MFCD22570332
2,4-DICHLOROPYRIMIDINE
CAS:3934-20-1
Formula: ClC1=NC(Cl)=NC=C1
98%
BD9378
MFCD00006061
2,4-DICHLOROPYRIMIDINE-5-CARBALDEHYDE
CAS:871254-61-4
Formula: ClC1=NC(Cl)=C(C=O)C=N1
98%
BD210578
MFCD11112096
2,4-DICHLOROPYRIMIDINE-5-CARBOHYDRAZIDE
CAS:1379317-74-4
Formula: O=C(C1=CN=C(Cl)N=C1Cl)NN
97%
BD586969
2,4-DICHLOROPYRIMIDINE-5-CARBONITRILE
CAS:3177-24-0
Formula: ClC1=NC=C(C(=N1)Cl)C#N
95%
BD66656
MFCD09746248
2,4-DICHLOROPYRIMIDINE-5-CARBOXYLIC ACID
CAS:37131-89-8
Formula: ClC1=NC=C(C(=N1)Cl)C(=O)O
97+%
BD66686
MFCD09999133
2,4-DICHLOROPYRIMIDINE-5-CARBOXYLIC ACID AMIDE
CAS:1240390-28-6
Formula: O=C(C1=CN=C(Cl)N=C1Cl)N
97%
BD215188
2,4-DICHLOROPYRIMIDO[4,5-B]QUINOLINE
CAS:118726-21-9
Formula: ClC1=C2C(N=C3C=CC=CC3=C2)=NC(Cl)=N1
97%
BD437216
MFCD22573689
2,4-DICHLOROPYRROLO[2,1-F][1,2,4]TRIAZIN-6-AMINE
CAS:1823364-13-1
Formula: NC1=CN2N=C(Cl)N=C(Cl)C2=C1
95%
BD441595
MFCD27991657
2,4-DICHLOROPYRROLO[2,1-F][1,2,4]TRIAZINE
CAS:918538-05-3
Formula: ClC1=NC(Cl)=NN2C1=CC=C2
95+%
BD149947
MFCD11044885
2,4-DICHLOROPYRROLO[2,1-F][1,2,4]TRIAZINE-7-CARBOXYLIC ACID
CAS:1784036-68-5
Formula: O=C(C1=CC=C2C(Cl)=NC(Cl)=NN21)O
97%
BD00793703
2,4-DICHLOROQUINAZOLIN-6-OL
CAS:464927-05-7
Formula: OC1=CC2=C(Cl)N=C(Cl)N=C2C=C1
95+%
BD293673
2,4-DICHLOROQUINAZOLINE
CAS:607-68-1
Formula: C1=CC2=C(C=C1)N=C(N=C2Cl)Cl
97+%
BD41848
MFCD00091950
2,4-DICHLOROQUINAZOLINE-5-CARBONITRILE
CAS:1823921-32-9
Formula: N#CC1=CC=CC2=NC(Cl)=NC(Cl)=C12
95+%
BD260167
2,4-DICHLOROQUINAZOLINE-6-CARBONITRILE
CAS:150449-98-2
Formula: N#CC1=CC2=C(Cl)N=C(Cl)N=C2C=C1
95+%
BD162841
MFCD12400768
2,4-DICHLOROQUINAZOLINE-7-CARBONITRILE
CAS:864292-40-0
Formula: ClC1=NC2=CC(=CC=C2C(Cl)=N1)C#N
95+%
BD162960
MFCD12400766
2,4-DICHLOROQUINAZOLINE-7-CARBOXYLIC ACID
CAS:879274-85-8
Formula: O=C(C1=CC2=NC(Cl)=NC(Cl)=C2C=C1)O
97%
BD453151
2,4-DICHLOROQUINOLIN-3-AMINE
CAS:1414786-90-5
Formula: NC1=C(Cl)C2=CC=CC=C2N=C1Cl
95+%
BD270986
2,4-DICHLOROQUINOLIN-5-AMINE
CAS:N/A
Formula: NC1=C2C(Cl)=CC(Cl)=NC2=CC=C1
97%
BD00809070
n/a
2,4-DICHLOROQUINOLIN-6-AMINE
CAS:N/A
Formula: NC1=CC=C2N=C(Cl)C=C(Cl)C2=C1
97%
BD00787899
n/a
2,4-DICHLOROQUINOLIN-7-AMINE
CAS:N/A
Formula: NC1=CC=C2C(Cl)=CC(Cl)=NC2=C1
97%
BD00784800
n/a
2,4-DICHLOROQUINOLIN-8-AMINE
CAS:N/A
Formula: NC1=C2N=C(Cl)C=C(Cl)C2=CC=C1
97%
BD00803737
n/a
2,4-DICHLOROQUINOLINE
CAS:703-61-7
Formula: ClC1=NC2=C(C=CC=C2)C(Cl)=C1
98%
BD11462
MFCD00023939
2,4-DICHLOROQUINOLINE-3-CARBONITRILE
CAS:69875-54-3
Formula: N#CC1=C(Cl)C2=CC=CC=C2N=C1Cl
95+%
BD315817
MFCD00206427
2,4-DICHLOROTHIAZOLE
CAS:4175-76-2
Formula: ClC1=NC(=CS1)Cl
97%
BD20754
MFCD08691358
2,4-DICHLOROTHIAZOLE-5-CARBOXYLIC ACID
CAS:62019-56-1
Formula: O=C(C1=C(Cl)N=C(Cl)S1)O
95+%
BD107432
MFCD09909676
2,4-DICHLOROTHIENO[2,3-D]PYRIMIDINE
CAS:18740-39-1
Formula: ClC1=NC2=C(C(=N1)Cl)C=CS2
98%
BD19044
MFCD09743991
2,4-DICHLOROTHIENO[3,2-D]PYRIMIDINE
CAS:16234-14-3
Formula: ClC1=C2C(C=CS2)=NC(Cl)=N1
95%
BD25036
MFCD08448158
2,4-DICHLOROTHIENO[3,4-D]PYRIMIDINE
CAS:36948-21-7
Formula: ClC1=NC(Cl)=NC2=CSC=C21
95+%
BD315579
MFCD10000792
2,4-DICHLOROTHIOBENZAMIDE
CAS:2775-38-4
Formula: NC(=S)C1=C(Cl)C=C(Cl)C=C1
97%
BD4341
MFCD00173930
2,4-DICYCLOPROPYL-6-(PIPERAZIN-1-YL)PYRIMIDINE
CAS:1713462-67-9
Formula: C1(C2CC2)=NC(N3CCNCC3)=CC(C4CC4)=N1
97%
BD623167
2,4-DICYCLOPROPYLBENZALDEHYDE
CAS:1245645-99-1
Formula: O=CC1=CC=C(C2CC2)C=C1C3CC3
95+%
BD164927
MFCD17677327
2,4-DICYCLOPROPYLTHIAZOLE
CAS:1427014-71-8
Formula: C1(C2CC2)=NC(C3CC3)=CS1
97%
BD616528
2,4-DIETHOXY-1,3-DIFLUORO-5-IODOBENZENE
CAS:1208078-14-1
Formula: FC1=C(OCC)C(F)=C(OCC)C(I)=C1
97%
BD589455
MFCD12547869
2,4-DIETHOXY-1,3-DIFLUORO-5-NITROBENZENE
CAS:1208076-37-2
Formula: FC1=C(OCC)C(F)=C(OCC)C([N+]([O-])=O)=C1
97%
BD589414
MFCD12547870
2,4-DIETHOXY-1-FLUOROBENZENE
CAS:851089-61-7
Formula: CCOC1=CC=C(F)C(OCC)=C1
97%
BD597802
MFCD12547864
2,4-DIETHOXY-6-METHYLPYRIMIDINE
CAS:55816-92-7
Formula: CC1=CC(OCC)=NC(OCC)=N1
96%
BD425845
MFCD00090782
2,4-DIETHOXY-7-METHYLQUINOLINE
CAS:443687-61-4
Formula: CC1C=C2C(C(=CC(=N2)OCC)OCC)=CC=1
95+%
BD00773117
n/a
2,4-DIETHOXYBENZALDEHYDE
CAS:22924-16-9
Formula: O=CC1=CC=C(OCC)C=C1OCC
97%
BD13270
MFCD00995010
2,4-DIETHOXYBENZOIC ACID
CAS:19074-30-7
Formula: O=C(O)C1=CC=C(OCC)C=C1OCC
97%
BD188555
2,4-DIETHOXYPYRIMIDINE
CAS:20461-60-3
Formula: CCOC1=NC(OCC)=NC=C1
95+%
BD262697
MFCD00056029
2,4-DIETHYL 1-BENZYLAZETIDINE-2,4-DICARBOXYLATE
CAS:N/A
Formula: O=C(C1N(CC2=CC=CC=C2)C(C(OCC)=O)C1)OCC
BD00784497
2,4-DIETHYL-6-METHYLBENZENE-1,3-DIAMINE
CAS:2095-02-5
Formula: NC1=C(C)C=C(CC)C(N)=C1CC
95%
BD124778
MFCD00036113
2,4-DIETHYL-6-METHYLBENZENE-1,3-DIAMINE COMPOUND WITH 4,6-DIETHYL-2-METHYLBENZENE-1,3-DIAMINE
CAS:75389-89-8
Formula: NC1=C(CC)C=C(C)C(N)=C1CC.NC2=C(CC)C=C(CC)C(N)=C2C
97%
BD491256
2,4-DIETHYL-9H-THIOXANTHEN-9-ONE
CAS:82799-44-8
Formula: CCC1=CC(CC)=C2SC3=C(C=CC=C3)C(=O)C2=C1
97%
BD17113
MFCD00082910
2,4-DIETHYLBENZENE-1,3,5-TRIOL
CAS:55380-53-5
Formula: OC1=C(CC)C(O)=CC(O)=C1CC
97%
BD00824274
MFCD24715792
2,4-DIETHYLBENZENE-1,3-DIAMINE
CAS:36394-50-0
Formula: CCC1=CC=C(N)C(CC)=C1N
95+%
BD233356
MFCD20712226
2,4-DIETHYLBENZENE-1,3-DIOL
CAS:52959-33-8
Formula: OC1=CC=C(CC)C(O)=C1CC
95+%
BD66824
MFCD06410806
2,4-DIETHYLBENZOIC ACID
CAS:104175-23-7
Formula: O=C(O)C1=CC=C(CC)C=C1CC
97%
BD447977
MFCD20641288
2,4-DIETHYLHEPTAN-1-OL
CAS:80192-55-8
Formula: CCCC(CC)CC(CC)CO
95+%
BD232821
MFCD00009709
2,4-DIETHYLPENTANEDIOIC ACID
CAS:27899-21-4
Formula: O=C(O)C(CC)CC(CC)C(O)=O
97%
BD66829
2,4-DIETHYLPYRIMIDINE
CAS:857990-28-4
Formula: CCC1=NC(CC)=NC=C1
97%
BD317662
MFCD22423156
2,4-DIETHYLPYRIMIDINE-5-CARBOXYLIC ACID
CAS:1306969-40-3
Formula: O=C(C1=CN=C(CC)N=C1CC)O
97%
BD609898
2,4-DIFLUORO-1,1-BIPHENYL
CAS:37847-52-2
Formula: FC1=CC=C(C2=CC=CC=C2)C(F)=C1
97%
BD41642
2,4-DIFLUORO-1,3,5-TRIMETHYLBENZENE
CAS:392-61-0
Formula: CC1=C(F)C(C)=C(F)C(C)=C1
95%
BD285060
MFCD18074339
2,4-DIFLUORO-1-(ISOCYANO(TOSYL)METHYL)BENZENE
CAS:660431-66-3
Formula: O=S(C(C1=CC=C(F)C=C1F)[N+]#[C-])(C2=CC=C(C)C=C2)=O
95+%
BD170781
MFCD07390260
2,4-DIFLUORO-1-(METHYLSULFONYL)BENZENE
CAS:236739-02-9
Formula: O=S(C1=CC=C(F)C=C1F)(C)=O
95+%
BD66898
MFCD03789188
2,4-DIFLUORO-1-(PROP-1-EN-2-YL)BENZENE
CAS:156570-11-5
Formula: C=C(C1=CC=C(F)C=C1F)C
95+%
BD252538
MFCD18825239
2,4-DIFLUORO-1-METHOXYBENZENE
CAS:452-10-8
Formula: COC1=C(F)C=C(F)C=C1
98%
BD66853
MFCD00010731
2,4-DIFLUORO-1-METHYLBENZENE
CAS:452-76-6
Formula: CC1=CC=C(F)C=C1F
97%
BD33690
MFCD00000332
2,4-DIFLUORO-1-NITROBENZENE
CAS:446-35-5
Formula: FC1=CC=C([N+]([O-])=O)C(F)=C1
98%
BD3178
MFCD00007050
2,4-DIFLUORO-1H-INDOLE
CAS:1934422-22-6
Formula: FC1=CC=CC2=C1C=C(F)N2
95+%
BD284583
MFCD24565868
2,4-DIFLUORO-2'-MORPHOLINOMETHYL BENZOPHENONE
CAS:898751-13-8
Formula: O=C(C1=CC=CC=C1CN2CCOCC2)C3=CC=C(F)C=C3F
95+%
BD309993
MFCD03842446
2,4-DIFLUORO-2'-NITRO-1,1'-BIPHENYL
CAS:52798-24-0
Formula: FC1=CC=C(C2=CC=CC=C2[N+]([O-])=O)C(F)=C1
97%
BD438961
MFCD28405047
2,4-DIFLUORO-2'-PIPERIDINOMETHYL BENZOPHENONE
CAS:898773-75-6
Formula: O=C(C1=CC=CC=C1CN2CCCCC2)C3=CC=C(F)C=C3F
95+%
BD311908
MFCD03842503
2,4-DIFLUORO-2'-PYRROLIDINOMETHYL BENZOPHENONE
CAS:898775-03-6
Formula: O=C(C1=CC=CC=C1CN2CCCC2)C3=CC=C(F)C=C3F
95+%
BD312005
MFCD03842560
2,4-DIFLUORO-2'-THIOMORPHOLINOMETHYL BENZOPHENONE
CAS:898782-41-7
Formula: O=C(C1=CC=CC=C1CN2CCSCC2)C3=CC=C(F)C=C3F
95+%
BD312689
MFCD03842787
2,4-DIFLUORO-3'-(1,3-DIOXOLAN-2-YL)BENZOPHENONE
CAS:898759-63-2
Formula: O=C(C1=CC=CC(C2OCCO2)=C1)C3=CC=C(F)C=C3F
95+%
BD310684
MFCD07699989
2,4-DIFLUORO-3'-MORPHOLINOMETHYL BENZOPHENONE
CAS:898792-28-4
Formula: O=C(C1=CC=CC(CN2CCOCC2)=C1)C3=CC=C(F)C=C3F
95+%
BD313612
MFCD03841937
2,4-DIFLUORO-3'-PIPERIDINOMETHYL BENZOPHENONE
CAS:898793-58-3
Formula: O=C(C1=CC=CC(CN2CCCCC2)=C1)C3=CC=C(F)C=C3F
95+%
BD313742
MFCD03841994
2,4-DIFLUORO-3'-PYRROLIDINOMETHYL BENZOPHENONE
CAS:898770-86-0
Formula: O=C(C1=CC=CC(CN2CCCC2)=C1)C3=CC=C(F)C=C3F
95+%
BD311698
MFCD03842051
2,4-DIFLUORO-3'-THIOMORPHOLINOMETHYL BENZOPHENONE
CAS:898787-93-4
Formula: O=C(C1=CC=CC(CN2CCSCC2)=C1)C3=CC=C(F)C=C3F
95+%
BD313200
MFCD03842276
2,4-DIFLUORO-3,5-DIMETHOXYBENZOIC ACID
CAS:1003709-80-5
Formula: COC1=CC(C(O)=O)=C(F)C(OC)=C1F
95%
BD161247
MFCD09839225
2,4-DIFLUORO-3-(TRIFLUOROMETHOXY)ANILINE
CAS:153338-24-0
Formula: NC1=CC=C(F)C(OC(F)(F)F)=C1F
95+%
BD247186
MFCD19440811
2,4-DIFLUORO-3-(TRIFLUOROMETHOXY)BENZOIC ACID
CAS:1119454-13-5
Formula: O=C(O)C1=CC=C(F)C(OC(F)(F)F)=C1F
95+%
BD257997
2,4-DIFLUORO-3-(TRIFLUOROMETHOXY)BENZONITRILE
CAS:1806314-81-7
Formula: N#CC1=CC=C(F)C(OC(F)(F)F)=C1F
97%
BD480672
MFCD28791003
2,4-DIFLUORO-3-(TRIFLUOROMETHYL)BENZALDEHYDE
CAS:134099-30-2
Formula: O=CC1=CC=C(F)C(C(F)(F)F)=C1F
98%
BD294095
MFCD12404958
2,4-DIFLUORO-3-(TRIFLUOROMETHYL)BENZOIC ACID
CAS:157337-81-0
Formula: OC(=O)C1=C(F)C(=C(F)C=C1)C(F)(F)F
98%
BD238807
MFCD12827981
2,4-DIFLUORO-3-(TRIFLUOROMETHYL)BENZONITRILE
CAS:1440535-21-6
Formula: N#CC1=CC=C(F)C(C(F)(F)F)=C1F
96%
BD473602
MFCD24850039
2,4-DIFLUORO-3-(TRIFLUOROMETHYL)BENZYL BROMIDE
CAS:1445995-80-1
Formula: FC(C1=C(F)C(CBr)=CC=C1F)(F)F
97%
BD00787033
2,4-DIFLUORO-3-(TRIFLUOROMETHYL)STYRENE
CAS:1432075-80-3
Formula: C=CC1=CC=C(F)C(C(F)(F)F)=C1F
97%
BD00789327
2,4-DIFLUORO-3-FORMYLBENZONITRILE
CAS:149489-14-5
Formula: N#CC1=CC=C(F)C(C=O)=C1F
98%
BD315311
MFCD09907858
2,4-DIFLUORO-3-HYDROXYBENZALDEHYDE
CAS:192927-69-8
Formula: O=CC1=CC=C(F)C(O)=C1F
95+%
BD223823
2,4-DIFLUORO-3-HYDROXYBENZOIC ACID
CAS:91659-08-4
Formula: OC(=O)C1=C(F)C(O)=C(F)C=C1
95+%
BD23387
MFCD06797839
2,4-DIFLUORO-3-IODOANILINE
CAS:1437316-91-0
Formula: NC1=CC=C(F)C(I)=C1F
97%
BD468954
MFCD28789174
2,4-DIFLUORO-3-IODOPYRIDINE
CAS:837364-88-2
Formula: IC1=C(F)C=CN=C1F
98%
BD165748
MFCD09029861
2,4-DIFLUORO-3-ISOPROPOXYPHENYLBORONIC ACID
CAS:1451390-95-6
Formula: OB(C1=CC=C(F)C(OC(C)C)=C1F)O
98%
BD326668
MFCD19981529
2,4-DIFLUORO-3-METHOXYANILINE
CAS:886499-08-7
Formula: NC1=CC=C(F)C(OC)=C1F
97%
BD293285
n/a
2,4-DIFLUORO-3-METHOXYBENZALDEHYDE
CAS:870837-66-4
Formula: COC1=C(F)C=CC(C=O)=C1F
98+%
BD235640
MFCD04115930
2,4-DIFLUORO-3-METHOXYBENZAMIDE
CAS:479091-06-0
Formula: O=C(N)C1=CC=C(F)C(OC)=C1F
95+%
BD308179
MFCD04115931
2,4-DIFLUORO-3-METHOXYBENZOIC ACID
CAS:178974-97-5
Formula: COC1=C(F)C=CC(C(O)=O)=C1F
98%
BD5928
MFCD02258905
2,4-DIFLUORO-3-METHOXYBENZONITRILE
CAS:220353-20-8
Formula: N#CC1=CC=C(F)C(OC)=C1F
98%
BD10894
MFCD04115932
2,4-DIFLUORO-3-METHOXYBENZOYL CHLORIDE
CAS:221221-11-0
Formula: O=C(Cl)C1=CC=C(F)C(OC)=C1F
95+%
BD319678
MFCD04115933
2,4-DIFLUORO-3-METHOXYBENZYLAMINE
CAS:717094-51-4
Formula: NCC1=CC=C(F)C(OC)=C1F
95+%
BD308643
MFCD04115935
2,4-DIFLUORO-3-METHOXYCINNAMIC ACID
CAS:886499-22-5
Formula: O=C(O)/C=C/C1=CC=C(F)C(OC)=C1F
95+%
BD309526
MFCD04115937
2,4-DIFLUORO-3-METHOXYPHENOL
CAS:886499-27-0
Formula: OC1=CC=C(F)C(OC)=C1F
95+%
BD309527
MFCD04115938
2,4-DIFLUORO-3-METHYL-5-NITROANILINE
CAS:112822-77-2
Formula: NC1=CC([N+]([O-])=O)=C(F)C(C)=C1F
95+%
BD332902
MFCD16620287
2,4-DIFLUORO-3-METHYLANILINE
CAS:76350-70-4
Formula: NC1=CC=C(F)C(C)=C1F
96%
BD247187
MFCD09261073
2,4-DIFLUORO-3-METHYLBENZALDEHYDE
CAS:847502-88-9
Formula: O=CC1=CC=C(F)C(C)=C1F
97%
BD66837
MFCD07777152
2,4-DIFLUORO-3-METHYLBENZENETHIOL
CAS:1349719-15-8
Formula: SC1=CC=C(F)C(C)=C1F
97%
BD460595
MFCD20233354
2,4-DIFLUORO-3-METHYLBENZOIC ACID
CAS:112857-68-8
Formula: FC1=C(C(=O)O)C=CC(=C1C)F
95%
BD41189
MFCD03265223
2,4-DIFLUORO-3-METHYLBENZONITRILE
CAS:847502-87-8
Formula: N#CC1=CC=C(F)C(C)=C1F
95%
BD42055
MFCD07777155
2,4-DIFLUORO-3-METHYLBENZYLAMINE
CAS:847502-90-3
Formula: NCC1=CC=C(F)C(C)=C1F
95%
BD309322
MFCD08275293
2,4-DIFLUORO-3-NITROBENZONITRILE
CAS:1186194-75-1
Formula: N#CC1=CC=C(F)C([N+]([O-])=O)=C1F
95%
BD333191
MFCD11226536
2,4-DIFLUORO-3-NITROPHENOL
CAS:1803809-58-6
Formula: OC1=CC=C(F)C([N+]([O-])=O)=C1F
98%
BD478127
MFCD28790770
2,4-DIFLUORO-3-NITROPYRIDINE
CAS:60186-14-3
Formula: O=[N+](C1=C(F)C=CN=C1F)[O-]
95%
BD251137
2,4-DIFLUORO-4'-(1,3-DIOXOLAN-2-YL)BENZOPHENONE
CAS:898760-76-4
Formula: O=C(C1=CC=C(C2OCCO2)C=C1)C3=CC=C(F)C=C3F
95+%
BD310773
MFCD07700040
2,4-DIFLUORO-4'-MORPHOLINOMETHYL BENZOPHENONE
CAS:898770-65-5
Formula: O=C(C1=CC=C(CN2CCOCC2)C=C1)C3=CC=C(F)C=C3F
95+%
BD311677
MFCD03841425
2,4-DIFLUORO-4'-PIPERIDINOMETHYL BENZOPHENONE
CAS:898775-63-8
Formula: O=C(C1=CC=C(CN2CCCCC2)C=C1)C3=CC=C(F)C=C3F
95+%
BD312061
MFCD03841482
2,4-DIFLUORO-4'-PYRROLIDINOMETHYL BENZOPHENONE
CAS:898776-89-1
Formula: O=C(C1=CC=C(CN2CCCC2)C=C1)C3=CC=C(F)C=C3F
95+%
BD312181
MFCD03841539
2,4-DIFLUORO-4'-THIOMORPHOLINOMETHYL BENZOPHENONE
CAS:898783-20-5
Formula: O=C(C1=CC=C(CN2CCSCC2)C=C1)C3=CC=C(F)C=C3F
95+%
BD312765
MFCD03841766
2,4-DIFLUORO-5-(TRIFLUOROMETHOXY)ANILINE
CAS:123572-59-8
Formula: NC1=CC(OC(F)(F)F)=C(F)C=C1F
97%
BD227880
2,4-DIFLUORO-5-(TRIFLUOROMETHYL)ANILINE
CAS:261944-56-3
Formula: NC1=CC(C(F)(F)F)=C(F)C=C1F
97%
BD4238
MFCD01631613
2,4-DIFLUORO-5-(TRIFLUOROMETHYL)BENZALDEHYDE
CAS:134099-31-3
Formula: O=CC1=CC(C(F)(F)F)=C(F)C=C1F
97%
BD00773370
2,4-DIFLUORO-5-(TRIFLUOROMETHYL)BENZOIC ACID
CAS:261945-01-1
Formula: O=C(O)C1=CC(C(F)(F)F)=C(F)C=C1F
97%
BD00806531
2,4-DIFLUORO-5-(TRIFLUOROMETHYL)BENZONITRILE
CAS:261945-18-0
Formula: N#CC1=CC(C(F)(F)F)=C(F)C=C1F
97%
BD488122
MFCD01631621
2,4-DIFLUORO-5-(TRIFLUOROMETHYL)BENZYL ALCOHOL
CAS:1936257-01-0
Formula: FC(C1=C(F)C=C(F)C(CO)=C1)(F)F
97%
BD00776803
2,4-DIFLUORO-5-(TRIFLUOROMETHYL)BENZYL BROMIDE
CAS:1934665-18-5
Formula: FC(C1=C(F)C=C(F)C(CBr)=C1)(F)F
97%
BD00799888
2,4-DIFLUORO-5-FORMYLBENZONITRILE
CAS:633327-10-3
Formula: N#CC1=CC(C=O)=C(F)C=C1F
95+%
BD294806
MFCD19440211
2,4-DIFLUORO-5-IODOANISOLE
CAS:1936250-49-5
Formula: COC1=CC(I)=C(F)C=C1F
97%
BD00794868
2,4-DIFLUORO-5-IODOBENZALDEHYDE
CAS:1097626-30-6
Formula: O=CC1=CC(I)=C(F)C=C1F
97%
BD454147
MFCD28789181
2,4-DIFLUORO-5-IODOBENZOIC ACID
CAS:161531-51-7
Formula: OC(=O)C1=C(F)C=C(F)C(I)=C1
95+%
BD236566
MFCD11226506
2,4-DIFLUORO-5-IODOBENZONITRILE
CAS:1803837-32-2
Formula: N#CC1=CC(I)=C(F)C=C1F
97%
BD454496
MFCD28789209
2,4-DIFLUORO-5-IODOBENZYL BROMIDE
CAS:2022670-54-6
Formula: IC1=C(F)C=C(F)C(CBr)=C1
97%
BD00792607
2,4-DIFLUORO-5-IODOPHENOL
CAS:1935521-44-0
Formula: OC1=CC(I)=C(F)C=C1F
97%
BD00772118
2,4-DIFLUORO-5-IODOPYRIDINE
CAS:837364-89-3
Formula: IC1=CN=C(F)C=C1F
95+%
BD218292
MFCD09029864
2,4-DIFLUORO-5-METHOXYANILINE
CAS:98446-51-6
Formula: NC1=CC(OC)=C(F)C=C1F
95+%
BD196773
MFCD08689699
2,4-DIFLUORO-5-METHOXYBENZALDEHYDE
CAS:177034-25-2
Formula: O=CC1=CC(OC)=C(F)C=C1F
95%
BD317437
MFCD24539280
2,4-DIFLUORO-5-METHOXYPHENYLBORONIC ACID
CAS:1395417-65-8
Formula: OB(C1=CC(OC)=C(F)C=C1F)O
98%
BD326378
MFCD21609510
2,4-DIFLUORO-5-METHYLANILINE
CAS:1378579-56-6
Formula: NC1=CC(C)=C(F)C=C1F
97%
BD443392
MFCD14583001
2,4-DIFLUORO-5-METHYLBENZALDEHYDE
CAS:315204-36-5
Formula: CC1=CC(C=O)=C(F)C=C1F
95+%
BD228204
MFCD12196967
2,4-DIFLUORO-5-METHYLBENZOIC ACID
CAS:367954-99-2
Formula: FC1=C(C(=O)O)C=C(C(=C1)F)C
97%
BD42232
MFCD09835285
2,4-DIFLUORO-5-METHYLBENZONITRILE
CAS:329314-68-3
Formula: CC1=CC(C#N)=C(F)C=C1F
98%
BD41602
MFCD09835341
2,4-DIFLUORO-5-METHYLPYRIMIDINE
CAS:96548-89-9
Formula: CC1=CN=C(F)N=C1F
97%
BD553240
2,4-DIFLUORO-5-NITROANILINE
CAS:123344-02-5
Formula: NC1=CC([N+]([O-])=O)=C(F)C=C1F
98%
BD257853
MFCD04038395
2,4-DIFLUORO-5-NITROBENZENESULFONYL CHLORIDE
CAS:1780-83-2
Formula: O=S(C1=CC([N+]([O-])=O)=C(F)C=C1F)(Cl)=O
95+%
BD326886
MFCD06655595
2,4-DIFLUORO-5-NITROBENZOIC ACID
CAS:153775-33-8
Formula: OC(=O)C1=C(F)C=C(F)C(=C1)[N+]([O-])=O
97%
BD66843
MFCD04115713
2,4-DIFLUORO-5-NITROBENZONITRILE
CAS:67152-20-9
Formula: [O-][N+](=O)C1=CC(C#N)=C(F)C=C1F
98%
BD66845
MFCD07772030
2,4-DIFLUORO-5-NITROPHENOL
CAS:113512-57-5
Formula: OC1=CC([N+]([O-])=O)=C(F)C=C1F
97%
BD226145
2,4-DIFLUORO-5-NITROPHENYL PROPIONATE
CAS:924868-80-4
Formula: CCC(OC1=CC([N+]([O-])=O)=C(F)C=C1F)=O
97%
BD199664
MFCD08443941
2,4-DIFLUORO-5-NITROPYRIDINE
CAS:60186-15-4
Formula: [O-][N+](=O)C1=CN=C(F)C=C1F
96%
BD216512
MFCD18802741
2,4-DIFLUORO-5-NITROTOLUENE
CAS:179011-38-2
Formula: O=[N+](C1=C(F)C=C(F)C(C)=C1)[O-]
96%
BD256790
2,4-DIFLUORO-6-((2-FLUORO-4-IODOPHENYL)AMINO)BENZOIC ACID
CAS:934665-14-2
Formula: O=C(O)C1=C(NC2=CC=C(I)C=C2F)C=C(F)C=C1F
95+%
BD269711
2,4-DIFLUORO-6-((TRIMETHYLSILYL)ETHYNYL)ANILINE
CAS:684250-21-3
Formula: NC1=C(C#C[Si](C)(C)C)C=C(F)C=C1F
95+%
BD241342
2,4-DIFLUORO-6-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)ANILINE
CAS:1415568-78-3
Formula: NC1=C(B2OC(C)(C)C(C)(C)O2)C=C(F)C=C1F
95%
BD329681
MFCD28291811
2,4-DIFLUORO-6-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PHENOL
CAS:1451391-16-4
Formula: OC1=C(B2OC(C)(C)C(C)(C)O2)C=C(F)C=C1F
98%
BD326670
MFCD16996285
2,4-DIFLUORO-6-HYDROXYBENZALDEHYDE
CAS:136516-64-8
Formula: O=CC1=C(O)C=C(F)C=C1F
97%
BD212993
MFCD03701048
2,4-DIFLUORO-6-HYDROXYBENZOIC ACID
CAS:189283-54-3
Formula: O=C(O)C1=C(O)C=C(F)C=C1F
96%
BD244177
MFCD06203215
2,4-DIFLUORO-6-HYDROXYBENZONITRILE
CAS:1261793-35-4
Formula: N#CC1=C(O)C=C(F)C=C1F
97%
BD449811
MFCD18394850
2,4-DIFLUORO-6-IODOANILINE
CAS:582319-15-1
Formula: NC1=C(F)C=C(F)C=C1I
95+%
BD238834
MFCD08059536
2,4-DIFLUORO-6-IODOPHENOL
CAS:551002-42-7
Formula: OC1=C(I)C=C(F)C=C1F
95+%
BD304200
2,4-DIFLUORO-6-METHOXYBENZALDEHYDE
CAS:608515-57-7
Formula: O=CC1=C(OC)C=C(F)C=C1F
95%
BD334768
MFCD20486219
2,4-DIFLUORO-6-METHOXYBENZONITRILE
CAS:1240518-41-5
Formula: N#CC1=C(OC)C=C(F)C=C1F
95%
BD469695
MFCD20486220
2,4-DIFLUORO-6-METHYLPYRIDINE
CAS:83261-73-8
Formula: CC1=CC(F)=CC(F)=N1
95+%
BD241270
2,4-DIFLUORO-6-METHYLPYRIMIDINE
CAS:696-80-0
Formula: CC1N=C(F)N=C(F)C=1
95+%
BD00753248
n/a
2,4-DIFLUORO-6-NITROANILINE
CAS:364-30-7
Formula: NC1=C(F)C=C(F)C=C1[N+]([O-])=O
98%
BD66847
MFCD00034058
2,4-DIFLUORO-6-NITROPHENOL
CAS:364-31-8
Formula: OC1=C([N+]([O-])=O)C=C(F)C=C1F
97%
BD3180
MFCD03094186
2,4-DIFLUORO-BENZENEPROPANAMINE
CAS:377084-64-5
Formula: NCCCC1=CC=C(F)C=C1F
95%
BD00772443
2,4-DIFLUORO-D-HOMOPHENYLALANINE
CAS:1260608-31-8
Formula: N[C@H](CCC1=CC=C(F)C=C1F)C(O)=O
95%
BD00775013
2,4-DIFLUORO-L-HOMOPHENYLALANINE
CAS:1260593-30-3
Formula: N[C@@H](CCC1=CC=C(F)C=C1F)C(O)=O
95%
BD00793712
2,4-DIFLUORO-N,N-DIMETHYLANILINE
CAS:78409-21-9
Formula: CN(C)C1=CC=C(F)C=C1F
95+%
BD66883
MFCD04116330
2,4-DIFLUORO-N-(2-METHOXY-5-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PYRIDIN-3-YL)BENZENESULFONAMIDE
CAS:1083326-73-1
Formula: O=S(C1=CC=C(F)C=C1F)(NC2=CC(B3OC(C)(C)C(C)(C)O3)=CN=C2OC)=O
95+%
BD252539
MFCD12923393
2,4-DIFLUORO-N-(2-NITROPHENYL)ANILINE
CAS:500302-20-5
Formula: O=[N+](C1=CC=CC=C1NC2=CC=C(F)C=C2F)[O-]
95+%
BD334467
MFCD10567165
2,4-DIFLUORO-N-ISOPROPYLANILINE
CAS:124703-94-2
Formula: CC(NC1=CC=C(F)C=C1F)C
95%
BD00836357
2,4-DIFLUORO-N-METHOXY-N-METHYLBENZAMIDE
CAS:198967-25-8
Formula: CON(C)C(=O)C1=C(F)C=C(F)C=C1
96%
BD66885
MFCD02684298
2,4-DIFLUORO-N-METHYLANILINE
CAS:138564-16-6
Formula: CNC1=CC=C(F)C=C1F
96%
BD66886
MFCD00042472
2,4-DIFLUORO-N-METHYLANILINE HYDROCHLORIDE
CAS:1187386-15-7
Formula: CNC1=CC=C(F)C=C1F.[H]Cl
98%
BD255848
MFCD11110410
2,4-DIFLUORO-PHENYLTHIOACETIC ACID
CAS:773108-57-9
Formula: OC(CC1=CC=C(F)C=C1F)=S
95+%
BD324176
MFCD06208194
2,4-DIFLUOROANILINE
CAS:367-25-9
Formula: NC1=CC=C(F)C=C1F
97%
BD3382
MFCD00007648
2,4-DIFLUOROBENZALDEHYDE
CAS:1550-35-2
Formula: O=CC1=CC=C(F)C=C1F
96%
BD32080
MFCD00010326
2,4-DIFLUOROBENZALDEHYDE OXIME
CAS:247092-11-1
Formula: FC1=CC=C(C(F)=C1)/C=N/O
95+%
BD66855
MFCD03265384
2,4-DIFLUOROBENZAMIDE
CAS:85118-02-1
Formula: O=C(N)C1=CC=C(F)C=C1F
98%
BD10358
MFCD00015547
2,4-DIFLUOROBENZAMIDOXIME
CAS:883022-90-0
Formula: N/C(C1=CC=C(F)C=C1F)=N\O
95+%
BD309438
MFCD05864461
2,4-DIFLUOROBENZENE-1,3-DIOL
CAS:195136-71-1
Formula: OC1=CC=C(F)C(O)=C1F
95%
BD66903
MFCD09836234
2,4-DIFLUOROBENZENE-1-SULFONYL CHLORIDE
CAS:13918-92-8
Formula: O=S(C1=CC=C(F)C=C1F)(Cl)=O
98%
BD3152
MFCD00042481
2,4-DIFLUOROBENZENESULFONAMIDE
CAS:13656-60-5
Formula: O=S(C1=CC=C(F)C=C1F)(N)=O
97%
BD66858
MFCD01320743
2,4-DIFLUOROBENZIMIDAMIDE
CAS:885957-21-1
Formula: N=C(N)C1=CC=C(F)C=C1F
95+%
BD259443
MFCD05662976
2,4-DIFLUOROBENZIMIDAMIDE HYDROCHLORIDE
CAS:1170536-00-1
Formula: N=C(C1=CC=C(F)C=C1F)N.[H]Cl
98%
BD492926
2,4-DIFLUOROBENZOHYDRAZIDE
CAS:118737-62-5
Formula: O=C(NN)C1=CC=C(F)C=C1F
98%
BD4623
MFCD00173685
2,4-DIFLUOROBENZOIC ACID
CAS:1583-58-0
Formula: C1=CC(=CC(=C1C(O)=O)F)F
98%
BD4216
MFCD00011670
2,4-DIFLUOROBENZONITRILE
CAS:3939-09-1
Formula: FC1=CC(F)=C(C#N)C=C1
98%
BD66862
MFCD00009826
2,4-DIFLUOROBENZOTHIOAMIDE
CAS:175276-92-3
Formula: S=C(N)C1=CC=C(F)C=C1F
95+%
BD66904
MFCD00085011
2,4-DIFLUOROBENZOYL CHLORIDE
CAS:72482-64-5
Formula: O=C(Cl)C1=CC=C(F)C=C1F
98%
BD34742
MFCD00000658
2,4-DIFLUOROBENZYL ALCOHOL
CAS:56456-47-4
Formula: OCC1=CC=C(F)C=C1F
96%
BD10444
MFCD00009983
2,4-DIFLUOROBENZYLSULFONAMIDE
CAS:1001026-56-7
Formula: O=S(CC1=CC=C(F)C=C1F)(N)=O
95+%
BD322269
MFCD09800677
2,4-DIFLUOROIODOBENZENE
CAS:2265-93-2
Formula: IC1=CC=C(F)C=C1F
98%
BD9775
MFCD00040151
2,4-DIFLUORONICOTINALDEHYDE
CAS:1227564-60-4
Formula: O=CC1=C(F)N=CC=C1F
95+%
BD260322
MFCD16610838
2,4-DIFLUORONICOTINAMIDE
CAS:1823943-65-2
Formula: O=C(N)C1=C(F)N=CC=C1F
95+%
BD260325
2,4-DIFLUORONICOTINIC ACID
CAS:849937-90-2
Formula: O=C(O)C1=C(F)N=CC=C1F
95+%
BD261929
MFCD09031030
2,4-DIFLUORONICOTINONITRILE
CAS:1807275-54-2
Formula: N#CC1=C(F)N=CC=C1F
95+%
BD260326
2,4-DIFLUOROPHENETHYL BROMIDE
CAS:214618-54-9
Formula: FC1=CC=C(C(F)=C1)CCBr
95%
BD00791837
2,4-DIFLUOROPHENOL
CAS:367-27-1
Formula: OC1=CC=C(F)C=C1F
98%
BD33414
MFCD00009715
2,4-DIFLUOROPHENYL 4-(CHLOROMETHYL)BENZOATE
CAS:219500-09-1
Formula: O=C(OC1=CC=C(F)C=C1F)C2=CC=C(CCl)C=C2
97%
BD66889
2,4-DIFLUOROPHENYL ACETATE
CAS:36914-77-9
Formula: FC1=CC=C(OC(C)=O)C(F)=C1
97%
BD492008
2,4-DIFLUOROPHENYLACETIC ACID
CAS:81228-09-3
Formula: O=C(O)CC1=CC=C(F)C=C1F
98%
BD5919
MFCD00009999
2,4-DIFLUOROPHENYLACETYL CHLORIDE
CAS:141060-00-6
Formula: O=C(Cl)CC1=CC=C(F)C=C1F
95%
BD323214
MFCD08458139
2,4-DIFLUOROPHENYLBORONIC ACID
CAS:144025-03-6
Formula: C1=C(F)C=CC(=C1F)B(O)O
97%
BD9873
MFCD01318998
2,4-DIFLUOROPHENYLSULFONYLETHANOL
CAS:688763-15-7
Formula: OCCS(=O)(C1=CC=C(F)C=C1F)=O
95+%
BD324066
MFCD03789227
2,4-DIFLUOROPHENYLTHIOETHANOL
CAS:688762-79-0
Formula: OCCSC1=CC=C(F)C=C1F
95+%
BD324061
MFCD03789207
2,4-DIFLUOROPYRIDIN-3(4H)-IMINE
CAS:1211528-95-8
Formula: N=C1C(F)=NC=CC1F
97%
BD586228
2,4-DIFLUOROPYRIDINE
CAS:34941-90-7
Formula: FC1=CC(F)=NC=C1
98%
BD41622
MFCD04114162
2,4-DIFLUOROTHIOPHENOL
CAS:1996-44-7
Formula: SC1=CC=C(F)C=C1F
97%
BD32511
MFCD00203477
2,4-DIHYDRO-5-(4-FLUOROPHENYL)-2-PHENYL-3H-PYRAZOL-3-ONE
CAS:575455-54-8
Formula: O=C1N(C2=CC=CC=C2)N=C(C3=CC=C(F)C=C3)C1
95+%
BD163305
MFCD09749464
2,4-DIHYDRO-5-(4-METHOXYPHENYL)-2-PHENYL-3H-PYRAZOL-3-ONE
CAS:454439-84-0
Formula: O=C1N(C2=CC=CC=C2)N=C(C3=CC=C(OC)C=C3)C1
95+%
BD163281
MFCD07809087
2,4-DIHYDROCHROMENO[4,3-C]PYRAZOLE
CAS:74618-03-4
Formula: C12=NNC=C1COC3=C2C=CC=C3
95+%
BD200276
2,4-DIHYDROCHROMENO[4,3-C]PYRAZOLE-3-CARBOXYLIC ACID
CAS:909091-78-7
Formula: O=C(C1=C(COC2=C3C=CC=C2)C3=NN1)O
95+%
BD316082
MFCD27982009
2,4-DIHYDROXY-3,3-DIMETHYLBUTANAMIDE
CAS:4417-86-1
Formula: O=C(N)C(O)C(C)(C)CO
95+%
BD66916
2,4-DIHYDROXY-3,6-DIMETHYLBENZOIC ACID
CAS:4707-46-4
Formula: CC1=CC(O)=C(C)C(O)=C1C(O)=O
95+%
BD66917
MFCD00239340
2,4-DIHYDROXY-3-(MORPHOLINOMETHYL)BENZALDEHYDE
CAS:917514-52-4
Formula: O=CC1=CC=C(O)C(CN2CCOCC2)=C1O
97%
BD604987
MFCD19103280
2,4-DIHYDROXY-3-ISOPROPYLBENZALDEHYDE
CAS:1629140-42-6
Formula: O=CC1=CC=C(O)C(C(C)C)=C1O
97%
BD440318
MFCD26406914
2,4-DIHYDROXY-3-METHOXYBENZALDEHYDE
CAS:58922-29-5
Formula: O=CC1=CC=C(O)C(OC)=C1O
97%
BD626366
MFCD19301266
2,4-DIHYDROXY-3-METHYLBENZALDEHYDE
CAS:6248-20-0
Formula: C1=CC(=C(C(=C1C=O)O)C)O
98%
BD21858
MFCD00156883
2,4-DIHYDROXY-3-METHYLBENZOHYDRAZIDE
CAS:1142211-15-1
Formula: O=C(NN)C1=CC=C(O)C(C)=C1O
95+%
BD177224
2,4-DIHYDROXY-3-NITROPYRIDINE
CAS:89282-12-2
Formula: OC1=NC=CC(=C1[N+](=O)[O-])O
98%
BD66923
MFCD01075671
2,4-DIHYDROXY-5,6,7,8-TETRAHYDROQUINAZOLINE-6-CARBOXYLIC ACID
CAS:5439-88-3
Formula: O=C(C1CC2=C(O)N=C(O)N=C2CC1)O
95+%
BD335741
MFCD23378423
2,4-DIHYDROXY-5,6-DIMETHYLPYRIMIDINE
CAS:26305-13-5
Formula: CC1=C(NC(=O)NC1=O)C
97%
BD101766
MFCD00010708
2,4-DIHYDROXY-5-IODOBENZALDEHYDE
CAS:131088-03-4
Formula: O=CC1=CC(I)=C(O)C=C1O
95+%
BD265339
2,4-DIHYDROXY-5-ISOPROPYLBENZODITHIOIC ACID
CAS:1046490-81-6
Formula: SC(C1=CC(C(C)C)=C(O)C=C1O)=S
97%
BD450110
MFCD27976457
2,4-DIHYDROXY-5-ISOPROPYLBENZOIC ACID
CAS:1184181-48-3
Formula: O=C(O)C1=CC(C(C)C)=C(O)C=C1O
97%
BD304287
MFCD16996083
2,4-DIHYDROXY-5-METHOXYBENZALDEHYDE
CAS:51061-83-7
Formula: O=CC1=CC(OC)=C(O)C=C1O
95+%
BD267132
2,4-DIHYDROXY-5-METHOXYPYRIMIDINE
CAS:6623-81-0
Formula: COC1=CNC(=O)NC1=O
96%
BD2750
MFCD00187903
2,4-DIHYDROXY-5-METHYLBENZALDEHYDE
CAS:39828-37-0
Formula: O=CC1=CC(C)=C(O)C=C1O
95%
BD691876
2,4-DIHYDROXY-5-NITROBENZALDEHYDE
CAS:53844-98-7
Formula: O=CC1=CC([N+]([O-])=O)=C(O)C=C1O
97%
BD66931
2,4-DIHYDROXY-5-NITROBENZOIC ACID
CAS:13722-96-8
Formula: O=C(O)C1=CC([N+]([O-])=O)=C(O)C=C1O
95+%
BD233869
MFCD08693128
2,4-DIHYDROXY-6-METHOXYQUINOLINE
CAS:14300-45-9
Formula: OC2=NC1=CC=C(C=C1C(=C2)O)OC
97%
BD31915
MFCD01463812
2,4-DIHYDROXY-6-METHYLBENZALDEHYDE
CAS:487-69-4
Formula: O=CC1=C(C)C=C(O)C=C1O
98%
BD227235
2,4-DIHYDROXY-6-METHYLNICOTINAMIDE
CAS:68373-65-9
Formula: O=C(N)C1=C(O)N=C(C)C=C1O
95+%
BD248716
2,4-DIHYDROXY-6-METHYLNICOTINIC ACID
CAS:846557-80-0
Formula: O=C(O)C1=C(O)N=C(C)C=C1O
96%
BD66938
MFCD06657553
2,4-DIHYDROXY-6-METHYLNICOTINONITRILE
CAS:67643-17-8
Formula: N#CC1=C(O)N=C(C)C=C1O
95%
BD335015
MFCD11847535
2,4-DIHYDROXY-6-METHYLPYRIMIDINE-5-CARBOXYLIC ACID
CAS:51622-67-4
Formula: O=C(C1=C(C)N=C(O)N=C1O)O
95+%
BD284687
MFCD18449364
2,4-DIHYDROXY-6-TRIFLUOROMETHYLPYRIMIDINE
CAS:672-45-7
Formula: O=C1NC(=CC(=O)N1)C(F)(F)F
95+%
BD2556
MFCD01011762
2,4-DIHYDROXY-7-METHYLQUINOLINE-3-CARBOXYLIC ACID
CAS:N/A
Formula: O=C(O)C1C(O)=NC2C(=CC=C(C=2)C)C=1O
95%
BD00761366
2,4-DIHYDROXY-N-(2-HYDROXYETHYL)BENZAMIDE
CAS:24207-41-8
Formula: O=C(NCCO)C1=CC=C(O)C=C1O
95+%
BD6856
MFCD00002835
2,4-DIHYDROXYACETOPHENONE
CAS:89-84-9
Formula: CC(C1=CC=C(O)C=C1O)=O
98%
BD40444
MFCD00002279
2,4-DIHYDROXYBENZALDEHYDE
CAS:95-01-2
Formula: O=CC1=CC=C(O)C=C1O
98%
BD35500
MFCD00011686
2,4-DIHYDROXYBENZALDEHYDE OXIME
CAS:5399-68-8
Formula: OC1=CC=C(C(O)=C1)/C=N/O
97%
BD66945
MFCD00016410
2,4-DIHYDROXYBENZAMIDE
CAS:3147-45-3
Formula: NC(=O)C1=C(O)C=C(O)C=C1
98%
BD7921
MFCD00064913
2,4-DIHYDROXYBENZOHYDRAZIDE
CAS:13221-86-8
Formula: O=C(NN)C1=CC=C(O)C=C1O
95%
BD66948
MFCD00017053
2,4-DIHYDROXYBENZOIC ACID
CAS:89-86-1
Formula: O=C(O)C1=CC=C(O)C=C1O
98%
BD23045
MFCD00002451
2,4-DIHYDROXYBENZONITRILE
CAS:64419-24-5
Formula: N#CC1=CC=C(O)C=C1O
98%
BD10392
2,4-DIHYDROXYBUTANOIC ACID
CAS:1518-62-3
Formula: O=C(O)C(O)CCO
95+%
BD224160
2,4-DIHYDROXYISOPHTHALALDEHYDE
CAS:3328-71-0
Formula: O=CC1=CC=C(O)C(C=O)=C1O
95+%
BD66947
MFCD09032324
2,4-DIHYDROXYPROPIOPHENONE
CAS:5792-36-9
Formula: CCC(C1=CC=C(O)C=C1O)=O
97+%
BD66960
MFCD00002280
2,4-DIHYDROXYPYRIDO[3,2-D]PYRIMIDINE
CAS:37538-68-4
Formula: OC1=NC2=C(N=CC=C2)C(O)=N1
95%
BD162889
MFCD18070985
2,4-DIHYDROXYPYRIMIDINE-5-CARBOXYLIC ACID
CAS:23945-44-0
Formula: O=C(C1=CN=C(O)N=C1O)O
97%
BD156181
MFCD00075737
2,4-DIHYDROXYQUINAZOLINE-5-CARBONITRILE
CAS:1823958-91-3
Formula: N#CC1=CC=CC2=NC(O)=NC(O)=C12
95+%
BD260168
2,4-DIHYDROXYQUINAZOLINE-6-CARBONITRILE
CAS:1334331-27-9
Formula: N#CC1=CC2=C(O)N=C(O)N=C2C=C1
95+%
BD260506
2,4-DIHYDROXYQUINAZOLINE-7-CARBOXYLIC ACID
CAS:864293-00-5
Formula: O=C(C1=CC2=NC(O)=NC(O)=C2C=C1)O
95+%
BD167394
MFCD11868316
2,4-DIHYDROXYQUINOLINE-3-CARBALDEHYDE
CAS:529-89-5
Formula: O=CC1=C(O)C2=CC=CC=C2N=C1O
97%
BD66918
2,4-DIIODO-1-METHYL-1H-IMIDAZOLE
CAS:71794-53-1
Formula: CN1C=C(I)N=C1I
96%
BD269512
2,4-DIIODO-1H-IMIDAZOLE
CAS:19198-80-2
Formula: IC1=CNC(I)=N1
95+%
BD66965
MFCD09800593
2,4-DIIODO-3-METHYLANILINE
CAS:860751-94-6
Formula: NC1=CC=C(I)C(C)=C1I
95+%
BD281774
2,4-DIIODO-5-METHOXYANILINE
CAS:117832-18-5
Formula: NC1=CC(OC)=C(I)C=C1I
95+%
BD296236
MFCD13186706
2,4-DIIODO-5-METHYLANILINE
CAS:117832-10-7
Formula: NC1=CC(C)=C(I)C=C1I
95+%
BD281773
2,4-DIIODO-6-METHYLANILINE
CAS:117832-09-4
Formula: NC1=C(C)C=C(I)C=C1I
95+%
BD66966
MFCD09033135
2,4-DIIODO-6-METHYLNICOTINONITRILE
CAS:1823894-28-5
Formula: N#CC1=C(I)N=C(C)C=C1I
95+%
BD279637
2,4-DIIODOANILINE
CAS:533-70-0
Formula: NC1=CC=C(I)C=C1I
95+%
BD33985
MFCD01851096
2,4-DIIODONICOTINONITRILE
CAS:827616-54-6
Formula: N#CC1=C(I)N=CC=C1I
95+%
BD66969
MFCD09037454
2,4-DIIODOOXAZOLE
CAS:1037597-73-1
Formula: IC1=COC(I)=N1
97%
BD225793
MFCD18785731
2,4-DIIODOPYRIDIN-3-OL
CAS:750638-97-2
Formula: OC1=C(I)C=CN=C1I
95+%
BD248539
2,4-DIIODOPYRIDINE
CAS:83674-71-9
Formula: IC1=CC(I)=NC=C1
95+%
BD66968
MFCD07437917
2,4-DIIODOPYRIMIDINE
CAS:262353-34-4
Formula: IC1=NC=CC(=N1)I
95+%
BD159560
MFCD09743716
2,4-DIISOPROPYLBENZENE-1,3-DIAMINE
CAS:133681-71-7
Formula: NC1=CC=C(C(C)C)C(N)=C1C(C)C
95+%
BD233318
MFCD20701825
2,4-DIISOPROPYLDIBENZO[B,D]FURAN-3-AMINE
CAS:1332881-95-4
Formula: NC1=C(C(C)C)C=C2C(OC3=CC=CC=C23)=C1C(C)C
95+%
BD262615
2,4-DIISOPROPYLPHENOL
CAS:2934-05-6
Formula: OC1=CC=C(C(C)C)C=C1C(C)C
95+%
BD66971
MFCD01707536
2,4-DIMETHANESULFONYLBENZONITRILE
CAS:1951441-77-2
Formula: N#CC1=CC=C(S(=O)(C)=O)C=C1S(=O)(C)=O
95%
BD00799975
2,4-DIMETHOXY-1,3,5-TRIAZINE
CAS:1898-72-2
Formula: COC1=NC=NC(OC)=N1
97%
BD582437
MFCD20257908
2,4-DIMETHOXY-1-(2-NITROVINYL)BENZENE
CAS:1891-10-7
Formula: O=[N+](/C=C/C1=CC=C(OC)C=C1OC)[O-]
95+%
BD0115
MFCD00015922
2,4-DIMETHOXY-1-FLUOROBENZENE
CAS:17715-70-7
Formula: FC1=CC=C(OC)C=C1OC
98%
BD66973
MFCD00042265
2,4-DIMETHOXY-1-METHYLBENZENE
CAS:38064-90-3
Formula: CC1=CC=C(OC)C=C1OC
97%
BD67024
2,4-DIMETHOXY-1-NAPHTHALDEHYDE
CAS:75965-84-3
Formula: O=CC1=C2C=CC=CC2=C(OC)C=C1OC
97%
BD571483
2,4-DIMETHOXY-1-NITROBENZENE
CAS:4920-84-7
Formula: COC1=CC(OC)=C(C=C1)[N+]([O-])=O
98%
BD66974
MFCD00024210
2,4-DIMETHOXY-3-METHYL-5-NITROANILINE
CAS:704877-30-5
Formula: NC1=CC([N+]([O-])=O)=C(OC)C(C)=C1OC
97%
BD177225
MFCD05858391
2,4-DIMETHOXY-3-METHYLBENZALDEHYDE
CAS:7149-92-0
Formula: O=CC1=CC=C(OC)C(C)=C1OC
97%
BD12038
2,4-DIMETHOXY-3-NITROPYRIDINE
CAS:18677-44-6
Formula: O=[N+](C1=C(OC)C=CN=C1OC)[O-]
97%
BD483830
MFCD00971984
2,4-DIMETHOXY-3-OXO-N-PHENYLBUTANAMIDE
CAS:16715-79-0
Formula: O=C(NC1=CC=CC=C1)C(OC)C(COC)=O
95%
BD66989
2,4-DIMETHOXY-5,6-DIMETHYLPYRIMIDINE
CAS:120129-83-1
Formula: COC1=NC(OC)=C(C)C(C)=N1
95+%
BD232674
2,4-DIMETHOXY-5-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PYRIDINE
CAS:2223053-94-7
Formula: CC1(C)C(C)(C)OB(C2=CN=C(OC)C=C2OC)O1
97%
BD00820921
n/a
2,4-DIMETHOXY-5-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PYRIMIDINE
CAS:936250-17-8
Formula: CC1(C)C(C)(C)OB(C2=CN=C(OC)N=C2OC)O1
96%
BD66982
MFCD06795654
2,4-DIMETHOXY-5-METHYLPYRIMIDINE
CAS:5151-34-8
Formula: CC1=CN=C(OC)N=C1OC
95+%
BD60588
MFCD03424272
2,4-DIMETHOXY-5-NITROBENZOIC ACID
CAS:90564-41-3
Formula: O=C(O)C1=CC([N+]([O-])=O)=C(OC)C=C1OC
98%
BD262474
MFCD12173036
2,4-DIMETHOXY-5-NITROPYRIDINE
CAS:607373-84-2
Formula: O=[N+](C1=CN=C(OC)C=C1OC)[O-]
97%
BD220993
MFCD09907962
2,4-DIMETHOXY-5-NITROPYRIMIDINE
CAS:30561-07-0
Formula: O=[N+](C1=CN=C(OC)N=C1OC)[O-]
97%
BD517154
MFCD00726922
2,4-DIMETHOXY-5-PHENYLPYRIMIDINE
CAS:685866-81-3
Formula: COC1=NC(OC)=NC=C1C2=CC=CC=C2
98%
BD583200
MFCD18074208
2,4-DIMETHOXY-5H-PYRROLO[3,2-D]PYRIMIDINE
CAS:84538-40-9
Formula: COC1=NC2=C(NC=C2)C(OC)=N1
98%
BD218317
MFCD12406107
2,4-DIMETHOXY-6-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)BENZALDEHYDE
CAS:1265360-45-9
Formula: O=CC1=C(B2OC(C)(C)C(C)(C)O2)C=C(OC)C=C1OC
98%
BD239700
MFCD22192538
2,4-DIMETHOXY-6-(PIPERAZIN-1-YL)PYRIMIDINE
CAS:38539-75-2
Formula: COC1=NC(OC)=NC(N2CCNCC2)=C1
97%
BD625108
2,4-DIMETHOXY-6-(TRIFLUOROMETHYL)PYRIDINE
CAS:1227588-22-8
Formula: FC(C1=CC(OC)=CC(OC)=N1)(F)F
97%
BD480186
MFCD16610905
2,4-DIMETHOXY-6-(TRIFLUOROMETHYL)PYRIMIDINE
CAS:76513-87-6
Formula: FC(C1=CC(OC)=NC(OC)=N1)(F)F
95+%
BD260009
2,4-DIMETHOXY-6-METHYL-5-NITROPYRIMIDINE
CAS:30561-09-2
Formula: O=[N+]([O-])C1C(OC)=NC(OC)=NC=1C
95+%
BD00702549
n/a
2,4-DIMETHOXY-6-METHYLBENZALDEHYDE
CAS:7149-90-8
Formula: O=CC1=C(C)C=C(OC)C=C1OC
97%
BD12039
2,4-DIMETHOXY-6-METHYLNICOTINONITRILE
CAS:1450662-05-1
Formula: N#CC1=C(OC)N=C(C)C=C1OC
97%
BD442995
MFCD28359302
2,4-DIMETHOXY-6-METHYLPYRIDINE
CAS:40334-96-1
Formula: CC1=CC(OC)=CC(OC)=N1
97%
BD452938
MFCD16610898
2,4-DIMETHOXY-6-METHYLPYRIMIDIN-5-AMINE
CAS:84538-45-4
Formula: NC1C(OC)=NC(OC)=NC=1C
95+%
BD00773233
n/a
2,4-DIMETHOXY-6-METHYLPYRIMIDINE
CAS:7781-23-9
Formula: CC1=CC(OC)=NC(OC)=N1
98%
BD247735
MFCD00458122
2,4-DIMETHOXY-6-METHYLPYRIMIDINE-5-CARBOXYLIC ACID
CAS:106852-32-8
Formula: O=C(C1=C(C)N=C(OC)N=C1OC)O
95+%
BD284689
MFCD20644919
2,4-DIMETHOXY-7-METHYLQUINOLINE
CAS:406205-07-0
Formula: CC1C=C2C(C(=CC(=N2)OC)OC)=CC=1
95+%
BD00746635
n/a
2,4-DIMETHOXY-7H-PYRROLO[2,3-D]PYRIMIDINE
CAS:90057-09-3
Formula: COC1=C2C(NC=C2)=NC(OC)=N1
95+%
BD218318
2,4-DIMETHOXY-D-HOMOPHENYLALANINE
CAS:1260592-42-4
Formula: N[C@H](CCC1=CC=C(OC)C=C1OC)C(O)=O
95%
BD00788802
2,4-DIMETHOXY-L-HOMOPHENYLALANINE
CAS:1260588-05-3
Formula: N[C@@H](CCC1=CC=C(OC)C=C1OC)C(O)=O
95%
BD00817693
2,4-DIMETHOXYANILINE
CAS:2735-04-8
Formula: NC1=CC=C(OC)C=C1OC
98%
BD66991
MFCD00008371
2,4-DIMETHOXYBENZALDEHYDE
CAS:613-45-6
Formula: O=CC1=CC=C(OC)C=C1OC
98%
BD21781
MFCD00003311
2,4-DIMETHOXYBENZALDEHYDE OXIME
CAS:31874-34-7
Formula: O/N=C/C1=CC=C(OC)C=C1OC
95%
BD66993
MFCD00082783
2,4-DIMETHOXYBENZENE-1-SULFONYL CHLORIDE
CAS:63624-28-2
Formula: COC1=CC(OC)=C(C=C1)S(Cl)(=O)=O
90%
BD66997
MFCD00060683
2,4-DIMETHOXYBENZENESULFONAMIDE
CAS:51770-71-9
Formula: O=S(C1=CC=C(OC)C=C1OC)(N)=O
96%
BD66996
MFCD06147001
2,4-DIMETHOXYBENZENESULFONOHYDRAZIDE
CAS:73737-06-1
Formula: O=S(C1=CC=C(OC)C=C1OC)(NN)=O
97%
BD177226
MFCD03423367
2,4-DIMETHOXYBENZIMIDAMIDE
CAS:32048-19-4
Formula: N=C(N)C1=CC=C(OC)C=C1OC
95+%
BD66994
MFCD05663022
2,4-DIMETHOXYBENZIMIDAMIDE HYDROCHLORIDE
CAS:131947-81-4
Formula: N=C(N)C1=CC=C(OC)C=C1OC.[H]Cl
98%
BD66995
2,4-DIMETHOXYBENZO[D]THIAZOLE
CAS:858635-78-6
Formula: COC1=C2N=C(OC)SC2=CC=C1
97%
BD471892
MFCD18416414
2,4-DIMETHOXYBENZOHYDRAZIDE
CAS:103956-10-1
Formula: O=C(NN)C1=CC=C(OC)C=C1OC
95+%
BD275167
2,4-DIMETHOXYBENZOIC ACID
CAS:91-52-1
Formula: C1=C(OC)C=CC(=C1OC)C(O)=O
97%
BD6714
MFCD00002434
2,4-DIMETHOXYBENZONITRILE
CAS:4107-65-7
Formula: COC1=CC(OC)=C(C=C1)C#N
98%
BD7784
MFCD00001786
2,4-DIMETHOXYBENZOTHIOAMIDE
CAS:23822-07-3
Formula: S=C(N)C1=CC=C(OC)C=C1OC
95+%
BD11295
MFCD04973328
2,4-DIMETHOXYBENZOYL CHLORIDE
CAS:39828-35-8
Formula: O=C(Cl)C1=CC=C(OC)C=C1OC
97+%
BD33549
MFCD00017527
2,4-DIMETHOXYIODOBENZENE
CAS:20469-63-0
Formula: COC1=CC(OC)=C(I)C=C1
98%
BD32585
MFCD00059268
2,4-DIMETHOXYPHENETHYL ACETATE
CAS:13372-46-8
Formula: CC(OCCC1=CC=C(OC)C=C1OC)=O
97%
BD590588
2,4-DIMETHOXYPHENETHYL ETHYL OXALATE
CAS:1443353-34-1
Formula: O=C(OCCC1=CC=C(OC)C=C1OC)C(OCC)=O
97%
BD510405
MFCD15145521
2,4-DIMETHOXYPHENOL
CAS:13330-65-9
Formula: COC1=C(C=CC(=C1)OC)O
97%
BD67011
MFCD00060637
2,4-DIMETHOXYPHENYLACETIC ACID
CAS:6496-89-5
Formula: O=C(O)CC1=CC=C(OC)C=C1OC
94%
BD12061
MFCD00183328
2,4-DIMETHOXYPHENYLBORONIC ACID
CAS:133730-34-4
Formula: OB(C1=CC=C(OC)C=C1OC)O
98%
BD5277
MFCD01074590
2,4-DIMETHOXYPYRIDIN-3-AMINE
CAS:217096-31-6
Formula: NC1=C(OC)C=CN=C1OC
95+%
BD330900
MFCD18255875
2,4-DIMETHOXYPYRIDINE
CAS:18677-43-5
Formula: COC1=CC(OC)=NC=C1
98%
BD27883
MFCD01646187
2,4-DIMETHOXYPYRIMIDIN-5-AMINE
CAS:14048-15-8
Formula: NC1=CN=C(OC)N=C1OC
95+%
BD262574
MFCD12546337
2,4-DIMETHOXYPYRIMIDINE
CAS:3551-55-1
Formula: C1=NC(=NC(=C1)OC)OC
97%
BD3698
MFCD00056028
2,4-DIMETHOXYPYRIMIDINE-5-BORONIC ACID
CAS:89641-18-9
Formula: COC1=NC(OC)=C(C=N1)B(O)O
97%
BD3728
MFCD01318985
2,4-DIMETHOXYPYRIMIDINE-5-CARBALDEHYDE
CAS:52606-02-7
Formula: O=CC1=CN=C(OC)N=C1OC
97%
BD104119
MFCD00132992
2,4-DIMETHOXYPYRIMIDINE-5-CARBONITRILE
CAS:14445-57-9
Formula: N#CC1=CN=C(OC)N=C1OC
97%
BD326643
MFCD24448829
2,4-DIMETHOXYPYRIMIDINE-5-CARBOXYLIC ACID
CAS:110821-07-3
Formula: O=C(C1=CN=C(OC)N=C1OC)O
95+%
BD211290
MFCD03232921
2,4-DIMETHOXYQUINAZOLINE-6-CARBONITRILE
CAS:1823776-39-1
Formula: N#CC1=CC2=C(OC)N=C(OC)N=C2C=C1
95+%
BD272304
2,4-DIMETHOXYQUINOLINE
CAS:40335-00-0
Formula: COC1=CC(OC)=NC2=CC=CC=C12
95+%
BD328548
MFCD27950422
2,4-DIMETHYL (2R,4R)-1-BENZYLAZETIDINE-2,4-DICARBOXYLATE
CAS:1807933-83-0
Formula: O=C([C@@H]1N(CC2=CC=CC=C2)[C@@H](C(OC)=O)C1)OC
BD00768919
2,4-DIMETHYL 1-BENZYLAZETIDINE-2,4-DICARBOXYLATE
CAS:186752-06-7
Formula: O=C(C1N(CC2=CC=CC=C2)C(C(OC)=O)C1)OC
BD00779396
2,4-DIMETHYL(1,3-DIOXOLAN-2-YLMETHYL)BENZENE
CAS:898759-33-6
Formula: CC1=CC=C(CC2OCCO2)C(C)=C1
95+%
BD310655
MFCD04117664
2,4-DIMETHYL-[1,1'-BIPHENYL]-3-AMINE
CAS:83011-75-0
Formula: NC1=C(C)C(C2=CC=CC=C2)=CC=C1C
95+%
BD318424
n/a
2,4-DIMETHYL-1,2,3,4-TETRAHYDROISOQUINOLINE
CAS:20666-00-6
Formula: CC1CN(C)CC2=C1C=CC=C2
97%
BD764268
2,4-DIMETHYL-1,2,3,4-TETRAHYDROQUINOLINE
CAS:19343-79-4
Formula: CC1CC(C)NC2=C1C=CC=C2
95+%
BD270444
2,4-DIMETHYL-1-((3-NITROBENZYL)OXY)BENZENE
CAS:712344-65-5
Formula: O=[N+](C1=CC(COC2=CC=C(C)C=C2C)=CC=C1)[O-]
97%
BD597191
MFCD04969866
2,4-DIMETHYL-1-(METHYLSULFONYL)BENZENE
CAS:6462-28-8
Formula: O=S(C1=CC=C(C)C=C1C)(C)=O
95+%
BD215983
MFCD03789175
2,4-DIMETHYL-1-(TRIMETHOXYMETHYL)BENZENE
CAS:133473-80-0
Formula: COC(C1=CC=C(C)C=C1C)(OC)OC
95+%
BD269390
2,4-DIMETHYL-1H-IMIDAZOL-5-AMINE
CAS:27802-66-0
Formula: NC1=C(C)N=C(C)N1
97%
BD587549
MFCD18800973
2,4-DIMETHYL-1H-IMIDAZOL-5-AMINE HYDROCHLORIDE
CAS:50774-58-8
Formula: NC1=C(C)N=C(C)N1.[H]Cl
97%
BD587751
2,4-DIMETHYL-1H-IMIDAZOLE-5-CARBALDEHYDE
CAS:68282-52-0
Formula: CC1=NC(C)=C(N1)C=O
95+%
BD237074
MFCD19300742
2,4-DIMETHYL-1H-INDOLE
CAS:10299-61-3
Formula: CC1=CC=CC2=C1C=C(C)N2
96%
BD263176
MFCD09701270
2,4-DIMETHYL-1H-PYRROLE
CAS:625-82-1
Formula: CC1=CNC(C)=C1
97%
BD41881
MFCD00192088
2,4-DIMETHYL-1H-PYRROLE-3-CARBONITRILE
CAS:26187-28-0
Formula: N#CC1=C(C)NC=C1C
95+%
BD218796
2,4-DIMETHYL-1H-PYRROLO[2,3-B]PYRIDINE
CAS:1190313-73-5
Formula: CC1=CC=NC2=C1C=C(C)N2
95+%
BD333254
MFCD03425552
2,4-DIMETHYL-1H-PYRROLO[3,2-C]PYRIDINE
CAS:1190313-94-0
Formula: CC1=NC=CC2=C1C=C(C)N2
97%
BD561449
2,4-DIMETHYL-2'-METHOXYBENZOPHENONE
CAS:750633-50-2
Formula: O=C(C1=CC=CC=C1OC)C2=CC=C(C)C=C2C
95+%
BD309061
MFCD01311510
2,4-DIMETHYL-2'-MORPHOLINOMETHYL BENZOPHENONE
CAS:898750-47-5
Formula: O=C(C1=CC=CC=C1CN2CCOCC2)C3=CC=C(C)C=C3C
95+%
BD309949
MFCD03842424
2,4-DIMETHYL-2'-PIPERIDINOMETHYL BENZOPHENONE
CAS:898773-24-5
Formula: O=C(C1=CC=CC=C1CN2CCCCC2)C3=CC=C(C)C=C3C
95+%
BD311878
MFCD03842481
2,4-DIMETHYL-2'-PYRROLIDINOMETHYL BENZOPHENONE
CAS:898774-59-9
Formula: O=C(C1=CC=CC=C1CN2CCCC2)C3=CC=C(C)C=C3C
95+%
BD311962
MFCD03842538
2,4-DIMETHYL-2'-THIOMORPHOLINOMETHYL BENZOPHENONE
CAS:898781-84-5
Formula: O=C(C1=CC=CC=C1CN2CCSCC2)C3=CC=C(C)C=C3C
95+%
BD312649
MFCD03842765
2,4-DIMETHYL-2,3-DIHYDROTHIENO[3,2-C]QUINOLINE-8-CARBOXYLIC ACID
CAS:364338-44-3
Formula: O=C(C1=CC=C2N=C(C)C(CC(C)S3)=C3C2=C1)O
97%
BD554253
MFCD01143285
2,4-DIMETHYL-2,5-DIHYDROTHIOPHENE 1,1-DIOXIDE
CAS:10033-92-8
Formula: O=S1(C(C)C=C(C)C1)=O
95+%
BD427336
MFCD00656685
2,4-DIMETHYL-2H-1,2,3-TRIAZOLE
CAS:60166-44-1
Formula: CC1=NN(C)N=C1
95+%
BD256567
2,4-DIMETHYL-2H-BENZO[E][1,2,4]THIADIAZIN-3(4H)-ONE 1,1-DIOXIDE
CAS:13338-03-9
Formula: O=C(N(C)C1=CC=CC=C12)N(C)S2(=O)=O
95+%
BD331762
MFCD09878050
2,4-DIMETHYL-2H-PYRAZOLO[3,4-B]PYRIDIN-6(7H)-ONE
CAS:73810-75-0
Formula: O=C1C=C(C)C2=CN(C)N=C2N1
97%
BD516419
MFCD09834156
2,4-DIMETHYL-3'-(1,3-DIOXOLAN-2-YL)BENZOPHENONE
CAS:898779-33-4
Formula: O=C(C1=CC=CC(C2OCCO2)=C1)C3=CC=C(C)C=C3C
95+%
BD312408
MFCD07699967
2,4-DIMETHYL-3'-METHOXYBENZOPHENONE
CAS:750633-70-6
Formula: O=C(C1=CC=CC(OC)=C1)C2=CC=C(C)C=C2C
95+%
BD309079
MFCD01311542
2,4-DIMETHYL-3'-MORPHOLINOMETHYL BENZOPHENONE
CAS:898765-56-5
Formula: O=C(C1=CC=CC(CN2CCOCC2)=C1)C3=CC=C(C)C=C3C
95+%
BD311189
MFCD03841915
2,4-DIMETHYL-3'-PIPERIDINOMETHYL BENZOPHENONE
CAS:898793-11-8
Formula: O=C(C1=CC=CC(CN2CCCCC2)=C1)C3=CC=C(C)C=C3C
95+%
BD313695
MFCD03841972
2,4-DIMETHYL-3'-PYRROLIDINOMETHYL BENZOPHENONE
CAS:898770-37-1
Formula: O=C(C1=CC=CC(CN2CCCC2)=C1)C3=CC=C(C)C=C3C
95+%
BD311649
MFCD03842029
2,4-DIMETHYL-3'-THIOMORPHOLINOMETHYL BENZOPHENONE
CAS:898763-13-8
Formula: O=C(C1=CC=CC(CN2CCSCC2)=C1)C3=CC=C(C)C=C3C
95+%
BD310947
MFCD03842254
2,4-DIMETHYL-3-(1H-TETRAZOL-1-YL)BENZENESULFONAMIDE
CAS:704875-75-2
Formula: O=S(C1=CC=C(C)C(N2N=NN=C2)=C1C)(N)=O
97%
BD507457
MFCD05857993
2,4-DIMETHYL-3-(2-OXOPYRROLIDIN-1-YL)BENZENE-1-SULFONYL CHLORIDE
CAS:331256-61-2
Formula: O=S(C1=CC=C(C)C(N2C(CCC2)=O)=C1C)(Cl)=O
95+%
BD318123
2,4-DIMETHYL-3-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PYRIDINE
CAS:1421252-89-2
Formula: CC1(C)C(C)(C)OB(C2=C(C)C=CN=C2C)O1
95+%
BD290349
n/a
2,4-DIMETHYL-3-ETHYL-1H-PYRROLE
CAS:517-22-6
Formula: CC1=CNC(C)=C1CC
95%
BD5401
MFCD00005222
2,4-DIMETHYL-3-NITROBENZOIC ACID
CAS:39053-47-9
Formula: O=C(O)C1=CC=C(C)C([N+]([O-])=O)=C1C
97%
BD449860
MFCD08693503
2,4-DIMETHYL-3-NITROBENZONITRILE
CAS:39053-46-8
Formula: N#CC1=CC=C(C)C([N+]([O-])=O)=C1C
97%
BD449861
MFCD08693500
2,4-DIMETHYL-3-NITROPYRIDINE
CAS:1074-76-6
Formula: CC1=NC=CC(C)=C1[N+]([O-])=O
98%
BD67061
MFCD08235269
2,4-DIMETHYL-3-OXO-3,4-DIHYDRO-2H-BENZO[B][1,4]OXAZINE-6-CARBOXYLIC ACID
CAS:1092352-74-3
Formula: O=C(C1=CC=C(C(N2C)=C1)OC(C)C2=O)O
95+%
BD201747
2,4-DIMETHYL-3-OXO-3,4-DIHYDRO-2H-BENZO[B][1,4]OXAZINE-7-CARBOXYLIC ACID
CAS:1092352-50-5
Formula: O=C(C1=CC=C(N2C)C(OC(C)C2=O)=C1)O
95+%
BD201630
2,4-DIMETHYL-4'-(1,3-DIOXOLAN-2-YL)BENZOPHENONE
CAS:898760-19-5
Formula: O=C(C1=CC=C(C2OCCO2)C=C1)C3=CC=C(C)C=C3C
95+%
BD310738
MFCD07700018
2,4-DIMETHYL-4'-METHOXYBENZOPHENONE
CAS:57800-66-5
Formula: O=C(C1=CC=C(OC)C=C1)C2=CC=C(C)C=C2C
95+%
BD308395
MFCD01311572
2,4-DIMETHYL-4'-MORPHOLINOMETHYL BENZOPHENONE
CAS:898770-05-3
Formula: O=C(C1=CC=C(CN2CCOCC2)C=C1)C3=CC=C(C)C=C3C
95+%
BD311617
MFCD03841403
2,4-DIMETHYL-4'-PIPERIDINOMETHYL BENZOPHENONE
CAS:898771-49-8
Formula: O=C(C1=CC=C(CN2CCCCC2)C=C1)C3=CC=C(C)C=C3C
95+%
BD311760
MFCD03841460
2,4-DIMETHYL-4'-PYRROLIDINOMETHYL BENZOPHENONE
CAS:898776-44-8
Formula: O=C(C1=CC=C(CN2CCCC2)C=C1)C3=CC=C(C)C=C3C
95+%
BD312140
MFCD03841517
2,4-DIMETHYL-4'-THIOMORPHOLINOMETHYL BENZOPHENONE
CAS:898782-73-5
Formula: O=C(C1=CC=C(CN2CCSCC2)C=C1)C3=CC=C(C)C=C3C
95+%
BD312718
MFCD03841744
2,4-DIMETHYL-4,5,6,7-TETRAHYDROTHIAZOLO[5,4-C]PYRIDINE
CAS:1017174-32-1
Formula: CC1C(SC(C)=N2)=C2CCN1
97%
BD605426
2,4-DIMETHYL-4H-THIENO[3,2-B]PYRROLE-5-CARBOXYLIC ACID
CAS:903173-34-2
Formula: O=C(C1=CC2=C(C=C(C)S2)N1C)O
97%
BD569525
2,4-DIMETHYL-5,6,7,8-TETRAHYDROQUINAZOLINE
CAS:88268-23-9
Formula: CC1=C2CCCCC2=NC(C)=N1
97%
BD748670
2,4-DIMETHYL-5-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PYRIDINE
CAS:1622217-32-6
Formula: CC1(C)C(C)(C)OB(C2=CN=C(C)C=C2C)O1
97%
BD625947
MFCD18719934
2,4-DIMETHYL-5-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)THIAZOLE
CAS:859833-13-9
Formula: CC1(C)C(C)(C)OB(C2=C(C)N=C(C)S2)O1
96%
BD165401
MFCD07783649
2,4-DIMETHYL-5-(METHYLSULFONYL)ANILINE
CAS:849035-63-8
Formula: NC1=CC(S(=O)(C)=O)=C(C)C=C1C
95%
BD11381
MFCD04037922
2,4-DIMETHYL-5-NITROANILINE
CAS:2124-47-2
Formula: NC1=CC([N+]([O-])=O)=C(C)C=C1C
97%
BD67072
MFCD00025199
2,4-DIMETHYL-5-NITROBENZOIC ACID
CAS:220504-75-6
Formula: O=C(O)C1=CC([N+]([O-])=O)=C(C)C=C1C
98%
BD215982
MFCD01463419
2,4-DIMETHYL-5-NITROBENZONITRILE
CAS:625112-44-9
Formula: N#CC1=CC([N+]([O-])=O)=C(C)C=C1C
97%
BD455172
MFCD16875749
2,4-DIMETHYL-5-NITROBENZOTRIFLUORIDE
CAS:261945-82-8
Formula: CC1=CC(C)=C(C=C1[N+]([O-])=O)C(F)(F)F
95+%
BD67073
MFCD01631630
2,4-DIMETHYL-5-NITROPHENOL
CAS:14969-00-7
Formula: OC1=CC([N+]([O-])=O)=C(C)C=C1C
95+%
BD330087
MFCD00667776
2,4-DIMETHYL-5-NITROPYRIDINE
CAS:1074-99-3
Formula: O=[N+](C1=CN=C(C)C=C1C)[O-]
97%
BD92882
2,4-DIMETHYL-5-VINYLTHIAZOLE
CAS:65505-18-2
Formula: C=CC1=C(C)N=C(C)S1
95+%
BD246245
MFCD00792504
2,4-DIMETHYL-6,7,8,9-TETRAHYDRO-5H-CYCLOHEPTA[D]PYRIMIDINE
CAS:138722-72-2
Formula: CC1=C(CCCCC2)C2=NC(C)=N1
97%
BD748672
2,4-DIMETHYL-6,7-DIHYDRO-5H-CYCLOPENTA[D]PYRIMIDINE
CAS:88268-24-0
Formula: CC1=C(CCC2)C2=NC(C)=N1
97%
BD551167
2,4-DIMETHYL-6-((2-METHYLALLYL)OXY)BENZALDEHYDE
CAS:1708169-96-3
Formula: O=CC1=C(OCC(C)=C)C=C(C)C=C1C
97%
BD621936
2,4-DIMETHYL-6-((3-METHYLCYCLOBUTYL)METHOXY)BENZALDEHYDE
CAS:1707393-26-7
Formula: O=CC1=C(OCC2CC(C)C2)C=C(C)C=C1C
97%
BD620626
2,4-DIMETHYL-6-((TETRAHYDROFURAN-2-YL)METHOXY)BENZALDEHYDE
CAS:1710853-45-4
Formula: O=CC1=C(OCC2OCCC2)C=C(C)C=C1C
97%
BD623090
2,4-DIMETHYL-6-(1H-PYRAZOL-3-YL)PHENOL
CAS:288401-54-7
Formula: OC1=C(C)C=C(C)C=C1C2=NNC=C2
97%
BD0530
2,4-DIMETHYL-6-(2-MORPHOLINOETHOXY)BENZALDEHYDE
CAS:1215903-35-7
Formula: O=CC1=C(OCCN2CCOCC2)C=C(C)C=C1C
97%
BD607622
2,4-DIMETHYL-6-(2-PIPERIDINYLMETHYL)PYRIDINE
CAS:526183-28-8
Formula: CC1=CC(C)=NC(CC2NCCCC2)=C1
95+%
BD327409
MFCD05190116
2,4-DIMETHYL-6-(2-PYRROLIDINYLMETHYL)PYRIDINE
CAS:524674-46-2
Formula: CC1=CC(C)=NC(CC2NCCC2)=C1
95+%
BD327406
MFCD05189306
2,4-DIMETHYL-6-(3-METHYL-1H-PYRAZOL-5-YL)ANILINE
CAS:1030618-76-8
Formula: NC1=C(C2=CC(C)=NN2)C=C(C)C=C1C
97%
BD588357
MFCD07186463
2,4-DIMETHYL-6-(PIPERAZIN-1-YL)PYRIMIDINE
CAS:887686-65-9
Formula: CC1=NC(C)=NC(N2CCNCC2)=C1
97%
BD506561
MFCD07365286
2,4-DIMETHYL-6-(TRIFLUOROMETHYL)PYRIDINE
CAS:749256-94-8
Formula: FC(C1=CC(C)=CC(C)=N1)(F)F
97%
BD765567
2,4-DIMETHYL-6-NITROANILINE
CAS:1635-84-3
Formula: NC1=C([N+]([O-])=O)C=C(C)C=C1C
97%
BD5187
MFCD00007739
2,4-DIMETHYL-6-NITROBENZOIC ACID
CAS:1379173-92-8
Formula: O=C(O)C1=C([N+]([O-])=O)C=C(C)C=C1C
96%
BD460297
MFCD09999741
2,4-DIMETHYL-6-NITROPHENOL
CAS:14452-34-7
Formula: OC1=C([N+]([O-])=O)C=C(C)C=C1C
98%
BD6532
MFCD00191633
2,4-DIMETHYL-6-PHENYLPYRIMIDINE
CAS:64571-30-8
Formula: CC1=NC(C)=NC(C2=CC=CC=C2)=C1
97%
BD541869
2,4-DIMETHYL-6-PROPOXYBENZALDEHYDE
CAS:1710301-86-2
Formula: O=CC1=C(OCCC)C=C(C)C=C1C
97%
BD622748
2,4-DIMETHYL-6-PROPOXYBENZONITRILE
CAS:1708037-50-6
Formula: N#CC1=C(OCCC)C=C(C)C=C1C
97%
BD621765
2,4-DIMETHYL-7,8,9,10-TETRAHYDROPYRIDO[4',3':3,4]PYRAZOLO[1,5-A]PYRIMIDINE
CAS:1706464-23-4
Formula: CC1=CC(C)=NC2=C3CNCCC3=NN12
97%
BD620116
2,4-DIMETHYL-8-HYDROXYQUINOLINE
CAS:115310-98-0
Formula: CC1=NC2=C(C=CC=C2O)C(C)=C1
97%
BD41197
MFCD09743812
2,4-DIMETHYL-8-NITROQUINOLIN-7-OL
CAS:1378259-98-3
Formula: OC1=CC=C2C(C)=CC(C)=NC2=C1[N+]([O-])=O
97%
BD614806
2,4-DIMETHYL-N,N-DIPHENYLANILINE
CAS:1228-80-4
Formula: CC1=CC(C)=C(C=C1)N(C1=CC=CC=C1)C1=CC=CC=C1
95+%
BD67146
MFCD09030600
2,4-DIMETHYL-N-(2-PHENOXYETHYL)ANILINE
CAS:327070-55-3
Formula: CC1=CC=C(NCCOC2=CC=CC=C2)C(C)=C1
97%
BD594300
MFCD02578880
2,4-DIMETHYL-N-(3-METHYLTHIAZOL-2(3H)-YLIDENE)ANILINE
CAS:61676-87-7
Formula: CN1/C(SC=C1)=N/C2=CC=C(C)C=C2C
95+%
BD21804
MFCD01311800
2,4-DIMETHYL-N-(PYRROLIDIN-2-YLMETHYL)ANILINE HYDROCHLORIDE
CAS:1177348-08-1
Formula: CC1=CC=C(NCC2NCCC2)C(C)=C1.[H]Cl
97%
BD562605
2,4-DIMETHYL-N-PHENYL-N-(P-TOLYL)ANILINE
CAS:1071935-18-6
Formula: CC1=CC=C(N(C2=CC=CC=C2)C3=CC=C(C)C=C3C)C=C1
95+%
BD247630
MFCD17015627
2,4-DIMETHYL-N-PHENYLANILINE
CAS:25078-04-0
Formula: CC1=CC=C(C(C)=C1)NC2=CC=CC=C2
98%
BD67108
MFCD08275461
2,4-DIMETHYL-PYRIMIDINE-5-CARBOXYLIC ACID
CAS:74356-36-8
Formula: CC1=NC(C)=C(C=N1)C(O)=O
98%
BD34803
MFCD07391755
2,4-DIMETHYLACETOPHENON
CAS:89-74-7
Formula: CC(=O)C1=C(C)C=C(C)C=C1
95%
BD67085
MFCD00003571
2,4-DIMETHYLANILINE HYDROCHLORIDE
CAS:21436-96-4
Formula: NC1=CC=C(C)C=C1C.[H]Cl
98%
BD5291
MFCD00060209
2,4-DIMETHYLANISOLE
CAS:6738-23-4
Formula: CC1=CC=C(OC)C(C)=C1
98+%
BD34578
MFCD00008377
2,4-DIMETHYLAZETIDINE
CAS:1314908-41-2
Formula: CC1CC(C)N1
BD00800736
2,4-DIMETHYLAZETIDINE HYDROCHLORIDE
CAS:1803606-22-5
Formula: CC1CC(C)N1.[H]Cl
BD00755362
2,4-DIMETHYLBENZALDEHYDE
CAS:15764-16-6
Formula: O=CC1=CC=C(C)C=C1C
95+%
BD67092
MFCD00003340
2,4-DIMETHYLBENZAMIDE
CAS:73258-94-3
Formula: O=C(N)C1=CC=C(C)C=C1C
95+%
BD324135
MFCD11643208
2,4-DIMETHYLBENZENE-1,3-DIAMINE
CAS:13438-26-1
Formula: CC1=C(N)C(C)=C(N)C=C1
95+%
BD233319
MFCD00130059
2,4-DIMETHYLBENZENE-1,3-DIOL
CAS:634-65-1
Formula: CC1=C(O)C(C)=C(O)C=C1
95+%
BD41899
MFCD06410805
2,4-DIMETHYLBENZENE-1-SULFONYL CHLORIDE
CAS:609-60-9
Formula: O=S(C1=CC=C(C)C=C1C)(Cl)=O
97%
BD11171
MFCD00156143
2,4-DIMETHYLBENZENESULFONAMIDE
CAS:7467-12-1
Formula: O=S(C1=CC=C(C)C=C1C)(N)=O
97%
BD188688
2,4-DIMETHYLBENZENESULFONIC ACID MONOHYDRATE
CAS:88-61-9
Formula: O=S(C1=CC=C(C)C=C1C)(O)=O
98%
BD140560
2,4-DIMETHYLBENZENESULFONOHYDRAZIDE
CAS:18626-10-3
Formula: O=S(C1=CC=C(C)C=C1C)(NN)=O
97%
BD177229
MFCD03423366
2,4-DIMETHYLBENZIMIDAMIDE
CAS:885957-73-3
Formula: N=C(N)C1=CC=C(C)C=C1C
95+%
BD285924
MFCD05662999
2,4-DIMETHYLBENZO[D]THIAZOLE
CAS:5262-63-5
Formula: CC1=NC2=C(S1)C=CC=C2C
95+%
BD236614
MFCD03161856
2,4-DIMETHYLBENZOIC ACID
CAS:611-01-8
Formula: C1=CC(=CC(=C1C(O)=O)C)C
95+%
BD6659
MFCD00002480
2,4-DIMETHYLBENZONITRILE
CAS:21789-36-6
Formula: N#CC1=CC=C(C)C=C1C
98%
BD67098
MFCD00016377
2,4-DIMETHYLBENZOTHIOAMIDE
CAS:57182-70-4
Formula: S=C(C1=CC=C(C)C=C1C)N
97%
BD67093
2,4-DIMETHYLBENZOXAZOLE
CAS:72692-90-1
Formula: CC1=C2N=C(C)OC2=CC=C1
97%
BD273822
2,4-DIMETHYLBENZYLAMINE
CAS:94-98-4
Formula: NCC1=CC=C(C)C=C1C
98%
BD35487
MFCD00025575
2,4-DIMETHYLBROMOBENZENE
CAS:583-70-0
Formula: CC1=CC=C(Br)C(C)=C1
95%
BD95279
2,4-DIMETHYLFURAN-3-CARBOXYLIC ACID
CAS:15058-72-7
Formula: O=C(C1=C(C)OC=C1C)O
97%
BD558268
MFCD08692087
2,4-DIMETHYLHEPTAN-3-ONE
CAS:18641-71-9
Formula: CC(C)C(C(C)CCC)=O
95+%
BD67057
MFCD00027146
2,4-DIMETHYLIMIDAZOLE
CAS:930-62-1
Formula: C1=C([NH]C(=N1)C)C
96%
BD67113
MFCD00022365
2,4-DIMETHYLMORPHOLINE HYDROCHLORIDE
CAS:59256-84-7
Formula: CN1CC(C)OCC1.[H]Cl
95+%
BD283924
2,4-DIMETHYLNAPHTHALEN-1-AMINE
CAS:51671-03-5
Formula: NC1=C2C=CC=CC2=C(C)C=C1C
95+%
BD272457
MFCD20691448
2,4-DIMETHYLNICOTINALDEHYDE
CAS:168072-32-0
Formula: O=CC1=C(C)N=CC=C1C
95+%
BD157660
MFCD11100698
2,4-DIMETHYLNICOTINAMIDE
CAS:72692-96-7
Formula: O=C(N)C1=C(C)N=CC=C1C
95+%
BD250804
MFCD09752319
2,4-DIMETHYLNICOTINIC ACID HYDROCHLORIDE
CAS:133897-06-0
Formula: O=C(O)C1=C(C)N=CC=C1C.[H]Cl
98%
BD67065
MFCD04972426
2,4-DIMETHYLOCTANE
CAS:4032-94-4
Formula: CC(C)CC(C)CCCC
97%
BD00799091
2,4-DIMETHYLOXAZOLE
CAS:7208-05-1
Formula: CC1=COC(C)=N1
98%
BD105600
MFCD00234124
2,4-DIMETHYLOXAZOLE-5-CARBALDEHYDE
CAS:69062-86-8
Formula: CC1=NC(C)=C(O1)C=O
97%
BD29426
MFCD06738688
2,4-DIMETHYLOXAZOLE-5-CARBOHYDRAZIDE
CAS:89598-65-2
Formula: O=C(C1=C(C)N=C(C)O1)NN
95+%
BD173257
2,4-DIMETHYLOXAZOLE-5-CARBONITRILE
CAS:59720-59-1
Formula: N#CC1=C(C)N=C(C)O1
97%
BD435688
MFCD16989998
2,4-DIMETHYLOXAZOLE-5-CARBOXYLIC ACID
CAS:2510-37-4
Formula: CC1=NC(C)=C(O1)C(O)=O
95+%
BD167638
MFCD06011090
2,4-DIMETHYLPENT-2-ENOIC ACID
CAS:66634-97-7
Formula: CC(C)/C=C(C)/C(O)=O
97%
BD67044
2,4-DIMETHYLPENT-4-EN-2-OL
CAS:19781-53-4
Formula: CC(O)(C)CC(C)=C
94+%
BD67068
MFCD00039615
2,4-DIMETHYLPENTAN-3-AMINE HYDROCHLORIDE
CAS:4083-58-3
Formula: CC(C)C(N)C(C)C.[H]Cl
97%
BD297822
MFCD22392217
2,4-DIMETHYLPHENETHYL ACETATE
CAS:22532-58-7
Formula: CC(OCCC1=CC=C(C)C=C1C)=O
97%
BD593743
2,4-DIMETHYLPHENYLACETIC ACID
CAS:6331-04-0
Formula: O=C(O)CC1=CC=C(C)C=C1C
98%
BD0153
2,4-DIMETHYLPHENYLBORONIC ACID
CAS:55499-44-0
Formula: CC1=C(C=CC(=C1)C)B(O)O
98%
BD5258
MFCD02683101
2,4-DIMETHYLPHENYLHYDRAZINE HYDROCHLORIDE
CAS:60480-83-3
Formula: [H]Cl.NNC1=CC=C(C)C=C1C
97%
BD5367
MFCD00013381
2,4-DIMETHYLPIPERIDIN-4-OL
CAS:1550821-91-4
Formula: OC1(C)CC(C)NCC1
BD00797106
2,4-DIMETHYLPIPERIDINE HYDROCHLORIDE
CAS:91846-47-8
Formula: CC1CC(C)NCC1.[H]Cl
97%
BD67251
MFCD10687193
2,4-DIMETHYLPYRAZOLO[1,5-A]PYRIMIDIN-5(4H)-ONE
CAS:N/A
Formula: O=C1N(C)C2=CC(C)=NN2C=C1
97%
BD753992
2,4-DIMETHYLPYRIDIN-3-AMINE
CAS:1073-21-8
Formula: CC1=NC=CC(C)=C1N
98%
BD83730
MFCD08235192
2,4-DIMETHYLPYRIDIN-3-OL
CAS:27296-76-0
Formula: OC1=C(C)C=CN=C1C
98%
BD67060
MFCD08235268
2,4-DIMETHYLPYRIDINE-3-BORONIC ACID
CAS:1029654-16-7
Formula: OB(C1=C(C)C=CN=C1C)O
95+%
BD168616
2,4-DIMETHYLPYRIDINE-3-CARBOXYLIC ACID
CAS:55314-30-2
Formula: O=C(C1=C(C)C=CN=C1C)O
95%
BD29038
MFCD03265250
2,4-DIMETHYLPYRIMIDIN-5-AMINE
CAS:35733-53-0
Formula: NC1=CN=C(C)N=C1C
98%
BD20416
MFCD09608073
2,4-DIMETHYLPYRIMIDIN-5-OL
CAS:412003-95-3
Formula: OC1=CN=C(C)N=C1C
98%
BD227081
MFCD18072447
2,4-DIMETHYLPYRIMIDINE
CAS:14331-54-5
Formula: CC1=NC(C)=NC=C1
95+%
BD250211
2,4-DIMETHYLPYRIMIDINE-5-CARBALDEHYDE
CAS:933702-51-3
Formula: O=CC1=CN=C(C)N=C1C
97%
BD584922
2,4-DIMETHYLPYRIMIDINE-5-CARBOXAMIDE
CAS:53554-30-6
Formula: O=C(C1=CN=C(C)N=C1C)N
97%
BD587773
2,4-DIMETHYLPYRROLE-3-CARBOXYLIC ACID
CAS:17106-13-7
Formula: O=C(C1=C(C)NC=C1C)O
98%
BD67133
MFCD09750426
2,4-DIMETHYLPYRROLIDINE HYDROCHLORIDE
CAS:1333946-75-0
Formula: CC1CC(C)NC1.[H]Cl
97%
BD440319
MFCD19982526
2,4-DIMETHYLPYRROLO[1,2-A]PYRIMIDINE-8-CARBOXYLIC ACID
CAS:1919049-95-8
Formula: O=C(C1=C2N=C(C)C=C(C)N2C=C1)O
97%
BD00823871
2,4-DIMETHYLQUINAZOLIN-8-OL
CAS:17056-97-2
Formula: OC1=CC=CC2=C(C)N=C(C)N=C12
95+%
BD330467
MFCD24715406
2,4-DIMETHYLQUINAZOLINE
CAS:703-63-9
Formula: C1=CC=CC2=C1N=C(N=C2C)C
95+%
BD210603
MFCD18449069
2,4-DIMETHYLQUINOLINE
CAS:1198-37-4
Formula: CC1=CC(C)=NC2=CC=CC=C12
98%
BD0480
MFCD00006760
2,4-DIMETHYLQUINOLINE-3-CARBOXYLIC ACID
CAS:104785-55-9
Formula: O=C(C1=C(C)C2=CC=CC=C2N=C1C)O
95+%
BD67135
MFCD07324847
2,4-DIMETHYLQUINOLINE-7-CARBOXYLIC ACID
CAS:936074-38-3
Formula: O=C(C1=CC=C2C(C)=CC(C)=NC2=C1)O
95+%
BD173430
n/a
2,4-DIMETHYLTHIAZOL-5-AMINE
CAS:856568-04-2
Formula: NC1=C(C)N=C(C)S1
95+%
BD251214
MFCD16669939
2,4-DIMETHYLTHIAZOLE
CAS:541-58-2
Formula: C1=C(N=C(C)S1)C
96%
BD9619
MFCD00014509
2,4-DIMETHYLTHIAZOLE-5-CARBALDEHYDE
CAS:95453-54-6
Formula: O=CC1=C(C)N=C(C)S1
97%
BD67030
2,4-DIMETHYLTHIAZOLE-5-CARBOHYDRAZIDE
CAS:99357-25-2
Formula: O=C(C1=C(C)N=C(C)S1)NN
97%
BD67141
2,4-DIMETHYLTHIAZOLE-5-CARBONITRILE
CAS:1215959-36-6
Formula: N#CC1=C(C)N=C(C)S1
97%
BD471300
2,4-DIMETHYLTHIAZOLE-5-CARBOXYLIC ACID
CAS:53137-27-2
Formula: O=C(C1=C(C)N=C(C)S1)O
98%
BD10000
MFCD00052943
2,4-DIMETHYLTHIAZOLE-5-SULFONAMIDE
CAS:80466-90-6
Formula: O=S(C1=C(C)N=C(C)S1)(N)=O
97%
BD549023
2,4-DIMETHYLTHIOPHENE
CAS:638-00-6
Formula: CC1=CSC(C)=C1
95+%
BD67142
MFCD00130082
2,4-DIMORPHOLINOANILINE
CAS:436088-92-5
Formula: NC1=CC=C(N2CCOCC2)C=C1N3CCOCC3
95+%
BD188188
MFCD03274726
2,4-DIMORPHOLINONITROBENZENE
CAS:133387-34-5
Formula: O=[N+](C1=CC=C(N2CCOCC2)C=C1N3CCOCC3)[O-]
95+%
BD317311
MFCD00546019
2,4-DINITROBENZALDEHYDE
CAS:528-75-6
Formula: O=CC1=CC=C([N+]([O-])=O)C=C1[N+]([O-])=O
98%
BD10317
MFCD00013376
2,4-DINITROBENZENESULFONAMIDE
CAS:73901-01-6
Formula: NS(=O)(=O)C1=C(C=C(C=C1)[N+]([O-])=O)[N+]([O-])=O
98%
BD236897
MFCD09733471
2,4-DIOXO-1,2,3,4-TETRAHYDROPYRIDO[2,3-D]PYRIMIDINE-6-SULFONYL CHLORIDE
CAS:1384431-51-9
Formula: O=S(C1=CN=C(C(C(N2)=O)=C1)NC2=O)(Cl)=O
97%
BD00783335
2,4-DIOXO-1,2,3,4-TETRAHYDROPYRIMIDINE-5-CARBALDEHYDE
CAS:1195-08-0
Formula: O=CC1=CNC(=O)NC1=O
95%
BD2615
MFCD00192185
2,4-DIOXO-1,2,3,4-TETRAHYDROPYRIMIDINE-5-CARBONITRILE
CAS:4425-56-3
Formula: N#CC1=CNC(NC1=O)=O
98%
BD41691
MFCD00051958
2,4-DIOXO-1,2,3,4-TETRAHYDROPYRIMIDINE-5-SULFONYL CHLORIDE
CAS:28485-18-9
Formula: O=S(C1=CNC(NC1=O)=O)(Cl)=O
95+%
BD67196
2,4-DIOXO-1,2,3,4-TETRAHYDROPYRIMIDO[4,5-B]QUINOLINE-5-CARBOXYLIC ACID
CAS:500300-26-5
Formula: O=C(C1=C(C(N2)=O)C(NC2=O)=NC3=CC=CC=C13)O
97%
BD625472
2,4-DIOXO-1,2,3,4-TETRAHYDROQUINAZOLINE-5-CARBOXYLIC ACID
CAS:5715-10-6
Formula: OC(=O)C1=C2C(=O)NC(=O)NC2=CC=C1
95+%
BD239478
MFCD16622795
2,4-DIOXO-1,2,3,4-TETRAHYDROQUINAZOLINE-6-CARBOXAMIDE
CAS:263010-13-5
Formula: O=C(C1=CC2=C(NC(NC2=O)=O)C=C1)N
95+%
BD260170
2,4-DIOXO-1,2,3,4-TETRAHYDROQUINAZOLINE-6-CARBOXYLIC ACID
CAS:1821028-80-1
Formula: O=C(C1=CC2=C(NC(NC2=O)=O)C=C1)O
97%
BD435270
MFCD20039830
2,4-DIOXO-1,2,3,4-TETRAHYDROQUINAZOLINE-6-SULFONYL CHLORIDE
CAS:56044-12-3
Formula: O=S(C1=CC2=C(NC(NC2=O)=O)C=C1)(Cl)=O
95%
BD183804
MFCD07186482
2,4-DIOXO-1,2,3,4-TETRAHYDROQUINAZOLINE-7-CARBONITRILE
CAS:864292-20-6
Formula: N#CC1=CC(NC(N2)=O)=C(C=C1)C2=O
95+%
BD247375
2,4-DIOXO-1,2,3,4-TETRAHYDROQUINAZOLINE-8-CARBONITRILE
CAS:1150617-69-8
Formula: O=C1NC(=O)C2=CC=CC(C#N)=C2N1
95+%
BD227924
MFCD12024545
2,4-DIOXO-1,3-DIAZASPIRO[4.5]DECANE-7-CARBOXYLIC ACID
CAS:26629-10-7
Formula: O=C(C(CCC1)CC1(NC(N2)=O)C2=O)O
97%
BD624460
2,4-DIOXO-1,3-DIPROPYL-1,2,3,4-TETRAHYDROPYRIDO[2,3-D]PYRIMIDINE-6-SULFONYL CHLORIDE
CAS:1334149-34-6
Formula: O=S(C1=CN=C(C(C(N2CCC)=O)=C1)N(CCC)C2=O)(Cl)=O
97%
BD00801470
2,4-DIOXO-1-(3-(TRIFLUOROMETHYL)PHENYL)-1,2,3,4-TETRAHYDROPYRIMIDINE-5-CARBONITRILE
CAS:75838-24-3
Formula: O=C(N1)N(C2=CC=CC(C(F)(F)F)=C2)C=C(C#N)C1=O
95+%
BD103726
MFCD00203322
2,4-DIOXO-1-PHENYL-1,2,3,4-TETRAHYDROPYRIMIDINE-5-CARBONITRILE
CAS:6275-84-9
Formula: O=C1NC(=O)C(=CN1C1=CC=CC=C1)C#N
95+%
BD67197
MFCD00172909
2,4-DIOXO-1-PROPYL-1,2,3,4-TETRAHYDROPYRIMIDINE-5-CARBOXYLIC ACID
CAS:1242282-11-6
Formula: O=C(C1=CN(CCC)C(NC1=O)=O)O
97%
BD608200
2,4-DIOXO-2,4-DIHYDRO-1H-BENZO[D][1,3]OXAZINE-6-CARBOXYLIC ACID
CAS:77423-13-3
Formula: OC(=O)C1=CC2=C(NC(=O)OC2=O)C=C1
95+%
BD42012
MFCD08704695
2,4-DIOXO-2,4-DIHYDRO-1H-BENZO[D][1,3]OXAZINE-7-CARBOXYLIC ACID
CAS:77423-14-4
Formula: OC(=O)C1=CC2=C(C=C1)C(=O)OC(=O)N2
96%
BD11477
MFCD00798181
2,4-DIOXO-2,4-DIHYDRO-1H-BENZO[D][1,3]OXAZINE-8-CARBOXYLIC ACID
CAS:167902-99-0
Formula: OC(=O)C1=CC=CC2=C1NC(=O)OC2=O
95+%
BD201982
MFCD09865033
2,4-DIOXO-4-(4-(PIPERIDIN-1-YL)PHENYL)BUTANOIC ACID
CAS:394655-15-3
Formula: O=C(O)C(CC(C1=CC=C(N2CCCCC2)C=C1)=O)=O
97%
BD67200
2,4-DIOXO-4-PHENYLBUTANOIC ACID
CAS:5817-92-5
Formula: O=C(O)C(CC(C1=CC=CC=C1)=O)=O
98%
BD319079
MFCD00456054
2,4-DIOXO-6-PHENYLHEXANOIC ACID
CAS:64165-16-8
Formula: O=C(O)C(CC(CCC1=CC=CC=C1)=O)=O
95+%
BD249644
2,4-DIOXO-N-PHENYLPENTANAMIDE
CAS:503300-35-4
Formula: CC(=O)CC(=O)C(=O)NC1=CC=CC=C1
95+%
BD219439
2,4-DIPHENYL-1H-PYRROLE
CAS:3274-56-4
Formula: C1(C2=CC=CC=C2)=CC(C3=CC=CC=C3)=CN1
97%
BD67218
MFCD00958534
2,4-DIPHENYL-1H-PYRROLE-3-CARBONITRILE
CAS:59009-62-0
Formula: N#CC1=C(C2=CC=CC=C2)NC=C1C3=CC=CC=C3
95+%
BD269130
MFCD02380383
2,4-DIPHENYL-5,6,7,8-TETRAHYDROCHROMENYLIUM TRIFLUOROMETHANESULFONATE
CAS:81128-01-0
Formula: O=S(C(F)(F)F)([O-])=O.C1(C2=CC=CC=C2)=CC(C3=CC=CC=C3)=C4CCCCC4=[O+]1
97%
BD67212
2,4-DIPHENYL-5,6,7,8-TETRAHYDROQUINAZOLINE
CAS:20954-93-2
Formula: C1(C2=CC=CC=C2)=NC(C3=CC=CC=C3)=C4CCCCC4=N1
97%
BD748671
2,4-DIPHENYL-6,7-DIHYDRO-5H-CYCLOPENTA[D]PYRIMIDINE
CAS:138722-71-1
Formula: C1(C2=CC=CC=C2)=NC(C3=CC=CC=C3)=C(CCC4)C4=N1
97%
BD748669
2,4-DIPHENYL-6-(4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PHENYL)-1,3,5-TRIAZINE
CAS:1219956-23-6
Formula: CC1(C)C(C)(C)OB(C2=CC=C(C3=NC(C4=CC=CC=C4)=NC(C5=CC=CC=C5)=N3)C=C2)O1
98%
BD291505
2,4-DIPHENYLCYCLOBUTANE-1,3-DIAMINE
CAS:101288-28-2
Formula: NC1C(C2=CC=CC=C2)C(N)C1C3=CC=CC=C3
97%
BD605377
2,4-DIPHENYLOXAZOL-5(4H)-ONE
CAS:28687-81-2
Formula: O=C1C(C2=CC=CC=C2)N=C(C3=CC=CC=C3)O1
97%
BD492928
2,4-DIPHENYLOXAZOLE
CAS:838-41-5
Formula: C1(C2=CC=CC=C2)=NC(C3=CC=CC=C3)=CO1
99%
BD67216
MFCD00016890
2,4-DIPHENYLPHTHALAZIN-1(2H)-ONE
CAS:36503-83-0
Formula: O=C1N(C2=CC=CC=C2)N=C(C3=CC=CC=C3)C4=C1C=CC=C4
97%
BD625001
2,4-DIPHENYLPYRIDINE
CAS:26274-35-1
Formula: C1(C2=CC=CC=C2)=NC=CC(C3=CC=CC=C3)=C1
98%
BD67217
MFCD00972966
2,4-DIPHENYLTHIAZOLE
CAS:1826-14-8
Formula: C1(C2=CC=CC=C2)=NC(C3=CC=CC=C3)=CS1
95+%
BD257419
2,4-DITRIFLUOROMETHYLANILINE
CAS:367-71-5
Formula: NC1=CC=C(C(F)(F)F)C=C1C(F)(F)F
95%
BD66451
MFCD00236209
2,4-DITRIFLUOROMETHYLPHENOL
CAS:908848-70-4
Formula: OC1=CC=C(C(F)(F)F)C=C1C(F)(F)F
97%
BD00762041
2,4-HEXADIEN-1-OL
CAS:111-28-4
Formula: C/C=C/C=C/CO
98% GC)
BD00842895
2,4-HEXANEDIONE
CAS:3002-24-2
Formula: CC(CC(CC)=O)=O
97%
BD67249
2,4-PIPERIDINEDICARBOXYLIC ACID
CAS:85819-03-0
Formula: O=C(C1NCCC(C(O)=O)C1)O
95+%
BD306875
MFCD12026391
2,4-PYRIMIDINEDIAMINE WITH LINKER
CAS:1430089-64-7
Formula: NCCCNC1=CC=C(NC2=NC=CC(NC3=NNC(C4CC4)=C3)=N2)C=C1
98+%
BD449969
MFCD28385887
2,4-THIAZOLIDINEDIONE
CAS:2295-31-0
Formula: O=C1SCC(N1)=O
97%
BD9326
MFCD00005478
2,5,6-TRIAMINOPYRIMIDIN-4(3H)-ONE
CAS:1004-75-7
Formula: O=C1NC(N)=NC(N)=C1N
95+%
BD220079
2,5,6-TRIAMINOPYRIMIDIN-4(3H)-ONE DIHYDROCHLORIDE
CAS:51324-37-9
Formula: Cl.Cl.NC1C(=O)N=C(N)N=C1N
95%
BD223096
MFCD00142115
2,5,6-TRIAMINOPYRIMIDIN-4(3H)-ONE SULFATE
CAS:35011-47-3
Formula: O=C1NC(N)=NC(N)=C1N.O=S(O)(O)=O
95+%
BD220080
MFCD00012785
2,5,6-TRIAMINOPYRIMIDIN-4(3H)-ONE SULFATE(1:X)
CAS:39267-74-8
Formula: O=C1NC(N)=NC(N)=C1N.O=S(O)(O)=O
95%
BD220087
n/a
2,5,6-TRIAMINOPYRIMIDIN-4-OL
CAS:N/A
Formula: OC1=NC(N)=NC(N)=C1N
95+%
BD109297
2,5,6-TRIAMINOPYRIMIDIN-4-YL HYDROGEN SULFATE
CAS:1603-02-7
Formula: NC1=NC(OS(O)(=O)=O)=C(N)C(N)=N1
95%
BD220088
MFCD00039040
2,5,6-TRIAMINOPYRIMIDINE-4(3H)-THIONE
CAS:54-19-3
Formula: S=C1NC(N)=NC(N)=C1N
95+%
BD282734
2,5,6-TRICHLORO-1H-BENZO[D]IMIDAZOLE
CAS:16865-11-5
Formula: ClC1=C(Cl)C=C2C(NC(Cl)=N2)=C1
98%
BD67291
MFCD09835289
2,5,6-TRICHLORO-4-METHYLNICOTINIC ACID
CAS:294876-53-2
Formula: O=C(O)C1=C(Cl)N=C(Cl)C(Cl)=C1C
95+%
BD260749
2,5,6-TRICHLORO-4-METHYLNICOTINONITRILE
CAS:63195-39-1
Formula: ClC1=NC(=C(C(=C1C#N)C)Cl)Cl
98%
BD163315
MFCD09754021
2,5,6-TRICHLORO-4-PROPYLNICOTINONITRILE
CAS:63195-40-4
Formula: N#CC1=C(Cl)N=C(Cl)C(Cl)=C1CCC
95+%
BD284535
2,5,6-TRICHLORO-N,N-DIMETHYLNICOTINAMIDE
CAS:N/A
Formula: O=C(C1C=C(Cl)C(Cl)=NC=1Cl)N(C)C
95%
BD00772280
2,5,6-TRICHLORO-N-METHYLNICOTINAMIDE
CAS:N/A
Formula: O=C(C1C=C(Cl)C(Cl)=NC=1Cl)NC
95%
BD00803764
2,5,6-TRICHLOROBENZO[D]THIAZOLE
CAS:120258-61-9
Formula: ClC1C=C2C(N=C(S2)Cl)=CC=1Cl
95+%
BD00765347
n/a
2,5,6-TRICHLORONICOTINALDEHYDE
CAS:55304-74-0
Formula: O=CC1=C(Cl)N=C(Cl)C(Cl)=C1
97%
BD754078
2,5,6-TRICHLORONICOTINAMIDE
CAS:142266-62-4
Formula: O=C(N)C1=C(Cl)N=C(Cl)C(Cl)=C1
97%
BD237000
2,5,6-TRICHLORONICOTINIC ACID
CAS:54718-39-7
Formula: OC(=O)C1=CC(Cl)=C(Cl)N=C1Cl
97%
BD236969
MFCD02070018
2,5,6-TRICHLORONICOTINOHYDRAZIDE
CAS:58584-91-1
Formula: O=C(C1C=C(Cl)C(Cl)=NC=1Cl)NN
95+%
BD00741972
n/a
2,5,6-TRICHLORONICOTINONITRILE
CAS:40381-92-8
Formula: N#CC1=C(Cl)N=C(Cl)C(Cl)=C1
95+%
BD218290
MFCD17392884
2,5,6-TRICHLOROPYRIDIN-3-AMINE
CAS:55304-76-2
Formula: NC1=CC(Cl)=C(Cl)N=C1Cl
95+%
BD248792
MFCD20714285
2,5,6-TRICHLOROPYRIMIDIN-4-AMINE
CAS:28969-60-0
Formula: NC1=NC(Cl)=NC(Cl)=C1Cl
98%
BD93616
MFCD09744035
2,5,6-TRICHLOROQUINAZOLINE
CAS:67092-21-1
Formula: ClC1=C(Cl)C2=CN=C(Cl)N=C2C=C1
97%
BD633828
2,5,6-TRIFLUORONICOTINIC ACID
CAS:773109-19-6
Formula: O=C(O)C1=C(F)N=C(F)C(F)=C1
97%
BD67294
2,5,6-TRIFLUORONICOTINONITRILE
CAS:870065-73-9
Formula: N#CC1=C(F)N=C(F)C(F)=C1
98%
BD67295
MFCD04973023
2,5,6-TRIFLUOROPYRIDINE-3,4-DIAMINE
CAS:6256-96-8
Formula: NC1=C(N)C(F)=C(F)N=C1F
95+%
BD216517
MFCD18803121
2,5,6-TRIMETHYL-2,3-DIHYDRO-1H-INDEN-1-ONE
CAS:89044-51-9
Formula: O=C1C(C)CC2=C1C=C(C)C(C)=C2
95+%
BD272737
2,5,6-TRIMETHYL-3-OXO-2,3-DIHYDROPYRIDAZINE-4-CARBONITRILE
CAS:60296-04-0
Formula: N#CC1=C(C)C(C)=NN(C)C1=O
97%
BD00833595
2,5,6-TRIMETHYL-3-OXO-2,3-DIHYDROPYRIDAZINE-4-CARBOTHIOAMIDE
CAS:114698-30-5
Formula: S=C(C1=C(C)C(C)=NN(C)C1=O)N
97%
BD00798870
2,5,6-TRIMETHYL-3-OXO-2,3-DIHYDROPYRIDAZINE-4-CARBOXYLIC ACID
CAS:106838-00-0
Formula: O=C(C1=C(C)C(C)=NN(C)C1=O)O
97%
BD00817817
2,5,6-TRIMETHYL-4H,7H-[1,2,4]TRIAZOLO[1,5-A]PYRIMIDIN-7-ONE
CAS:879624-34-7
Formula: O=C1C(C)=C(C)NC2=NC(C)=NN12
BD00819015
2,5,6-TRIMETHYLBENZO[D]OXAZOLE
CAS:19219-98-8
Formula: CC1=C(C)C=C2N=C(C)OC2=C1
98%
BD0091
MFCD00022849
2,5,6-TRIMETHYLBENZO[D]THIAZOLE
CAS:5683-41-0
Formula: CC1=C(C)C=C2N=C(C)SC2=C1
95+%
BD67299
MFCD00128832
2,5,6-TRIMETHYLPYRIMIDIN-4-OL
CAS:89943-15-7
Formula: OC1=NC(C)=NC(C)=C1C
95+%
BD279371
2,5,6-TRIMETHYLTHIENO[2,3-D]PYRIMIDINE-4-THIOL
CAS:743452-19-9
Formula: SC1=C(C(C)=C(C)S2)C2=NC(C)=N1
97%
BD496843
MFCD05263743
2,5,7-TRIAZASPIRO[3.4]OCTAN-6-ONE
CAS:1392210-92-2
Formula: O=C(NC1)NC21CNC2
95+%
BD329520
MFCD22372582
2,5,7-TRIAZASPIRO[3.4]OCTAN-8-ONE HYDROCHLORIDE
CAS:686344-68-3
Formula: O=C1NCNC21CNC2.[H]Cl
95+%
BD163807
MFCD12755759
2,5,7-TRIAZASPIRO[3.4]OCTANE-6,8-DIONE HYDROCHLORIDE
CAS:1026796-27-9
Formula: O=C(NC1=O)NC21CNC2.[H]Cl
95+%
BD314075
MFCD20688617
2,5,7-TRICHLOROBENZO[D]THIAZOLE
CAS:898747-75-6
Formula: ClC1=NC2=C(S1)C(Cl)=CC(Cl)=C2
95+%
BD236620
MFCD08459005
2,5,7-TRICHLOROTHIAZOLO[4,5-D]PYRIMIDINE
CAS:122970-50-7
Formula: ClC1=C(SC(Cl)=N2)C2=NC(Cl)=N1
95+%
BD281276
2,5,7-TRIMETHYL-1H-INDOLE-3-CARBALDEHYDE
CAS:88611-38-5
Formula: O=CC1=C(C)NC2=C1C=C(C)C=C2C
97%
BD195290
MFCD07643235
2,5,7-TRIMETHYL-2,3-DIHYDRO-1H-INDEN-1-ONE
CAS:65001-59-4
Formula: CC1CC2=CC(C)=CC(C)=C2C1=O
95+%
BD67304
MFCD09030781
2,5,7-TRIMETHYL-3-PHENYLPYRAZOLO[1,5-A]PYRIMIDINE
CAS:138628-46-3
Formula: CC1=CC(C)=NC2=C(C3=CC=CC=C3)C(C)=NN12
97%
BD584231
2,5,7-TRIMETHYL-3H-IMIDAZO[4,5-B]PYRIDINE
CAS:N/A
Formula: CC1C=C(C)N=C2NC(=NC=12)C
95%
BD00735449
2,5,7-TRIMETHYL-4,5,6,7-TETRAHYDROPYRAZOLO[1,5-A]PYRIMIDINE
CAS:174469-70-6
Formula: CC1CC(C)NC2=CC(C)=NN12
95+%
BD264147
MFCD09332629
2,5,7-TRIMETHYLPYRAZOLO[1,5-A]PYRIMIDINE-3-CARBOXYLIC ACID
CAS:1158269-53-4
Formula: O=C(C1=C2N=C(C)C=C(C)N2N=C1C)O
95+%
BD279010
2,5,7-TRIMETHYLQUINOLIN-8-OL
CAS:6759-80-4
Formula: CC1=NC2=C(C=C1)C(C)=CC(C)=C2O
95+%
BD225848
MFCD00168977
2,5,8,11,14,17,20,23,26,29,32,35-DODECAOXAHEPTATRIACONTAN-37-AMINE
CAS:80506-64-5
Formula: COCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCN
95+%
BD434646
n/a
2,5,8,11,14,17,20,23,26,29,32-UNDECAOXATETRATRIACONTAN-34-AMINE
CAS:854601-60-8
Formula: COCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCN
95+%
BD434644
2,5,8,11,14,17,20,23,26,29-DECAOXAHENTRIACONTAN-31-OL
CAS:27425-92-9
Formula: COCCOCCOCCOCCOCCOCCOCCOCCOCCOCCO
95%
BD262364
MFCD06797087
2,5,8,11,14,17,20,23,26-NONAOXAOCTACOSAN-28-AMINE
CAS:211859-73-3
Formula: COCCOCCOCCOCCOCCOCCOCCOCCOCCN
95+%
BD434549
2,5,8,11,14,17,20,23,26-NONAOXAOCTACOSAN-28-OL
CAS:6048-68-6
Formula: COCCOCCOCCOCCOCCOCCOCCOCCOCCO
93%
BD262363
MFCD06797148
2,5,8,11,14,17,20,23-OCTAOXAHEXACOSAN-26-OIC ACID
CAS:1093647-41-6
Formula: COCCOCCOCCOCCOCCOCCOCCOCCC(O)=O
95%
BD434518
2,5,8,11,14,17,20,23-OCTAOXAPENTACOSAN-25-AMINE
CAS:869718-81-0
Formula: COCCOCCOCCOCCOCCOCCOCCOCCN
95+%
BD434645
2,5,8,11,14,17,20,23-OCTAOXAPENTACOSAN-25-OL
CAS:25990-96-9
Formula: COCCOCCOCCOCCOCCOCCOCCOCCO
96%
BD212984
MFCD06797152
2,5,8,11,14,17,20-HEPTAOXADOCOSAN-22-AMINE
CAS:170572-38-0
Formula: COCCOCCOCCOCCOCCOCCOCCN
95+%
BD434538
2,5,8,11,14,17,20-HEPTAOXATRICOSAN-23-OIC ACID
CAS:874208-91-0
Formula: COCCOCCOCCOCCOCCOCCOCCC(O)=O
95+%
BD434649
2,5,8,11,14,17-HEXAOXANONADECAN-19-AMINE
CAS:184357-46-8
Formula: COCCOCCOCCOCCOCCOCCN
95+%
BD434540
2,5,8,11,14,17-HEXAOXANONADECAN-19-OL
CAS:23601-40-3
Formula: COCCOCCOCCOCCOCCOCCO
98%
BD133156
MFCD00045996
2,5,8,11,14,17-HEXAOXANONADECANE-19-THIOL
CAS:441771-60-4
Formula: COCCOCCOCCOCCOCCOCCS
95+%
BD434581
2,5,8,11,14,17-HEXAOXAOCTADECANE
CAS:1191-87-3
Formula: COCCOCCOCCOCCOCCOC
95+%
BD304163
n/a
2,5,8,11,14-PENTAOXABICYCLO[13.4.0]NONADECA-1(15),16,18-TRIENE-17-CARBALDEHYDE
CAS:60835-73-6
Formula: O=CC(C=C1)=CC2=C1OCCOCCOCCOCCO2
98%
BD634346
MFCD00192180
2,5,8,11,14-Pentaoxaheptadec-16-yne
CAS:1101668-39-6
Formula: COCCOCCOCCOCCOCC#C
98% GC)
BD00775138
2,5,8,11,14-PENTAOXAHEPTADECAN-17-OIC ACID
CAS:81836-43-3
Formula: COCCOCCOCCOCCOCCC(O)=O
98%
BD434637
2,5,8,11,14-PENTAOXAHEXADECAN-16-AMINE
CAS:5498-83-9
Formula: COCCOCCOCCOCCOCCN
95+%
BD434599
2,5,8,11,14-PENTAOXAHEXADECANE-16-THIOL
CAS:524030-00-0
Formula: COCCOCCOCCOCCOCCS
95+%
BD434594
2,5,8,11,14-PENTAOXAPENTADECANE
CAS:143-24-8
Formula: COCCOCCOCCOCCOC
97%
BD153379
MFCD00008505
2,5,8,11-TETRA-TERT-BUTYLPERYLENE
CAS:80663-92-9
Formula: CC(C1=CC2=C(C(C3=C4C5=CC(C(C)(C)C)=CC4=CC(C(C)(C)C)=C3)=CC(C(C)(C)C)=C2)C5=C1)(C)C
97% HPLC)
BD00821768
2,5,8,11-TETRAMETHYL-1,4,7,10-TETRAAZACYCLODODECANE
CAS:494751-27-8
Formula: CC1NCC(C)NCC(C)NCC(C)NC1
98%
BD226538
2,5,8,11-TETRAOXATETRADECAN-14-OIC ACID
CAS:67319-28-2
Formula: COCCOCCOCCOCCC(O)=O
95+%
BD434617
n/a
2,5,8,11-TETRAOXATRIDECAN-13-OL
CAS:23783-42-8
Formula: COCCOCCOCCOCCO
98%
BD7139
MFCD00041756
2,5,8,11-TETRAOXATRIDECAN-13-YL 4-METHYLBENZENESULFONATE
CAS:62921-76-0
Formula: O=S(C1=CC=C(C)C=C1)(OCCOCCOCCOCCOC)=O
95%
BD768012
MFCD11041134
2,5,8,11-TETRAOXATRIDECANE-13-THIOL
CAS:52190-55-3
Formula: COCCOCCOCCOCCS
95+%
BD67308
2,5,8-TRICHLOROQUINAZOLINE
CAS:67092-22-2
Formula: ClC1=CC=C(Cl)C2=CN=C(Cl)N=C12
97%
BD633830
2,5,8-TRIMETHOXY-4-METHYLQUINOLIN-6-AMINE
CAS:49584-51-2
Formula: NC1=CC(OC)=C2N=C(OC)C=C(C)C2=C1OC
97%
BD625444
2,5,8-TRIMETHYL-[1,2,4]TRIAZOLO[1,5-A]PYRAZINE
CAS:54410-76-3
Formula: CC1=NC=C(C)N2C1=NC(C)=N2
95+%
BD249597
MFCD18971092
2,5,8-TRIMETHYLQUINOLINE
CAS:102871-69-2
Formula: CC1=C2N=C(C)C=CC2=C(C)C=C1
95+%
BD282757
MFCD09787532
2,5-ANHYDRO-D-GLUCITOL 1,6-DIPHOSPHATE
CAS:4429-47-4
Formula: O[C@H]1[C@H](O)[C@@H](COP(O)(O)=O)O[C@H]1COP(O)(O)=O
97%
BD67312
MFCD01863342
2,5-BIS((2-HYDROXYETHYL)AMINO)CYCLOHEXA-2,5-DIENE-1,4-DIONE
CAS:5557-53-9
Formula: O=C(C(NCCO)=C1)C=C(NCCO)C1=O
97%
BD596671
MFCD00721337
2,5-BIS(2,2'-BIPYRIDIN-6-YL)-1,1-DIMETHYL-3,4-DIPHENYLSILOLE
CAS:350042-00-1
Formula: C[Si]1(C)C(C2=CC=CC(C3=NC=CC=C3)=N2)=C(C4=CC=CC=C4)C(C5=CC=CC=C5)=C1C6=CC=CC(C7=NC=CC=C7)=N6
98% HPLC,N)
BD00800203
2,5-BIS(2,2,2-TRIFLUOROETHOXY)ANILINE
CAS:66300-37-6
Formula: NC1=CC(OCC(F)(F)F)=CC=C1OCC(F)(F)F
95+%
BD334971
MFCD28291791
2,5-BIS(2,2,2-TRIFLUOROETHOXY)BENZENE-1-SULFONYL CHLORIDE
CAS:152457-95-9
Formula: O=S(C1=CC(OCC(F)(F)F)=CC=C1OCC(F)(F)F)(Cl)=O
95%
BD12573
MFCD00052841
2,5-BIS(2,2,2-TRIFLUOROETHOXY)BENZOHYDRAZIDE
CAS:50778-75-1
Formula: O=C(NN)C1=CC(OCC(F)(F)F)=CC=C1OCC(F)(F)F
95+%
BD12936
MFCD00221192
2,5-BIS(2,2,2-TRIFLUOROETHOXY)BENZOIC ACID
CAS:35480-52-5
Formula: OC(=O)C1=C(OCC(F)(F)F)C=CC(OCC(F)(F)F)=C1
98%
BD20400
MFCD00221424
2,5-BIS(2,4,4-TRIMETHYLPENTAN-2-YL)BENZENE-1,4-DIOL
CAS:903-19-5
Formula: OC1=CC(C(CC(C)(C)C)(C)C)=C(O)C=C1C(CC(C)(C)C)(C)C
95%
BD67320
MFCD00128797
2,5-BIS(2-ETHYLHEXYL)-3,6-BIS(5-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)THIOPHEN-2-YL)PYRROLO[3,4-C]PYRROLE-1,4(2H,5H)-DIONE
CAS:1269004-46-7
Formula: O=C1N(CC(CC)CCCC)C(C2=CC=C(B3OC(C)(C)C(C)(C)O3)S2)=C4C1=C(C5=CC=C(B6OC(C)(C)C(C)(C)O6)S5)N(CC(CC)CCC
95+%
BD262608
2,5-BIS(2-ETHYLHEXYL)-3,6-BIS(5-(TRIMETHYLSTANNYL)THIOPHEN-2-YL)PYRROLO[3,4-C]PYRROLE-1,4(2H,5H)-DIONE
CAS:1392422-47-7
Formula: O=C1N(CC(CC)CCCC)C(C2=CC=C([Sn](C)(C)C)S2)=C3C1=C(C4=CC=C([Sn](C)(C)C)S4)N(CC(CC)CCCC)C3=O
95+%
BD293567
n/a
2,5-BIS(2-ETHYLHEXYL)-3,6-DI(THIOPHEN-2-YL)PYRROLO[3,4-C]PYRROLE-1,4(2H,5H)-DIONE
CAS:1185885-86-2
Formula: O=C1N(CC(CC)CCCC)C(C2=CC=CS2)=C3C1=C(C4=CC=CS4)N(CC(CC)CCCC)C3=O
95+%
BD254710
MFCD22200076
2,5-BIS(2-OCTYLDODECYL)-3,6-DI(THIOPHEN-2-YL)PYRROLO[3,4-C]PYRROLE-1,4(2H,5H)-DIONE
CAS:1267540-02-2
Formula: O=C1N(CC(CCCCCCCC)CCCCCCCCCC)C(C2=CC=CS2)=C3C1=C(C4=CC=CS4)N(CC(CCCCCCCC)CCCCCCCCCC)C3=O
95+%
BD318473
2,5-BIS(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)THIENO[3,2-B]THIOPHENE
CAS:924894-85-9
Formula: CC1(C)C(C)(C)OB(C(S2)=CC3=C2C=C(B4OC(C)(C)C(C)(C)O4)S3)O1
97%
BD226625
2,5-BIS(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)THIOPHENE
CAS:175361-81-6
Formula: CC1(C)C(C)(C)OB(C2=CC=C(B3OC(C)(C)C(C)(C)O3)S2)O1
97%
BD273711
MFCD09800563
2,5-BIS(4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PHENYL)-1,3,4-OXADIAZOLE
CAS:1116122-85-0
Formula: CC1(C)C(C)(C)OB(C2=CC=C(C3=NN=C(C4=CC=C(B5OC(C)(C)C(C)(C)O5)C=C4)O3)C=C2)O1
95+%
BD303076
MFCD25460334
2,5-BIS(4-BROMOPHENYL)-1,1-DIMETHYL-3,4-DIPHENYLSILOLE
CAS:866769-99-5
Formula: C[Si]1(C)C(C2=CC=C(Br)C=C2)=C(C3=CC=CC=C3)C(C4=CC=CC=C4)=C1C5=CC=C(Br)C=C5
95% GC)
BD00801406
2,5-BIS(4-BROMOPHENYL)-1,3,4-OXADIAZOLE
CAS:19542-05-3
Formula: BrC1=CC=C(C2=NN=C(C3=CC=C(Br)C=C3)O2)C=C1
95%
BD303060
MFCD00020715
2,5-BIS(4-CHLOROPHENYL)-1,3,4-OXADIAZOLE
CAS:2491-90-9
Formula: ClC1=CC=C(C2=NN=C(C3=CC=C(Cl)C=C3)O2)C=C1
95+%
BD67340
MFCD00050998
2,5-BIS(4-DIETHYLAMINOPHENYL)-1,3,4-OXADIAZOLE
CAS:1679-98-7
Formula: CCN(C1=CC=C(C2=NN=C(C3=CC=C(N(CC)CC)C=C3)O2)C=C1)CC
99+%
BD306194
MFCD00010070
2,5-BIS(5-(TERT-BUTYL)BENZO[D]OXAZOL-2-YL)THIOPHENE
CAS:7128-64-5
Formula: CC(C)(C)C1=CC2=C(OC(=N2)C2=CC=C(S2)C2=NC3=C(O2)C=CC(=C3)C(C)(C)C)C=C1
98%
BD22336
MFCD00005774
2,5-BIS(BENZYLOXY)BENZALDEHYDE
CAS:6109-54-2
Formula: O=CC1=CC(OCC2=CC=CC=C2)=CC=C1OCC3=CC=CC=C3
97+%
BD182530
MFCD02380367
2,5-BIS(BENZYLOXY)BENZOIC ACID
CAS:67127-91-7
Formula: O=C(O)C1=CC(OCC2=CC=CC=C2)=CC=C1OCC3=CC=CC=C3
98%
BD34573
MFCD00156981
2,5-BIS(ETHYLAMINO)NICOTINONITRILE
CAS:1346809-31-1
Formula: N#CC1=C(NCC)N=CC(NCC)=C1
95+%
BD252541
MFCD19688662
2,5-BIS(METHYLSULFONYL)BENZONITRILE
CAS:1820608-13-6
Formula: N#CC1=CC(S(=O)(C)=O)=CC=C1S(=O)(C)=O
98%
BD452469
MFCD28096642
2,5-BIS(MORPHOLINOMETHYL)-1,4-PHENYLENE DIACETATE
CAS:1865-04-9
Formula: CC(OC1=CC(CN2CCOCC2)=C(OC(C)=O)C=C1CN3CCOCC3)=O
95+%
BD240885
MFCD03413579
2,5-BIS(TRI-N-BUTYLSTANNYL)FURAN
CAS:193361-76-1
Formula: CCCC[Sn](C1=CC=C([Sn](CCCC)(CCCC)CCCC)O1)(CCCC)CCCC
95+%
BD306744
MFCD09833740
2,5-BIS(TRIETHOXYSILYL)THIOPHENE
CAS:40190-22-5
Formula: CCO[Si](C1=CC=C([Si](OCC)(OCC)OCC)S1)(OCC)OCC
95+%
BD251995
2,5-BIS(TRIFLUOROMETHYL)-1,3,4-OXADIAZOLE
CAS:1868-48-0
Formula: FC(C1=NN=C(C(F)(F)F)O1)(F)F
97%
BD2148
2,5-BIS(TRIFLUOROMETHYL)-1H-BENZO[D]IMIDAZOLE
CAS:399-69-9
Formula: FC(C1=CC=C2NC(C(F)(F)F)=NC2=C1)(F)F
95+%
BD248475
2,5-BIS(TRIFLUOROMETHYL)-1H-BENZO[D]IMIDAZOLE-6-CARBOXYLIC ACID
CAS:1309602-77-4
Formula: O=C(C1=C(C(F)(F)F)C=C2N=C(C(F)(F)F)NC2=C1)O
97%
BD492938
2,5-BIS(TRIFLUOROMETHYL)ANILINE
CAS:328-93-8
Formula: C1=C(C(=CC=C1C(F)(F)F)C(F)(F)F)N
98%
BD5773
MFCD00074940
2,5-BIS(TRIFLUOROMETHYL)BENZALDEHYDE
CAS:395-64-2
Formula: O=CC1=CC(C(F)(F)F)=CC=C1C(F)(F)F
97%
BD7165
MFCD00674087
2,5-BIS(TRIFLUOROMETHYL)BENZAMIDE
CAS:53130-46-4
Formula: O=C(N)C1=CC(C(F)(F)F)=CC=C1C(F)(F)F
97%
BD483225
MFCD04973747
2,5-BIS(TRIFLUOROMETHYL)BENZENE-1-SULFONYL CHLORIDE
CAS:351003-22-0
Formula: O=S(C1=CC(C(F)(F)F)=CC=C1C(F)(F)F)(Cl)=O
97%
BD67361
MFCD03094042
2,5-BIS(TRIFLUOROMETHYL)BENZENEBORONIC ACID
CAS:196083-18-8
Formula: OB(C1=CC(C(F)(F)F)=CC=C1C(F)(F)F)O
98%
BD67360
MFCD04038223
2,5-BIS(TRIFLUOROMETHYL)BENZENESULFONAMIDE
CAS:951625-11-9
Formula: O=S(C1=CC(C(F)(F)F)=CC=C1C(F)(F)F)(N)=O
98%
BD188768
2,5-BIS(TRIFLUOROMETHYL)BENZOIC ACID
CAS:42580-42-7
Formula: O=C(O)C1=CC(C(F)(F)F)=CC=C1C(F)(F)F
98%
BD7168
MFCD00013249
2,5-BIS(TRIFLUOROMETHYL)BENZONITRILE
CAS:51012-27-2
Formula: N#CC1=CC(C(F)(F)F)=CC=C1C(F)(F)F
95+%
BD67363
MFCD03094423
2,5-BIS(TRIFLUOROMETHYL)BENZYLAMINE
CAS:771582-21-9
Formula: NCC1=CC(C(F)(F)F)=CC=C1C(F)(F)F
98%
BD00838912
2,5-BIS(TRIFLUOROMETHYL)CINNAMIC ACID
CAS:312619-48-0
Formula: O=C(O)/C=C/C1=CC(C(F)(F)F)=CC=C1C(F)(F)F
95+%
BD307869
MFCD00799486
2,5-BIS(TRIFLUOROMETHYL)FLUOROBENZENE
CAS:887268-08-8
Formula: FC(C1=CC=C(C(F)(F)F)C(F)=C1)(F)F
95%
BD309562
MFCD03412236
2,5-BIS(TRIFLUOROMETHYL)PHENOL
CAS:779-88-4
Formula: OC1=CC(C(F)(F)F)=CC=C1C(F)(F)F
95%
BD10847
MFCD04973414
2,5-BIS(TRIFLUOROMETHYL)PYRIDINE
CAS:20857-44-7
Formula: FC(C1=CN=C(C(F)(F)F)C=C1)(F)F
95+%
BD318972
MFCD00128906
2,5-BIS(TRIMETHYLSILYL)THIAZOLE
CAS:79265-34-2
Formula: C[Si](C1=CN=C([Si](C)(C)C)S1)(C)C
95%
BD67378
MFCD09800395
2,5-BIS(TRIMETHYLSTANNYL)THIENO[3,2-B]THIOPHENE
CAS:469912-82-1
Formula: C[Sn](C(S1)=CC2=C1C=C([Sn](C)(C)C)S2)(C)C
98%
BD305825
n/a
2,5-BIS-(TRIFLUOROMETHYL)PYRAZINE
CAS:1365988-35-7
Formula: FC(C1=CN=C(C(F)(F)F)C=N1)(F)F
95+%
BD323148
MFCD21602144
2,5-BIS[(4-BUTOXYBENZOYL)OXY]-BENZOIC ACID
CAS:205689-93-6
Formula: O=C(O)C1=CC(OC(C2=CC=C(OCCCC)C=C2)=O)=CC=C1OC(C3=CC=C(OCCCC)C=C3)=O
95%
BD00794869
2,5-BIS[(DIMETHYLAMINO)METHYL]CYCLOPENTANONE
CAS:13290-51-2
Formula: O=C1C(CN(C)C)CCC1CN(C)C
95+%
BD171263
MFCD01210808
2,5-Bis[(trimethylsilyl)ethynyl]thieno[3,2-b]thiophene
CAS:139896-65-4
Formula: C[Si](C#CC(S1)=CC2=C1C=C(C#C[Si](C)(C)C)S2)(C)C
98% GC)
BD00780219
2,5-BIS[(TRIMETHYLSILYL)ETHYNYL]THIOPHENE
CAS:79109-69-6
Formula: C[Si](C#CC1=CC=C(C#C[Si](C)(C)C)S1)(C)C
96% GC)
BD00797924
2,5-BIS[[4-(DECYLOXY)BENZOYL]OXY]BENZOIC ACID
CAS:1448589-33-0
Formula: O=C(O)C1=CC(OC(C2=CC=C(OCCCCCCCCCC)C=C2)=O)=CC=C1OC(C3=CC=C(OCCCCCCCCCC)C=C3)=O
95%
BD00774860
2,5-BISPIPERIDIN-1-YLMETHYLBENZENE-1,4-DIOL
CAS:1753-68-0
Formula: OC1=CC(N2CCCCC2)=C(O)C(C)=C1N3CCCCC3
95+%
BD323388
MFCD00185950
2,5-DI([1,1'-BIPHENYL]-4-YL)THIOPHENE
CAS:56316-86-0
Formula: C1(C2=CC=C(C3=CC=CC=C3)C=C2)=CC=C(C4=CC=C(C5=CC=CC=C5)C=C4)S1
95+%
BD331654
2,5-DI(2-THIENYL)-1H-PYRROLE
CAS:89814-62-0
Formula: C1(C2=CC=CS2)=CC=C(C3=CC=CS3)N1
95+%
BD322191
2,5-DI(NAPHTHALEN-1-YL)-1,3,4-OXADIAZOLE
CAS:905-62-4
Formula: C1(C2=C3C=CC=CC3=CC=C2)=NN=C(C4=C5C=CC=CC5=CC=C4)O1
97%
BD67325
MFCD00045582
2,5-DI(THIOPHEN-2-YL)THIENO[3,2-B]THIOPHENE
CAS:21210-90-2
Formula: C1(C=C(C2=CC=CS2)S3)=C3C=C(C4=CC=CS4)S1
94%
BD262634
MFCD11114556
2,5-DI-TERT-BUTYL PYRIDINE-2,5-DICARBOXYLATE
CAS:1414029-44-9
Formula: O=C(C1=NC=C(C(OC(C)(C)C)=O)C=C1)OC(C)(C)C
98%
BD326476
MFCD22574962
2,5-DI-TERT-BUTYL-1H-PYRROLE
CAS:3760-56-3
Formula: CC(C1=CC=C(C(C)(C)C)N1)(C)C
95+%
BD67895
2,5-DI-TERT-BUTYLANILINE
CAS:21860-03-7
Formula: NC1=CC(C(C)(C)C)=CC=C1C(C)(C)C
95%
BD67897
2,5-DI-TERT-BUTYLCYCLOHEXA-2,5-DIENE-1,4-DIONE
CAS:2460-77-7
Formula: O=C(C(C(C)(C)C)=C1)C=C(C(C)(C)C)C1=O
98%
BD67900
2,5-DI-TERT-BUTYLFURAN
CAS:4789-40-6
Formula: CC(C1=CC=C(C(C)(C)C)O1)(C)C
95+%
BD268849
2,5-DI-TERT-BUTYLHYDROQUINONE
CAS:88-58-4
Formula: C1=C(O)C(=CC(=C1C(C)(C)C)O)C(C)(C)C
98%
BD22988
MFCD00008825
2,5-DI-TERT-BUTYLPYRAZOLO[1,5-A]PYRIMIDIN-7-AMINE
CAS:626223-27-6
Formula: NC1=CC(C(C)(C)C)=NC2=CC(C(C)(C)C)=NN12
97%
BD494569
MFCD04035547
2,5-DI-TERT-PENTYLBENZENE-1,4-DIOL
CAS:79-74-3
Formula: OC1=CC(C(C)(C)CC)=C(O)C=C1C(C)(C)CC
93%
BD67894
MFCD00027029
2,5-DI-TERT-PENTYLCYCLOHEXA-2,5-DIENE-1,4-DIONE
CAS:4584-63-8
Formula: O=C1C(C(C)(C)CC)=CC(C(C(C)(C)CC)=C1)=O
95%
BD67893
MFCD00142843
2,5-DIACETOXYHEXANE
CAS:10299-35-1
Formula: CC(OC(C)=O)CCC(OC(C)=O)C
98% GC)
BD00780608
2,5-DIAMINEPYRIMIDINE
CAS:22715-27-1
Formula: C1=C(N)C=NC(=N1)N
95%
BD41477
MFCD00129726
2,5-DIAMINO-2-METHYLPENTANOIC ACID HYDROCHLORIDE
CAS:52372-32-4
Formula: O=C(O)C(C)(N)CCCN.[H]Cl
97%
BD67386
2,5-DIAMINO-3-BROMOBENZONITRILE
CAS:82997-65-7
Formula: N#CC1=CC(N)=CC(Br)=C1N
95+%
BD327776
MFCD22205744
2,5-DIAMINO-3-CHLOROBENZONITRILE
CAS:82997-64-6
Formula: N#CC1=CC(N)=CC(Cl)=C1N
97%
BD67387
MFCD08704820
2,5-DIAMINO-4,6-DICHLOROPYRIMIDINE
CAS:55583-59-0
Formula: ClC1=C(N)C(Cl)=NC(N)=N1
98%
BD9440
MFCD00792652
2,5-DIAMINO-4,6-DIHYDROXYPYRIMIDINE HYDROCHLORIDE
CAS:56830-58-1
Formula: Cl.NC1=NC(O)=C(N)C(O)=N1
98%
BD2319
MFCD00082893
2,5-DIAMINO-6-NITROQUINAZOLIN-4(3H)-ONE
CAS:103884-20-4
Formula: OC1=C2C(N)=C([N+]([O-])=O)C=CC2=NC(N)=N1
97%
BD633821
2,5-DIAMINO-9H-FLUOREN-9-ONE
CAS:46487-37-0
Formula: O=C1C2=C(C3=C1C=CC=C3N)C=CC(N)=C2
97%
BD625387
2,5-DIAMINOADIPIC ACID DIHYDROCHLORIDE
CAS:52408-04-5
Formula: O=C(O)C(N)CCC(N)C(O)=O.[H]Cl.[H]Cl
95+%
BD33920
MFCD09836090
2,5-DIAMINOBENZENE-1,3-DISULFONIC ACID
CAS:6409-48-9
Formula: O=S(C1=CC(N)=CC(S(=O)(O)=O)=C1N)(O)=O
95+%
BD67382
MFCD06200774
2,5-DIAMINOBENZENE-1,4-DIOL DIHYDROCHLORIDE
CAS:24171-03-7
Formula: OC1=CC(N)=C(O)C=C1N.[H]Cl.[H]Cl
95+%
BD67384
MFCD00239416
2,5-DIAMINOBENZENE-1,4-DISULFONIC ACID
CAS:7139-89-1
Formula: O=S(C1=CC(N)=C(S(=O)(O)=O)C=C1N)(O)=O
97%
BD54804
MFCD00272406
2,5-DIAMINOBENZENE-1,4-DITHIOL DIHYDROCHLORIDE
CAS:75464-52-7
Formula: SC1=CC(N)=C(S)C=C1N.[H]Cl.[H]Cl
97%
BD3716
MFCD00142835
2,5-DIAMINOBENZENESULFONAMIDE
CAS:20896-44-0
Formula: O=S(C1=CC(N)=CC=C1N)(N)=O
97%
BD261177
MFCD16618593
2,5-DIAMINOBENZENESULFONIC ACID
CAS:88-45-9
Formula: O=S(C1=CC(N)=CC=C1N)(O)=O
95+%
BD35286
MFCD00007904
2,5-DIAMINOBENZOIC ACID
CAS:610-74-2
Formula: NC1=CC(C(O)=O)=C(N)C=C1
97%
BD4954
MFCD00127689
2,5-DIAMINOBENZOIC ACID DIHYDROCHLORIDE
CAS:1158259-09-6
Formula: O=C(O)C1=CC(N)=CC=C1N.[H]Cl.[H]Cl
96%
BD408546
MFCD01596222
2,5-DIAMINOBENZONITRILE
CAS:14346-13-5
Formula: N#CC1=CC(N)=CC=C1N
97%
BD4803
2,5-DIAMINONICOTINONITRILE
CAS:1184645-19-9
Formula: N#CC1=C(N)N=CC(N)=C1
97%
BD586087
2,5-DIAMINOPYRIDINE DIHYDROCHLORIDE
CAS:26878-35-3
Formula: NC1=CN=C(N)C=C1.[H]Cl.[H]Cl
97%
BD19851
MFCD00040818
2,5-DIAMINOPYRIDINE HYDROCHLORIDE
CAS:119261-84-6
Formula: NC1=CN=C(N)C=C1.[H]Cl
95+%
BD216688
2,5-DIAMINOPYRIMIDIN-4(3H)-ONE
CAS:77994-12-8
Formula: O=C1NC(N)=NC=C1N
95+%
BD271107
2,5-DIAMINOPYRIMIDINE-4,6-DIOL
CAS:40769-69-5
Formula: NC1=NC(O)=C(N)C(O)=N1
95+%
BD5435
MFCD02094729
2,5-DIAMINOPYRIMIDINE-4-CARBOXYLIC ACID
CAS:1260859-20-8
Formula: O=C(C1=NC(N)=NC=C1N)O
95+%
BD222354
MFCD13193549
2,5-DIAMINOTEREPHTHALIC ACID
CAS:945-30-2
Formula: O=C(O)C1=CC(N)=C(C(O)=O)C=C1N
95+%
BD221961
MFCD00464161
2,5-DIAMINOTHIAZOLO[4,5-D]PYRIMIDIN-7(6H)-ONE
CAS:22288-77-3
Formula: NC1=NC2=C(S1)C(=O)NC(N)=N2
95+%
BD237686
MFCD09753539
2,5-DIAZABICYCLO[2.2.1]HEPTANE DIHYDROCHLORIDE
CAS:89487-38-7
Formula: [H]Cl.[H]Cl.C1(C2)NCC2NC1
98%
BD33927
n/a
2,5-DIAZABICYCLO[2.2.2]OCTANE
CAS:658-24-2
Formula: C1(CC2)NCC2NC1
95+%
BD225959
MFCD08694643
2,5-DIAZABICYCLO[2.2.2]OCTANE DIHYDROCHLORIDE
CAS:1192-92-3
Formula: C1(CC2)NCC2NC1.[H]Cl.[H]Cl
96%
BD268704
MFCD11506237
2,5-DIAZABICYCLO[2.2.2]OCTANE-3,6-DIONE
CAS:1004-98-4
Formula: O=C(C1N2)NC(CC1)C2=O
95+%
BD317197
MFCD18086974
2,5-DIAZABICYCLO[4.1.0]HEPTANE DIHYDROCHLORIDE
CAS:87640-95-7
Formula: [H]Cl.[H]Cl.C12NCCNC1C2
97%
BD00811291
2,5-DIAZABICYCLO[4.2.0]OCTANE BIS(2,2,2-TRIFLUOROACETATE)
CAS:936706-47-7
Formula: O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.C12NCCNC1CC2
97%
BD00801737
2,5-DIAZASPIRO[3.4]OCTAN-6-ONE
CAS:1373028-77-3
Formula: O=C(CC1)NC21CNC2
97%
BD570341
MFCD22209694
2,5-DIAZASPIRO[3.4]OCTAN-6-ONE HYDROCHLORIDE
CAS:1630906-86-3
Formula: O=C(CC1)NC21CNC2.[H]Cl
95+%
BD300631
2,5-DIAZASPIRO[3.5]NONANE DIHYDROCHLORIDE
CAS:1334499-64-7
Formula: [H]Cl.[H]Cl.C1NCC12NCCCC2
97%
BD328994
MFCD20261444
2,5-DIBENZYLIDENECYCLOPENTANONE
CAS:895-80-7
Formula: O=C1/C(CC/C1=C\C2=CC=CC=C2)=C/C3=CC=CC=C3
98%
BD67414
2,5-DIBENZYLOCTAHYDROPYRROLO[3,4-C]PYRROLE
CAS:165894-00-8
Formula: N1(CC2=CC=CC=C2)CC(CN(CC3=CC=CC=C3)C4)C4C1
98%
BD249386
2,5-DIBENZYLTETRAHYDROPYRROLO[3,4-C]PYRROLE-1,3(2H,3AH)-DIONE
CAS:165893-99-2
Formula: O=C(C1C2CN(CC3=CC=CC=C3)C1)N(CC4=CC=CC=C4)C2=O
95+%
BD27701
MFCD09037882
2,5-DIBROMO-[1,2,4]TRIAZOLO[1,5-A]PYRIDINE
CAS:1214901-64-0
Formula: BrC1=CC=CC2=NC(Br)=NN12
95+%
BD245331
MFCD20527883
2,5-DIBROMO-1,1,3,4-TETRAPHENYLSILOLE
CAS:200068-36-6
Formula: BrC1=C(C2=CC=CC=C2)C(C3=CC=CC=C3)=C(Br)[Si]1(C4=CC=CC=C4)C5=CC=CC=C5
98% GC)
BD00808783
2,5-DIBROMO-1,1-DIMETHYL-3,4-DIPHENYLSILOLE
CAS:686290-22-2
Formula: C[Si]1(C)C(Br)=C(C2=CC=CC=C2)C(C3=CC=CC=C3)=C1Br
98% GC)
BD00754962
2,5-DIBROMO-1,3,4-THIADIAZOLE
CAS:55981-29-8
Formula: BrC1=NN=C(Br)S1
98%
BD223435
MFCD00466397
2,5-DIBROMO-1,3-DICHLOROBENZENE
CAS:19393-97-6
Formula: ClC1=C(Br)C(Cl)=CC(Br)=C1
95+%
BD254348
2,5-DIBROMO-1,3-DIETHYLBENZENE
CAS:314084-64-5
Formula: CCC1=C(Br)C(CC)=CC(Br)=C1
97%
BD496006
MFCD09743753
2,5-DIBROMO-1,3-DIFLUOROBENZENE
CAS:128259-71-2
Formula: FC1=C(Br)C(F)=CC(Br)=C1
98%
BD260769
2,5-DIBROMO-1,3-DIMETHYLBENZENE
CAS:100189-84-2
Formula: CC1=CC(Br)=CC(C)=C1Br
98%
BD67458
MFCD00079745
2,5-DIBROMO-1,4-DIMETHYL-1H-IMIDAZOLE
CAS:850429-58-2
Formula: CC1=C(Br)N(C)C(Br)=N1
98%
BD67419
MFCD06659900
2,5-DIBROMO-1-CHLORO-3-FLUOROBENZENE
CAS:1000572-88-2
Formula: FC1=C(Br)C(Cl)=CC(Br)=C1
97%
BD224247
2,5-DIBROMO-1-CHLORO-3-METHYLBENZENE
CAS:1000573-82-9
Formula: CC1=CC(Br)=CC(Cl)=C1Br
97%
BD587971
MFCD09878184
2,5-DIBROMO-1-METHYL-1H-IMIDAZOLE
CAS:53857-59-3
Formula: CN1C(Br)=CN=C1Br
96%
BD67420
MFCD01632217
2,5-DIBROMO-1-METHYL-1H-IMIDAZOLE-4-CARBONITRILE
CAS:1799420-96-4
Formula: N#CC1=C(Br)N(C)C(Br)=N1
95+%
BD297513
2,5-DIBROMO-1-METHYL-3-NITROBENZENE
CAS:408340-39-6
Formula: CC1=CC(Br)=CC([N+]([O-])=O)=C1Br
97%
BD483297
MFCD11846032
2,5-DIBROMO-1-TRITYL-1H-IMIDAZOLE
CAS:850429-53-7
Formula: BrC1=CN=C(Br)N1C(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4
95%
BD67421
MFCD04115731
2,5-DIBROMO-1H-IMIDAZOL-4-AMINE
CAS:1029720-13-5
Formula: NC1N=C(Br)NC=1Br
95+%
BD00752178
n/a
2,5-DIBROMO-1H-IMIDAZOLE
CAS:64591-03-3
Formula: BrC1=CN=C(Br)N1
97%
BD66598
MFCD02179517
2,5-DIBROMO-3,4,6-TRIFLUOROANILINE
CAS:232267-32-2
Formula: NC1=C(F)C(Br)=C(F)C(F)=C1Br
95+%
BD67422
MFCD01862003
2,5-DIBROMO-3,4,6-TRIFLUOROPHENOL
CAS:5510-39-4
Formula: OC1=C(F)C(Br)=C(F)C(F)=C1Br
95+%
BD257972
MFCD01861999
2,5-DIBROMO-3,4-DIHYDROXYBENZALDEHYDE
CAS:70625-28-4
Formula: O=CC1=CC(Br)=C(O)C(O)=C1Br
97%
BD583903
2,5-DIBROMO-3,4-DIMETHOXYBENZALDEHYDE
CAS:854660-03-0
Formula: O=CC1=CC(Br)=C(OC)C(OC)=C1Br
97%
BD583905
2,5-DIBROMO-3,4-DINITROTHIOPHENE
CAS:52431-30-8
Formula: O=[N+](C1=C(Br)SC(Br)=C1[N+]([O-])=O)[O-]
97%
BD67423
MFCD00015537
2,5-DIBROMO-3,6-DIFLUOROANILINE
CAS:702640-60-6
Formula: NC1=C(F)C(Br)=CC(F)=C1Br
97%
BD462962
MFCD20484398
2,5-DIBROMO-3,6-DIFLUOROBENZALDEHYDE
CAS:1263377-10-1
Formula: O=CC1=C(F)C(Br)=CC(F)=C1Br
97%
BD460671
MFCD18379858
2,5-DIBROMO-3,6-DIFLUOROBENZAMIDE
CAS:1803713-73-6
Formula: O=C(N)C1=C(F)C(Br)=CC(F)=C1Br
97%
BD485600
MFCD28783322
2,5-DIBROMO-3,6-DIFLUOROBENZENE-1-SULFONYL CHLORIDE
CAS:207853-66-5
Formula: O=S(C1=C(F)C(Br)=CC(F)=C1Br)(Cl)=O
95+%
BD67425
MFCD00052364
2,5-DIBROMO-3,6-DIFLUOROBENZOIC ACID
CAS:1263376-61-9
Formula: O=C(O)C1=C(F)C(Br)=CC(F)=C1Br
97%
BD468846
MFCD18379859
2,5-DIBROMO-3,6-DIFLUOROBENZONITRILE
CAS:1806347-47-6
Formula: N#CC1=C(F)C(Br)=CC(F)=C1Br
97%
BD461374
MFCD28783420
2,5-DIBROMO-3,6-DIHYDROXYCYCLOHEXA-2,5-DIENE-1,4-DIONE
CAS:4370-59-6
Formula: O=C1C(Br)=C(O)C(C(Br)=C1O)=O
95%
BD118722
MFCD00058956
2,5-DIBROMO-3,6-DIMETHYLPYRIDINE
CAS:38749-93-8
Formula: CC1=C(Br)C=C(C)C(Br)=N1
97%
BD248787
MFCD00234281
2,5-DIBROMO-3-(2-ETHYLHEXYL)THIOPHENE
CAS:444177-63-3
Formula: CCCCC(CC)CC1=C(Br)SC(Br)=C1
95+%
BD254712
2,5-DIBROMO-3-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PYRIDINE
CAS:852228-17-2
Formula: BrC1=CN=C(Br)C(B(OC2(C)C)OC2(C)C)=C1
95+%
BD161577
MFCD08689613
2,5-DIBROMO-3-(BROMOMETHYL)PYRIDINE
CAS:61686-65-5
Formula: BrCC1=CC(Br)=CN=C1Br
95+%
BD284420
2,5-DIBROMO-3-(CHLOROMETHYL)PYRIDINE
CAS:N/A
Formula: ClCC1C(Br)=NC=C(Br)C=1
95%
BD00738094
2,5-DIBROMO-3-(DIFLUOROMETHYL)PYRIDIN-4-OL
CAS:1806838-73-2
Formula: OC1=C(C(F)F)C(Br)=NC=C1Br
97%
BD489288
MFCD25486085
2,5-DIBROMO-3-(ETHOXYCARBONYL)BENZOIC ACID
CAS:N/A
Formula: O=C(C1C(Br)=C(C(=O)OCC)C=C(Br)C=1)O
95%
BD00750158
2,5-DIBROMO-3-(METHOXYCARBONYL)BENZOIC ACID
CAS:N/A
Formula: O=C(C1C(Br)=C(C(=O)OC)C=C(Br)C=1)O
95%
BD00770270
2,5-DIBROMO-3-(TRIFLUOROMETHYL)PYRIDINE
CAS:79623-39-5
Formula: FC(C1=CC(Br)=CN=C1Br)(F)F
97%
BD168963
MFCD13185530
2,5-DIBROMO-3-BUTYLTHIOPHENE
CAS:116971-10-9
Formula: CCCCC1=C(Br)SC(Br)=C1
97%
BD10624
2,5-DIBROMO-3-CHLORO-4-METHYLPYRIDINE
CAS:1335050-94-6
Formula: CC1=C(Cl)C(Br)=NC=C1Br
95+%
BD258885
2,5-DIBROMO-3-CHLOROANILINE
CAS:1449688-58-7
Formula: NC1=CC(Br)=CC(Cl)=C1Br
97%
BD617779
2,5-DIBROMO-3-CHLOROPYRAZINE
CAS:21943-16-8
Formula: ClC1=NC(Br)=CN=C1Br
95+%
BD215437
MFCD18250179
2,5-DIBROMO-3-CHLOROPYRIDINE
CAS:160599-70-2
Formula: ClC1=CC(Br)=CN=C1Br
98%
BD32147
MFCD08277306
2,5-DIBROMO-3-CYCLOHEXYLTHIOPHENE
CAS:302912-44-3
Formula: BrC1=CC(C2CCCCC2)=C(Br)S1
97%
BD341904
MFCD02683539
2,5-DIBROMO-3-DECYLTHIOPHENE
CAS:158956-23-1
Formula: CCCCCCCCCCC1=C(Br)SC(Br)=C1
97%
BD5693
2,5-DIBROMO-3-DODECYLTHIOPHENE
CAS:148256-63-7
Formula: CCCCCCCCCCCCC1=C(Br)SC(Br)=C1
98%
BD8819
2,5-DIBROMO-3-ETHYLTHIOPHENE
CAS:53119-57-6
Formula: CCC1=C(Br)SC(Br)=C1
95+%
BD247025
MFCD20486051
2,5-DIBROMO-3-FLUOROPYRIDINE
CAS:156772-60-0
Formula: FC1=CC(Br)=CN=C1Br
98%
BD18605
MFCD06659497
2,5-DIBROMO-3-HEXADECYLTHIOPHENE
CAS:178452-13-6
Formula: CCCCCCCCCCCCCCCCC1=C(Br)SC(Br)=C1
96% GC)
BD00826067
2,5-DIBROMO-3-HEXYLTHIOPHENE
CAS:116971-11-0
Formula: CCCCCCC1=C(Br)SC(Br)=C1
98%
BD0220
2,5-DIBROMO-3-IODOPYRAZINE
CAS:1447607-44-4
Formula: IC1=NC(Br)=CN=C1Br
97%
BD439844
MFCD25542083
2,5-DIBROMO-3-IODOPYRIDINE
CAS:1214383-63-7
Formula: IC1=CC(Br)=CN=C1Br
95+%
BD260510
MFCD13185519
2,5-DIBROMO-3-METHOXYPYRAZINE
CAS:489431-66-5
Formula: COC1=NC(Br)=CN=C1Br
95+%
BD158276
MFCD09909711
2,5-DIBROMO-3-METHOXYPYRIDINE
CAS:1142191-57-8
Formula: COC1=CC(Br)=CN=C1Br
97%
BD197172
2,5-DIBROMO-3-METHYLBENZOIC ACID
CAS:908597-09-1
Formula: O=C(O)C1=CC(Br)=CC(C)=C1Br
97%
BD598710
MFCD18379818
2,5-DIBROMO-3-METHYLFURAN
CAS:89284-16-2
Formula: CC1=C(Br)OC(Br)=C1
97%
BD238751
MFCD11870160
2,5-DIBROMO-3-METHYLPYRAZINE
CAS:1260672-37-4
Formula: CC1=NC(Br)=CN=C1Br
95+%
BD302144
MFCD18250173
2,5-DIBROMO-3-METHYLPYRIDINE
CAS:3430-18-0
Formula: C1=C(Br)C=NC(=C1C)Br
98%
BD3321
MFCD02093085
2,5-DIBROMO-3-METHYLTHIOPHENE
CAS:13191-36-1
Formula: CC1=C(Br)SC(Br)=C1
97%
BD67434
MFCD00015470
2,5-DIBROMO-3-NITROPYRAZINE
CAS:1245645-88-8
Formula: O=[N+](C1=NC(Br)=CN=C1Br)[O-]
95+%
BD163047
MFCD18072686
2,5-DIBROMO-3-NITROPYRIDINE
CAS:15862-37-0
Formula: C1=C([N+]([O-])=O)C(=NC=C1Br)Br
98%
BD18636
MFCD09266223
2,5-DIBROMO-3-NITROTHIOPHENE
CAS:2160-51-2
Formula: O=[N+](C1=C(Br)SC(Br)=C1)[O-]
95+%
BD67436
MFCD06660778
2,5-DIBROMO-3-OCTYLTHIOPHENE
CAS:149703-84-4
Formula: CCCCCCCCC1=C(Br)SC(Br)=C1
98%
BD0905
2,5-DIBROMO-3-TETRADECYLTHIOPHENE
CAS:160096-74-2
Formula: CCCCCCCCCCCCCCC1=C(Br)SC(Br)=C1
97% GC)
BD00801958
2,5-DIBROMO-4-(4-METHOXYPHENOXY)PYRIMIDINE
CAS:1298101-41-3
Formula: COC1=CC=C(OC2=NC(Br)=NC=C2Br)C=C1
95+%
BD269037
2,5-DIBROMO-4-(DIFLUOROMETHYL)PYRIDIN-3-OL
CAS:1806878-60-3
Formula: OC1=C(C(F)F)C(Br)=CN=C1Br
97%
BD469848
MFCD25486087
2,5-DIBROMO-4-(TRIFLUOROMETHYL)PYRIDINE
CAS:1099597-94-0
Formula: FC(C1=CC(Br)=NC=C1Br)(F)F
97%
BD194601
MFCD10699123
2,5-DIBROMO-4-(TRIFLUOROMETHYL)PYRIMIDINE
CAS:785777-91-5
Formula: FC(C1=NC(Br)=NC=C1Br)(F)F
95%
BD474578
MFCD13176602
2,5-DIBROMO-4-CHLOROPYRIDINE
CAS:1033203-47-2
Formula: ClC1=CC(Br)=NC=C1Br
96%
BD324714
MFCD11100661
2,5-DIBROMO-4-ETHOXYPYRIDINE
CAS:52311-22-5
Formula: CCOC1=CC(Br)=NC=C1Br
97%
BD583883
2,5-DIBROMO-4-FLUORO-1-METHYL-1H-IMIDAZOLE
CAS:1824064-07-4
Formula: CN1C(Br)=C(F)N=C1Br
95+%
BD337384
MFCD28119174
2,5-DIBROMO-4-FLUOROANILINE
CAS:172377-05-8
Formula: NC1=CC(Br)=C(F)C=C1Br
98%
BD245033
MFCD18089317
2,5-DIBROMO-4-FLUOROBENZENE-1-SULFONYL CHLORIDE
CAS:1123306-72-8
Formula: O=S(C1=CC(Br)=C(F)C=C1Br)(Cl)=O
97%
BD496879
MFCD18089320
2,5-DIBROMO-4-FLUOROBENZENESULFONAMIDE
CAS:1263377-19-0
Formula: O=S(C1=CC(Br)=C(F)C=C1Br)(N)=O
97%
BD455936
MFCD18089322
2,5-DIBROMO-4-FLUOROBENZENETHIOL
CAS:1263376-15-3
Formula: SC1=CC(Br)=C(F)C=C1Br
97%
BD458424
MFCD18089321
2,5-DIBROMO-4-FLUOROBENZONITRILE
CAS:1379326-67-6
Formula: N#CC1=CC(Br)=C(F)C=C1Br
97%
BD303696
MFCD18906828
2,5-DIBROMO-4-FLUOROIODOBENZENE
CAS:1263376-83-5
Formula: FC1=C(Br)C=C(I)C(Br)=C1
95+%
BD322983
MFCD18089319
2,5-DIBROMO-4-FLUOROPYRIDINE
CAS:1033203-46-1
Formula: FC1=CC(Br)=NC=C1Br
95+%
BD220036
2,5-DIBROMO-4-HYDROXYBENZOIC ACID
CAS:101421-19-6
Formula: O=C(O)C1=CC(Br)=C(O)C=C1Br
95+%
BD332326
MFCD10574704
2,5-DIBROMO-4-HYDROXYBENZONITRILE
CAS:1824055-68-6
Formula: N#CC1=CC(Br)=C(O)C=C1Br
97%
BD443691
MFCD28053778
2,5-DIBROMO-4-IODOPYRIDINE
CAS:1061357-86-5
Formula: IC1=CC(Br)=NC=C1Br
95+%
BD217782
2,5-DIBROMO-4-METHOXYPYRIDINE
CAS:1211520-71-6
Formula: COC1=CC(Br)=NC=C1Br
97%
BD563577
MFCD18255776
2,5-DIBROMO-4-METHOXYPYRIMIDINE
CAS:89284-12-8
Formula: COC1=NC(Br)=NC=C1Br
98%
BD269031
2,5-DIBROMO-4-METHYL-3-NITROPYRIDINE
CAS:947534-69-2
Formula: O=[N+](C1=C(C)C(Br)=CN=C1Br)[O-]
98%
BD67438
MFCD09839233
2,5-DIBROMO-4-METHYLANILINE
CAS:140373-62-2
Formula: NC1=CC(Br)=C(C)C=C1Br
95+%
BD220652
2,5-DIBROMO-4-METHYLBENZALDEHYDE
CAS:706820-09-9
Formula: O=CC1=CC(Br)=C(C)C=C1Br
97%
BD763462
2,5-DIBROMO-4-METHYLBENZOIC ACID
CAS:20871-01-6
Formula: O=C(O)C1=CC(Br)=C(C)C=C1Br
97%
BD748077
2,5-DIBROMO-4-METHYLIMIDAZOLE
CAS:219814-29-6
Formula: CC1=C(N=C([NH]1)Br)Br
97+%
BD41463
MFCD02179519
2,5-DIBROMO-4-METHYLPYRIDINE
CAS:3430-26-0
Formula: CC1=CC(Br)=NC=C1Br
98%
BD20330
MFCD00234955
2,5-DIBROMO-4-METHYLPYRIMIDINE
CAS:171408-73-4
Formula: CC1=NC(Br)=NC=C1Br
97%
BD242293
MFCD13193658
2,5-DIBROMO-4-METHYLTHIAZOLE
CAS:79247-78-2
Formula: CC1=C(Br)SC(Br)=N1
98%
BD67442
MFCD09260910
2,5-DIBROMO-4-NITRO-1H-IMIDAZOLE
CAS:6154-30-9
Formula: [O-][N+](=O)C1=C(Br)NC(Br)=N1
97%
BD67443
MFCD11877989
2,5-DIBROMO-4-NITROANILINE
CAS:25462-68-4
Formula: NC1=CC(Br)=C([N+]([O-])=O)C=C1Br
95+%
BD331065
MFCD14582986
2,5-DIBROMO-4-NITROPYRIDINE
CAS:221241-31-2
Formula: O=[N+](C1=CC(Br)=NC=C1Br)[O-]
95+%
BD225985
MFCD16876007
2,5-DIBROMO-6-METHYLPYRIDINE
CAS:39919-65-8
Formula: BrC1=NC(=C(C=C1)Br)C
97%
BD33555
MFCD06254589
2,5-DIBROMO-8-FLUOROQUINOLINE
CAS:1597291-48-9
Formula: FC1=C2N=C(Br)C=CC2=C(Br)C=C1
97%
BD752633
2,5-DIBROMO-N-HYDROXYNICOTINIMIDAMIDE
CAS:N/A
Formula: N=C(C1C=C(Br)C=NC=1Br)NO
95%
BD00747837
2,5-DIBROMO-N-METHOXY-N-METHYLNICOTINAMIDE
CAS:1394291-26-9
Formula: O=C(C1=CC(Br)=CN=C1Br)N(OC)C
97%
BD563804
MFCD22543728
2,5-DIBROMOANISOLE
CAS:95970-08-4
Formula: COC1=CC(Br)=CC=C1Br
98%
BD161265
MFCD07780698
2,5-DIBROMOBENZALDEHYDE
CAS:74553-29-0
Formula: BrC1=C(C=O)C=C(C=C1)Br
98+%
BD0016
MFCD00462864
2,5-DIBROMOBENZENE-1,4-DIAMINE
CAS:25462-61-7
Formula: NC1=CC(Br)=C(N)C=C1Br
97%
BD625834
MFCD19441210
2,5-DIBROMOBENZENE-1,4-DIOL
CAS:14753-51-6
Formula: OC1=CC(Br)=C(O)C=C1Br
98%
BD67457
MFCD00192664
2,5-DIBROMOBENZENE-1-SULFONYL CHLORIDE
CAS:23886-64-8
Formula: O=S(C1=CC(Br)=CC=C1Br)(Cl)=O
97%
BD3098
MFCD00060685
2,5-DIBROMOBENZENESULFONAMIDE
CAS:7467-11-0
Formula: O=S(C1=CC(Br)=CC=C1Br)(N)=O
97%
BD67450
MFCD00460436
2,5-DIBROMOBENZO[B]FURAN-3(2H)-ONE
CAS:1823918-46-2
Formula: O=C1C2=CC(Br)=CC=C2OC1Br
97%
BD00790594
2,5-DIBROMOBENZO[D]OXAZOLE
CAS:1520623-36-2
Formula: BrC1C=C2N=C(Br)OC2=CC=1
95+%
BD00747040
n/a
2,5-DIBROMOBENZOIC ACID
CAS:610-71-9
Formula: C1=C(Br)C=CC(=C1C(O)=O)Br
98%
BD4113
MFCD00016494
2,5-DIBROMOBENZONITRILE
CAS:57381-41-6
Formula: N#CC1=CC(Br)=CC=C1Br
98%
BD323915
MFCD00672994
2,5-DIBROMOBENZOTHIAZOLE
CAS:1019111-64-8
Formula: BrC1=NC2=C(S1)C=CC(=C2)Br
95+%
BD161928
MFCD09749228
2,5-DIBROMOCYCLOHEXA-2,5-DIENE-1,4-DIONE
CAS:1633-14-3
Formula: O=C1C(Br)=CC(C(Br)=C1)=O
95%
BD67418
2,5-DIBROMOFURAN-3-CARBOXYLIC ACID
CAS:32460-22-3
Formula: OC(=O)C1=C(Br)OC(Br)=C1
95+%
BD216476
MFCD21603840
2,5-DIBROMOHEXANEDIAMIDE
CAS:99584-96-0
Formula: O=C(N)C(Br)CCC(Br)C(N)=O
95+%
BD389324
MFCD27976335
2,5-DIBROMOHEXANEDIOIC ACID
CAS:3479-85-4
Formula: O=C(O)C(Br)CCC(Br)C(O)=O
95+%
BD67447
MFCD00046516
2,5-DIBROMOISONICOTINALDEHYDE
CAS:959244-28-1
Formula: O=CC1=C(Br)C=NC(Br)=C1
97%
BD67469
MFCD10574709
2,5-DIBROMOISONICOTINIC ACID
CAS:942473-59-8
Formula: BrC1=NC=C(C(=C1)C(=O)O)Br
97%
BD168839
MFCD08741485
2,5-DIBROMOISOPHTHALIC ACID
CAS:N/A
Formula: O=C(C1C(Br)=C(C(=O)O)C=C(Br)C=1)O
95%
BD00753772
2,5-DIBROMONICOTINALDEHYDE
CAS:852181-11-4
Formula: O=CC1=C(Br)N=CC(Br)=C1
95+%
BD67459
MFCD07368560
2,5-DIBROMONICOTINAMIDE
CAS:1394291-40-7
Formula: O=C(N)C1=C(Br)N=CC(Br)=C1
97%
BD563812
MFCD22543724
2,5-DIBROMONICOTINIC ACID
CAS:29312-99-0
Formula: BrC1=C(C(=O)O)C=C(C=N1)Br
97%
BD67460
MFCD06254512
2,5-DIBROMONICOTINIMIDAMIDE
CAS:N/A
Formula: N=C(C1C=C(Br)C=NC=1Br)N
95%
BD00780214
2,5-DIBROMONICOTINIMIDAMIDE HYDROCHLORIDE
CAS:N/A
Formula: N=C(C1C=C(Br)C=NC=1Br)N.[H]Cl
95%
BD00748920
2,5-DIBROMONICOTINONITRILE
CAS:1214340-41-6
Formula: N#CC1=C(Br)N=CC(Br)=C1
97%
BD215156
MFCD13185477
2,5-DIBROMOPHENOL
CAS:28165-52-8
Formula: OC1=CC(Br)=CC=C1Br
98%
BD67462
2,5-DIBROMOPHENYLBORONIC ACID
CAS:1008106-93-1
Formula: BrC1=C(C=C(C=C1)Br)B(O)O
97%
BD7924
MFCD09743927
2,5-DIBROMOPYRAZINE
CAS:23229-26-7
Formula: BrC1=NC=C(N=C1)Br
98%
BD32766
MFCD08061601
2,5-DIBROMOPYRIDIN-3-AMINE
CAS:90902-84-4
Formula: NC1=CC(Br)=CN=C1Br
98%
BD67426
MFCD09266224