Phone (USA) +1 212-348-5610
Whatsapp: +1 516-336-9307
WeChat: chembuyersguide
Chemical Search
 
























BLD Pharmatech Ltd.




Country: China

BLD Pharmatech Ltd.
488 Taoqiao Road, Building 5, 5F
HuiNan Town, Pudong New Area,
Shanghai 201203, China


Phone: +86-21-61629022
E-Mail:E-Mail this Supplier

Contact: Elva Cui

http://www.bldpharm.com

BLD Pharmatech Ltd.

Page: Home | 1 | 2 | 3 | 4 | 5 | 6 | 7 | 8 | 9 | 10 | 11 | 12 | 13 | 14 | 15 | 16 | 17 | 18 | 19 | 20 | 21 | 22 | 23 | 24 | 25 | 26 | 27 | 28 | 29 | 30 | 31 | 32 | 33 | 34 | 35 | 36 | 37 | 38 | 39 | 40 | 41 | 42 | 43 | 44 | 45 | 46 | 47 | 48 | 49 | 50 | 51 | 52 | 53 | 54 | 55 | 56 | 57 | 58 | 59 | 60 | 61 | 62 | 63 | 64 | 65 | 66 | 67 | 68 | 69 | 70 | 71 | 72 | 73 | 74 | 75 | 76 | 77 | 78 | 79 | 80 | 81 | 82 | 83 | 84 | 85 | 86 | 87 | 88 | 89 | 90 | 91 | 92 | 93 | 94 | 95 | 96 | 97 | 98 | 99 | 100 | 101 | 102 | 103 | 104 | 105 | 106 | 107 | 108 | 109 | 110 | 111 | 112 | 113 | 114 | 115 | 116 | 117 | 118 | 119 | 120 | 121 | 122 | 123 | 124 | 125 | 126 | 127 | 128 | 129 | 130 | 131 | 132 | 133 | 134 | 135 | 136 | 137 | 138 | 139 | 140 | 141 | 142 | 143 | 144 | 145 | 146 | 147 | 148 | 149 | 150 | 151 | 152 | 153 | 154 | 155 | 156 | 157 | 158 | 159 | 160 | 161 | 162 | 163 | 164 | 165 | 166 | 167 | 168 | 169 | 170 | 171 | 172 | 173 | 174 | 175 | 176 | 177 | 178 | 179 | 180 | 181 | 182 | 183 | 184 | 185 | 186 | 187 | 188 | 189 | 190 | 191 | 192 | 193 | 194 | 195 | 196 | 197 | 198 | 199 | 200 | 201 | 202 | 203 | 204 | 205 | 206 | 207 | 208 | 209 | 210 | 211 | 212 | 213 | 214 | 215 | 216 | 217 | 218 | 219 | 220 | 221 | 222 | 223 | 224 | 225 | 226 | 227 | 228 | 229 | 230 | 231 | 232 | 233 | 234 | 235 | 236 | 237 | 238 | 239 | 240 | 241 | 242 | 243 | 244 | 245 | 246 | 247 | 248 | 249 | 250 | 251 | 252 | 253 | 254 | 255 | 256 | 257 | 258 | 259 | 260 | 261 | 262 | 263 | 264 | 265 | 266 | 267 | 268 | 269 | 270 | 271 | 272 | 273 | 274 | 275 | 276 | 277 | 278 | 279 | 280 | 281 | 282 | 283 | 284 | 285 | 286 | 287 | 288 | 289 | 290 | 291 | 292 | 293 | 294 | 295 | 296 | 297 | 298 | 299 | 300 | 301 | 302 | 303 | 304 | 305 | 306 | 307 | 308 |
 


Product List

2,5-DIBROMOPYRIDIN-3-OL
CAS:857429-79-9
Formula: OC1=CC(Br)=CN=C1Br
97%
BD196690
MFCD09959722
2,5-DIBROMOPYRIDIN-4-AMINE
CAS:221241-37-8
Formula: NC1=CC(Br)=NC=C1Br
95+%
BD261277
MFCD13185831
2,5-DIBROMOPYRIDIN-4-OL
CAS:1033203-55-2
Formula: OC1=CC(Br)=NC=C1Br
98%
BD324715
MFCD11100682
2,5-DIBROMOPYRIDINE
CAS:624-28-2
Formula: BrC1=CN=C(Br)C=C1
98%
BD7925
MFCD00006221
2,5-DIBROMOPYRIDINE 1-OXIDE
CAS:20734-22-9
Formula: BrC1=CC=C(Br)[N+]([O-])=C1
95%
BD00802610
2,5-DIBROMOPYRIDINE-3,4-DIAMINE
CAS:221241-11-8
Formula: NC1=C(N)C(Br)=NC=C1Br
98%
BD238859
MFCD15526814
2,5-DIBROMOPYRIMIDINE
CAS:32779-37-6
Formula: BrC1=NC=C(C=N1)Br
98%
BD20238
MFCD08275684
2,5-DIBROMOSELENOPHENE
CAS:1755-36-8
Formula: BrC1=CC=C(Br)[Se]1
98% GC)
BD00764554
2,5-DIBROMOTEREPHTALIC ACID
CAS:13731-82-3
Formula: C1=C(Br)C(=CC(=C1C(O)=O)Br)C(O)=O
98%
BD5593
MFCD00204593
2,5-DIBROMOTEREPHTHALALDEHYDE
CAS:63525-48-4
Formula: BrC1=CC(C=O)=C(Br)C=C1C=O
97%
BD164199
MFCD11521314
2,5-DIBROMOTEREPHTHALONITRILE
CAS:18870-11-6
Formula: N#CC1=CC(Br)=C(C#N)C=C1Br
95+%
BD164140
MFCD03426731
2,5-DIBROMOTHIAZOLE
CAS:4175-78-4
Formula: C1=C(SC(=N1)Br)Br
98%
BD41682
MFCD00016891
2,5-DIBROMOTHIAZOLE-4-CARBOXYLIC ACID
CAS:943735-44-2
Formula: O=C(C1=C(Br)SC(Br)=N1)O
95+%
BD67473
MFCD10001381
2,5-DIBROMOTHIENO[2,3-B]THIOPHENE
CAS:25121-86-2
Formula: BrC(S1)=CC2=C1SC(Br)=C2
97%
BD582569
MFCD18451757
2,5-DIBROMOTHIENO[3,2-B]THIOPHENE
CAS:25121-87-3
Formula: BrC(S1)=CC2=C1C=C(Br)S2
97%
BD167906
MFCD03931293
2,5-DIBROMOTHIOPHENE
CAS:3141-27-3
Formula: C1=C(Br)SC(=C1)Br
98%
BD9373
MFCD00005420
2,5-DIBROMOTHIOPHENE 1,1-DIOXIDE
CAS:89088-95-9
Formula: BrC1=CC=C(Br)S1(=O)=O
95+%
BD322189
2,5-DIBROMOTHIOPHENE-3,4-DICARBALDEHYDE
CAS:57308-96-0
Formula: O=CC1=C(Br)SC(Br)=C1C=O
95+%
BD281561
2,5-DIBROMOTHIOPHENE-3,4-DICARBOXYLIC ACID
CAS:190723-12-7
Formula: O=C(C1=C(Br)SC(Br)=C1C(O)=O)O
95%
BD268496
MFCD08695787
2,5-DIBROMOTHIOPHENE-3-CARBALDEHYDE
CAS:1193-69-7
Formula: O=CC1=C(Br)SC(Br)=C1
95+%
BD225526
MFCD03426905
2,5-DIBROMOTHIOPHENE-3-CARBONITRILE
CAS:18792-01-3
Formula: N#CC1=C(Br)SC(Br)=C1
95+%
BD264534
MFCD22578679
2,5-DIBROMOTHIOPHENE-3-CARBOXAMIDE
CAS:857979-62-5
Formula: O=C(C1=C(Br)SC(Br)=C1)N
95+%
BD264537
MFCD18801039
2,5-DIBROMOTHIOPHENE-3-CARBOXYLIC ACID
CAS:7311-70-8
Formula: O=C(C1=C(Br)SC(Br)=C1)O
97%
BD212051
MFCD08445656
2,5-DICARBOXYLIC ACID-3,4-ETHYLENE DIOXYTHIOPHENE
CAS:18361-03-0
Formula: OC(=O)C1=C2OCCOC2=C(S1)C(O)=O
95%
BD18988
MFCD00966477
2,5-DICHLORO(1,3-DIOXOLAN-2-YLMETHYL)BENZENE
CAS:898759-15-4
Formula: ClC1=CC=C(Cl)C(CC2OCCO2)=C1
95+%
BD310639
MFCD04117652
2,5-DICHLORO-1,6-NAPHTHYRIDINE
CAS:23616-35-5
Formula: ClC1=C2C=CC(Cl)=NC2=CC=N1
97%
BD55086
2,5-DICHLORO-1,8-NAPHTHYRIDINE
CAS:91870-15-4
Formula: ClC1=CC=C2C(Cl)=CC=NC2=N1
95+%
BD238371
MFCD13181698
2,5-DICHLORO-1-FLUORO-3-METHYLBENZENE
CAS:1242339-87-2
Formula: CC1=C(Cl)C(F)=CC(Cl)=C1
97%
BD282772
MFCD16817664
2,5-DICHLORO-1-METHYL-3,6-DIHYDROPYRIDIN-4(1H)-ONE
CAS:1624262-49-2
Formula: O=C1CC(Cl)N(C)CC1Cl
95+%
BD289449
2,5-DICHLORO-1-METHYLPYRIDIN-4(1H)-ONE
CAS:1449008-17-6
Formula: O=C1C=C(Cl)N(C)C=C1Cl
95+%
BD297755
MFCD24848705
2,5-DICHLORO-1-NITRO-3-(TRIFLUOROMETHYL)BENZENE
CAS:98373-83-2
Formula: FC(C1=C(Cl)C([N+]([O-])=O)=CC(Cl)=C1)(F)F
95+%
BD208104
2,5-DICHLORO-1H-IMIDAZO[4,5-B]PYRIDINE
CAS:438190-90-0
Formula: ClC1=CC=C2C(N=C(Cl)N2)=N1
95+%
BD158277
MFCD11518936
2,5-DICHLORO-1H-INDOLE-3-CARBALDEHYDE
CAS:535924-87-9
Formula: O=CC1=C(Cl)NC2=C1C=C(Cl)C=C2
95+%
BD263665
MFCD05178178
2,5-DICHLORO-1H-PYRROLO[3,2-B]PYRIDINE
CAS:1000342-87-9
Formula: ClC1=CC=C(NC(Cl)=C2)C2=N1
95+%
BD301463
2,5-DICHLORO-2'-MORPHOLINOMETHYL BENZOPHENONE
CAS:898751-05-8
Formula: O=C(C1=CC=CC=C1CN2CCOCC2)C3=CC(Cl)=CC=C3Cl
95+%
BD309987
MFCD03842443
2,5-DICHLORO-2'-PIPERIDINOMETHYL BENZOPHENONE
CAS:898773-69-8
Formula: O=C(C1=CC=CC=C1CN2CCCCC2)C3=CC(Cl)=CC=C3Cl
95+%
BD311905
MFCD03842500
2,5-DICHLORO-2'-PYRROLIDINOMETHYL BENZOPHENONE
CAS:898774-97-5
Formula: O=C(C1=CC=CC=C1CN2CCCC2)C3=CC(Cl)=CC=C3Cl
95+%
BD311999
MFCD03842557
2,5-DICHLORO-2'-THIOMORPHOLINOMETHYL BENZOPHENONE
CAS:898782-32-6
Formula: O=C(C1=CC=CC=C1CN2CCSCC2)C3=CC(Cl)=CC=C3Cl
95+%
BD312683
MFCD03842784
2,5-DICHLORO-2,5-DIMETHYLHEXANE
CAS:6223-78-5
Formula: CC(C)(Cl)CCC(C)(Cl)C
98%
BD67488
MFCD00126854
2,5-DICHLORO-3'-(1,3-DIOXOLAN-2-YL)BENZOPHENONE
CAS:898759-55-2
Formula: O=C(C1=CC=CC(C2OCCO2)=C1)C3=CC(Cl)=CC=C3Cl
95+%
BD310677
MFCD07699986
2,5-DICHLORO-3'-MORPHOLINOMETHYL BENZOPHENONE
CAS:898792-22-8
Formula: O=C(C1=CC=CC(CN2CCOCC2)=C1)C3=CC(Cl)=CC=C3Cl
95+%
BD313606
MFCD03841934
2,5-DICHLORO-3'-PIPERIDINOMETHYL BENZOPHENONE
CAS:898793-52-7
Formula: O=C(C1=CC=CC(CN2CCCCC2)=C1)C3=CC(Cl)=CC=C3Cl
95+%
BD313736
MFCD03841991
2,5-DICHLORO-3'-PYRROLIDINOMETHYL BENZOPHENONE
CAS:898770-80-4
Formula: O=C(C1=CC=CC(CN2CCCC2)=C1)C3=CC(Cl)=CC=C3Cl
95+%
BD311692
MFCD03842048
2,5-DICHLORO-3'-THIOMORPHOLINOMETHYL BENZOPHENONE
CAS:898787-84-3
Formula: O=C(C1=CC=CC(CN2CCSCC2)=C1)C3=CC(Cl)=CC=C3Cl
95+%
BD313191
MFCD03842273
2,5-DICHLORO-3,6-DIFLUOROBENZALDEHYDE
CAS:1263376-60-8
Formula: O=CC1=C(F)C(Cl)=CC(F)=C1Cl
97%
BD590068
MFCD18379847
2,5-DICHLORO-3,6-DIFLUOROBENZOIC ACID
CAS:1263376-11-9
Formula: O=C(O)C1=C(F)C(Cl)=CC(F)=C1Cl
97%
BD590048
MFCD18379846
2,5-DICHLORO-3,6-DIMETHYLANILINE
CAS:81742-11-2
Formula: NC1=C(C)C(Cl)=CC(C)=C1Cl
95+%
BD262701
MFCD20696073
2,5-DICHLORO-3,6-DIMETHYLPYRIDINE
CAS:125014-98-4
Formula: CC1=C(Cl)C=C(C)C(Cl)=N1
95+%
BD284501
2,5-DICHLORO-3-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PYRIDINE
CAS:1073371-98-8
Formula: CC1(C)OB(OC1(C)C)C1=CC(Cl)=CN=C1Cl
96%
BD236040
MFCD08063094
2,5-DICHLORO-3-(DIFLUOROMETHYL)PYRIDINE
CAS:71701-93-4
Formula: FC(F)C1=CC(Cl)=CN=C1Cl
95+%
BD238789
MFCD18384828
2,5-DICHLORO-3-(DIMETHOXYMETHYL)PYRIDINE
CAS:1299607-61-6
Formula: COC(C1=CC(Cl)=CN=C1Cl)OC
97%
BD602798
MFCD18803499
2,5-DICHLORO-3-(METHOXYMETHYL)PYRIDINE
CAS:1386986-05-5
Formula: COCC1=CC(Cl)=CN=C1Cl
97%
BD448747
MFCD23163276
2,5-DICHLORO-3-(METHYLTHIO)PYRIDINE
CAS:1416713-50-2
Formula: CSC1=CC(Cl)=CN=C1Cl
95+%
BD329709
MFCD22689783
2,5-DICHLORO-3-(TRIFLUOROMETHYL)ANILINE
CAS:103995-81-9
Formula: NC1=CC(Cl)=CC(C(F)(F)F)=C1Cl
97%
BD479815
MFCD27986858
2,5-DICHLORO-3-(TRIFLUOROMETHYL)BENZOIC ACID
CAS:871254-76-1
Formula: O=C(O)C1=CC(Cl)=CC(C(F)(F)F)=C1Cl
97%
BD270143
2,5-DICHLORO-3-(TRIFLUOROMETHYL)PYRIDINE
CAS:70158-59-7
Formula: FC(C1=CC(Cl)=CN=C1Cl)(F)F
97%
BD196659
MFCD00042244
2,5-DICHLORO-3-FLUORO-4-IODOPYRIDINE
CAS:514798-04-0
Formula: IC1=C(F)C(Cl)=NC=C1Cl
95+%
BD334527
MFCD20925318
2,5-DICHLORO-3-FLUOROBENZALDEHYDE
CAS:1553716-42-9
Formula: O=CC1=CC(Cl)=CC(F)=C1Cl
97%
BD593283
MFCD22414486
2,5-DICHLORO-3-FLUOROBENZOIC ACID
CAS:501008-42-0
Formula: OC(=O)C1=C(Cl)C(F)=CC(Cl)=C1
95+%
BD236855
MFCD13250174
2,5-DICHLORO-3-FLUOROISONICOTINALDEHYDE
CAS:1936591-33-1
Formula: O=CC1=C(Cl)C=NC(Cl)=C1F
97%
BD442921
MFCD28405283
2,5-DICHLORO-3-FLUOROISONICOTINIC ACID
CAS:514798-00-6
Formula: O=C(O)C1=C(Cl)C=NC(Cl)=C1F
95+%
BD334526
MFCD20921504
2,5-DICHLORO-3-FLUOROPYRIDINE
CAS:103999-77-5
Formula: FC1=CC(Cl)=CN=C1Cl
98%
BD167751
MFCD10699709
2,5-DICHLORO-3-HYDROXY-6-METHOXYBENZOIC ACID
CAS:7600-50-2
Formula: O=C(O)C1=C(OC)C(Cl)=CC(O)=C1Cl
95+%
BD83045
2,5-DICHLORO-3-IODOPYRIDINE
CAS:942206-23-7
Formula: IC1=CC(Cl)=CN=C1Cl
98%
BD67495
MFCD09037444
2,5-DICHLORO-3-METHOXY-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PYRIDINE
CAS:1357387-36-0
Formula: CC1(C)C(C)(C)OB(C2=C(OC)C(Cl)=NC=C2Cl)O1
95+%
BD321860
MFCD20487033
2,5-DICHLORO-3-METHOXY-6-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PYRIDINE
CAS:1357387-52-0
Formula: CC1(C)C(C)(C)OB(C2=C(Cl)C=C(OC)C(Cl)=N2)O1
95+%
BD321862
MFCD18803488
2,5-DICHLORO-3-METHOXYISONICOTINALDEHYDE
CAS:1305324-89-3
Formula: O=CC1=C(Cl)C=NC(Cl)=C1OC
97%
BD602841
MFCD20487035
2,5-DICHLORO-3-METHOXYISONICOTINIC ACID
CAS:1305324-55-3
Formula: O=C(O)C1=C(Cl)C=NC(Cl)=C1OC
97%
BD602820
MFCD20487034
2,5-DICHLORO-3-METHOXYPYRAZINE
CAS:36398-43-3
Formula: COC1=NC(Cl)=CN=C1Cl
97%
BD587626
2,5-DICHLORO-3-METHOXYPYRIDINE
CAS:1214366-19-4
Formula: COC1=CC(Cl)=CN=C1Cl
98%
BD242414
MFCD13185540
2,5-DICHLORO-3-METHYLANILINE
CAS:1379291-18-5
Formula: NC1=CC(Cl)=CC(C)=C1Cl
95+%
BD281762
MFCD20700007
2,5-DICHLORO-3-METHYLBENZALDEHYDE
CAS:1160573-34-1
Formula: O=CC1=CC(Cl)=CC(C)=C1Cl
97%
BD463399
MFCD11846003
2,5-DICHLORO-3-METHYLBENZOIC ACID
CAS:1160573-37-4
Formula: O=C(O)C1=CC(Cl)=CC(C)=C1Cl
97%
BD484245
MFCD11846004
2,5-DICHLORO-3-METHYLPYRAZINE
CAS:107378-41-6
Formula: CC1=NC(Cl)=CN=C1Cl
95+%
BD298118
MFCD15144441
2,5-DICHLORO-3-METHYLPYRIDINE
CAS:59782-88-6
Formula: CC1=CC(Cl)=CN=C1Cl
98%
BD21688
MFCD03840754
2,5-DICHLORO-3-METHYLTHIOPHENE
CAS:17249-90-0
Formula: CC1=C(Cl)SC(Cl)=C1
97%
BD2597
MFCD00022490
2,5-DICHLORO-3-NITROBENZOIC ACID
CAS:88-86-8
Formula: O=C(O)C1=CC(Cl)=CC([N+]([O-])=O)=C1Cl
98%
BD22999
MFCD00014691
2,5-DICHLORO-3-NITROPYRIDIN-4-AMINE
CAS:405230-91-3
Formula: NC1=C([N+]([O-])=O)C(Cl)=NC=C1Cl
95+%
BD248718
MFCD18909332
2,5-DICHLORO-3-NITROPYRIDINE
CAS:21427-62-3
Formula: ClC1=NC=C(C=C1[N+](=O)[O-])Cl
98%
BD19366
MFCD06658963
2,5-DICHLORO-3-PHENYLQUINOXALINE
CAS:N/A
Formula: ClC1C=CC=C2C=1N=C(C(=N2)Cl)C1C=CC=CC=1
95%
BD00731038
2,5-DICHLORO-4'-(1,3-DIOXOLAN-2-YL)BENZOPHENONE
CAS:898760-70-8
Formula: O=C(C1=CC=C(C2OCCO2)C=C1)C3=CC(Cl)=CC=C3Cl
95+%
BD310770
MFCD07700037
2,5-DICHLORO-4'-MORPHOLINOMETHYL BENZOPHENONE
CAS:898770-59-7
Formula: O=C(C1=CC=C(CN2CCOCC2)C=C1)C3=CC(Cl)=CC=C3Cl
95+%
BD311671
MFCD03841422
2,5-DICHLORO-4'-PIPERIDINOMETHYL BENZOPHENONE
CAS:898775-57-0
Formula: O=C(C1=CC=C(CN2CCCCC2)C=C1)C3=CC(Cl)=CC=C3Cl
95+%
BD312055
MFCD03841479
2,5-DICHLORO-4'-PYRROLIDINOMETHYL BENZOPHENONE
CAS:898776-83-5
Formula: O=C(C1=CC=C(CN2CCCC2)C=C1)C3=CC(Cl)=CC=C3Cl
95+%
BD312175
MFCD03841536
2,5-DICHLORO-4'-THIOMORPHOLINOMETHYL BENZOPHENONE
CAS:898783-14-7
Formula: O=C(C1=CC=C(CN2CCSCC2)C=C1)C3=CC(Cl)=CC=C3Cl
95+%
BD312759
MFCD03841763
2,5-DICHLORO-4,6-DIIODOPYRIDIN-3-OL
CAS:1261365-34-7
Formula: OC1=C(I)C(Cl)=C(I)N=C1Cl
95+%
BD314698
MFCD18374111
2,5-DICHLORO-4,6-DIMETHYLNICOTINIC ACID
CAS:142266-66-8
Formula: O=C(O)C1=C(Cl)N=C(C)C(Cl)=C1C
97+%
BD238231
MFCD02932725
2,5-DICHLORO-4,6-DIMETHYLNICOTINONITRILE
CAS:91591-63-8
Formula: CC1=C(C(=NC(=C1Cl)C)Cl)C#N
98%
BD67504
MFCD00052631
2,5-DICHLORO-4,6-DIMETHYLPYRIMIDINE
CAS:19573-83-2
Formula: CC1=C(Cl)C(C)=NC(Cl)=N1
95+%
BD271316
MFCD25960625
2,5-DICHLORO-4-(1,1,2,3,3,3-HEXAFLUOROPROPOXY)ANILINE
CAS:103015-84-5
Formula: NC1=CC(Cl)=C(OC(F)(F)C(F)C(F)(F)F)C=C1Cl
95+%
BD232773
MFCD17170052
2,5-DICHLORO-4-(1H-PYRROL-1-YL)ANILINE
CAS:175135-55-4
Formula: NC1=CC(Cl)=C(N2C=CC=C2)C=C1Cl
95+%
BD67501
2,5-DICHLORO-4-(3-METHYL-5-OXO-4,5-DIHYDRO-1H-PYRAZOL-1-YL)BENZENESULFONIC ACID
CAS:84-57-1
Formula: O=S(C1=CC(Cl)=C(N2N=C(C)CC2=O)C=C1Cl)(O)=O
95%
BD12668
MFCD00035706
2,5-DICHLORO-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PYRIDINE
CAS:1073353-98-6
Formula: CC1(C)OB(OC1(C)C)C1=CC(Cl)=NC=C1Cl
96%
BD236033
MFCD06798256
2,5-DICHLORO-4-(4-METHOXYPHENOXY)PYRIMIDINE
CAS:358978-09-3
Formula: COC1=CC=C(OC2=NC(Cl)=NC=C2Cl)C=C1
95+%
BD281680
MFCD22715650
2,5-DICHLORO-4-(DIFLUOROMETHOXY)ANILINE
CAS:1804421-14-4
Formula: NC1=CC(Cl)=C(OC(F)F)C=C1Cl
97%
BD462165
MFCD28785183
2,5-DICHLORO-4-(DIFLUOROMETHYL)PYRIDINE
CAS:1374659-30-9
Formula: FC(C1=CC(Cl)=NC=C1Cl)F
95+%
BD304296
MFCD22199291
2,5-DICHLORO-4-(TRIFLUOROMETHYL)PYRIDINE
CAS:89719-92-6
Formula: FC(C1=CC(Cl)=NC=C1Cl)(F)F
96%
BD182668
MFCD09749663
2,5-DICHLORO-4-(TRIFLUOROMETHYL)PYRIMIDINE
CAS:785777-98-2
Formula: FC(C1=NC(Cl)=NC=C1Cl)(F)F
95%
BD204418
MFCD13176599
2,5-DICHLORO-4-AMINOPHENOL
CAS:50392-39-7
Formula: ClC1=C(C=C(C(=C1)N)Cl)O
96%
BD21055
MFCD09743861
2,5-DICHLORO-4-CYCLOPROPOXYPYRIMIDINE
CAS:1823893-30-6
Formula: ClC1=CN=C(Cl)N=C1OC2CC2
97%
BD440320
MFCD26406915
2,5-DICHLORO-4-ETHOXYPYRIMIDINE
CAS:1351762-11-2
Formula: CCOC1=NC(Cl)=NC=C1Cl
95+%
BD329131
MFCD23161540
2,5-DICHLORO-4-FLUOROANILINE
CAS:2729-37-5
Formula: NC1=CC(Cl)=C(F)C=C1Cl
97%
BD479843
MFCD06808808
2,5-DICHLORO-4-FLUOROBENZENETHIOL
CAS:1349718-28-0
Formula: SC1=CC(Cl)=C(F)C=C1Cl
97%
BD459971
MFCD20233377
2,5-DICHLORO-4-FLUOROPYRIDINE
CAS:1214350-63-6
Formula: FC1=CC(Cl)=NC=C1Cl
97%
BD455301
MFCD13185533
2,5-DICHLORO-4-IODO-3-METHOXYPYRIDINE
CAS:1299607-34-3
Formula: COC1=C(I)C(Cl)=CN=C1Cl
97%
BD602787
MFCD18803486
2,5-DICHLORO-4-IODOPYRIDINE
CAS:796851-03-1
Formula: IC1=CC(Cl)=NC=C1Cl
98%
BD160294
MFCD13185538
2,5-DICHLORO-4-ISOPROPOXYANILINE
CAS:478399-40-5
Formula: NC1=CC(Cl)=C(OC(C)C)C=C1Cl
95+%
BD284439
2,5-DICHLORO-4-ISOPROPOXYBENZALDEHYDE
CAS:1707584-13-1
Formula: O=CC1=CC(Cl)=C(OC(C)C)C=C1Cl
97%
BD621198
2,5-DICHLORO-4-ISOPROPOXYBENZOIC ACID
CAS:1431727-75-1
Formula: O=C(O)C1=CC(Cl)=C(OC(C)C)C=C1Cl
97%
BD616890
2,5-DICHLORO-4-ISOPROPOXYPYRIMIDINE
CAS:1351762-13-4
Formula: CC(OC1=NC(Cl)=NC=C1Cl)C
97%
BD440321
MFCD23737398
2,5-DICHLORO-4-METHOXYANILINE
CAS:101251-23-4
Formula: NC1=CC(Cl)=C(OC)C=C1Cl
98%
BD473252
MFCD16606083
2,5-DICHLORO-4-METHOXYBENZOIC ACID
CAS:2500-03-0
Formula: O=C(O)C1=CC(Cl)=C(OC)C=C1Cl
95%
BD517161
MFCD00214270
2,5-DICHLORO-4-METHOXYPYRIDINE
CAS:1122090-95-2
Formula: COC1=CC(Cl)=NC=C1Cl
95+%
BD225293
MFCD13185541
2,5-DICHLORO-4-METHOXYPYRIMIDINE
CAS:5750-74-3
Formula: COC1=C(Cl)C=NC(Cl)=N1
97%
BD234943
MFCD11858598
2,5-DICHLORO-4-METHYL-1H-BENZO[D]IMIDAZOLE
CAS:N/A
Formula: CC1=C2C(NC(Cl)=N2)=CC=C1Cl
BD00788974
2,5-DICHLORO-4-METHYL-3-NITROPYRIDINE
CAS:884495-05-0
Formula: O=[N+](C1=C(C)C(Cl)=CN=C1Cl)[O-]
97%
BD22979
2,5-DICHLORO-4-METHYLANILINE
CAS:88434-66-6
Formula: NC1=CC(Cl)=C(C)C=C1Cl
95+%
BD281758
MFCD20690650
2,5-DICHLORO-4-METHYLBENZOIC ACID
CAS:21460-88-8
Formula: O=C(O)C1=CC(Cl)=C(C)C=C1Cl
97%
BD449862
MFCD24479896
2,5-DICHLORO-4-METHYLPYRIDINE
CAS:886365-00-0
Formula: CC1=CC(Cl)=NC=C1Cl
97%
BD167413
MFCD07375099
2,5-DICHLORO-4-METHYLPYRIMIDINE
CAS:1192064-63-3
Formula: ClC1=NC=C(C(=N1)C)Cl
97%
BD161373
MFCD13193656
2,5-DICHLORO-4-METHYLTHIOPHENE-3-CARBALDEHYDE
CAS:210098-00-3
Formula: O=CC1=C(Cl)SC(Cl)=C1C
95+%
BD281528
MFCD24685978
2,5-DICHLORO-4-NITROANILINE
CAS:6627-34-5
Formula: NC1=CC(Cl)=C([N+]([O-])=O)C=C1Cl
98%
BD9826
MFCD00025157
2,5-DICHLORO-4-NITROPHENOL
CAS:5847-57-4
Formula: OC1=C(Cl)C=C(C(Cl)=C1)[N+]([O-])=O
95+%
BD237518
MFCD08689866
2,5-DICHLORO-4-NITROTHIOPHENE-3-SULFONYL CHLORIDE
CAS:59768-12-6
Formula: O=S(C1=C(Cl)SC(Cl)=C1[N+]([O-])=O)(Cl)=O
97%
BD00778743
2,5-DICHLORO-6-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)QUINAZOLINE
CAS:N/A
Formula: ClC1=C(B2OC(C)(C)C(C)(C)O2)C=CC3=C1C=NC(Cl)=N3
97%
BD443283
MFCD28405536
2,5-DICHLORO-6-(HYDROXYMETHYL)-4-IODOPYRIDIN-3-OL
CAS:1261365-52-9
Formula: OC1=C(I)C(Cl)=C(CO)N=C1Cl
95+%
BD314710
MFCD18374112
2,5-DICHLORO-6-(HYDROXYMETHYL)PYRIDIN-3-OL
CAS:1261365-99-4
Formula: OC1=CC(Cl)=C(CO)N=C1Cl
95+%
BD314741
MFCD18374106
2,5-DICHLORO-6-(TRIFLUOROMETHYL)PYRIMIDIN-4-AMINE
CAS:84737-30-4
Formula: NC1=NC(Cl)=NC(C(F)(F)F)=C1Cl
95+%
BD264835
2,5-DICHLORO-6-CYCLOPROPYLNICOTINONITRILE
CAS:1135283-17-8
Formula: N#CC1=C(Cl)N=C(C2CC2)C(Cl)=C1
95+%
BD200935
MFCD11840988
2,5-DICHLORO-6-FLUORO-1H-BENZO[D]IMIDAZOLE
CAS:142356-65-8
Formula: FC1=C(Cl)C=C2N=C(Cl)NC2=C1
97%
BD497766
MFCD12963758
2,5-DICHLORO-6-IODO-3-METHOXYPYRIDINE
CAS:1261365-95-0
Formula: COC1=CC(Cl)=C(I)N=C1Cl
95+%
BD314738
MFCD18374115
2,5-DICHLORO-6-IODONICOTINALDEHYDE
CAS:1299607-54-7
Formula: O=CC1=C(Cl)N=C(I)C(Cl)=C1
97%
BD582096
MFCD18803498
2,5-DICHLORO-6-IODOPYRIDIN-3-OL
CAS:1261365-62-1
Formula: OC1=CC(Cl)=C(I)N=C1Cl
95+%
BD314715
MFCD18374107
2,5-DICHLORO-6-METHOXY-4-METHYLNICOTINONITRILE
CAS:886047-45-6
Formula: N#CC1=C(Cl)N=C(OC)C(Cl)=C1C
97%
BD163380
2,5-DICHLORO-6-METHYL-3-NITROPYRIDINE
CAS:1624260-64-5
Formula: O=[N+](C1=CC(Cl)=C(C)N=C1Cl)[O-]
95+%
BD289543
MFCD26792314
2,5-DICHLORO-7-METHOXYQUINAZOLIN-4(3H)-ONE
CAS:601516-86-3
Formula: OC1=C2C(Cl)=CC(OC)=CC2=NC(Cl)=N1
97%
BD633793
2,5-DICHLORO-7H-PYRROLO[2,3-D]PYRIMIDINE
CAS:N/A
Formula: ClC1C2C(=NC(=NC=2)Cl)NC=1
95%
BD00721591
n/a
2,5-DICHLORO-8-METHOXYQUINAZOLINE
CAS:953040-09-0
Formula: COC1=CC=C(Cl)C2=CN=C(Cl)N=C12
97%
BD633833
2,5-DICHLORO-8-METHYLQUINOLINE-4-CARBOXYLIC ACID
CAS:1267302-08-8
Formula: O=C(C1=CC(Cl)=NC2=C(C)C=CC(Cl)=C12)O
97%
BD608975
2,5-DICHLORO-N'-[3-CHLORO-5-(TRIFLUOROMETHYL)PYRIDIN-2-YL]PYRIDINE-3-CARBOHYDRAZIDE
CAS:680217-58-7
Formula: O=C(C1=CC(Cl)=CN=C1Cl)NNC2=NC=C(C(F)(F)F)C=C2Cl
97%
BD00811578
2,5-DICHLORO-N,N-DIMETHYLBENZENESULFONAMIDE
CAS:88522-19-4
Formula: O=S(C1=CC(Cl)=CC=C1Cl)(N(C)C)=O
95+%
BD324364
MFCD01211994
2,5-DICHLORO-N-(2-(ISOPROPYLSULFONYL)PHENYL)PYRIMIDIN-4-AMINE
CAS:761440-16-8
Formula: CC(C)S(=O)(=O)C1=C(NC2=C(Cl)C=NC(Cl)=N2)C=CC=C1
98%
BD237827
MFCD12827956
2,5-DICHLORO-N-(5-METHYL-1H-PYRAZOL-3-YL)PYRIMIDIN-4-AMINE
CAS:543712-81-8
Formula: CC1=CC(NC2=NC(Cl)=NC=C2Cl)=NN1
97%
BD316941
n/a
2,5-DICHLORO-N-(PYRROLIDIN-2-YLMETHYL)ANILINE OXALATE
CAS:1177285-53-8
Formula: ClC1=CC=C(Cl)C(NCC2NCCC2)=C1.O=C(O)C(O)=O
95+%
BD321425
MFCD08277114
2,5-DICHLORO-N-ETHYLANILINE
CAS:42265-81-6
Formula: CCNC1=CC(Cl)=CC=C1Cl
96%
BD28700
MFCD06658423
2,5-DICHLORO-N-METHOXY-N-METHYLISONICOTINAMIDE
CAS:864674-17-9
Formula: O=C(N(OC)C)C1=C(Cl)C=NC(Cl)=C1
97%
BD448918
MFCD15526781
2,5-DICHLORO-N-METHYLANILINE HYDROCHLORIDE
CAS:1193389-58-0
Formula: CNC1=CC(Cl)=CC=C1Cl.[H]Cl
98%
BD230524
2,5-DICHLORO-N-METHYLBENZENESULFONAMIDE
CAS:6326-15-4
Formula: O=S(C1=CC(Cl)=CC=C1Cl)(NC)=O
95+%
BD323976
MFCD01211993
2,5-DICHLORO-N-METHYLPYRIMIDIN-4-AMINE
CAS:940927-35-5
Formula: CNC1=NC(Cl)=NC=C1Cl
95+%
BD246616
2,5-DICHLORO-P-XYLENE
CAS:1124-05-6
Formula: CC1=CC(Cl)=C(C)C=C1Cl
98%
BD41185
MFCD00000610
2,5-DICHLOROBENZALDEHYDE
CAS:6361-23-5
Formula: C1=C(C(=CC=C1Cl)Cl)C=O
95%
BD34447
MFCD00156140
2,5-DICHLOROBENZAMIDE
CAS:980-26-7
Formula: C3=C2C(C1=CC(=CC=C1NC2=CC4=C3NC5=C(C4=O)C=C(C)C=C5)C)=O
98+%
BD148031
MFCD00071968
2,5-DICHLOROBENZENE-1,3-DISULFONYL DICHLORIDE
CAS:111228-71-8
Formula: O=S(C1=CC(Cl)=CC(S(=O)(Cl)=O)=C1Cl)(Cl)=O
95+%
BD267689
MFCD00625741
2,5-DICHLOROBENZENE-1,4-DIAMINE
CAS:20103-09-7
Formula: NC1=CC(Cl)=C(N)C=C1Cl
97%
BD218887
MFCD00007902
2,5-DICHLOROBENZENESULFONAMIDE
CAS:7720-45-8
Formula: O=S(C1=CC(Cl)=CC=C1Cl)(N)=O
97%
BD67517
2,5-DICHLOROBENZENESULFONIC ACID
CAS:88-42-6
Formula: O=S(C1=CC(Cl)=CC=C1Cl)(O)=O
98%
BD35269
2,5-DICHLOROBENZENESULFONIC ACID DIHYDRATE
CAS:38484-94-5
Formula: O=S(C1=CC(Cl)=CC=C1Cl)(O)=O.[H]O[H].[H]O[H]
95+%
BD434097
MFCD08271971
2,5-DICHLOROBENZENESULFONOHYDRAZIDE
CAS:6775-66-2
Formula: O=S(C1=CC(Cl)=CC=C1Cl)(NN)=O
95+%
BD177231
MFCD00159279
2,5-DICHLOROBENZENESULFONYL CHLORIDE
CAS:5402-73-3
Formula: ClC1=CC(=C(Cl)C=C1)S(Cl)(=O)=O
97%
BD3148
MFCD00007429
2,5-DICHLOROBENZENETHIOL
CAS:5858-18-4
Formula: SC1=CC(Cl)=CC=C1Cl
98%
BD67575
MFCD00004831
2,5-DICHLOROBENZO-1,4-QUINONE
CAS:615-93-0
Formula: O=C1C(Cl)=CC(C(Cl)=C1)=O
98%
BD3082
MFCD00041736
2,5-DICHLOROBENZOHYDRAZIDE
CAS:67487-35-8
Formula: O=C(NN)C1=CC(Cl)=CC=C1Cl
97%
BD4549
2,5-DICHLOROBENZOIC ACID
CAS:50-79-3
Formula: C1=C(Cl)C=CC(=C1C(O)=O)Cl
98%
BD4157
MFCD00002416
2,5-DICHLOROBENZONITRILE
CAS:21663-61-6
Formula: N#CC1=CC(Cl)=CC=C1Cl
98%
BD10169
MFCD00019741
2,5-DICHLOROBENZOOXAZOLE
CAS:3621-81-6
Formula: ClC1=NC2=C(O1)C=CC(=C2)Cl
98%
BD20439
MFCD09264312
2,5-DICHLOROBENZOTHIAZOLE
CAS:2941-48-2
Formula: ClC1=CC=C(SC(Cl)=N2)C2=C1
97%
BD157724
MFCD00044024
2,5-DICHLOROBENZYL CYANIDE
CAS:3218-50-6
Formula: ClC1=CC=C(Cl)C(CC#N)=C1
98%
BD33202
MFCD02671209
2,5-DICHLOROFLUOROBENZENE
CAS:348-59-4
Formula: FC1=C(Cl)C=CC(Cl)=C1
98%
BD33334
MFCD00060656
2,5-DICHLOROISONICOTINALDEHYDE
CAS:102645-33-0
Formula: O=CC1=C(Cl)C=NC(Cl)=C1
97%
BD17316
MFCD06410679
2,5-DICHLOROISONICOTINAMIDE
CAS:1221791-56-5
Formula: O=C(N)C1=C(Cl)C=NC(Cl)=C1
95+%
BD207847
2,5-DICHLOROISONICOTINIC ACID
CAS:88912-26-9
Formula: O=C(O)C1=C(Cl)C=NC(Cl)=C1
98%
BD23000
MFCD00466640
2,5-DICHLOROISONICOTINONITRILE
CAS:102645-35-2
Formula: ClC1=NC=C(Cl)C(=C1)C#N
96%
BD207848
MFCD13185482
2,5-DICHLORONICOTINALDEHYDE
CAS:176433-49-1
Formula: O=CC1=C(Cl)N=CC(Cl)=C1
98%
BD160122
MFCD08056627
2,5-DICHLORONICOTINAMIDE
CAS:75291-86-0
Formula: O=C(N)C1=C(Cl)N=CC(Cl)=C1
98%
BD67540
MFCD00204159
2,5-DICHLORONICOTINIC ACID
CAS:59782-85-3
Formula: ClC1=C(C(=O)O)C=C(C=N1)Cl
97%
BD21687
MFCD01861979
2,5-DICHLORONICOTINONITRILE
CAS:126954-66-3
Formula: N#CC1=C(Cl)N=CC(Cl)=C1
97%
BD206300
MFCD13185481
2,5-DICHLORONICOTINOYL CHLORIDE
CAS:78686-87-0
Formula: O=C(Cl)C1=C(Cl)N=CC(Cl)=C1
95+%
BD67559
MFCD00210149
2,5-DICHLOROPENTAN-1-AMINE HYDROCHLORIDE
CAS:62922-45-6
Formula: NCC(Cl)CCCCl.[H]Cl
95+%
BD67544
MFCD00012877
2,5-DICHLOROPHENETHYL BROMIDE
CAS:40173-98-6
Formula: ClC1=CC=C(Cl)C(CCBr)=C1
95%
BD00825417
2,5-DICHLOROPHENYLBORONIC ACID
CAS:135145-90-3
Formula: OB(O)C1=C(Cl)C=CC(Cl)=C1
98%
BD9870
MFCD01863182
2,5-DICHLOROPHENYLHYDRAZINE
CAS:305-15-7
Formula: NNC1=C(Cl)C=CC(Cl)=C1
98%
BD3463
MFCD00007576
2,5-DICHLOROPHENYLSULFONYLETHANOL
CAS:107737-91-7
Formula: OCCS(=O)(C1=CC(Cl)=CC=C1Cl)=O
95+%
BD322410
MFCD03789220
2,5-DICHLOROPYRAZINE
CAS:19745-07-4
Formula: C1=NC(=CN=C1Cl)Cl
97+%
BD32490
MFCD04117886
2,5-DICHLOROPYRIDIN-3-OL
CAS:53335-73-2
Formula: OC1=CC(Cl)=CN=C1Cl
98%
BD297241
MFCD13185537
2,5-DICHLOROPYRIDIN-4-AMINE
CAS:405230-82-2
Formula: NC1=CC(Cl)=NC=C1Cl
98%
BD231155
MFCD11044256
2,5-DICHLOROPYRIDIN-4-OL
CAS:847664-65-7
Formula: OC1=CC(Cl)=NC=C1Cl
97%
BD67507
MFCD01861982
2,5-DICHLOROPYRIDINE
CAS:16110-09-1
Formula: C1=CC(=NC=C1Cl)Cl
98%
BD18681
MFCD00006239
2,5-DICHLOROPYRIDINE-3,4-DIAMINE
CAS:405230-94-6
Formula: NC1=C(N)C(Cl)=CN=C1Cl
95+%
BD248719
MFCD19690311
2,5-DICHLOROPYRIDINE-3-BORONIC ACID
CAS:536693-97-7
Formula: OB(O)C1=CC(Cl)=CN=C1Cl
98%
BD28978
MFCD06659486
2,5-DICHLOROPYRIDINE-3-METHANOL
CAS:558465-93-3
Formula: OCC1=CC(Cl)=CN=C1Cl
95%
BD21461
MFCD06659487
2,5-DICHLOROPYRIDINE-3-SULFONYL CHLORIDE
CAS:1208081-36-0
Formula: O=S(C1=CC(Cl)=CN=C1Cl)(Cl)=O
97%
BD497644
MFCD15142815
2,5-DICHLOROPYRIDINE-4-BORONIC ACID
CAS:847664-64-6
Formula: OB(C1=CC(Cl)=NC=C1Cl)O
98%
BD35093
MFCD06798254
2,5-DICHLOROPYRIDO[2,3-D]PYRIDAZINE
CAS:1447959-04-7
Formula: ClC1=NN=CC2=NC(Cl)=CC=C21
97%
BD617655
2,5-DICHLOROPYRIDO[3,4-B]PYRAZINE
CAS:1600511-80-5
Formula: ClC1=C(N=CC(Cl)=N2)C2=CC=N1
97%
BD436974
MFCD28670261
2,5-DICHLOROPYRIMIDIN-4-AMINE
CAS:89180-51-8
Formula: NC1=C(Cl)C=NC(Cl)=N1
95%
BD174327
MFCD13191633
2,5-DICHLOROPYRIMIDINE
CAS:22536-67-0
Formula: ClC1=NC=C(C=N1)Cl
98%
BD40845
MFCD00673131
2,5-DICHLOROPYRIMIDINE-4-CARBOXYLIC ACID
CAS:1240594-41-5
Formula: O=C(C1=NC(Cl)=NC=C1Cl)O
95+%
BD284182
2,5-DICHLOROQUINAZOLIN-4(3H)-ONE
CAS:1107694-73-4
Formula: O=C1NC(Cl)=NC2=C1C(Cl)=CC=C2
95+%
BD225304
2,5-DICHLOROQUINAZOLINE
CAS:445041-29-2
Formula: ClC1=NC2=CC=CC(Cl)=C2C=N1
95+%
BD167293
MFCD17215769
2,5-DICHLOROQUINOLIN-8-AMINE
CAS:1935574-21-2
Formula: NC1=C2N=C(Cl)C=CC2=C(Cl)C=C1
97%
BD443203
MFCD28405456
2,5-DICHLOROQUINOLINE
CAS:59412-12-3
Formula: ClC1=C2C=CC(Cl)=NC2=CC=C1
95%
BD247469
MFCD00832074
2,5-DICHLOROQUINOLINE-3-CARBALDEHYDE
CAS:1064137-50-3
Formula: O=CC1=CC2=C(Cl)C=CC=C2N=C1Cl
95+%
BD337727
MFCD22370818
2,5-DICHLOROQUINOXALINE
CAS:55687-05-3
Formula: ClC1=NC2=C(N=C1)C(Cl)=CC=C2
97%
BD226752
MFCD11846477
2,5-DICHLOROTEREPHTHALIC ACID
CAS:13799-90-1
Formula: OC(=O)C1=CC(Cl)=C(C=C1Cl)C(O)=O
97%
BD5611
MFCD00058982
2,5-DICHLOROTEREPHTHALONITRILE
CAS:1897-43-4
Formula: N#CC1=CC(Cl)=C(C#N)C=C1Cl
97%
BD67566
MFCD00059584
2,5-DICHLOROTHIAZOLE-4-CARBALDEHYDE
CAS:929910-36-1
Formula: O=CC1=C(Cl)SC(Cl)=N1
95+%
BD260443
2,5-DICHLOROTHIAZOLE-4-CARBONITRILE
CAS:127426-26-0
Formula: N#CC1=C(Cl)SC(Cl)=N1
98%
BD250535
2,5-DICHLOROTHIAZOLE-4-CARBOXAMIDE
CAS:127426-27-1
Formula: O=C(C1=C(Cl)SC(Cl)=N1)N
95+%
BD260024
2,5-DICHLOROTHIAZOLE-4-CARBOXYLIC ACID
CAS:127426-30-6
Formula: ClC1=NC(=C(S1)Cl)C(=O)O
95%
BD159329
MFCD16615251
2,5-DICHLOROTHIAZOLO[5,4-D]THIAZOLE
CAS:50616-95-0
Formula: ClC(S1)=NC2=C1N=C(Cl)S2
97%
BD492940
2,5-DICHLOROTHIOBENZAMIDE
CAS:69622-81-7
Formula: NC(C1=CC(Cl)=CC=C1Cl)=S
95+%
BD308607
MFCD09025686
2,5-DICHLOROTHIOPHENE
CAS:3172-52-9
Formula: ClC1=CC=C(Cl)S1
98%
BD20182
MFCD00005423
2,5-DICHLOROTHIOPHENE-3,4-DICARBALDEHYDE
CAS:55581-76-5
Formula: O=CC1=C(Cl)SC(Cl)=C1C=O
95+%
BD281531
2,5-DICHLOROTHIOPHENE-3-CARBALDEHYDE
CAS:61200-60-0
Formula: ClC1=C(C=C(S1)Cl)C=O
98%
BD67569
MFCD01571097
2,5-DICHLOROTHIOPHENE-3-CARBOXYLIC ACID
CAS:36157-41-2
Formula: O=C(C1=C(Cl)SC(Cl)=C1)O
97%
BD2515
MFCD00082908
2,5-DICHLOROTHIOPHENE-3-SULFONAMIDE
CAS:53595-68-9
Formula: NS(=O)(=O)C1=C(Cl)SC(Cl)=C1
95+%
BD9386
MFCD00767573
2,5-DICHLOROTHIOPHENE-3-SULFONYL CHLORIDE
CAS:56946-83-9
Formula: O=S(C1=C(Cl)SC(Cl)=C1)(Cl)=O
95+%
BD21531
MFCD00051665
2,5-DIETHOXY-4-(P-TOLYLTHIO)ANILINE
CAS:68400-48-6
Formula: NC1=CC(OCC)=C(SC2=CC=C(C)C=C2)C=C1OCC
95+%
BD16739
MFCD00129825
2,5-DIETHOXY-4-MORPHOLINOANILINE
CAS:51963-82-7
Formula: NC1=CC(OCC)=C(N2CCOCC2)C=C1OCC
95+%
BD15632
MFCD02052680
2,5-DIETHOXY-4-MORPHOLINOANILINE DIHYDROCHLORIDE
CAS:136334-84-4
Formula: NC1=CC(OCC)=C(N2CCOCC2)C=C1OCC.[H]Cl.[H]Cl
95+%
BD67588
2,5-DIETHOXY-4-NITROANILINE
CAS:56185-25-2
Formula: NC1=CC(OCC)=C([N+]([O-])=O)C=C1OCC
97%
BD625685
2,5-DIETHOXYANILINE
CAS:94-85-9
Formula: NC1=CC(OCC)=CC=C1OCC
98%
BD67590
MFCD00015144
2,5-DIETHOXYBENZALDEHYDE
CAS:4686-98-0
Formula: O=CC1=CC(OCC)=CC=C1OCC
97%
BD67591
MFCD02093696
2,5-DIETHOXYBENZENETHIOL
CAS:29236-93-9
Formula: SC1=CC(OCC)=CC=C1OCC
95%
BD492941
2,5-DIETHOXYPYRAZINE
CAS:38629-25-3
Formula: CCOC1=CN=C(OCC)C=N1
95+%
BD264820
2,5-DIETHOXYTETRAHYDROFURAN
CAS:3320-90-9
Formula: CCOC1CCC(OCC)O1
95%
BD67594
n/a
2,5-DIETHYL-1H-PYRROLE
CAS:766-95-0
Formula: CCC1=CC=C(CC)N1
95+%
BD235014
MFCD18427143
2,5-DIETHYL-3,6-DIMETHYLPYRAZINE
CAS:18903-30-5
Formula: CCC1=NC(C)=C(CC)N=C1C
95+%
BD238949
MFCD18449287
2,5-DIETHYL-6-METHYLTHIENO[2,3-D]PYRIMIDINE-4-THIOL
CAS:917747-85-4
Formula: SC1=C(C(CC)=C(C)S2)C2=NC(CC)=N1
97%
BD598868
MFCD08898752
2,5-DIETHYLPIPERAZINE
CAS:23703-03-9
Formula: CCC1NCC(CC)NC1
97%
BD00807925
2,5-DIETHYLPYRAZINE
CAS:13238-84-1
Formula: CCC1=CN=C(CC)C=N1
95+%
BD67598
MFCD06657570
2,5-DIETHYLTHIOPHENE
CAS:5069-23-8
Formula: CCC1=CC=C(CC)S1
95+%
BD246239
MFCD11656329
2,5-DIETHYNYLANILINE
CAS:137000-70-5
Formula: NC1=CC(C#C)=CC=C1C#C
95+%
BD241343
2,5-DIFLUORO-1-METHOXY-3-NITROBENZENE
CAS:1803826-15-4
Formula: COC1=CC(F)=CC([N+]([O-])=O)=C1F
95%
BD482617
MFCD28790589
2,5-DIFLUORO-1-METHYL-3-NITROBENZENE
CAS:1093758-82-7
Formula: O=[N+](C1=C(F)C(C)=CC(F)=C1)[O-]
97%
BD215263
2,5-DIFLUORO-3-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)ANILINE
CAS:1269233-00-2
Formula: NC1=CC(F)=CC(B2OC(C)(C)C(C)(C)O2)=C1F
95+%
BD334275
MFCD22189455
2,5-DIFLUORO-3-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PYRIDINE
CAS:1256358-86-7
Formula: CC1(C)OB(OC1(C)C)C1=CC(F)=CN=C1F
95%
BD236214
MFCD17926496
2,5-DIFLUORO-3-(NAPHTHALEN-2-YL)-5-PHENYL-4H,5H,6H,7H-THIENO[2,3-B]PYRIDINE-4,6-DIONE
CAS:1313504-21-0
Formula: O=C(C1(F)C2=CC=CC=C2)C(C(C3=CC=C4C=CC=CC4=C3)=C(F)S5)=C5NC1=O
97%
BD00794652
2,5-DIFLUORO-3-(TRIFLUOROMETHYL)ANILINE
CAS:1682-26-4
Formula: NC1=CC(F)=CC(C(F)(F)F)=C1F
95+%
BD323366
MFCD20695812
2,5-DIFLUORO-3-IODOPYRIDINE
CAS:1214377-11-3
Formula: IC1=CC(F)=CN=C1F
97%
BD751431
2,5-DIFLUORO-3-METHYLBENZOIC ACID
CAS:1003710-01-7
Formula: O=C(O)C1=CC(F)=CC(C)=C1F
98%
BD160403
MFCD09835286
2,5-DIFLUORO-3-METHYLBENZONITRILE
CAS:1003712-20-6
Formula: N#CC1=CC(F)=CC(C)=C1F
98%
BD160404
MFCD09996954
2,5-DIFLUORO-3-NITROBENZALDEHYDE
CAS:1803824-20-5
Formula: O=CC1=CC(F)=CC([N+]([O-])=O)=C1F
96%
BD266448
2,5-DIFLUORO-3-NITROBENZAMIDE
CAS:1701869-33-1
Formula: O=C(N)C1=CC(F)=CC([N+]([O-])=O)=C1F
95+%
BD266432
2,5-DIFLUORO-3-NITROBENZOIC ACID
CAS:741721-49-3
Formula: O=C(O)C1=CC(F)=CC([N+]([O-])=O)=C1F
97%
BD266741
MFCD11848537
2,5-DIFLUORO-3-NITROBENZONITRILE
CAS:1690818-46-2
Formula: N#CC1=CC(F)=CC([N+]([O-])=O)=C1F
95+%
BD266433
2,5-DIFLUORO-3-NITROBENZOTRIFLUORIDE
CAS:2837-22-1
Formula: FC(F)(F)C1=CC(F)=CC([N+]([O-])=O)=C1F
95+%
BD323566
MFCD22375209
2,5-DIFLUORO-3-NITROPYRIDINE
CAS:179558-82-8
Formula: O=[N+](C1=CC(F)=CN=C1F)[O-]
97%
BD286600
2,5-DIFLUORO-4-(1H-TETRAZOL-1-YL)PHENOL
CAS:1255574-38-9
Formula: OC1=CC(F)=C(N2N=NN=C2)C=C1F
96%
BD00795856
MFCD17926509
2,5-DIFLUORO-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PYRIDINE
CAS:1622217-35-9
Formula: CC1(C)C(C)(C)OB(C2=CC(F)=NC=C2F)O1
96%
BD326805
MFCD18712644
2,5-DIFLUORO-4-(METHYLSULFONYL)ANILINE
CAS:1147557-75-2
Formula: NC1=CC(F)=C(S(=O)(C)=O)C=C1F
96%
BD283501
MFCD20259003
2,5-DIFLUORO-4-(TRIFLUOROMETHYL)BENZOIC ACID
CAS:261945-05-5
Formula: O=C(O)C1=CC(F)=C(C(F)(F)F)C=C1F
95+%
BD257998
MFCD01631618
2,5-DIFLUORO-4-FORMYLBENZONITRILE
CAS:433940-02-4
Formula: O=CC1=CC(F)=C(C#N)C=C1F
97%
BD334359
MFCD16876871
2,5-DIFLUORO-4-HYDRAZINYLBENZONITRILE
CAS:129946-63-0
Formula: NNC1=CC(F)=C(C=C1F)C#N
95+%
BD67601
MFCD04972812
2,5-DIFLUORO-4-HYDROXYBENZALDEHYDE
CAS:918523-99-6
Formula: O=CC1=CC(F)=C(O)C=C1F
95%
BD67602
MFCD04112521
2,5-DIFLUORO-4-HYDROXYBENZONITRILE
CAS:887267-05-2
Formula: N#CC1=CC(F)=C(O)C=C1F
97%
BD551259
2,5-DIFLUORO-4-IODOANILINE
CAS:155906-13-1
Formula: NC1=CC(F)=C(I)C=C1F
98%
BD286650
MFCD07774188
2,5-DIFLUORO-4-IODOPYRIDINE
CAS:1017793-20-2
Formula: FC1=CN=C(F)C=C1I
98%
BD213074
MFCD11040606
2,5-DIFLUORO-4-METHOXYANILINE
CAS:394223-61-1
Formula: NC1=CC(F)=C(OC)C=C1F
95+%
BD215272
MFCD18394891
2,5-DIFLUORO-4-METHOXYBENZALDEHYDE
CAS:879093-08-0
Formula: O=CC1=CC(F)=C(OC)C=C1F
98%
BD67603
MFCD06246882
2,5-DIFLUORO-4-METHOXYBENZENE-1-SULFONYL CHLORIDE
CAS:1208075-47-1
Formula: O=S(C1=CC(F)=C(OC)C=C1F)(Cl)=O
97%
BD496225
MFCD12026236
2,5-DIFLUORO-4-METHOXYBENZENESULFONAMIDE
CAS:1208075-55-1
Formula: O=S(C1=CC(F)=C(OC)C=C1F)(N)=O
97%
BD481649
MFCD12026276
2,5-DIFLUORO-4-METHOXYBENZOIC ACID
CAS:1060739-01-6
Formula: COC1=CC(F)=C(C=C1F)C(O)=O
98%
BD237703
MFCD11847151
2,5-DIFLUORO-4-METHOXYBENZONITRILE
CAS:1007605-44-8
Formula: N#CC1=CC(F)=C(OC)C=C1F
97%
BD257979
MFCD06246886
2,5-DIFLUORO-4-METHOXYPHENOL
CAS:1024068-86-7
Formula: OC1=CC(F)=C(OC)C=C1F
95%
BD472934
MFCD06246893
2,5-DIFLUORO-4-METHYLANILINE
CAS:878285-14-4
Formula: CC1=CC(F)=C(N)C=C1F
95+%
BD215220
MFCD11519027
2,5-DIFLUORO-4-METHYLBENZOIC ACID
CAS:103877-80-1
Formula: O=C(O)C1=CC(F)=C(C)C=C1F
97%
BD29991
MFCD08063230
2,5-DIFLUORO-4-METHYLBENZONITRILE
CAS:1003708-66-4
Formula: N#CC1=CC(F)=C(C)C=C1F
97+%
BD160405
2,5-DIFLUORO-4-NITROANILINE
CAS:1542-36-5
Formula: NC1=CC(F)=C([N+]([O-])=O)C=C1F
98%
BD233203
MFCD11519059
2,5-DIFLUORO-4-NITROBENZALDEHYDE
CAS:1160474-72-5
Formula: O=CC1=CC(F)=C([N+]([O-])=O)C=C1F
95+%
BD201227
n/a
2,5-DIFLUORO-4-NITROBENZOIC ACID
CAS:116465-48-6
Formula: O=C(O)C1=CC(F)=C([N+]([O-])=O)C=C1F
95%
BD17666
MFCD03425705
2,5-DIFLUORO-4-NITROBENZONITRILE
CAS:172921-32-3
Formula: N#CC1=CC(F)=C([N+]([O-])=O)C=C1F
95+%
BD297146
MFCD13185567
2,5-DIFLUORO-4-NITROPHENOL
CAS:120103-18-6
Formula: OC1=CC(F)=C([N+]([O-])=O)C=C1F
96%
BD3179
MFCD04039297
2,5-DIFLUORO-4-THIOCYANATOANILINE
CAS:1150339-43-7
Formula: NC1=CC(F)=C(SC#N)C=C1F
95+%
BD304503
n/a
2,5-DIFLUORO-4-THIOCYANATOANILINE, HCL
CAS:1150114-25-2
Formula: NC1=CC(F)=C(SC#N)C=C1F.[H]Cl
97%
BD324939
MFCD11855821
2,5-DIFLUORO-D-HOMOPHENYLALANINE
CAS:1260613-73-7
Formula: N[C@H](CCC1=CC(F)=CC=C1F)C(O)=O
95%
BD00775950
2,5-DIFLUORO-N-HYDROXYBENZIMIDAMIDE
CAS:885957-32-4
Formula: N=C(NO)C1=CC(F)=CC=C1F
95+%
BD294232
2,5-DIFLUORO-N-METHOXY-N-METHYLNICOTINAMIDE
CAS:1263316-53-5
Formula: O=C(N(OC)C)C1=C(F)N=CC(F)=C1
97%
BD751357
2,5-DIFLUORO-PHENOXYACETONITRILE
CAS:857279-52-8
Formula: N#CCOC1=CC(F)=CC=C1F
95+%
BD324297
MFCD09475444
2,5-DIFLUORO-PYRIDINE-4-CARBALDEHYDE
CAS:1227602-08-5
Formula: O=CC1=CC(F)=NC=C1F
95+%
BD322670
MFCD12756646
2,5-DIFLUOROANILINE
CAS:367-30-6
Formula: C1=C(F)C=CC(=C1N)F
98%
BD9909
MFCD00007651
2,5-DIFLUOROBENZALDEHYDE
CAS:2646-90-4
Formula: C1=CC(=C(C=C1F)C=O)F
98%
BD4213
MFCD00010327
2,5-DIFLUOROBENZAMIDE
CAS:85118-03-2
Formula: O=C(N)C1=CC(F)=CC=C1F
97%
BD291135
2,5-DIFLUOROBENZENE-1-SULFONYL CHLORIDE
CAS:26120-86-5
Formula: O=S(C1=CC(F)=CC=C1F)(Cl)=O
97%
BD3153
MFCD00060682
2,5-DIFLUOROBENZENESULFONAMIDE
CAS:120022-63-1
Formula: NS(=O)(=O)C1=C(F)C=CC(F)=C1
98%
BD3386
MFCD00798115
2,5-DIFLUOROBENZIMIDAMIDE HYDROCHLORIDE
CAS:1187929-28-7
Formula: N=C(C1=CC(F)=CC=C1F)N.[H]Cl
98%
BD492944
2,5-DIFLUOROBENZOHYDRAZIDE
CAS:265644-03-9
Formula: NNC(=O)C1=C(F)C=CC(F)=C1
95+%
BD236820
MFCD02183537
2,5-DIFLUOROBENZOIC ACID
CAS:2991-28-8
Formula: O=C(O)C1=CC(F)=CC=C1F
98%
BD10285
MFCD00002410
2,5-DIFLUOROBENZONITRILE
CAS:64248-64-2
Formula: FC1=CC(C#N)=C(F)C=C1
98%
BD10202
MFCD00001777
2,5-DIFLUOROBENZOTHIOHYDRAZIDE 2,2,2-TRIFLUOROACETATE
CAS:1956363-93-1
Formula: NNC(C1=CC(F)=CC=C1F)=S.O=C(O)C(F)(F)F
95+%
BD337448
MFCD28991777
2,5-DIFLUOROBENZOYL CHLORIDE
CAS:35730-09-7
Formula: O=C(Cl)C1=CC(F)=CC=C1F
96%
BD33376
MFCD00009929
2,5-DIFLUOROBENZYL ALCOHOL
CAS:75853-20-2
Formula: OCC1=CC(F)=CC=C1F
98%
BD34849
MFCD00010627
2,5-DIFLUOROBENZYL CARBAMIMIDOTHIOATE HYDROBROMIDE
CAS:1197237-07-2
Formula: N=C(SCC1=CC(F)=CC=C1F)N.[H]Br
97%
BD568183
2,5-DIFLUOROISONICOTINIC ACID
CAS:851386-39-5
Formula: O=C(O)C1=C(F)C=NC(F)=C1
95+%
BD168817
MFCD09031179
2,5-DIFLUOROISONICOTINONITRILE
CAS:1214331-33-5
Formula: N#CC1=C(F)C=NC(F)=C1
96%
BD261899
MFCD12756649
2,5-DIFLUORONICOTINALDEHYDE
CAS:1227602-25-6
Formula: O=CC1=C(F)N=CC(F)=C1
95+%
BD236766
MFCD16606480
2,5-DIFLUORONICOTINAMIDE
CAS:1934952-86-9
Formula: O=C(N)C1=C(F)N=CC(F)=C1
97%
BD465824
2,5-DIFLUORONICOTINIC ACID
CAS:851386-43-1
Formula: O=C(O)C1=C(F)N=CC(F)=C1
95%
BD67645
2,5-DIFLUORONICOTINONITRILE
CAS:1214350-46-5
Formula: N#CC1=C(F)N=CC(F)=C1
97%
BD460998
2,5-DIFLUORONITROBENZENE
CAS:364-74-9
Formula: C1=C(F)C=CC(=C1[N+](=O)[O-])F
98+%
BD67632
MFCD00007054
2,5-DIFLUOROPHENETHYL BROMIDE
CAS:1340124-22-2
Formula: FC1=CC=C(F)C(CCBr)=C1
95%
BD00799512
2,5-DIFLUOROPHENOL
CAS:2713-31-7
Formula: OC1=CC(F)=CC=C1F
98%
BD9840
MFCD00042501
2,5-DIFLUOROPHENYLACETIC ACID
CAS:85068-27-5
Formula: O=C(O)CC1=CC(F)=CC=C1F
97%
BD5920
MFCD00010000
2,5-DIFLUOROPHENYLACETONITRILE
CAS:69584-87-8
Formula: FC1=CC(CC#N)=C(F)C=C1
98%
BD10889
MFCD00009972
2,5-DIFLUOROPHENYLACETYL CHLORIDE
CAS:157033-23-3
Formula: O=C(Cl)CC1=CC(F)=CC=C1F
95+%
BD323338
MFCD03424719
2,5-DIFLUOROPHENYLHYDRAZINE
CAS:97108-50-4
Formula: NNC1=C(F)C=CC(F)=C1
98%
BD3490
MFCD00013384
2,5-DIFLUOROPYRIDIN-3-AMINE
CAS:1214349-97-9
Formula: NC1=CC(F)=CN=C1F
97%
BD751379
2,5-DIFLUOROPYRIDIN-4-AMINE
CAS:189281-61-6
Formula: NC1=CC(F)=NC=C1F
96%
BD279588
MFCD18261573
2,5-DIFLUOROPYRIDINE
CAS:84476-99-3
Formula: FC1=NC=C(C=C1)F
96%
BD29704
MFCD04114191
2,5-DIFLUOROSTYRENE
CAS:398-70-9
Formula: C=CC1=CC(F)=CC=C1F
99%
BD00830822
2,5-DIFLUOROTOLUENE
CAS:452-67-5
Formula: CC1=CC(F)=CC=C1F
95+%
BD41702
MFCD00000347
2,5-DIHEXYL-3,6-DI(THIOPHEN-2-YL)PYRROLO[3,4-C]PYRROLE-1,4(2H,5H)-DIONE
CAS:852435-01-9
Formula: O=C1N(CCCCCC)C(C2=CC=CS2)=C3C1=C(C4=CC=CS4)N(CCCCCC)C3=O
95+%
BD254709
2,5-DIHYDRO-1-(4-NITROPHENYL)-5-OXO-1H-1,2,4-TRIAZOLE-3-CARBOXYLIC ACID
CAS:854738-30-0
Formula: O=C(C1=NC(N(C2=CC=C([N+]([O-])=O)C=C2)N1)=O)O
95+%
BD324291
MFCD09877953
2,5-DIHYDRO-1H-PYRROLE HYDROCHLORIDE
CAS:63468-63-3
Formula: [H]Cl.N1CC=CC1
97%
BD158278
MFCD09991892
2,5-DIHYDRO-1H-PYRROLE-2-CARBOXYLIC ACID
CAS:3395-35-5
Formula: O=C(C1NCC=C1)O
95+%
BD81649
MFCD00005214
2,5-DIHYDRO-1H-PYRROLE-3-CARBOXYLIC ACID
CAS:72519-12-1
Formula: O=C(C1=CCNC1)O
96%
BD636622
2,5-DIHYDRO-5-OXO-1-PHENYL-1H-1,2,4-TRIAZOLE-3-CARBOXYLIC ACID PHENYLAMIDE
CAS:32589-62-1
Formula: O=C(C1=NC(N(C2=CC=CC=C2)N1)=O)NC3=CC=CC=C3
95+%
BD323641
MFCD09877895
2,5-DIHYDROFURAN-2-CARBOXYLIC ACID
CAS:22694-55-9
Formula: O=C(C1OCC=C1)O
90%
BD32738
MFCD07784085
2,5-DIHYDROTHIOPHENE-3-CARBALDEHYDE
CAS:113772-16-0
Formula: O=CC1=CCSC1
95+%
BD67654
MFCD06375933
2,5-DIHYDROTHIOPHENE-3-SULFONYL CHLORIDE 1,1-DIOXIDE
CAS:112161-61-2
Formula: O=S(C(C1)=CCS1(=O)=O)(Cl)=O
95+%
BD183680
2,5-DIHYDROXY-1,4-BENZOQUINONE
CAS:615-94-1
Formula: O=C(C(O)=C1)C=C(O)C1=O
97%
BD67656
MFCD00001598
2,5-DIHYDROXY-3,6-DIMETHOXYBENZOIC ACID
CAS:6212-41-5
Formula: O=C(O)C1=C(OC)C(O)=CC(OC)=C1O
95+%
BD281653
MFCD24482687
2,5-DIHYDROXY-3-METHOXYBENZOIC ACID
CAS:5981-38-4
Formula: O=C(O)C1=CC(O)=CC(OC)=C1O
95+%
BD281635
MFCD20639612
2,5-DIHYDROXY-3-TRIDECYLCYCLOHEXA-2,5-DIENE-1,4-DIONE
CAS:573-40-0
Formula: O=C(C(O)=C1)C(CCCCCCCCCCCCC)=C(O)C1=O
97%
BD1107
MFCD00075883
2,5-DIHYDROXY-N-(2-HYDROXYETHYL)BENZAMIDE
CAS:61969-53-7
Formula: O=C(NCCO)C1=CC(O)=CC=C1O
97%
BD67664
2,5-DIHYDROXYBENZALDEHYDE
CAS:1194-98-5
Formula: O=CC1=CC(O)=CC=C1O
98%
BD4701
MFCD00003333
2,5-DIHYDROXYBENZOHYDRAZIDE
CAS:15791-90-9
Formula: O=C(NN)C1=CC(O)=CC=C1O
95+%
BD171361
MFCD01921944
2,5-DIHYDROXYBENZONITRILE
CAS:4640-29-3
Formula: N#CC1=CC(O)=CC=C1O
97%
BD490275
MFCD00797121
2,5-DIHYDROXYNAPHTHALENE-1,4-DIONE
CAS:4923-55-1
Formula: O=C1C(O)=CC(C2=C1C=CC=C2O)=O
95+%
BD295061
n/a
2,5-DIHYDROXYPHENYL(DIPHENYL)PHOSPHINE OXIDE
CAS:13291-46-8
Formula: OC1=CC=C(O)C(P(C2=CC=CC=C2)(C3=CC=CC=C3)=O)=C1
98%
BD322175
2,5-DIHYDROXYTEREPHTHALALDEHYDE
CAS:1951-36-6
Formula: O=CC1=CC(O)=C(C=O)C=C1O
95+%
BD222966
2,5-DIHYDROXYTEREPHTHALIC ACID
CAS:610-92-4
Formula: O=C(O)C1=CC(O)=C(C(O)=O)C=C1O
98%
BD6030
MFCD00132933
2,5-DIIODO-1-METHYLIMIDAZOLE
CAS:86026-81-5
Formula: CN1C(I)=CN=C1I
98%
BD29753
MFCD02179540
2,5-DIIODO-3-(TRIFLUOROMETHYL)PYRIDINE
CAS:1806353-75-2
Formula: FC(C1=CC(I)=CN=C1I)(F)F
97%
BD466744
MFCD28792769
2,5-DIIODO-3-METHOXYPYRIDINE
CAS:1138444-33-3
Formula: COC1=CC(I)=CN=C1I
97%
BD196363
MFCD11857704
2,5-DIIODO-4-METHYL-1H-IMIDAZOLE
CAS:149510-85-0
Formula: CC1=C(I)NC(I)=N1
98%
BD41309
2,5-DIIODOBENZENE-1,4-DIOL
CAS:13064-64-7
Formula: OC1=CC(I)=C(O)C=C1I
95+%
BD328828
MFCD09910095
2,5-DIIODOBENZOHYDRAZIDE
CAS:1023444-89-4
Formula: O=C(NN)C1=CC(I)=CC=C1I
97%
BD601677
MFCD03425684
2,5-DIIODOBENZOIC ACID
CAS:14192-12-2
Formula: OC(=O)C1=C(I)C=CC(I)=C1
95%
BD67672
MFCD00045801
2,5-DIIODOPYRAZINE
CAS:1093418-77-9
Formula: IC1=CN=C(I)C=N1
95+%
BD332776
MFCD23143964
2,5-DIIODOPYRIDIN-3-OL
CAS:1142191-68-1
Formula: OC1=CC(I)=CN=C1I
97%
BD196367
MFCD11857702
2,5-DIIODOPYRIDINE
CAS:116195-81-4
Formula: IC1=CN=C(I)C=C1
98%
BD17661
MFCD00234028
2,5-DIIODOTHIOPHENE
CAS:625-88-7
Formula: IC1=CC=C(I)S1
98%
BD2192
MFCD00014525
2,5-DIISOPROPYLPYRAZINE
CAS:24294-83-5
Formula: CC(C1=CN=C(C(C)C)C=N1)C
95+%
BD331018
MFCD18449282
2,5-DIMETHANESULFONYLBENZOIC ACID
CAS:2140317-02-6
Formula: O=C(O)C1=CC(S(=O)(C)=O)=CC=C1S(=O)(C)=O
97%
BD00805922
2,5-DIMETHOXY-1,3-DIMETHYLBENZENE
CAS:14538-50-2
Formula: CC1=C(OC)C(C)=CC(OC)=C1
95+%
BD258079
MFCD07780697
2,5-DIMETHOXY-1,4-BENZOQUINONE
CAS:3117-03-1
Formula: O=C(C(OC)=C1)C=C(OC)C1=O
95%
BD67681
2,5-DIMETHOXY-2,5-DIHYDROFURAN-2-CARBOXAMIDE
CAS:1706452-97-2
Formula: O=C(C1(OC)OC(OC)C=C1)N
97%
BD619776
2,5-DIMETHOXY-3-METHYLPYRIDINE
CAS:1330754-04-5
Formula: CC1=CC(OC)=CN=C1OC
97%
BD563733
MFCD19981664
2,5-DIMETHOXY-3-NITROBENZOIC ACID
CAS:17894-26-7
Formula: O=C(O)C1=CC(OC)=CC([N+]([O-])=O)=C1OC
95+%
BD67683
MFCD00017022
2,5-DIMETHOXY-3-NITROPYRIDINE
CAS:1804518-04-4
Formula: O=[N+](C1=CC(OC)=CN=C1OC)[O-]
97%
BD475051
MFCD28793715
2,5-DIMETHOXY-4-(PIPERIDIN-1-YL)BENZALDEHYDE
CAS:886501-97-9
Formula: O=CC1=CC(OC)=C(N2CCCCC2)C=C1OC
97%
BD598411
MFCD06740051
2,5-DIMETHOXY-4-(PYRROLIDIN-1-YL)BENZALDEHYDE
CAS:692775-87-4
Formula: O=CC1=CC(OC)=C(N2CCCC2)C=C1OC
97%
BD496657
MFCD03995331
2,5-DIMETHOXY-4-CHLOROANILINE
CAS:6358-64-1
Formula: COC1=CC(N)=C(OC)C=C1Cl
97%
BD95658
MFCD00014893
2,5-DIMETHOXY-4-METHYLBENZALDEHYDE
CAS:4925-88-6
Formula: COC1=CC(C=O)=C(OC)C=C1C
98%
BD235089
MFCD02253192
2,5-DIMETHOXY-4-MORPHOLINOBENZALDEHYDE
CAS:154519-07-0
Formula: O=CC1=CC(OC)=C(N2CCOCC2)C=C1OC
97%
BD554658
MFCD06740113
2,5-DIMETHOXY-4-NITROANILINE
CAS:6313-37-7
Formula: NC1=CC(OC)=C([N+]([O-])=O)C=C1OC
97%
BD29279
MFCD00007361
2,5-DIMETHOXY-4-NITROBENZALDEHYDE
CAS:1207-59-6
Formula: O=CC1=CC(OC)=C([N+]([O-])=O)C=C1OC
97%
BD556068
MFCD22054475
2,5-DIMETHOXY-4-PROPYLBENZALDEHYDE
CAS:53581-81-0
Formula: O=CC1C(OC)=CC(CCC)=C(OC)C=1
95%
BD00763443
MFCD19302282
2,5-DIMETHOXY-N-(THIOPHEN-2-YLMETHYL)ANILINE
CAS:1021029-10-6
Formula: COC1=CC=C(OC)C(NCC2=CC=CS2)=C1
97%
BD601671
MFCD10687632
2,5-DIMETHOXYANILINE
CAS:102-56-7
Formula: NC1=CC(OC)=CC=C1OC
98%
BD67698
MFCD00008368
2,5-DIMETHOXYBENZALDEHYDE
CAS:93-02-7
Formula: O=CC1=CC(OC)=CC=C1OC
98%
BD35450
MFCD00003314
2,5-DIMETHOXYBENZAMIDE
CAS:42020-21-3
Formula: O=C(N)C1=CC(OC)=CC=C1OC
95%
BD67701
2,5-DIMETHOXYBENZENESULFONAMIDE
CAS:19116-90-6
Formula: O=S(C1=CC(OC)=CC=C1OC)(N)=O
97%
BD5341
MFCD00833415
2,5-DIMETHOXYBENZENESULFONOHYDRAZIDE
CAS:19116-91-7
Formula: O=S(C1=CC(OC)=CC=C1OC)(NN)=O
97%
BD177232
MFCD03423368
2,5-DIMETHOXYBENZENESULFONYL CHLORIDE
CAS:1483-28-9
Formula: COC1=CC(=C(OC)C=C1)S(Cl)(=O)=O
98%
BD6477
MFCD00024872
2,5-DIMETHOXYBENZENETHIOL
CAS:1483-27-8
Formula: SC1=CC(OC)=CC=C1OC
95%
BD67735
MFCD00052738
2,5-DIMETHOXYBENZOHYDRAZIDE
CAS:17894-25-6
Formula: O=C(NN)C1=CC(OC)=CC=C1OC
95%
BD11326
MFCD00017049
2,5-DIMETHOXYBENZOIC ACID
CAS:2785-98-0
Formula: C1=C(OC)C=CC(=C1C(O)=O)OC
98%
BD6715
MFCD00002436
2,5-DIMETHOXYBENZONITRILE
CAS:5312-97-0
Formula: COC1=CC(C#N)=C(OC)C=C1
98%
BD67708
MFCD00016375
2,5-DIMETHOXYBENZOTHIOAMIDE
CAS:351065-79-7
Formula: NC(C1=CC(OC)=CC=C1OC)=S
97%
BD11296
2,5-DIMETHOXYBENZYL 3-METHYLBUTANOATE
CAS:876665-00-8
Formula: COC1=CC(COC(=O)CC(C)C)=C(OC)C=C1
97%
BD234387
2,5-DIMETHOXYBENZYLAMINE
CAS:3275-95-4
Formula: NCC1=CC(OC)=CC=C1OC
98%
BD67712
MFCD00052811
2,5-DIMETHOXYNAPHTHALENE
CAS:3900-49-0
Formula: COC1=CC2=CC=CC(OC)=C2C=C1
98%
BD41650
MFCD00086330
2,5-DIMETHOXYPHENETHYL ACETATE
CAS:1159550-36-3
Formula: CC(OCCC1=CC(OC)=CC=C1OC)=O
97%
BD588830
2,5-DIMETHOXYPHENETHYL ETHYL OXALATE
CAS:1443314-39-3
Formula: O=C(OCCC1=CC(OC)=CC=C1OC)C(OCC)=O
97%
BD512156
MFCD15145495
2,5-DIMETHOXYPHENOL
CAS:18113-18-3
Formula: COC1=C(C=C(C=C1)OC)O
97%
BD67723
MFCD00094237
2,5-DIMETHOXYPHENYL ACETATE
CAS:27257-06-3
Formula: CC(OC1=CC(OC)=CC=C1OC)=O
95+%
BD112112
MFCD09032517
2,5-DIMETHOXYPYRAZINE
CAS:117856-61-8
Formula: COC1=CN=C(OC)C=N1
98%
BD264819
MFCD18411892
2,5-DIMETHOXYPYRIDIN-3-AMINE
CAS:1211595-19-5
Formula: NC1=CC(OC)=CN=C1OC
95+%
BD325146
MFCD09038237
2,5-DIMETHOXYPYRIDINE
CAS:867267-24-1
Formula: COC1=CN=C(OC)C=C1
95+%
BD00761618
MFCD12546620
2,5-DIMETHOXYPYRIDINE-4-BORONIC ACID
CAS:1630193-77-9
Formula: COC1=CN=C(OC)C=C1B(O)O
95+%
BD321550
MFCD18256800
2,5-DIMETHOXYPYRIMIDIN-4(3H)-ONE
CAS:370103-23-4
Formula: O=C1NC(OC)=NC=C1OC
98%
BD248646
MFCD20480733
2,5-DIMETHOXYPYRIMIDIN-4-AMINE
CAS:6960-17-4
Formula: NC1=NC(OC)=NC=C1OC
95+%
BD262485
MFCD20486065
2,5-DIMETHOXYPYRIMIDINE
CAS:16290-94-1
Formula: COC1=CN=C(OC)N=C1
95+%
BD210669
MFCD18411893
2,5-DIMETHOXYTEREPHTHALALDEHYDE
CAS:7310-97-6
Formula: O=CC1=CC(OC)=C(C=O)C=C1OC
97%
BD67731
n/a
2,5-DIMETHOXYTETRAHYDROFURAN
CAS:696-59-3
Formula: COC1CCC(OC)O1
98%
BD67732
MFCD00005359
2,5-DIMETHOXYTETRAHYDROFURAN-3,4-DIOL
CAS:201464-10-0
Formula: COC1C(O)C(O)C(OC)O1
97%
BD81975
2,5-DIMETHOXYTETRAHYDROFURAN-3-CARBALDEHYDE,MIXTURE OF ISOMERS
CAS:50634-05-4
Formula: O=CC1C(OC)OC(OC)C1
90%
BD3874
MFCD00010283
2,5-DIMETHOXYTHIOPHENE
CAS:58386-20-2
Formula: COC1=CC=C(OC)S1
95+%
BD289451
MFCD01096545
2,5-DIMETHOXYTOLUENE
CAS:24599-58-4
Formula: COC1=CC(C)=C(OC)C=C1
98%
BD28154
MFCD00041901
2,5-DIMETHYL 3-NITROTHIOPHENE-2,5-DICARBOXYLATE
CAS:858840-42-3
Formula: O=C(C1=C([N+]([O-])=O)C=C(C(OC)=O)S1)OC
96%
BD327844
MFCD22381980
2,5-DIMETHYL-[1,2,4]TRIAZOLO[1,5-A]PYRIMIDIN-7(4H)-ONE
CAS:89852-99-3
Formula: O=C1C=C(C)NC2=NC(C)=NN12
97%
BD447053
MFCD04114018
2,5-DIMETHYL-[1,2,4]TRIAZOLO[1,5-A]PYRIMIDIN-7-OL
CAS:51596-06-6
Formula: OC1=CC(C)=NC2=NC(C)=NN12
97%
BD625534
2,5-DIMETHYL-1,3,4-OXADIAZOLE
CAS:13148-65-7
Formula: CC1=NN=C(C)O1
95%
BD216434
MFCD00483011
2,5-DIMETHYL-1,3,4-THIADIAZOLE
CAS:27464-82-0
Formula: CC1=NN=C(C)S1
95+%
BD67747
MFCD00020722
2,5-DIMETHYL-1,4-PHENYLENEDIAMINE
CAS:6393-01-7
Formula: CC1=CC(N)=C(C)C=C1N
95%
BD5350
MFCD00052675
2,5-DIMETHYL-1-((4-METHYLTHIAZOL-2-YL)METHYL)-1H-PYRROLE-3-CARBALDEHYDE
CAS:1248059-28-0
Formula: O=CC1=C(C)N(CC2=NC(C)=CS2)C(C)=C1
97%
BD608385
2,5-DIMETHYL-1-((TETRAHYDROFURAN-2-YL)METHYL)-1H-PYRROLE-3-CARBALDEHYDE
CAS:790263-33-1
Formula: O=CC1=C(C)N(CC2OCCC2)C(C)=C1
95+%
BD58951
MFCD04321849
2,5-DIMETHYL-1-(1,3-DIOXOLAN-2-YLMETHYL)BENZENE
CAS:898759-36-9
Formula: CC1=CC=C(C)C(CC2OCCO2)=C1
95+%
BD310658
MFCD04117665
2,5-DIMETHYL-1-(2-MORPHOLINOETHYL)-1H-PYRROLE-3-CARBALDEHYDE
CAS:887694-84-0
Formula: O=CC1=C(C)N(CCN2CCOCC2)C(C)=C1
97%
BD555320
MFCD07400631
2,5-DIMETHYL-1-(3-(TRIFLUOROMETHYL)PHENYL)-1H-PYRROLE
CAS:570-04-7
Formula: FC(C1=CC(N2C(C)=CC=C2C)=CC=C1)(F)F
98%
BD67741
MFCD03228549
2,5-DIMETHYL-1-(3-(TRIFLUOROMETHYL)PHENYL)-1H-PYRROLE-3-CARBALDEHYDE
CAS:207233-99-6
Formula: O=CC1=C(C)N(C2=CC=CC(C(F)(F)F)=C2)C(C)=C1
95+%
BD67739
MFCD00192093
2,5-DIMETHYL-1-(3-METHYLPYRIDIN-2-YL)-1H-PYRROLE-3-CARBALDEHYDE
CAS:142230-98-6
Formula: O=CC1=C(C)N(C2=NC=CC=C2C)C(C)=C1
95+%
BD302389
MFCD07643249
2,5-DIMETHYL-1-(3-NITROPHENYL)-1H-PYRROLE
CAS:32570-23-3
Formula: CC1=CC=C(C)N1C2=CC=CC([N+]([O-])=O)=C2
95+%
BD50702
MFCD00033567
2,5-DIMETHYL-1-(3-PHENYLPROPYL)PIPERAZINE
CAS:63474-82-8
Formula: CC1NCC(C)N(CCCC2=CC=CC=C2)C1
95+%
BD233800
MFCD19288056
2,5-DIMETHYL-1-(4-(TRIFLUOROMETHYL)PHENYL)-1H-PYRROLE
CAS:570-05-8
Formula: FC(C1=CC=C(N2C(C)=CC=C2C)C=C1)(F)F
98%
BD1451
2,5-DIMETHYL-1-(4-METHYLPYRIDIN-2-YL)-1H-PYRROLE-3-CARBALDEHYDE
CAS:445428-51-3
Formula: O=CC1=C(C)N(C2=NC=CC(C)=C2)C(C)=C1
95+%
BD183786
2,5-DIMETHYL-1-(4-NITROPHENYL)-1H-PYRROLE
CAS:5044-22-4
Formula: O=[N+](C1=CC=C(N2C(C)=CC=C2C)C=C1)[O-]
98%
BD67744
MFCD00085038
2,5-DIMETHYL-1-(4H-1,2,4-TRIAZOL-4-YL)-1H-PYRROLE-3-CARBALDEHYDE
CAS:453557-49-8
Formula: O=CC1=C(C)N(N2C=NN=C2)C(C)=C1
95+%
BD196602
2,5-DIMETHYL-1-(5-METHYLPYRIDIN-2-YL)-1H-PYRROLE-3-CARBALDEHYDE
CAS:876717-21-4
Formula: O=CC1=C(C)N(C2=NC=C(C)C=C2)C(C)=C1
97%
BD598002
MFCD07643248
2,5-DIMETHYL-1-(7-METHYL-2,3-DIHYDROBENZO[B][1,4]DIOXIN-6-YL)-1H-PYRROLE-3-CARBALDEHYDE
CAS:879045-05-3
Formula: O=CC1=C(C)N(C2=C(C)C=C(OCCO3)C3=C2)C(C)=C1
97%
BD604879
MFCD07402329
2,5-DIMETHYL-1-(M-TOLYL)-1H-PYRROLE-3-CARBOXYLIC ACID
CAS:749219-01-0
Formula: O=C(C1=C(C)N(C2=CC=CC(C)=C2)C(C)=C1)O
97%
BD566667
MFCD03658004
2,5-DIMETHYL-1-(O-TOLYL)-1H-PYRROLE-3-CARBALDEHYDE
CAS:119673-47-1
Formula: CC1=C(C=C([N]1C2=C(C=CC=C2)C)C)C=O
95+%
BD67759
MFCD02212920
2,5-DIMETHYL-1-(O-TOLYL)-1H-PYRROLE-3-CARBOXYLIC ACID
CAS:500728-34-7
Formula: O=C(C1=C(C)N(C2=CC=CC=C2C)C(C)=C1)O
97%
BD566474
MFCD03988001
2,5-DIMETHYL-1-(P-TOLYL)-1H-PYRROLE
CAS:32411-27-1
Formula: CC1=CC=C(N2C(C)=CC=C2C)C=C1
95+%
BD67745
MFCD01552283
2,5-DIMETHYL-1-(P-TOLYL)-1H-PYRROLE-3-CARBALDEHYDE
CAS:327060-71-9
Formula: O=CC1=C(C)N(C2=CC=C(C)C=C2)C(C)=C1
97%
BD67766
2,5-DIMETHYL-1-(PHENYLSULFONYL)-1H-PYRROLO[2,3-B]PYRIDINE
CAS:1227270-58-7
Formula: CC1=CC2=C(N(S(=O)(C3=CC=CC=C3)=O)C(C)=C2)N=C1
95+%
BD333703
MFCD16875841
2,5-DIMETHYL-1-(PYRIDIN-2-YL)-1H-PYRROLE-3-CARBALDEHYDE
CAS:32570-90-4
Formula: O=CC1=C(C)N(C2=NC=CC=C2)C(C)=C1
97%
BD554529
MFCD04218024
2,5-DIMETHYL-1-(PYRIDIN-3-YL)-1H-PYRROLE-3-CARBALDEHYDE
CAS:35711-47-8
Formula: O=CC1=C(C)N(C2=CC=CN=C2)C(C)=C1
95+%
BD183423
2,5-DIMETHYL-1-(PYRIDIN-3-YLMETHYL)-1H-PYRROLE-3-CARBALDEHYDE
CAS:878424-30-7
Formula: O=CC1=C(C)N(CC2=CC=CN=C2)C(C)=C1
95+%
BD183902
2,5-DIMETHYL-1-(PYRIDIN-4-YL)-1H-PYRROLE-3-CARBALDEHYDE
CAS:431980-51-7
Formula: O=CC1=C(C)N(C2=CC=NC=C2)C(C)=C1
97%
BD447240
MFCD03085916
2,5-DIMETHYL-1-(PYRIDIN-4-YLMETHYL)-1H-PYRROLE-3-CARBOXYLIC ACID
CAS:306936-15-2
Formula: O=C(C1=C(C)N(CC2=CC=NC=C2)C(C)=C1)O
97%
BD67746
2,5-DIMETHYL-1-(THIAZOL-2-YL)-1H-PYRROLE-3-CARBALDEHYDE
CAS:142230-96-4
Formula: O=CC1=C(C)N(C2=NC=CS2)C(C)=C1
97%
BD554679
MFCD06655933
2,5-DIMETHYL-1-PHENYL-1H-PYRROLE
CAS:83-24-9
Formula: CC1=CC=C(C)N1C2=CC=CC=C2
95%
BD67762
2,5-DIMETHYL-1-PHENYL-1H-PYRROLE-3-CARBALDEHYDE
CAS:83-18-1
Formula: O=CC1=C(C)N(C2=CC=CC=C2)C(C)=C1
95+%
BD67763
MFCD00051494
2,5-DIMETHYL-1-PHENYL-1H-PYRROLE-3-CARBOXAMIDE
CAS:1266376-84-4
Formula: O=C(C1=C(C)N(C2=CC=CC=C2)C(C)=C1)N
97%
BD608923
2,5-DIMETHYL-1-PHENYL-1H-PYRROLE-3-CARBOXYLIC ACID
CAS:3807-56-5
Formula: O=C(C1=C(C)N(C2=CC=CC=C2)C(C)=C1)O
95+%
BD67761
2,5-DIMETHYL-1-PROPYL-1H-PYRROLE-3-CARBALDEHYDE
CAS:18870-75-2
Formula: O=CC1=C(C)N(CCC)C(C)=C1
95+%
BD67765
2,5-DIMETHYL-1H-BENZO[D]IMIDAZOLE
CAS:1792-41-2
Formula: CC1=CC=C2C(N=C(C)N2)=C1
95+%
BD67755
MFCD00125906
2,5-DIMETHYL-1H-INDOLE
CAS:1196-79-8
Formula: C1=C([NH]C2=CC=C(C=C12)C)C
98%
BD0084
MFCD00005621
2,5-DIMETHYL-1H-INDOLE-3-CARBALDEHYDE
CAS:61364-25-8
Formula: O=CC1=C(C)NC2=C1C=C(C)C=C2
95%
BD172597
MFCD06800613
2,5-DIMETHYL-1H-PYRAZOL-3(2H)-ONE
CAS:3201-29-4
Formula: O=C1N(C)NC(C)=C1
97%
BD517958
MFCD09953250
2,5-DIMETHYL-1H-PYRROLE
CAS:625-84-3
Formula: CC1=CC=C(C)N1
98%
BD67855
MFCD00005223
2,5-DIMETHYL-1H-PYRROLE-3,4-DICARBALDEHYDE
CAS:56139-74-3
Formula: O=CC1=C(C)NC(C)=C1C=O
95+%
BD323890
MFCD02660558
2,5-DIMETHYL-1H-PYRROLE-3-CARBALDEHYDE
CAS:2199-63-5
Formula: O=CC1=C(C)NC(C)=C1
95%
BD67757
2,5-DIMETHYL-1H-PYRROLE-3-CARBONITRILE
CAS:26187-29-1
Formula: CC1=CC(C#N)=C(C)N1
95+%
BD231884
MFCD12923809
2,5-DIMETHYL-1H-PYRROLE-3-CARBOXYLIC ACID
CAS:57338-76-8
Formula: O=C(C1=C(C)NC(C)=C1)O
97%
BD5073
MFCD00203874
2,5-DIMETHYL-1H-PYRROLO[2,3-B]PYRIDINE
CAS:1190314-46-5
Formula: CC1=CC2=C(NC(C)=C2)N=C1
95+%
BD333261
MFCD12962786
2,5-DIMETHYL-1H-PYRROLO[3,2-B]PYRIDINE
CAS:854018-76-1
Formula: CC1=CC=C(NC(C)=C2)C2=N1
95+%
BD335526
MFCD12963003
2,5-DIMETHYL-2'-METHOXYBENZOPHENONE
CAS:750633-51-3
Formula: O=C(C1=CC=CC=C1OC)C2=CC(C)=CC=C2C
95+%
BD309062
MFCD01311511
2,5-DIMETHYL-2'-MORPHOLINOMETHYL BENZOPHENONE
CAS:898750-50-0
Formula: O=C(C1=CC=CC=C1CN2CCOCC2)C3=CC(C)=CC=C3C
95+%
BD309951
MFCD03842425
2,5-DIMETHYL-2'-PIPERIDINOMETHYL BENZOPHENONE
CAS:898773-27-8
Formula: O=C(C1=CC=CC=C1CN2CCCCC2)C3=CC(C)=CC=C3C
95+%
BD311880
MFCD03842482
2,5-DIMETHYL-2'-PYRROLIDINOMETHYL BENZOPHENONE
CAS:898774-61-3
Formula: O=C(C1=CC=CC=C1CN2CCCC2)C3=CC(C)=CC=C3C
95+%
BD311964
MFCD03842539
2,5-DIMETHYL-2'-THIOMORPHOLINOMETHYL BENZOPHENONE
CAS:898781-86-7
Formula: O=C(C1=CC=CC=C1CN2CCSCC2)C3=CC(C)=CC=C3C
95+%
BD312651
MFCD03842766
2,5-DIMETHYL-2,3-DIHYDROBENZOFURAN-7-CARBOXYLIC ACID
CAS:31457-02-0
Formula: O=C(C1=C(OC(C)C2)C2=CC(C)=C1)O
97%
BD442692
MFCD20653549
2,5-DIMETHYL-2,5-DIAZABICYCLO[4.2.0]OCT-1(6)-ENE-7,8-DIONE
CAS:64186-72-7
Formula: O=C1C(C2=C1N(C)CCN2C)=O
97%
BD54708
2,5-DIMETHYL-2,5-HEXANEDIOL
CAS:110-03-2
Formula: CC(C)(O)CCC(C)(C)O
98%
BD17502
MFCD00004473
2,5-DIMETHYL-2H-INDAZOLE
CAS:1195697-22-3
Formula: CC1=CC2=CN(C)N=C2C=C1
97%
BD489641
2,5-DIMETHYL-3'-(1,3-DIOXOLAN-2-YL)BENZOPHENONE
CAS:898779-36-7
Formula: O=C(C1=CC=CC(C2OCCO2)=C1)C3=CC(C)=CC=C3C
95+%
BD312411
MFCD07699968
2,5-DIMETHYL-3'-METHOXYBENZOPHENONE
CAS:750633-71-7
Formula: O=C(C1=CC=CC(OC)=C1)C2=CC(C)=CC=C2C
95+%
BD309080
MFCD01311543
2,5-DIMETHYL-3'-MORPHOLINOMETHYL BENZOPHENONE
CAS:898765-59-8
Formula: O=C(C1=CC=CC(CN2CCOCC2)=C1)C3=CC(C)=CC=C3C
95+%
BD311192
MFCD03841916
2,5-DIMETHYL-3'-PIPERIDINOMETHYL BENZOPHENONE
CAS:898793-14-1
Formula: O=C(C1=CC=CC(CN2CCCCC2)=C1)C3=CC(C)=CC=C3C
95+%
BD313698
MFCD03841973
2,5-DIMETHYL-3'-PYRROLIDINOMETHYL BENZOPHENONE
CAS:898770-40-6
Formula: O=C(C1=CC=CC(CN2CCCC2)=C1)C3=CC(C)=CC=C3C
95+%
BD311652
MFCD03842030
2,5-DIMETHYL-3'-THIOMORPHOLINOMETHYL BENZOPHENONE
CAS:898763-16-1
Formula: O=C(C1=CC=CC(CN2CCSCC2)=C1)C3=CC(C)=CC=C3C
95+%
BD310950
MFCD03842255
2,5-DIMETHYL-3-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PYRIDINE
CAS:1309980-12-8
Formula: CC1(C)C(C)(C)OB(C2=CC(C)=CN=C2C)O1
95+%
BD244906
MFCD17012671
2,5-DIMETHYL-3-(4-(TRIFLUOROMETHYL)BENZYL)THIOPHENE
CAS:1006037-09-7
Formula: CC1=CC(CC2=CC=C(C(F)(F)F)C=C2)=C(C)S1
97%
BD332281
MFCD17926241
2,5-DIMETHYL-3-(METHYLSULFONYL)BENZENE-1-SULFONYL CHLORIDE
CAS:1258639-68-7
Formula: O=S(=O)(Cl)C1C(C)=C(S(=O)(C)=O)C=C(C)C=1
95%
BD00776313
MFCD17977050
2,5-DIMETHYL-3-(PIPERAZIN-1-YL)PYRAZINE
CAS:59215-42-8
Formula: CC1=CN=C(C)C(N2CCNCC2)=N1
95+%
BD157781
MFCD05182224
2,5-DIMETHYL-3-(TRIFLUOROMETHYL)PHENOL
CAS:1806451-09-1
Formula: FC(F)(F)C1=CC(C)=CC(O)=C1C
97%
BD486766
MFCD28794739
2,5-DIMETHYL-3-NITROANILINE
CAS:62564-50-5
Formula: NC1=CC(C)=CC([N+]([O-])=O)=C1C
95+%
BD70674
MFCD08062504
2,5-DIMETHYL-3-NITROBENZALDEHYDE
CAS:69022-52-2
Formula: O=CC1=CC(C)=CC([N+]([O-])=O)=C1C
95+%
BD262075
MFCD18909277
2,5-DIMETHYL-3-NITROBENZOIC ACID
CAS:27022-97-5
Formula: CC1=CC(C(O)=O)=C(C)C(=C1)[N+]([O-])=O
95+%
BD168352
2,5-DIMETHYL-3-NITROPHENOL
CAS:65151-57-7
Formula: OC1=CC(C)=CC([N+]([O-])=O)=C1C
95+%
BD261484
MFCD11007935
2,5-DIMETHYL-3-PHENYLPYRAZOLO[1,5-A]PYRIMIDIN-7-OL
CAS:331739-47-0
Formula: OC1=CC(C)=NC2=C(C3=CC=CC=C3)C(C)=NN12
97%
BD624780
2,5-DIMETHYL-3-PHENYLPYRAZOLO[1,5-A]PYRIMIDINE
CAS:1781423-38-8
Formula: CC1=NC2=C(C3=CC=CC=C3)C(C)=NN2C=C1
97%
BD593494
MFCD27978267
2,5-DIMETHYL-4'-(1,3-DIOXOLAN-2-YL)BENZOPHENONE
CAS:898760-22-0
Formula: O=C(C1=CC=C(C2OCCO2)C=C1)C3=CC(C)=CC=C3C
95+%
BD310740
MFCD07700019
2,5-DIMETHYL-4'-MORPHOLINOMETHYL BENZOPHENONE
CAS:898770-08-6
Formula: O=C(C1=CC=C(CN2CCOCC2)C=C1)C3=CC(C)=CC=C3C
95+%
BD311620
MFCD03841404
2,5-DIMETHYL-4'-PIPERIDINOMETHYL BENZOPHENONE
CAS:898775-05-8
Formula: O=C(C1=CC=C(CN2CCCCC2)C=C1)C3=CC(C)=CC=C3C
95+%
BD312007
MFCD03841461
2,5-DIMETHYL-4'-PYRROLIDINOMETHYL BENZOPHENONE
CAS:898776-47-1
Formula: O=C(C1=CC=C(CN2CCCC2)C=C1)C3=CC(C)=CC=C3C
95+%
BD312143
MFCD03841518
2,5-DIMETHYL-4'-THIOMORPHOLINOMETHYL BENZOPHENONE
CAS:898782-75-7
Formula: O=C(C1=CC=C(CN2CCSCC2)C=C1)C3=CC(C)=CC=C3C
95+%
BD312720
MFCD03841745
2,5-DIMETHYL-4,5,6,7-TETRAHYDRO-2H-PYRAZOLO[3,4-B]PYRIDIN-3-OL
CAS:1707568-46-4
Formula: OC1=C(CC(C)CN2)C2=NN1C
97%
BD620995
2,5-DIMETHYL-4,5,6,7-TETRAHYDRO-OXAZOLO[4,5-C]PYRIDINE HYDROCHLORIDE
CAS:1187932-78-0
Formula: CN1CCC(OC(C)=N2)=C2C1.[H]Cl
97%
BD00795059
2,5-DIMETHYL-4,5,6,7-TETRAHYDROOXAZOLO[4,5-C]PYRIDINE
CAS:1017781-98-4
Formula: CN1CCC(OC(C)=N2)=C2C1
97%
BD283216
MFCD09997826
2,5-DIMETHYL-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)THIAZOLE
CAS:1314306-11-0
Formula: CC1(C)C(C)(C)OB(C2=C(C)SC(C)=N2)O1
97%
BD00763101
n/a
2,5-DIMETHYL-4-(4-(TRIFLUOROMETHYL)BENZYL)THIOPHENE-3-CARBOXYLIC ACID
CAS:1006037-08-6
Formula: O=C(C1=C(C)SC(C)=C1CC2=CC=C(C(F)(F)F)C=C2)O
97%
BD332280
MFCD17926253
2,5-DIMETHYL-4-(4-METHYLPIPERAZIN-1-YL)THIENO[2,3-D]PYRIMIDINE-6-CARBOXYLIC ACID
CAS:421565-56-2
Formula: O=C(C1=C(C)C2=C(N3CCN(C)CC3)N=C(C)N=C2S1)O
95+%
BD196593
MFCD03030508
2,5-DIMETHYL-4-(N-(THIOPHEN-2-YLMETHYL)SULFAMOYL)FURAN-3-CARBOXYLIC ACID
CAS:306936-40-3
Formula: O=C(C1=C(C)OC(C)=C1S(=O)(NCC2=CC=CS2)=O)O
95+%
BD0815
MFCD02180782
2,5-DIMETHYL-4-(PYRROLIDIN-1-YL)BENZALDEHYDE
CAS:708280-61-9
Formula: O=CC1=CC(C)=C(N2CCCC2)C=C1C
97%
BD597181
MFCD05992707
2,5-DIMETHYL-4-IODOPHENOL
CAS:114971-53-8
Formula: OC1=CC(C)=C(I)C=C1C
98%
BD11183
MFCD00219922
2,5-DIMETHYL-4-METHOXYPHENYLBORONIC ACID
CAS:246023-54-1
Formula: COC1=CC(C)=C(C=C1C)B(O)O
97%
BD161530
MFCD06801676
2,5-DIMETHYL-4-NITROANILINE
CAS:3460-29-5
Formula: NC1=CC(C)=C([N+]([O-])=O)C=C1C
95%
BD67797
MFCD00025207
2,5-DIMETHYL-4-NITROBENZO[D]THIAZOLE
CAS:650635-66-8
Formula: O=[N+](C1=C2N=C(C)SC2=CC=C1C)[O-]
96%
BD289539
MFCD18826462
2,5-DIMETHYL-4-NITROBENZOIC ACID
CAS:6954-70-7
Formula: O=C(O)C1=CC(C)=C([N+]([O-])=O)C=C1C
97%
BD475283
MFCD00086153
2,5-DIMETHYL-4-NITROBENZONITRILE
CAS:73713-69-6
Formula: N#CC1=CC(C)=C([N+]([O-])=O)C=C1C
95+%
BD283303
MFCD00024285
2,5-DIMETHYL-4-NITROPHENOL
CAS:3139-05-7
Formula: CC1=CC(O)=C(C)C=C1[N+]([O-])=O
95+%
BD220094
MFCD07357405
2,5-DIMETHYL-4-NITROPYRIDINE
CAS:22282-82-2
Formula: O=[N+](C1=CC(C)=NC=C1C)[O-]
95+%
BD267393
MFCD26520944
2,5-DIMETHYL-4-OXO-1,4-DIHYDROTHIENO[2,3-D]PYRIMIDINE-6-CARBOXYLIC ACID
CAS:146628-89-9
Formula: O=C(C(S1)=C(C)C2=C1NC(C)=NC2=O)O
95+%
BD279427
2,5-DIMETHYL-4-OXO-4,5-DIHYDROFURAN-3-YL ACETATE
CAS:4166-20-5
Formula: CC(OC1=C(C)OC(C)C1=O)=O
97%
BD10658
MFCD00799462
2,5-DIMETHYL-4-PHENYLFURAN-3-CARBOXYLIC ACID
CAS:104794-30-1
Formula: O=C(O)C1=C(C)OC(C)=C1C2=CC=CC=C2
97%
BD508766
MFCD00684731
2,5-DIMETHYL-4-PHENYLTHIAZOLE
CAS:19968-59-3
Formula: CC1=C(C2=CC=CC=C2)N=C(C)S1
95+%
BD319197
MFCD01021040
2,5-DIMETHYL-6-NITROBENZO[D]THIAZOLE
CAS:686747-49-9
Formula: CC1=NC2=C(S1)C=C(C(C)=C2)[N+]([O-])=O
95+%
BD237076
MFCD18826463
2,5-DIMETHYL-7-(TRIFLUOROMETHYL)-4,5,6,7-TETRAHYDROPYRAZOLO[1,5-A]PYRIMIDINE
CAS:869945-59-5
Formula: FC(C1CC(C)NC2=CC(C)=NN12)(F)F
97%
BD494734
MFCD04969225
2,5-DIMETHYL-N-(2-PHENOXYETHYL)ANILINE
CAS:356086-80-1
Formula: CC1=CC=C(C)C(NCCOC2=CC=CC=C2)=C1
97%
BD595735
MFCD02603499
2,5-DIMETHYL-N-(3-(TRIFLUOROMETHYL)PHENYL)ANILINE
CAS:949161-10-8
Formula: FC(C1=CC(NC2=CC(C)=CC=C2C)=CC=C1)(F)F
95+%
BD252542
MFCD18207284
2,5-DIMETHYL-N-(O-TOLYL)ANILINE
CAS:949161-06-2
Formula: CC1=CC=CC=C1NC2=CC(C)=CC=C2C
95+%
BD252543
MFCD18207279
2,5-DIMETHYL-N-(P-TOLYL)ANILINE
CAS:34160-15-1
Formula: CC1=CC=C(NC2=CC(C)=CC=C2C)C=C1
95+%
BD252545
MFCD18207294
2,5-DIMETHYL-N-PHENYLANILINE
CAS:32446-14-3
Formula: CC1=CC=C(C)C(NC2=CC=CC=C2)=C1
95+%
BD252544
MFCD18207295
2,5-DIMETHYL-PYRROLIDINE HYDROCHLORIDE
CAS:63639-02-1
Formula: CC1CCC(C)N1.[H]Cl
96%
BD00777579
2,5-DIMETHYLANILINE HYDROCHLORIDE
CAS:51786-53-9
Formula: NC1=CC(C)=CC=C1C.[H]Cl
95+%
BD240604
2,5-DIMETHYLBENZALDEHYDE
CAS:5779-94-2
Formula: O=CC1=CC(C)=CC=C1C
95+%
BD6653
MFCD00003342
2,5-DIMETHYLBENZAMIDE
CAS:5692-34-2
Formula: O=C(N)C1=CC(C)=CC=C1C
95+%
BD308380
MFCD06093542
2,5-DIMETHYLBENZENE-1,3-DIOL
CAS:488-87-9
Formula: CC1=CC(O)=C(C)C(O)=C1
95+%
BD10652
MFCD00134473
2,5-DIMETHYLBENZENE-1-SULFONYL CHLORIDE
CAS:19040-62-1
Formula: O=S(C1=CC(C)=CC=C1C)(Cl)=O
98%
BD41412
MFCD00024875
2,5-DIMETHYLBENZENESULFONAMIDE
CAS:6292-58-6
Formula: O=S(C1=CC(C)=CC=C1C)(N)=O
97%
BD115572
2,5-DIMETHYLBENZENESULFONIC ACID
CAS:609-54-1
Formula: O=S(C1=CC(C)=CC=C1C)(O)=O
98%
BD149569
MFCD00151010
2,5-DIMETHYLBENZENESULFONOHYDRAZIDE
CAS:38045-54-4
Formula: O=S(C1=CC(C)=CC=C1C)(NN)=O
97%
BD67810
2,5-DIMETHYLBENZO[D]THIAZOL-4-AMINE
CAS:650635-67-9
Formula: NC1=C2N=C(C)SC2=CC=C1C
95%
BD542031
2,5-DIMETHYLBENZO[D]THIAZOL-6-AMINE
CAS:686747-14-8
Formula: CC1=NC2=C(S1)C=C(N)C(C)=C2
96%
BD237075
MFCD18822299
2,5-DIMETHYLBENZO[D]THIAZOL-6-OL
CAS:90563-67-0
Formula: OC1=C(C)C=C2N=C(C)SC2=C1
97%
BD752335
2,5-DIMETHYLBENZO[D]THIAZOLE
CAS:95-26-1
Formula: CC1=CC=C(SC(C)=N2)C2=C1
97%
BD67816
2,5-DIMETHYLBENZOIC ACID
CAS:610-72-0
Formula: C1=C(C)C=CC(=C1C(O)=O)C
98%
BD6660
MFCD00002482
2,5-DIMETHYLBENZONITRILE
CAS:13730-09-1
Formula: CC1=CC(C#N)=C(C)C=C1
97%
BD11682
MFCD00001793
2,5-DIMETHYLBENZOXAZOLE
CAS:5676-58-4
Formula: CC1=NC2=C(O1)C=CC(C)=C2
98%
BD11694
MFCD00005773
2,5-DIMETHYLBENZYL CHLORIDE
CAS:824-45-3
Formula: O=C(N1CCCCCCCC)C2C(C3)C=CC3C2C1=O
98%
BD35018
2,5-DIMETHYLBROMOBENZENE
CAS:553-94-6
Formula: C1=C(C(=CC=C1C)C)Br
98%
BD72296
MFCD00000074
2,5-DIMETHYLCHROMAN-4-ONE
CAS:69687-87-2
Formula: O=C1CC(C)OC2=CC=CC(C)=C12
95+%
BD298919
2,5-DIMETHYLCYCLOHEXANOL
CAS:3809-32-3
Formula: OC1C(C)CCC(C)C1
99%
BD67826
MFCD00001504
2,5-DIMETHYLCYCLOPENTANAMINE HYDROCHLORIDE
CAS:1375472-17-5
Formula: NC1C(C)CCC1C.[H]Cl
95%
BD683287
2,5-DIMETHYLDIHYDRO-2H-PYRAN-4(3H)-ONE
CAS:66109-81-7
Formula: O=C1CC(C)OCC1C
95+%
BD270093
2,5-DIMETHYLFURAN-3(2H)-ONE
CAS:14400-67-0
Formula: O=C1C(C)OC(C)=C1
98%
BD67777
MFCD00052571
2,5-DIMETHYLFURAN-3,4-DICARBOXYLIC ACID
CAS:14597-13-8
Formula: O=C(C1=C(C)OC(C)=C1C(O)=O)O
97%
BD617814
2,5-DIMETHYLFURAN-3-CARBOHYDRAZIDE
CAS:159881-93-3
Formula: O=C(C1=C(C)OC(C)=C1)NN
95%
BD274392
MFCD18252913
2,5-DIMETHYLFURAN-3-CARBONYL CHLORIDE
CAS:50990-93-7
Formula: O=C(Cl)C1=C(C)OC(C)=C1
98%
BD67829
MFCD00221073
2,5-DIMETHYLFURAN-3-CARBOXYLIC ACID
CAS:636-44-2
Formula: O=C(C1=C(C)OC(C)=C1)O
95%
BD29292
MFCD00082181
2,5-DIMETHYLFURAN-3-SULFONYL CHLORIDE
CAS:166964-26-7
Formula: CC1=CC(=C(C)O1)S(Cl)(=O)=O
95+%
BD67781
MFCD04115370
2,5-DIMETHYLFURAN-3-THIOL
CAS:55764-23-3
Formula: SC1=C(C)OC(C)=C1
97%
BD67830
2,5-DIMETHYLFURO[2,3-D]PYRIMIDIN-4-AMINE
CAS:1369247-36-8
Formula: NC1=C2C(OC=C2C)=NC(C)=N1
97%
BD442664
MFCD22068844
2,5-DIMETHYLHEX-3-ENE-2,5-DIOL
CAS:927-81-1
Formula: CC(O)(C)/C=C/C(O)(C)C
95%
BD00816643
2,5-DIMETHYLHEX-3-YNE-2,5-DIOL
CAS:142-30-3
Formula: CC(O)(C)C#CC(O)(C)C
98%
BD18307
MFCD00004468
2,5-DIMETHYLHEXAN-2-OL
CAS:3730-60-7
Formula: CC(O)(C)CCC(C)C
95+%
BD67773
MFCD00021814
2,5-DIMETHYLHEXANE
CAS:592-13-2
Formula: CC(C)CCC(C)C
98%
BD306342
MFCD00008951
2,5-DIMETHYLHEXANEDIOIC ACID
CAS:4454-18-6
Formula: O=C(O)C(C)CCC(C)C(O)=O
98%
BD67833
MFCD00020410
2,5-DIMETHYLIMIDAZO[1,2-A]PYRIDIN-3-AMINE
CAS:82199-92-6
Formula: NC1N2C(C=CC=C2C)=NC=1C
95+%
BD00780303
n/a
2,5-DIMETHYLIMIDAZO[1,2-A]PYRIDINE-3-CARBOXYLIC ACID
CAS:81438-50-8
Formula: O=C(C1=C(C)N=C2C=CC=C(C)N21)O
97%
BD561748
2,5-DIMETHYLISONICOTINONITRILE
CAS:7584-10-3
Formula: N#CC1=C(C)C=NC(C)=C1
95+%
BD248721
MFCD13175868
2,5-DIMETHYLISOQUINOLIN-1(2H)-ONE
CAS:N/A
Formula: O=C1N(C)C=CC2=C1C=CC=C2C
97%
BD751309
2,5-DIMETHYLMORPHOLINE
CAS:106-56-9
Formula: CC1COC(C)CN1
96%
BD232588
MFCD09971504
2,5-DIMETHYLNICOTINALDEHYDE
CAS:1211522-52-9
Formula: O=CC1=C(C)N=CC(C)=C1
95+%
BD268535
MFCD17012149
2,5-DIMETHYLNICOTINONITRILE
CAS:63820-75-7
Formula: N#CC1=C(C)N=CC(C)=C1
95+%
BD270175
MFCD13176003
2,5-DIMETHYLOXAZOLE
CAS:23012-11-5
Formula: CC1=CN=C(C)O1
95+%
BD225794
n/a
2,5-DIMETHYLOXAZOLE-4-CARBALDEHYDE
CAS:92901-88-7
Formula: O=CC1=C(C)OC(C)=N1
97%
BD67748
MFCD03923827
2,5-DIMETHYLOXAZOLE-4-CARBONYL CHLORIDE
CAS:197719-27-0
Formula: O=C(Cl)C1=C(C)OC(C)=N1
97%
BD27940
2,5-DIMETHYLOXAZOLE-4-CARBOXYLIC ACID
CAS:23000-14-8
Formula: O=C(C1=C(C)OC(C)=N1)O
98%
BD67750
MFCD03011595
2,5-DIMETHYLPHENYL ACETATE
CAS:877-48-5
Formula: CC(OC1=CC(C)=CC=C1C)=O
95+%
BD67842
MFCD03357477
2,5-DIMETHYLPHENYLACETYL CHLORIDE
CAS:55312-97-5
Formula: O=C(Cl)CC1=CC(C)=CC=C1C
95%
BD306335
MFCD12024950
2,5-DIMETHYLPHENYLBORONIC ACID
CAS:85199-06-0
Formula: C1=C(C=CC(=C1B(O)O)C)C
97%
BD5259
MFCD01863525
2,5-DIMETHYLPHENYLHYDRAZINE HYDROCHLORIDE
CAS:56737-78-1
Formula: NNC1=CC(C)=CC=C1C.[H]Cl
95+%
BD5368
MFCD00013382
2,5-DIMETHYLPIPERAZINE
CAS:106-55-8
Formula: CC1NCC(C)NC1
97%
BD67851
MFCD00005955
2,5-DIMETHYLPIPERAZINE DIHYDROCHLORIDE
CAS:1003-69-6
Formula: CC1NCC(C)NC1.[H]Cl.[H]Cl
97%
BD00798303
2,5-DIMETHYLPYRAZINE
CAS:123-32-0
Formula: C1=NC(=CN=C1C)C
97%
BD3685
MFCD00006147
2,5-DIMETHYLPYRAZOLIDIN-3-ONE
CAS:54945-11-8
Formula: O=C1CC(C)NN1C
97%
BD54155
2,5-DIMETHYLPYRAZOLO[1,5-A]PYRIMIDIN-7(4H)-ONE
CAS:98488-10-9
Formula: O=C1C=C(C)NC2=CC(C)=NN12
97%
BD67853
2,5-DIMETHYLPYRAZOLO[1,5-A]PYRIMIDIN-7-AMINE
CAS:2369-89-3
Formula: NC1=CC(C)=NC2=CC(C)=NN12
95+%
BD278299
2,5-DIMETHYLPYRAZOLO[1,5-A]PYRIMIDIN-7-OL
CAS:27166-46-7
Formula: OC1=CC(C)=NC2=CC(C)=NN12
95+%
BD389410
MFCD08729601
2,5-DIMETHYLPYRAZOLO[1,5-A]PYRIMIDINE-7-CARBOXYLIC ACID
CAS:1011355-87-5
Formula: O=C(C1=CC(C)=NC2=CC(C)=NN12)O
95+%
BD177234
MFCD09471033
2,5-DIMETHYLPYRIDAZIN-3(2H)-ONE
CAS:337956-28-2
Formula: O=C1C=C(C)C=NN1C
97%
BD00786897
2,5-DIMETHYLPYRIDIN-3-AMINE
CAS:89943-02-2
Formula: NC1=CC(C)=CN=C1C
95+%
BD243970
2,5-DIMETHYLPYRIDIN-4-AMINE
CAS:22279-89-6
Formula: NC1=CC(C)=NC=C1C
98%
BD248722
MFCD00235163
2,5-DIMETHYLPYRIDIN-4-OL
CAS:22279-59-0
Formula: CC1=CN=C(C)C=C1O
95+%
BD216457
MFCD13175268
2,5-DIMETHYLPYRIMIDIN-4(1H)-ONE
CAS:3059-71-0
Formula: O=C1N=C(C)NC=C1C
95+%
BD260622
2,5-DIMETHYLPYRIMIDIN-4-AMINE
CAS:73-70-1
Formula: NC1=NC(C)=NC=C1C
97%
BD249680
MFCD09909809
2,5-DIMETHYLPYRIMIDINE
CAS:22868-76-4
Formula: CC1=CN=C(C)N=C1
95+%
BD149831
MFCD16036322
2,5-DIMETHYLQUINAZOLIN-4(1H)-ONE
CAS:147006-56-2
Formula: O=C1N=C(C)NC2=C1C(C)=CC=C2
95+%
BD259939
2,5-DIMETHYLQUINOLIN-8-OL
CAS:10522-43-7
Formula: OC1=C2N=C(C)C=CC2=C(C)C=C1
95+%
BD225823
2,5-DIMETHYLQUINOLINE
CAS:26190-82-9
Formula: CC1=NC2=CC=CC(C)=C2C=C1
95+%
BD233340
MFCD11108670
2,5-DIMETHYLTEREPHTHALIC ACID
CAS:6051-66-7
Formula: CC1=CC(C(O)=O)=C(C)C=C1C(O)=O
96%
BD11847
MFCD00020292
2,5-DIMETHYLTEREPHTHALONITRILE
CAS:39095-25-5
Formula: N#CC1=CC(C)=C(C#N)C=C1C
97%
BD67862
2,5-DIMETHYLTHIAZOLE
CAS:4175-66-0
Formula: C1=C(C)SC(=N1)C
98%
BD9620
MFCD00130120
2,5-DIMETHYLTHIAZOLE-4-CARBOXYLIC ACID
CAS:113366-73-7
Formula: O=C(C1=C(C)SC(C)=N1)O
95+%
BD229152
MFCD09881001
2,5-DIMETHYLTHIOPHEN-3-AMINE HYDROCHLORIDE
CAS:854628-35-6
Formula: NC1=C(C)SC(C)=C1.[H]Cl
95%
BD756627
2,5-DIMETHYLTHIOPHENE
CAS:638-02-8
Formula: CC1=CC=C(C)S1
98%
BD67865
n/a
2,5-DIMETHYLTHIOPHENE-3-CARBALDEHYDE
CAS:26421-44-3
Formula: O=CC1=C(C)SC(C)=C1
97%
BD10578
MFCD03426895
2,5-DIMETHYLTHIOPHENE-3-CARBONITRILE
CAS:31883-38-2
Formula: N#CC1=C(C)SC(C)=C1
97%
BD624698
2,5-DIMETHYLTHIOPHENE-3-CARBOXYLIC ACID
CAS:26421-32-9
Formula: O=C(C1=C(C)SC(C)=C1)O
95%
BD10573
MFCD01860238
2,5-DIMETHYLTHIOPHENE-3-SULFONYL CHLORIDE
CAS:97272-04-3
Formula: CC1=CC(=C(C)S1)S(Cl)(=O)=O
95+%
BD67787
MFCD03086201
2,5-DIOCTYL-3,6-DI(THIOPHEN-2-YL)PYRROLO[3,4-C]PYRROLE-1,4(2H,5H)-DIONE
CAS:1057401-08-7
Formula: O=C1N(CCCCCCCC)C(C2=CC=CS2)=C3C1=C(C4=CC=CS4)N(CCCCCCCC)C3=O
95+%
BD254708
2,5-DIOXA-8-AZASPIRO[3.5]NONANE
CAS:1184185-17-8
Formula: C1OCC12OCCNC2
95+%
BD248146
MFCD11520356
2,5-DIOXA-8-AZASPIRO[3.5]NONANE HYDROCHLORIDE
CAS:1394840-20-0
Formula: [H]Cl.C1OCC12OCCNC2
95+%
BD210911
2,5-DIOXA-8-AZASPIRO[3.5]NONANE OXALATE(2:1)
CAS:1845713-71-4
Formula: O=C(O)C(O)=O.C1OCC12OCCNC2.C3OCC34OCCNC4
95%
BD628053
MFCD28166324
2,5-DIOXASPIRO[3.5]NONAN-7-AMINE
CAS:N/A
Formula: NC(CC1)COC21COC2
97%
BD00757544
2,5-DIOXASPIRO[3.5]NONAN-7-ONE
CAS:N/A
Formula: O=C(CC1)COC21COC2
97%
BD00804584
2,5-DIOXASPIRO[3.5]NONAN-8-AMINE
CAS:1934361-63-3
Formula: NC(C1)CCOC21COC2
97%
BD00810302
2,5-DIOXO-1,2,5,6,7,8-HEXAHYDROQUINOLINE-3-CARBOXYLIC ACID
CAS:106551-76-2
Formula: O=C(C1=CC2=C(NC1=O)CCCC2=O)O
95+%
BD67877
MFCD03423969
2,5-DIOXO-1-(4-(PYRIDIN-2-YLDISULFANYL)BUTANOYLOXY)PYRROLIDINE-3-SULFONIC ACID
CAS:1628113-16-5
Formula: O=S(C(C1)C(N(OC(CCCSSC2=NC=CC=C2)=O)C1=O)=O)(O)=O
95+%
BD338623
2,5-DIOXO-1-(4-(PYRIDIN-2-YLDISULFANYL)PENTANOYLOXY)PYRROLIDINE-3-SULFONIC ACID
CAS:452072-27-4
Formula: O=S(C(C1)C(N(OC(CCC(SSC2=NC=CC=C2)C)=O)C1=O)=O)(O)=O
95+%
BD338631
2,5-DIOXO-1-PYRROLIDINYL 6-QUINOLYLCARBAMATE
CAS:148757-94-2
Formula: O=C(ON1C(CCC1=O)=O)NC2=CC=C3N=CC=CC3=C2
95+%
BD289369
2,5-DIOXO-2,3,4,5-TETRAHYDRO-1H-BENZO[E][1,4]DIAZEPINE-8-CARBOXYLIC ACID
CAS:195985-12-7
Formula: O=C(O)C1=CC=C2C(NC(CNC2=O)=O)=C1
97%
BD0418
MFCD00798180
2,5-DIOXO-7-(M-TOLYL)-1,2,5,6,7,8-HEXAHYDROQUINOLINE-3-CARBOXYLIC ACID
CAS:945202-24-4
Formula: O=C(C1=CC2=C(NC1=O)CC(C3=CC=CC(C)=C3)CC2=O)O
97%
BD508103
MFCD09785547
2,5-DIOXO-7-(P-TOLYL)-1,2,5,6,7,8-HEXAHYDROQUINOLINE-3-CARBOXYLIC ACID
CAS:924834-92-4
Formula: O=C(C1=CC2=C(NC1=O)CC(C3=CC=C(C)C=C3)CC2=O)O
95+%
BD320484
MFCD09439077
2,5-DIOXO-PYRROLIDINE-3-CARBOXYLIC ACID
CAS:96905-69-0
Formula: O=C(C(C1)C(NC1=O)=O)O
95+%
BD324568
MFCD16039577
2,5-DIOXO-PYRROLIDINE-3-CARBOXYLIC ACID ETHYL ESTER
CAS:96905-68-9
Formula: O=C(C(C1)C(NC1=O)=O)OCC
95+%
BD324567
MFCD16039578
2,5-DIOXOPYRROLIDIN-1-YL ((3R,3AS,6AR)-HEXAHYDROFURO[2,3-B]FURAN-3-YL) CARBONATE
CAS:253265-97-3
Formula: O=C(ON1C(CCC1=O)=O)O[C@@H]2[C@@]3([H])[C@@](OCC3)([H])OC2
95+%
BD234419
2,5-DIOXOPYRROLIDIN-1-YL (2,2,2-TRICHLOROETHYL) CARBONATE
CAS:66065-85-8
Formula: ClC(Cl)(Cl)COC(=O)ON1C(=O)CCC1=O
95+%
BD235215
MFCD00075216
2,5-DIOXOPYRROLIDIN-1-YL (2-(METHYLSULFONYL)ETHYL) CARBONATE
CAS:57903-15-8
Formula: O=C(OCCS(=O)(C)=O)ON1C(CCC1=O)=O
97%
BD140474
MFCD00043142
2,5-DIOXOPYRROLIDIN-1-YL (2-(TRIMETHYLSILYL)ETHYL) CARBONATE
CAS:78269-85-9
Formula: C[Si](C)(C)CCOC(=O)ON1C(=O)CCC1=O
97%
BD227516
MFCD02683467
2,5-DIOXOPYRROLIDIN-1-YL [1,1'-BIPHENYL]-4-CARBOXYLATE
CAS:299969-20-3
Formula: O=C(C1=CC=C(C2=CC=CC=C2)C=C1)ON3C(CCC3=O)=O
97%
BD624586
n/a
2,5-DIOXOPYRROLIDIN-1-YL 1-((4-FLUOROPHENYL)SULFONYL)PIPERIDINE-4-CARBOXYLATE
CAS:1352517-05-5
Formula: O=C(C1CCN(S(=O)(C2=CC=C(F)C=C2)=O)CC1)ON3C(CCC3=O)=O
97%
BD611930
2,5-DIOXOPYRROLIDIN-1-YL 1-((4-METHOXYPHENYL)SULFONYL)PIPERIDINE-4-CARBOXYLATE
CAS:903853-23-6
Formula: O=C(CC1)N(OC(C2CCN(S(=O)(C3=CC=C(OC)C=C3)=O)CC2)=O)C1=O
97%
BD507757
MFCD08289822
2,5-DIOXOPYRROLIDIN-1-YL 1-(1,3-DIOXOISOINDOLIN-2-YLOXY)-3,6,9,12-TETRAOXAPENTADECAN-15-OATE
CAS:1415328-95-8
Formula: O=C(ON1C(CCC1=O)=O)CCOCCOCCOCCOCCON(C(C2=C3C=CC=C2)=O)C3=O
95+%
BD338605
2,5-DIOXOPYRROLIDIN-1-YL 1-(2,5-DIOXO-2H-PYRROL-1(5H)-YL)-3,6,9,12,15,18-HEXAOXAHENICOSAN-21-OATE
CAS:1599472-25-9
Formula: O=C(ON1C(CCC1=O)=O)CCOCCOCCOCCOCCOCCOCCN2C(C=CC2=O)=O
95+%
BD338617
2,5-DIOXOPYRROLIDIN-1-YL 1-(TRIFLUOROMETHYL)CYCLOBUTANECARBOXYLATE
CAS:1820739-93-2
Formula: O=C(C1(C(F)(F)F)CCC1)ON2C(CCC2=O)=O
97%
BD455696
MFCD09951811
2,5-DIOXOPYRROLIDIN-1-YL 1-[(4-FORMYLPHENYL)FORMAMIDO]-3,6,9,12-TETRAOXAPENTADECAN-15-OATE
CAS:1353011-74-1
Formula: O=C(ON1C(CCC1=O)=O)CCOCCOCCOCCOCCNC(C2=CC=C(C=O)C=C2)=O
95+%
BD338603
2,5-DIOXOPYRROLIDIN-1-YL 1-BROMO-2-OXO-6,9,12,15-TETRAOXA-3-AZAOCTADECAN-18-OATE
CAS:1260139-70-5
Formula: O=C(ON1C(CCC1=O)=O)CCOCCOCCOCCOCCNC(CBr)=O
95%
BD338584
2,5-DIOXOPYRROLIDIN-1-YL 1-CHLORO-2-OXO-6,9,12,15-TETRAOXA-3-AZAOCTADECAN-18-OATE
CAS:1353011-95-6
Formula: O=C(ON1C(CCC1=O)=O)CCOCCOCCOCCOCCNC(CCl)=O
95%
BD321593
MFCD20926381
2,5-DIOXOPYRROLIDIN-1-YL 11-(2,5-DIOXO-2,5-DIHYDRO-1H-PYRROL-1-YL)UNDECANOATE
CAS:87981-04-2
Formula: O=C(ON1C(CCC1=O)=O)CCCCCCCCCCN2C(C=CC2=O)=O
98%
BD145689
MFCD00467873
2,5-DIOXOPYRROLIDIN-1-YL 19-(2,5-DIOXO-2H-PYRROL-1(5H)-YL)-17-OXO-4,7,10,13-TETRAOXA-16-AZANONADECAN-1-OATE
CAS:756525-99-2
Formula: O=C(ON1C(CCC1=O)=O)CCOCCOCCOCCOCCNC(CCN2C(C=CC2=O)=O)=O
95+%
BD338647
2,5-DIOXOPYRROLIDIN-1-YL 1H-INDOLE-4-CARBOXYLATE
CAS:1707737-27-6
Formula: O=C(C1=CC=CC2=C1C=CN2)ON3C(CCC3=O)=O
97%
BD621670
2,5-DIOXOPYRROLIDIN-1-YL 2,4-DIMETHOXYBENZOATE
CAS:1638612-98-2
Formula: O=C(ON1C(CCC1=O)=O)C2=CC=C(OC)C=C2OC
97%
BD618785
2,5-DIOXOPYRROLIDIN-1-YL 2,5,8,11,14,17,20-HEPTAOXATRICOSAN-23-OATE
CAS:874208-92-1
Formula: COCCOCCOCCOCCOCCOCCOCCC(ON1C(CCC1=O)=O)=O
97%
BD446644
2,5-DIOXOPYRROLIDIN-1-YL 2,5,8,11,14-PENTAOXAHEPTADECAN-17-OATE
CAS:874208-94-3
Formula: COCCOCCOCCOCCOCCC(ON1C(CCC1=O)=O)=O
97%
BD446358
2,5-DIOXOPYRROLIDIN-1-YL 2,5,8,11-TETRAOXATETRADECAN-14-OATE
CAS:622405-78-1
Formula: COCCOCCOCCOCCC(ON1C(CCC1=O)=O)=O
97%
BD306356
n/a
2,5-DIOXOPYRROLIDIN-1-YL 2,6-DIMETHYLQUINOLINE-4-CARBOXYLATE
CAS:569355-30-2
Formula: CC1=CC2=C(C=C1)N=C(C)C=C2C(=O)ON1C(=O)CCC1=O
95+%
BD236870
MFCD16875520
2,5-DIOXOPYRROLIDIN-1-YL 2-(((BENZYLOXY)CARBONYL)AMINO)PROPANOATE
CAS:73488-77-4
Formula: CC(C(ON1C(CCC1=O)=O)=O)NC(OCC2=CC=CC=C2)=O
97%
BD156945
MFCD00189303
2,5-DIOXOPYRROLIDIN-1-YL 2-(((TERT-BUTOXYCARBONYL)AMINO)OXY)ACETATE
CAS:80366-85-4
Formula: O=C(ON1C(CCC1=O)=O)CONC(OC(C)(C)C)=O
98%
BD517434
2,5-DIOXOPYRROLIDIN-1-YL 2-((TERT-BUTOXYCARBONYL)AMINO)-4-METHYLPENTANOATE
CAS:74124-83-7
Formula: CC(C)CC(C(ON1C(CCC1=O)=O)=O)NC(OC(C)(C)C)=O
97%
BD448219
MFCD00836326
2,5-DIOXOPYRROLIDIN-1-YL 2-(2-(((BENZYLOXY)CARBONYL)AMINO)ACETAMIDO)ACETATE
CAS:32943-08-1
Formula: O=C(ON1C(CCC1=O)=O)CNC(CNC(OCC2=CC=CC=C2)=O)=O
97%
BD157066
MFCD00191098
2,5-DIOXOPYRROLIDIN-1-YL 2-(2-(TERT-BUTOXYCARBONYL)HYDRAZINYL)ISONICOTINATE
CAS:870776-18-4
Formula: O=C(C1C=C(NNC(=O)OC(C)(C)C)N=CC=1)ON1C(=O)CCC1=O
95+%
BD00737011
n/a
2,5-DIOXOPYRROLIDIN-1-YL 2-(2-(TERT-BUTOXYCARBONYL)HYDRAZINYL)NICOTINATE
CAS:N/A
Formula: O=C(C1C=CC=NC=1NNC(=O)OC(C)(C)C)ON1C(=O)CCC1=O
95%
BD00725688
2,5-DIOXOPYRROLIDIN-1-YL 2-(3-HYDROXY-3-METHYLBUT-1-YN-1-YL)BENZOATE
CAS:886493-65-8
Formula: O=C(ON1C(CCC1=O)=O)C2=CC=CC=C2C#CC(C)(O)C
97%
BD598160
MFCD06740157
2,5-DIOXOPYRROLIDIN-1-YL 2-(4-NITROPHENYL)ACETATE
CAS:68123-33-1
Formula: O=C(ON1C(CCC1=O)=O)CC2=CC=C([N+]([O-])=O)C=C2
98%
BD145691
MFCD00047124
2,5-DIOXOPYRROLIDIN-1-YL 2-(7-HYDROXY-4-METHYL-2-OXO-2H-CHROMEN-3-YL)ACETATE
CAS:96735-88-5
Formula: O=C(ON1C(CCC1=O)=O)CC(C2=O)=C(C)C3=C(O2)C=C(O)C=C3
90%
BD99173
2,5-DIOXOPYRROLIDIN-1-YL 2-(7-METHOXY-2-OXO-2H-CHROMEN-4-YL)ACETATE
CAS:359436-89-8
Formula: O=C1OC2=C(C=CC(OC)=C2)C(CC(ON3C(CCC3=O)=O)=O)=C1
97%
BD601441
2,5-DIOXOPYRROLIDIN-1-YL 2-(ACETYLTHIO)ACETATE
CAS:76931-93-6
Formula: O=C(ON1C(CCC1=O)=O)CSC(C)=O
94%
BD150866
MFCD00036891
2,5-DIOXOPYRROLIDIN-1-YL 2-(CYCLOOCT-2-YNYLOXY)ACETATE
CAS:1425803-45-7
Formula: O=C(ON1C(CCC1=O)=O)COC2C#CCCCCC2
95+%
BD338609
2,5-DIOXOPYRROLIDIN-1-YL 2-BROMOACETATE
CAS:42014-51-7
Formula: BrCC(=O)ON1C(=O)CCC1=O
98%
BD118758
MFCD00058571
2,5-DIOXOPYRROLIDIN-1-YL 2-CYANOACETATE
CAS:56657-76-2
Formula: O=C(ON1C(CCC1=O)=O)CC#N
97%
BD157830
MFCD00798802
2,5-DIOXOPYRROLIDIN-1-YL 2-ETHOXYBENZOATE
CAS:1401320-15-7
Formula: O=C(ON1C(CCC1=O)=O)C2=CC=CC=C2OCC
97%
BD615455
2,5-DIOXOPYRROLIDIN-1-YL 2-IODOACETATE
CAS:39028-27-8
Formula: O=C(ON1C(CCC1=O)=O)CI
95+%
BD134753
MFCD00058451
2,5-DIOXOPYRROLIDIN-1-YL 2-IODOBENZOATE
CAS:153969-44-9
Formula: O=C(ON1C(CCC1=O)=O)C2=CC=CC=C2I
97%
BD618345
2,5-DIOXOPYRROLIDIN-1-YL 2-METHOXYACETATE
CAS:161742-67-2
Formula: O=C(CC1)N(OC(COC)=O)C1=O
95+%
BD330271
MFCD22193834
2,5-DIOXOPYRROLIDIN-1-YL 2-METHYLBENZOATE
CAS:110920-14-4
Formula: O=C(ON1C(CCC1=O)=O)C2=CC=CC=C2C
97%
BD606514
2,5-DIOXOPYRROLIDIN-1-YL 2-PHENYLBUTANOATE
CAS:152683-20-0
Formula: CCC(C1=CC=CC=C1)C(ON2C(CCC2=O)=O)=O
97%
BD618284
2,5-DIOXOPYRROLIDIN-1-YL 3,3,3-TRIFLUOROPROPANOATE
CAS:405878-89-9
Formula: O=C(ON1C(CCC1=O)=O)CC(F)(F)F
95%
BD00785772
2,5-DIOXOPYRROLIDIN-1-YL 3,5-DICHLOROBENZOATE
CAS:143558-02-5
Formula: O=C(ON1C(CCC1=O)=O)C2=CC(Cl)=CC(Cl)=C2
97%
BD617014
2,5-DIOXOPYRROLIDIN-1-YL 3-(((BENZYLOXY)CARBONYL)AMINO)BENZOATE
CAS:129666-48-4
Formula: O=C(ON1C(CCC1=O)=O)C2=CC=CC(NC(OCC3=CC=CC=C3)=O)=C2
97%
BD156768
2,5-DIOXOPYRROLIDIN-1-YL 3-(2,5-DIOXO-2,5-DIHYDRO-1H-PYRROL-1-YL)BENZOATE
CAS:58626-38-3
Formula: O=C(ON1C(CCC1=O)=O)C2=CC=CC(N3C(C=CC3=O)=O)=C2
98%
BD87625
MFCD00005514
2,5-DIOXOPYRROLIDIN-1-YL 3-(2-(2-(4-FORMYLBENZAMIDO)ETHOXY)ETHOXY)PROPANOATE
CAS:1807521-07-8
Formula: O=C(ON1C(CCC1=O)=O)CCOCCOCCNC(C2=CC=C(C=O)C=C2)=O
97%
BD625962
2,5-DIOXOPYRROLIDIN-1-YL 3-(2-(2-METHOXYETHOXY)ETHOXY)PROPANOATE
CAS:876746-59-7
Formula: O=C(CC1)N(OC(CCOCCOCCOC)=O)C1=O
97%
BD446435
2,5-DIOXOPYRROLIDIN-1-YL 3-(2-BROMOACETAMIDO)PROPANOATE
CAS:57159-62-3
Formula: O=C(ON1C(CCC1=O)=O)CCNC(CBr)=O
97%
BD170769
MFCD01863457
2,5-DIOXOPYRROLIDIN-1-YL 3-(4-HYDROXYPHENYL)PROPANOATE
CAS:34071-95-9
Formula: O=C(ON1C(CCC1=O)=O)CCC2=CC=C(O)C=C2
95+%
BD20320
MFCD00005515
2,5-DIOXOPYRROLIDIN-1-YL 3-(4-OXO-3,4-DIHYDROQUINAZOLIN-2-YL)-4-((4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)BENZYL)OXY)BENZOATE
CAS:N/A
Formula: O=C(ON1C(CCC1=O)=O)C2=CC=C(OCC3=CC=C(B4OC(C)(C)C(C)(C)O4)C=C3)C(C(N5)=NC6=C(C=CC=C6)C5=O)=C2
95%
BD00732369
n/a
2,5-DIOXOPYRROLIDIN-1-YL 3-(PYRIDIN-2-YLDISULFANYL)BUTANOATE
CAS:107348-47-0
Formula: CC(SSC1=NC=CC=C1)CC(ON2C(CCC2=O)=O)=O
95+%
BD337735
MFCD28398150
2,5-DIOXOPYRROLIDIN-1-YL 3-(TRITYLTHIO)PROPANOATE
CAS:129431-12-5
Formula: O=C(ON1C(CCC1=O)=O)CCSC(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4
95+%
BD251996
2,5-DIOXOPYRROLIDIN-1-YL 3-METHOXYPROPANOATE
CAS:1027371-75-0
Formula: O=C(ON1C(CCC1=O)=O)CCOC
97%
BD446611
2,5-DIOXOPYRROLIDIN-1-YL 3-OXOCYCLOBUTANECARBOXYLATE
CAS:939412-81-4
Formula: O=C(C1CC(C1)=O)ON2C(CCC2=O)=O
97%
BD447032
MFCD23378924
2,5-DIOXOPYRROLIDIN-1-YL 4,7,10,13-TETRAOXAHEXADEC-15-YN-1-OATE
CAS:1428629-70-2
Formula: C#CCOCCOCCOCCOCCC(ON1C(CCC1=O)=O)=O
95+%
BD338610
2,5-DIOXOPYRROLIDIN-1-YL 4-((2,5-DIOXO-2,5-DIHYDRO-1H-PYRROL-1-YL)METHYL)CYCLOHEXANECARBOXYLATE
CAS:64987-85-5
Formula: O=C(C1CCC(CN2C(C=CC2=O)=O)CC1)ON3C(CCC3=O)=O
97%
BD151232
MFCD00009634
2,5-DIOXOPYRROLIDIN-1-YL 4-((3-(DIMETHYLCARBAMOYL)PYRIDIN-4-YL)DISULFANYL)PENTANOATE
CAS:663599-10-8
Formula: CC(SSC1=C(C(N(C)C)=O)C=NC=C1)CCC(ON2C(CCC2=O)=O)=O
95+%
BD338642
2,5-DIOXOPYRROLIDIN-1-YL 4-((5-NITROPYRIDIN-2-YL)DISULFANYL)PENTANOATE
CAS:663598-61-6
Formula: CC(SSC1=NC=C([N+]([O-])=O)C=C1)CCC(ON2C(CCC2=O)=O)=O
95+%
BD338634
2,5-DIOXOPYRROLIDIN-1-YL 4-(2-IODOACETAMIDO)BENZOATE
CAS:72252-96-1
Formula: O=C(ON1C(CCC1=O)=O)C2=CC=C(NC(CI)=O)C=C2
95+%
BD145694
2,5-DIOXOPYRROLIDIN-1-YL 4-(4-(2,5-DIOXO-2,5-DIHYDRO-1H-PYRROL-1-YL)PHENYL)BUTANOATE
CAS:79886-55-8
Formula: O=C(ON1C(CCC1=O)=O)CCCC2=CC=C(N3C(C=CC3=O)=O)C=C2
97%
BD16849
MFCD00054961
2,5-DIOXOPYRROLIDIN-1-YL 4-(5-((3AS,4S,6AR)-2-OXOHEXAHYDRO-1H-THIENO[3,4-D]IMIDAZOL-4-YL)PENTANAMIDO)BUTANOATE
CAS:258289-54-2
Formula: O=C(ON1C(CCC1=O)=O)CCCNC(CCCC[C@@H]2SC[C@]([C@]2([H])N3)([H])NC3=O)=O
95+%
BD289625
2,5-DIOXOPYRROLIDIN-1-YL 4-(TERT-BUTYL)BENZOATE
CAS:141537-23-7
Formula: O=C(ON1C(CCC1=O)=O)C2=CC=C(C(C)(C)C)C=C2
97%
BD615694
2,5-DIOXOPYRROLIDIN-1-YL 4-(VINYLSULFONYL)BENZOATE
CAS:343934-41-8
Formula: O=C(ON1C(CCC1=O)=O)C2=CC=C(S(=O)(C=C)=O)C=C2
95+%
BD170740
MFCD16876289
2,5-DIOXOPYRROLIDIN-1-YL 4-BENZOYLBENZOATE
CAS:91990-88-4
Formula: O=C(ON1C(CCC1=O)=O)C2=CC=C(C(C3=CC=CC=C3)=O)C=C2
98%
BD94379
2,5-DIOXOPYRROLIDIN-1-YL 4-CYANO-4-(((ETHYLTHIO)CARBONOTHIOYL)THIO)PENTANOATE
CAS:1195771-65-3
Formula: CC(SC(SCC)=S)(C#N)CCC(ON1C(CCC1=O)=O)=O
97%
BD571782
n/a
2,5-DIOXOPYRROLIDIN-1-YL 4-FLUOROBENZOATE
CAS:66134-67-6
Formula: FC1=CC=C(C=C1)C(=O)ON1C(=O)CCC1=O
95+%
BD236504
MFCD00587232
2,5-DIOXOPYRROLIDIN-1-YL 4-FORMYLBENZOATE
CAS:60444-78-2
Formula: O=C(ON1C(CCC1=O)=O)C2=CC=C(C=O)C=C2
97%
BD152075
MFCD00133733
2,5-DIOXOPYRROLIDIN-1-YL 4-IODOBENZOATE
CAS:39028-25-6
Formula: O=C(ON1C(CCC1=O)=O)C2=CC=C(I)C=C2
98%
BD331516
MFCD24387072
2,5-DIOXOPYRROLIDIN-1-YL 4-METHOXYBENZOATE
CAS:30364-57-9
Formula: O=C(ON1C(CCC1=O)=O)C2=CC=C(OC)C=C2
97%
BD624615
2,5-DIOXOPYRROLIDIN-1-YL 4-METHYL-4-((5-NITROPYRIDIN-2-YL)DISULFANYL)PENTANOATE
CAS:663598-98-9
Formula: CC(SSC1=NC=C([N+]([O-])=O)C=C1)(C)CCC(ON2C(CCC2=O)=O)=O
95+%
BD338638
2,5-DIOXOPYRROLIDIN-1-YL 4-METHYL-4-(PYRIDIN-2-YLDISULFANYL)PENTANOATE
CAS:890409-85-5
Formula: CC(SSC1=NC=CC=C1)(C)CCC(ON2C(CCC2=O)=O)=O
95+%
BD338489
MFCD20230415
2,5-DIOXOPYRROLIDIN-1-YL 4-NITROBENZOATE
CAS:30364-58-0
Formula: O=C(ON1C(CCC1=O)=O)C2=CC=C([N+]([O-])=O)C=C2
97%
BD624616
2,5-DIOXOPYRROLIDIN-1-YL 5-ETHYL-3-METHYLBENZOFURAN-2-CARBOXYLATE
CAS:1269534-09-9
Formula: O=C(C1=C(C)C2=CC(CC)=CC=C2O1)ON3C(CCC3=O)=O
97%
BD609160
2,5-DIOXOPYRROLIDIN-1-YL 6-((((9H-FLUOREN-9-YL)METHOXY)CARBONYL)AMINO)HEXANOATE
CAS:125697-63-4
Formula: O=C(ON1C(CCC1=O)=O)CCCCCNC(OCC2C3=C(C4=C2C=CC=C4)C=CC=C3)=O
95+%
BD239728
MFCD03788086
2,5-DIOXOPYRROLIDIN-1-YL 6-((2,4-DINITROPHENYL)AMINO)HEXANOATE
CAS:82321-04-8
Formula: O=C(ON1C(CCC1=O)=O)CCCCCNC2=CC=C([N+]([O-])=O)C=C2[N+]([O-])=O
97%
BD450103
MFCD00191630
2,5-DIOXOPYRROLIDIN-1-YL 6-(2,2,2-TRIFLUOROACETAMIDO)HEXANOATE
CAS:117032-51-6
Formula: O=C(ON1C(CCC1=O)=O)CCCCCNC(C(F)(F)F)=O
98%
BD316834
n/a
2,5-DIOXOPYRROLIDIN-1-YL 6-(2-(PROPAN-2-YLIDENE)HYDRAZINYL)NICOTINATE
CAS:362522-50-7
Formula: O=C(ON1C(CCC1=O)=O)C2=CN=C(NN=C(C)C)C=C2
97%
BD629279
n/a
2,5-DIOXOPYRROLIDIN-1-YL 6-(2-(TERT-BUTOXYCARBONYL)HYDRAZINYL)NICOTINATE
CAS:133081-26-2
Formula: CC(C)(C)OC(=O)NNC1=NC=C(C=C1)C(=O)ON1C(=O)CCC1=O
95+%
BD152076
MFCD03788694
2,5-DIOXOPYRROLIDIN-1-YL 6-(2-(TERT-BUTOXYCARBONYL)HYDRAZINYL)PICOLINATE
CAS:N/A
Formula: O=C(C1C=CC=C(NNC(=O)OC(C)(C)C)N=1)ON1C(=O)CCC1=O
95%
BD00750029
2,5-DIOXOPYRROLIDIN-1-YL 6-(2-IODOACETAMIDO)HEXANOATE
CAS:134759-23-2
Formula: O=C(ON1C(CCC1=O)=O)CCCCCNC(CI)=O
95+%
BD170691
MFCD00132999
2,5-DIOXOPYRROLIDIN-1-YL 6-(3-(2,5-DIOXO-2,5-DIHYDRO-1H-PYRROL-1-YL)PROPANAMIDO)HEXANOATE
CAS:367927-39-7
Formula: O=C(ON1C(CCC1=O)=O)CCCCCNC(CCN2C(C=CC2=O)=O)=O
97%
BD170744
2,5-DIOXOPYRROLIDIN-1-YL 6-(5-((3AS,4S,6AR)-2-OXOHEXAHYDRO-1H-THIENO[3,4-D]IMIDAZOL-4-YL)PENTANAMIDO)HEXANOATE
CAS:72040-63-2
Formula: O=C(ON1C(CCC1=O)=O)CCCCCNC(CCCC[C@@H]2SC[C@]([C@]2([H])N3)([H])NC3=O)=O
95+%
BD116735
MFCD00065502
2,5-DIOXOPYRROLIDIN-1-YL 6-(TERT-BUTOXYCARBONYLAMINO)HEXANOATE
CAS:51513-80-5
Formula: O=C(ON1C(CCC1=O)=O)CCCCCNC(OC(C)(C)C)=O
95%
BD33886
2,5-DIOXOPYRROLIDIN-1-YL 7-(2,5-DIOXO-2,5-DIHYDRO-1H-PYRROL-1-YL)HEPTANOATE
CAS:724721-93-1
Formula: O=C(ON1C(CCC1=O)=O)CCCCCCN2C(C=CC2=O)=O
95+%
BD290553
2,5-DIOXOPYRROLIDIN-1-YL 7-(DIETHYLAMINO)-2-OXO-2H-CHROMENE-3-CARBOXYLATE
CAS:139346-57-9
Formula: O=C(C(C1=O)=CC2=C(O1)C=C(N(CC)CC)C=C2)ON3C(CCC3=O)=O
95+%
BD110553
MFCD00467585
2,5-DIOXOPYRROLIDIN-1-YL 7-HYDROXY-2-OXO-2H-CHROMENE-3-CARBOXYLATE
CAS:134471-24-2
Formula: OC1=CC=C2C=C(C(=O)ON3C(=O)CCC3=O)C(=O)OC2=C1
96%
BD110692
MFCD00037568
2,5-DIOXOPYRROLIDIN-1-YL 7-METHOXY-2-OXO-2H-CHROMENE-3-CARBOXYLATE
CAS:150321-92-9
Formula: COC1=CC=C2C=C(C(=O)ON3C(=O)CCC3=O)C(=O)OC2=C1
98%
BD145692
MFCD00467593
2,5-DIOXOPYRROLIDIN-1-YL ACETATE
CAS:14464-29-0
Formula: CC(=O)ON1C(=O)CCC1=O
98%
BD152077
MFCD00037916
2,5-DIOXOPYRROLIDIN-1-YL ACRYLATE
CAS:38862-24-7
Formula: C=CC(ON1C(CCC1=O)=O)=O
97%
BD4868
MFCD00078261
2,5-DIOXOPYRROLIDIN-1-YL BENZOATE
CAS:23405-15-4
Formula: O=C(ON1C(CCC1=O)=O)C2=CC=CC=C2
97%
BD119282
MFCD00078953
2,5-DIOXOPYRROLIDIN-1-YL DODECANOATE
CAS:14565-47-0
Formula: CCCCCCCCCCCC(ON1C(CCC1=O)=O)=O
97%
BD571135
MFCD00050401
2,5-DIOXOPYRROLIDIN-1-YL METHYL ADIPATE
CAS:118380-06-6
Formula: O=C(ON1C(CCC1=O)=O)CCCCC(OC)=O
97%
BD139554
2,5-DIOXOPYRROLIDIN-1-YL METHYL PHTHALATE
CAS:438470-19-0
Formula: COC(=O)C1=CC=CC=C1C(=O)ON1C(=O)CCC1=O
95+%
BD228253
MFCD05865192
2,5-DIOXOPYRROLIDIN-1-YL METHYLCARBAMATE
CAS:18342-66-0
Formula: CNC(=O)ON1C(=O)CCC1=O
97%
BD145695
MFCD00800292
2,5-DIOXOPYRROLIDIN-1-YL OCTANOATE
CAS:14464-30-3
Formula: CCCCCCCC(ON1C(CCC1=O)=O)=O
97%
BD119865
MFCD00050404
2,5-DIOXOPYRROLIDIN-1-YL QUINOLIN-2-YLCARBAMATE
CAS:N/A
Formula: O=C(NC1C=CC2C(=CC=CC=2)N=1)ON1C(=O)CCC1=O
95%
BD00744531
n/a
2,5-DIOXOPYRROLIDIN-1-YL QUINOLIN-3-YLCARBAMATE
CAS:148757-95-3
Formula: O=C(NC1C=NC2C(=CC=CC=2)C=1)ON1C(=O)CCC1=O
95+%
BD00725051
n/a
2,5-DIOXOPYRROLIDIN-1-YL QUINOLIN-4-YLCARBAMATE
CAS:N/A
Formula: O=C(NC1C2C(=CC=CC=2)N=CC=1)ON1C(=O)CCC1=O
95%
BD00738443
n/a
2,5-DIOXOPYRROLIDIN-1-YL QUINOLIN-5-YLCARBAMATE
CAS:148757-98-6
Formula: O=C(ON1C(CCC1=O)=O)NC2=C3C=CC=NC3=CC=C2
97%
BD752843
2,5-DIOXOPYRROLIDIN-1-YL QUINOLIN-7-YLCARBAMATE
CAS:N/A
Formula: O=C(ON1C(CCC1=O)=O)NC2=CC=C3C=CC=NC3=C2
97%
BD751464
2,5-DIOXOPYRROLIDIN-1-YL QUINOLIN-8-YLCARBAMATE
CAS:N/A
Formula: O=C(ON1C(CCC1=O)=O)NC2=C3N=CC=CC3=CC=C2
97%
BD751465
2,5-DIOXOPYRROLIDIN-1-YL TETRADECANOATE
CAS:69888-86-4
Formula: CCCCCCCCCCCCCC(ON1C(CCC1=O)=O)=O
95+%
BD293772
2,5-DIOXOPYRROLIDIN-1-YL TETRAHYDRO-2H-PYRAN-4-CARBOXYLATE
CAS:1369515-33-2
Formula: O=C(C1CCOCC1)ON2C(CCC2=O)=O
95+%
BD306690
MFCD25562901
2,5-DIOXOPYRROLIDIN-3-YL 3-((((2,5-DIOXOPYRROLIDIN-1-YL)OXY)CARBONYL)AMINO)PROPANOATE
CAS:21994-89-8
Formula: O=C(OC(CC1=O)C(N1)=O)CCNC(ON2C(CCC2=O)=O)=O
97%
BD582524
MFCD09952655
2,5-DIPHENYL-1,3,4-OXADIAZOLE
CAS:725-12-2
Formula: C1(C2=CC=CC=C2)=NN=C(C3=CC=CC=C3)O1
95+%
BD67879
MFCD00003102
2,5-DIPHENYL-1H-IMIDAZOLE
CAS:670-83-7
Formula: N1C=C(N=C1C1=CC=CC=C1)C1=CC=CC=C1
98%
BD67215
MFCD07772899
2,5-DIPHENYL-1H-PYRROLE
CAS:838-40-4
Formula: C1(C2=CC=CC=C2)=CC=C(C3=CC=CC=C3)N1
95+%
BD319160
MFCD00767151
2,5-DIPHENYL-1H-PYRROLE-3-CARBONITRILE
CAS:67421-66-3
Formula: N#CC1=C(C2=CC=CC=C2)NC(C3=CC=CC=C3)=C1
95+%
BD269129
MFCD00767152
2,5-DIPHENYLFURAN
CAS:955-83-9
Formula: C1(C2=CC=CC=C2)=CC=C(C3=CC=CC=C3)O1
97%
BD16251
MFCD00037353
2,5-DIPHENYLOXAZOLE
CAS:92-71-7
Formula: C1(C2=CC=CC=C2)=NC=C(C3=CC=CC=C3)O1
98%
BD67887
MFCD00005306
2,5-DIPHENYLPYRAZOLO[1,5-A]PYRIMIDIN-7-AMINE
CAS:310422-25-4
Formula: NC1=CC(C2=CC=CC=C2)=NC3=CC(C4=CC=CC=C4)=NN13
97%
BD594144
MFCD01053019
2,5-DIPHENYLPYRAZOLO[1,5-A]PYRIMIDIN-7-OL
CAS:331968-09-3
Formula: OC1=CC(C2=CC=CC=C2)=NC3=CC(C4=CC=CC=C4)=NN13
97%
BD594434
MFCD00634656
2,5-DIPHENYLPYRIDINE
CAS:15827-72-2
Formula: C1(C2=CC=CC=C2)=NC=C(C3=CC=CC=C3)C=C1
95+%
BD67889
MFCD00444961
2,5-DIPHENYLTHIAZOL-4-OL
CAS:59484-42-3
Formula: OC1=C(C2=CC=CC=C2)SC(C3=CC=CC=C3)=N1
95+%
BD67880
MFCD00895725
2,5-DIPHENYLTHIOPHENE
CAS:1445-78-9
Formula: C1(C2=CC=CC=C2)=CC=C(C3=CC=CC=C3)S1
98%
BD8604
MFCD00626285
2,5-DITERT-BUTYL-1H-INDOLE
CAS:900640-46-2
Formula: CC(C1=CC2=C(NC(C(C)(C)C)=C2)C=C1)(C)C
95+%
BD328014
MFCD05224491
2,5-DITERT-BUTYL-1H-INDOLE-3-CARBALDEHYDE
CAS:590347-37-8
Formula: O=CC1=C(C(C)(C)C)NC2=C1C=C(C(C)(C)C)C=C2
95+%
BD327500
MFCD05180762
2,5-DITHIOCYANATOTHIOPHENE
CAS:34099-59-7
Formula: N#CSC1=CC=C(SC#N)S1
97%
BD508537
MFCD20441363
2,5-DITHIOXO-3-(P-TOLYL)-2,3,5,6-TETRAHYDROTHIAZOLO[4,5-D]PYRIMIDIN-7(4H)-ONE
CAS:1325304-08-2
Formula: O=C(N1)C(SC(N2C3=CC=C(C)C=C3)=S)=C2NC1=S
97%
BD610240
2,5-Furandicarbonyl Dichloride
CAS:10375-34-5
Formula: O=C(Cl)C1=CC=C(C(Cl)=O)O1
98% GC)
BD00780669
2,5-PYRIDINEDICARBOXYLIC ACID
CAS:100-26-5
Formula: OC(=O)C1=CN=C(C=C1)C(O)=O
98%
BD17209
MFCD00006297
2,5-THIOPHENEDICARBOXALDEHYDE
CAS:932-95-6
Formula: O=CC1=CC=C(C=O)S1
97%
BD67922
MFCD00216592
2,6 DIFLUORO 3-HYDROXY BENZOIC ACID
CAS:749230-32-8
Formula: OC(=O)C1=C(F)C(O)=CC=C1F
97%
BD212677
MFCD08275286
2,6,10,10-TETRAMETHYL-1-OXASPIRO[4.5]DEC-6-ENE
CAS:36431-72-8
Formula: CC1(C)CCC=C(C)C21CCC(C)O2
95+%
BD130161
MFCD00085214
2,6,10,15,19,23-HEXAMETHYLTETRACOSANE
CAS:111-01-3
Formula: CC(C)CCCC(C)CCCC(C)CCCCC(C)CCCC(C)CCCC(C)C
95%
BD151864
MFCD00008953
2,6,16-KAURANETRIOL
CAS:41530-90-9
Formula: CC1(C)C[C@@H](O)C[C@@]2(C)[C@@]3([H])[C@@]4(C[C@]([C@H](CC3)C4)(O)C)C[C@@H](O)[C@]12[H]
95+%
BD235867
MFCD17214868
2,6,16-KAURANETRIOL 2-O-BETA-D-ALLOPYRANOSIDE
CAS:195735-16-1
Formula: O[C@H]1[C@H](O[C@@H]2CC(C)(C)[C@@]3([H])[C@H](O)C[C@@](C[C@@](C)(O)[C@]4([H])CC5)(C4)[C@]5([H])[C@]3
95+%
BD235811
MFCD17214897
2,6,6-TRIMETHYL-2-CYCLOHEXENE-1,4-DIONE
CAS:1125-21-9
Formula: O=C1C(C)=CC(CC1(C)C)=O
98%
BD67937
MFCD00043119
2,6,6-TRIMETHYL-6,7-DIHYDRO-1H-INDOL-4(5H)-ONE
CAS:69595-03-5
Formula: CC1=CC2=C(CC(C)(C)CC2=O)N1
95+%
BD238129
MFCD00129627
2,6,6-TRIMETHYLBICYCLO[3.1.1]HEPTAN-3-AMINE
CAS:69460-11-3
Formula: NC1CC2CC(C1C)C2(C)C
97%
BD42903
2,6,6-TRIMETHYLBICYCLO[3.1.1]HEPTAN-3-OL
CAS:473-61-0
Formula: OC1C(C)C(C2)C(C)(C)C2C1
95+%
BD287411
2,6,6-TRIMETHYLBICYCLO[3.1.1]HEPTANE
CAS:473-55-2
Formula: CC1(C)C2CCC(C)C1C2
95%
BD148089
MFCD00078047
2,6,6-TRIMETHYLCYCLOHEPTA-2,4-DIENONE
CAS:503-93-5
Formula: O=C1C(C)=CC=CC(C)(C)C1
96%
BD67936
MFCD00182537
2,6,7-TRICHLORO-3-(TRIFLUOROMETHYL)QUINOXALINE
CAS:281209-13-0
Formula: FC(C1=NC2=CC(Cl)=C(Cl)C=C2N=C1Cl)(F)F
95+%
BD258159
MFCD09801052
2,6,7-TRICHLOROIMIDAZO[1,2-A]PYRIDINE
CAS:131773-47-2
Formula: ClC1=CC2=NC(Cl)=CN2C=C1Cl
95+%
BD67941
2,6,7-TRICHLOROQUINAZOLIN-4(3H)-ONE
CAS:N/A
Formula: O=C1NC(Cl)=NC2=C1C=C(Cl)C(Cl)=C2
97%
BD753091
2,6,7-TRICHLOROQUINAZOLIN-4-AMINE
CAS:N/A
Formula: NC1=C2C=C(Cl)C(Cl)=CC2=NC(Cl)=N1
97%
BD753092
2,6,7-TRICHLOROQUINAZOLINE
CAS:N/A
Formula: ClC1=CC2=NC(Cl)=NC=C2C=C1Cl
97%
BD752034
2,6,7-TRICHLOROQUINOLINE-3-CARBALDEHYDE
CAS:281208-97-7
Formula: ClC1=CC2=C(C=C1Cl)N=C(Cl)C(C=O)=C2
95+%
BD235639
MFCD06202346
2,6,7-TRICHLOROQUINOXALINE
CAS:41213-31-4
Formula: ClC1=C(Cl)C=C2N=CC(Cl)=NC2=C1
97%
BD250030
MFCD11519427
2,6,7-TRIHYDROXY-9-PHENYL-3H-XANTHEN-3-ONE
CAS:975-17-7
Formula: O=C1C(O)=CC2=C(C3=CC=CC=C3)C4=C(C=C(O)C(O)=C4)OC2=C1
97%
BD111854
MFCD00005048
2,6,7-TRIMETHYLQUINOLINE
CAS:72681-37-9
Formula: CC1=C(C)C=C2C=CC(C)=NC2=C1
95+%
BD348727
MFCD08437588
2,6,8-TRICHLORO-7H-PURINE
CAS:2562-52-9
Formula: ClC1=NC2=NC(Cl)=NC(Cl)=C2N1
95+%
BD248723
MFCD00067308
2,6,8-TRIMETHYL-1-(2-OXOPROPYL)QUINOLIN-4(1H)-ONE
CAS:1209876-74-3
Formula: O=C1C=C(C)N(CC(C)=O)C2=C1C=C(C)C=C2C
97%
BD607494
2,6,8-TRIMETHYLQUINOLINE
CAS:2243-90-5
Formula: CC1=C2N=C(C)C=CC2=CC(C)=C1
97%
BD587471
2,6,8-TRIMETHYLQUINOLINE-3-CARBOXYLIC ACID
CAS:876721-02-7
Formula: O=C(C1=CC2=CC(C)=CC(C)=C2N=C1C)O
97%
BD183895
2,6,8-TRIMETHYLQUINOLINE-4-CARBOXYLIC ACID
CAS:93189-20-9
Formula: O=C(C1=CC(C)=NC2=C(C)C=C(C)C=C12)O
95+%
BD173413
2,6-?BIS(2-?PYRIDYL)?-?4(1H)-PYRIDONE
CAS:128143-88-4
Formula: O=C1C=C(C2=NC=CC=C2)NC(C3=NC=CC=C3)=C1
98%
BD67954
MFCD01321386
2,6-BIS(((BENZYLOXY)CARBONYL)AMINO)HEXANOIC ACID
CAS:55592-85-3
Formula: O=C(O)C(NC(OCC1=CC=CC=C1)=O)CCCCNC(OCC2=CC=CC=C2)=O
97%
BD156953
MFCD00069644
2,6-BIS((2-HYDROXYETHYL)AMINO)-4-METHYLNICOTINONITRILE
CAS:38841-88-2
Formula: N#CC1=C(C)C=C(NCCO)N=C1NCCO
97%
BD651730
2,6-BIS((3-METHOXYPROPYL)AMINO)-4-METHYLNICOTINONITRILE
CAS:51560-72-6
Formula: N#CC1=C(C)C=C(NCCCOC)N=C1NCCCOC
97%
BD86283
2,6-BIS((3AR,8AS)-8,8A-DIHYDRO-3AH-INDENO[1,2-D]OXAZOL-2-YL)PYRIDINE
CAS:357209-32-6
Formula: C1[C@@H]2OC(=N[C@@H]2C2=CC=CC=C12)C1=CC=CC(=N1)C1=N[C@H]2[C@H](CC3=CC=CC=C23)O1
97%
BD214228
MFCD09265074
2,6-BIS((3AS,8AR)-8,8A-DIHYDRO-3AH-INDENO[1,2-D]OXAZOL-2-YL)PYRIDINE
CAS:185346-09-2
Formula: C1[C@H]2OC(=N[C@H]2C2=CC=CC=C12)C1=CC=CC(=N1)C1=N[C@@H]2[C@@H](CC3=CC=CC=C23)O1
98%
BD214220
MFCD05861599
2,6-BIS((BIS(PYRIDIN-2-YLMETHYL)AMINO)METHYL)-4-METHYLPHENOL
CAS:80528-41-2
Formula: OC1=C(CN(CC2=NC=CC=C2)CC3=NC=CC=C3)C=C(C)C=C1CN(CC4=NC=CC=C4)CC5=NC=CC=C5
95+%
BD405444
MFCD16652516
2,6-BIS((DI-TERT-BUTYLPHOSPHINO)METHYL)PYRIDINE
CAS:338800-13-8
Formula: CC(P(CC1=CC=CC(CP(C(C)(C)C)C(C)(C)C)=N1)C(C)(C)C)(C)C
98%
BD244499
MFCD10565623
2,6-BIS((DIMETHYLAMINO)METHYL)-4-(PENTAN-2-YL)PHENOL
CAS:924868-91-7
Formula: OC1=C(CN(C)C)C=C(C(CCC)C)C=C1CN(C)C
95+%
BD201048
2,6-BIS((DIMETHYLAMINO)METHYL)-4-ETHYLPHENOL
CAS:36805-45-5
Formula: OC1=C(CN(C)C)C=C(CC)C=C1CN(C)C
95+%
BD200971
2,6-BIS((DIMETHYLAMINO)METHYL)PYRIDIN-3-OL
CAS:2168-17-4
Formula: OC1=CC=C(CN(C)C)N=C1CN(C)C
95+%
BD350831
MFCD00030824
2,6-BIS((PHENYLSULFONYL)OXY)-1,4-PHENYLENE DIACETATE
CAS:20032-31-9
Formula: O=S(OC1=C(OC(C)=O)C(OS(=O)(C2=CC=CC=C2)=O)=CC(OC(C)=O)=C1)(C3=CC=CC=C3)=O
95+%
BD227412
2,6-BIS((R)-4-(TERT-BUTYL)-4,5-DIHYDROOXAZOL-2-YL)PYRIDINE
CAS:185346-17-2
Formula: CC([C@H]1N=C(C2=CC=CC(C3=N[C@H](C(C)(C)C)CO3)=N2)OC1)(C)C
98%
BD67984
2,6-BIS((R)-4-BENZYL-4,5-DIHYDROOXAZOL-2-YL)PYRIDINE
CAS:365215-38-9
Formula: C1(C2=N[C@H](CC3=CC=CC=C3)CO2)=NC(C4=N[C@H](CC5=CC=CC=C5)CO4)=CC=C1
97%
BD233638
2,6-BIS((R)-4-ISOPROPYL-4,5-DIHYDROOXAZOL-2-YL)PYRIDINE
CAS:131864-67-0
Formula: CC([C@H]1N=C(C2=CC=CC(C3=N[C@H](C(C)C)CO3)=N2)OC1)C
97%
BD8908
MFCD01321334
2,6-BIS((R)-4-PHENYL-4,5-DIHYDROOXAZOL-2-YL)PYRIDINE
CAS:128249-70-7
Formula: [C@@H]1(N=C(OC1)C2=NC(=CC=C2)C4=N[C@H](C3=CC=CC=C3)CO4)C5=CC=CC=C5
98%
BD43012
MFCD01863585
2,6-BIS((S)-4-(TERT-BUTYL)-4,5-DIHYDROOXAZOL-2-YL)PYRIDINE
CAS:118949-63-6
Formula: CC(C)(C)[C@H]1COC(=N1)C1=CC=CC(=N1)C1=N[C@H](CO1)C(C)(C)C
97%
BD42680
MFCD07368372
2,6-BIS((S)-4-ISOPROPYL-4,5-DIHYDROOXAZOL-2-YL)PYRIDINE
CAS:118949-61-4
Formula: CC(C)[C@H]1COC(=N1)C1=CC=CC(=N1)C1=N[C@H](CO1)C(C)C
98%
BD214217
MFCD00191815
2,6-BIS((S)-4-PHENYL-4,5-DIHYDROOXAZOL-2-YL)PYRIDINE
CAS:174500-20-0
Formula: [C@H]1(N=C(OC1)C2=CC=CC(=N2)C4=N[C@@H](C3=CC=CC=C3)CO4)C5=CC=CC=C5
97%
BD27775
MFCD01863586
2,6-BIS(1,1-DIMETHYLETHYL)-N,N-DIMETHYL-4-PYRIDINAMINE
CAS:38222-90-1
Formula: CN(C)C1=CC(C(C)(C)C)=NC(C(C)(C)C)=C1
95+%
BD305791
n/a
2,6-BIS(1,3-DIOXOISOINDOLIN-2-YL)HEXANOIC ACID
CAS:43018-26-4
Formula: O=C(O)C(N(C(C1=C2C=CC=C1)=O)C2=O)CCCCN(C(C3=C4C=CC=C3)=O)C4=O
97%
BD562955
2,6-BIS(1-METHYL-1H-BENZO[D]IMIDAZOL-2-YL)PYRIDIN-4-OL
CAS:533928-74-4
Formula: OC1=CC(C2=NC3=CC=CC=C3N2C)=NC(C4=NC5=CC=CC=C5N4C)=C1
97%
BD232860
2,6-BIS(1-METHYL-1H-BENZO[D]IMIDAZOL-2-YL)PYRIDINE
CAS:112362-30-8
Formula: CN1C(C2=CC=CC(C3=NC4=CC=CC=C4N3C)=N2)=NC5=CC=CC=C15
95+%
BD232840
2,6-BIS(1H-2-IMIDAZOLYL)PYRIDINE
CAS:151674-75-8
Formula: C1(C2=NC=CN2)=NC(C3=NC=CN3)=CC=C1
95+%
BD323311
MFCD08668015
2,6-BIS(1H-BENZO[D]IMIDAZOL-1-YL)PYRIDINE
CAS:1030366-99-4
Formula: C1(N2C=NC3=CC=CC=C23)=NC(N4C=NC5=CC=CC=C45)=CC=C1
98%
BD262404
2,6-BIS(2,2,2-TRIFLUOROETHOXY)BENZONITRILE
CAS:93624-57-8
Formula: N#CC1=C(OCC(F)(F)F)C=CC=C1OCC(F)(F)F
97%
BD67950
2,6-BIS(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)BENZO[1,2-B:4,5-B']DITHIOPHENE
CAS:861398-06-3
Formula: CC1(C)C(C)(C)OB(C2=CC3=C(C=C(C=C(B4OC(C)(C)C(C)(C)O4)S5)C5=C3)S2)O1
95+%
BD331733
2,6-BIS(4,5-DIHYDROOXAZOL-2-YL)PYRIDINE
CAS:165125-95-1
Formula: C1(C2=NCCO2)=NC(C3=NCCO3)=CC=C1
97%
BD293022
MFCD28145681
2,6-BIS(4-METHOXYPHENYL)-3,5-DIMETHYLPIPERIDIN-4-ONE
CAS:151454-11-4
Formula: O=C1C(C)C(C2=CC=C(OC)C=C2)NC(C3=CC=C(OC)C=C3)C1C
95+%
BD268638
MFCD01126398
2,6-BIS(BENZIMIDAZOL-2-YL)PYRIDINE
CAS:28020-73-7
Formula: C1(C2=NC3=CC=CC=C3N2)=NC(C4=NC5=CC=CC=C5N4)=CC=C1
98%
BD67952
MFCD00134500
2,6-BIS(BENZO[D]OXAZOL-2-YL)PYRIDINE
CAS:33858-36-5
Formula: O1C2=C(C=CC=C2)N=C1C1=CC=CC(=N1)C1=NC2=C(O1)C=CC=C2
98%
BD216982
MFCD05241117
2,6-BIS(BENZYLOXY)-3-BROMOPYRIDINE
CAS:16727-47-2
Formula: BrC1=CC=C(OCC2=CC=CC=C2)N=C1OCC3=CC=CC=C3
96%
BD229843
2,6-BIS(BENZYLOXY)PYRIDIN-4-AMINE
CAS:23827-19-2
Formula: NC1=CC(OCC2=CC=CC=C2)=NC(OCC3=CC=CC=C3)=C1
95+%
BD252546
MFCD20257886
2,6-BIS(BENZYLOXY)PYRIDINE
CAS:16727-46-1
Formula: C1(OCC2=CC=CC=C2)=NC(OCC3=CC=CC=C3)=CC=C1
97%
BD229838
2,6-BIS(BROMOMETHYL)NAPHTHALENE
CAS:4542-77-2
Formula: BrCC1=CC2=CC=C(CBr)C=C2C=C1
97%
BD254681
MFCD00228693
2,6-BIS(CHLOROMETHYL)-1,4-DIMETHOXYBENZENE
CAS:1379163-23-1
Formula: COC1=CC(CCl)=C(OC)C(CCl)=C1
97%
BD00789909
2,6-BIS(CHLOROMETHYL)NAPHTHALENE
CAS:93036-77-2
Formula: ClCC1=CC2=CC=C(CCl)C=C2C=C1
97%
BD765928
2,6-BIS(CHLOROMETHYL)PYRIDINE HYDROCHLORIDE
CAS:55422-79-2
Formula: ClCC1=CC=CC(CCl)=N1.[H]Cl
97%
BD33146
MFCD00142844
2,6-BIS(DIMETHYLAMINO)-5-FORMYL-4-METHYLNICOTINONITRILE
CAS:57959-35-0
Formula: N#CC1=C(N(C)C)N=C(N(C)C)C(C=O)=C1C
95+%
BD283839
2,6-BIS(DIMETHYLAMINO)PYRIMIDINE-4-CARBOXYLIC ACID HYDRATE
CAS:386715-39-5
Formula: O=C(C1=NC(N(C)C)=NC(N(C)C)=C1)O.[H]O[H]
95+%
BD320223
MFCD07366474
2,6-BIS(DIPHENYLAMINO)ANTHRACENE-9,10-DIONE
CAS:868850-50-4
Formula: O=C1C2=C(C=C(N(C3=CC=CC=C3)C4=CC=CC=C4)C=C2)C(C5=CC=C(N(C6=CC=CC=C6)C7=CC=CC=C7)C=C15)=O
95+%
BD417777
MFCD20040460
2,6-BIS(DIPHENYLPHOSPHINO)PYRIDINE
CAS:64741-27-1
Formula: C1(P(C2=CC=CC=C2)C3=CC=CC=C3)=NC(P(C4=CC=CC=C4)C5=CC=CC=C5)=CC=C1
98%
BD245067
MFCD04039760
2,6-BIS(DODECYLOXY)BENZALDEHYDE
CAS:1198467-57-0
Formula: O=CC1=C(OCCCCCCCCCCCC)C=CC=C1OCCCCCCCCCCCC
97%
BD283681
2,6-BIS(FLUOROMETHYL)MORPHOLINE HYDROCHLORIDE
CAS:1454650-20-4
Formula: FCC1OC(CF)CNC1.[H]Cl
95%
BD441071
MFCD27922437
2,6-BIS(HYDROXYMETHYL)-P-CRESOL
CAS:91-04-3
Formula: CC1=CC(CO)=C(O)C(CO)=C1
95%
BD67966
MFCD00004619
2,6-BIS(METHOXYMETHYL)PYRIMIDIN-4-AMINE
CAS:1250358-31-6
Formula: NC1=NC(OC)=NC(OC)=C1C
97%
BD283113
MFCD16707671
2,6-BIS(METHYLTHIO)BENZALDEHYDE
CAS:918882-53-8
Formula: O=CC1=C(SC)C=CC=C1SC
97%
BD561749
2,6-BIS(OCTYLOXY)BENZALDEHYDE
CAS:1175455-04-5
Formula: O=CC1=C(OCCCCCCCC)C=CC=C1OCCCCCCCC
95%
BD759598
MFCD30471372
2,6-BIS(TRIBUTYLSTANNYL)PYRIDINE
CAS:163630-07-7
Formula: CCCC[Sn](C1=CC=CC([Sn](CCCC)(CCCC)CCCC)=N1)(CCCC)CCCC
95+%
BD289616
MFCD01114685
2,6-BIS(TRIFLUOROMETHYL)ANILINE
CAS:313-13-3
Formula: NC1=C(C=CC=C1C(F)(F)F)C(F)(F)F
95+%
BD67972
MFCD01313162
2,6-BIS(TRIFLUOROMETHYL)BENZOIC ACID
CAS:24821-22-5
Formula: OC(=O)C1=C(C=CC=C1C(F)(F)F)C(F)(F)F
98%
BD11453
MFCD00000376
2,6-BIS(TRIFLUOROMETHYL)BENZONITRILE
CAS:25753-25-7
Formula: N#CC1=C(C(F)(F)F)C=CC=C1C(F)(F)F
98%
BD32906
MFCD00061226
2,6-BIS(TRIFLUOROMETHYL)NAPHTHALENE
CAS:50318-10-0
Formula: FC(C1=CC2=CC=C(C(F)(F)F)C=C2C=C1)(F)F
97%
BD451343
MFCD00525619
2,6-BIS(TRIFLUOROMETHYL)PHENOL
CAS:46377-35-9
Formula: OC1=C(C(F)(F)F)C=CC=C1C(F)(F)F
95+%
BD160743
MFCD00045072
2,6-BIS(TRIFLUOROMETHYL)PHENYLBORONIC ACID
CAS:681812-07-7
Formula: FC(C1=C(B(O)O)C(C(F)(F)F)=CC=C1)(F)F
97%
BD67973
MFCD04039321
2,6-BIS(TRIFLUOROMETHYL)PYRIMIDIN-4-OL
CAS:884-30-0
Formula: OC1=NC(C(F)(F)F)=NC(C(F)(F)F)=C1
95+%
BD221207
MFCD08436595
2,6-BIS(TRIFLUOROMETHYL)QUINAZOLIN-4(3H)-ONE
CAS:1352933-90-4
Formula: O=C1NC(C(F)(F)F)=NC2=C1C=C(C(F)(F)F)C=C2
97%
BD752275
2,6-BIS(TRIFLUOROMETHYL)QUINAZOLIN-4-AMINE
CAS:N/A
Formula: NC1=C2C=C(C(F)(F)F)C=CC2=NC(C(F)(F)F)=N1
97%
BD753147
2,6-BIS(TRIFLUOROMETHYL)QUINOLIN-4-OL
CAS:35877-04-4
Formula: OC1=CC(=NC2=C1C=C(C=C2)C(F)(F)F)C(F)(F)F
95+%
BD13542
MFCD00276581
2,6-BIS(TRIFLUOROMETHYL)QUINOLINE-4-CARBONITRILE
CAS:206559-70-8
Formula: N#CC1=CC(C(F)(F)F)=NC2=CC=C(C(F)(F)F)C=C12
95+%
BD427398
MFCD12197307
2,6-BIS(TRIFLUOROMETHYL)QUINOLINE-4-CARBOXAMIDE
CAS:1185292-83-4
Formula: O=C(C1=CC(C(F)(F)F)=NC2=CC=C(C(F)(F)F)C=C12)N
97%
BD626232
MFCD12197306
2,6-BIS[(2R,4S,5S)-1-BENZYL-4,5-DIPHENYLIMIDAZOLIDIN-2-YL]PYRIDINE
CAS:1223020-29-8
Formula: C1([C@@H]2N[C@@H](C3=CC=CC=C3)[C@H](C4=CC=CC=C4)N2CC5=CC=CC=C5)=NC([C@@H]6N[C@@H](C7=CC=CC=C7)[C@H](
90% HPLC)
BD00795399
2,6-BIS[[(R)-2-[HYDROXY(DIPHENYL)METHYL]-1-PYRROLIDINYL]METHYL]-4-METHYLPHENOL
CAS:877395-58-9
Formula: CC1=CC(CN2[C@@H](C(C3=CC=CC=C3)(C4=CC=CC=C4)O)CCC2)=C(O)C(CN5[C@@H](C(C6=CC=CC=C6)(C7=CC=CC=C7)O)CCC
98%
BD338463
MFCD08276885
2,6-BIS[3-(9H-CARBAZOL-9-YL)PHENYL]PYRIDINE
CAS:1013405-24-7
Formula: C1(C2=CC=CC(N3C4=C(C5=C3C=CC=C5)C=CC=C4)=C2)=NC(C6=CC=CC(N7C8=C(C9=C7C=CC=C9)C=CC=C8)=C6)=CC=C1
95+%
BD306095
MFCD20275106
2,6-DI(1-PYRAZOLYL)PYRIDINE
CAS:123640-38-0
Formula: C1(N2N=CC=C2)=NC(N3N=CC=C3)=CC=C1
95%
BD322153
2,6-DI(1H-1,2,4-TRIAZOL-1-YL)PYRIDINE
CAS:39242-18-7
Formula: C1(N2N=CN=C2)=NC(N3N=CN=C3)=CC=C1
98%
BD262405
2,6-DI(1H-IMIDAZOL-1-YL)PYRIDINE
CAS:39242-17-6
Formula: C1(N2C=CN=C2)=NC(N3C=CN=C3)=CC=C1
98%
BD262403
2,6-Di(2H-1,2,3-triazol-4-yl)pyridine
CAS:1542234-40-1
Formula: C1(C2=NNN=C2)=NC(C3=NNN=C3)=CC=C1
98% HPLC)
BD00817865
2,6-DI(9H-CARBAZOL-9-YL)PYRIDINE
CAS:168127-49-9
Formula: C1(N2C3=C(C4=C2C=CC=C4)C=CC=C3)=NC(N5C6=C(C7=C5C=CC=C7)C=CC=C6)=CC=C1
98%
BD627648
n/a
2,6-DI(PENTAN-3-YL)ANILINE
CAS:948587-90-4
Formula: CCC(CC)C1=CC=CC(C(CC)CC)=C1N
95+%
BD236947
2,6-DI(THIOPHEN-2-YL)DITHIENO[3,2-B:2',3'-D]THIOPHENE
CAS:910788-24-8
Formula: C1(C=C(C2=CC=CS2)S3)=C3C4=C(C=C(C5=CC=CS5)S4)S1
95+%
BD262674
MFCD11215198
2,6-DI-P-TOLYL-4,4'-BIPYRIDINE
CAS:16208-89-2
Formula: CC1=CC=C(C2=CC(C3=CC=NC=C3)=CC(C4=CC=C(C)C=C4)=N2)C=C1
97%
BD763446
2,6-DI-P-TOLYLPYRIDINE
CAS:14435-88-2
Formula: CC1=CC=C(C2=CC=CC(C3=CC=C(C)C=C3)=N2)C=C1
97%
BD67969
MFCD00006282
2,6-DI-SEC-BUTYLPHENOL
CAS:5510-99-6
Formula: OC1=C(C(C)CC)C=CC=C1C(C)CC
95+%
BD328386
MFCD00009330
2,6-DI-TERT-BUTYL-4-(DIPHENYLAMINO)PHENOL
CAS:10419-65-5
Formula: OC1=C(C(C)(C)C)C=C(N(C2=CC=CC=C2)C3=CC=CC=C3)C=C1C(C)(C)C
95+%
BD284302
2,6-DI-TERT-BUTYL-4-ETHYLIDENECYCLOHEXA-2,5-DIENONE
CAS:6738-27-8
Formula: CC=C(C=C1C(C)(C)C)C=C(C(C)(C)C)C1=O
97%
BD490983
n/a
2,6-DI-TERT-BUTYL-4-METHOXYPHENOL
CAS:489-01-0
Formula: OC1=C(C(C)(C)C)C=C(OC)C=C1C(C)(C)C
98%
BD68550
MFCD00008824
2,6-DI-TERT-BUTYL-4-METHYLCYCLOHEXANOL
CAS:163119-16-2
Formula: CC1CC(C(O)C(C1)C(C)(C)C)C(C)(C)C
97%
BD227574
MFCD00278493
2,6-DI-TERT-BUTYL-4-METHYLCYCLOHEXANONE
CAS:23790-39-8
Formula: O=C1C(C(C)(C)C)CC(C)CC1C(C)(C)C
97%
BD712140
2,6-DI-TERT-BUTYL-4-METHYLPHENOL
CAS:128-37-0
Formula: CC1=CC(=C(O)C(=C1)C(C)(C)C)C(C)(C)C
98%
BD17931
MFCD00011644
2,6-DI-TERT-BUTYL-4-METHYLPYRIDINE
CAS:38222-83-2
Formula: CC1=CC(C(C)(C)C)=NC(C(C)(C)C)=C1
98%
BD33484
MFCD00006305
2,6-DI-TERT-BUTYL-4-NITROPHENOL
CAS:728-40-5
Formula: OC1=C(C(C)(C)C)C=C([N+]([O-])=O)C=C1C(C)(C)C
97%
BD305953
n/a
2,6-DI-TERT-BUTYL-4-VINYLPHENOL
CAS:19263-36-6
Formula: OC1=C(C(C)(C)C)C=C(C=C)C=C1C(C)(C)C
95%
BD636961
2,6-DI-TERT-BUTYLANTHRACENE
CAS:62375-58-0
Formula: CC(C1=CC2=CC3=CC=C(C(C)(C)C)C=C3C=C2C=C1)(C)C
95+%
BD34367
MFCD00407977
2,6-DI-TERT-BUTYLCYCLOHEXA-2,5-DIENE-1,4-DIONE
CAS:719-22-2
Formula: O=C1C(C(C)(C)C)=CC(C=C1C(C)(C)C)=O
98%
BD15605
MFCD00001601
2,6-DI-TERT-BUTYLISONICOTINIC ACID
CAS:191478-92-9
Formula: O=C(O)C1=CC(C(C)(C)C)=NC(C(C)(C)C)=C1
95+%
BD281826
MFCD06496458
2,6-DI-TERT-BUTYLNAPHTHALENE
CAS:3905-64-4
Formula: CC(C1=CC2=CC=C(C(C)(C)C)C=C2C=C1)(C)C
98%
BD67948
2,6-DI-TERT-BUTYLPHENOL
CAS:128-39-2
Formula: OC1=C(C(C)(C)C)C=CC=C1C(C)(C)C
98%
BD17932
MFCD00008820
2,6-DI-TERT-BUTYLPYRIDINE
CAS:585-48-8
Formula: CC(C)(C)C1=CC=CC(=N1)C(C)(C)C
98%
BD34179
MFCD00006306
2,6-DIACETAMIDOHEXANOIC ACID
CAS:35436-74-9
Formula: O=C(O)C(NC(C)=O)CCCCNC(C)=O
95+%
BD331386
MFCD00048197
2,6-DIACETYLPYRIDINE
CAS:1129-30-2
Formula: O=C(C1=CC=CC(C(C)=O)=N1)C
97%
BD30251
MFCD00006304
2,6-DIALLYL-4-METHYL-1,2,3,6-TETRAHYDROPYRIDINE
CAS:436088-93-6
Formula: CC1=CC(CC=C)NC(CC=C)C1
97%
BD67999
2,6-DIAMINO-3,5-DIFLUOROPYRIDINE
CAS:247069-27-8
Formula: FC1=C(N)N=C(N)C(F)=C1
98%
BD68001
MFCD03412208
2,6-DIAMINO-3H-IMIDAZO[4,5-G]QUINAZOLIN-8(7H)-ONE
CAS:1001242-71-2
Formula: OC1=C2C=C(N=C(N)N3)C3=CC2=NC(N)=N1
97%
BD633818
2,6-DIAMINO-4-(1-METHYL-1H-PYRROL-2-YL)-4H-THIOPYRAN-3,5-DICARBONITRILE
CAS:933838-32-5
Formula: N#CC1=C(N)SC(N)=C(C#N)C1C2=CC=CN2C
97%
BD508943
MFCD00854966
2,6-DIAMINO-4-(2,3,4-TRIMETHOXYPHENYL)-4H-THIOPYRAN-3,5-DICARBONITRILE
CAS:333759-74-3
Formula: N#CC1=C(N)SC(N)=C(C#N)C1C2=CC=C(OC)C(OC)=C2OC
97%
BD508945
MFCD01450896
2,6-DIAMINO-4-(2-BUTOXYPHENYL)-4H-THIOPYRAN-3,5-DICARBONITRILE
CAS:337496-64-7
Formula: N#CC1=C(N)SC(N)=C(C#N)C1C2=CC=CC=C2OCCCC
97%
BD595500
MFCD02046731
2,6-DIAMINO-4-(3,4-DIMETHOXYPHENYL)-4H-THIOPYRAN-3,5-DICARBONITRILE
CAS:127118-64-3
Formula: N#CC1=C(N)SC(N)=C(C#N)C1C2=CC=C(OC)C(OC)=C2
97%
BD508944
MFCD00404952
2,6-DIAMINO-4-(4-CHLOROPHENYL)-4H-THIOPYRAN-3,5-DICARBONITRILE
CAS:102423-75-6
Formula: N#CC1=C(N)SC(N)=C(C#N)C1C2=CC=C(Cl)C=C2
95+%
BD166336
MFCD00228040
2,6-DIAMINO-4-(4-FLUOROPHENYL)-4H-THIOPYRAN-3,5-DICARBONITRILE
CAS:125240-16-6
Formula: N#CC1=C(N)SC(N)=C(C#N)C1C2=CC=C(F)C=C2
97%
BD166337
MFCD00430028
2,6-DIAMINO-4-(4-ISOPROPYLPHENYL)-4H-THIOPYRAN-3,5-DICARBONITRILE
CAS:303066-28-6
Formula: N#CC1=C(N)SC(N)=C(C#N)C1C2=CC=C(C(C)C)C=C2
97%
BD508949
MFCD00715806
2,6-DIAMINO-4-(4-METHOXYPHENYL)-4H-THIOPYRAN-3,5-DICARBONITRILE
CAS:102423-74-5
Formula: N#CC1=C(N)SC(N)=C(C#N)C1C2=CC=C(OC)C=C2
95+%
BD341834
MFCD00428438
2,6-DIAMINO-4-(6-CHLOROBENZO[D][1,3]DIOXOL-5-YL)-4H-THIOPYRAN-3,5-DICARBONITRILE
CAS:299168-59-5
Formula: N#CC1=C(N)SC(N)=C(C#N)C1C2=C(Cl)C=C(OCO3)C3=C2
97%
BD593998
MFCD02045989
2,6-DIAMINO-4-(FURAN-2-YL)-4H-THIOPYRAN-3,5-DICARBONITRILE
CAS:123518-02-5
Formula: N#CC1=C(N)SC(N)=C(C#N)C1C2=CC=CO2
97%
BD508941
MFCD00446172
2,6-DIAMINO-4-(O-TOLYL)-4H-THIOPYRAN-3,5-DICARBONITRILE
CAS:202405-84-3
Formula: N#CC1=C(N)SC(N)=C(C#N)C1C2=CC=CC=C2C
97%
BD508948
MFCD00742421
2,6-DIAMINO-4-(P-TOLYL)-4H-THIOPYRAN-3,5-DICARBONITRILE
CAS:127118-56-3
Formula: N#CC1=C(N)SC(N)=C(C#N)C1C2=CC=C(C)C=C2
97%
BD508946
MFCD00716390
2,6-DIAMINO-4-(PYRIDIN-3-YL)-4H-THIOPYRAN-3,5-DICARBONITRILE
CAS:125219-61-6
Formula: N#CC1=C(N)SC(N)=C(C#N)C1C2=CC=CN=C2
97%
BD508947
MFCD00446174
2,6-DIAMINO-4-(PYRROLIDIN-1-YL)PYRIMIDINE 1-OXIDE
CAS:55921-65-8
Formula: NC1=[N+]([O-])C(N)=NC(N2CCCC2)=C1
97%
BD627878
MFCD22041981
2,6-DIAMINO-4-(THIOPHEN-2-YL)-4H-THIOPYRAN-3,5-DICARBONITRILE
CAS:127118-65-4
Formula: N#CC1=C(N)SC(N)=C(C#N)C1C2=CC=CS2
97%
BD508942
MFCD00446173
2,6-DIAMINO-4-CYCLOPROPYL-4H-THIOPYRAN-3,5-DICARBONITRILE
CAS:931252-55-0
Formula: N#CC1=C(N)SC(N)=C(C#N)C1C2CC2
97%
BD508940
MFCD09668263
2,6-DIAMINO-4-HYDROXYQUINAZOLINE
CAS:53745-23-6
Formula: OC1=C2C=C(N)C=CC2=NC(N)=N1
95+%
BD323863
MFCD06411663
2,6-DIAMINO-4-ISOPROPYL-4H-THIOPYRAN-3,5-DICARBONITRILE
CAS:180537-84-2
Formula: N#CC1=C(N)SC(N)=C(C#N)C1C(C)C
97%
BD508939
MFCD00449775
2,6-DIAMINO-4-METHYLNICOTINONITRILE
CAS:38841-52-0
Formula: CC1=C(C#N)C(N)=NC(N)=C1
95+%
BD233357
MFCD00963851
2,6-DIAMINO-4-PHENYL-4H-THIOPYRAN-3,5-DICARBONITRILE
CAS:102434-73-1
Formula: N#CC1=C(N)SC(N)=C(C#N)C1C2=CC=CC=C2
97%
BD166339
MFCD00228002
2,6-DIAMINO-5,6,7,8-TETRAHYDROQUINAZOLIN-4(3H)-ONE
CAS:102077-48-5
Formula: O=C1NC(N)=NC2=C1CC(N)CC2
95+%
BD332383
MFCD20704468
2,6-DIAMINO-5-(2,2-DIETHOXYETHYL)PYRIMIDIN-4-OL
CAS:63026-85-7
Formula: OC1=NC(N)=NC(N)=C1CC(OCC)OCC
95+%
BD334839
MFCD00223566
2,6-DIAMINO-5-BROMOPYRIMIDIN-4(1H)-ONE
CAS:6312-72-7
Formula: NC1=NC(=O)C(Br)=C(N)N1
97%
BD102624
MFCD00023262
2,6-DIAMINO-5-CHLORONICOTINIC ACID
CAS:465513-33-1
Formula: O=C(O)C1=C(N)N=C(N)C(Cl)=C1
97%
BD556148
MFCD20656749
2,6-DIAMINO-5-CHLOROPYRIMIDIN-4-OL
CAS:71552-22-2
Formula: OC1=NC(N)=NC(N)=C1Cl
95+%
BD370224
MFCD22196157
2,6-DIAMINO-5-CHLOROQUINAZOLIN-4(3H)-ONE
CAS:143745-30-6
Formula: OC1=C2C(Cl)=C(N)C=CC2=NC(N)=N1
97%
BD633817
2,6-DIAMINO-5-HYDROXYHEXANOIC ACID HYDROCHLORIDE
CAS:13204-98-3
Formula: O=C(O)C(N)CCC(O)CN.[H]Cl
95%
BD31752
n/a
2,6-DIAMINO-5-NITROPYRIMIDIN-4-OL
CAS:3346-23-4
Formula: O=[N+](C1=C(O)N=C(N)N=C1N)[O-]
97%
BD66517
MFCD01365774
2,6-DIAMINO-5-THIOCYANATOPYRIMIDIN-4(3H)-ONE
CAS:22288-75-1
Formula: O=C1NC(N)=NC(N)=C1SC#N
95+%
BD234912
MFCD09840405
2,6-DIAMINO-9H-PURINE-8-THIOL
CAS:462066-71-3
Formula: SC1=NC2=C(N)N=C(N)N=C2N1
97%
BD68012
2,6-DIAMINOANTHRACENE-9,10-DIONE
CAS:131-14-6
Formula: NC1=CC2=C(C=C1)C(=O)C1=C(C=CC(N)=C1)C2=O
98%
BD17998
MFCD00001234
2,6-DIAMINOBENZOIC ACID
CAS:102000-59-9
Formula: O=C(O)C1=C(N)C=CC=C1N
95+%
BD270148
MFCD01661065
2,6-DIAMINOHEXAN-1-OL
CAS:25441-01-4
Formula: OCC(N)CCCCN
97%
BD752205
MFCD24495167
2,6-DIAMINOHEXAN-1-OL HYDROCHLORIDE
CAS:N/A
Formula: OCC(N)CCCCN.[H]Cl
97%
BD753825
2,6-DIAMINOHEXANOIC ACID DIHYDROCHLORIDE
CAS:617-68-5
Formula: NC(CCCCN)C(O)=O.[H]Cl.[H]Cl
98%
BD126557
MFCD00037587
2,6-DIAMINOHEXANOIC ACID HYDRATE
CAS:885701-25-7
Formula: NC(CCCCN)C(O)=O.[H]O[H]
98%
BD583569
MFCD00151036
2,6-DIAMINOISONICOTINAMIDE
CAS:98135-36-5
Formula: O=C(C1C=C(N)N=C(N)C=1)N
95+%
BD00753511
n/a
2,6-DIAMINOISONICOTINIC ACID
CAS:6313-56-0
Formula: O=C(O)C1=CC(N)=NC(N)=C1
97%
BD262527
MFCD12828291
2,6-DIAMINOISONICOTINONITRILE
CAS:1158785-01-3
Formula: N#CC1C=C(N)N=C(N)C=1
95+%
BD00750281
n/a
2,6-DIAMINONICOTINAMIDE
CAS:69925-29-7
Formula: O=C(C1=CC=C(N)N=C1N)N
97%
BD651848
2,6-DIAMINONICOTINIC ACID
CAS:175155-53-0
Formula: O=C(O)C1=C(N)N=C(N)C=C1
95+%
BD285868
MFCD13188956
2,6-DIAMINONICOTINIC ACID HYDROCHLORIDE
CAS:N/A
Formula: O=C(C1C=CC(N)=NC=1N)O.[H]Cl
95%
BD00759811
2,6-DIAMINONICOTINONITRILE
CAS:99761-27-0
Formula: N#CC1=C(N)N=C(N)C=C1
97%
BD553748
2,6-DIAMINOPHENOL
CAS:22440-82-0
Formula: OC1=C(N)C=CC=C1N
95+%
BD252547
MFCD00462574
2,6-DIAMINOPHENOL DIHYDROCHLORIDE
CAS:403986-18-5
Formula: OC1=C(N)C=CC=C1N.[H]Cl.[H]Cl
95+%
BD296941
2,6-DIAMINOPHENOL HYDROCHLORIDE
CAS:1808091-49-7
Formula: OC1=C(N)C=CC=C1N.[H]Cl
95+%
BD302661
n/a
2,6-DIAMINOPIMELIC ACID
CAS:583-93-7
Formula: NC(CCCC(N)C(O)=O)C(O)=O
97%
BD34175
MFCD00002637
2,6-DIAMINOPYRAZINE
CAS:41536-80-5
Formula: NC1=CN=CC(N)=N1
95+%
BD214238
MFCD09907864
2,6-DIAMINOPYRIDINE
CAS:141-86-6
Formula: C1=CC=C(N=C1N)N
98%
BD18286
MFCD00006329
2,6-DIAMINOPYRIMIDIN-4(1H)-ONE
CAS:56-06-4
Formula: O=C1N=C(N)NC(N)=C1
96%
BD00752686
MFCD08528919
2,6-DIAMINOPYRIMIDIN-4(3H)-ONE
CAS:143504-99-8
Formula: O=C1NC(N)=NC(N)=C1
95+%
BD165479
2,6-DIAMINOPYRIMIDIN-4-OL
CAS:100643-27-4
Formula: OC1=CC(N)=NC(N)=N1
97%
BD2314
MFCD00006098
2,6-DIAMINOPYRIMIDINE-4(1H)-THIONE
CAS:56-08-6
Formula: NC1=NC(N)=CC(=S)N1
95+%
BD2322
MFCD00006099
2,6-DIAMINOPYRIMIDINE-4-THIOL SULFATE
CAS:307496-37-3
Formula: SC1=CC(N)=NC(N)=N1.O=S(O)(O)=O
97%
BD66525
MFCD01863745
2,6-DIAZASPIRO[3.3]HEPTANE
CAS:174-77-6
Formula: C1NCC12CNC2
95+%
BD215903
MFCD11849044
2,6-DIAZASPIRO[3.3]HEPTANE DIHYDROCHLORIDE
CAS:1184963-68-5
Formula: C1NCC12CNC2.Cl.Cl
95%
BD257556
2,6-DIAZASPIRO[3.3]HEPTANE HYDROCHLORIDE
CAS:1557591-41-9
Formula: [H]Cl.C1NCC12CNC2
95+%
BD215905
MFCD11878485
2,6-DIAZASPIRO[3.4]OCTAN-5-ONE
CAS:1203797-62-9
Formula: O=C(NCC1)C21CNC2
95+%
BD246909
MFCD22372536
2,6-DIAZASPIRO[3.4]OCTAN-7-ONE
CAS:1211515-65-9
Formula: O=C(C1)NCC21CNC2
95%
BD246911
MFCD21364482
2,6-DIAZASPIRO[3.4]OCTAN-7-ONE 4-METHYLBENZENESULFONATE
CAS:1958100-97-4
Formula: O=C(C1)NCC21CNC2.O=S(C3=CC=C(C)C=C3)(O)=O
96%
BD634818
MFCD29042820
2,6-DIAZASPIRO[3.4]OCTAN-7-ONE HYDROCHLORIDE
CAS:1956355-12-6
Formula: O=C(C1)NCC21CNC2.[H]Cl
97%
BD256685
n/a
2,6-DIAZASPIRO[3.4]OCTAN-7-ONE OXALATE
CAS:1588440-97-4
Formula: O=C(C1)NCC21CNC2.O=C(O)C(O)=O
95+%
BD263504
2,6-DIAZASPIRO[3.4]OCTANE
CAS:136098-13-0
Formula: C1NCC12CNCC2
95+%
BD254673
MFCD16877057
2,6-DIAZASPIRO[3.4]OCTANE DIHYDROCHLORIDE
CAS:1630906-93-2
Formula: [H]Cl.[H]Cl.C1NCC12CNCC2
95+%
BD301754
2,6-DIAZASPIRO[3.5]NONAN-1-ONE
CAS:1422062-20-1
Formula: O=C1NCC12CNCCC2
97%
BD570582
MFCD23378266
2,6-DIAZASPIRO[3.5]NONANE
CAS:885482-15-5
Formula: C1NCC12CNCCC2
95+%
BD254672
MFCD13193040
2,6-DIAZASPIRO[3.5]NONANE DIHYDROCHLORIDE
CAS:1334499-63-6
Formula: [H]Cl.[H]Cl.C1NCC12CNCCC2
97%
BD328993
MFCD20261445
2,6-DIAZASPIRO[4.5]DECANE
CAS:35731-28-3
Formula: C1NCCC12NCCCC2
97%
BD254667
MFCD21090354
2,6-DIAZASPIRO[4.5]DECANE DIHYDROCHLORIDE
CAS:1334499-58-9
Formula: [H]Cl.[H]Cl.C1NCCC12NCCCC2
97%
BD756481
MFCD18206762
2,6-DIAZATRICYCLO[3.3.1.13,7]DECANE, 2-METHYL-
CAS:39122-99-1
Formula: CN1C(C2)CC3NC2CC1C3
BD00799732
2,6-DIBENZHYDRYL-2,6-DIAZASPIRO[3.3]HEPTANE
CAS:913814-37-6
Formula: N1(C(C2=CC=CC=C2)C3=CC=CC=C3)CC4(CN(C(C5=CC=CC=C5)C6=CC=CC=C6)C4)C1
95+%
BD246160
MFCD13180718
2,6-DIBROMO-[1,2,4]TRIAZOLO[1,5-A]PYRIDINE
CAS:1401624-81-4
Formula: BrC1=CN2C(C=C1)=NC(Br)=N2
95+%
BD329597
MFCD26131653
2,6-DIBROMO-1,4-PHENYLENEDIAMINE
CAS:29213-03-4
Formula: NC1=C(Br)C=C(N)C=C1Br
98%
BD306260
n/a
2,6-DIBROMO-1,5-DIMETHOXYNAPHTHALENE
CAS:91394-96-6
Formula: COC1=C(Br)C=CC2=C(OC)C(Br)=CC=C12
98%
BD68026
MFCD06656533
2,6-DIBROMO-1,5-NAPHTHYRIDINE
CAS:42309-15-9
Formula: BrC1=CC=C2N=C(Br)C=CC2=N1
97%
BD629309
2,6-DIBROMO-1,8-NAPHTHYRIDINE
CAS:72754-04-2
Formula: BrC1=CC2=CC=C(Br)N=C2N=C1
95+%
BD238357
MFCD13189448
2,6-DIBROMO-1-METHYLPYRIDIN-4(1H)-ONE
CAS:N/A
Formula: O=C1C=C(Br)N(C)C(Br)=C1
97%
BD753197
2,6-DIBROMO-3,4-DIFLUOROANILINE
CAS:1000574-69-5
Formula: NC1=C(Br)C=C(F)C(F)=C1Br
97%
BD496124
MFCD09878204
2,6-DIBROMO-3,4-DIHYDRONAPHTHALEN-1(2H)-ONE
CAS:99657-23-5
Formula: O=C1C(Br)CCC2=C1C=CC(Br)=C2
95+%
BD267761
MFCD15526783
2,6-DIBROMO-3,4-DIMETHYLANILINE
CAS:80948-77-2
Formula: NC1=C(Br)C=C(C)C(C)=C1Br
95+%
BD324204
MFCD08062433
2,6-DIBROMO-3,5-DICHLORO-4-FLUOROANILINE
CAS:1160573-76-1
Formula: NC1=C(Br)C(Cl)=C(F)C(Cl)=C1Br
95+%
BD322521
MFCD11845855
2,6-DIBROMO-3,5-DIFLUOROBENZONITRILE
CAS:1803778-30-4
Formula: N#CC1=C(Br)C(F)=CC(F)=C1Br
95%
BD00725616
n/a
2,6-DIBROMO-3,5-DIFLUOROISONICOTINIC ACID
CAS:325461-60-7
Formula: O=C(O)C1=C(F)C(Br)=NC(Br)=C1F
98%
BD68028
MFCD03411655
2,6-DIBROMO-3,5-DIFLUOROPYRIDINE
CAS:210169-13-4
Formula: FC1=CC(F)=C(Br)N=C1Br
95+%
BD216455
MFCD21603841
2,6-DIBROMO-3,5-DIHYDROXYBENZOIC ACID
CAS:79200-80-9
Formula: O=C(O)C1=C(Br)C(O)=CC(O)=C1Br
95+%
BD68029
MFCD01108707
2,6-DIBROMO-3,5-DIMETHYLPYRIDINE
CAS:117846-58-9
Formula: CC1=C(Br)N=C(Br)C(C)=C1
97%
BD216420
2,6-DIBROMO-3-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PYRIDINE
CAS:N/A
Formula: BrC1=CC=C(B2OC(C)(C)C(C)(C)O2)C(Br)=N1
97%
BD438427
MFCD18910596
2,6-DIBROMO-3-(BROMOMETHYL)-5-CHLOROPYRIDINE
CAS:55304-79-5
Formula: ClC1=C(Br)N=C(Br)C(CBr)=C1
95+%
BD284466
2,6-DIBROMO-3-(TRIFLUOROMETHYL)PYRIDINE
CAS:55304-87-5
Formula: FC(C1=CC=C(Br)N=C1Br)(F)F
95+%
BD268304
2,6-DIBROMO-3-CHLORO-4-FLUOROANILINE
CAS:175135-09-8
Formula: NC1=C(Br)C(Cl)=C(F)C=C1Br
97%
BD3096
MFCD00042199
2,6-DIBROMO-3-CHLORO-4-METHYLANILINE
CAS:84483-22-7
Formula: NC1=C(Br)C=C(C)C(Cl)=C1Br
97%
BD10401
MFCD00051580
2,6-DIBROMO-3-CHLORO-5-(CHLOROMETHYL)PYRIDINE
CAS:1823897-35-3
Formula: ClCC1=C(Br)N=C(Br)C(Cl)=C1
95+%
BD284401
2,6-DIBROMO-3-CHLOROPYRIDIN-4-AMINE
CAS:1384213-52-8
Formula: NC1=C(Cl)C(Br)=NC(Br)=C1
97%
BD752258
2,6-DIBROMO-3-CHLOROPYRIDINE
CAS:55304-77-3
Formula: ClC1=CC=C(Br)N=C1Br
95%
BD633534
n/a
2,6-DIBROMO-3-FLUORO-4-METHYLANILINE
CAS:1000576-48-6
Formula: NC1=C(Br)C=C(C)C(F)=C1Br
97%
BD567099
2,6-DIBROMO-3-FLUOROANILINE
CAS:1691609-18-3
Formula: NC1=C(Br)C=CC(F)=C1Br
97%
BD460334
MFCD28784571
2,6-DIBROMO-3-FLUOROBENZOIC ACID
CAS:1806327-84-3
Formula: O=C(O)C1=C(Br)C=CC(F)=C1Br
97%
BD481607
MFCD28784652
2,6-DIBROMO-3-FLUOROPYRIDINE
CAS:41404-59-5
Formula: FC1=CC=C(Br)N=C1Br
95+%
BD230319
MFCD13185513
2,6-DIBROMO-3-HYDROXYPYRIDINE
CAS:6602-33-1
Formula: OC1=CC=C(Br)N=C1Br
95+%
BD68030
2,6-DIBROMO-3-IODOPYRIDIN-4-AMINE
CAS:N/A
Formula: NC1=C(I)C(Br)=NC(Br)=C1
97%
BD751749
2,6-DIBROMO-3-IODOPYRIDINE
CAS:1032582-80-1
Formula: BrC1=CC=C(I)C(Br)=N1
95+%
BD207540
MFCD13185520
2,6-DIBROMO-3-METHOXY-5-NITROPYRIDINE
CAS:79491-46-6
Formula: O=[N+](C1=C(Br)N=C(Br)C(OC)=C1)[O-]
97%
BD248724
MFCD18632733
2,6-DIBROMO-3-METHOXY-N-METHYLANILINE
CAS:808736-58-5
Formula: CNC1=C(Br)C=CC(OC)=C1Br
95+%
BD284075
2,6-DIBROMO-3-METHOXYPYRIDINE
CAS:79491-45-5
Formula: COC1=CC=C(Br)N=C1Br
97%
BD248725
2,6-DIBROMO-3-METHYL-4-NITROPHENOL
CAS:14401-03-7
Formula: CC1=C(C=C(Br)C(O)=C1Br)[N+]([O-])=O
95+%
BD4293
MFCD04038152
2,6-DIBROMO-3-METHYLBENZOIC ACID
CAS:N/A
Formula: O=C(C1C(Br)=C(C)C=CC=1Br)O
95%
BD00760805
2,6-DIBROMO-3-METHYLPYRIDINE
CAS:887571-15-5
Formula: CC1=CC=C(Br)N=C1Br
97%
BD68033
MFCD03840755
2,6-DIBROMO-3-NITROPYRIDIN-4-AMINE
CAS:848470-14-4
Formula: NC1=C([N+]([O-])=O)C(Br)=NC(Br)=C1
95+%
BD226364
MFCD11044253
2,6-DIBROMO-3-NITROPYRIDINE
CAS:55304-80-8
Formula: BrC1=NC(=CC=C1[N+](=O)[O-])Br
97%
BD21422
MFCD00233995
2,6-DIBROMO-3-PYRIDINECARBOXYLIC ACID
CAS:55304-85-3
Formula: O=C(C1=CC=C(Br)N=C1Br)O
97%
BD168801
MFCD11846496
2,6-DIBROMO-4,4-BIS(2-ETHYLHEXYL)-4H-CYCLOPENTA[1,2-B:5,4-B']DITHIOPHENE
CAS:365547-21-3
Formula: CCCCC(CC)CC1(CC(CC)CCCC)C2=C(C3=C1C=C(Br)S3)SC(Br)=C2
95+%
BD247418
MFCD16619302
2,6-DIBROMO-4,4-BIS(2-ETHYLHEXYL)-4H-SILOLO[3,2-B:4,5-B']DITHIOPHENE
CAS:1089687-05-7
Formula: CCCCC(CC)C[Si]1(CC(CC)CCCC)C2=C(C3=C1C=C(Br)S3)SC(Br)=C2
97%
BD293915
MFCD16621138
2,6-DIBROMO-4,4-DIHEXYL-4H-CYCLOPENTA[1,2-B:5,4-B']DITHIOPHENE
CAS:528570-55-0
Formula: CCCCCCC1(CCCCCC)C2=C(C3=C1C=C(Br)S3)SC(Br)=C2
95+%
BD254693
MFCD16619321
2,6-DIBROMO-4,4-DIHEXYL-4H-SILOLO[3,2-B:4,5-B']DITHIOPHENE
CAS:188690-66-6
Formula: CCCCCC[Si]1(CCCCCC)C2=C(C3=C1C=C(Br)S3)SC(Br)=C2
95+%
BD254694
MFCD16621085
2,6-DIBROMO-4,4-DIOCTYL-4H-SILOLO[3,2-B:4,5-B']DITHIOPHENE
CAS:1160106-14-8
Formula: CCCCCCCC[Si]1(CCCCCCCC)C2=C(C3=C1C=C(Br)S3)SC(Br)=C2
95+%
BD247421
2,6-DIBROMO-4,8-BIS((2-BUTYLOCTYL)OXY)BENZO[1,2-B:4,5-B']DITHIOPHENE
CAS:1336893-15-2
Formula: CCCCCCC(CCCC)COC1=C2C(C=C(Br)S2)=C(OCC(CCCC)CCCCCC)C3=C1C=C(Br)S3
97%
BD633431
2,6-DIBROMO-4,8-BIS((2-ETHYLHEXYL)OXY)BENZO[1,2-B:4,5-B']DITHIOPHENE
CAS:1226782-13-3
Formula: CCCCC(CC)COC1=C2C(C=C(Br)S2)=C(OCC(CC)CCCC)C3=C1C=C(Br)S3
95+%
BD247399
MFCD17018552
2,6-DIBROMO-4,8-BIS(OCTYLOXY)BENZO[1,2-B:4,5-B']DITHIOPHENE
CAS:1294515-75-5
Formula: CCCCCCCCOC1=C2C(C=C(Br)S2)=C(OCCCCCCCC)C3=C1C=C(Br)S3
95+%
BD262609
2,6-DIBROMO-4,8-DIHEXYLBENZO[1,2-B:4,5-B']DITHIOPHENE
CAS:359017-65-5
Formula: CCCCCCC1=C2C(C=C(Br)S2)=C(CCCCCC)C3=C1C=C(Br)S3
95+%
BD254696
MFCD16619301
2,6-DIBROMO-4-((TRIFLUOROMETHYL)SULFONYL)PHENOL
CAS:432-79-1
Formula: OC1=C(Br)C=C(S(=O)(C(F)(F)F)=O)C=C1Br
97%
BD492951
2,6-DIBROMO-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PYRIDINE
CAS:1192037-24-3
Formula: CC1(C)C(C)(C)OB(C2=CC(Br)=NC(Br)=C2)O1
98%
BD247274
MFCD12923190
2,6-DIBROMO-4-(DIFLUOROMETHOXY)ANILINE
CAS:1000575-08-5
Formula: NC1=C(Br)C=C(OC(F)F)C=C1Br
97%
BD477463
MFCD09878211
2,6-DIBROMO-4-(DIFLUOROMETHOXY)PYRIDINE
CAS:1214326-08-5
Formula: FC(F)OC1=CC(Br)=NC(Br)=C1
97%
BD469352
MFCD14698410
2,6-DIBROMO-4-(DIFLUOROMETHYL)PYRIDIN-3-OL
CAS:1806805-35-5
Formula: OC1=C(C(F)F)C=C(Br)N=C1Br
97%
BD464623
MFCD25486093
2,6-DIBROMO-4-(HYDROXYMETHYL)PHENOL
CAS:2316-62-3
Formula: OC1=C(Br)C=C(CO)C=C1Br
97%
BD624329
2,6-DIBROMO-4-(METHYLSULFONYL)ANILINE
CAS:26595-53-9
Formula: NC1=C(Br)C=C(S(=O)(C)=O)C=C1Br
97%
BD496105
MFCD09800838
2,6-DIBROMO-4-(TERT-BUTYL)ANILINE
CAS:10546-67-5
Formula: NC1=C(Br)C=C(C(C)(C)C)C=C1Br
97%
BD257953
MFCD06657952
2,6-DIBROMO-4-(TERT-BUTYL)PHENOL
CAS:98-22-6
Formula: OC1=C(Br)C=C(C(C)(C)C)C=C1Br
95+%
BD68056
MFCD00152389
2,6-DIBROMO-4-(TRIFLUOROMETHOXY)ANILINE
CAS:88149-49-9
Formula: BrC1=C(N)C(=CC(=C1)OC(F)(F)F)Br
98%
BD10232
MFCD00153113
2,6-DIBROMO-4-(TRIFLUOROMETHOXY)PHENOL
CAS:914635-67-9
Formula: OC1=C(Br)C=C(OC(F)(F)F)C=C1Br
95+%
BD257974
MFCD08059524
2,6-DIBROMO-4-(TRIFLUOROMETHYL)ANILINE
CAS:72678-19-4
Formula: NC1=C(Br)C=C(C(F)(F)F)C=C1Br
98%
BD10231
MFCD00068181
2,6-DIBROMO-4-(TRIFLUOROMETHYL)NICOTINONITRILE
CAS:1416373-32-4
Formula: N#CC1=C(Br)N=C(Br)C=C1C(F)(F)F
95+%
BD218619
2,6-DIBROMO-4-(TRIFLUOROMETHYL)PYRIDINE
CAS:1000152-84-0
Formula: FC(C1=CC(Br)=NC(Br)=C1)(F)F
95+%
BD258715
MFCD22682722
2,6-DIBROMO-4-BUTYLANILINE
CAS:10546-66-4
Formula: NC1=C(Br)C=C(CCCC)C=C1Br
98%
BD230512
2,6-DIBROMO-4-CHLORO-3,5-DIMETHYLPHENOL
CAS:175204-32-7
Formula: OC1=C(Br)C(C)=C(Cl)C(C)=C1Br
97%
BD68038
MFCD00219924
2,6-DIBROMO-4-CHLORO-3-FLUOROANILINE
CAS:1160574-58-2
Formula: NC1=C(Br)C=C(Cl)C(F)=C1Br
97%
BD496172
MFCD11845909
2,6-DIBROMO-4-CHLOROPHENOL
CAS:5324-13-0
Formula: OC1=C(Br)C=C(Cl)C=C1Br
98%
BD68039
MFCD00029751
2,6-DIBROMO-4-CHLOROPYRIDINE
CAS:1196156-59-8
Formula: ClC1=CC(Br)=NC(Br)=C1
95+%
BD230339
2,6-DIBROMO-4-CYANOPHENYL OCTANOATE
CAS:1689-99-2
Formula: CCCCCCCC(OC1=C(Br)C=C(C#N)C=C1Br)=O
95+%
BD18808
MFCD00055484
2,6-DIBROMO-4-CYCLOHEXYLANILINE
CAS:175135-11-2
Formula: NC1=C(Br)C=C(C2CCCCC2)C=C1Br
95+%
BD68040
2,6-DIBROMO-4-CYCLOPENTYLTHIAZOLO[5,4-B]PYRIDIN-5(4H)-ONE
CAS:1956380-01-0
Formula: O=C1C(Br)=CC2=C(SC(Br)=N2)N1C3CCCC3
97%
BD444583
2,6-DIBROMO-4-ETHOXYPYRIDINE
CAS:52311-44-1
Formula: CCOC1=CC(Br)=NC(Br)=C1
95+%
BD260608
2,6-DIBROMO-4-ETHYLANILINE
CAS:10546-63-1
Formula: NC1=C(Br)C=C(CC)C=C1Br
95+%
BD318921
MFCD00031418
2,6-DIBROMO-4-FLUORO-3-METHYLANILINE
CAS:1000576-72-6
Formula: NC1=C(Br)C=C(F)C(C)=C1Br
97%
BD496091
MFCD09800776
2,6-DIBROMO-4-FLUOROANILINE
CAS:344-18-3
Formula: NC1=C(Br)C=C(F)C=C1Br
98%
BD9799
MFCD00041445
2,6-DIBROMO-4-FLUOROBENZALDEHYDE
CAS:938467-02-8
Formula: O=CC1=C(Br)C=C(F)C=C1Br
95+%
BD337166
MFCD13186760
2,6-DIBROMO-4-FLUOROBENZONITRILE
CAS:404928-18-3
Formula: N#CC1=C(Br)C=C(F)C=C1Br
97%
BD476928
MFCD24387472
2,6-DIBROMO-4-FLUOROPHENOL
CAS:344-20-7
Formula: OC1=C(Br)C=C(F)C=C1Br
95%
BD9739
MFCD00002317
2,6-DIBROMO-4-FLUOROPYRIDINE
CAS:1214344-15-6
Formula: FC1=CC(Br)=NC(Br)=C1
95+%
BD294363
n/a
2,6-DIBROMO-4-FORMYLPHENYL ACETATE
CAS:74849-10-8
Formula: CC(OC1=C(Br)C=C(C=O)C=C1Br)=O
97%
BD510038
MFCD12030631
2,6-DIBROMO-4-HYDROXYBENZONITRILE
CAS:74283-33-3
Formula: N#CC1=C(Br)C=C(O)C=C1Br
95+%
BD257980
n/a
2,6-DIBROMO-4-IODOPYRIDIN-3-OL
CAS:478148-75-3
Formula: OC1=C(I)C=C(Br)N=C1Br
95+%
BD315655
MFCD21648228
2,6-DIBROMO-4-IODOPYRIDINE
CAS:1160184-14-4
Formula: IC1=CC(Br)=NC(Br)=C1
96%
BD249044
MFCD13185521
2,6-DIBROMO-4-ISOPROPYLANILINE
CAS:10546-65-3
Formula: NC1=C(Br)C=C(C(C)C)C=C1Br
95%
BD11270
MFCD00015475
2,6-DIBROMO-4-METHOXYANILINE
CAS:95970-05-1
Formula: NC1=C(Br)C=C(OC)C=C1Br
98%
BD259473
MFCD06654495
2,6-DIBROMO-4-METHOXYBENZALDEHYDE
CAS:856766-94-4
Formula: O=CC1=C(Br)C=C(OC)C=C1Br
97%
BD691905
2,6-DIBROMO-4-METHOXYBENZONITRILE
CAS:74746-06-8
Formula: N#CC1C(Br)=CC(OC)=CC=1Br
95+%
BD00753506
n/a
2,6-DIBROMO-4-METHOXYPHENOL
CAS:2423-74-7
Formula: OC1=C(Br)C=C(OC)C=C1Br
97%
BD634924
MFCD12755175
2,6-DIBROMO-4-METHOXYPYRIDINE
CAS:117873-72-0
Formula: COC1=CC(Br)=NC(Br)=C1
98%
BD208279
MFCD11036227
2,6-DIBROMO-4-METHYL-3-NITROANILINE
CAS:117824-54-1
Formula: NC1=C(Br)C=C(C)C([N+]([O-])=O)=C1Br
95+%
BD320477
MFCD09260847
2,6-DIBROMO-4-METHYL-3-NITROPYRIDINE
CAS:593671-26-2
Formula: CC1=C(C(Br)=NC(Br)=C1)[N+]([O-])=O
95+%
BD241520
2,6-DIBROMO-4-METHYLANILINE
CAS:6968-24-7
Formula: C1=C(C)C=C(C(=C1Br)N)Br
98%
BD10488
MFCD00007641
2,6-DIBROMO-4-METHYLANISOLE
CAS:51699-89-9
Formula: COC1=C(Br)C=C(C)C=C1Br
98%
BD00785864
2,6-DIBROMO-4-METHYLBENZALDEHYDE
CAS:88174-23-6
Formula: O=CC1=C(Br)C=C(C)C=C1Br
95+%
BD217786
2,6-DIBROMO-4-METHYLNICOTINONITRILE
CAS:38824-75-8
Formula: N#CC1=C(Br)N=C(Br)C=C1C
95+%
BD284545
2,6-DIBROMO-4-METHYLPHENOL
CAS:2432-14-6
Formula: CC1=CC(Br)=C(O)C(Br)=C1
98%
BD68049
MFCD00002154
2,6-DIBROMO-4-METHYLPYRIDIN-3-AMINE
CAS:126354-83-4
Formula: NC1=C(C)C=C(Br)N=C1Br
98%
BD229343