Phone (USA) +1 212-348-5610
Whatsapp: +1 516-336-9307
WeChat: chembuyersguide
Chemical Search
 
























BLD Pharmatech Ltd.




Country: China

BLD Pharmatech Ltd.
488 Taoqiao Road, Building 5, 5F
HuiNan Town, Pudong New Area,
Shanghai 201203, China


Phone: +86-21-61629022
E-Mail:E-Mail this Supplier

Contact: Elva Cui

http://www.bldpharm.com

BLD Pharmatech Ltd.

Page: Home | 1 | 2 | 3 | 4 | 5 | 6 | 7 | 8 | 9 | 10 | 11 | 12 | 13 | 14 | 15 | 16 | 17 | 18 | 19 | 20 | 21 | 22 | 23 | 24 | 25 | 26 | 27 | 28 | 29 | 30 | 31 | 32 | 33 | 34 | 35 | 36 | 37 | 38 | 39 | 40 | 41 | 42 | 43 | 44 | 45 | 46 | 47 | 48 | 49 | 50 | 51 | 52 | 53 | 54 | 55 | 56 | 57 | 58 | 59 | 60 | 61 | 62 | 63 | 64 | 65 | 66 | 67 | 68 | 69 | 70 | 71 | 72 | 73 | 74 | 75 | 76 | 77 | 78 | 79 | 80 | 81 | 82 | 83 | 84 | 85 | 86 | 87 | 88 | 89 | 90 | 91 | 92 | 93 | 94 | 95 | 96 | 97 | 98 | 99 | 100 | 101 | 102 | 103 | 104 | 105 | 106 | 107 | 108 | 109 | 110 | 111 | 112 | 113 | 114 | 115 | 116 | 117 | 118 | 119 | 120 | 121 | 122 | 123 | 124 | 125 | 126 | 127 | 128 | 129 | 130 | 131 | 132 | 133 | 134 | 135 | 136 | 137 | 138 | 139 | 140 | 141 | 142 | 143 | 144 | 145 | 146 | 147 | 148 | 149 | 150 | 151 | 152 | 153 | 154 | 155 | 156 | 157 | 158 | 159 | 160 | 161 | 162 | 163 | 164 | 165 | 166 | 167 | 168 | 169 | 170 | 171 | 172 | 173 | 174 | 175 | 176 | 177 | 178 | 179 | 180 | 181 | 182 | 183 | 184 | 185 | 186 | 187 | 188 | 189 | 190 | 191 | 192 | 193 | 194 | 195 | 196 | 197 | 198 | 199 | 200 | 201 | 202 | 203 | 204 | 205 | 206 | 207 | 208 | 209 | 210 | 211 | 212 | 213 | 214 | 215 | 216 | 217 | 218 | 219 | 220 | 221 | 222 | 223 | 224 | 225 | 226 | 227 | 228 | 229 | 230 | 231 | 232 | 233 | 234 | 235 | 236 | 237 | 238 | 239 | 240 | 241 | 242 | 243 | 244 | 245 | 246 | 247 | 248 | 249 | 250 | 251 | 252 | 253 | 254 | 255 | 256 | 257 | 258 | 259 | 260 | 261 | 262 | 263 | 264 | 265 | 266 | 267 | 268 | 269 | 270 | 271 | 272 | 273 | 274 | 275 | 276 | 277 | 278 | 279 | 280 | 281 | 282 | 283 | 284 | 285 | 286 | 287 | 288 | 289 | 290 | 291 | 292 | 293 | 294 | 295 | 296 | 297 | 298 | 299 | 300 | 301 | 302 | 303 | 304 | 305 | 306 | 307 | 308 |
 


Product List

2,6-DIBROMO-4-METHYLPYRIDINE
CAS:73112-16-0
Formula: CC1=CC(Br)=NC(Br)=C1
98%
BD159333
MFCD11036225
2,6-DIBROMO-4-NITROANILINE
CAS:827-94-1
Formula: NC1=C(Br)C=C(C=C1Br)[N+]([O-])=O
98%
BD22766
MFCD00007639
2,6-DIBROMO-4-NITROPHENOL
CAS:99-28-5
Formula: OC1=C(Br)C=C([N+]([O-])=O)C=C1Br
97%
BD42147
MFCD00007334
2,6-DIBROMO-4-NITROPYRIDIN-3-OL
CAS:2140305-51-5
Formula: OC1=C([N+]([O-])=O)C=C(Br)N=C1Br
97%
BD00793528
2,6-DIBROMO-4-NITROPYRIDINE
CAS:175422-04-5
Formula: BrC1=NC(=CC(=C1)[N+](=O)[O-])Br
97+%
BD32306
MFCD07369947
2,6-DIBROMO-4-NITROPYRIDINE 1-OXIDE
CAS:98027-81-7
Formula: O=[N+](C1=CC(Br)=[N+]([O-])C(Br)=C1)[O-]
97%
BD161616
n/a
2,6-DIBROMO-4-OCTYL-4H-DITHIENO[3,2-B:2',3'-D]PYRROLE
CAS:1346688-54-7
Formula: CCCCCCCCN1C(C=C(Br)S2)=C2C3=C1C=C(Br)S3
95+%
BD262616
2,6-DIBROMO-4-TRIFLUOROMETHYLPHENOL
CAS:35852-57-4
Formula: OC1=C(Br)C=C(C(F)(F)F)C=C1Br
97%
BD323689
MFCD09261146
2,6-DIBROMO-4H-CYCLOPENTA[1,2-B:5,4-B']DITHIOPHEN-4-ONE
CAS:636588-79-9
Formula: O=C1C2=C(C3=C1C=C(Br)S3)SC(Br)=C2
95+%
BD233945
2,6-DIBROMO-4H-CYCLOPENTA[1,2-B:5,4-B']DITHIOPHENE
CAS:258527-25-2
Formula: BrC1=CC2=C(C3=C(C2)C=C(Br)S3)S1
95+%
BD247417
2,6-DIBROMO-5-CHLORONICOTINIC ACID
CAS:55304-86-4
Formula: O=C(O)C1=C(Br)N=C(Br)C(Cl)=C1
95+%
BD248726
2,6-DIBROMO-5-ETHOXYPYRIDIN-3-AMINE
CAS:1000018-10-9
Formula: NC1=CC(OCC)=C(Br)N=C1Br
95%
BD40995
MFCD09864810
2,6-DIBROMO-5-IODOPYRIDIN-3-OL
CAS:1105675-63-5
Formula: OC1=CC(I)=C(Br)N=C1Br
95+%
BD197104
MFCD11857620
2,6-DIBROMO-5-METHOXYPYRIDIN-3-AMINE
CAS:79491-47-7
Formula: NC1=CC(OC)=C(Br)N=C1Br
95+%
BD257907
2,6-DIBROMO-5-METHYL-[1,2,4]TRIAZOLO[1,5-A]PYRIDINE
CAS:1823367-14-1
Formula: CC1=C(Br)C=CC2=NC(Br)=NN12
97%
BD440322
MFCD26406916
2,6-DIBROMO-5-METHYLPYRIDIN-3-AMINE
CAS:126325-51-7
Formula: NC1=CC(C)=C(Br)N=C1Br
95%
BD586560
MFCD01570844
2,6-DIBROMO-7H-PURINE
CAS:1196-41-4
Formula: BrC1=NC2=C(N=CN2)C(Br)=N1
95+%
BD233153
MFCD00056909
2,6-DIBROMO-9,10-BIS(4-(TERT-BUTYL)PHENYL)ANTHRACENE
CAS:1187763-68-3
Formula: CC(C1=CC=C(C2=C3C=C(Br)C=CC3=C(C4=CC=C(C(C)(C)C)C=C4)C5=CC(Br)=CC=C25)C=C1)(C)C
99%
BD292575
2,6-DIBROMO-9,10-DI(NAPHTHALEN-1-YL)ANTHRACENE
CAS:914306-89-1
Formula: BrC1=CC2=C(C3=C4C=CC=CC4=CC=C3)C5=CC=C(Br)C=C5C(C6=C7C=CC=CC7=CC=C6)=C2C=C1
95+%
BD246840
MFCD16660915
2,6-DIBROMO-9,10-DI(NAPHTHALEN-2-YL)ANTHRACENE
CAS:561064-15-1
Formula: BrC1=CC2=C(C3=CC=C4C=CC=CC4=C3)C5=CC=C(Br)C=C5C(C6=CC=C7C=CC=CC7=C6)=C2C=C1
98%
BD246841
MFCD16660916
2,6-DIBROMO-9,10-DIHYDROANTHRACENE
CAS:1065644-53-2
Formula: BrC1=CC(CC2=CC=C(Br)C=C2C3)=C3C=C1
95+%
BD291101
2,6-DIBROMO-9,10-DIPHENYLANTHRACENE
CAS:528609-98-5
Formula: BrC1=CC2=C(C3=CC=CC=C3)C4=CC=C(Br)C=C4C(C5=CC=CC=C5)=C2C=C1
98%
BD292574
2,6-DIBROMO-9,9-DIMETHYL-9H-FLUORENE
CAS:925889-85-6
Formula: CC1(C)C2=C(C3=C1C=CC(Br)=C3)C=CC(Br)=C2
97%
BD36846
MFCD09025330
2,6-DIBROMO-9H-FLUORENE
CAS:858800-80-3
Formula: BrC1=CC2=C(CC3=C2C=CC(Br)=C3)C=C1
95+%
BD335561
MFCD26959809
2,6-DIBROMOANILINE
CAS:608-30-0
Formula: NC1=C(Br)C=CC=C1Br
98%
BD34272
MFCD00007638
2,6-DIBROMOANTHRACENE
CAS:186517-01-1
Formula: BrC1=CC2=CC3=CC=C(Br)C=C3C=C2C=C1
98%
BD216862
2,6-DIBROMOANTHRACENE-9,10-DIONE
CAS:633-70-5
Formula: O=C1C2=C(C=C(Br)C=C2)C(C3=CC=C(Br)C=C13)=O
96%
BD68061
MFCD08276344
2,6-DIBROMOBENZALDEHYDE
CAS:67713-23-9
Formula: O=CC1=C(Br)C=CC=C1Br
98%
BD68062
MFCD11040410
2,6-DIBROMOBENZAMIDE
CAS:96237-91-1
Formula: O=C(C1C(Br)=CC=CC=1Br)N
95+%
BD00757512
n/a
2,6-DIBROMOBENZO[1,2-B:4,5-B']DITHIOPHENE
CAS:909280-97-3
Formula: BrC1=CC2=C(C=C(C=C(Br)S3)C3=C2)S1
98%
BD262688
MFCD22124718
2,6-DIBROMOBENZO[B]FURAN-3(2H)-ONE
CAS:1823370-21-3
Formula: O=C1C2=CC=C(Br)C=C2OC1Br
97%
BD00796109
2,6-DIBROMOBENZOIC ACID
CAS:601-84-3
Formula: OC(=O)C1=C(Br)C=CC=C1Br
98%
BD173598
2,6-DIBROMOBENZONITRILE
CAS:6575-12-8
Formula: N#CC1=C(Br)C=CC=C1Br
95+%
BD158279
MFCD09834774
2,6-DIBROMOBENZOTHIAZOLE
CAS:408328-13-2
Formula: BrC1=NC2=C(S1)C=C(C=C2)Br
95+%
BD20713
MFCD07783783
2,6-DIBROMOBENZYL ACETATE
CAS:1147858-83-0
Formula: CC(OCC1=C(Br)C=CC=C1Br)=O
95+%
BD244224
MFCD20482187
2,6-DIBROMODITHIENO[3,2-B:2',3'-D]THIOPHENE
CAS:67061-69-2
Formula: BrC1=CC2=C(S1)C1=C(S2)C=C(Br)S1
97%
BD235044
MFCD11215199
2,6-DIBROMOHEXANOIC ACID
CAS:13137-43-4
Formula: OC(=O)C(Br)CCCCBr
95+%
BD68064
MFCD00046517
2,6-DIBROMOIMIDAZO[1,2-A]PYRIDINE
CAS:851916-83-1
Formula: BrC1=CN2C(C=C1)=NC(Br)=C2
95+%
BD264189
MFCD11976189
2,6-DIBROMOIMIDAZO[1,2-B]PYRIDAZINE
CAS:1105714-53-1
Formula: BrC1=NN2C(C=C1)=NC(Br)=C2
95+%
BD264167
MFCD12828166
2,6-DIBROMOISONICOTINALDEHYDE
CAS:316800-46-1
Formula: O=CC1=CC(Br)=NC(Br)=C1
95+%
BD20180
MFCD06410666
2,6-DIBROMOISONICOTINIC ACID
CAS:2016-99-1
Formula: BrC1=NC(=CC(=C1)C(=O)O)Br
96%
BD19222
MFCD09743987
2,6-DIBROMOISONICOTINONITRILE
CAS:408352-58-9
Formula: N#CC1=CC(Br)=NC(Br)=C1
95+%
BD282979
MFCD03086034
2,6-DIBROMONAPHTHALENE
CAS:13720-06-4
Formula: BrC1=CC2=C(C=C1)C=C(Br)C=C2
98%
BD41266
MFCD01026462
2,6-DIBROMONAPHTHALENE-1,5-DIOL
CAS:84-59-3
Formula: OC1=C2C=CC(Br)=C(O)C2=CC=C1Br
93%
BD12496
MFCD00021473
2,6-DIBROMONICOTINALDEHYDE
CAS:55304-83-1
Formula: BrC1=CC=C(C=O)C(Br)=N1
95+%
BD68072
MFCD10574710
2,6-DIBROMONICOTINAMIDE
CAS:1379303-54-4
Formula: O=C(N)C1=C(Br)N=C(Br)C=C1
96%
BD260503
MFCD18904518
2,6-DIBROMONICOTINOHYDRAZIDE
CAS:1260790-20-2
Formula: O=C(NN)C1=C(Br)N=C(Br)C=C1
95+%
BD267226
2,6-DIBROMONICOTINONITRILE
CAS:53367-52-5
Formula: N#CC1C=CC(Br)=NC=1Br
95+%
BD00727060
n/a
2,6-DIBROMOPHENOL
CAS:608-33-3
Formula: C1=CC=C(C(=C1Br)O)Br
98%
BD21742
MFCD00002152
2,6-DIBROMOPYRAZINE
CAS:23229-25-6
Formula: BrC1=CN=CC(Br)=N1
97%
BD158280
MFCD09834804
2,6-DIBROMOPYRIDIN-3-AMINE
CAS:39856-57-0
Formula: NC1=CC=C(Br)N=C1Br
97%
BD9538
MFCD00128862
2,6-DIBROMOPYRIDIN-4-AMINE
CAS:39771-34-1
Formula: NC1=CC(Br)=NC(Br)=C1
97%
BD161539
MFCD00234047
2,6-DIBROMOPYRIDIN-4-OL
CAS:220616-68-2
Formula: OC1=CC(Br)=NC(Br)=C1
95+%
BD248727
MFCD13185517
2,6-DIBROMOPYRIDINE
CAS:626-05-1
Formula: BrC1=CC=CC(Br)=N1
97%
BD7929
MFCD00006223
2,6-DIBROMOPYRIDINE 1-OXIDE
CAS:25373-69-7
Formula: BrC1=[N+]([O-])C(Br)=CC=C1
97%
BD235624
MFCD00234019
2,6-DIBROMOPYRIDINE-3,4-DIAMINE
CAS:1121583-59-2
Formula: NC1=C(N)C=C(Br)N=C1Br
97%
BD161731
MFCD18072577
2,6-DIBROMOQUINAZOLINE
CAS:161425-75-8
Formula: BrC2=NC1=CC=C(C=C1C=N2)Br
97%
BD158281
MFCD04114090
2,6-DIBROMOQUINOLINE
CAS:77514-31-9
Formula: BrC1=CC=C2N=C(Br)C=CC2=C1
95+%
BD250080
MFCD09261124
2,6-DIBROMOQUINOXALINE
CAS:175858-10-3
Formula: BrC1=CC=C2N=C(Br)C=NC2=C1
95+%
BD160327
MFCD12406104
2,6-DIBROMOTOLUENE
CAS:69321-60-4
Formula: C1=CC=C(C(=C1Br)C)Br
98%
BD4489
MFCD00013524
2,6-DICHLORO-1,3-BENZOTHIAZOLE
CAS:3622-23-9
Formula: C1=CC(=CC2=C1N=C(S2)Cl)Cl
97%
BD20441
MFCD00044101
2,6-DICHLORO-1,4-BENZOQUINONE
CAS:697-91-6
Formula: O=C(C=C1Cl)C=C(Cl)C1=O
98%
BD68078
2,6-DICHLORO-1,5-NAPHTHYRIDINE
CAS:27017-66-9
Formula: ClC1=CC=C2N=C(Cl)C=CC2=N1
95+%
BD234696
MFCD03931483
2,6-DICHLORO-1,7-NAPHTHYRIDINE
CAS:93493-69-7
Formula: ClC1=NC=C2N=C(Cl)C=CC2=C1
97%
BD55133
MFCD11044727
2,6-DICHLORO-1,8-NAPHTHYRIDINE
CAS:1260898-43-8
Formula: ClC1=CN=C2N=C(Cl)C=CC2=C1
95+%
BD218242
MFCD13189448
2,6-DICHLORO-1,8-NAPHTHYRIDINE-3-CARBONITRILE
CAS:1330583-69-1
Formula: N#CC1=CC2=CC(Cl)=CN=C2N=C1Cl
97%
BD603086
MFCD19982797
2,6-DICHLORO-1-FLUOROPYRIDIN-1-IUM TETRAFLUOROBORATE
CAS:140623-89-8
Formula: F[N+]1=C(Cl)C=CC=C1Cl.F[B-](F)(F)F
95%
BD58359
2,6-DICHLORO-1H-BENZO[D]IMIDAZOLE
CAS:4887-95-0
Formula: ClC1=CC=C2C(NC(Cl)=N2)=C1
95+%
BD67521
MFCD00091850
2,6-DICHLORO-3,4-DIMETHYLPHENOL
CAS:1570-67-8
Formula: OC1=C(Cl)C=C(C)C(C)=C1Cl
95+%
BD389363
MFCD16622257
2,6-DICHLORO-3,5-DIFLUOROPHENOL
CAS:63418-08-6
Formula: OC1=C(Cl)C(F)=CC(F)=C1Cl
95+%
BD68088
MFCD03424471
2,6-DICHLORO-3,5-DIMETHOXYANILINE
CAS:872509-56-3
Formula: NC1=C(Cl)C(OC)=CC(OC)=C1Cl
98%
BD290441
MFCD21648506
2,6-DICHLORO-3-(1,3-DIOXOLAN-2-YL)PYRIDINE
CAS:1485111-20-3
Formula: ClC1=CC=C(C2OCCO2)C(Cl)=N1
95+%
BD330068
MFCD28400800
2,6-DICHLORO-3-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PYRIDINE
CAS:1073371-78-4
Formula: ClC1=CC=C(B(OC2(C)C)OC2(C)C)C(Cl)=N1
95+%
BD161512
MFCD06798261
2,6-DICHLORO-3-(CHLOROMETHYL)-5-FLUORO-4-METHYLPYRIDINE
CAS:N/A
Formula: CC1C(F)=C(Cl)N=C(Cl)C=1CCl
95%
BD00721298
2,6-DICHLORO-3-(CHLOROMETHYL)PYRIDINE
CAS:41789-37-1
Formula: ClCC1=CC=C(Cl)N=C1Cl
98%
BD68081
MFCD07368052
2,6-DICHLORO-3-(CHLOROSULFONYL)BENZOIC ACID
CAS:53553-05-2
Formula: O=C(O)C1=C(Cl)C=CC(S(=O)(Cl)=O)=C1Cl
97%
BD68089
2,6-DICHLORO-3-(DIFLUOROMETHYL)-5-FLUOROPYRIDINE
CAS:1374659-39-8
Formula: FC1=C(Cl)N=C(Cl)C(C(F)F)=C1
97%
BD455374
MFCD22199308
2,6-DICHLORO-3-(DIFLUOROMETHYL)ISONICOTINIC ACID
CAS:1805238-73-6
Formula: O=C(C1=C(C(F)F)C(Cl)=NC(Cl)=C1)O
95%
BD469067
MFCD25487230
2,6-DICHLORO-3-(DIFLUOROMETHYL)PYRIDIN-4-AMINE
CAS:1805322-96-6
Formula: FC(C1=C(N)C=C(Cl)N=C1Cl)F
95+%
BD343999
MFCD25486753
2,6-DICHLORO-3-(DIFLUOROMETHYL)PYRIDIN-4-OL
CAS:1805327-37-0
Formula: OC1=C(C(F)F)C(Cl)=NC(Cl)=C1
97%
BD459120
MFCD25486870
2,6-DICHLORO-3-(HYDRAZONOMETHYL)PYRIDINE
CAS:2140803-84-3
Formula: N/N=C/C1=CC=C(Cl)N=C1Cl
98%
BD00773103
2,6-DICHLORO-3-(METHOXYMETHYL)PYRIDINE
CAS:1330763-31-9
Formula: COCC1=CC=C(Cl)N=C1Cl
95+%
BD336230
MFCD20230576
2,6-DICHLORO-3-(METHYLAMINO)ISONICOTINIC ACID
CAS:N/A
Formula: O=C(C1C(NC)=C(Cl)N=C(Cl)C=1)O
95%
BD00750370
n/a
2,6-DICHLORO-3-(METHYLSULFONYL)PYRIDINE
CAS:1820647-64-0
Formula: O=S(C1=CC=C(Cl)N=C1Cl)(C)=O
95%
BD482243
MFCD26940378
2,6-DICHLORO-3-(TRICHLOROMETHYL)PYRIDINE
CAS:55366-30-8
Formula: ClC1=CC=C(C(Cl)=N1)C(Cl)(Cl)Cl
95+%
BD68083
MFCD00185759
2,6-DICHLORO-3-(TRIFLUOROMETHYL)ANILINE
CAS:6656-72-0
Formula: NC1=C(Cl)C=CC(C(F)(F)F)=C1Cl
95+%
BD308560
MFCD11226279
2,6-DICHLORO-3-(TRIFLUOROMETHYL)BENZALDEHYDE
CAS:134741-65-4
Formula: O=CC1=C(Cl)C=CC(C(F)(F)F)=C1Cl
95+%
BD254345
2,6-DICHLORO-3-(TRIFLUOROMETHYL)BENZAMIDE
CAS:53012-81-0
Formula: O=C(N)C1=C(Cl)C=CC(C(F)(F)F)=C1Cl
95+%
BD321941
MFCD11519346
2,6-DICHLORO-3-(TRIFLUOROMETHYL)BENZOIC ACID
CAS:25922-41-2
Formula: O=C(O)C1=C(Cl)C=CC(C(F)(F)F)=C1Cl
97%
BD5557
MFCD09743917
2,6-DICHLORO-3-(TRIFLUOROMETHYL)BENZONITRILE
CAS:1092461-02-3
Formula: N#CC1=C(Cl)C=CC(C(F)(F)F)=C1Cl
95+%
BD314149
MFCD11519347
2,6-DICHLORO-3-(TRIFLUOROMETHYL)BENZOYL CHLORIDE
CAS:53012-82-1
Formula: O=C(Cl)C1=C(Cl)C=CC(C(F)(F)F)=C1Cl
95+%
BD321942
MFCD11519345
2,6-DICHLORO-3-(TRIFLUOROMETHYL)PYRIDINE
CAS:55304-75-1
Formula: FC(C1=CC=C(Cl)N=C1Cl)(F)F
97%
BD21421
MFCD00042245
2,6-DICHLORO-3-BROMOPYRIDINE
CAS:866755-20-6
Formula: BrC1=CC=C(N=C1Cl)Cl
97%
BD35172
MFCD06798231
2,6-DICHLORO-3-CYCLOPROPYLPYRIDINE
CAS:1211529-21-3
Formula: ClC1=CC=C(C2CC2)C(Cl)=N1
95+%
BD252548
MFCD18254123
2,6-DICHLORO-3-FLUORO-5-(TRIFLUOROMETHYL)PYRIDINE
CAS:1099598-11-4
Formula: FC(C1=C(Cl)N=C(Cl)C(F)=C1)(F)F
95+%
BD194621
MFCD11100554
2,6-DICHLORO-3-FLUOROBENZOIC ACID
CAS:178813-78-0
Formula: O=C(O)C1=C(Cl)C=CC(F)=C1Cl
97%
BD4068
MFCD06658165
2,6-DICHLORO-3-FLUOROPHENACYL BROMIDE
CAS:914635-49-7
Formula: O=C(C1=C(Cl)C=CC(F)=C1Cl)CBr
96%
BD00787105
2,6-DICHLORO-3-FLUOROPHENOL
CAS:1803854-58-1
Formula: OC1=C(Cl)C=CC(F)=C1Cl
97%
BD454885
MFCD28786273
2,6-DICHLORO-3-FLUOROPYRIDINE
CAS:52208-50-1
Formula: ClC1=NC(=CC=C1F)Cl
96%
BD68092
MFCD09907815
2,6-DICHLORO-3-FORMYLPYRIDINE
CAS:55304-73-9
Formula: ClC1=NC(=CC=C1C=O)Cl
98%
BD34076
MFCD07369746
2,6-DICHLORO-3-HYDRAZINYLPYRIDINE
CAS:1035173-57-9
Formula: NNC1=CC=C(Cl)N=C1Cl
97%
BD605891
2,6-DICHLORO-3-HYDRAZINYLQUINOXALINE
CAS:91895-34-0
Formula: NNC1=NC2=CC(Cl)=CC=C2N=C1Cl
95+%
BD282581
2,6-DICHLORO-3-HYDROXYBENZONITRILE
CAS:3336-34-3
Formula: N#CC1=C(Cl)C=CC(O)=C1Cl
96%
BD582699
MFCD01662155
2,6-DICHLORO-3-HYDROXYISONICOTINALDEHYDE
CAS:185423-26-1
Formula: O=CC1=CC(Cl)=NC(Cl)=C1O
95+%
BD19015
MFCD06410675
2,6-DICHLORO-3-HYDROXYISONICOTINIC ACID
CAS:185422-96-2
Formula: OC(=O)C1=C(O)C(Cl)=NC(Cl)=C1
98%
BD68094
MFCD03411718
2,6-DICHLORO-3-IODO-4-(TRIFLUOROMETHYL)PYRIDINE
CAS:1186405-02-6
Formula: FC(C1=C(I)C(Cl)=NC(Cl)=C1)(F)F
95+%
BD202107
2,6-DICHLORO-3-IODOPYRIDINE
CAS:148493-37-2
Formula: IC1=CC=C(Cl)N=C1Cl
98%
BD9510
MFCD03094686
2,6-DICHLORO-3-METHOXYANILINE
CAS:55285-43-3
Formula: NC1=C(Cl)C=CC(OC)=C1Cl
95+%
BD271725
MFCD20694612
2,6-DICHLORO-3-METHOXYBENZOIC ACID
CAS:32890-93-0
Formula: COC1=CC=C(Cl)C(C(O)=O)=C1Cl
98%
BD228242
2,6-DICHLORO-3-METHOXYPYRIDINE
CAS:1214340-74-5
Formula: COC1=CC=C(Cl)N=C1Cl
95+%
BD333566
MFCD13185542
2,6-DICHLORO-3-METHYL-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PYRIDINE
CAS:1010101-08-2
Formula: CC1(C)C(C)(C)OB(C2=C(C)C(Cl)=NC(Cl)=C2)O1
95%
BD324618
MFCD11617878
2,6-DICHLORO-3-METHYL-4-NITROPYRIDINE
CAS:N/A
Formula: O=[N+](C1=C(C)C(Cl)=NC(Cl)=C1)[O-]
97%
BD751254
2,6-DICHLORO-3-METHYL-4-NITROPYRIDINE 1-OXIDE
CAS:N/A
Formula: O=[N+]([O-])C1C(C)=C(Cl)[N+]([O-])=C(Cl)C=1
95%
BD00769892
n/a
2,6-DICHLORO-3-METHYL-5-NITROPYRIDINE
CAS:58596-88-6
Formula: O=[N+](C1=C(Cl)N=C(Cl)C(C)=C1)[O-]
95+%
BD211950
2,6-DICHLORO-3-METHYLANILINE
CAS:64063-37-2
Formula: NC1=C(Cl)C=CC(C)=C1Cl
98%
BD4753
MFCD00007676
2,6-DICHLORO-3-METHYLBENZALDEHYDE
CAS:60611-23-6
Formula: O=CC1=C(Cl)C=CC(C)=C1Cl
97%
BD564243
MFCD09999657
2,6-DICHLORO-3-METHYLBENZOIC ACID
CAS:58671-77-5
Formula: O=C(O)C1=C(Cl)C=CC(C)=C1Cl
95%
BD227701
2,6-DICHLORO-3-METHYLISONICOTINALDEHYDE
CAS:N/A
Formula: O=CC1C(C)=C(Cl)N=C(Cl)C=1
95%
BD00766457
2,6-DICHLORO-3-METHYLISONICOTINAMIDE
CAS:N/A
Formula: O=C(C1C(C)=C(Cl)N=C(Cl)C=1)N
95%
BD00738005
2,6-DICHLORO-3-METHYLISONICOTINIC ACID
CAS:1256835-40-1
Formula: O=C(O)C1=CC(Cl)=NC(Cl)=C1C
95+%
BD295895
2,6-DICHLORO-3-METHYLISONICOTINONITRILE
CAS:N/A
Formula: N#CC1C(C)=C(Cl)N=C(Cl)C=1
95%
BD00731482
2,6-DICHLORO-3-METHYLPHENOL
CAS:13481-70-4
Formula: OC1=C(Cl)C=CC(C)=C1Cl
96%
BD467170
MFCD08061909
2,6-DICHLORO-3-METHYLPHENYLBORONIC ACID
CAS:851756-54-2
Formula: CC1=C(Cl)C(B(O)O)=C(Cl)C=C1
98%
BD161576
MFCD09800875
2,6-DICHLORO-3-METHYLPYRIDIN-4-AMINE
CAS:N/A
Formula: NC1=C(C)C(Cl)=NC(Cl)=C1
97%
BD753282
2,6-DICHLORO-3-METHYLPYRIDINE
CAS:58584-94-4
Formula: CC1=CC=C(Cl)N=C1Cl
98%
BD21616
MFCD00137847
2,6-DICHLORO-3-NITROANILINE
CAS:13785-48-3
Formula: NC1=C(Cl)C=CC([N+]([O-])=O)=C1Cl
95+%
BD262060
MFCD11110683
2,6-DICHLORO-3-NITROBENZALDEHYDE
CAS:5866-97-7
Formula: C1=CC(=C(C(=C1Cl)C=O)Cl)[N+](=O)[O-]
95+%
BD4043
MFCD00090332
2,6-DICHLORO-3-NITROBENZENE-1-SULFONYL CHLORIDE
CAS:276702-53-5
Formula: [O-][N+](=O)C1=CC=C(Cl)C(=C1Cl)S(Cl)(=O)=O
95+%
BD234927
MFCD11109540
2,6-DICHLORO-3-NITROBENZENESULFONAMIDE
CAS:89281-19-6
Formula: O=S(C1=C(Cl)C=CC([N+]([O-])=O)=C1Cl)(N)=O
97%
BD464971
MFCD17014706
2,6-DICHLORO-3-NITROBENZENESULFONIC ACID
CAS:276702-52-4
Formula: OS(=O)(=O)C1=C(Cl)C(=CC=C1Cl)[N+]([O-])=O
95+%
BD234926
2,6-DICHLORO-3-NITROBENZOIC ACID
CAS:55775-97-8
Formula: O=C(O)C1=C(Cl)C=CC([N+]([O-])=O)=C1Cl
98%
BD161275
MFCD00075422
2,6-DICHLORO-3-NITROBENZONITRILE
CAS:5866-98-8
Formula: N#CC1=C(Cl)C=CC([N+]([O-])=O)=C1Cl
98%
BD68101
MFCD00051513
2,6-DICHLORO-3-NITROPYRIDIN-4-AMINE
CAS:2897-43-0
Formula: C1=C(Cl)N=C(Cl)C(=C1N)[N+]([O-])=O
97+%
BD68099
MFCD03265754
2,6-DICHLORO-3-NITROPYRIDINE
CAS:16013-85-7
Formula: C1=C(C(=NC(=C1)Cl)Cl)[N+](=O)[O-]
98%
BD7930
MFCD00006234
2,6-DICHLORO-3-PHENYLPYRIDINE
CAS:18700-11-3
Formula: ClC1=CC=C(C2=CC=CC=C2)C(Cl)=N1
95+%
BD246652
MFCD00234689
2,6-DICHLORO-3-PHENYLQUINOXALINE
CAS:76672-25-8
Formula: ClC1=CC=C2N=C(Cl)C(C3=CC=CC=C3)=NC2=C1
95+%
BD269200
2,6-DICHLORO-3H-PYRIMIDIN-4-ONE
CAS:120977-94-8
Formula: ClC1=NC(=CC(N1)=O)Cl
95+%
BD216245
MFCD00955562
2,6-DICHLORO-4,8-DI(PIPERIDIN-1-YL)PYRIMIDO[5,4-D]PYRIMIDINE
CAS:7139-02-8
Formula: ClC1=NC2=C(N=C(Cl)N=C2N2CCCCC2)C(=N1)N1CCCCC1
97%
BD234860
MFCD07779463
2,6-DICHLORO-4-((TRIFLUOROMETHYL)THIO)ANILINE
CAS:99479-65-9
Formula: NC1=C(Cl)C=C(SC(F)(F)F)C=C1Cl
95+%
BD68145
MFCD04972800
2,6-DICHLORO-4-((TRIFLUOROMETHYL)THIO)PHENOL
CAS:102794-04-7
Formula: OC1=C(Cl)C=C(SC(F)(F)F)C=C1Cl
97%
BD4033
MFCD04972801
2,6-DICHLORO-4-(1-(OXETAN-3-YL)PIPERIDIN-4-YL)PYRIDINE
CAS:1496582-60-5
Formula: ClC1=CC(C2CCN(C3COC3)CC2)=CC(Cl)=N1
97%
BD442233
MFCD28133681
2,6-DICHLORO-4-(1-PYRROLYL)PYRIMIDINE
CAS:321328-97-6
Formula: ClC1=CC(N2C=CC=C2)=NC(Cl)=N1
95+%
BD160322
MFCD11846489
2,6-DICHLORO-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)ANILINE
CAS:1371630-51-1
Formula: NC1=C(Cl)C=C(B2OC(C)(C)C(C)(C)O2)C=C1Cl
95+%
BD315019
MFCD23380454
2,6-DICHLORO-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PHENOL
CAS:1003298-87-0
Formula: OC1=C(Cl)C=C(B2OC(C)(C)C(C)(C)O2)C=C1Cl
97%
BD266292
2,6-DICHLORO-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PYRIDINE
CAS:408492-27-3
Formula: CC1(C)C(C)(C)OB(C2=CC(Cl)=NC(Cl)=C2)O1
98%
BD226529
2,6-DICHLORO-4-(6-CHLOROOXAZOLO[5,4-B]PYRIDIN-2-YL)ANILINE
CAS:1354750-87-0
Formula: NC1=C(Cl)C=C(C2=NC3=CC(Cl)=CN=C3O2)C=C1Cl
97%
BD612861
2,6-DICHLORO-4-(CHLOROMETHYL)-3-METHYLPYRIDINE
CAS:N/A
Formula: CC1C(Cl)=NC(Cl)=CC=1CCl
95%
BD00759117
2,6-DICHLORO-4-(CHLOROMETHYL)NICOTINONITRILE
CAS:1248784-79-3
Formula: N#CC1=C(Cl)N=C(Cl)C=C1CCl
95+%
BD284517
2,6-DICHLORO-4-(CHLOROMETHYL)PYRIDINE
CAS:101990-72-1
Formula: ClCC1=CC(Cl)=NC(Cl)=C1
95%
BD68105
MFCD03783562
2,6-DICHLORO-4-(CHLOROMETHYL)PYRIDINE HYDROCHLORIDE
CAS:223407-50-9
Formula: ClCC1=CC(Cl)=NC(Cl)=C1.[H]Cl
97%
BD475314
2,6-DICHLORO-4-(DIFLUOROMETHOXY)ANILINE
CAS:154807-46-2
Formula: NC1=C(Cl)C=C(OC(F)F)C=C1Cl
95+%
BD330192
MFCD21602867
2,6-DICHLORO-4-(DIFLUOROMETHYL)NICOTINONITRILE
CAS:960293-93-0
Formula: N#CC1=C(Cl)N=C(Cl)C=C1C(F)F
95+%
BD284518
2,6-DICHLORO-4-(DIFLUOROMETHYL)PYRIDIN-3-OL
CAS:1805332-81-3
Formula: OC1=C(C(F)F)C=C(Cl)N=C1Cl
97%
BD467929
MFCD25486872
2,6-DICHLORO-4-(DIFLUOROMETHYL)PYRIDINE
CAS:1201675-01-5
Formula: FC(C1=CC(Cl)=NC(Cl)=C1)F
97%
BD555977
MFCD16658727
2,6-DICHLORO-4-(DIMETHYLAMINO)NICOTINALDEHYDE
CAS:1823371-33-0
Formula: O=CC1=C(Cl)N=C(Cl)C=C1N(C)C
95+%
BD265654
2,6-DICHLORO-4-(HYDROXYMETHYL)PHENOL
CAS:22002-17-1
Formula: OC1=C(Cl)C=C(CO)C=C1Cl
97%
BD476583
2,6-DICHLORO-4-(METHYLSULFONYL)ANILINE
CAS:80866-96-2
Formula: NC1=C(Cl)C=C(S(=O)(C)=O)C=C1Cl
95+%
BD182618
MFCD00007678
2,6-DICHLORO-4-(METHYLSULFONYL)PHENOL
CAS:20951-05-7
Formula: OC1=C(Cl)C=C(S(=O)(C)=O)C=C1Cl
95%
BD68106
MFCD00216500
2,6-DICHLORO-4-(O-TOLYL)NICOTINONITRILE
CAS:873443-66-4
Formula: N#CC1=C(C2=CC=CC=C2C)C=C(Cl)N=C1Cl
97%
BD651488
2,6-DICHLORO-4-(PIPERIDIN-1-YLCARBONYL)PYRIDINE
CAS:287196-80-9
Formula: C1CCN(CC1)C(C2=CC(=NC(=C2)Cl)Cl)=O
96%
BD44007
MFCD01764510
2,6-DICHLORO-4-(PIPERIDIN-4-YL)PYRIDINE HYDROCHLORIDE
CAS:1956326-74-1
Formula: ClC1=CC(C2CCNCC2)=CC(Cl)=N1.[H]Cl
97%
BD442232
MFCD28133680
2,6-DICHLORO-4-(TERT-PENTYL)PHENOL
CAS:75908-77-9
Formula: OC1=C(Cl)C=C(C(C)(C)CC)C=C1Cl
97%
BD68107
2,6-DICHLORO-4-(TETRAHYDRO-2H-PYRAN-4-YL)PYRIDINE
CAS:1496582-11-6
Formula: ClC1=CC(C2CCOCC2)=CC(Cl)=N1
95+%
BD330085
MFCD28133682
2,6-DICHLORO-4-(TRICHLOROMETHYL)PYRIDINE
CAS:22652-14-8
Formula: ClC(C1=CC(Cl)=NC(Cl)=C1)(Cl)Cl
95%
BD00786739
2,6-DICHLORO-4-(TRIFLUOROMETHOXY)ANILINE
CAS:99479-66-0
Formula: NC1=C(Cl)C=C(OC(F)(F)F)C=C1Cl
95+%
BD10262
MFCD00190128
2,6-DICHLORO-4-(TRIFLUOROMETHOXY)BENZALDEHYDE
CAS:118754-54-4
Formula: O=CC1=C(Cl)C=C(OC(F)(F)F)C=C1Cl
97%
BD68109
MFCD06660298
2,6-DICHLORO-4-(TRIFLUOROMETHOXY)BENZONITRILE
CAS:1822673-40-4
Formula: N#CC1=C(Cl)C=C(OC(F)(F)F)C=C1Cl
97%
BD438965
MFCD22581446
2,6-DICHLORO-4-(TRIFLUOROMETHOXY)PYRIDINE
CAS:1361889-82-8
Formula: FC(F)(F)OC1=CC(Cl)=NC(Cl)=C1
95+%
BD271431
MFCD22391937
2,6-DICHLORO-4-(TRIFLUOROMETHYL)ANILINE
CAS:24279-39-8
Formula: C1=C(C=C(C(=C1Cl)N)Cl)C(F)(F)F
98%
BD10261
MFCD00052918
2,6-DICHLORO-4-(TRIFLUOROMETHYL)BENZALDEHYDE
CAS:118754-52-2
Formula: O=CC1=C(Cl)C=C(C(F)(F)F)C=C1Cl
95+%
BD254344
2,6-DICHLORO-4-(TRIFLUOROMETHYL)BENZENE-1-SULFONYL CHLORIDE
CAS:175205-76-2
Formula: FC(F)(F)C1=CC(Cl)=C(C(Cl)=C1)S(Cl)(=O)=O
98%
BD3989
MFCD00220929
2,6-DICHLORO-4-(TRIFLUOROMETHYL)BENZOIC ACID
CAS:189338-32-7
Formula: O=C(O)C1=C(Cl)C=C(C(F)(F)F)C=C1Cl
97%
BD217790
MFCD01934568
2,6-DICHLORO-4-(TRIFLUOROMETHYL)BENZONITRILE
CAS:157021-61-9
Formula: N#CC1=C(Cl)C=C(C(F)(F)F)C=C1Cl
97%
BD5543
MFCD00220879
2,6-DICHLORO-4-(TRIFLUOROMETHYL)NICOTINALDEHYDE
CAS:914636-56-9
Formula: O=CC1=C(Cl)N=C(Cl)C=C1C(F)(F)F
95%
BD238801
MFCD08056286
2,6-DICHLORO-4-(TRIFLUOROMETHYL)NICOTINAMIDE
CAS:158063-67-3
Formula: O=C(N)C1=C(Cl)N=C(Cl)C=C1C(F)(F)F
95%
BD4030
MFCD00173903
2,6-DICHLORO-4-(TRIFLUOROMETHYL)NICOTINIC ACID
CAS:503437-19-2
Formula: O=C(O)C1=C(Cl)N=C(Cl)C=C1C(F)(F)F
95+%
BD68144
MFCD06208180
2,6-DICHLORO-4-(TRIFLUOROMETHYL)NICOTINONITRILE
CAS:13600-42-5
Formula: N#CC1=C(Cl)N=C(Cl)C=C1C(F)(F)F
98%
BD5109
MFCD00084977
2,6-DICHLORO-4-(TRIFLUOROMETHYL)PHENYLBORONIC ACID
CAS:1887240-36-9
Formula: OB(C1=C(Cl)C=C(C(F)(F)F)C=C1Cl)O
95%
BD00836029
2,6-DICHLORO-4-(TRIFLUOROMETHYL)PYRIDIN-3-AMINE
CAS:175277-67-5
Formula: NC1=C(C(F)(F)F)C=C(Cl)N=C1Cl
98%
BD3129
MFCD00173957
2,6-DICHLORO-4-(TRIFLUOROMETHYL)PYRIDINE
CAS:39890-98-7
Formula: C1=C(C=C(Cl)N=C1Cl)C(F)(F)F
98%
BD68120
MFCD00042246
2,6-DICHLORO-4-CYANOBENZOIC ACID
CAS:1258298-05-3
Formula: O=C(O)C1=C(Cl)C=C(C#N)C=C1Cl
97%
BD218174
2,6-DICHLORO-4-CYANOPHENYL BENZOATE
CAS:3861-44-7
Formula: O=C(OC1=C(Cl)C=C(C#N)C=C1Cl)C2=CC=CC=C2
97%
BD625109
2,6-DICHLORO-4-ETHOXYPYRIDINE
CAS:894804-42-3
Formula: CCOC1=CC(Cl)=NC(Cl)=C1
98%
BD241818
2,6-DICHLORO-4-ETHYLNICOTINIC ACID
CAS:62774-91-8
Formula: O=C(O)C1=C(Cl)N=C(Cl)C=C1CC
95+%
BD248728
2,6-DICHLORO-4-ETHYLNICOTINONITRILE
CAS:52338-11-1
Formula: N#CC1=C(Cl)N=C(Cl)C=C1CC
95+%
BD248729
2,6-DICHLORO-4-FLUOROANILINE
CAS:344-19-4
Formula: NC1=C(Cl)C=C(F)C=C1Cl
98%
BD3229
MFCD00142845
2,6-DICHLORO-4-FLUOROBENZALDEHYDE
CAS:1182709-86-9
Formula: FC1=CC(Cl)=C(C=O)C(Cl)=C1
95+%
BD224422
2,6-DICHLORO-4-FLUOROBENZENESULFONYL CHLORIDE
CAS:88972-04-7
Formula: O=S(C1=C(Cl)C=C(F)C=C1Cl)(Cl)=O
95+%
BD324397
MFCD16817657
2,6-DICHLORO-4-FLUOROBENZENETHIOL
CAS:38366-83-5
Formula: SC1=C(Cl)C=C(F)C=C1Cl
97%
BD469112
MFCD16817658
2,6-DICHLORO-4-FLUOROBENZOIC ACID
CAS:232275-55-7
Formula: OC(=O)C1=C(Cl)C=C(F)C=C1Cl
95+%
BD241148
2,6-DICHLORO-4-FLUOROBENZONITRILE
CAS:1473423-59-4
Formula: N#CC1=C(Cl)C=C(F)C=C1Cl
98%
BD481898
MFCD28064264
2,6-DICHLORO-4-FLUOROPHENOL
CAS:392-71-2
Formula: OC1=C(Cl)C=C(F)C=C1Cl
98%
BD9759
MFCD00010675
2,6-DICHLORO-4-HYDROXYBENZALDEHYDE
CAS:60964-09-2
Formula: OC1=CC(Cl)=C(C=O)C(Cl)=C1
95%
BD29217
MFCD06797919
2,6-DICHLORO-4-HYDROXYBENZOIC ACID
CAS:4641-38-7
Formula: O=C(O)C1=C(Cl)C=C(O)C=C1Cl
95+%
BD257894
2,6-DICHLORO-4-HYDROXYMETHYLBENZALDEHYDE
CAS:616195-96-1
Formula: O=CC1=C(Cl)C=C(CO)C=C1Cl
95+%
BD323958
MFCD18904376
2,6-DICHLORO-4-HYDROXYPYRIDINE
CAS:17228-74-9
Formula: ClC1=NC(=CC(=C1)O)Cl
98%
BD18855
MFCD00955619
2,6-DICHLORO-4-IODOANILINE
CAS:697-89-2
Formula: NC1=C(Cl)C=C(I)C=C1Cl
98%
BD68131
MFCD01670182
2,6-DICHLORO-4-IODOBENZAMIDE
CAS:N/A
Formula: O=C(C1C(Cl)=CC(I)=CC=1Cl)N
95%
BD00734971
2,6-DICHLORO-4-IODOBENZOIC ACID
CAS:1258298-01-9
Formula: O=C(O)C1=C(Cl)C=C(I)C=C1Cl
98%
BD289755
MFCD22690836
2,6-DICHLORO-4-IODONICOTINIC ACID
CAS:343781-55-5
Formula: O=C(C1=C(I)C=C(Cl)N=C1Cl)O
97%
BD450111
MFCD16658922
2,6-DICHLORO-4-IODOPHENOL
CAS:34074-22-1
Formula: OC1=C(Cl)C=C(I)C=C1Cl
98%
BD220268
MFCD00466446
2,6-DICHLORO-4-IODOPYRIDINE
CAS:98027-84-0
Formula: ClC1=NC(=CC(=C1)I)Cl
98%
BD60597
MFCD07368400
2,6-DICHLORO-4-ISOPROPYLNICOTINONITRILE
CAS:503843-54-7
Formula: N#CC1=C(Cl)N=C(Cl)C=C1C(C)C
97%
BD625494
2,6-DICHLORO-4-METHOXYANILINE
CAS:6480-66-6
Formula: NC1=C(Cl)C=C(OC)C=C1Cl
95+%
BD262059
MFCD00115065
2,6-DICHLORO-4-METHOXYBENZALDEHYDE
CAS:82772-93-8
Formula: O=CC1=C(Cl)C=C(OC)C=C1Cl
95+%
BD254340
MFCD12024958
2,6-DICHLORO-4-METHOXYBENZONITRILE
CAS:30482-87-2
Formula: N#CC1=C(Cl)C=C(OC)C=C1Cl
95+%
BD284578
MFCD24539384
2,6-DICHLORO-4-METHOXYPYRIDINE
CAS:17228-75-0
Formula: COC1=CC(Cl)=NC(Cl)=C1
98%
BD167625
MFCD00955755
2,6-DICHLORO-4-METHYL-3-NITROPYRIDINE
CAS:60010-03-9
Formula: O=[N+](C1=C(C)C=C(Cl)N=C1Cl)[O-]
98%
BD68133
2,6-DICHLORO-4-METHYLANILINE
CAS:56461-98-4
Formula: NC1=C(Cl)C=C(C)C=C1Cl
98%
BD217791
MFCD00190134
2,6-DICHLORO-4-METHYLBENZALDEHYDE
CAS:116070-31-6
Formula: O=CC1=C(Cl)C=C(C)C=C1Cl
95+%
BD40966
2,6-DICHLORO-4-METHYLBENZOIC ACID
CAS:99520-05-5
Formula: O=C(O)C1=C(Cl)C=C(C)C=C1Cl
97%
BD217792
2,6-DICHLORO-4-METHYLNICOTINALDEHYDE
CAS:91591-70-7
Formula: CC1=CC(Cl)=NC(Cl)=C1C=O
97%
BD220654
2,6-DICHLORO-4-METHYLNICOTINAMIDE
CAS:38841-54-2
Formula: O=C(N)C1=C(Cl)N=C(Cl)C=C1C
96%
BD68135
MFCD00052636
2,6-DICHLORO-4-METHYLNICOTINIC ACID
CAS:62774-90-7
Formula: ClC1=NC(=CC(=C1C(=O)O)C)Cl
97+%
BD68134
MFCD02932724
2,6-DICHLORO-4-METHYLNICOTINONITRILE
CAS:875-35-4
Formula: N#CC1=C(Cl)N=C(Cl)C=C1C
98%
BD7931
MFCD00052633
2,6-DICHLORO-4-METHYLPHENOL
CAS:2432-12-4
Formula: CC1=CC(Cl)=C(O)C(Cl)=C1
96%
BD36855
MFCD00134679
2,6-DICHLORO-4-METHYLPYRIDIN-3-AMINE
CAS:129432-25-3
Formula: NC1=C(C)C=C(Cl)N=C1Cl
98%
BD162487
2,6-DICHLORO-4-METHYLPYRIDINE
CAS:39621-00-6
Formula: CC1=CC(Cl)=NC(Cl)=C1
98%
BD68143
MFCD09264302
2,6-DICHLORO-4-METHYLQUINAZOLINE
CAS:1260798-81-9
Formula: CC1=C2C=C(Cl)C=CC2=NC(Cl)=N1
95+%
BD263954
MFCD13193409
2,6-DICHLORO-4-METHYLQUINOLINE
CAS:90723-71-0
Formula: CC1=CC(Cl)=NC2=CC=C(Cl)C=C12
95+%
BD160572
MFCD01316208
2,6-DICHLORO-4-NITROANILINE
CAS:99-30-9
Formula: NC1=C(Cl)C=C(C=C1Cl)[N+]([O-])=O
96%
BD23355
MFCD00007677
2,6-DICHLORO-4-NITROPHENOL
CAS:618-80-4
Formula: OC1=C(Cl)C=C([N+]([O-])=O)C=C1Cl
98%
BD21818
MFCD00014715
2,6-DICHLORO-4-NITROPYRIDINE
CAS:25194-01-8
Formula: O=[N+](C1=CC(Cl)=NC(Cl)=C1)[O-]
97%
BD60598
MFCD05670545
2,6-DICHLORO-4-PHENYLPYRIDINE
CAS:25297-51-2
Formula: ClC1=CC(C2=CC=CC=C2)=CC(Cl)=N1
95%
BD68142
MFCD09030072
2,6-DICHLORO-4-PHENYLQUINAZOLINE
CAS:5185-54-6
Formula: ClC1=CC2=C(C3=CC=CC=C3)N=C(Cl)N=C2C=C1
95+%
BD183149
MFCD00563519
2,6-DICHLORO-4-PROPYLNICOTINONITRILE
CAS:52338-17-7
Formula: N#CC1=C(Cl)N=C(Cl)C=C1CCC
95+%
BD284510
MFCD23098026
2,6-DICHLORO-4-PYRIMIDINEPROPANOIC ACID
CAS:212650-39-0
Formula: O=C(O)CCC1=NC(Cl)=NC(Cl)=C1
95%
BD239606
MFCD22682800
2,6-DICHLORO-4-TRIFLUOROMETHYLBENZENE SULFONAMIDE
CAS:259683-79-9
Formula: O=S(C1=C(Cl)C=C(C(F)(F)F)C=C1Cl)(N)=O
95+%
BD323546
MFCD00728630
2,6-DICHLORO-5-(TRIFLUOROMETHYL)NICOTINONITRILE
CAS:1319804-30-2
Formula: N#CC1=C(Cl)N=C(Cl)C(C(F)(F)F)=C1
95+%
BD284528
n/a
2,6-DICHLORO-5-CYCLOPROPYLNICOTINONITRILE
CAS:1319804-29-9
Formula: N#CC1=C(Cl)N=C(Cl)C(C2CC2)=C1
95+%
BD284508
MFCD28099456
2,6-DICHLORO-5-ETHYLPYRIMIDIN-4-AMINE
CAS:81316-68-9
Formula: NC1=NC(Cl)=NC(Cl)=C1CC
95+%
BD261233
MFCD11977464
2,6-DICHLORO-5-FLUORO-4-IODONICOTINONITRILE
CAS:905587-20-4
Formula: N#CC1=C(I)C(F)=C(Cl)N=C1Cl
97%
BD00771873
n/a
2,6-DICHLORO-5-FLUORO-4-METHYLNICOTINALDEHYDE
CAS:N/A
Formula: O=CC1C(C)=C(F)C(Cl)=NC=1Cl
95%
BD00731307
2,6-DICHLORO-5-FLUORO-4-METHYLNICOTINAMIDE
CAS:N/A
Formula: O=C(C1C(C)=C(F)C(Cl)=NC=1Cl)N
95%
BD00734562
2,6-DICHLORO-5-FLUORO-4-METHYLNICOTINIC ACID
CAS:132195-42-7
Formula: O=C(O)C1=C(Cl)N=C(Cl)C(F)=C1C
95+%
BD260748
2,6-DICHLORO-5-FLUORO-4-METHYLNICOTINONITRILE
CAS:2168342-60-5
Formula: N#CC1C(C)=C(F)C(Cl)=NC=1Cl
95%
BD00742572
n/a
2,6-DICHLORO-5-FLUORO-N-(PYRIDIN-3-YL)NICOTINAMIDE
CAS:680217-89-4
Formula: O=C(NC1=CC=CN=C1)C2=C(Cl)N=C(Cl)C(F)=C2
97%
BD492955
2,6-DICHLORO-5-FLUORO-N-(THIOPHEN-2-YLMETHYL)NICOTINAMIDE
CAS:680217-82-7
Formula: O=C(NCC1=CC=CS1)C2=C(Cl)N=C(Cl)C(F)=C2
97%
BD492954
2,6-DICHLORO-5-FLUORO-N-ISOPROPYLNICOTINAMIDE
CAS:680217-86-1
Formula: O=C(NC(C)C)C1=C(Cl)N=C(Cl)C(F)=C1
97%
BD11665
2,6-DICHLORO-5-FLUORONICOTINAMIDE
CAS:113237-20-0
Formula: O=C(N)C1=C(Cl)N=C(Cl)C(F)=C1
98%
BD218277
2,6-DICHLORO-5-FLUORONICOTINONITRILE
CAS:82671-02-1
Formula: N#CC1=C(Cl)N=C(Cl)C(F)=C1
98%
BD10040
MFCD01863289
2,6-DICHLORO-5-FLUORONICOTINOYL CHLORIDE
CAS:96568-02-4
Formula: O=C(Cl)C1=C(Cl)N=C(Cl)C(F)=C1
97%
BD68148
MFCD01863240
2,6-DICHLORO-5-FLUOROPYRIDIN-3-AMINE
CAS:152840-65-8
Formula: NC1=CC(F)=C(Cl)N=C1Cl
98%
BD215246
MFCD11044255
2,6-DICHLORO-5-FLUOROPYRIDIN-3-AMINE HYDROCHLORIDE
CAS:1416351-81-9
Formula: NC1=CC(F)=C(Cl)N=C1Cl.[H]Cl
95+%
BD225887
2,6-DICHLORO-5-FLUOROPYRIDINE-3-CARBOXYLIC ACID
CAS:82671-06-5
Formula: O=C(C1=CC(F)=C(Cl)N=C1Cl)O
98%
BD9725
MFCD00799517
2,6-DICHLORO-5-IODONICOTINONITRILE
CAS:1353087-61-2
Formula: N#CC1=C(Cl)N=C(Cl)C(I)=C1
95+%
BD284547
2,6-DICHLORO-5-METHOXYNICOTINONITRILE
CAS:2089381-34-8
Formula: N#CC1=C(Cl)N=C(Cl)C(OC)=C1
97%
BD763924
2,6-DICHLORO-5-METHOXYPYRIMIDINE-4-CARBALDEHYDE
CAS:1446253-05-9
Formula: O=CC1=NC(Cl)=NC(Cl)=C1OC
95%
BD00796733
MFCD28965117
2,6-DICHLORO-5-METHOXYPYRIMIDINE-4-CARBONITRILE
CAS:N/A
Formula: N#CC1=NC(Cl)=NC(Cl)=C1OC
97%
BD00805843
n/a
2,6-DICHLORO-5-METHOXYPYRIMIDINE-4-CARBOXAMIDE
CAS:N/A
Formula: O=C(C1=NC(Cl)=NC(Cl)=C1OC)N
97%
BD00796309
n/a
2,6-DICHLORO-5-METHOXYPYRIMIDINE-4-CARBOXYLIC ACID
CAS:1936241-21-2
Formula: O=C(C1=NC(Cl)=NC(Cl)=C1OC)O
97%
BD443671
MFCD28400799
2,6-DICHLORO-5-METHYL-1H-BENZO[D]IMIDAZOLE
CAS:683240-82-6
Formula: CC1=C(Cl)C=C(NC(Cl)=N2)C2=C1
98%
BD335032
MFCD24566022
2,6-DICHLORO-5-METHYLPYRIDIN-3-AMINE
CAS:58596-89-7
Formula: NC1=CC(C)=C(Cl)N=C1Cl
95+%
BD248730
MFCD20697565
2,6-DICHLORO-5-NITROPYRIMIDIN-4-AMINE
CAS:31221-68-8
Formula: NC1=NC(Cl)=NC(Cl)=C1[N+]([O-])=O
95+%
BD255775
MFCD16657246
2,6-DICHLORO-5-NITROQUINOLINE
CAS:1209246-34-3
Formula: O=[N+](C1=C2C=CC(Cl)=NC2=CC=C1Cl)[O-]
96%
BD158537
MFCD12406121
2,6-DICHLORO-5-PHENYLNICOTINONITRILE
CAS:10177-06-7
Formula: N#CC1=C(Cl)N=C(Cl)C(C2=CC=CC=C2)=C1
95+%
BD284534
MFCD00235086
2,6-DICHLORO-5-PROPYLNICOTINONITRILE
CAS:1299492-97-9
Formula: N#CC1=C(Cl)N=C(Cl)C(CCC)=C1
97%
BD284516
MFCD25957674
2,6-DICHLORO-7-METHYLPURINE
CAS:2273-93-0
Formula: CN1C=NC2=NC(Cl)=NC(Cl)=C12
97%
BD3233
MFCD00039690
2,6-DICHLORO-7-METHYLQUINOXALINE
CAS:39267-03-3
Formula: CC1=C(Cl)C=C2N=CC(Cl)=NC2=C1
95+%
BD269185
2,6-DICHLORO-8,9-DIMETHYL-9H-PURINE
CAS:1474018-06-8
Formula: CN1C(C)=NC2=C(Cl)N=C(Cl)N=C12
97%
BD445951
MFCD28501974
2,6-DICHLORO-8-METHYL-9H-PURINE
CAS:57476-37-6
Formula: CC1=NC2=C(N1)N=C(Cl)N=C2Cl
95+%
BD228222
MFCD17016015
2,6-DICHLORO-9-(TETRAHYDRO-2H-PYRAN-2-YL)-9H-PURINE
CAS:20419-68-5
Formula: ClC1=C2N=CN(C3CCCCO3)C2=NC(Cl)=N1
95+%
BD68151
2,6-DICHLORO-9-ISOPROPYL-8-METHYL-9H-PURINE
CAS:1313026-86-6
Formula: CC(N1C(C)=NC2=C(Cl)N=C(Cl)N=C12)C
95%
BD295243
MFCD18432767
2,6-DICHLORO-9-ISOPROPYL-9H-PURINE
CAS:203436-45-7
Formula: CC(N1C=NC2=C(Cl)N=C(Cl)N=C12)C
97%
BD244442
MFCD11047295
2,6-DICHLORO-9-METHYL-9H-PURINE
CAS:2382-10-7
Formula: CN1C=NC2=C(Cl)N=C(Cl)N=C12
97+%
BD162223
2,6-DICHLORO-ISONICOTINIC ACID ETHYL ESTER
CAS:1604-14-4
Formula: O=C(OCC)C1=CC(Cl)=NC(Cl)=C1
95+%
BD307432
MFCD00235122
2,6-DICHLORO-N,N-DIETHYLANILINE
CAS:67888-72-6
Formula: CCN(CC)C1=C(Cl)C=CC=C1Cl
95+%
BD335021
MFCD16620285
2,6-DICHLORO-N,N-DIETHYLPYRIMIDIN-4-AMINE
CAS:78418-15-2
Formula: CCN(CC)C1=NC(Cl)=NC(Cl)=C1
95+%
BD68192
MFCD09746260
2,6-DICHLORO-N,N-DIMETHYLPYRIDIN-4-AMINE
CAS:175461-34-4
Formula: CN(C)C1=CC(Cl)=NC(Cl)=C1
98%
BD261900
MFCD09031039
2,6-DICHLORO-N,N-DIMETHYLPYRIMIDIN-4-AMINE
CAS:117077-93-7
Formula: CN(C)C1=NC(Cl)=NC(Cl)=C1
95+%
BD252550
MFCD09746252
2,6-DICHLORO-N-((3-CHLORO-5-(TRIFLUOROMETHYL)PYRIDIN-2-YL)METHYL)BENZAMIDE
CAS:239110-15-7
Formula: O=C(NCC1=NC=C(C(F)(F)F)C=C1Cl)C2=C(Cl)C=CC=C2Cl
95+%
BD130514
MFCD09751509
2,6-DICHLORO-N-(1-METHYL-1H-IMIDAZOL-4-YL)PYRIMIDIN-4-AMINE
CAS:1208893-80-4
Formula: CN1C=C(NC2=NC(Cl)=NC(Cl)=C2)N=C1
95+%
BD244306
MFCD20229094
2,6-DICHLORO-N-(2-METHOXYETHYL)PYRIMIDIN-4-AMINE
CAS:879609-73-1
Formula: COCCNC1=NC(Cl)=NC(Cl)=C1
95+%
BD252549
MFCD20228012
2,6-DICHLORO-N-(CYCLOPENTA-1,3-DIEN-1-YL)-N-METHYLPYRIMIDIN-4-AMINE
CAS:1332531-17-5
Formula: CN(C1=CC=CC1)C2=NC(Cl)=NC(Cl)=C2
97%
BD603102
MFCD19982832
2,6-DICHLORO-N-(N,N-DIMETHYLCARBAMIMIDOYL)ISONICOTINAMIDE
CAS:649699-62-7
Formula: O=C(NC(N(C)C)=N)C1=CC(Cl)=NC(Cl)=C1
97%
BD00805175
2,6-DICHLORO-N-(PYRIDIN-4-YL)BENZAMIDE
CAS:113204-35-6
Formula: O=C(NC1=CC=NC=C1)C2=C(Cl)C=CC=C2Cl
95+%
BD289675
MFCD01195760
2,6-DICHLORO-N-ETHYLPYRIMIDIN-4-AMINE
CAS:70958-39-3
Formula: CCNC1=NC(Cl)=NC(Cl)=C1
95+%
BD252551
MFCD11520483
2,6-DICHLORO-N-HYDROXYBENZIMIDOYL CHLORIDE
CAS:6579-27-7
Formula: Cl/C(C1=C(Cl)C=CC=C1Cl)=N\O
97%
BD10264
2,6-DICHLORO-N-ISOBUTYLPYRIMIDIN-4-AMINE
CAS:72063-78-6
Formula: CC(C)CNC1=NC(Cl)=NC(Cl)=C1
95+%
BD252552
MFCD20226414
2,6-DICHLORO-N-ISOPROPYLPYRIMIDIN-4-AMINE
CAS:30297-43-9
Formula: CC(NC1=NC(Cl)=NC(Cl)=C1)C
95+%
BD252553
MFCD11520485
2,6-DICHLORO-N-METHOXY-N-METHYLISONICOTINAMIDE
CAS:848498-98-6
Formula: O=C(N(OC)C)C1=CC(Cl)=NC(Cl)=C1
95+%
BD271327
MFCD11847257
2,6-DICHLORO-N-METHOXY-N-METHYLNICOTINAMIDE
CAS:873936-98-2
Formula: O=C(N(OC)C)C1=C(Cl)N=C(Cl)C=C1
97%
BD449549
MFCD11847422
2,6-DICHLORO-N-METHYL-3-NITROPYRIDIN-4-AMINE
CAS:887147-20-8
Formula: O=[N+](C1=C(NC)C=C(Cl)N=C1Cl)[O-]
97%
BD248731
2,6-DICHLORO-N-METHYL-N-PHENYLPYRIMIDIN-4-AMINE
CAS:91064-29-8
Formula: CN(C1=CC=CC=C1)C2=NC(Cl)=NC(Cl)=C2
95+%
BD252554
MFCD02183492
2,6-DICHLORO-N-METHYLANILINE
CAS:56462-00-1
Formula: CNC1=C(Cl)C=CC=C1Cl
95+%
BD318915
MFCD00028479
2,6-DICHLORO-N-METHYLPYRIDIN-4-AMINE
CAS:175461-33-3
Formula: CNC1=CC(Cl)=NC(Cl)=C1
97+%
BD237935
MFCD12024871
2,6-DICHLORO-N-METHYLPYRIMIDIN-4-AMINE
CAS:32998-03-1
Formula: CNC1=NC(Cl)=NC(Cl)=C1
95+%
BD252555
MFCD11520482
2,6-DICHLORO-N-PHENYLANILINE
CAS:15307-93-4
Formula: ClC1=CC=CC(Cl)=C1NC1=CC=CC=C1
98%
BD68178
MFCD00269648
2,6-DICHLORO-N-PHENYLISONICOTINAMIDE
CAS:287174-84-9
Formula: O=C(C1=CC(Cl)=NC(Cl)=C1)NC2=CC=CC=C2
97%
BD584493
MFCD00125185
2,6-DICHLORO-N-PHENYLPYRIMIDIN-4-AMINE
CAS:28230-47-9
Formula: ClC1=CC(NC2=CC=CC=C2)=NC(Cl)=N1
95+%
BD44008
MFCD09756977
2,6-DICHLORO-N1-((TETRAHYDROFURAN-2-YL)METHYL)BENZENE-1,4-DIAMINE
CAS:1690654-29-5
Formula: NC1=CC(Cl)=C(NCC2OCCC2)C(Cl)=C1
97%
BD618842
2,6-DICHLORO-N1-(2-(DIETHYLAMINO)ETHYL)BENZENE-1,4-DIAMINE
CAS:1708255-07-5
Formula: NC1=CC(Cl)=C(NCCN(CC)CC)C(Cl)=C1
97%
BD622094
2,6-DICHLORO-N1-(2-(DIMETHYLAMINO)ETHYL)BENZENE-1,4-DIAMINE
CAS:1695170-50-3
Formula: NC1=CC(Cl)=C(NCCN(C)C)C(Cl)=C1
97%
BD618871
2,6-DICHLORO-N1-(2-(PYRIDIN-2-YL)ETHYL)BENZENE-1,4-DIAMINE
CAS:1708436-23-0
Formula: NC1=CC(Cl)=C(NCCC2=NC=CC=C2)C(Cl)=C1
97%
BD622503
2,6-DICHLORO-N1-(2-MORPHOLINOETHYL)BENZENE-1,4-DIAMINE
CAS:1707746-83-5
Formula: NC1=CC(Cl)=C(NCCN2CCOCC2)C(Cl)=C1
97%
BD621678
2,6-DICHLORO-N1-(3-(DIMETHYLAMINO)PROPYL)BENZENE-1,4-DIAMINE
CAS:1693685-57-2
Formula: NC1=CC(Cl)=C(NCCCN(C)C)C(Cl)=C1
97%
BD618861
2,6-DICHLORO-N1-(3-ETHOXYPROPYL)BENZENE-1,4-DIAMINE
CAS:1692140-34-3
Formula: NC1=CC(Cl)=C(NCCCOCC)C(Cl)=C1
97%
BD618851
2,6-DICHLORO-N1-(3-METHOXYPROPYL)BENZENE-1,4-DIAMINE
CAS:1695751-20-2
Formula: NC1=CC(Cl)=C(NCCCOC)C(Cl)=C1
97%
BD618877
2,6-DICHLORO-N1-CYCLOPROPYLBENZENE-1,4-DIAMINE
CAS:1697584-78-3
Formula: NC1=CC(Cl)=C(NC2CC2)C(Cl)=C1
97%
BD618889
2,6-DICHLORO-N1-PROPYLBENZENE-1,4-DIAMINE
CAS:1700397-85-8
Formula: NC1=CC(Cl)=C(NCCC)C(Cl)=C1
97%
BD618920
2,6-DICHLORO-N4-METHYLPYRIDINE-3,4-DIAMINE
CAS:914942-86-2
Formula: NC1=C(NC)C=C(Cl)N=C1Cl
95+%
BD250843
MFCD22551530
2,6-DICHLOROBENZALDEHYDE
CAS:83-38-5
Formula: C1=CC=C(C(=C1Cl)C=O)Cl
97%
BD22784
MFCD00003307
2,6-DICHLOROBENZALDEHYDE OXIME
CAS:25185-95-9
Formula: ClC1=C(C(Cl)=CC=C1)/C=N/O
95+%
BD19688
MFCD00013938
2,6-DICHLOROBENZAMIDE
CAS:2008-58-4
Formula: O=C(N)C1=C(Cl)C=CC=C1Cl
95%
BD19210
MFCD00007975
2,6-DICHLOROBENZENE-1,4-DIAMINE
CAS:609-20-1
Formula: NC1=C(Cl)C=C(N)C=C1Cl
97%
BD3464
MFCD00025369
2,6-DICHLOROBENZENE-1,4-DIOL
CAS:20103-10-0
Formula: OC1=C(Cl)C=C(O)C=C1Cl
97%
BD68079
2,6-DICHLOROBENZENESULFONAMIDE
CAS:10290-98-9
Formula: O=S(C1=C(Cl)C=CC=C1Cl)(N)=O
95+%
BD306989
MFCD03093819
2,6-DICHLOROBENZENESULFONYL CHLORIDE
CAS:6579-54-0
Formula: O=S(C1=C(Cl)C=CC=C1Cl)(Cl)=O
98%
BD9761
MFCD00052311
2,6-DICHLOROBENZIMIDAMIDE
CAS:3797-84-0
Formula: N=C(N)C1=C(Cl)C=CC=C1Cl
95+%
BD28555
MFCD05662972
2,6-DICHLOROBENZIMIDAMIDE HYDROCHLORIDE
CAS:3797-81-7
Formula: N=C(N)C1=C(Cl)C=CC=C1Cl.[H]Cl
97%
BD285692
MFCD04114466
2,6-DICHLOROBENZOIC ACID
CAS:50-30-6
Formula: O=C(O)C1=C(Cl)C=CC=C1Cl
98%
BD4158
MFCD00002418
2,6-DICHLOROBENZONITRILE
CAS:1194-65-6
Formula: N#CC1=C(Cl)C=CC=C1Cl
98%
BD4038
MFCD00001781
2,6-DICHLOROBENZOTHIOAMIDE
CAS:1918-13-4
Formula: NC(C1=C(Cl)C=CC=C1Cl)=S
98%
BD68245
MFCD00053523
2,6-DICHLOROBENZOXAZOLE
CAS:3621-82-7
Formula: ClC1=CC=C2N=C(Cl)OC2=C1
98%
BD10172
MFCD07368635
2,6-DICHLOROBENZOYL CHLORIDE
CAS:4659-45-4
Formula: O=C(Cl)C1=C(Cl)C=CC=C1Cl
98%
BD33720
MFCD00000662
2,6-DICHLOROBENZYL 1-(2,6-DICHLOROBENZYL)AZETIDINE-3-CARBOXYLATE
CAS:1353959-32-6
Formula: O=C(C1CN(CC2=C(Cl)C=CC=C2Cl)C1)OCC3=C(Cl)C=CC=C3Cl
95+%
BD288196
MFCD21098447
2,6-DICHLOROBENZYL BROMIDE
CAS:20443-98-5
Formula: ClC1=C(C(Cl)=CC=C1)CBr
98%
BD32581
MFCD00000577
2,6-DICHLOROBENZYL CHLORIDE
CAS:2014-83-7
Formula: ClCC1=C(Cl)C=CC=C1Cl
98%
BD68170
MFCD00000897
2,6-DICHLOROFLUOROBENZENE
CAS:2268-05-5
Formula: C1=CC=C(C(=C1Cl)F)Cl
98%
BD68179
MFCD00010307
2,6-DICHLOROIMIDAZO[1,2-A]PYRIDINE
CAS:112581-60-9
Formula: ClC1=CN2C(C=C1)=NC(Cl)=C2
97%
BD68180
MFCD08236842
2,6-DICHLOROIMIDAZO[1,2-B]PYRIDAZINE
CAS:112581-77-8
Formula: ClC1=C[N]2C(=N1)C=CC(=N2)Cl
95%
BD68181
MFCD11044765
2,6-DICHLOROIMIDAZO[2,1-B]THIAZOLE
CAS:135718-53-5
Formula: ClC1=CN2C(SC(Cl)=C2)=N1
95+%
BD258469
MFCD09878678
2,6-DICHLOROISONICOTINALDEHYDE
CAS:113293-70-2
Formula: ClC1=CC(C=O)=CC(Cl)=N1
98%
BD17601
MFCD00124816
2,6-DICHLOROISONICOTINAMIDE
CAS:89281-13-0
Formula: O=C(N)C1=CC(Cl)=NC(Cl)=C1
95+%
BD68184
MFCD00052640
2,6-DICHLOROISONICOTINIC ACID
CAS:5398-44-7
Formula: O=C(O)C1=CC(Cl)=NC(Cl)=C1
97+%
BD3139
MFCD00234147
2,6-DICHLOROISONICOTINIMIDAMIDE HYDROCHLORIDE
CAS:175204-59-8
Formula: N=C(N)C1=CC(Cl)=NC(Cl)=C1.[H]Cl
95%
BD68236
2,6-DICHLOROISONICOTINOHYDRAZIDE
CAS:57803-51-7
Formula: O=C(NN)C1=CC(Cl)=NC(Cl)=C1
97%
BD68186
2,6-DICHLOROISONICOTINONITRILE
CAS:32710-65-9
Formula: ClC1=CC(=CC(Cl)=N1)C#N
98%
BD3081
MFCD00173784
2,6-DICHLOROISONICOTINOYL CHLORIDE
CAS:42521-08-4
Formula: O=C(Cl)C1=CC(Cl)=NC(Cl)=C1
95+%
BD33660
MFCD00052639
2,6-DICHLORONAPHTHALENE
CAS:2065-70-5
Formula: ClC1=CC2=C(C=C1)C=C(Cl)C=C2
95+%
BD68193
MFCD01861450
2,6-DICHLORONICOTINAMIDE
CAS:62068-78-4
Formula: NC(=O)C1=CC=C(Cl)N=C1Cl
97%
BD238698
MFCD03230010
2,6-DICHLORONICOTINIC ACID
CAS:38496-18-3
Formula: O=C(O)C1=C(Cl)N=C(Cl)C=C1
98%
BD7932
MFCD00075583
2,6-DICHLOROPHENETHYL ALCOHOL
CAS:30595-79-0
Formula: ClC1=C(C(Cl)=CC=C1)CCO
98%
BD68201
MFCD00800674
2,6-DICHLOROPHENOLINDOPHENOL SODIUM SALT HYDRATE
CAS:620-45-1
Formula: O=C1C(Cl)=C/C(C=C1Cl)=N/C2=CC=C(C=C2)[O-].[Na+]
95%
BD68207
MFCD00150014
2,6-DICHLOROPHENYLACETIC ACID
CAS:6575-24-2
Formula: O=C(O)CC1=C(Cl)C=CC=C1Cl
98%
BD5855
MFCD00004320
2,6-DICHLOROPHENYLHYDRAZINE HYDROCHLORIDE
CAS:50709-36-9
Formula: [H+].C1=CC=C(C(=C1Cl)NN)Cl.[Cl-]
98%
BD3467
MFCD00012930
2,6-DICHLOROPHENYLSULFONYLETHANOL
CAS:688763-07-7
Formula: OCCS(=O)(C1=C(Cl)C=CC=C1Cl)=O
95+%
BD324064
MFCD03789221
2,6-DICHLOROPIPERIDINE-3-CARBOXYLIC ACID
CAS:1936188-08-7
Formula: O=C(C1C(Cl)NC(Cl)CC1)O
97%
BD438807
MFCD28404871
2,6-DICHLOROPURINE
CAS:5451-40-1
Formula: C2=NC1=C(C(=NC(=N1)Cl)Cl)[NH]2
98%
BD7935
MFCD07357405
2,6-DICHLOROPYRAZINE
CAS:4774-14-5
Formula: ClC1=CN=CC(Cl)=N1
98%
BD9379
MFCD00006125
2,6-DICHLOROPYRIDIN-3-OL
CAS:52764-11-1
Formula: OC1=CC=C(Cl)N=C1Cl
98%
BD245445
MFCD11044319
2,6-DICHLOROPYRIDIN-3-YLBORONIC ACID
CAS:148493-34-9
Formula: C1=C(N=C(C(=C1)B(O)O)Cl)Cl
97%
BD2578
MFCD03094989
2,6-DICHLOROPYRIDIN-4(1H)-ONE
CAS:253435-44-8
Formula: O=C1C=C(Cl)NC(Cl)=C1
95+%
BD260607
2,6-DICHLOROPYRIDIN-4-AMINE
CAS:2587-02-2
Formula: ClC1=CC(N)=CC(Cl)=N1
98%
BD2591
MFCD00052832
2,6-DICHLOROPYRIDINE
CAS:2402-78-0
Formula: ClC1=CC=CC(Cl)=N1
98%
BD32816
MFCD00006244
2,6-DICHLOROPYRIDINE-3,4-DIAMINE
CAS:101079-63-4
Formula: NC1=C(N)C=C(Cl)N=C1Cl
98%
BD158733
MFCD10697689
2,6-DICHLOROPYRIDINE-3,4-DICARBOXYLIC ACID
CAS:1935433-61-6
Formula: O=C(C1=C(C(O)=O)C=C(Cl)N=C1Cl)O
97%
BD445498
MFCD29035248
2,6-DICHLOROPYRIDINE-3,5-DICARBALDEHYDE
CAS:81319-42-8
Formula: ClC1=NC(Cl)=C(C=O)C=C1C=O
95+%
BD237833
2,6-DICHLOROPYRIDINE-3,5-DICARBONITRILE
CAS:151229-84-4
Formula: N#CC1=CC(C#N)=C(Cl)N=C1Cl
95+%
BD248732
MFCD03272798
2,6-DICHLOROPYRIDINE-3,5-DICARBOXYLIC ACID
CAS:58584-82-0
Formula: O=C(C1=CC(C(O)=O)=C(Cl)N=C1Cl)O
95+%
BD280162
MFCD00834966
2,6-DICHLOROPYRIDINE-3-CARBONITRILE
CAS:40381-90-6
Formula: ClC1=NC(=CC=C1C#N)Cl
97%
BD33592
MFCD03411341
2,6-DICHLOROPYRIDINE-3-SULFONAMIDE
CAS:1078627-77-6
Formula: O=S(C1=CC=C(Cl)N=C1Cl)(N)=O
97%
BD505248
MFCD15142801
2,6-DICHLOROPYRIDINE-3-SULFONYL CHLORIDE
CAS:239810-43-6
Formula: O=S(C1=CC=C(Cl)N=C1Cl)(Cl)=O
97%
BD25045
MFCD06739118
2,6-DICHLOROPYRIDINE-4-CARBOTHIOAMIDE
CAS:175204-46-3
Formula: S=C(C1=CC(Cl)=NC(Cl)=C1)N
97%
BD68234
2,6-DICHLOROPYRIDINE-4-METHANOL
CAS:101990-69-6
Formula: ClC1=NC(=CC(=C1)CO)Cl
97%
BD215430
MFCD00052638
2,6-DICHLOROPYRIDINE-4-METHYLAMINE
CAS:88579-63-9
Formula: NCC1=CC(Cl)=NC(Cl)=C1
95+%
BD68237
MFCD06212867
2,6-DICHLOROPYRIDINE-4-SULFONYL CHLORIDE
CAS:N/A
Formula: O=S(=O)(Cl)C1C=C(Cl)N=C(Cl)C=1
95%
BD00745762
2,6-DICHLOROPYRIDINE-4-THIOL
CAS:33256-13-2
Formula: SC1=CC(Cl)=NC(Cl)=C1
95+%
BD248733
2,6-DICHLOROPYRIDO[2,3-B]PYRAZINE
CAS:N/A
Formula: ClC1N=C2N=CC(=NC2=CC=1)Cl
95%
BD00760443
2,6-DICHLOROPYRIMIDINE-4,5-DIAMINE
CAS:130838-36-7
Formula: NC1=NC(Cl)=NC(Cl)=C1N
95+%
BD292261
2,6-DICHLOROPYRIMIDINE-4-CARBONITRILE
CAS:26293-93-6
Formula: N#CC1=NC(Cl)=NC(Cl)=C1
98%
BD161617
MFCD16988336
2,6-DICHLOROPYRIMIDINE-4-CARBONYL CHLORIDE
CAS:26830-94-4
Formula: O=C(Cl)C1=NC(Cl)=NC(Cl)=C1
95+%
BD68238
MFCD08444236
2,6-DICHLOROPYRIMIDINE-4-CARBOXAMIDE
CAS:98136-42-6
Formula: O=C(C1=NC(Cl)=NC(Cl)=C1)N
96%
BD219997
MFCD09881209
2,6-DICHLOROPYRIMIDINE-4-CARBOXYLIC ACID
CAS:16492-28-7
Formula: OC(=O)C1=CC(Cl)=NC(Cl)=N1
97%
BD212733
MFCD02933142
2,6-DICHLOROQUINAZOLIN-4(3H)-ONE
CAS:20197-87-9
Formula: O=C1NC(Cl)=NC2=C1C=C(Cl)C=C2
95+%
BD162023
2,6-DICHLOROQUINAZOLIN-4-AMINE
CAS:N/A
Formula: NC1N=C(Cl)N=C2C=1C=C(C=C2)Cl
95%
BD00751823
n/a
2,6-DICHLOROQUINAZOLINE
CAS:67092-18-6
Formula: ClC1=CC2=CN=C(Cl)N=C2C=C1
97%
BD263123
MFCD15527159
2,6-DICHLOROQUINOLIN-5-AMINE
CAS:607380-28-9
Formula: ClC2=NC1=C(C(=C(C=C1)Cl)N)C=C2
95+%
BD68239
MFCD09835367
2,6-DICHLOROQUINOLINE
CAS:1810-72-6
Formula: ClC1=CC=C2N=C(Cl)C=CC2=C1
97%
BD68240
MFCD03427194
2,6-DICHLOROQUINOLINE-3-CARBALDEHYDE
CAS:73568-41-9
Formula: O=CC1=CC2=CC(Cl)=CC=C2N=C1Cl
95+%
BD68241
MFCD06202347
2,6-DICHLOROQUINOLINE-3-CARBOXYLIC ACID
CAS:1017378-98-1
Formula: O=C(C1=CC2=CC(Cl)=CC=C2N=C1Cl)O
97%
BD605477
2,6-DICHLOROQUINONE-4-CHLOROIMIDE
CAS:101-38-2
Formula: Cl/N=C(C=C1Cl)/C=C(Cl)C1=O
95%
BD3083
MFCD00001611
2,6-DICHLOROQUINOXALINE
CAS:18671-97-1
Formula: ClC1=CC=C2N=C(Cl)C=NC2=C1
98%
BD10821
MFCD00839695
2,6-DICHLOROTEREPHTHALIC ACID
CAS:116802-97-2
Formula: O=C(O)C1=C(Cl)C=C(C(O)=O)C=C1Cl
97%
BD600013
n/a
2,6-DICHLOROTHIENO[3,2-C]PYRIDINE
CAS:N/A
Formula: ClC1=CC2=C(C=C(Cl)S2)C=N1
96%
BD00768985
n/a
2,6-DICYANO-1-FLUOROPYRIDIN-1-IUM TRIFLUOROMETHANESULFONATE
CAS:135182-99-9
Formula: F[N+]1=C(C#N)C=CC=C1C#N.O=S(C(F)(F)F)([O-])=O
95+%
BD270069
2,6-DIETHOXYANILINE
CAS:91251-96-6
Formula: NC1=C(OCC)C=CC=C1OCC
97%
BD00812502
n/a
2,6-DIETHOXYBENZOIC ACID
CAS:82935-36-2
Formula: O=C(O)C1=C(OCC)C=CC=C1OCC
95+%
BD398757
MFCD00156982
2,6-DIETHOXYISONICOTINIC ACID
CAS:5397-75-1
Formula: O=C(O)C1=CC(OCC)=NC(OCC)=C1
95+%
BD269652
2,6-DIETHOXYPYRAZINE
CAS:33870-85-8
Formula: CCOC1=CN=CC(OCC)=N1
95+%
BD264821
MFCD15144517
2,6-DIETHOXYPYRIDIN-4-AMINE
CAS:183296-01-7
Formula: NC1=CC(OCC)=NC(OCC)=C1
95+%
BD252556
MFCD20257885
2,6-DIETHYL-2,6-DIHYDRO-7H-PYRAZOLO[3,4-D]PYRIDAZIN-7-ONE
CAS:1823934-76-4
Formula: O=C1C2=NN(CC)C=C2C=NN1CC
97%
BD00813823
2,6-DIETHYL-3-NITROANILINE
CAS:103392-86-5
Formula: NC1=C(CC)C=CC([N+]([O-])=O)=C1CC
95+%
BD284797
MFCD24539377
2,6-DIETHYL-4-METHYLANILINE
CAS:24544-08-9
Formula: CCC1=CC(C)=CC(CC)=C1N
98%
BD19627
MFCD00035950
2,6-DIETHYL-5-THIOXO-5,6-DIHYDRO-2H-PYRAZOLO[4,3-D]PYRIMIDIN-7(4H)-ONE
CAS:828299-89-4
Formula: O=C(N1CC)C2=NN(CC)C=C2NC1=S
97%
BD549739
2,6-DIETHYLANILINE
CAS:579-66-8
Formula: NC1=C(CC)C=CC=C1CC
98%
BD68252
MFCD00007753
2,6-DIETHYLANILINE HYDROCHLORIDE
CAS:71477-82-2
Formula: NC1=C(CC)C=CC=C1CC.[H]Cl
95+%
BD324107
MFCD19982483
2,6-DIETHYLBENZOIC ACID
CAS:78114-07-5
Formula: O=C(O)C1=C(CC)C=CC=C1CC
97%
BD597489
MFCD09260802
2,6-DIETHYLISONICOTINONITRILE
CAS:37581-44-5
Formula: N#CC1=CC(CC)=NC(CC)=C1
95+%
BD271102
2,6-DIETHYLMORPHOLINE
CAS:52382-34-0
Formula: CCC1OC(CC)CNC1
97%
BD00790444
2,6-DIETHYLPHENOL
CAS:1006-59-3
Formula: OC1=C(CC)C=CC=C1CC
98%
BD68254
MFCD01707589
2,6-DIETHYLPYRAZINE
CAS:13067-27-1
Formula: CCC1=CN=CC(CC)=N1
97%
BD00805205
2,6-DIETHYLPYRIDIN-4-OL
CAS:1115035-61-4
Formula: OC1=CC(CC)=NC(CC)=C1
95+%
BD248734
MFCD17011769
2,6-DIETHYLPYRIDINE
CAS:935-28-4
Formula: CCC1=CC=CC(CC)=N1
95+%
BD167692
MFCD00049215
2,6-DIFLUORO-3,5-BIS(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PYRIDINE
CAS:1218789-90-2
Formula: CC1(C)C(C)(C)OB(C2=C(F)N=C(F)C(B3OC(C)(C)C(C)(C)O3)=C2)O1
96%
BD230282
2,6-DIFLUORO-3,5-DIIODOPYRIDINE
CAS:685517-77-5
Formula: IC1=C(F)N=C(F)C(I)=C1
95+%
BD336475
MFCD12756678
2,6-DIFLUORO-3,5-DIMETHOXYANILINE
CAS:651734-54-2
Formula: NC1=C(F)C(OC)=CC(OC)=C1F
97%
BD304761
MFCD12973804
2,6-DIFLUORO-3,5-DIMETHOXYBENZALDEHYDE
CAS:1890954-24-1
Formula: O=CC1=C(F)C(OC)=CC(OC)=C1F
97%
BD436858
MFCD29058863
2,6-DIFLUORO-3,5-DIMETHOXYBENZOIC ACID
CAS:651734-56-4
Formula: O=C(O)C1=C(F)C(OC)=CC(OC)=C1F
95+%
BD334934
MFCD24448610
2,6-DIFLUORO-3-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PYRIDINE
CAS:1072945-00-6
Formula: CC1(C)OB(OC1(C)C)C1=CC=C(F)N=C1F
97%
BD236007
MFCD09037475
2,6-DIFLUORO-3-(METHOXYMETHOXY)BENZAMIDE
CAS:1384476-82-7
Formula: O=C(N)C1=C(F)C=CC(OCOC)=C1F
97%
BD448364
MFCD24645484
2,6-DIFLUORO-3-(METHOXYMETHOXY)BENZOIC ACID
CAS:1190603-51-0
Formula: O=C(O)C1=C(F)C=CC(OCOC)=C1F
95+%
BD316838
n/a
2,6-DIFLUORO-3-(PROPYLSULFONAMIDO)BENZOIC ACID
CAS:1103234-56-5
Formula: O=C(O)C1=C(F)C=CC(NS(=O)(CCC)=O)=C1F
97%
BD226199
MFCD18157658
2,6-DIFLUORO-3-(PROPYLSULFONYL)BENZOIC ACID
CAS:1152501-92-2
Formula: O=C(O)C1=C(F)C=CC(S(=O)(CCC)=O)=C1F
95+%
BD247206
MFCD11103057
2,6-DIFLUORO-3-(PYRIDIN-2-YL)BENZONITRILE
CAS:883106-18-1
Formula: N#CC1=C(F)C=CC(C2=NC=CC=C2)=C1F
95+%
BD251552
2,6-DIFLUORO-3-(TRIFLUOROMETHYL)BENZALDEHYDE
CAS:134099-24-4
Formula: O=CC1=C(F)C=CC(C(F)(F)F)=C1F
97%
BD00792982
2,6-DIFLUORO-3-(TRIFLUOROMETHYL)BENZOIC ACID
CAS:1048921-49-8
Formula: O=C(O)C1=C(F)C=CC(C(F)(F)F)=C1F
98%
BD284847
MFCD03412249
2,6-DIFLUORO-3-(TRIFLUOROMETHYL)BENZONITRILE
CAS:1806333-92-5
Formula: N#CC1=C(F)C=CC(C(F)(F)F)=C1F
97%
BD453349
MFCD27937181
2,6-DIFLUORO-3-(TRIFLUOROMETHYL)BENZYL ALCOHOL
CAS:1800231-22-4
Formula: FC(C1=C(F)C(CO)=C(F)C=C1)(F)F
97%
BD00760535
2,6-DIFLUORO-3-(TRIFLUOROMETHYL)PHENACYL BROMIDE
CAS:1823271-81-3
Formula: O=C(C1=C(F)C=CC(C(F)(F)F)=C1F)CBr
97%
BD00769008
2,6-DIFLUORO-3-CYANOPYRIDINE
CAS:869557-17-5
Formula: N#CC1=CC=C(F)N=C1F
95+%
BD212633
2,6-DIFLUORO-3-ETHOXYPHENYLBORONIC ACID
CAS:849062-00-6
Formula: OB(C1=C(F)C=CC(OCC)=C1F)O
98%
BD68258
MFCD07369735
2,6-DIFLUORO-3-HYDROXYBENZALDEHYDE
CAS:152434-88-3
Formula: O=CC1=C(F)C=CC(O)=C1F
95%
BD217796
MFCD08275284
2,6-DIFLUORO-3-HYDROXYBENZAMIDE
CAS:951122-37-5
Formula: O=C(N)C1=C(F)C=CC(O)=C1F
95+%
BD286829
2,6-DIFLUORO-3-HYDROXYBENZONITRILE
CAS:946796-26-5
Formula: N#CC1=C(F)C=CC(O)=C1F
95+%
BD256725
2,6-DIFLUORO-3-IODOBENZALDEHYDE
CAS:1160573-18-1
Formula: O=CC1=C(F)C=CC(I)=C1F
97%
BD487844
MFCD11845973
2,6-DIFLUORO-3-IODOBENZOIC ACID
CAS:229178-74-9
Formula: O=C(O)C1=C(F)C=CC(I)=C1F
98%
BD68259
2,6-DIFLUORO-3-IODOBENZONITRILE
CAS:1447606-20-3
Formula: N#CC1=C(F)C=CC(I)=C1F
97%
BD439845
MFCD25542085
2,6-DIFLUORO-3-IODOPYRIDINE
CAS:685517-67-3
Formula: IC1=CC=C(F)N=C1F
95+%
BD217997
2,6-DIFLUORO-3-METHOXYANILINE
CAS:144851-62-7
Formula: NC1=C(F)C=CC(OC)=C1F
95+%
BD229240
2,6-DIFLUORO-3-METHOXYBENZALDEHYDE
CAS:149949-30-4
Formula: O=CC1=C(F)C=CC(OC)=C1F
97%
BD68260
MFCD04115899
2,6-DIFLUORO-3-METHOXYBENZAMIDE
CAS:886498-26-6
Formula: O=C(N)C1=C(F)C=CC(OC)=C1F
95+%
BD319671
MFCD04115900
2,6-DIFLUORO-3-METHOXYBENZOIC ACID
CAS:886498-30-2
Formula: O=C(O)C1=C(F)C=CC(OC)=C1F
98%
BD257999
MFCD04115901
2,6-DIFLUORO-3-METHOXYBENZONITRILE
CAS:886498-35-7
Formula: N#CC1=C(F)C=CC(OC)=C1F
95+%
BD309520
MFCD04115902
2,6-DIFLUORO-3-METHOXYBENZOYL CHLORIDE
CAS:886498-40-4
Formula: O=C(Cl)C1=C(F)C=CC(OC)=C1F
95+%
BD319672
MFCD04115903
2,6-DIFLUORO-3-METHOXYBENZYL BROMIDE
CAS:886498-55-1
Formula: COC1=C(F)C(CBr)=C(F)C=C1
95+%
BD309521
MFCD04115906
2,6-DIFLUORO-3-METHOXYPHENOL
CAS:886498-60-8
Formula: OC1=C(F)C=CC(OC)=C1F
95+%
BD257973
MFCD04115907
2,6-DIFLUORO-3-METHOXYPHENYLACETIC ACID
CAS:886498-65-3
Formula: O=C(O)CC1=C(F)C=CC(OC)=C1F
95+%
BD309522
MFCD04115908
2,6-DIFLUORO-3-METHOXYPHENYLBORONIC ACID
CAS:870779-02-5
Formula: OB(C1=C(F)C=CC(OC)=C1F)O
98%
BD68261
MFCD06657880
2,6-DIFLUORO-3-METHYLANILINE
CAS:144851-63-8
Formula: NC1=C(F)C=CC(C)=C1F
95+%
BD286773
2,6-DIFLUORO-3-METHYLBENZALDEHYDE
CAS:261763-34-2
Formula: O=CC1=C(F)C=CC(C)=C1F
95+%
BD182322
MFCD01631333
2,6-DIFLUORO-3-METHYLBENZAMIDE
CAS:261763-36-4
Formula: O=C(N)C1=C(F)C=CC(C)=C1F
97%
BD182877
2,6-DIFLUORO-3-METHYLBENZOIC ACID
CAS:32890-88-3
Formula: O=C(O)C1=C(F)C=CC(C)=C1F
98+%
BD68263
MFCD01631332
2,6-DIFLUORO-3-METHYLBENZONITRILE
CAS:886502-09-6
Formula: N#CC1=C(F)C=CC(C)=C1F
97%
BD220370
MFCD06660181
2,6-DIFLUORO-3-METHYLBENZOYL CHLORIDE
CAS:261763-39-7
Formula: O=C(Cl)C1=C(F)C=CC(C)=C1F
95+%
BD68264
MFCD01631334
2,6-DIFLUORO-3-METHYLPHENOL
CAS:261763-46-6
Formula: OC1=C(F)C=CC(C)=C1F
98%
BD182879
MFCD01631340
2,6-DIFLUORO-3-METHYLPHENYLBORONIC ACID
CAS:1586045-40-0
Formula: OB(C1=C(F)C=CC(C)=C1F)O
98%
BD326773
MFCD09265479
2,6-DIFLUORO-3-NITROANILINE
CAS:25892-09-5
Formula: NC1=C(F)C=CC([N+]([O-])=O)=C1F
97%
BD217283
2,6-DIFLUORO-3-NITROBENZALDEHYDE
CAS:606966-11-4
Formula: O=CC1=C(F)C=CC([N+]([O-])=O)=C1F
97%
BD166341
2,6-DIFLUORO-3-NITROBENZAMIDE
CAS:124169-54-6
Formula: O=C(N)C1=C(F)C=CC([N+]([O-])=O)=C1F
97%
BD479089
MFCD00120281
2,6-DIFLUORO-3-NITROBENZOIC ACID
CAS:83141-10-0
Formula: O=C(O)C1=C(F)C=CC([N+]([O-])=O)=C1F
96%
BD68267
MFCD00119291
2,6-DIFLUORO-3-NITROBENZONITRILE
CAS:143879-77-0
Formula: N#CC1=C(F)C=CC([N+]([O-])=O)=C1F
98%
BD3999
MFCD00042254
2,6-DIFLUORO-3-NITROBENZOYL CHLORIDE
CAS:260552-98-5
Formula: O=C(Cl)C1=C(F)C=CC([N+]([O-])=O)=C1F
95+%
BD307750
MFCD01571122
2,6-DIFLUORO-3-NITROPHENOL
CAS:1393179-72-0
Formula: OC1=C(F)C=CC([N+]([O-])=O)=C1F
95%
BD00778587
2,6-DIFLUORO-3-NITROPYRIDIN-4-AMINE
CAS:60186-20-1
Formula: NC1=C([N+]([O-])=O)C(F)=NC(F)=C1
95+%
BD248735
MFCD19690092
2,6-DIFLUORO-3-NITROPYRIDINE
CAS:58602-02-1
Formula: O=[N+](C1=CC=C(F)N=C1F)[O-]
97%
BD230298
2,6-DIFLUORO-3-PENTAFLUOROETHYL-PYRIDINE
CAS:1204234-54-7
Formula: FC(C1=CC=C(F)N=C1F)(F)C(F)(F)F
95+%
BD322642
MFCD23382209
2,6-DIFLUORO-3-TRIFLUOROMETHYLPYRIDINE
CAS:58584-98-8
Formula: FC(C1=CC=C(F)N=C1F)(F)F
95+%
BD308412
MFCD12546949
2,6-DIFLUORO-4-(1H-PYRAZOL-3-YL)PHENOL
CAS:1803574-06-2
Formula: OC1=C(F)C=C(C2=NNC=C2)C=C1F
97%
BD437084
MFCD29058992
2,6-DIFLUORO-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)ANILINE
CAS:939968-08-8
Formula: NC1=C(F)C=C(B2OC(C)(C)C(C)(C)O2)C=C1F
95+%
BD336798
MFCD16996398
2,6-DIFLUORO-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)BENZALDEHYDE
CAS:N/A
Formula: O=CC1=C(F)C=C(B2OC(C)(C)C(C)(C)O2)C=C1F
97%
BD466672
MFCD17215216
2,6-DIFLUORO-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)BENZOIC ACID
CAS:1008119-07-0
Formula: CC1(C)OB(OC1(C)C)C1=CC(F)=C(C(O)=O)C(F)=C1
98%
BD217800
MFCD16996277
2,6-DIFLUORO-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)BENZONITRILE
CAS:1003298-73-4
Formula: N#CC1=C(F)C=C(B2OC(C)(C)C(C)(C)O2)C=C1F
97%
BD245280
MFCD22419275
2,6-DIFLUORO-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PHENOL
CAS:1029439-83-5
Formula: OC1=C(F)C=C(B2OC(C)(C)C(C)(C)O2)C=C1F
97%
BD490933
MFCD16996286
2,6-DIFLUORO-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PYRIDINE
CAS:1204333-58-3
Formula: CC1(C)C(C)(C)OB(C2=CC(F)=NC(F)=C2)O1
98%
BD232565
MFCD12913987
2,6-DIFLUORO-4-(METHYLSULFONYL)ANILINE
CAS:1147557-74-1
Formula: NC1=C(F)C=C(S(=O)(C)=O)C=C1F
95+%
BD337776
MFCD24642337
2,6-DIFLUORO-4-(TRIFLUOROMETHYL)ANILINE
CAS:123950-45-8
Formula: NC1=C(F)C=C(C(F)(F)F)C=C1F
95%
BD469852
MFCD20545747
2,6-DIFLUORO-4-(TRIFLUOROMETHYL)BENZALDEHYDE
CAS:134099-34-6
Formula: O=CC1=C(F)C=C(C(F)(F)F)C=C1F
95+%
BD294597
2,6-DIFLUORO-4-(TRIFLUOROMETHYL)BENZOIC ACID
CAS:1309597-24-7
Formula: O=C(O)C1=C(F)C=C(C(F)(F)F)C=C1F
97%
BD00794791
2,6-DIFLUORO-4-(TRIFLUOROMETHYL)BENZONITRILE
CAS:1803828-56-9
Formula: N#CC1=C(F)C=C(C(F)(F)F)C=C1F
97%
BD00812187
2,6-DIFLUORO-4-(TRIFLUOROMETHYL)BENZYL ALCOHOL
CAS:1803570-73-1
Formula: FC(C1=CC(F)=C(C(F)=C1)CO)(F)F
97%
BD00795083
2,6-DIFLUORO-4-(TRIFLUOROMETHYL)BENZYL BROMIDE
CAS:493038-91-8
Formula: FC(C1=CC(F)=C(C(F)=C1)CBr)(F)F
97%
BD00784448
2,6-DIFLUORO-4-(TRIFLUOROMETHYL)PHENOL
CAS:276244-25-8
Formula: OC1=C(F)C=C(C(F)(F)F)C=C1F
97%
BD00785681
2,6-DIFLUORO-4-FORMYLBENZOIC ACID
CAS:1242070-98-9
Formula: O=C(O)C1=C(F)C=C(C=O)C=C1F
95+%
BD217558
2,6-DIFLUORO-4-FORMYLBENZONITRILE
CAS:433939-88-9
Formula: FC1=C(C#N)C(=CC(=C1)C=O)F
98%
BD96570
MFCD09263470
2,6-DIFLUORO-4-HYDRAZINYLPYRIDINE
CAS:837364-94-0
Formula: NNC1=CC(F)=NC(F)=C1
97%
BD295482
MFCD08436095
2,6-DIFLUORO-4-HYDROXYBENZALDEHYDE
CAS:532967-21-8
Formula: O=CC1=C(F)C=C(O)C=C1F
98%
BD161921
MFCD07772042
2,6-DIFLUORO-4-HYDROXYBENZAMIDE
CAS:1261825-32-4
Formula: O=C(N)C1=C(F)C=C(O)C=C1F
97%
BD264625
MFCD18204748
2,6-DIFLUORO-4-HYDROXYBENZOHYDRAZIDE
CAS:1314928-16-9
Formula: O=C(NN)C1=C(F)C=C(O)C=C1F
95+%
BD264626
MFCD18204749
2,6-DIFLUORO-4-HYDROXYBENZOIC ACID
CAS:214917-68-7
Formula: O=C(O)C1=C(F)C=C(O)C=C1F
95%
BD10287
MFCD03094500
2,6-DIFLUORO-4-HYDROXYBENZONITRILE
CAS:123843-57-2
Formula: OC1=CC(F)=C(C#N)C(F)=C1
98%
BD10203
MFCD03094499
2,6-DIFLUORO-4-HYDROXYBENZYL ALCOHOL
CAS:438049-36-6
Formula: FC1=C(CO)C(=CC(=C1)O)F
95%
BD209379
MFCD11040173
2,6-DIFLUORO-4-IODOANILINE
CAS:141743-49-9
Formula: NC1=C(F)C=C(I)C=C1F
97%
BD68272
MFCD07774189
2,6-DIFLUORO-4-IODOBENZALDEHYDE
CAS:1160573-10-3
Formula: O=CC1=C(F)C=C(I)C=C1F
97%
BD297276
MFCD11845966
2,6-DIFLUORO-4-IODOBENZOIC ACID
CAS:1160575-07-4
Formula: O=C(O)C1=C(F)C=C(I)C=C1F
95+%
BD294598
2,6-DIFLUORO-4-IODOPHENOL
CAS:950858-06-7
Formula: OC1=C(F)C=C(I)C=C1F
95+%
BD313967
MFCD09907951
2,6-DIFLUORO-4-IODOPYRIDINE
CAS:685517-71-9
Formula: IC1=CC(F)=NC(F)=C1
97%
BD222957
n/a
2,6-DIFLUORO-4-METHOXYANILINE
CAS:151414-47-0
Formula: FC1=C(N)C(=CC(=C1)OC)F
98%
BD159691
MFCD04115922
2,6-DIFLUORO-4-METHOXYBENZALDEHYDE
CAS:256417-10-4
Formula: O=CC1=C(F)C=C(OC)C=C1F
98%
BD5921
MFCD04114368
2,6-DIFLUORO-4-METHOXYBENZAMIDE
CAS:125369-57-5
Formula: O=C(N)C1=C(F)C=C(OC)C=C1F
95+%
BD264622
MFCD03094497
2,6-DIFLUORO-4-METHOXYBENZOIC ACID
CAS:123843-65-2
Formula: O=C(O)C1=C(F)C=C(OC)C=C1F
95+%
BD68275
MFCD02949623
2,6-DIFLUORO-4-METHOXYBENZONITRILE
CAS:123843-66-3
Formula: COC1=CC(F)=C(C#N)C(F)=C1
97%
BD27325
MFCD03094498
2,6-DIFLUORO-4-METHOXYPHENOL
CAS:886498-93-7
Formula: OC1=C(F)C=C(OC)C=C1F
98%
BD309523
MFCD04115926
2,6-DIFLUORO-4-METHOXYPHENYLACETIC ACID
CAS:886498-98-2
Formula: FC1=C(C(=CC(=C1)OC)F)CC(=O)O
97%
BD35321
MFCD04115927
2,6-DIFLUORO-4-METHOXYPHENYLBORONIC ACID
CAS:406482-20-0
Formula: FC1=C(C(=CC(=C1)OC)F)B(O)O
97+%
BD161540
MFCD05664299
2,6-DIFLUORO-4-METHOXYPYRIDINE
CAS:1184172-35-7
Formula: COC1=CC(F)=NC(F)=C1
95+%
BD434677
MFCD13185564
2,6-DIFLUORO-4-METHYLANILINE
CAS:1379028-84-8
Formula: CC1=CC(F)=C(N)C(F)=C1
97%
BD213061
2,6-DIFLUORO-4-METHYLBENZALDEHYDE
CAS:1201597-22-9
Formula: CC1=CC(F)=C(C=O)C(F)=C1
95+%
BD241092
2,6-DIFLUORO-4-METHYLBENZOIC ACID
CAS:1201597-23-0
Formula: CC1=CC(F)=C(C(O)=O)C(F)=C1
98%
BD215290
2,6-DIFLUORO-4-METHYLBENZONITRILE
CAS:1803792-98-4
Formula: N#CC1=C(F)C=C(C)C=C1F
97%
BD486720
MFCD28790316
2,6-DIFLUORO-4-METHYLPYRIDINE
CAS:885267-39-0
Formula: CC1=CC(F)=NC(F)=C1
97%
BD481183
MFCD13175503
2,6-DIFLUORO-4-MORPHOLINOBENZONITRILE
CAS:840481-30-3
Formula: N#CC1=C(F)C=C(N2CCOCC2)C=C1F
95+%
BD408260
MFCD19442761
2,6-DIFLUORO-4-NITROANILINE
CAS:23156-27-6
Formula: NC1=C(F)C=C(C=C1F)[N+]([O-])=O
95%
BD68280
MFCD03094274
2,6-DIFLUORO-4-NITROANISOLE
CAS:392-25-6
Formula: COC1=C(F)C=C([N+]([O-])=O)C=C1F
98%
BD208241
MFCD06656243
2,6-DIFLUORO-4-NITROPHENOL
CAS:658-07-1
Formula: FC1=C(C(=CC(=C1)[N+](=O)[O-])F)O
97%
BD22056
MFCD07366521
2,6-DIFLUORO-4-PROPYLPHENOL
CAS:183244-98-6
Formula: OC1=C(F)C=C(CCC)C=C1F
95%
BD330600
MFCD24727965
2,6-DIFLUORO-N,N-DIMETHYLBENZAMIDE
CAS:81652-57-5
Formula: O=C(N(C)C)C1=C(F)C=CC=C1F
98%
BD327765
MFCD20356572
2,6-DIFLUORO-N-(2-NITROPHENYL)ANILINE
CAS:1033225-43-2
Formula: O=[N+](C1=CC=CC=C1NC2=C(F)C=CC=C2F)[O-]
95+%
BD231735
MFCD11865240
2,6-DIFLUORO-N-(4-(4-METHYL-1,2,5,6-TETRAHYDROPYRIDIN-3-YL)PHENYL)BENZAMIDE
CAS:1108684-91-8
Formula: O=C(NC1=CC=C(C2=C(C)CCNC2)C=C1)C3=C(F)C=CC=C3F
95+%
BD267118
MFCD16621149
2,6-DIFLUORO-N-(4-(4-METHYLPYRIDIN-3-YL)PHENYL)BENZAMIDE
CAS:1108684-81-6
Formula: O=C(NC1=CC=C(C2=C(C)C=CN=C2)C=C1)C3=C(F)C=CC=C3F
95+%
BD267117
MFCD16621147
2,6-DIFLUORO-N-(4-IODOPHENYL)BENZAMIDE
CAS:418801-29-3
Formula: O=C(NC1=CC=C(I)C=C1)C2=C(F)C=CC=C2F
95+%
BD267121
MFCD01469870
2,6-DIFLUORO-N-(OXIRAN-2-YLMETHYL)BENZAMIDE
CAS:1437457-78-7
Formula: O=C(NCC1OC1)C2=C(F)C=CC=C2F
97%
BD617210
2,6-DIFLUORO-N-(PIPERIDIN-4-YL)BENZAMIDE HYDROCHLORIDE
CAS:1016497-11-2
Formula: O=C(NC1CCNCC1)C2=C(F)C=CC=C2F.[H]Cl
97%
BD569740
2,6-DIFLUORO-N-HYDROXYBENZIMIDAMIDE
CAS:296766-98-8
Formula: N=C(NO)C1=C(F)C=CC=C1F
97%
BD68311
2,6-DIFLUORO-N-HYDROXYBENZIMIDOYL CHLORIDE
CAS:118591-69-8
Formula: Cl/C(C1=C(F)C=CC=C1F)=N\O
95%
BD68312
MFCD09027155
2,6-DIFLUORO-N-METHOXY-N-METHYL-4-(TRIFLUOROMETHYL)BENZAMIDE
CAS:1980040-18-3
Formula: O=C(N(OC)C)C1=C(F)C=C(C(F)(F)F)C=C1F
97%
BD00772016
2,6-DIFLUORO-N-METHOXY-N-METHYLBENZAMIDE
CAS:937601-82-6
Formula: CON(C)C(=O)C1=C(F)C=CC=C1F
95%
BD201459
MFCD08689758
2,6-DIFLUORO-N-METHYLANILINE
CAS:55847-14-8
Formula: CNC1=C(F)C=CC=C1F
95+%
BD243956
MFCD11178054
2,6-DIFLUORO-N-METHYLANILINE HYDROCHLORIDE
CAS:1193390-17-8
Formula: CNC1=C(F)C=CC=C1F.[H]Cl
BD00802745
2,6-DIFLUORO-PHENOXYACETONITRILE
CAS:18062-97-0
Formula: N#CCOC1=C(F)C=CC=C1F
95+%
BD323403
MFCD09475445
2,6-DIFLUOROANILINE
CAS:5509-65-9
Formula: C1=CC=C(C(=C1F)N)F
98%
BD9910
MFCD00007655
2,6-DIFLUOROANISOLE
CAS:437-82-1
Formula: COC1=C(F)C=CC=C1F
96%
BD68288
MFCD00142846
2,6-DIFLUOROBENZALDEHYDE
CAS:437-81-0
Formula: C1=CC=C(C(=C1F)C=O)F
98%
BD10284
MFCD00010293
2,6-DIFLUOROBENZALDEHYDE OXIME
CAS:19064-16-5
Formula: FC1=C(C(F)=CC=C1)/C=N/O
95+%
BD68290
MFCD01764489
2,6-DIFLUOROBENZAMIDE
CAS:18063-03-1
Formula: O=C(N)C1=C(F)C=CC=C1F
97%
BD10359
MFCD00007972
2,6-DIFLUOROBENZENE-1-SULFONYL CHLORIDE
CAS:60230-36-6
Formula: O=S(C1=C(F)C=CC=C1F)(Cl)=O
98%
BD9763
MFCD00085004
2,6-DIFLUOROBENZENESULFONAMIDE
CAS:60230-37-7
Formula: O=S(C1=C(F)C=CC=C1F)(N)=O
96%
BD68294
MFCD00729101
2,6-DIFLUOROBENZIMIDAMIDE
CAS:762229-49-2
Formula: N=C(N)C1=C(F)C=CC=C1F
95+%
BD68292
MFCD05662968
2,6-DIFLUOROBENZIMIDAMIDE HYDROCHLORIDE
CAS:304867-43-4
Formula: N=C(N)C1=C(F)C=CC=C1F.[H]Cl
97%
BD25046
MFCD04114427
2,6-DIFLUOROBENZOHYDRAZIDE
CAS:172935-91-0
Formula: O=C(NN)C1=C(F)C=CC=C1F
97%
BD183085
MFCD00119406
2,6-DIFLUOROBENZOIC ACID
CAS:385-00-2
Formula: O=C(O)C1=C(F)C=CC=C1F
97%
BD7938
MFCD00002411
2,6-DIFLUOROBENZONITRILE
CAS:1897-52-5
Formula: N#CC1=C(F)C=CC=C1F
98%
BD19076
MFCD00001778
2,6-DIFLUOROBENZYLAMINE
CAS:69385-30-4
Formula: NCC1=C(F)C=CC=C1F
98%
BD10507
MFCD00010144
2,6-DIFLUOROCINNAMALDEHYDE
CAS:117338-43-9
Formula: O=C/C=C/C1=C(F)C=CC=C1F
97%
BD174035
2,6-DIFLUOROCINNAMIC ACID
CAS:152152-09-5
Formula: O=C(O)/C=C/C1=C(F)C=CC=C1F
95%
BD68308
MFCD00010319
2,6-DIFLUOROISONICOTINIC ACID
CAS:88912-23-6
Formula: O=C(O)C1=CC(F)=NC(F)=C1
97%
BD68282
MFCD09864665
2,6-DIFLUOROPHENETHYL BROMIDE
CAS:1260790-92-8
Formula: FC1=C(C(F)=CC=C1)CCBr
95%
BD00799764
2,6-DIFLUOROPHENOL
CAS:28177-48-2
Formula: OC1=C(F)C=CC=C1F
98%
BD3268
MFCD00002158
2,6-DIFLUOROPHENYLACETIC ACID
CAS:85068-28-6
Formula: O=C(O)CC1=C(F)C=CC=C1F
97%
BD5922
MFCD00010001
2,6-DIFLUOROPHENYLACETYL CHLORIDE
CAS:116622-90-3
Formula: O=C(Cl)CC1=C(F)C=CC=C1F
95%
BD322551
MFCD03424718
2,6-DIFLUOROPHENYLBORONIC ACID
CAS:162101-25-9
Formula: OB(C1=C(F)C=CC=C1F)O
98%
BD9875
MFCD00792436
2,6-DIFLUOROPHENYLHYDRAZINE HYDROCHLORIDE
CAS:502496-26-6
Formula: Cl.NNC1=C(F)C=CC=C1F
98%
BD9959
MFCD03094169
2,6-DIFLUOROPYRAZINE
CAS:33873-09-5
Formula: FC1N=C(F)C=NC=1
95+%
BD00757740
n/a
2,6-DIFLUOROPYRIDIN-3-AMINE
CAS:108118-69-0
Formula: NC1=CC=C(F)N=C1F
98%
BD00753889
MFCD13185331
2,6-DIFLUOROPYRIDIN-3-OL
CAS:209328-85-8
Formula: OC1=CC=C(F)N=C1F
96%
BD217797
2,6-DIFLUOROPYRIDIN-4-AMINE
CAS:63489-58-7
Formula: NC1=CC(F)=NC(F)=C1
97%
BD233377
MFCD08436089
2,6-DIFLUOROPYRIDIN-4-OL
CAS:197717-50-3
Formula: OC1=CC(F)=NC(F)=C1
97%
BD491153
2,6-DIFLUOROPYRIDINE
CAS:1513-65-1
Formula: FC1=CC=CC(F)=N1
98%
BD32038
MFCD00006227
2,6-DIFLUOROPYRIDINE-3,4-DIAMINE
CAS:60186-25-6
Formula: NC1=C(N)C=C(F)N=C1F
95+%
BD248736
MFCD18384657
2,6-DIFLUOROPYRIDINE-3-BORONIC ACID
CAS:136466-94-9
Formula: OB(C1=CC=C(F)N=C1F)O
98%
BD2579
MFCD03788245
2,6-DIFLUOROPYRIDINE-3-CARBOXALDEHYDE
CAS:155601-65-3
Formula: FC1=NC(=CC=C1C=O)F
98%
BD68313
MFCD08277633
2,6-DIFLUOROPYRIDINE-3-CARBOXYLIC ACID
CAS:171178-50-0
Formula: O=C(O)C1=C(F)N=C(F)C=C1
96%
BD18837
MFCD08064047
2,6-DIFLUOROPYRIMIDIN-4-AMINE
CAS:675-12-7
Formula: NC1=CC(F)=NC(F)=N1
98%
BD9395
MFCD00457061
2,6-DIFLUOROTEREPHTHALONITRILE
CAS:510772-86-8
Formula: N#CC1=C(F)C=C(C#N)C=C1F
97%
BD489828
2,6-DIFLUOROTOLUENE
CAS:443-84-5
Formula: FC1=C(C)C(F)=CC=C1
98%
BD40391
MFCD00043898
2,6-DIFORMYLISONICOTINONITRILE
CAS:1393550-72-5
Formula: N#CC1=CC(C=O)=NC(C=O)=C1
95+%
BD304481
MFCD22545036
2,6-DIHYDRO-7H-PYRAZOLO[3,4-D]PYRIDAZIN-7-ONE
CAS:219631-04-6
Formula: O=C1C2=NNC=C2C=NN1
97%
BD00775358
2,6-DIHYDROXY-3,4-DIMETHYLPYRIDINE
CAS:84540-47-6
Formula: CC1=C(C)C(O)=NC(O)=C1
95%
BD10604
MFCD05662686
2,6-DIHYDROXY-3-CYANOPYRIDINE
CAS:35441-10-2
Formula: N#CC1=CC=C(O)N=C1O
95%
BD167510
MFCD11558977
2,6-DIHYDROXY-3-NITROBENZONITRILE
CAS:233585-04-1
Formula: N#CC1=C(O)C=CC([N+]([O-])=O)=C1O
97%
BD4263
2,6-DIHYDROXY-4-(TRIFLUOROMETHYL)NICOTINONITRILE
CAS:3335-46-4
Formula: N#CC1=C(O)N=C(O)C=C1C(F)(F)F
95%
BD86258
MFCD06200911
2,6-DIHYDROXY-4-METHYLBENZOIC ACID
CAS:480-67-1
Formula: CC1=CC(O)=C(C(O)=O)C(O)=C1
95+%
BD11150
MFCD00184686
2,6-DIHYDROXY-5-METHOXYPYRIMIDINE-4-CARBOXYLIC ACID
CAS:6944-35-0
Formula: O=C(C1=NC(O)=NC(O)=C1OC)O
95+%
BD279763
2,6-DIHYDROXYANTHRACENE
CAS:101488-73-7
Formula: OC1=CC2=CC3=CC=C(O)C=C3C=C2C=C1
95% GC)
BD00810319
2,6-DIHYDROXYANTHRACENE-9,10-DIONE
CAS:84-60-6
Formula: O=C1C2=C(C=C(O)C=C2)C(C3=CC=C(O)C=C13)=O
97%
BD68345
2,6-DIHYDROXYBENZALDEHYDE
CAS:387-46-2
Formula: O=CC1=C(O)C=CC=C1O
98%
BD220378
MFCD08061915
2,6-DIHYDROXYBENZAMIDE
CAS:3147-50-0
Formula: O=C(N)C1=C(O)C=CC=C1O
95+%
BD4851
2,6-DIHYDROXYBENZOIC ACID
CAS:303-07-1
Formula: C1=C(C(=C(C=C1)O)C(O)=O)O
97%
BD20083
MFCD00002462
2,6-DIHYDROXYPYRIDINE
CAS:626-06-2
Formula: OC1=NC(O)=CC=C1
95%
BD2700
MFCD00129028
2,6-DIHYDROXYPYRIDINE HYDROCHLORIDE
CAS:10357-84-3
Formula: OC1=CC=CC(O)=N1.[H]Cl
95%
BD68355
MFCD00012817
2,6-DIHYDROXYPYRIDINE-4-CARBOXAMIDE
CAS:14533-64-3
Formula: O=C(C1=CC(O)=NC(O)=C1)N
95+%
BD216108
2,6-DIHYDROXYPYRROLO[3,4-F]ISOINDOLE-1,3,5,7(2H,6H)-TETRAONE
CAS:57583-53-6
Formula: O=C1N(O)C(C2=C1C=C3C(C(N(O)C3=O)=O)=C2)=O
95+%
BD306338
n/a
2,6-DIIODO-3,5-DIMETHOXYPYRIDINE
CAS:1131335-49-3
Formula: COC1=C(I)N=C(I)C(OC)=C1
97%
BD196323
MFCD11857638
2,6-DIIODO-3-METHOXYPYRIDINE
CAS:437709-98-3
Formula: COC1=CC=C(I)N=C1I
97%
BD196598
MFCD11857683
2,6-DIIODO-4-(TRIFLUOROMETHYL)ANILINE
CAS:214400-66-5
Formula: NC1=C(I)C=C(C(F)(F)F)C=C1I
95+%
BD238984
MFCD11847372
2,6-DIIODO-4-(TRIFLUOROMETHYL)PHENOL
CAS:169255-50-9
Formula: OC1=C(I)C=C(C(F)(F)F)C=C1I
95+%
BD307485
MFCD20486163
2,6-DIIODO-4-(TRIFLUOROMETHYL)PYRIDINE
CAS:100366-76-5
Formula: FC(C1=CC(I)=NC(I)=C1)(F)F
95+%
BD270750
2,6-DIIODO-4-NITROANILINE
CAS:5398-27-6
Formula: NC1=C(I)C=C([N+]([O-])=O)C=C1I
98%
BD3281
MFCD00007683
2,6-DIIODO-4-NITROPHENOL
CAS:305-85-1
Formula: OC1=C(I)C=C([N+]([O-])=O)C=C1I
95+%
BD3194
MFCD00007335
2,6-DIIODO-5-METHOXYPYRIDIN-3-OL
CAS:1087659-27-5
Formula: OC1=CC(OC)=C(I)N=C1I
97%
BD196295
MFCD11857637
2,6-DIIODO-7H-PURINE
CAS:98027-95-3
Formula: IC1=C2NC=NC2=NC(I)=N1
95+%
BD68360
MFCD09907813
2,6-DIIODOPYRAZINE
CAS:58138-79-7
Formula: IC1=NC(=CN=C1)I
97%
BD159298
MFCD09265492
2,6-DIIODOPYRIDIN-3-OL
CAS:14764-90-0
Formula: OC1=CC=C(I)N=C1I
95+%
BD196479
MFCD03265756
2,6-DIIODOPYRIDINE
CAS:53710-17-1
Formula: C1=CC=C(I)N=C1I
95+%
BD28979
MFCD07366728
2,6-DIISOPROPYL-4-NITROANILINE
CAS:163704-72-1
Formula: NC1=C(C(C)C)C=C([N+]([O-])=O)C=C1C(C)C
95+%
BD14222
MFCD03426208
2,6-DIISOPROPYL-4-PHENOXYANILINE
CAS:80058-85-1
Formula: NC1=C(C(C)C)C=C(OC2=CC=CC=C2)C=C1C(C)C
97%
BD99869
2,6-DIISOPROPYL-N-(PYRIDIN-2-YLMETHYLENE)ANILINE
CAS:149810-35-5
Formula: CC(C1=C(/N=C/C2=NC=CC=C2)C(C(C)C)=CC=C1)C
97%
BD698633
2,6-DIISOPROPYLANILINE
CAS:24544-04-5
Formula: NC1=C(C(C)C)C=CC=C1C(C)C
97%
BD32845
MFCD00008887
2,6-DIISOPROPYLBENZOIC ACID
CAS:92035-95-5
Formula: O=C(O)C1=C(C(C)C)C=CC=C1C(C)C
95+%
BD306051
n/a
2,6-DIISOPROPYLCYCLOHEXA-2,5-DIENE-1,4-DIONE
CAS:1988-11-0
Formula: O=C1C(C(C)C)=CC(C=C1C(C)C)=O
95+%
BD230962
MFCD18379392
2,6-DIISOPROPYLIODOBENZENE
CAS:163704-47-0
Formula: CC(C)C1=CC=CC(C(C)C)=C1I
95%
BD226137
MFCD12547790
2,6-DIISOPROPYLNAPHTHALENE
CAS:24157-81-1
Formula: CC(C1=CC2=CC=C(C(C)C)C=C2C=C1)C
95%
BD68365
MFCD00021648
2,6-DIISOPROPYLPHENYLBORONIC ACID
CAS:363166-79-4
Formula: OB(C1=C(C(C)C)C=CC=C1C(C)C)O
96%
BD239423
MFCD16876786
2,6-DIMETHOXY-1,4-BENZOQUINONE
CAS:530-55-2
Formula: O=C1C(OC)=CC(C=C1OC)=O
95+%
BD6411
MFCD00016368
2,6-DIMETHOXY-1-ACETONYLQUINOL
CAS:2215-96-5
Formula: CC(CC(C(OC)=C1)(O)C(OC)=CC1=O)=O
95+%
BD228578
2,6-DIMETHOXY-3-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PYRIDINE
CAS:214360-59-5
Formula: COC1=CC=C(B2OC(C)(C)C(C)(C)O2)C(OC)=N1
98%
BD2824
MFCD03788240
2,6-DIMETHOXY-3-NITROBENZOIC ACID
CAS:55776-17-5
Formula: O=C(O)C1=C(OC)C=CC([N+]([O-])=O)=C1OC
95+%
BD68377
MFCD00017324
2,6-DIMETHOXY-3-NITROPYRIDINE
CAS:18677-41-3
Formula: COC1=CC=C(C(OC)=N1)[N+]([O-])=O
97%
BD4987
MFCD00832858
2,6-DIMETHOXY-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PYRIDINE
CAS:1150561-54-8
Formula: CC1(C)C(C)(C)OB(C2=CC(OC)=NC(OC)=C2)O1
98%
BD261680
MFCD11855988
2,6-DIMETHOXY-4-HYDROXYBENZALDEHYDE
CAS:22080-96-2
Formula: O=CC1=C(OC)C=C(O)C=C1OC
98%
BD6717
MFCD01407645
2,6-DIMETHOXY-4-METHYLANILINE
CAS:54812-41-8
Formula: NC1=C(OC)C=C(C)C=C1OC
95+%
BD260333
MFCD20691380
2,6-DIMETHOXY-4-METHYLPHENOL
CAS:6638-05-7
Formula: COC1=CC(C)=CC(OC)=C1O
95%
BD68382
MFCD00017289
2,6-DIMETHOXY-5-NITROPYRIDIN-3-AMINE
CAS:96859-47-1
Formula: NC1=CC([N+]([O-])=O)=C(OC)N=C1OC
97%
BD286493
MFCD18432624
2,6-DIMETHOXYANILINE
CAS:2734-70-5
Formula: C1=CC=C(C(=C1OC)N)OC
97%
BD28242
MFCD00053934
2,6-DIMETHOXYANILINE HYDROCHLORIDE
CAS:375397-36-7
Formula: NC1=C(OC)C=CC=C1OC.[H]Cl
98%
BD230589
2,6-DIMETHOXYANTHRACENE
CAS:36319-03-6
Formula: COC1=CC2=CC3=CC=C(OC)C=C3C=C2C=C1
95+%
BD435006
n/a
2,6-DIMETHOXYBENZALDEHYDE
CAS:3392-97-0
Formula: O=CC1=C(OC)C=CC=C1OC
98%
BD33277
MFCD00010862
2,6-DIMETHOXYBENZENE-1,4-DIOL
CAS:15233-65-5
Formula: COC1=C(O)C(OC)=CC(O)=C1
95+%
BD68393
MFCD00017160
2,6-DIMETHOXYBENZIMIDAMIDE HYDROCHLORIDE
CAS:1171047-31-6
Formula: N=C(N)C1=C(OC)C=CC=C1OC.[H]Cl
98%
BD286982
MFCD04114428
2,6-DIMETHOXYBENZOIC ACID
CAS:1466-76-8
Formula: O=C(O)C1=C(OC)C=CC=C1OC
98%
BD6718
MFCD00002437
2,6-DIMETHOXYBENZONITRILE
CAS:16932-49-3
Formula: COC1=CC=CC(OC)=C1C#N
98%
BD7785
MFCD00001788
2,6-DIMETHOXYISONICOTINALDEHYDE
CAS:52606-01-6
Formula: COC1=CC(C=O)=CC(OC)=N1
95+%
BD21225
MFCD06410685
2,6-DIMETHOXYISONICOTINAMIDE
CAS:N/A
Formula: O=C(C1C=C(OC)N=C(OC)C=1)N
95%
BD00792239
2,6-DIMETHOXYISONICOTINIC ACID
CAS:6274-82-4
Formula: COC1=CC(=CC(OC)=N1)C(O)=O
98%
BD238003
MFCD18257556
2,6-DIMETHOXYISONICOTINONITRILE
CAS:1261269-80-0
Formula: N#CC1=CC(OC)=NC(OC)=C1
97%
BD586508
2,6-DIMETHOXYNAPHTHALENE
CAS:5486-55-5
Formula: COC1=CC2=CC=C(OC)C=C2C=C1
98%
BD68395
MFCD00004063
2,6-DIMETHOXYNICOTINIC ACID
CAS:16727-43-8
Formula: COC1=CC=C(C(O)=O)C(OC)=N1
97%
BD32206
MFCD00075582
2,6-DIMETHOXYNICOTINOYL CHLORIDE
CAS:95383-48-5
Formula: O=C(Cl)C1=C(OC)N=C(OC)C=C1
97%
BD553047
2,6-DIMETHOXYPHENOL
CAS:91-10-1
Formula: COC1=CC=CC(OC)=C1O
98%
BD68397
MFCD00064434
2,6-DIMETHOXYPHENYLBORONIC ACID
CAS:23112-96-1
Formula: OB(C1=C(OC)C=CC=C1OC)O
98%
BD5278
MFCD01318987
2,6-DIMETHOXYPYRAZINE
CAS:4774-15-6
Formula: COC1=CN=CC(OC)=N1
98%
BD68401
MFCD00955843
2,6-DIMETHOXYPYRIDIN-3-AMINE HYDROCHLORIDE
CAS:80789-72-6
Formula: COC1=CC=C(N)C(OC)=N1.[H]Cl
95+%
BD3800
MFCD00012816
2,6-DIMETHOXYPYRIDIN-3-OL
CAS:885963-28-0
Formula: OC1=CC=C(OC)N=C1OC
95+%
BD370276
MFCD06858697
2,6-DIMETHOXYPYRIDIN-3-YLBORONIC ACID
CAS:221006-70-8
Formula: OB(C1=CC=C(OC)N=C1OC)O
97%
BD3772
MFCD03788239
2,6-DIMETHOXYPYRIDINE
CAS:6231-18-1
Formula: COC1=CC=CC(OC)=N1
98%
BD41869
MFCD00006266
2,6-DIMETHOXYPYRIDINE-3,5-DIAMINE
CAS:85679-78-3
Formula: NC1=CC(N)=C(OC)N=C1OC
95+%
BD259498
MFCD09753474
2,6-DIMETHOXYPYRIDINE-3,5-DIAMINE HYDROCHLORIDE
CAS:169381-75-3
Formula: NC1=CC(N)=C(OC)N=C1OC.[H]Cl
95+%
BD233860
MFCD03939179
2,6-DIMETHOXYPYRIDINE-3,5-DIBORONIC ACID
CAS:1217501-25-1
Formula: OB(C1=CC(B(O)O)=C(OC)N=C1OC)O
98%
BD325238
MFCD12756421
2,6-DIMETHOXYPYRIDINE-3-CARBOXALDEHYDE
CAS:58819-72-0
Formula: COC1=CC=C(C=O)C(OC)=N1
98%
BD60602
MFCD08064048
2,6-DIMETHOXYPYRIMIDINE-4-CARBONITRILE
CAS:N/A
Formula: N#CC1C=C(OC)N=C(OC)N=1
95%
BD00771842
2,6-DIMETHOXYPYRIMIDINE-4-CARBOXYLIC ACID
CAS:59864-30-1
Formula: O=C(C1=NC(OC)=NC(OC)=C1)O
97%
BD10567
MFCD01568105
2,6-DIMETHOXYQUINOLINE-3-CARBALDEHYDE
CAS:883549-54-0
Formula: O=CC1=CC2=CC(OC)=CC=C2N=C1OC
97%
BD554692
MFCD07364443
2,6-DIMETHOXYQUINOLINE-3-CARBOXYLIC ACID
CAS:929343-44-2
Formula: O=C(C1=CC2=CC(OC)=CC=C2N=C1OC)O
95%
BD00770135
2,6-DIMETHOXYTOLUENE
CAS:5673-07-4
Formula: CC1=C(OC)C=CC=C1OC
98%
BD68407
MFCD00008374
2,6-DIMETHYL 4-METHOXYPYRIDINE-2,6-DICARBOXYLATE
CAS:19872-93-6
Formula: O=C(C1=NC(C(OC)=O)=CC(OC)=C1)OC
98%
BD326977
MFCD00957190
2,6-DIMETHYL(1,3-DIOXOLAN-2-YLMETHYL)BENZENE
CAS:898785-37-0
Formula: CC1=C(CC2OCCO2)C(C)=CC=C1
95+%
BD312967
MFCD08064184
2,6-DIMETHYL-[1,2,4]TRIAZOLO[1,5-A]PYRAZINE
CAS:N/A
Formula: CC1N=CC2=NC(=NN2C=1)C
95%
BD00728613
n/a
2,6-DIMETHYL-1,8-NAPHTHYRIDINE
CAS:14757-45-0
Formula: CC1=CN=C2N=C(C)C=CC2=C1
97%
BD182214
MFCD13563078
2,6-DIMETHYL-1-(1-(PHENYLTHIO)CYCLOPROPYL)CYCLOHEX-2-ENOL
CAS:1956334-14-7
Formula: CC1CCC=C(C)C1(O)C2(SC3=CC=CC=C3)CC2
97%
BD441597
MFCD27991658
2,6-DIMETHYL-1-(2-OXOPROPYL)QUINOLIN-4(1H)-ONE
CAS:1210792-62-3
Formula: O=C1C=C(C)N(CC(C)=O)C2=C1C=C(C)C=C2
97%
BD607520
2,6-DIMETHYL-1-(PIPERIDIN-2-YLMETHYL)PIPERIDINE
CAS:1005116-45-9
Formula: CC1CCCC(C)N1CC2NCCCC2
95+%
BD321375
MFCD06653469
2,6-DIMETHYL-1-PROPYL-1H-INDOLE-3-CARBALDEHYDE
CAS:1134334-36-3
Formula: O=CC1=C(C)N(CCC)C2=C1C=CC(C)=C2
97%
BD177236
MFCD12027449
2,6-DIMETHYL-1H-INDOLE
CAS:5649-36-5
Formula: CC1=CC2=C(C=C1)C=C(C)N2
97%
BD218666
MFCD04117975
2,6-DIMETHYL-1H-INDOLE 3-METHYLBENZOATE
CAS:1227267-30-2
Formula: CC1=CC2=C(C=C1)C=C(C)N2.CC3=CC=CC(C(O)=O)=C3
95+%
BD333693
MFCD16875998
2,6-DIMETHYL-1H-INDOLE-3-CARBALDEHYDE
CAS:728024-59-7
Formula: O=CC1=C(C)NC2=C1C=CC(C)=C2
95+%
BD172916
2,6-DIMETHYL-1H-INDOLE-3-CARBOXYLIC ACID
CAS:1227267-27-7
Formula: O=C(C1=C(C)NC2=C1C=CC(C)=C2)O
95+%
BD217059
MFCD16875909
2,6-DIMETHYL-1H-PYRROLO[2,3-B]PYRIDINE
CAS:1255099-47-8
Formula: CC1=CC=C2C(NC(C)=C2)=N1
97%
BD247066
MFCD17926420
2,6-DIMETHYL-1H-PYRROLO[3,2-B]PYRIDINE
CAS:1448260-44-3
Formula: CC1=CN=C2C(NC(C)=C2)=C1
BD00805308
2,6-DIMETHYL-1H-PYRROLO[3,2-C]PYRIDINE
CAS:1190315-37-7
Formula: CC1=CC(NC(C)=C2)=C2C=N1
95+%
BD333264
MFCD12963238
2,6-DIMETHYL-2'-METHOXYBENZOPHENONE
CAS:750633-52-4
Formula: O=C(C1=CC=CC=C1OC)C2=C(C)C=CC=C2C
95+%
BD309063
MFCD01311512
2,6-DIMETHYL-2'-MORPHOLINOMETHYL BENZOPHENONE
CAS:898750-53-3
Formula: O=C(C1=CC=CC=C1CN2CCOCC2)C3=C(C)C=CC=C3C
95+%
BD309953
MFCD03842426
2,6-DIMETHYL-2'-PIPERIDINOMETHYL BENZOPHENONE
CAS:898773-30-3
Formula: O=C(C1=CC=CC=C1CN2CCCCC2)C3=C(C)C=CC=C3C
95+%
BD311882
MFCD03842483
2,6-DIMETHYL-2'-PYRROLIDINOMETHYL BENZOPHENONE
CAS:898774-63-5
Formula: O=C(C1=CC=CC=C1CN2CCCC2)C3=C(C)C=CC=C3C
95+%
BD311966
MFCD03842540
2,6-DIMETHYL-2'-THIOMORPHOLINOMETHYL BENZOPHENONE
CAS:898781-88-9
Formula: O=C(C1=CC=CC=C1CN2CCSCC2)C3=C(C)C=CC=C3C
95+%
BD312653
MFCD03842767
2,6-DIMETHYL-2,5-HEPTADIEN-4-ONE
CAS:504-20-1
Formula: CC(=CC(C=C(C)C)=O)C
98%
BD68417
MFCD00008901
2,6-DIMETHYL-2,6-DIHYDRO-7H-PYRAZOLO[3,4-D]PYRIDAZIN-7-ONE
CAS:69792-74-1
Formula: O=C1C2=NN(C)C=C2C=NN1C
97%
BD00823238
2,6-DIMETHYL-2H-BENZO[B][1,4]OXAZIN-3(4H)-ONE
CAS:17959-90-9
Formula: O=C1NC2=CC(C)=CC=C2OC1C
98%
BD68418
MFCD01833988
2,6-DIMETHYL-3'-(1,3-DIOXOLAN-2-YL)BENZOPHENONE
CAS:898779-39-0
Formula: O=C(C1=CC=CC(C2OCCO2)=C1)C3=C(C)C=CC=C3C
95+%
BD312413
MFCD07699969
2,6-DIMETHYL-3'-METHOXYBENZOPHENONE
CAS:750633-72-8
Formula: O=C(C1=CC=CC(OC)=C1)C2=C(C)C=CC=C2C
95+%
BD309081
MFCD01311544
2,6-DIMETHYL-3'-MORPHOLINOMETHYL BENZOPHENONE
CAS:898765-62-3
Formula: O=C(C1=CC=CC(CN2CCOCC2)=C1)C3=C(C)C=CC=C3C
95+%
BD311195
MFCD03841917
2,6-DIMETHYL-3'-PIPERIDINOMETHYL BENZOPHENONE
CAS:898793-17-4
Formula: O=C(C1=CC=CC(CN2CCCCC2)=C1)C3=C(C)C=CC=C3C
95+%
BD313701
MFCD03841974
2,6-DIMETHYL-3'-PYRROLIDINOMETHYL BENZOPHENONE
CAS:898770-43-9
Formula: O=C(C1=CC=CC(CN2CCCC2)=C1)C3=C(C)C=CC=C3C
95+%
BD311655
MFCD03842031
2,6-DIMETHYL-3'-THIOMORPHOLINOMETHYL BENZOPHENONE
CAS:898763-19-4
Formula: O=C(C1=CC=CC(CN2CCSCC2)=C1)C3=C(C)C=CC=C3C
95+%
BD310953
MFCD03842256
2,6-DIMETHYL-3,4-DIHYDRO-2H-1,4-BENZOXAZINE
CAS:58959-93-6
Formula: CC1=CC=C(OC(C)CN2)C2=C1
98%
BD327498
MFCD11603425
2,6-DIMETHYL-3,5-HEPTANEDIONE
CAS:18362-64-6
Formula: CC(C)C(CC(C(C)C)=O)=O
97%
BD68422
MFCD00015040
2,6-DIMETHYL-3,7-OCTADIENE-2,6-DIOL
CAS:51276-34-7
Formula: CC(O)(C)/C=C/CC(O)(C)C=C
95+%
BD235876
2,6-DIMETHYL-3-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PYRIDINE
CAS:693774-10-6
Formula: CC1=CC=C(B2OC(C)(C)C(C)(C)O2)C(C)=N1
95+%
BD213114
MFCD13195066
2,6-DIMETHYL-3-(METHYLSULFONYL)ANILINE
CAS:10311-40-7
Formula: NC1=C(C)C=CC(S(=O)(C)=O)=C1C
95%
BD11382
MFCD04037921
2,6-DIMETHYL-3-(METHYLTHIO)-1H-PYRROLO[2,3-B]PYRIDINE
CAS:850785-43-2
Formula: CSC1=C(C)NC2=NC(C)=CC=C21
97%
BD335503
MFCD17926421
2,6-DIMETHYL-3-(PYRROLIDIN-1-YL)ANILINE
CAS:1056963-14-4
Formula: CC1=CC=C(N2CCCC2)C(C)=C1N
95%
BD332604
MFCD17926233
2,6-DIMETHYL-3-HYDROXYPYRIDINE
CAS:1122-43-6
Formula: OC1=CC=C(C)N=C1C
98%
BD10596
MFCD00228692
2,6-DIMETHYL-3-MORPHOLINOANILINE
CAS:1138341-41-9
Formula: CC1=CC=C(N2CCOCC2)C(C)=C1N
95%
BD332927
MFCD17926234
2,6-DIMETHYL-3-NITROANILINE
CAS:67083-28-7
Formula: NC1=C(C)C=CC([N+]([O-])=O)=C1C
97%
BD234739
MFCD00156348
2,6-DIMETHYL-3-NITROBENZOIC ACID
CAS:6307-70-6
Formula: O=C(O)C1=C(C)C=CC([N+]([O-])=O)=C1C
97%
BD457910
MFCD09260790
2,6-DIMETHYL-3-NITROISONICOTINIC ACID
CAS:89977-02-6
Formula: O=C(O)C1=CC(C)=NC(C)=C1[N+]([O-])=O
97%
BD249011
2,6-DIMETHYL-3-NITROPYRIDIN-4-AMINE
CAS:18232-98-9
Formula: NC1=C([N+]([O-])=O)C(C)=NC(C)=C1
95+%
BD254859
MFCD13186748
2,6-DIMETHYL-3-NITROPYRIDIN-4-OL
CAS:13603-45-7
Formula: OC1=C([N+]([O-])=O)C(C)=NC(C)=C1
98%
BD230331
2,6-DIMETHYL-3-NITROPYRIDINE
CAS:15513-52-7
Formula: O=[N+](C1=CC=C(C)N=C1C)[O-]
98%
BD18578
MFCD00023503
2,6-DIMETHYL-3-O-METHYL-4-(2-METHYLBUTYRYL)PHLOROGLUCINOL
CAS:97761-91-6
Formula: CCC(C)C(C1=C(OC)C(C)=C(O)C(C)=C1O)=O
95+%
BD298920
2,6-DIMETHYL-3-OXO-2,3-DIHYDROPYRIDAZINE-4-CARBOXYLIC ACID
CAS:857992-70-2
Formula: O=C(C1=CC(C)=NN(C)C1=O)O
97%
BD00825640
2,6-DIMETHYL-3-OXO-3,4-DIHYDRO-2H-BENZO[B][1,4]OXAZINE-7-SULFONYL CHLORIDE
CAS:1171749-11-3
Formula: O=S(=O)(Cl)C1C=C2OC(C(=O)NC2=CC=1C)C
95%
BD00727401
MFCD14281369
2,6-DIMETHYL-3-PHENYLPYRIMIDIN-4(3H)-ONE
CAS:32363-53-4
Formula: O=C1N(C2=CC=CC=C2)C(C)=NC(C)=C1
95%
BD441598
MFCD27991659
2,6-DIMETHYL-4'-(1,3-DIOXOLAN-2-YL)BENZOPHENONE
CAS:898760-25-3
Formula: O=C(C1=CC=C(C2OCCO2)C=C1)C3=C(C)C=CC=C3C
95+%
BD310742
MFCD07700020
2,6-DIMETHYL-4'-(TRIFLUOROMETHYL)-[1,1'-BIPHENYL]-4-OL
CAS:872258-58-7
Formula: OC1=CC(C)=C(C2=CC=C(C(F)(F)F)C=C2)C(C)=C1
95+%
BD249766
MFCD09907917
2,6-DIMETHYL-4'-METHOXYBENZOPHENONE
CAS:52629-41-1
Formula: O=C(C1=CC=C(OC)C=C1)C2=C(C)C=CC=C2C
95+%
BD308295
MFCD01311574
2,6-DIMETHYL-4'-MORPHOLINOMETHYL BENZOPHENONE
CAS:898770-11-1
Formula: O=C(C1=CC=C(CN2CCOCC2)C=C1)C3=C(C)C=CC=C3C
95+%
BD311623
MFCD03841405
2,6-DIMETHYL-4'-PIPERIDINOMETHYL BENZOPHENONE
CAS:898775-08-1
Formula: O=C(C1=CC=C(CN2CCCCC2)C=C1)C3=C(C)C=CC=C3C
95+%
BD312010
MFCD03841462
2,6-DIMETHYL-4'-PYRROLIDINOMETHYL BENZOPHENONE
CAS:898776-49-3
Formula: O=C(C1=CC=C(CN2CCCC2)C=C1)C3=C(C)C=CC=C3C
95+%
BD312145
MFCD03841519
2,6-DIMETHYL-4'-THIOMORPHOLINOMETHYL BENZOPHENONE
CAS:898782-77-9
Formula: O=C(C1=CC=C(CN2CCSCC2)C=C1)C3=C(C)C=CC=C3C
95+%
BD312722
MFCD03841746
2,6-DIMETHYL-4,5-DIHYDROPYRIDAZIN-3(2H)-ONE
CAS:39998-27-1
Formula: O=C1CCC(C)=NN1C
95+%
BD281470
MFCD00828685
2,6-DIMETHYL-4-(2-NITRO-4-(TRIFLUOROMETHYL)PHENYL)MORPHOLINE
CAS:405910-36-3
Formula: FC(C1=CC=C(N2CC(C)OC(C)C2)C([N+]([O-])=O)=C1)(F)F
97%
BD495904
MFCD02018696
2,6-DIMETHYL-4-(2-PYRROLIDINYLMETHYL)PYRIDINE
CAS:881041-84-5
Formula: CC1=CC(CC2NCCC2)=CC(C)=N1
95+%
BD327921
MFCD06653523
2,6-DIMETHYL-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)ANILINE
CAS:1004761-68-5
Formula: NC1=C(C)C=C(B2OC(C)(C)C(C)(C)O2)C=C1C
95%
BD229348
2,6-DIMETHYL-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)BENZOIC ACID
CAS:890839-23-3
Formula: O=C(O)C1=C(C)C=C(B2OC(C)(C)C(C)(C)O2)C=C1C
97%
BD564311
MFCD23379533
2,6-DIMETHYL-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)BENZONITRILE
CAS:1111096-09-3
Formula: N#CC1=C(C)C=C(B2OC(C)(C)C(C)(C)O2)C=C1C
97%
BD488024
MFCD12405371
2,6-DIMETHYL-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PHENOL
CAS:269410-25-5
Formula: OC1=C(C)C=C(B2OC(C)(C)C(C)(C)O2)C=C1C
98%
BD5627
MFCD02093724
2,6-DIMETHYL-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PYRIDINE
CAS:325142-95-8
Formula: CC1(C)C(C)(C)OB(C2=CC(C)=NC(C)=C2)O1
95%
BD226550
2,6-DIMETHYL-4-(4-NITROBENZYL)MORPHOLINE
CAS:415719-74-3
Formula: O=[N+](C1=CC=C(C=C1)CN2CC(C)OC(C)C2)[O-]
97%
BD509409
MFCD00978378
2,6-DIMETHYL-4-(4-NITROPHENYL)MORPHOLINE
CAS:N/A
Formula: O=[N+](C1=CC=C(N2CC(C)OC(C)C2)C=C1)[O-]
95+%
BD200760
2,6-DIMETHYL-4-(5-NITROPYRIDIN-2-YL)MORPHOLINE
CAS:260447-04-9
Formula: CC1CN(CC(C)O1)C1=NC=C(C=C1)[N+]([O-])=O
97%
BD237763
MFCD00118337
2,6-DIMETHYL-4-(METHYLTHIO)PHENOL
CAS:7379-49-9
Formula: OC1=C(C)C=C(SC)C=C1C
97%
BD509999
MFCD00020052
2,6-DIMETHYL-4-(MORPHOLINOMETHYL)PHENOL
CAS:21894-01-9
Formula: OC1=C(C)C=C(CN2CCOCC2)C=C1C
97%
BD68431
2,6-DIMETHYL-4-(NAPHTHALEN-1-YL)PYRIDINE-3,5-DICARBOXYLIC ACID
CAS:94301-28-7
Formula: O=C(C1=C(C2=C3C=CC=CC3=CC=C2)C(C(O)=O)=C(C)N=C1C)O
97%
BD509782
MFCD12972436
2,6-DIMETHYL-4-(PENTYLOXY)BENZALDEHYDE
CAS:1443349-67-4
Formula: O=CC1=C(C)C=C(OCCCCC)C=C1C
97%
BD593129
2,6-DIMETHYL-4-(PENTYLOXY)BENZENETHIOL
CAS:1443311-20-3
Formula: SC1=C(C)C=C(OCCCCC)C=C1C
97%
BD592975
2,6-DIMETHYL-4-(PIPERIDIN-4-YL)MORPHOLINE
CAS:436099-87-5
Formula: CC1OC(C)CN(C2CCNCC2)C1
97%
BD68452
2,6-DIMETHYL-4-(TETRAHYDRO-2H-PYRAN-4-YL)PYRIDINE
CAS:27328-13-8
Formula: CC1=CC(C2CCOCC2)=CC(C)=N1
97%
BD593881
MFCD06637462
2,6-DIMETHYL-4-(THIOPHEN-2-YL)PYRIDINE
CAS:50581-77-6
Formula: CC1=CC(C2=CC=CS2)=CC(C)=N1
97%
BD629781
2,6-DIMETHYL-4-FLUOROBENZOIC ACID
CAS:16633-50-4
Formula: O=C(O)C1=C(C)C=C(F)C=C1C
98%
BD160462
2,6-DIMETHYL-4-METHOXYBENZOIC ACID
CAS:37934-89-7
Formula: COC1=CC(C)=C(C(O)=O)C(C)=C1
98%
BD161284
MFCD01194287
2,6-DIMETHYL-4-NITROANILINE
CAS:16947-63-0
Formula: CC1=CC(=CC(C)=C1N)[N+]([O-])=O
95%
BD69296
MFCD02093072
2,6-DIMETHYL-4-NITROBENZOIC ACID
CAS:90564-17-3
Formula: O=C(O)C1=C(C)C=C([N+]([O-])=O)C=C1C
97%
BD463965
2,6-DIMETHYL-4-NITROPHENOL
CAS:2423-71-4
Formula: OC1=C(C)C=C([N+]([O-])=O)C=C1C
98%
BD11205
MFCD00007339
2,6-DIMETHYL-4-NITROPYRIDINE
CAS:4913-57-9
Formula: CC1=CC(=CC(C)=N1)[N+]([O-])=O
97%
BD236956
MFCD00234324
2,6-DIMETHYL-4-NITROPYRIDINE 1-OXIDE
CAS:4808-64-4
Formula: O=[N+](C1=CC(C)=[N+]([O-])C(C)=C1)[O-]
97%
BD219226
MFCD00023406
2,6-DIMETHYL-4-OXO-1,4-DIHYDROPYRIDINE-3-CARBOXYLIC ACID
CAS:52403-25-5
Formula: O=C(C1=C(C)NC(C)=CC1=O)O
95+%
BD279305
2,6-DIMETHYL-4-PHENYLPYRIDINE
CAS:3044-71-1
Formula: CC1=CC(C2=CC=CC=C2)=CC(C)=N1
97%
BD629782
2,6-DIMETHYL-4-PROPOXYBENZALDEHYDE
CAS:100256-36-8
Formula: O=CC1=C(C)C=C(OCCC)C=C1C
97%
BD588106
2,6-DIMETHYL-4-PROPOXYBENZOIC ACID
CAS:100256-91-5
Formula: O=C(O)C1=C(C)C=C(OCCC)C=C1C
97%
BD588107
2,6-DIMETHYL-4H-BENZO[D][1,3]OXAZIN-4-ONE
CAS:62175-49-9
Formula: O=C1OC(C)=NC2=CC=C(C)C=C12
95+%
BD212182
MFCD00115483
2,6-DIMETHYL-4H-PYRAN-4-ONE
CAS:1004-36-0
Formula: O=C1C=C(C)OC(C)=C1
95%
BD68481
MFCD00006579
2,6-DIMETHYL-4H-PYRIDO[1,2-A]PYRIMIDIN-4-ONE
CAS:16867-28-0
Formula: O=C1C=C(C)N=C2N1C(C)=CC=C2
95+%
BD336409
MFCD03369387
2,6-DIMETHYL-5-OXO-5,6-DIHYDRO-1,6-NAPHTHYRIDINE-3-CARBOXYLIC ACID
CAS:1432334-25-2
Formula: O=C(C1=CC2=C(N=C1C)C=CN(C)C2=O)O
97%
BD617003
2,6-DIMETHYL-7-OCTENE-2,3,6-TRIOL
CAS:73815-21-1
Formula: CC(O)(C)C(O)CCC(O)(C)C=C
95+%
BD235939
2,6-DIMETHYL-7-OXO-6,7-DIHYDRO-1H-PYRROLO[2,3-C]PYRIDINE-3-CARBOXYLIC ACID
CAS:1956327-94-8
Formula: O=C(C1=C(C)NC2=C1C=CN(C)C2=O)O
97%
BD442985
MFCD28405299
2,6-DIMETHYL-8-(PENTAN-3-YL)IMIDAZO[1,2-B]PYRIDAZINE
CAS:910552-63-5
Formula: CCC(C1=CC(C)=NN2C1=NC(C)=C2)CC
95+%
BD239036
MFCD12923363
2,6-DIMETHYL-9H-FLUOREN-9-ONE
CAS:21436-48-6
Formula: O=C1C2=C(C3=C1C=CC(C)=C3)C=CC(C)=C2
95+%
BD379890
MFCD28976614
2,6-DIMETHYL-N-(3-(TRIFLUOROMETHYL)PHENYL)ANILINE
CAS:949161-11-9
Formula: FC(C1=CC(NC2=C(C)C=CC=C2C)=CC=C1)(F)F
95+%
BD252557
MFCD18207282
2,6-DIMETHYL-N-(O-TOLYL)ANILINE
CAS:68014-57-3
Formula: CC1=CC=CC=C1NC2=C(C)C=CC=C2C
95+%
BD252558
MFCD18207291
2,6-DIMETHYL-N-(P-TOLYL)ANILINE
CAS:24542-61-8
Formula: CC1=CC=C(NC2=C(C)C=CC=C2C)C=C1
95+%
BD252559
MFCD18207297
2,6-DIMETHYL-NICOTINIC ACID HYDROCHLORIDE
CAS:100960-91-6
Formula: O=C(O)C1=C(C)N=C(C)C=C1.[H]Cl
96%
BD00790346
2,6-DIMETHYL-TETRAHYDRO-PYRAN-4-CARBALDEHYDE
CAS:1212021-29-8
Formula: O=CC1CC(C)OC(C)C1
96%
BD00807715
2,6-DIMETHYLACETANILIDE
CAS:2198-53-0
Formula: CC(NC1=C(C)C=CC=C1C)=O
96%
BD68457
MFCD00008675
2,6-DIMETHYLANILINE HYDROCHLORIDE
CAS:21436-98-6
Formula: NC1=C(C)C=CC=C1C.[H]Cl
96%
BD68460
MFCD00060213
2,6-DIMETHYLANISOLE
CAS:1004-66-6
Formula: COC1=C(C)C=CC=C1C
97%
BD68461
MFCD00008380
2,6-DIMETHYLAZEPANE
CAS:1314920-15-4
Formula: CC1CCCC(C)NC1
BD00792807
2,6-DIMETHYLBENZALDEHYDE
CAS:1123-56-4
Formula: CC1=C(C=O)C(=CC=C1)C
95%
BD6654
MFCD00128003
2,6-DIMETHYLBENZAMIDE
CAS:55321-98-7
Formula: O=C(N)C1=C(C)C=CC=C1C
97%
BD68463
2,6-DIMETHYLBENZENE-1,4-DIAMINE
CAS:7218-02-2
Formula: CC1=CC(N)=CC(C)=C1N
95+%
BD233382
MFCD02752808
2,6-DIMETHYLBENZENE-1,4-DIAMINE DIHYDROCHLORIDE
CAS:56496-89-0
Formula: NC1=C(C)C=C(N)C=C1C.[H]Cl.[H]Cl
95+%
BD261059
MFCD18973468
2,6-DIMETHYLBENZENE-1-SULFONYL CHLORIDE
CAS:2905-29-5
Formula: O=S(C1=C(C)C=CC=C1C)(Cl)=O
95+%
BD224117
MFCD03789123
2,6-DIMETHYLBENZENESULFONAMIDE
CAS:24010-56-8
Formula: O=S(C1=C(C)C=CC=C1C)(N)=O
97%
BD530436
2,6-DIMETHYLBENZO[1,2-D:4,5-D']BIS(THIAZOLE)
CAS:13399-12-7
Formula: CC1=NC(C=C(SC(C)=N2)C2=C3)=C3S1
95+%
BD370613
MFCD07161751
2,6-DIMETHYLBENZO[D]THIAZOL-5-AMINE
CAS:98953-72-1
Formula: NC1=C(C)C=C(SC(C)=N2)C2=C1
97%
BD226165
2,6-DIMETHYLBENZO[D]THIAZOLE
CAS:2941-71-1
Formula: CC1=NC2=C(S1)C=C(C)C=C2
95+%
BD236611
MFCD00022880
2,6-DIMETHYLBENZOIC ACID
CAS:632-46-2
Formula: O=C(O)C1=C(C)C=CC=C1C
98%
BD11241
MFCD00002483
2,6-DIMETHYLBENZONITRILE
CAS:6575-13-9
Formula: C1=C(C(=C(C=C1)C)C#N)C
98%
BD7746
MFCD00037166
2,6-DIMETHYLBENZOTRIFLUORIDE
CAS:41818-96-6
Formula: FC(F)(F)C1=C(C)C=CC=C1C
95+%
BD308110
MFCD14525527
2,6-DIMETHYLBENZOYL CHLORIDE
CAS:21900-37-8
Formula: O=C(Cl)C1=C(C)C=CC=C1C
95+%
BD307665
MFCD00052854
2,6-DIMETHYLBENZYLAMINE
CAS:74788-82-2
Formula: CC1=CC=CC(C)=C1CN
98%
BD68474
MFCD01310814
2,6-DIMETHYLBROMOBENZENE
CAS:576-22-7
Formula: C1=CC=C(C(=C1C)Br)C
98%
BD41810
MFCD00000075
2,6-DIMETHYLCYCLOHEXA-2,5-DIENE-1,4-DIONE
CAS:527-61-7
Formula: CC1=CC(=O)C=C(C)C1=O
98%
BD6379
MFCD00001605
2,6-DIMETHYLCYCLOHEXANOL
CAS:5337-72-4
Formula: OC1C(C)CCCC1C
95%
BD68476
MFCD00001502
2,6-DIMETHYLHEPT-5-ENAL
CAS:106-72-9
Formula: C/C(C)=C/CCC(C)C=O
85+%
BD68454
MFCD00006981
2,6-DIMETHYLHEPTAN-2-OL
CAS:13254-34-7
Formula: CC(O)(C)CCCC(C)C
95%
BD68419
MFCD00072198
2,6-DIMETHYLHEPTAN-4-AMINE
CAS:65530-92-9
Formula: CC(C)CC(N)CC(C)C
95+%
BD227352
MFCD00048359
2,6-DIMETHYLHEPTAN-4-OL
CAS:108-82-7
Formula: CC(C)CC(O)CC(C)C
85%
BD68435
MFCD00008944
2,6-DIMETHYLHEPTANE-2,4-DIOL
CAS:73264-93-4
Formula: CC(O)(C)CC(O)CC(C)C
95+%
BD335210
MFCD28362046
2,6-DIMETHYLHYDROQUINONE
CAS:654-42-2
Formula: OC1=C(C)C=C(O)C=C1C
97%
BD68483
MFCD00016466
2,6-DIMETHYLIMIDAZO[1,2-A]PYRAZINE-3-CARBOXYLIC ACID
CAS:190381-50-1
Formula: O=C(C1=C(C)N=C2C=NC(C)=CN21)O
97%
BD587403
2,6-DIMETHYLIMIDAZO[1,2-A]PYRIDIN-3-AMINE
CAS:1216104-44-7
Formula: NC1=C(C)N=C2C=CC(C)=CN21
97%
BD586286
2,6-DIMETHYLIMIDAZO[1,2-A]PYRIDINE-3-CARBALDEHYDE
CAS:728864-60-6
Formula: O=CC1=C(C)N=C2C=CC(C)=CN21
95+%
BD0040
n/a
2,6-DIMETHYLIMIDAZO[1,2-A]PYRIDINE-3-CARBOXYLIC ACID
CAS:81438-52-0
Formula: O=C(C1=C(C)N=C2C=CC(C)=CN21)O
95%
BD278614
2,6-DIMETHYLIMIDAZO[1,2-A]PYRIMIDINE-3-CARBOXYLIC ACID
CAS:1335052-44-2
Formula: O=C(C1=C(C)N=C2N=CC(C)=CN21)O
95+%
BD289794
MFCD20661163
2,6-DIMETHYLIMIDAZO[1,2-B]PYRIDAZIN-3-AMINE
CAS:1936272-20-6
Formula: NC1=C(C)N=C2C=CC(C)=NN21
97%
BD755497
2,6-DIMETHYLIMIDAZO[1,2-B]PYRIDAZINE
CAS:17412-39-4
Formula: CC1=NN2C(C=C1)=NC(C)=C2
95+%
BD68484
n/a
2,6-DIMETHYLIMIDAZO[1,2-B]PYRIDAZINE-3-CARBOXYLIC ACID
CAS:1518631-38-3
Formula: O=C(C1=C(C)N=C2C=CC(C)=NN21)O
97%
BD00782996
2,6-DIMETHYLIMIDAZO[1,2-C]PYRIMIDIN-5(6H)-ONE
CAS:57491-47-1
Formula: O=C1N2C(C=CN1C)=NC(C)=C2
95+%
BD271025
MFCD21336451
2,6-DIMETHYLISONICOTINALDEHYDE
CAS:18206-06-9
Formula: O=CC1=CC(C)=NC(C)=C1
95+%
BD68509
MFCD06410687
2,6-DIMETHYLISONICOTINAMIDE
CAS:113708-04-6
Formula: O=C(N)C1=CC(C)=NC(C)=C1
95+%
BD294308
2,6-DIMETHYLISONICOTINIC ACID
CAS:54221-93-1
Formula: CC1=CC(=CC(C)=N1)C(O)=O
98%
BD68486
MFCD03731176
2,6-DIMETHYLISONICOTINIC ACID HYDROCHLORIDE
CAS:857363-49-6
Formula: O=C(O)C1=CC(C)=NC(C)=C1.[H]Cl
95+%
BD219227
MFCD17171377
2,6-DIMETHYLISONICOTINIMIDAMIDE
CAS:913240-33-2
Formula: N=C(N)C1=CC(C)=NC(C)=C1
97%
BD751699
2,6-DIMETHYLISONICOTINIMIDAMIDE HYDROCHLORIDE
CAS:N/A
Formula: N=C(C1C=C(C)N=C(C)C=1)N.[H]Cl
95%
BD00745948
n/a
2,6-DIMETHYLISONICOTINONITRILE
CAS:39965-81-6
Formula: N#CC1=CC(C)=NC(C)=C1
97%
BD68434
2,6-DIMETHYLMORPHOLINE HYDROCHLORIDE
CAS:80567-00-6
Formula: CC1OC(C)CNC1.[H]Cl
95+%
BD283915
2,6-DIMETHYLNAPHTHALENE
CAS:581-42-0
Formula: CC1=CC2=CC=C(C)C=C2C=C1
97%
BD68489
MFCD00004120
2,6-DIMETHYLNICOTINIC ACID
CAS:5860-71-9
Formula: O=C(O)C1=C(C)N=C(C)C=C1
98%
BD29157
MFCD06738677
2,6-DIMETHYLPHENYL 2-((3-CYANO-4,6-DIPHENYLPYRIDIN-2-YL)THIO)ACETATE
CAS:336173-47-8
Formula: O=C(OC1=C(C)C=CC=C1C)CSC2=NC(C3=CC=CC=C3)=CC(C4=CC=CC=C4)=C2C#N
97%
BD595406
MFCD01541880
2,6-DIMETHYLPHENYL 2-((5-(2-CHLOROPHENYL)-1,3,4-OXADIAZOL-2-YL)THIO)ACETATE
CAS:332126-69-9
Formula: O=C(OC1=C(C)C=CC=C1C)CSC2=NN=C(C3=CC=CC=C3Cl)O2
97%
BD594589
MFCD01817973
2,6-DIMETHYLPHENYLHYDRAZINE HYDROCHLORIDE
CAS:2538-61-6
Formula: [H+].C1=CC=C(C(=C1C)NN)C.[Cl-]
97%
BD41506
MFCD01861265
2,6-DIMETHYLPIPERAZINE
CAS:108-49-6
Formula: CC1CNCC(C)N1
98%
BD3036
MFCD07772435
2,6-DIMETHYLPIPERAZINE DIHYDROCHLORIDE
CAS:98618-52-1
Formula: CC1CNCC(C)N1.[H]Cl.[H]Cl
95+%
BD297637
MFCD12025404
2,6-DIMETHYLPIPERIDIN-4-OL
CAS:4733-70-4
Formula: OC1CC(C)NC(C)C1
95+%
BD68441
MFCD00771653
2,6-DIMETHYLPIPERIDIN-4-ONE
CAS:45717-87-1
Formula: O=C1CC(C)NC(C)C1
95+%
BD284960
MFCD08703343
2,6-DIMETHYLPIPERIDIN-4-ONE HYDROCHLORIDE
CAS:1005397-62-5
Formula: O=C1CC(C)NC(C)C1.[H]Cl
97%
BD252560
MFCD11656348
2,6-DIMETHYLPIPERIDINE
CAS:504-03-0
Formula: CC1CCCC(C)N1
98%
BD68502
MFCD00066304
2,6-DIMETHYLPIPERIDINE-4-CARBOXYLIC ACID
CAS:1330752-22-1
Formula: O=C(C1CC(C)NC(C)C1)O
95+%
BD291420
2,6-DIMETHYLPYRAZINE
CAS:108-50-9
Formula: CC1=CN=CC(C)=N1
98%
BD10009
MFCD00006148
2,6-DIMETHYLPYRIDIN-3-AMINE
CAS:3430-33-9
Formula: NC1=CC=C(C)N=C1C
98%
BD3778
MFCD01646409
2,6-DIMETHYLPYRIDIN-3-YLBORONIC ACID
CAS:693774-55-9
Formula: CC1=CC=C(B(O)O)C(C)=N1
95%
BD68507
MFCD07437925
2,6-DIMETHYLPYRIDIN-4(1H)-ONE
CAS:7516-31-6
Formula: O=C1C=C(C)NC(C)=C1
95+%
BD219228
n/a
2,6-DIMETHYLPYRIDIN-4-AMINE
CAS:3512-80-9
Formula: NC1=CC(C)=NC(C)=C1
97%
BD25053
MFCD00130078
2,6-DIMETHYLPYRIDIN-4-OL
CAS:13603-44-6
Formula: CC1=CC(C=C(C)N1)=O
95+%
BD7940
MFCD00956021
2,6-DIMETHYLPYRIDINE-3,4-DIAMINE
CAS:3726-26-9
Formula: NC1=C(N)C=C(C)N=C1C
95+%
BD254860
MFCD13176241
2,6-DIMETHYLPYRIDINE-3,4-DICARBOXYLIC ACID
CAS:13602-84-1
Formula: O=C(C1=C(C(O)=O)C=C(C)N=C1C)O
97%
BD614295
2,6-DIMETHYLPYRIDINE-3-CARBALDEHYDE
CAS:650141-20-1
Formula: CC1=CC=C(C=O)C(C)=N1
96%
BD29317
MFCD03265780
2,6-DIMETHYLPYRIDINE-4-SULFONYL CHLORIDE
CAS:1025509-76-5
Formula: O=S(C1=CC(C)=NC(C)=C1)(Cl)=O
97%
BD585149
MFCD10700202
2,6-DIMETHYLPYRIMIDIN-4-AMINE
CAS:461-98-3
Formula: CC1=NC(C)=NC(N)=C1
98%
BD20915
MFCD00006106
2,6-DIMETHYLPYRIMIDIN-4-AMINE HYDROCHLORIDE
CAS:79091-25-1
Formula: NC1=NC(C)=NC(C)=C1.[H]Cl
95+%
BD280077
2,6-DIMETHYLPYRIMIDIN-4-OL
CAS:6622-92-0
Formula: CC1=NC(C)=NC(O)=C1
98%
BD3692
MFCD00006105
2,6-DIMETHYLPYRIMIDIN-4-YL ACETATE
CAS:1823935-40-5
Formula: CC(OC1=NC(C)=NC(C)=C1)=O
95+%
BD280078
2,6-DIMETHYLPYRIMIDINE-4-CARBALDEHYDE
CAS:1074-39-1
Formula: O=CC1=NC(C)=NC(C)=C1
95+%
BD268529
MFCD10696982
2,6-DIMETHYLPYRIMIDINE-4-CARBONITRILE
CAS:64571-35-3
Formula: N#CC1=NC(C)=NC(C)=C1
95+%
BD248874
MFCD16657332
2,6-DIMETHYLQUINAZOLIN-4(1H)-ONE
CAS:18731-19-6
Formula: O=C1N=C(C)NC2=C1C=C(C)C=C2
98%
BD254083
MFCD07787530
2,6-DIMETHYLQUINAZOLINE
CAS:16499-40-4
Formula: CC1=CC2=CN=C(C)N=C2C=C1
97%
BD587317
MFCD18448851
2,6-DIMETHYLQUINOLIN-4-OL
CAS:15644-82-3
Formula: OC1=CC(C)=NC2=CC=C(C)C=C12
95+%
BD32889
MFCD00272319
2,6-DIMETHYLQUINOLIN-5-AMINE
CAS:116632-59-8
Formula: NC1=C2C=CC(C)=NC2=CC=C1C
95+%
BD333062
MFCD00457007
2,6-DIMETHYLQUINOLIN-8-AMINE
CAS:30465-70-4
Formula: NC1=C2N=C(C)C=CC2=CC(C)=C1
97%
BD624617
2,6-DIMETHYLQUINOLINE
CAS:877-43-0
Formula: CC1=CC2=C(C=C1)N=C(C)C=C2
98%
BD13006
MFCD00006762
2,6-DIMETHYLQUINOLINE-3-CARBOXYLIC ACID
CAS:610261-45-5
Formula: O=C(C1=CC2=CC(C)=CC=C2N=C1C)O
95%
BD183814
2,6-DIMETHYLQUINOLINE-4-CARBOHYDRAZIDE
CAS:613656-68-1
Formula: O=C(C1=CC(C)=NC2=CC=C(C)C=C12)NN
95+%
BD177237
MFCD03420427
2,6-DIMETHYLQUINOLINE-4-CARBOXYLIC ACID
CAS:104175-33-9
Formula: O=C(C1=CC(C)=NC2=CC=C(C)C=C12)O
95+%
BD68512
MFCD00487548
2,6-DIMETHYLTEREPHTHALIC ACID
CAS:80238-12-6
Formula: O=C(O)C1=C(C)C=C(C(O)=O)C=C1C
96%
BD227439
2,6-DIMETHYLTEREPHTHALONITRILE
CAS:95216-09-4
Formula: N#CC1=C(C)C=C(C#N)C=C1C
95+%
BD250829
MFCD20037433
2,6-DIMETHYLTETRAHYDRO-2H-PYRAN-4-OL
CAS:41866-70-0
Formula: OC1CC(C)OC(C)C1
97%
BD254093
MFCD18089272
2,6-DIMETHYLTETRAHYDRO-4H-THIOPYRAN-4-ONE 1,1-DIOXIDE
CAS:56580-78-0
Formula: O=C(CC1C)CC(C)S1(=O)=O
97%
BD00810530
2,6-DIMETHYLTHIENO[3,2-D]PYRIMIDIN-4-AMINE
CAS:1017789-22-8
Formula: NC1=C2C(C=C(C)S2)=NC(C)=N1
95+%
BD320626
MFCD09991580
2,6-DIMORPHOLINOPYRIMIDINE-4-CARBOXYLIC ACID
CAS:450368-32-8
Formula: O=C(C1=NC(N2CCOCC2)=NC(N3CCOCC3)=C1)O
95%
BD183121
MFCD01765571
2,6-DINONYLNAPHTHALENE-1,5-DISULFONIC ACID
CAS:60223-95-2
Formula: O=S(C1=C2C=CC(CCCCCCCCC)=C(S(=O)(O)=O)C2=CC=C1CCCCCCCCC)(O)=O
97%
BD125736
2,6-DIOXA-9-AZASPIRO[4.5]DECANE
CAS:923277-59-2
Formula: C1OCCC12OCCNC2
95+%
BD282969
2,6-DIOXASPIRO[3.3]HEPTANE
CAS:174-79-8
Formula: C1OCC11COC1
95+%
BD236800
MFCD01730191
2,6-DIOXASPIRO[4.5]DECAN-9-AMINE
CAS:1343024-86-1
Formula: NC(C1)CCOC21CCOC2
97%
BD00800065
2,6-DIOXO-1,2,3,6-TETRAHYDROPYRIMIDINE-4-CARBALDEHYDE
CAS:36327-91-0
Formula: O=CC(NC1=O)=CC(N1)=O
98%
BD2619
MFCD00466409
2,6-DIOXO-1,2,3,6-TETRAHYDROPYRIMIDINE-4-CARBALDEHYDE HYDRATE
CAS:1052405-08-9
Formula: O=CC(NC1=O)=CC(N1)=O.[H]O[H]
95+%
BD389513
MFCD03002359
2,6-DIOXO-1,2,3,6-TETRAHYDROPYRIMIDINE-4-CARBOXYLIC ACID HYDRATE
CAS:50887-69-9
Formula: O=C(N1)NC(C(O)=O)=CC1=O.[H]O[H]
95+%
BD21091
MFCD00149398
2,6-DIOXO-2,3-DIHYDRO-1H-PURINE-9(6H)-CARBOXYLIC ACID
CAS:71965-22-5
Formula: OC(=O)N1C=NC2=C1NC(=O)NC2=O
95+%
BD106046
2,6-DIOXO-3,6-DIHYDRO-2H-PYRAN-4-YL ACETATE
CAS:15997-62-3
Formula: CC(OC(CC1=O)=CC(O1)=O)=O
97%
BD561820
2,6-DIOXO-5-(PIPERIDIN-1-YLMETHYL)-1,2,3,6-TETRAHYDROPYRIMIDINE-4-CARBOXYLIC ACID
CAS:4116-21-6
Formula: O=C(C(NC1=O)=C(CN2CCCCC2)C(N1)=O)O
97%
BD595969
MFCD00563244
2,6-DIOXOPIPERIDINE-4-CARBOXYLIC ACID
CAS:6973-55-3
Formula: O=C(C(C1)CC(NC1=O)=O)O
95+%
BD303654
MFCD00154712
2,6-DIPHENETHYL-4H-PYRAN-4-ONE
CAS:56150-35-7
Formula: O=C1C=C(CCC2=CC=CC=C2)OC(CCC3=CC=CC=C3)=C1
95+%
BD269565
2,6-DIPHENYL-2H-PYRAN-4(3H)-ONE
CAS:126855-57-0
Formula: O=C1CC(C2=CC=CC=C2)OC(C3=CC=CC=C3)=C1
95+%
BD269575
2,6-DIPHENYLBENZO[1,2-B:4,5-B']DIFURAN
CAS:5379-77-1
Formula: C1(OC(C2=CC=CC=C2)=CC1=C3)=CC4=C3OC(C5=CC=CC=C5)=C4
95+%
BD331642
2,6-DIPHENYLDITHIENO[3,2-B:2',3'-D]THIOPHENE
CAS:881838-94-4
Formula: C1(C=C(C2=CC=CC=C2)S3)=C3C4=C(C=C(C5=CC=CC=C5)S4)S1
95+%
BD262671
2,6-DIPHENYLISONICOTINIC ACID
CAS:38947-57-8
Formula: O=C(O)C1=CC(C2=CC=CC=C2)=NC(C3=CC=CC=C3)=C1
97%
BD60604
2,6-DIPHENYLPIPERIDIN-4-ONE
CAS:5554-55-2
Formula: O=C1CC(C2=CC=CC=C2)NC(C3=CC=CC=C3)C1
95+%
BD349816
MFCD00229918
2,6-DIPHENYLPIPERIDIN-4-ONE HYDROCHLORIDE
CAS:56965-71-0
Formula: O=C1CC(C2=CC=CC=C2)NC(C3=CC=CC=C3)C1.[H]Cl
97%
BD68540
2,6-DIPHENYLPYRIDIN-3-AMINE
CAS:56568-39-9
Formula: NC1=CC=C(C2=CC=CC=C2)N=C1C3=CC=CC=C3
97%
BD444584
2,6-DIPHENYLPYRIDINE
CAS:3558-69-8
Formula: C1(C2=CC=CC=C2)=NC(C3=CC=CC=C3)=CC=C1
98%
BD68542
MFCD00006284
2,6-DISTYRYL-4H-PYRAN-4-ONE
CAS:17173-83-0
Formula: O=C1C=C(/C=C/C2=CC=CC=C2)OC(/C=C/C3=CC=CC=C3)=C1
95+%
BD269564
MFCD00156429
2,6-DITOSYL-2,6-DIAZASPIRO[3.3]HEPTANE
CAS:13595-48-7
Formula: O=S(N(C1)CC21CN(S(=O)(C3=CC=C(C)C=C3)=O)C2)(C4=CC=C(C)C=C4)=O
97%
BD626852
n/a
2,6-NAPHTHALENEDICARBOXYLIC ACID
CAS:1141-38-4
Formula: O=C(C1=CC=C2C=C(C(O)=O)C=CC2=C1)O
95%
BD14409
MFCD00004105
2,6-NAPHTHYRIDIN-1(2H)-ONE
CAS:80935-77-9
Formula: O=C1NC=CC2=C1C=CN=C2
97%
BD158284
MFCD06762736
2,6-NAPHTHYRIDIN-1(2H)-ONE HYDROBROMIDE
CAS:1182323-46-1
Formula: O=C1NC=CC2=C1C=CN=C2.[H]Br
95+%
BD297660
2,6-NAPHTHYRIDIN-1-AMINE
CAS:80935-81-5
Formula: NC1=NC=CC2=C1C=CN=C2
96%
BD285767
MFCD11506145
2,6-NAPHTHYRIDIN-3-OL
CAS:1308285-72-4
Formula: OC1=CC2=C(C=N1)C=CN=C2
97%
BD446393
2,6-PYRIDINEDICARBOXALDEHYDE
CAS:5431-44-7
Formula: O=CC1=NC(C=O)=CC=C1
98%
BD21339
MFCD00010103
2,6-PYRIDINEDIMETHANOL
CAS:1195-59-1
Formula: OCC1=NC(CO)=CC=C1
98%
BD5074
MFCD00006351
2,7,7-TRIMETHYL-6,7-DIHYDRO-5H-PYRROLO[3,4-D]PYRIMIDINE
CAS:1823951-91-2
Formula: CC1(C)NCC2=CN=C(C)N=C21
95%
BD440782
MFCD27922239
2,7,8-TRIAMINO-4-(3-BROMO-4,5-DIMETHOXYPHENYL)-4H-CHROMENE-3-CARBONITRILE
CAS:475576-83-1
Formula: N#CC1=C(N)OC2=C(C=CC(N)=C2N)C1C3=CC(OC)=C(OC)C(Br)=C3
95+%
BD249561
2,7,8-TRIMETHYLQUINOLIN-4-OL
CAS:449199-19-3
Formula: OC1=CC(C)=NC2=C(C)C(C)=CC=C12
95+%
BD349985
MFCD02968777
2,7-BIS(2-(DIMETHYLAMINO)ETHYL)BENZO[LMN][3,8]PHENANTHROLINE-1,3,6,8(2H,7H)-TETRAONE
CAS:22291-04-9
Formula: O=C(N(CCN(C)C)C(C(C=C1)=C23)=O)C3=CC=C(C(N4CCN(C)C)=O)C2=C1C4=O
95+%
BD262636
2,7-BIS(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)-1H-INDOLE
CAS:919119-72-5
Formula: CC1(C)C(C)(C)OB(C2=CC=CC3=C2NC(B4OC(C)(C)C(C)(C)O4)=C3)O1
98%
BD332092
MFCD12405487
2,7-BIS(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)-9,9'-SPIROBI[9H-FLUORENE]
CAS:728911-52-2
Formula: CC1(C)C(C)(C)OB(C2=CC3=C(C=C2)C4=C(C=C(B5OC(C)(C)C(C)(C)O5)C=C4)C36C7=C(C8=C6C=CC=C8)C=CC=C7)O1
98% HPLC,T)
BD00817966
2,7-BIS(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)TRIPHENYLENE
CAS:929103-40-2
Formula: CC1(C)C(C)(C)OB(C2=CC=C3C4=CC=C(B5OC(C)(C)C(C)(C)O5)C=C4C6=CC=CC=C6C3=C2)O1
97%
BD585603
2,7-BIS(4-BROMOPHENYL)-9-HEXYL-9H-CARBAZOLE
CAS:1884420-79-4
Formula: CCCCCCN1C2=C(C3=C1C=C(C4=CC=C(Br)C=C4)C=C3)C=CC(C5=CC=C(Br)C=C5)=C2
97%
BD491386
2,7-BIS(BROMOMETHYL)-9,9-DIHEXYL-9H-FLUORENE
CAS:187148-75-0
Formula: CCCCCCC1(CCCCCC)C2=C(C3=C1C=C(CBr)C=C3)C=CC(CBr)=C2
95+%
BD254716
MFCD07784372
2,7-BIS(TRIFLUOROMETHYL)PYRAZOLO[1,5-A]PYRIMIDIN-5(4H)-ONE
CAS:1245806-65-8
Formula: O=C1NC2=CC(C(F)(F)F)=NN2C(C(F)(F)F)=C1
97%
BD608286
2,7-DI(PYREN-1-YL)SPIRO[FLUORENE-9,9'-XANTHENE]
CAS:1160862-04-3
Formula: C1(C2(C3=C(OC4=C2C=CC=C4)C=CC=C3)C5=C6C=CC(C7=C(C8=C9%10)C=CC%10=CC=CC9=CC=C8C=C7)=C5)=C6C=CC(C%11=C
97%
BD763436
2,7-DI(PYRIDIN-4-YL)BENZO[LMN][3,8]PHENANTHROLINE-1,3,6,8(2H,7H)-TETRAONE
CAS:34151-49-0
Formula: O=C(N(C1=CC=NC=C1)C(C(C=C2)=C34)=O)C4=CC=C(C(N5C6=CC=NC=C6)=O)C3=C2C5=O
98%
BD765241
2,7-DI-TERT-BUTYL-9,9-DIMETHYL-9H-XANTHENE
CAS:130525-41-6
Formula: CC1(C)C2=C(OC3=C1C=C(C(C)(C)C)C=C3)C=CC(C(C)(C)C)=C2
95+%
BD68659
2,7-DI-TERT-BUTYLFLUORENE
CAS:58775-05-6
Formula: CC(C1=CC2=C(C=C1)C3=C(C=C(C(C)(C)C)C=C3)C2)(C)C
98%
BD68660
2,7-DI-TERT-BUTYLNAPHTHALENE
CAS:10275-58-8
Formula: CC(C1=CC2=CC(C(C)(C)C)=CC=C2C=C1)(C)C
97%
BD68661
2,7-DI-TERT-BUTYLPYRENE
CAS:24300-91-2
Formula: CC(C)(C)C1=CC2=C3C(C=CC4=CC(=CC(C=C2)=C34)C(C)(C)C)=C1
97%
BD237182
MFCD01013641
2,7-DIAMINO-1,3-BENZOXAZOLE-5-SULFONIC ACID
CAS:1820649-69-1
Formula: O=S(C1=CC(N)=C(OC(N)=N2)C2=C1)(O)=O
95%
BD00806675
2,7-DIAMINO-2-PHENYLHEPTANOIC ACID DIHYDROCHLORIDE
CAS:1177328-53-8
Formula: O=C(O)C(C1=CC=CC=C1)(N)CCCCCN.[H]Cl.[H]Cl
95+%
BD321463
MFCD09832407
2,7-DIAMINO-4-(3,4-DIMETHOXYPHENYL)-4H-CHROMENE-3-CARBONITRILE
CAS:326919-67-9
Formula: N#CC1=C(N)OC2=C(C=CC(N)=C2)C1C3=CC=C(OC)C(OC)=C3
97%
BD594295
MFCD00715997
2,7-DIAMINO-4-(PYRIDIN-3-YL)-4H-CHROMENE-3-CARBONITRILE
CAS:314767-75-4
Formula: N#CC1=C(N)OC2=C(C=CC(N)=C2)C1C3=CC=CN=C3
97%
BD594222
MFCD00486656
2,7-DIAMINO-4-PHENYL-4H-CHROMENE-3-CARBONITRILE
CAS:111861-39-3
Formula: N#CC1=C(N)OC2=C(C=CC(N)=C2)C1C3=CC=CC=C3
97%
BD185424
MFCD00235202
2,7-DIAMINO-FLUORENE
CAS:525-64-4
Formula: NC1=CC=C2C(CC3=CC(N)=CC=C23)=C1
98%
BD21218
MFCD00001128
2,7-DIAZABICYCLO[4.2.0]OCTANE
CAS:51392-74-6
Formula: C12NCCCC1NC2
95+%
BD315679
MFCD19226952
2,7-DIAZASPIRO[3.5]NONAN-1-ONE
CAS:1147422-92-1
Formula: O=C1NCC12CCNCC2
97%
BD280639
2,7-DIAZASPIRO[3.5]NONAN-1-ONE HYDROCHLORIDE
CAS:1818847-63-0
Formula: O=C1NCC12CCNCC2.[H]Cl
95+%
BD281390
2,7-DIAZASPIRO[3.5]NONANE
CAS:136098-14-1
Formula: C1NCC12CCNCC2
95+%
BD254668
MFCD13193041
2,7-DIAZASPIRO[3.5]NONANE DIHYDROCHLORIDE
CAS:1334499-85-2
Formula: [H]Cl.[H]Cl.C1NCC12CCNCC2
97%
BD329005
MFCD20261446
2,7-DIAZASPIRO[4.4]NONAN-1-ONE
CAS:1203796-97-7
Formula: O=C1NCCC12CNCC2
95+%
BD246908
MFCD22372537
2,7-DIAZASPIRO[4.4]NONAN-1-ONE HYDROCHLORIDE
CAS:1203682-17-0
Formula: O=C1NCCC12CNCC2.[H]Cl
95+%
BD253993
2,7-DIAZASPIRO[4.4]NONAN-3-ONE
CAS:1226550-00-0
Formula: O=C1NCC2(CNCC2)C1
95+%
BD246912
MFCD19226811
2,7-DIAZASPIRO[4.4]NONAN-3-ONE HYDROCHLORIDE
CAS:1393330-70-5
Formula: O=C1NCC2(CNCC2)C1.[H]Cl
95+%
BD301468
n/a
2,7-DIAZASPIRO[4.4]NONANE
CAS:175-96-2
Formula: C1NCCC12CNCC2
95+%
BD249403
MFCD08752486
2,7-DIAZASPIRO[4.4]NONANE DIHYDROBROMIDE
CAS:77415-55-5
Formula: C1NCCC12CNCC2.[H]Br.[H]Br
95+%
BD288626
MFCD27964259
2,7-DIAZASPIRO[4.4]NONANE DIHYDROCHLORIDE
CAS:1394122-72-5
Formula: [H]Cl.[H]Cl.C1NCCC12CNCC2
98%
BD571619
MFCD10700113
2,7-DIAZASPIRO[4.4]NONANE HYDROCHLORIDE
CAS:N/A
Formula: [H]Cl.C1C2(CCNC2)CCN1
95%
BD00790360
2,7-DIAZASPIRO[4.4]NONANE-1,3,6,8-TETRAONE
CAS:77415-70-4
Formula: O=C1NC(CC12C(NC(C2)=O)=O)=O
95+%
BD219087
2,7-DIAZASPIRO[4.5]DECAN-1-ONE
CAS:887118-43-6
Formula: C1(C2(CCN1)CCCNC2)=O
95+%
BD162596
MFCD12406550
2,7-DIAZASPIRO[4.5]DECAN-1-ONE HYDROCHLORIDE
CAS:1187173-43-8
Formula: O=C1NCCC21CNCCC2.[H]Cl
97%
BD163498
MFCD08460858
2,7-DIAZASPIRO[4.5]DECAN-3-ONE
CAS:1158750-89-0
Formula: O=C1CC2(CN1)CCCNC2
95+%
BD235226
MFCD12406549
2,7-DIAZASPIRO[4.5]DECAN-3-ONE HYDROCHLORIDE
CAS:1385696-86-5
Formula: O=C1NCC2(CNCCC2)C1.Cl
95+%
BD279804
2,7-DIAZASPIRO[4.5]DECANE
CAS:40865-50-7
Formula: C1NCCC12CNCCC2
95+%
BD215911
MFCD13180577
2,7-DIAZASPIRO[4.5]DECANE DIHYDROCHLORIDE
CAS:1334499-87-4
Formula: [H]Cl.[H]Cl.C1NCCC12CNCCC2
97%
BD329006
MFCD10700110
2,7-DIBENZYL-2,7-DIAZASPIRO[4.4]NONANE
CAS:77415-72-6
Formula: N1(CC2=CC=CC=C2)CC3(CN(CC4=CC=CC=C4)CC3)CC1
95+%
BD68604
MFCD06858480
2,7-DIBROMO-[1,2,4]TRIAZOLO[1,5-A]PYRIDINE
CAS:1380331-15-6
Formula: BrC1=CC2=NC(Br)=NN2C=C1
95+%
BD329422
MFCD22574163
2,7-DIBROMO-2',3',5',6'-TETRAHYDROSPIRO[FLUORENE-9,4'-PYRAN]
CAS:934269-17-7
Formula: BrC1=CC2=C(C=C1)C3=C(C=C(Br)C=C3)C24CCOCC4
98%
BD242830
MFCD09800926
2,7-DIBROMO-2',7'-DI-TERT-BUTYL-9,9'-SPIROBI[FLUORENE]
CAS:439791-57-8
Formula: CC(C1=CC2=C(C=C1)C3=C(C42C5=C(C6=C4C=C(Br)C=C6)C=CC(Br)=C5)C=C(C(C)(C)C)C=C3)(C)C
98%
BD334367
MFCD20921692
2,7-DIBROMO-3,4-DIHYDRONAPHTHALEN-1(2H)-ONE
CAS:148378-71-6
Formula: O=C1C(Br)CCC2=C1C=C(Br)C=C2
97%
BD435985
MFCD26521751
2,7-DIBROMO-3,6-DI-TERT-BUTYL-9H-FLUORENE
CAS:106112-41-8
Formula: CC(C1=CC2=C(CC3=C2C=C(C(C)(C)C)C(Br)=C3)C=C1Br)(C)C
95%
BD00769082
n/a
2,7-DIBROMO-3,6-DIMETHOXYNAPHTHALENE
CAS:105404-89-5
Formula: COC1=CC2=CC(OC)=C(Br)C=C2C=C1Br
95+%
BD68606
MFCD01851104
2,7-DIBROMO-3,6-DIMETHYL-9H-FLUORENE
CAS:1047991-77-4
Formula: CC1=CC2=C(CC3=C2C=C(C)C(Br)=C3)C=C1Br
95%
BD00779792
n/a
2,7-DIBROMO-3-METHYL-5H-PYRROLO[2,3-B]PYRAZINE
CAS:N/A
Formula: CC1N=C2NC=C(Br)C2=NC=1Br
95%
BD00736823
n/a
2,7-DIBROMO-4,4,9,9-TETRAKIS(4-HEXYLPHENYL)-4,9-DIHYDRO-S-INDACENO[1,2-B:5,6-B']DITHIOPHENE
CAS:1049034-71-0
Formula: CCCCCCC1=CC=C(C2(C3=CC(C4=C5C=C(S4)Br)=C(C(C6=CC=C(C=C6)CCCCCC)5C7=CC=C(C=C7)CCCCCC)C=C3C8=C2C=C(S8)
95+%
BD254723
2,7-DIBROMO-5,10-DIPHENYL-5,10-DIHYDROINDOLO[3,2-B]INDOLE
CAS:1919062-54-6
Formula: BrC1=CC(N2C3=CC=CC=C3)=C(C(N4C5=CC=CC=C5)=C2C6=C4C=C(Br)C=C6)C=C1
97%
BD438469
MFCD28291924
2,7-DIBROMO-5-(PHENYLSULFONYL)-5H-PYRROLO[2,3-B]PYRAZINE
CAS:N/A
Formula: O=S(N1C=C(Br)C2=NC(Br)=CN=C21)(C3=CC=CC=C3)=O
97%
BD752320
2,7-DIBROMO-5-METHYL-5H-PYRROLO[2,3-B]PYRAZINE
CAS:N/A
Formula: CN1C=C(Br)C2=NC(Br)=CN=C21
97%
BD751443
2,7-DIBROMO-5-TOSYL-5H-PYRROLO[2,3-B]PYRAZINE
CAS:N/A
Formula: O=S(=O)(C1C=CC(C)=CC=1)N1C2C(=NC(=CN=2)Br)C(Br)=C1
95%
BD00782854
n/a
2,7-DIBROMO-5H-PYRROLO[2,3-B]PYRAZINE
CAS:1209703-87-6
Formula: BrC1=CN=C2NC=C(Br)C2=N1
95+%
BD159021
MFCD11109803
2,7-DIBROMO-6-METHOXYBENZO[D]THIAZOLE
CAS:440123-48-8
Formula: COC1=CC=C2N=C(Br)SC2=C1Br
95%
BD00777921
n/a
2,7-DIBROMO-9,9'-SPIROBIFLUORENE
CAS:171408-84-7
Formula: BrC1=CC2=C(C=C1)C3=C(C=C(Br)C=C3)C24C5=C(C6=C4C=CC=C6)C=CC=C5
98%
BD18842
MFCD08704218
2,7-DIBROMO-9,9-BIS(2-ETHYLHEXYL)-9H-FLUORENE
CAS:188200-93-3
Formula: CCCCC(CC)CC1(CC(CC)CCCC)C2=C(C3=C1C=C(Br)C=C3)C=CC(Br)=C2
95+%
BD245816
MFCD03427217
2,7-DIBROMO-9,9-BIS(6-BROMOHEXYL)-9H-FLUORENE
CAS:570414-33-4
Formula: BrCCCCCCC1(CCCCCCBr)C2=C(C3=C1C=C(Br)C=C3)C=CC(Br)=C2
98%
BD331657
MFCD09260450
2,7-DIBROMO-9,9-DI-P-TOLYL-9H-FLUORENE
CAS:357645-37-5
Formula: CC1=CC=C(C2(C3=CC=C(C)C=C3)C4=C(C5=C2C=C(Br)C=C5)C=CC(Br)=C4)C=C1
95+%
BD254678
MFCD16619300
2,7-DIBROMO-9,9-DIDECYL-9H-FLUORENE
CAS:175922-78-8
Formula: CCCCCCCCCCC1(CCCCCCCCCC)C2=C(C3=C1C=C(Br)C=C3)C=CC(Br)=C2
97%
BD165621
2,7-DIBROMO-9,9-DIDODECYL-9H-FLUORENE
CAS:286438-45-7
Formula: CCCCCCCCCCCCC1(CCCCCCCCCCCC)C2=C(C3=C1C=C(Br)C=C3)C=CC(Br)=C2
97%
BD165631
MFCD03427214
2,7-DIBROMO-9,9-DIFLUORO-9H-FLUORENE
CAS:1229603-71-7
Formula: FC1(F)C2=C(C3=C1C=C(Br)C=C3)C=CC(Br)=C2
98%
BD280361
2,7-DIBROMO-9,9-DIHEXYL-9H-FLUORENE
CAS:189367-54-2
Formula: CCCCCCC1(CCCCCC)C2=C(C3=C1C=C(Br)C=C3)C=CC(Br)=C2
97%
BD19070
MFCD03427215
2,7-DIBROMO-9,9-DIMETHYL-9,10-DIHYDROACRIDINE
CAS:1333316-35-0
Formula: CC1(C)C2=C(C=CC(Br)=C2)NC3=CC=C(Br)C=C13
97%
BD627869
n/a
2,7-DIBROMO-9,9-DIMETHYL-9H-FLUORENE
CAS:28320-32-3
Formula: CC1(C)C2=C(C3=C1C=C(Br)C=C3)C=CC(Br)=C2
98%
BD111599
MFCD00099471
2,7-DIBROMO-9,9-DIPHENYL-9H-FLUORENE
CAS:186259-63-2
Formula: BrC1=CC2=C(C=C1)C3=C(C=C(Br)C=C3)C2(C4=CC=CC=C4)C5=CC=CC=C5
97%
BD68609
2,7-DIBROMO-9,9-DIPROPYLFLUORENE
CAS:157771-56-7
Formula: CCCC1(CCC)C2=C(C3=C1C=C(Br)C=C3)C=CC(Br)=C2
95+%
BD306183
MFCD12024280
2,7-DIBROMO-9-(2-ETHYLHEXYL)-9H-CARBAZOLE
CAS:544436-46-6
Formula: CCCCC(CC)CN1C2=C(C3=C1C=C(Br)C=C3)C=CC(Br)=C2
95+%
BD247411
2,7-DIBROMO-9-(4-BROMOPHENYL)-9H-CARBAZOLE
CAS:1313900-20-7
Formula: BrC1=CC=C(N2C3=C(C4=C2C=C(Br)C=C4)C=CC(Br)=C3)C=C1
98% HPLC)
BD00805738
2,7-DIBROMO-9-(HEPTADECAN-9-YL)-9H-CARBAZOLE
CAS:955964-73-5
Formula: CCCCCCCCC(N1C2=C(C3=C1C=C(Br)C=C3)C=CC(Br)=C2)CCCCCCCC
95+%
BD247413
MFCD16619379
2,7-DIBROMO-9-HEPTYL-9H-CARBAZOLE
CAS:1173071-58-3
Formula: CCCCCCCN1C2=C(C3=C1C=C(Br)C=C3)C=CC(Br)=C2
98% GC)
BD00757312
2,7-DIBROMO-9-HEXYL-9H-CARBAZOLE
CAS:654676-12-7
Formula: CCCCCCN1C2=C(C3=C1C=C(Br)C=C3)C=CC(Br)=C2
97%
BD491250
2,7-DIBROMO-9-OCTYL-9H-CARBAZOLE
CAS:726169-75-1
Formula: CCCCCCCCN1C2=C(C3=C1C=C(Br)C=C3)C=CC(Br)=C2
95+%
BD247407
2,7-DIBROMO-9-PHENYL-9H-CARBAZOLE
CAS:444796-09-2
Formula: BrC1=CC2=C(C=C1)C3=C(C=C(Br)C=C3)N2C4=CC=CC=C4
95%
BD331621
2,7-DIBROMO-9-PHENYL-9H-FLUOREN-9-OL
CAS:132717-37-4
Formula: OC1(C2=CC=CC=C2)C3=C(C4=C1C=C(Br)C=C4)C=CC(Br)=C3
98%
BD111774
2,7-DIBROMO-9H-CARBAZOLE
CAS:136630-39-2
Formula: BrC1=CC2=C(C=C1)C3=C(C=C(Br)C=C3)N2
98%
BD68612
MFCD09033507
2,7-DIBROMO-9H-FLUOREN-4-AMINE
CAS:1785-09-7
Formula: NC1=CC(Br)=CC(C2)=C1C3=C2C=C(Br)C=C3
98%
BD00787405
2,7-DIBROMO-9H-FLUOREN-9-ONE
CAS:14348-75-5
Formula: C3=C2C1=C(C=C(Br)C=C1)C(C2=CC(=C3)Br)=O
98%
BD18340
MFCD00010790
2,7-DIBROMO-9H-FLUORENE
CAS:16433-88-8
Formula: C1=C(Br)C=CC2=C1CC3=C2C=CC(=C3)Br
97%
BD15028
MFCD00019048
2,7-DIBROMOBENZO[D]THIAZOLE
CAS:1188090-10-9
Formula: BrC1C=CC=C2N=C(Br)SC=12
95+%
BD00750975
n/a
2,7-DIBROMONAPHTHALENE
CAS:58556-75-5
Formula: BrC2=CC1=CC(=CC=C1C=C2)Br
98%
BD41823
MFCD00238580
2,7-DIBROMOPHENANTHRENE
CAS:62325-30-8
Formula: BrC1=CC=C2C3=CC=C(Br)C=C3C=CC2=C1
98%
BD68615
MFCD09909861
2,7-DIBROMOPHENANTHRENE-9,10-DIONE
CAS:84405-44-7
Formula: O=C1C2=C(C=CC(Br)=C2)C3=CC=C(Br)C=C3C1=O
97%
BD68607
MFCD03931078
2,7-DIBROMOPYRENE
CAS:102587-98-4
Formula: BrC1=CC2=CC=C3C=C(Br)C=C(C3=C24)C=CC4=C1
95+%
BD68616
MFCD09909862
2,7-DIBROMOQUINOLINE
CAS:1334405-59-2
Formula: BrC1=CC=C2C=CC(Br)=NC2=C1
95%
BD216206
MFCD09261125
2,7-DIBROMOSPIRO[FLUORENE-9,9'-XANTHENE]
CAS:198142-65-3
Formula: BrC1=CC2=C(C=C1)C3=C(C=C(Br)C=C3)C24C5=C(OC6=C4C=CC=C6)C=CC=C5
97%
BD626202
2,7-DIBROMOTHIAZOLO[4,5-C]PYRIDINE
CAS:N/A
Formula: BrC1C2SC(=NC=2C=NC=1)Br
95%
BD00732440
n/a
2,7-DIBROMOTRIPHENYLENE
CAS:888041-37-0
Formula: BrC1=CC=C2C3=CC=C(Br)C=C3C4=CC=CC=C4C2=C1
97%
BD290597
MFCD22571695
2,7-DICHLORO-1,8-NAPHTHYRIDINE
CAS:55243-02-2
Formula: ClC1=CC=C2C=CC(Cl)=NC2=N1
97%
BD68617
MFCD08234796
2,7-DICHLORO-1-HEPTENE
CAS:485320-12-5
Formula: C=C(Cl)CCCCCCl
95+%
BD308184
MFCD00671829
2,7-DICHLORO-4,8-DIMETHYLQUINOLINE
CAS:326481-08-7
Formula: CC1=C2N=C(Cl)C=C(C)C2=CC=C1Cl
97%
BD624730
2,7-DICHLORO-4-METHYL-N-PHENYLQUINOLINE-6-SULFONAMIDE
CAS:1418265-69-6
Formula: O=S(C1=C(Cl)C=C2N=C(Cl)C=C(C)C2=C1)(NC3=CC=CC=C3)=O
97%
BD616127
2,7-DICHLORO-4-METHYLQUINOLINE
CAS:59666-16-9
Formula: CC1=CC(Cl)=NC2=CC(Cl)=CC=C12
95+%
BD274465
2,7-DICHLORO-4-METHYLQUINOLINE-6-SULFONAMIDE
CAS:1418265-71-0
Formula: O=S(C1=C(Cl)C=C2N=C(Cl)C=C(C)C2=C1)(N)=O
97%
BD616128
2,7-DICHLORO-4-OXO-4H-PYRIDO[1,2-A]PYRIMIDINE-3-CARBALDEHYDE
CAS:1204297-25-5
Formula: O=CC1=C(Cl)N=C(C=CC(Cl)=C2)N2C1=O
97%
BD00806336
2,7-DICHLORO-5-((2-(TRIMETHYLSILYL)ETHOXY)METHYL)-5H-PYRROLO[2,3-B]PYRAZINE
CAS:N/A
Formula: C[Si](C)(C)CCOCN1C2C(=NC(=CN=2)Cl)C(Cl)=C1
95%
BD00720646
n/a
2,7-DICHLORO-5-(METHYLSULFONYL)-5H-PYRROLO[3,2-D]PYRIMIDINE
CAS:N/A
Formula: O=S(N1C=C(Cl)C2=NC(Cl)=NC=C21)(C)=O
97%
BD753818
2,7-DICHLORO-5-(TRIISOPROPYLSILYL)-5H-PYRROLO[2,3-B]PYRAZINE
CAS:N/A
Formula: CC(C)[Si](C(C)C)(C(C)C)N1C2C(=NC(=CN=2)Cl)C(Cl)=C1
95%
BD00765921
n/a
2,7-DICHLORO-5-METHYL-5H-PYRROLO[3,2-D]PYRIMIDINE
CAS:N/A
Formula: CN1C2C(=NC(=NC=2)Cl)C(Cl)=C1
95%
BD00802988
n/a
2,7-DICHLORO-5-TOSYL-5H-PYRROLO[2,3-B]PYRAZINE
CAS:N/A
Formula: O=S(N1C=C(Cl)C2=NC(Cl)=CN=C21)(C3=CC=C(C)C=C3)=O
97%
BD752649
2,7-DICHLORO-5-TRITYL-5H-PYRROLO[2,3-B]PYRAZINE
CAS:N/A
Formula: ClC1=CN(C(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4)C5=NC=C(Cl)N=C51
97%
BD753617
2,7-DICHLORO-5H-PYRROLO[2,3-B]PYRAZINE
CAS:N/A
Formula: ClC1C2C(=NC=C(N=2)Cl)NC=1
95%
BD00751101
n/a
2,7-DICHLORO-5H-PYRROLO[3,2-D]PYRIMIDINE
CAS:1934415-98-1
Formula: ClC1=CNC2=CN=C(Cl)N=C21
97%
BD753732
2,7-DICHLORO-6-FLUOROQUINAZOLIN-4(3H)-ONE
CAS:1227170-09-3
Formula: OC1=C2C=C(F)C(Cl)=CC2=NC(Cl)=N1
97%
BD633788
2,7-DICHLORO-6-FLUOROQUINAZOLINE
CAS:1512749-33-5
Formula: FC1=CC2=CN=C(Cl)N=C2C=C1Cl
97%
BD633827
2,7-DICHLORO-6-IODOQUINAZOLIN-4(3H)-ONE
CAS:540501-10-8
Formula: OC1=C2C=C(I)C(Cl)=CC2=NC(Cl)=N1
97%
BD633789
2,7-DICHLORO-6-METHOXYBENZO[D]THIAZOLE
CAS:1784096-83-8
Formula: COC1C(Cl)=C2C(N=C(S2)Cl)=CC=1
95+%
BD00753821
MFCD28968767
2,7-DICHLORO-6-METHYLQUINOXALINE
CAS:1163123-60-1
Formula: CC1=C(Cl)C=C2N=C(Cl)C=NC2=C1
95+%
BD269188
2,7-DICHLORO-8-METHYLQUINOLINE
CAS:1215205-97-2
Formula: CC1=C2N=C(Cl)C=CC2=CC=C1Cl
98%
BD231303
MFCD15143625
2,7-DICHLORO-9H-FLUORENE
CAS:7012-16-0
Formula: ClC1=CC2=C(C=C1)C3=C(C=C(Cl)C=C3)C2
97%
BD68621
MFCD00032840
2,7-DICHLORO-ALPHA-[(DIBUTYLAMINO)METHYL]-9H-FLUORENE-4-METHANOL
CAS:69759-61-1
Formula: OC(CN(CCCC)CCCC)C1=CC(Cl)=CC(C2)=C1C3=C2C=C(Cl)C=C3
97%
BD165241
2,7-DICHLOROBENZO[D]OXAZOLE
CAS:86691-34-1
Formula: ClC1=C(OC(Cl)=N2)C2=CC=C1
95+%
BD216798
2,7-DICHLOROBENZO[D]THIAZOL-4-AMINE
CAS:70200-93-0
Formula: NC1=C2N=C(Cl)SC2=C(Cl)C=C1
95+%
BD269520
2,7-DICHLOROBENZO[D]THIAZOL-6-AMINE
CAS:70200-94-1
Formula: NC1=CC=C2N=C(Cl)SC2=C1Cl
95+%
BD269519
2,7-DICHLOROBENZO[D]THIAZOLE
CAS:2942-23-6
Formula: ClC1=NC2=C(S1)C(Cl)=CC=C2
97%
BD237173
MFCD09037778
2,7-DICHLORODIHYDROFLUORESCEIN DIACETATE
CAS:4091-99-0
Formula: O=C(O)C1=CC=CC=C1C2C3=C(OC4=C2C=C(Cl)C(OC(C)=O)=C4)C=C(OC(C)=O)C(Cl)=C3
95+%
BD221268
MFCD00128955
2,7-DICHLOROFLUORESCEIN
CAS:76-54-0
Formula: O=C1OC2(C3=C(OC4=C2C=C(Cl)C(O)=C4)C=C(O)C(Cl)=C3)C5=C1C=CC=C5
95%
BD68622
MFCD00005047
2,7-DICHLOROIMIDAZO[1,2-A]PYRIDINE
CAS:190074-50-1
Formula: ClC1=CN2C=CC(Cl)=CC2=N1
96%
BD27899
MFCD06739216
2,7-DICHLOROPYRAZOLO[1,5-A]PYRIMIDINE
CAS:1211535-91-9
Formula: ClC1N2C(=CC(=N2)Cl)N=CC=1
95+%
BD00758793
n/a
2,7-DICHLOROPYRIDO[4,3-D]PYRIMIDIN-4(3H)-ONE
CAS:N/A
Formula: O=C1NC(Cl)=NC2C=C(Cl)N=CC1=2
95%
BD00779486
2,7-DICHLOROPYRIDO[4,3-D]PYRIMIDIN-4-AMINE
CAS:N/A
Formula: NC1N=C(Cl)N=C2C=C(Cl)N=CC=12
95%
BD00762269
2,7-DICHLOROPYRIDO[4,3-D]PYRIMIDIN-4-OL
CAS:N/A
Formula: OC1N=C(Cl)N=C2C=C(Cl)N=CC=12
95%
BD00730442
2,7-DICHLOROPYRIDO[4,3-D]PYRIMIDINE
CAS:N/A
Formula: ClC1N=CC2C(=NC(=NC=2)Cl)C=1
95%
BD00768751
2,7-DICHLOROQUINAZOLIN-4(3H)-ONE
CAS:20197-96-0
Formula: O=C1NC(Cl)=NC2=C1C=CC(Cl)=C2
95+%
BD224912
MFCD11520688
2,7-DICHLOROQUINAZOLIN-4-AMINE
CAS:111218-91-8
Formula: NC1=C2C=CC(Cl)=CC2=NC(Cl)=N1
95+%
BD245256
MFCD00563869
2,7-DICHLOROQUINAZOLINE
CAS:67092-19-7
Formula: ClC1=CC2=NC(Cl)=NC=C2C=C1
95+%
BD286480
MFCD15527158
2,7-DICHLOROQUINOLINE
CAS:613-77-4
Formula: ClC1=CC=C2C=CC(Cl)=NC2=C1
95+%
BD334783
MFCD00830402
2,7-DICHLOROQUINOLINE-3-CARBALDEHYDE
CAS:73568-33-9
Formula: O=CC1=CC2=CC=C(Cl)C=C2N=C1Cl
95+%
BD386750
MFCD06202348
2,7-DICHLOROQUINOXALINE
CAS:59489-31-5
Formula: ClC1=CC=C2N=CC(Cl)=NC2=C1
98%
BD34237
2,7-DICHLOROTHIAZOLO[4,5-C]PYRIDINE
CAS:N/A
Formula: ClC1C2SC(=NC=2C=NC=1)Cl
95%
BD00713627
n/a
2,7-DICHLOROTHIAZOLO[4,5-D]PYRIMIDIN-5-AMINE
CAS:1266572-32-0
Formula: NC1=NC(Cl)=C(SC(Cl)=N2)C2=N1
95+%
BD281275
2,7-DICHLOROTHIAZOLO[5,4-C]PYRIDINE
CAS:884860-61-1
Formula: ClC1=NC2=C(S1)C=NC=C2Cl
95+%
BD204360
MFCD13193435
2,7-DICHLOROTHIAZOLO[5,4-D]PYRIMIDINE
CAS:19602-61-0
Formula: ClC1=C2C(SC(Cl)=N2)=NC=N1
95+%
BD68627
MFCD09702028
2,7-DIDEACETOXYTAXININE J
CAS:115810-14-5
Formula: O=C(O[C@H](C1=C)CC[C@]2(C)[C@]1([H])C[C@](C3(C)C)([H])C[C@H](OC(C)=O)C(C)=C3[C@@H](OC(C)=O)[C@@H]2OC
95+%
BD299324
2,7-DIFLURO-3,6-BIS[(2-METHOXYETHOXY)METHOXY]-9H-XANTHEN-9-ONE
CAS:430459-53-3
Formula: O=C1C2=C(OC3=C1C=C(F)C(OCOCCOC)=C3)C=C(OCOCCOC)C(F)=C2
95+%
BD306794
n/a
2,7-DIHEXYLBENZO[LMN][3,8]PHENANTHROLINE-1,3,6,8(2H,7H)-TETRAONE
CAS:23536-15-4
Formula: O=C1C2=CC=C3C4=C(C(=O)N(CCCCCC)C3=O)C=CC(=C24)C(=O)N1CCCCCC
95+%
BD00687265
n/a
2,7-DIHYDROHOMOERYSOTRINE
CAS:51095-85-3
Formula: CO[C@H]1CC=C2CCN3CCCC4=CC(OC)=C(OC)C=C4[C@@]32C1
95+%
BD298790
2,7-DIHYDROXY-1-NAPHTHALDEHYDE
CAS:20258-95-1
Formula: O=CC1=C2C=C(O)C=CC2=CC=C1O
97%
BD583887
2,7-DIHYDROXY-2H-1,4-BENZOXAZIN-3(4H)-ONE
CAS:69804-59-7
Formula: O=C1NC2=CC=C(O)C=C2OC1O
95+%
BD235929
2,7-DIHYDROXY-9-FLUORENONE
CAS:42523-29-5
Formula: OC1=CC2=C(C=C1)C1=C(C=C(O)C=C1)C2=O
98%
BD7941
MFCD00037141
2,7-DIHYDROXYANTHRACENE-9,10-DIONE
CAS:572-93-0
Formula: O=C1C2C(=CC=C(C=2)O)C(=O)C2C=CC(=CC1=2)O
95+%
BD00739507
n/a
2,7-DIHYDROXYNAPHTHALENE
CAS:582-17-2
Formula: OC1=CC2=CC(O)=CC=C2C=C1
97%
BD68634
MFCD00004085
2,7-DIHYDROXYQUINOLINE
CAS:70500-72-0
Formula: OC2=NC1=CC(=CC=C1C=C2)O
98%
BD30961
MFCD07644575
2,7-DIIODO-9,9-DIMETHYL-9H-FLUORENE
CAS:144981-86-2
Formula: CC1(C)C2=CC(I)=CC=C2C2=CC=C(I)C=C12
98%
BD238722
MFCD12827985
2,7-DIIODO-9H-FLUORENE
CAS:16218-28-3
Formula: IC1=CC=C2C(CC3=CC(I)=CC=C23)=C1
98%
BD68637
MFCD00040153
2,7-DIIODOPHENANTHRENE-9,10-DIONE
CAS:16218-32-9
Formula: O=C1C2=C(C=CC(I)=C2)C3=CC=C(I)C=C3C1=O
95+%
BD68638
2,7-DIISOPROPYLNAPHTHALENE
CAS:40458-98-8
Formula: CC(C1=CC2=CC(C(C)C)=CC=C2C=C1)C
95%
BD00791175
2,7-DIMETHOXY-1,4,5,8-TETRAHYDRONAPHTHALENE
CAS:1614-82-0
Formula: COC1=CCC2=C(C1)CC(OC)=CC2
95+%
BD32158
MFCD00269695
2,7-DIMETHOXY-1,5-NAPHTHYRIDINE
CAS:1003944-36-2
Formula: COC1=CN=C2C=CC(OC)=NC2=C1
95+%
BD245283
MFCD20925356
2,7-DIMETHOXY-1,8-NAPHTHYRIDINE-4-CARBALDEHYDE
CAS:N/A
Formula: O=CC1=CC(OC)=NC2=NC(OC)=CC=C12
BD00796069
2,7-DIMETHOXY-1-NAPHTHAMIDE
CAS:1706453-95-3
Formula: O=C(C1=C2C=C(OC)C=CC2=CC=C1OC)N
97%
BD619832
2,7-DIMETHOXY-1-NAPHTHOIC ACID
CAS:17953-58-1
Formula: O=C(C1=C2C=C(OC)C=CC2=CC=C1OC)O
97%
BD623949
2,7-DIMETHOXY-1-NAPHTHONITRILE
CAS:16000-40-1
Formula: N#CC1=C2C=C(OC)C=CC2=CC=C1OC
97%
BD618664
2,7-DIMETHOXY-9H-CARBAZOLE
CAS:61822-18-2
Formula: COC1=CC2=C(C=C1)C3=C(C=C(OC)C=C3)N2
98%
BD492962
2,7-DIMETHOXYNAPHTHALENE
CAS:3469-26-9
Formula: COC1=CC2=CC(OC)=CC=C2C=C1
97%
BD68641
MFCD00004064
2,7-DIMETHOXYQUINOLINE-3-CARBALDEHYDE
CAS:95395-23-6
Formula: O=CC1=CC2=CC=C(OC)C=C2N=C1OC
95+%
BD183646
MFCD06800600
2,7-DIMETHYL-[1,2,4]TRIAZOLO[1,5-A]PYRIMIDINE-6-CARBOXYLIC ACID
CAS:108129-01-7
Formula: O=C(C1=C(C)N2C(N=C1)=NC(C)=N2)O
97%
BD196024
MFCD09439067
2,7-DIMETHYL-1-PROPYL-1H-INDOLE-3-CARBALDEHYDE
CAS:1134334-37-4
Formula: O=CC1=C(C)N(CCC)C2=C1C=CC=C2C
97%
BD177239
MFCD12027451
2,7-DIMETHYL-1H-BENZO[D]IMIDAZOLE
CAS:23291-66-9
Formula: CC1=C2NC(C)=NC2=CC=C1
95+%
BD272277