Phone (USA) +1 212-348-5610
Whatsapp: +1 516-336-9307
WeChat: chembuyersguide
Chemical Search
 


























BLD Pharmatech Ltd.




Country: China

BLD Pharmatech Ltd.
488 Taoqiao Road, Building 5, 5F
HuiNan Town, Pudong New Area,
Shanghai 201203, China


Phone: +86-21-61629022
E-Mail:E-Mail this Supplier

Contact: sales team

http://www.bldpharm.com

BLD Pharmatech Ltd.

Page: Home | 1 | 2 | 3 | 4 | 5 | 6 | 7 | 8 | 9 | 10 | 11 | 12 | 13 | 14 | 15 | 16 | 17 | 18 | 19 | 20 | 21 | 22 | 23 | 24 | 25 | 26 | 27 | 28 | 29 | 30 | 31 | 32 | 33 | 34 | 35 | 36 | 37 | 38 | 39 | 40 | 41 | 42 | 43 | 44 | 45 | 46 | 47 | 48 | 49 | 50 | 51 | 52 | 53 | 54 | 55 | 56 | 57 | 58 | 59 | 60 | 61 | 62 | 63 | 64 | 65 | 66 | 67 | 68 | 69 | 70 | 71 | 72 | 73 | 74 | 75 | 76 | 77 | 78 | 79 | 80 | 81 | 82 | 83 | 84 | 85 | 86 | 87 | 88 | 89 | 90 | 91 | 92 | 93 | 94 | 95 | 96 | 97 | 98 | 99 | 100 | 101 | 102 | 103 | 104 | 105 | 106 | 107 | 108 | 109 | 110 | 111 | 112 | 113 | 114 | 115 | 116 | 117 | 118 | 119 | 120 | 121 | 122 | 123 | 124 | 125 | 126 | 127 | 128 | 129 | 130 | 131 | 132 | 133 | 134 | 135 | 136 | 137 | 138 | 139 | 140 | 141 | 142 | 143 | 144 | 145 | 146 | 147 | 148 | 149 | 150 | 151 | 152 | 153 | 154 | 155 | 156 | 157 | 158 | 159 | 160 | 161 | 162 | 163 | 164 | 165 | 166 | 167 | 168 | 169 | 170 | 171 | 172 | 173 | 174 | 175 | 176 | 177 | 178 | 179 | 180 | 181 | 182 | 183 | 184 | 185 | 186 | 187 | 188 | 189 | 190 | 191 | 192 | 193 | 194 | 195 | 196 | 197 | 198 | 199 | 200 | 201 | 202 | 203 | 204 | 205 | 206 | 207 | 208 | 209 | 210 | 211 | 212 | 213 | 214 | 215 | 216 | 217 | 218 | 219 | 220 | 221 | 222 | 223 | 224 | 225 | 226 | 227 | 228 | 229 | 230 | 231 | 232 | 233 | 234 | 235 | 236 | 237 | 238 | 239 | 240 | 241 | 242 | 243 | 244 | 245 | 246 | 247 | 248 | 249 | 250 | 251 | 252 | 253 | 254 | 255 | 256 | 257 | 258 | 259 | 260 | 261 | 262 | 263 | 264 | 265 | 266 | 267 | 268 | 269 | 270 | 271 | 272 | 273 | 274 | 275 | 276 | 277 | 278 | 279 | 280 | 281 | 282 | 283 | 284 | 285 | 286 | 287 | 288 | 289 | 290 | 291 | 292 | 293 | 294 | 295 | 296 | 297 | 298 | 299 | 300 | 301 | 302 | 303 | 304 | 305 | 306 | 307 | 308 | 309 | 310 | 311 | 312 | 313 | 314 | 315 | 316 | 317 | 318 | 319 | 320 | 321 | 322 | 323 | 324 |
 


Product List

2,4,5-TRIFLUOROPYRIMIDINE
CAS:17573-79-4
Formula: FC1=CN=C(F)N=C1F
BD196490
97%
MFCD11845791
2,4,5-TRIHYDROXYBENZALDEHYDE
CAS:35094-87-2
Formula: OC1=CC(O)=C(C=O)C=C1O
BD4707
98%
MFCD00016592
2,4,5-TRIIODO-1-METHYLIMIDAZOLE
CAS:37067-97-3
Formula: IC1=C(N=C(N1C)I)I
BD00868274
98%
MFCD11850344
2,4,5-TRIIODO-1H-IMIDAZOLE
CAS:1746-25-4
Formula: IC1=NC(I)=C(I)N1
BD32300
98%
MFCD00068812
2,4,5-TRIMETHOXYANILINE
CAS:26510-91-8
Formula: COC1=CC(N)=C(OC)C=C1OC
BD66139
97%
MFCD03840519
2,4,5-TRIMETHOXYBENZALDEHYDE
CAS:4460-86-0
Formula: O=CC1=CC(OC)=C(OC)C=C1OC
BD33671
98%
MFCD00003312
2,4,5-TRIMETHOXYBENZOHYDRAZIDE
CAS:588677-34-3
Formula: O=C(NN)C1=CC(OC)=C(OC)C=C1OC
BD172494
95+%
MFCD03423206
2,4,5-TRIMETHOXYBENZOIC ACID
CAS:490-64-2
Formula: O=C(O)C1=CC(OC)=C(OC)C=C1OC
BD12074
98%
MFCD00002435
2,4,5-TRIMETHOXYBENZONITRILE
CAS:14894-77-0
Formula: N#CC1=CC(OC)=C(OC)C=C1OC
BD66143
97%
MFCD00017530
2,4,5-TRIMETHOXYCINNAMIC ACID
CAS:24160-53-0
Formula: O=C(O)/C=C/C1=CC(OC)=C(OC)C=C1OC
BD14032
97%
MFCD00004377
2,4,5-TRIMETHOXYPHENOL
CAS:20491-91-2
Formula: OC1=CC(OC)=C(OC)C=C1OC
BD161765
97%
MFCD17015434
2,4,5-TRIMETHYL-1H-PYRROLE-3-CARBALDEHYDE
CAS:288089-52-1
Formula: O=CC1=C(C)NC(C)=C1C
BD278874
95+%
MFCD12827508
2,4,5-TRIMETHYL-4,5-DIHYDRO-1H-IMIDAZOLE-4,5-DIOL
CAS:740025-56-3
Formula: CC1=NC(C)(O)C(C)(O)N1
BD237086
95+%
MFCD22493430
2,4,5-TRIMETHYL-4,5-DIHYDROTHIAZOLE
CAS:4145-93-1
Formula: CC1=NC(C(S1)C)C
BD00917107
95%
MFCD22479355
2,4,5-TRIMETHYLACETOPHENONE
CAS:2040-07-5
Formula: CC(C1=CC(C)=C(C)C=C1C)=O
BD66151
MFCD00017244
2,4,5-TRIMETHYLANILINE
CAS:137-17-7
Formula: NC1=CC(C)=C(C)C=C1C
BD66152
97%
MFCD00025201
2,4,5-TRIMETHYLBENZALDEHYDE
CAS:5779-72-6
Formula: O=CC1=CC(C)=C(C)C=C1C
BD66154
97%
MFCD00017713
2,4,5-TRIMETHYLBENZENE-1-SULFONYL CHLORIDE
CAS:92890-80-7
Formula: O=S(C1=CC(C)=C(C)C=C1C)(Cl)=O
BD174603
95+%
MFCD09880301
2,4,5-TRIMETHYLBENZENESULFONIC ACID
CAS:3453-84-7
Formula: CC1=CC(C)=C(C=C1C)S(O)(=O)=O
BD149423
95+%
MFCD00024913
2,4,5-TRIMETHYLBENZO[D]THIAZOLE
CAS:401936-07-0
Formula: CC1=CC=C(SC(C)=N2)C2=C1C
BD249042
95+%
MFCD00643246
2,4,5-TRIMETHYLBENZOIC ACID
CAS:528-90-5
Formula: O=C(O)C1=CC(C)=C(C)C=C1C
BD12021
98%
MFCD00075863
2,4,5-TRIMETHYLFURAN-3-CARBOXYLIC ACID
CAS:28730-32-7
Formula: O=C(O)C1=C(C)OC(C)=C1C
BD66149
97%
MFCD07687287
2,4,5-TRIMETHYLOXAZOLE
CAS:20662-84-4
Formula: CC1=C(C)N=C(C)O1
BD66158
95+%
MFCD00005308
2,4,5-TRIMETHYLPHENOL
CAS:496-78-6
Formula: OC1=CC(C)=C(C)C=C1C
BD66159
95+%
MFCD00020050
2,4,5-TRIMETHYLTHIAZOLE
CAS:13623-11-5
Formula: CC1=NC(C)=C(C)S1
BD66163
98%
MFCD00005332
2,4,5-TRIPHENYL-1H-PYRROLE-3-CARBONITRILE
CAS:63324-77-6
Formula: N#CC1=C(C2=CC=CC=C2)NC(C3=CC=CC=C3)=C1C4=CC=CC=C4
BD269135
95+%
2,4,5-TRIPHENYLIMIDAZOLE
CAS:484-47-9
Formula: C1(C2=CC=CC=C2)=NC(C3=CC=CC=C3)=C(C4=CC=CC=C4)N1
BD1303
98%
MFCD00005187
2,4,6,7-TETRACHLOROQUINAZOLINE
CAS:1219456-89-9
Formula: ClC1=CC2=NC(Cl)=NC(Cl)=C2C=C1Cl
BD752032
97%
2,4,6,7-TETRAHYDRO-5H-INDAZOL-5-ONE
CAS:N/A
Formula: O=C1CC2=CNN=C2CC1
BD209951
98+%
n/a
2,4,6,7-TETRAHYDRO-PYRANO[4,3-C]PYRAZOLE-3-CARBOXYLIC ACID
CAS:933694-89-4
Formula: OC(C1=C2COCCC2=NN1)=O
BD00934919
95%
n/a
2,4,6,7-TETRAHYDRO-PYRANO[4,3-C]PYRAZOLE-3-CARBOXYLIC ACID ETHYL ESTER
CAS:1297547-66-0
Formula: CCOC(C1=C2COCCC2=NN1)=O
BD00824534
95%
MFCD26593859
2,4,6,7-TETRAHYDROPYRANO[4,3-C]PYRAZOLE-3-CARBALDEHYDE
CAS:933752-21-7
Formula: O=CC1=C(COCC2)C2=NN1
BD552591
97%
MFCD18250997
2,4,6,8,10,12,14,16,18-NONAOXANONADECANE
CAS:13352-78-8
Formula: COCOCOCOCOCOCOCOCOC
BD289475
97%
MFCD26792353
2,4,6,8,10,12,14,16-OCTAOXAHEPTADECANE
CAS:13353-04-3
Formula: COCOCOCOCOCOCOCOC
BD289474
97%
MFCD26792355
2,4,6,8,10,12,14-HEPTAOXAPENTADECANE
CAS:13352-77-7
Formula: COCOCOCOCOCOCOC
BD289473
97%
MFCD26792352
2,4,6,8,10,12-HEXAOXATRIDECANE
CAS:13352-76-6
Formula: COCOCOCOCOCOC
BD289472
97%
MFCD26792351
2,4,6,8,10-PENTAOXAUNDECANE
CAS:13352-75-5
Formula: COCOCOCOCOC
BD289471
97%
MFCD26792350
2,4,6,8-TETRACHLOROQUINAZOLINE
CAS:54185-42-1
Formula: ClC1=CC(Cl)=CC2=C(Cl)N=C(Cl)N=C12
BD66175
97%
MFCD03844695
2,4,6,8-TETRAHYDROXYPYRIMIDO[5,4-D]PYRIMIDINE
CAS:6713-54-8
Formula: O=C1NC(C2=C(N1)C(=O)NC(=O)N2)=O
BD22113
95+%
MFCD00129147
2,4,6,8-TETRAMETHYL-2,4,6,8-TETRAPHENYL-1,3,5,7,2,4,6,8-TETRAOXATETRASILOCANE
CAS:77-63-4
Formula: C[Si]1(C2=CC=CC=C2)O[Si](C3=CC=CC=C3)(C)O[Si](C4=CC=CC=C4)(C)O[Si](C5=CC=CC=C5)(C)O1
BD290655
95+%
MFCD01862826
2,4,6,8-TETRAMETHYL-2,4,6,8-TETRAVINYL-1,3,5,7,2,4,6,8-TETRAOXATETRASILOCANE
CAS:2554-06-5
Formula: C=C[Si]1(C)O[Si](C=C)(C)O[Si](C=C)(C)O[Si](C=C)(C)O1
BD66177
97%
MFCD00040293
2,4,6,8-TETRAMETHYLCYCLOTETRASILOXANE
CAS:2370-88-9
Formula: C[SiH]1O[SiH](C)O[SiH](C)O[SiH](C)O1
BD290651
95%
MFCD00039567
2,4,6,8-TETRAMETHYLQUINOLINE
CAS:49616-71-9
Formula: CC1=C2N=C(C)C=C(C)C2=CC(C)=C1
BD33791
97%
2,4,6,8-TETRAOXANONANE
CAS:13353-03-2
Formula: COCOCOCOC
BD289470
95%
MFCD26792354
2,4,6-TRI([1,1'-BIPHENYL]-4-YL)-1,3,5-TRIAZINE
CAS:31274-51-8
Formula: C1(C2=CC=C(C3=CC=CC=C3)C=C2)=NC(C4=CC=C(C5=CC=CC=C5)C=C4)=NC(C6=CC=C(C7=CC=CC=C7)C=C6)=N1
BD00792281
98% HPLC,N
MFCD29071839
2,4,6-TRI(2-PYRIDYL)-1,3,5-TRIAZINE
CAS:3682-35-7
Formula: C1(C2=NC=CC=C2)=NC(C3=NC=CC=C3)=NC(C4=NC=CC=C4)=N1
BD154437
96%
MFCD00006045
2,4,6-TRI(4-PYRIDYL)-1,3,5-TRIAZINE
CAS:42333-78-8
Formula: C1(C2=CC=NC=C2)=NC(C3=CC=NC=C3)=NC(C4=CC=NC=C4)=N1
BD66183
95%
MFCD00129048
2,4,6-TRI(9H-CARBAZOL-9-YL)-5-CHLOROISOPHTHALONITRILE
CAS:1469704-61-7
Formula: N#CC1=C(N2C3=C(C4=C2C=CC=C4)C=CC=C3)C(Cl)=C(N5C6=C(C7=C5C=CC=C7)C=CC=C6)C(C#N)=C1N8C9=C(C%10=C8C=CC=
BD01170288
97%
MFCD32062494
2,4,6-TRI-TERT-BUTYLANILINE
CAS:961-38-6
Formula: C1=C(C(C)(C)C)C=C(C(=C1C(C)(C)C)N)C(C)(C)C
BD66403
98%
MFCD00011645
2,4,6-TRI-TERT-BUTYLPHENOL
CAS:732-26-3
Formula: OC1=C(C(C)(C)C)C=C(C(C)(C)C)C=C1C(C)(C)C
BD66408
98%
MFCD00008821
2,4,6-TRI-TERT-BUTYLPYRIDINE
CAS:20336-15-6
Formula: CC(C1=CC(C(C)(C)C)=CC(C(C)(C)C)=N1)(C)C
BD66409
95%
MFCD00027417
2,4,6-TRI-TERTBUTYLPYRIMIDINE
CAS:67490-21-5
Formula: CC(C)(C)C1=CC(=NC(=N1)C(C)(C)C)C(C)(C)C
BD60583
98%
MFCD03094045
2,4,6-TRIAMINOPYRIMIDINE
CAS:1004-38-2
Formula: C1=C(N=C(N=C1N)N)N
BD9452
97%
MFCD00006100
2,4,6-TRIAMINOPYRIMIDINE-5-CARBONITRILE
CAS:465531-97-9
Formula: NC1=NC(N)=C(C#N)C(N)=N1
BD237224
95+%
MFCD07760382
2,4,6-TRIBROMO-3,5-DIFLUOROBENZONITRILE
CAS:943528-40-3
Formula: N#CC1=C(Br)C(F)=C(Br)C(F)=C1Br
BD00808944
97%
MFCD27933955
2,4,6-TRIBROMO-3-(TRIFLUOROMETHYL)PHENOL
CAS:384-87-2
Formula: OC1=C(Br)C=C(Br)C(C(F)(F)F)=C1Br
BD257318
96%
MFCD13195740
2,4,6-TRIBROMO-3-HYDROXYBENZALDEHYDE
CAS:2737-22-6
Formula: O=CC1=C(Br)C=C(Br)C(O)=C1Br
BD4008
98+%
MFCD00017320
2,4,6-TRIBROMO-3-METHOXYANILINE
CAS:36255-23-9
Formula: NC1=C(Br)C=C(Br)C(OC)=C1Br
BD00789771
96%
2,4,6-TRIBROMO-3-METHYLPHENOL
CAS:4619-74-3
Formula: OC1=C(Br)C=C(Br)C(C)=C1Br
BD10321
97+%
MFCD00019976
2,4,6-TRIBROMO-3-NITROANILINE
CAS:62406-72-8
Formula: NC1=C(Br)C=C(Br)C([N+]([O-])=O)=C1Br
BD323963
95+%
MFCD00760398
2,4,6-TRIBROMO-3-NITROPHENOL
CAS:69076-62-6
Formula: OC1=C(Br)C=C(Br)C([N+]([O-])=O)=C1Br
BD257929
97%
MFCD12025953
2,4,6-TRIBROMO-5-METHYLPYRIDIN-3-AMINE
CAS:126325-52-8
Formula: NC1=C(Br)C(C)=C(Br)N=C1Br
BD230240
98%
MFCD11504908
2,4,6-TRIBROMOBENZALDEHYDE
CAS:45859-98-1
Formula: O=CC1=C(Br)C=C(Br)C=C1Br
BD587711
97%
MFCD13181607
2,4,6-TRIBROMOBENZENE-1,3,5-TRICARBONITRILE
CAS:60510-14-7
Formula: N#CC1=C(Br)C(C#N)=C(Br)C(C#N)=C1Br
BD00818216
95%
2,4,6-TRIBROMOBENZENE-1,3,5-TRIOL
CAS:3354-82-3
Formula: OC1=C(C(O)=C(C(O)=C1Br)Br)Br
BD00856990
95%
MFCD01706660
2,4,6-TRIBROMOBENZENE-1,3-DIAMINE
CAS:62477-06-9
Formula: NC1=C(Br)C=C(Br)C(N)=C1Br
BD492933
97%
2,4,6-TRIBROMOBENZENESULFONYL CHLORIDE
CAS:115876-73-8
Formula: O=S(C1=C(Br)C=C(Br)C=C1Br)(Cl)=O
BD307109
95+%
MFCD09996887
2,4,6-TRIBROMOBENZOIC ACID
CAS:633-12-5
Formula: O=C(O)C1=C(Br)C=C(Br)C=C1Br
BD66193
95%
MFCD00059882
2,4,6-TRIBROMOPHENOL
CAS:118-79-6
Formula: OC1=C(Br)C=C(Br)C=C1Br
BD66196
98%
MFCD00002150
2,4,6-TRIBROMOPHENYL ACRYLATE
CAS:3741-77-3
Formula: C=CC(OC1=C(Br)C=C(Br)C=C1Br)=O
BD66198
98%
MFCD00078430
2,4,6-TRIBROMOPHENYL HEXANOATE
CAS:16732-09-5
Formula: CCCCCC(OC1=C(Br)C=C(Br)C=C1Br)=O
BD13905
95+%
MFCD00059464
2,4,6-TRIBROMOPHENYLMETHACRYLATE
CAS:37721-71-4
Formula: CC(C(OC1=C(Br)C=C(Br)C=C1Br)=O)=C
BD12564
95%
MFCD00078329
2,4,6-TRIBROMOPYRIDIN-3-AMINE
CAS:84539-49-1
Formula: NC1=C(Br)C=C(Br)N=C1Br
BD00815601
96%
2,4,6-TRIBROMOPYRIDIN-3-OL
CAS:6602-34-2
Formula: OC1=C(Br)C=C(Br)N=C1Br
BD66189
98%
MFCD00955610
2,4,6-TRIBROMOPYRIDINE
CAS:2408-70-0
Formula: BrC1=CC(Br)=CC(Br)=N1
BD66201
98%
MFCD00234002
2,4,6-TRIBROMOPYRIMIDINE
CAS:36847-11-7
Formula: BrC1=CC(Br)=NC(Br)=N1
BD66202
98%
MFCD00233942
2,4,6-TRIBROMOQUINOLINE
CAS:1823338-51-7
Formula: BrC1=CC=C2N=C(Br)C=C(Br)C2=C1
BD260202
95+%
2,4,6-TRIBROMORESORCINOL
CAS:2437-49-2
Formula: OC1=C(Br)C=C(Br)C(O)=C1Br
BD66203
98%
MFCD00009717
2,4,6-TRICHLORO-3,4-DIHYDROQUINAZOLINE
CAS:1060795-17-6
Formula: ClC1=CC2=C(N=C(Cl)NC2Cl)C=C1
BD158264
95+%
MFCD11100782
2,4,6-TRICHLORO-3,5-DIFLUOROPYRIDINE
CAS:52074-51-8
Formula: FC1=C(Cl)N=C(Cl)C(F)=C1Cl
BD285289
95+%
MFCD18970022
2,4,6-TRICHLORO-3,5-DIMETHYLPYRIDINE
CAS:98274-04-5
Formula: CC1=C(Cl)N=C(Cl)C(C)=C1Cl
BD00753801
97%
n/a
2,4,6-TRICHLORO-3-(CHLOROMETHYL)PYRIDINE
CAS:N/A
Formula: ClCC1C(Cl)=NC(Cl)=CC=1Cl
BD00714897
95%
n/a
2,4,6-TRICHLORO-3-(CHLOROMETHYL)PYRIDINE HYDROCHLORIDE
CAS:N/A
Formula: ClCC1=C(Cl)C=C(Cl)N=C1Cl.[H]Cl
BD751559
97%
2,4,6-TRICHLORO-3-METHYLANILINE
CAS:5400-76-0
Formula: NC1=C(Cl)C=C(Cl)C(C)=C1Cl
BD00834772
97%
MFCD00971976
2,4,6-TRICHLORO-3-NITROPYRIDINE
CAS:60186-13-2
Formula: O=[N+](C1=C(Cl)C=C(Cl)N=C1Cl)[O-]
BD248712
97%
MFCD09264535
2,4,6-TRICHLORO-3-NITROQUINOLINE
CAS:259180-81-9
Formula: O=[N+](C1=C(Cl)C2=CC(Cl)=CC=C2N=C1Cl)[O-]
BD624436
97%
2,4,6-TRICHLORO-5-(METHYLTHIO)PYRIMIDINE
CAS:24795-76-4
Formula: CSC1=C(Cl)N=C(Cl)N=C1Cl
BD293675
95+%
2,4,6-TRICHLORO-5-CYANOPYRIMIDINE
CAS:3029-64-9
Formula: C1(=C(C#N)C(=NC(=N1)Cl)Cl)Cl
BD66209
98%
MFCD07636745
2,4,6-TRICHLORO-5-ETHYLPYRIMIDINE
CAS:1780-38-7
Formula: CCC1=C(Cl)N=C(Cl)N=C1Cl
BD149830
95+%
MFCD11112097
2,4,6-TRICHLORO-5-FLUOROPYRIMIDINE
CAS:6693-08-9
Formula: FC1=C(Cl)N=C(Cl)N=C1Cl
BD160045
97%
MFCD11040435
2,4,6-TRICHLORO-5-IODOPYRIMIDINE
CAS:1137576-61-4
Formula: IC1=C(Cl)N=C(Cl)N=C1Cl
BD163041
95+%
MFCD18072685
2,4,6-TRICHLORO-5-ISOPROPYLPYRIMIDINE
CAS:1780-42-3
Formula: CC(C1=C(Cl)N=C(Cl)N=C1Cl)C
BD258206
95+%
MFCD19441365
2,4,6-TRICHLORO-5-METHOXYPYRIMIDINE
CAS:60703-46-0
Formula: COC1=C(Cl)N=C(Cl)N=C1Cl
BD247148
95+%
MFCD11226168
2,4,6-TRICHLORO-5-METHYLPYRIMIDINE
CAS:1780-36-5
Formula: CC1=C(N=C(Cl)N=C1Cl)Cl
BD2538
98%
MFCD00233525
2,4,6-TRICHLORO-5-NITROPYRIMIDINE
CAS:4359-87-9
Formula: O=[N+](C1=C(Cl)N=C(Cl)N=C1Cl)[O-]
BD66211
97%
MFCD00091516
2,4,6-TRICHLORO-5-PHENYLPYRIMIDINE
CAS:1780-39-8
Formula: ClC1=C(C2=CC=CC=C2)C(Cl)=NC(Cl)=N1
BD259692
95+%
2,4,6-TRICHLORO-7-METHYL-7H-PYRROLO[2,3-D]PYRIMIDINE
CAS:1131992-46-5
Formula: CN1C(Cl)=CC2=C(Cl)N=C(Cl)N=C21
BD272190
95+%
2,4,6-TRICHLORO-PYRIDO[3,2-D]PYRIMIDINE
CAS:1036738-12-1
Formula: ClC1=NC2=C(Cl)N=C(Cl)N=C2C=C1
BD314094
97%
MFCD16251065
2,4,6-TRICHLOROBENZALDEHYDE
CAS:24473-00-5
Formula: ClC1=CC(Cl)=C(C=O)C(Cl)=C1
BD208481
97+%
MFCD12024961
2,4,6-TRICHLOROBENZENE-1,3-DIOL
CAS:26378-73-4
Formula: OC1=C(C=C(C(O)=C1Cl)Cl)Cl
BD00959602
95%
MFCD00179932
2,4,6-TRICHLOROBENZENE-1-SULFONYL CHLORIDE
CAS:51527-73-2
Formula: O=S(C1=C(Cl)C=C(Cl)C=C1Cl)(Cl)=O
BD3086
98%
MFCD00052973
2,4,6-TRICHLOROBENZENESULFONAMIDE
CAS:28460-30-2
Formula: O=S(C1=C(Cl)C=C(Cl)C=C1Cl)(N)=O
BD60581
97%
MFCD00955746
2,4,6-TRICHLOROBENZENETHIOL
CAS:24207-66-7
Formula: SC1=C(Cl)C=C(Cl)C=C1Cl
BD66215
97%
MFCD00052937
2,4,6-TRICHLOROBENZOIC ACID
CAS:50-43-1
Formula: O=C(O)C1=C(Cl)C=C(Cl)C=C1Cl
BD7911
97%
MFCD00060699
2,4,6-TRICHLOROBENZONITRILE
CAS:6575-05-9
Formula: N#CC1=C(Cl)C=C(Cl)C=C1Cl
BD66217
98%
MFCD00052711
2,4,6-TRICHLOROBENZOYL CHLORIDE
CAS:4136-95-2
Formula: O=C(Cl)C1=C(Cl)C=C(Cl)C=C1Cl
BD66218
97%
MFCD00075323
2,4,6-TRICHLOROBENZYL ALCOHOL
CAS:217479-60-2
Formula: ClC1=C(C(Cl)=CC(Cl)=C1)CO
BD160485
97%
MFCD03093891
2,4,6-TRICHLORONICOTINALDEHYDE
CAS:1261269-66-2
Formula: O=CC1=C(Cl)N=C(Cl)C=C1Cl
BD252531
97%
MFCD17012148
2,4,6-TRICHLORONICOTINAMIDE
CAS:53815-29-5
Formula: O=C(N)C1=C(Cl)N=C(Cl)C=C1Cl
BD753284
97%
MFCD23102832
2,4,6-TRICHLORONICOTINIC ACID
CAS:69422-72-6
Formula: O=C(O)C1=C(Cl)N=C(Cl)C=C1Cl
BD66221
97%
MFCD09038102
2,4,6-TRICHLORONICOTINONITRILE
CAS:40381-91-7
Formula: N#CC1=C(Cl)N=C(Cl)C=C1Cl
BD221052
95+%
MFCD19707185
2,4,6-TRICHLOROPHENYL 2-CYANOBENZENESULFONATE
CAS:1171919-29-1
Formula: O=S(C1=CC=CC=C1C#N)(OC2=C(Cl)C=C(Cl)C=C2Cl)=O
BD201902
95+%
MFCD12498725
2,4,6-TRICHLOROPHENYL 2-FLUOROBENZENESULFONATE
CAS:1171919-36-0
Formula: O=S(C1=CC=CC=C1F)(OC2=C(Cl)C=C(Cl)C=C2Cl)=O
BD201906
95+%
MFCD12498728
2,4,6-TRICHLOROPHENYL 3-(TRIFLUOROMETHYL)BENZENESULFONATE
CAS:1171919-24-6
Formula: O=S(C1=CC=CC(C(F)(F)F)=C1)(OC2=C(Cl)C=C(Cl)C=C2Cl)=O
BD201900
95+%
MFCD12498723
2,4,6-TRICHLOROPHENYL 4-(TRIFLUOROMETHOXY)BENZENESULFONATE
CAS:1171919-27-9
Formula: O=S(C1=CC=C(OC(F)(F)F)C=C1)(OC2=C(Cl)C=C(Cl)C=C2Cl)=O
BD201901
95+%
MFCD12498724
2,4,6-TRICHLOROPHENYL 4-BROMOBENZENESULFONATE
CAS:934986-62-6
Formula: O=S(C1=CC=C(Br)C=C1)(OC2=C(Cl)C=C(Cl)C=C2Cl)=O
BD201899
95+%
MFCD12498722
2,4,6-TRICHLOROPHENYL 4-FLUOROBENZENESULFONATE
CAS:1171919-37-1
Formula: O=S(C1=CC=C(F)C=C1)(OC2=C(Cl)C=C(Cl)C=C2Cl)=O
BD201907
95+%
MFCD12498729
2,4,6-TRICHLOROPHENYL 4-METHYLBENZENESULFONATE
CAS:7466-04-8
Formula: O=S(C1=CC=C(C)C=C1)(OC2=C(Cl)C=C(Cl)C=C2Cl)=O
BD196670
95%
MFCD00422258
2,4,6-TRICHLOROPHENYL 5-BROMO-2-METHOXYBENZENESULFONATE
CAS:1171919-47-3
Formula: O=S(C1=CC(Br)=CC=C1OC)(OC2=C(Cl)C=C(Cl)C=C2Cl)=O
BD201911
95+%
MFCD12498733
2,4,6-TRICHLOROPHENYL 5-BROMOTHIOPHENE-2-SULFONATE
CAS:1171919-31-5
Formula: O=S(C1=CC=C(Br)S1)(OC2=C(Cl)C=C(Cl)C=C2Cl)=O
BD201903
95+%
MFCD12498726
2,4,6-TRICHLOROPHENYL BUTANE-1-SULFONATE
CAS:1171919-49-5
Formula: CCCCS(=O)(OC1=C(Cl)C=C(Cl)C=C1Cl)=O
BD201912
95+%
MFCD12498734
2,4,6-TRICHLOROPHENYL ETHANESULFONATE
CAS:934986-60-4
Formula: CCS(=O)(OC1=C(Cl)C=C(Cl)C=C1Cl)=O
BD201905
95+%
MFCD12498727
2,4,6-TRICHLOROPHENYL FORMATE
CAS:4525-65-9
Formula: O=COC1=C(Cl)C=C(Cl)C=C1Cl
BD306311
95%
MFCD27996252
2,4,6-TRICHLOROPHENYL NAPHTHALENE-2-SULFONATE
CAS:1171919-42-8
Formula: O=S(C1=CC=C2C=CC=CC2=C1)(OC3=C(Cl)C=C(Cl)C=C3Cl)=O
BD201909
95+%
MFCD12498731
2,4,6-TRICHLOROPHENYL PHENYLMETHANESULFONATE
CAS:1171919-33-7
Formula: O=S(CC1=CC=CC=C1)(OC2=C(Cl)C=C(Cl)C=C2Cl)=O
BD201904
95+%
MFCD01231356
2,4,6-TRICHLOROPHENYL PROPANE-1-SULFONATE
CAS:1171919-51-9
Formula: CCCS(=O)(OC1=C(Cl)C=C(Cl)C=C1Cl)=O
BD201913
95+%
MFCD12498735
2,4,6-TRICHLOROPHENYL QUINOLINE-8-SULFONATE
CAS:1171919-22-4
Formula: O=S(C1=C2N=CC=CC2=CC=C1)(OC3=C(Cl)C=C(Cl)C=C3Cl)=O
BD201898
95+%
MFCD12498721
2,4,6-TRICHLOROPHENYLACETYLENE
CAS:152174-09-9
Formula: C#CC1=C(Cl)C=C(Cl)C=C1Cl
BD323315
95+%
MFCD11655770
2,4,6-TRICHLOROPHENYLBORONIC ACID
CAS:73852-18-3
Formula: OB(O)C1=C(Cl)C=C(Cl)C=C1Cl
BD3200
98%
MFCD01074621
2,4,6-TRICHLOROPTERIDINE
CAS:26850-60-2
Formula: ClC1=NC2=C(Cl)N=C(Cl)N=C2N=C1
BD258899
95+%
MFCD22548384
2,4,6-TRICHLOROPYRIDIN-3-AMINE
CAS:91872-08-1
Formula: NC1=C(Cl)C=C(Cl)N=C1Cl
BD238047
96%
MFCD20703662
2,4,6-TRICHLOROPYRIDINE
CAS:16063-69-7
Formula: C1=C(N=C(C=C1Cl)Cl)Cl
BD60582
98%
MFCD00971928
2,4,6-TRICHLOROPYRIDO[3,4-D]PYRIMIDINE
CAS:2143878-49-1
Formula: ClC1=CC2=C(Cl)N=C(Cl)N=C2C=N1
BD00813189
95+%
2,4,6-TRICHLOROPYRIMIDIN-5-AMINE
CAS:91322-00-8
Formula: NC1=C(Cl)N=C(Cl)N=C1Cl
BD158045
95+%
MFCD08693695
2,4,6-TRICHLOROPYRIMIDIN-5-OL
CAS:1382979-41-0
Formula: OC1=C(Cl)N=C(Cl)N=C1Cl
BD586990
97%
2,4,6-TRICHLOROPYRIMIDINE
CAS:3764-01-0
Formula: ClC1=CC(Cl)=NC(Cl)=N1
BD7913
98%
MFCD00006063
2,4,6-TRICHLOROPYRIMIDINE-5-CARBALDEHYDE
CAS:50270-27-4
Formula: ClC1=NC(=C(C(=N1)Cl)C=O)Cl
BD33832
97%
MFCD02257700
2,4,6-TRICHLOROPYRIMIDINE-5-CARBOXYLIC ACID
CAS:93416-51-4
Formula: O=C(C1=C(Cl)N=C(Cl)N=C1Cl)O
BD220651
97%
MFCD09909820
2,4,6-TRICHLOROPYRROLO[2,1-F][1,2,4]TRIAZINE
CAS:1315593-59-9
Formula: ClC1=CN2N=C(Cl)N=C(Cl)C2=C1
BD00815066
97%
2,4,6-TRICHLOROQUINAZOLINE
CAS:20028-68-6
Formula: ClC1=CC2=C(Cl)N=C(Cl)N=C2C=C1
BD66235
97%
MFCD08445622
2,4,6-TRICHLOROQUINOLINE
CAS:1677-50-5
Formula: ClC1=CC=C2N=C(Cl)C=C(Cl)C2=C1
BD330449
95+%
MFCD17171175
2,4,6-TRICHLOROTHIENO[3,2-D]PYRIMIDINE
CAS:41102-26-5
Formula: ClC1=CC2=NC(Cl)=NC(Cl)=C2S1
BD561745
97%
MFCD21364607
2,4,6-TRIETHOXYPYRIMIDINE-5-CARBOXYLIC ACID
CAS:4320-00-7
Formula: O=C(C1=C(OCC)N=C(OCC)N=C1OCC)O
BD284640
95+%
2,4,6-TRIETHYL-3-(HYDROXYMETHYL)BENZALDEHYDE OXIME
CAS:347367-16-2
Formula: OCC1=C(CC)C(/C=N/O)=C(CC)C=C1CC
BD177220
97%
MFCD00757575
2,4,6-TRIETHYLANILINE
CAS:19779-32-9
Formula: NC1=C(CC)C=C(CC)C=C1CC
BD274570
95+%
MFCD00561929
2,4,6-TRIFLUORO-3,5-DIMETHYLBENZALDEHYDE
CAS:1951441-62-5
Formula: O=CC1=C(F)C(C)=C(F)C(C)=C1F
BD00785039
98%
2,4,6-TRIFLUORO-3,5-DIMETHYLBENZOIC ACID
CAS:886762-23-8
Formula: O=C(O)C1=C(F)C(C)=C(F)C(C)=C1F
BD283664
95+%
MFCD04039199
2,4,6-TRIFLUORO-3-METHOXYBENZALDEHYDE
CAS:886499-89-4
Formula: O=CC1=C(F)C=C(F)C(OC)=C1F
BD320064
95+%
MFCD06660224
2,4,6-TRIFLUORO-3-METHYLBENZALDEHYDE
CAS:1504554-92-0
Formula: O=CC1=C(F)C=C(F)C(C)=C1F
BD00780162
98%
2,4,6-TRIFLUORO-3-NITROPYRIDINE
CAS:60186-17-6
Formula: O=[N+](C1=C(F)C=C(F)N=C1F)[O-]
BD269531
95+%
2,4,6-TRIFLUORO-N-METHOXY-N-METHYLBENZAMIDE
CAS:937602-31-8
Formula: O=C(N(OC)C)C1=C(F)C=C(F)C=C1F
BD201611
95+%
MFCD08689800
2,4,6-TRIFLUOROANILINE
CAS:363-81-5
Formula: NC1=C(F)C=C(F)C=C1F
BD9847
98%
MFCD00007650
2,4,6-TRIFLUOROBENZALDEHYDE
CAS:58551-83-0
Formula: C1=C(C(=C(C=C1F)F)C=O)F
BD10213
98%
MFCD00061197
2,4,6-TRIFLUOROBENZAMIDE
CAS:82019-50-9
Formula: O=C(N)C1=C(F)C=C(F)C=C1F
BD4225
97%
MFCD00061199
2,4,6-TRIFLUOROBENZENE-1-SULFONYL CHLORIDE
CAS:220239-64-5
Formula: O=S(C1=C(F)C=C(F)C=C1F)(Cl)=O
BD66243
98%
MFCD01091015
2,4,6-TRIFLUOROBENZENE-1-THIOL
CAS:130922-42-8
Formula: SC1=C(F)C=C(F)C=C1F
BD01068178
95%
MFCD11189397
2,4,6-TRIFLUOROBENZIMIDAMIDE
CAS:1005460-15-0
Formula: N=C(N)C1=C(F)C=C(F)C=C1F
BD283532
95+%
MFCD09745451
2,4,6-TRIFLUOROBENZIMIDAMIDE XHYDROCHLORIDE
CAS:1006047-63-7
Formula: N=C(N)C1=C(F)C=C(F)C=C1F.[H]Cl
BD283542
98%
MFCD04114456
2,4,6-TRIFLUOROBENZOIC ACID
CAS:28314-80-9
Formula: O=C(O)C1=C(F)C=C(F)C=C1F
BD4087
95%
MFCD00042398
2,4,6-TRIFLUOROBENZONITRILE
CAS:96606-37-0
Formula: N#CC1=C(F)C=C(F)C=C1F
BD35527
98%
MFCD00042399
2,4,6-TRIFLUOROBENZOYLCHLORIDE
CAS:79538-29-7
Formula: O=C(Cl)C1=C(F)C=C(F)C=C1F
BD34966
98%
MFCD00070810
2,4,6-TRIFLUOROBENZYL METHACRYLATE
CAS:1820739-95-4
Formula: CC(C(OCC1=C(F)C=C(F)C=C1F)=O)=C
BD439338
97%
MFCD28096613
2,4,6-TRIFLUOROPHENACYL BROMIDE
CAS:746630-36-4
Formula: O=C(C1=C(F)C=C(F)C=C1F)CBr
BD00796820
95%
MFCD07368690
2,4,6-TRIFLUOROPHENOL
CAS:2268-17-9
Formula: OC1=C(F)C=C(F)C=C1F
BD9782
97%
MFCD00061216
2,4,6-TRIFLUOROPHENYLACETIC ACID
CAS:209991-63-9
Formula: O=C(O)CC1=C(F)C=C(F)C=C1F
BD5746
98%
MFCD00061218
2,4,6-TRIFLUOROPHENYLBORONIC ACID
CAS:182482-25-3
Formula: OB(O)C1=C(F)C=C(F)C=C1F
BD7914
98%
MFCD01863169
2,4,6-TRIFLUOROPHENYLHYDRAZINE
CAS:80025-72-5
Formula: NNC1=C(F)C=C(F)C=C1F
BD3390
97%
MFCD03095329
2,4,6-TRIFLUOROPYRIDINE
CAS:3512-17-2
Formula: FC1=CC(F)=CC(F)=N1
BD33348
95+%
MFCD03001161
2,4,6-TRIFLUOROPYRIDINE-3-CARBOXYLIC ACID
CAS:3512-14-9
Formula: O=C(C1=C(F)C=C(F)N=C1F)O
BD00795816
95%
2,4,6-TRIFLUOROPYRIMIDINE
CAS:696-82-2
Formula: FC1=CC(F)=NC(F)=N1
BD34657
98%
MFCD00039705
2,4,6-TRIHYDROXY-3-METHYLBENZALDEHYDE
CAS:55743-13-0
Formula: O=CC1=C(O)C=C(O)C(C)=C1O
BD00796133
97%
MFCD24674224
2,4,6-TRIHYDROXYBENZALDEHYDE
CAS:487-70-7
Formula: O=CC1=C(O)C=C(O)C=C1O
BD4708
95%
MFCD00003329
2,4,6-TRIHYDROXYBENZENE-1,3,5-TRICARBALDEHYDE
CAS:34374-88-4
Formula: O=CC1=C(O)C(C=O)=C(O)C(C=O)=C1O
BD626553
95%
MFCD24713435
2,4,6-TRIHYDROXYBENZOIC ACID
CAS:83-30-7
Formula: O=C(O)C1=C(O)C=C(O)C=C1O
BD22781
95+%
MFCD00002453
2,4,6-TRIHYDROXYBENZOIC ACID HYDRATE
CAS:71989-93-0
Formula: O=C(O)C1=C(O)C=C(O)C=C1O.[H]O[H]
BD66273
95+%
MFCD00149095
2,4,6-TRIHYDROXYISOPHTHALALDEHYDE
CAS:4396-13-8
Formula: O=CC1=C(O)C=C(O)C(C=O)=C1O
BD262157
95+%
2,4,6-TRIIODOANILINE
CAS:24154-37-8
Formula: NC1=C(I)C=C(I)C=C1I
BD66276
97%
MFCD00822650
2,4,6-TRIIODOBENZENE-1,3,5-TRIOL
CAS:57730-42-4
Formula: OC1=C(C(O)=C(C(O)=C1I)I)I
BD00856489
95%
MFCD09839509
2,4,6-TRIIODOBENZENE-1,3-DIOL
CAS:19403-92-0
Formula: OC1=C(I)C=C(I)C(O)=C1I
BD32467
95+%
MFCD00463616
2,4,6-TRIIODOPHENOL
CAS:609-23-4
Formula: OC1=C(I)C=C(I)C=C1I
BD34277
98%
MFCD00002179
2,4,6-TRIISOPROPYL-1-PHENYLBENZENE
CAS:76804-34-7
Formula: CC(C1=C(C2=CC=CC=C2)C(C(C)C)=CC(C(C)C)=C1)C
BD00942951
95%
MFCD27964410
2,4,6-TRIISOPROPYL-N'-(2,2,2-TRIFLUORO-1-(TRIPHENYLSILYL)ETHYLIDENE)BENZENESULFONOHYDRAZIDE
CAS:145574-05-6
Formula: O=S(C1=C(C(C)C)C=C(C(C)C)C=C1C(C)C)(N/N=C([Si](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4)\C(F)(F)F)=O
BD27549
95+%
MFCD08752567
2,4,6-TRIISOPROPYLBENZENE-1-SULFONYL CHLORIDE
CAS:6553-96-4
Formula: O=S(C1=C(C(C)C)C=C(C(C)C)C=C1C(C)C)(Cl)=O
BD41924
98%
MFCD00007433
2,4,6-TRIISOPROPYLBENZENESULFONAMIDE
CAS:105536-22-9
Formula: O=S(C1=C(C(C)C)C=C(C(C)C)C=C1C(C)C)(N)=O
BD8264
95+%
MFCD00051975
2,4,6-TRIISOPROPYLBENZENESULFONIC ACID
CAS:63877-57-6
Formula: O=S(C1=C(C(C)C)C=C(C(C)C)C=C1C(C)C)(O)=O
BD00790291
96%
MFCD00544490
2,4,6-TRIISOPROPYLBENZENESULFONOHYDRAZIDE
CAS:39085-59-1
Formula: O=S(C1=C(C(C)C)C=C(C(C)C)C=C1C(C)C)(NN)=O
BD8275
97%
MFCD00014750
2,4,6-TRIISOPROPYLBENZOIC ACID
CAS:49623-71-4
Formula: O=C(O)C1=C(C(C)C)C=C(C(C)C)C=C1C(C)C
BD16502
97+%
MFCD00015031
2,4,6-TRIISOPROPYLBENZOYLCHLORIDE
CAS:57199-00-5
Formula: O=C(Cl)C1=C(C(C)C)C=C(C(C)C)C=C1C(C)C
BD66283
MFCD00015030
2,4,6-TRIMETHOXY-1,3,5,2,4,6-TRIOXATRIBORINANE
CAS:102-24-9
Formula: COB1OB(OC)OB(OC)O1
BD155417
96%
MFCD00005946
2,4,6-TRIMETHOXY-1,3,5-TRIAZINE
CAS:877-89-4
Formula: COC1=NC(OC)=NC(OC)=N1
BD66286
95+%
MFCD00142809
2,4,6-TRIMETHOXYANILINE
CAS:14227-17-9
Formula: NC1=C(OC)C=C(OC)C=C1OC
BD66290
98%
MFCD00017165
2,4,6-TRIMETHOXYANILINE HYDROCHLORIDE
CAS:102438-99-3
Formula: NC1=C(OC)C=C(OC)C=C1OC.[H]Cl
BD66291
95+%
MFCD00211326
2,4,6-TRIMETHOXYBENZALDEHYDE
CAS:830-79-5
Formula: C1=C(OC)C=C(C(=C1OC)C=O)OC
BD35036
97%
MFCD00003313
2,4,6-TRIMETHOXYBENZALDEHYDE OXIME
CAS:51903-38-9
Formula: COC1=C(C(OC)=CC(OC)=C1)/C=N/O
BD00786883
95%
2,4,6-TRIMETHOXYBENZAMIDE
CAS:N/A
Formula: O=C(C1C(OC)=CC(OC)=CC=1OC)N
BD00711034
95%
2,4,6-TRIMETHOXYBENZENETHIOL
CAS:77189-99-2
Formula: SC(C(OC)=CC(OC)=C1)=C1OC
BD00963832
95%
MFCD11189388
2,4,6-TRIMETHOXYBENZIMIDAMIDE
CAS:160150-35-6
Formula: N=C(N)C1=C(OC)C=C(OC)C=C1OC
BD286977
95+%
MFCD05663400
2,4,6-TRIMETHOXYBENZIMIDAMIDE HYDROCHLORIDE
CAS:1187929-24-3
Formula: N=C(N)C1=C(OC)C=C(OC)C=C1OC.[H]Cl
BD286972
95+%
MFCD04114425
2,4,6-TRIMETHOXYBENZOIC ACID
CAS:570-02-5
Formula: O=C(O)C1=C(OC)C=C(OC)C=C1OC
BD12075
98%
MFCD00016497
2,4,6-TRIMETHOXYBENZONITRILE
CAS:2571-54-2
Formula: N#CC1=C(OC)C=C(OC)C=C1OC
BD66296
95+%
MFCD00001787
2,4,6-TRIMETHOXYBENZYLAMINE HYDROCHLORIDE
CAS:146548-59-6
Formula: Cl[H].COC1=CC(OC)=C(CN)C(OC)=C1
BD12308
98+%
MFCD00012855
2,4,6-TRIMETHOXYNITROBENZENE
CAS:14227-18-0
Formula: O=[N+](C1=C(OC)C=C(OC)C=C1OC)[O-]
BD6865
98%
MFCD00016992
2,4,6-TRIMETHOXYPHENOL
CAS:20491-92-3
Formula: COC1=CC(OC)=C(O)C(OC)=C1
BD66304
95+%
MFCD00017159
2,4,6-TRIMETHOXYPHENYLBORONIC ACID
CAS:135159-25-0
Formula: COC1=CC(OC)=C(B(O)O)C(OC)=C1
BD66293
98%
MFCD01114642
2,4,6-TRIMETHOXYPYRIDIN-3-OL
CAS:1949816-21-0
Formula: OC1=C(OC)C=C(OC)N=C1OC
BD00793983
95%
2,4,6-TRIMETHOXYPYRIDINE
CAS:91591-88-7
Formula: COC1=CC(OC)=CC(OC)=N1
BD254814
95+%
MFCD11044393
2,4,6-TRIMETHOXYPYRIMIDINE
CAS:13106-85-9
Formula: COC1=CC(OC)=NC(OC)=N1
BD3807
98%
MFCD00829225
2,4,6-TRIMETHOXYPYRIMIDINE-5-CARBOXYLIC ACID
CAS:4319-98-6
Formula: O=C(C1=C(OC)N=C(OC)N=C1OC)O
BD284611
95+%
2,4,6-TRIMETHYL(1,3-DIOXOLAN-2-YLMETHYL)BENZENE
CAS:898785-34-7
Formula: CC1=C(CC2OCCO2)C(C)=CC(C)=C1
BD312964
95+%
MFCD08064183
2,4,6-TRIMETHYL(DIACETOXYIODO)BENZENE
CAS:33035-41-5
Formula: CC1=C(I(OC(C)=O)OC(C)=O)C(C)=CC(C)=C1
BD00802668
98%
n/a
2,4,6-TRIMETHYL-1,3,5-TRIAZINANE TRIHYDRATE
CAS:58052-80-5
Formula: CC1NC(C)NC(C)N1.[H]O[H].[H]O[H].[H]O[H]
BD133216
95%
MFCD00149559
2,4,6-TRIMETHYL-1,3,5-TRIAZINE
CAS:823-94-9
Formula: CC1=NC(C)=NC(C)=N1
BD297589
95+%
MFCD00456896
2,4,6-TRIMETHYL-1,3,5-TRIPENTYL-1,3,5,2,4,6-TRIAZATRIBORINANE
CAS:N/A
Formula: CCCCCN1B(C)N(CCCCC)B(C)N(CCCCC)B1C
BD443718
97%
MFCD29048587
2,4,6-TRIMETHYL-1,3,5-TRIPROPYL-1,3,5,2,4,6-TRIAZATRIBORINANE
CAS:53340-69-5
Formula: CCCN1B(C)N(CCC)B(C)N(CCC)B1C
BD628152
97%
MFCD28968053
2,4,6-TRIMETHYL-1,3-PHENYLENEDIAMINE
CAS:3102-70-3
Formula: CC1=CC(C)=C(N)C(C)=C1N
BD66314
98%
MFCD00010149
2,4,6-TRIMETHYL-1H-INDENE
CAS:150096-40-5
Formula: CC1=CC2=C(C)C=C(C)C=C2C1
BD237485
98%
MFCD09835224
2,4,6-TRIMETHYL-1H-INDOLE-3-CARBALDEHYDE
CAS:883547-93-1
Formula: O=CC1=C(C)NC2=C1C(C)=CC(C)=C2
BD187718
97%
MFCD08144096
2,4,6-TRIMETHYL-2,4,6-TRIPHENYL-1,3,5,2,4,6-TRIOXATRISILINANE(MIXTURE OF TETRAMER)
CAS:546-45-2
Formula: C[Si]1(C2=CC=CC=C2)O[Si](C3=CC=CC=C3)(C)O[Si](C4=CC=CC=C4)(C)O1
BD53653
97%
MFCD00053565
2,4,6-TRIMETHYL-2,4,6-TRIVINYL-1,3,5,2,4,6-TRIOXATRISILINANE
CAS:3901-77-7
Formula: C=C[Si]1(C)O[Si](C=C)(C)O[Si](C=C)(C)O1
BD290654
97%
MFCD00023111
2,4,6-TRIMETHYL-3-(1H-TETRAZOL-1-YL)BENZENESULFONAMIDE
CAS:670230-57-6
Formula: CC1=CC(C)=C(S(N)(=O)=O)C(C)=C1N2C=NN=N2
BD00855855
95%
MFCD03197313
2,4,6-TRIMETHYL-3-(PYRROLIDIN-1-YL)ANILINE
CAS:250651-02-6
Formula: CC1=C(N2CCCC2)C(C)=C(N)C(C)=C1
BD331048
95%
MFCD17926231
2,4,6-TRIMETHYL-3-MORPHOLINOANILINE
CAS:847414-28-2
Formula: CC1=C(N2CCOCC2)C(C)=C(N)C(C)=C1
BD335485
95%
MFCD17926232
2,4,6-TRIMETHYL-3-NITROPYRIDINE
CAS:21203-55-4
Formula: O=[N+](C1=C(C)C=C(C)N=C1C)[O-]
BD68726
95+%
MFCD00110819
2,4,6-TRIMETHYL-N'-(1,4-DIOXASPIRO[4.5]DECAN-8-YLIDENE)BENZENESULFONOHYDRAZIDE
CAS:1199773-18-6
Formula: O=S(C1=C(C)C=C(C)C=C1C)(N/N=C(CC2)\CCC32OCCO3)=O
BD251700
95%
MFCD13195684
2,4,6-TRIMETHYL-N'-(4-METHYLCYCLOHEXYLIDENE)BENZENESULFONOHYDRAZIDE
CAS:1393441-80-9
Formula: O=S(C1=C(C)C=C(C)C=C1C)(NN=C2CCC(C)CC2)=O
BD399138
98%
MFCD22383686
2,4,6-TRIMETHYL-N'-[(1E)-(3-NITROPHENYL)METHYLIDENE]BENZENE-1-SULFONOHYDRAZIDE
CAS:1081835-58-6
Formula: CC1=CC(C)=C(S(=O)(N/N=C/C2=CC=CC([N+]([O-])=O)=C2)=O)C(C)=C1
BD00883627
95%
2,4,6-TRIMETHYL-N,N-DIPHENYLANILINE
CAS:603134-65-2
Formula: CC1=C(C(C)=CC(C)=C1)N(C2=CC=CC=C2)C3=CC=CC=C3
BD261550
95+%
MFCD22200048
2,4,6-TRIMETHYL-N-(2-(TRIFLUOROMETHYL)PHENYL)BENZENESULFONAMIDE
CAS:313981-55-4
Formula: O=S(C1=C(C)C=C(C)C=C1C)(NC2=CC=CC=C2C(F)(F)F)=O
BD16342
97%
MFCD00784362
2,4,6-TRIMETHYL-N-PHENYLANILINE
CAS:23592-67-8
Formula: CC1=C(C(C)=CC(C)=C1)NC2=CC=CC=C2
BD147597
95+%
MFCD09032845
2,4,6-TRIMETHYL-N-PROPYLANILINE
CAS:356532-68-8
Formula: CCCNC1=C(C)C=C(C)C=C1C
BD193805
95+%
MFCD03210929
2,4,6-TRIMETHYL-PYRIMIDINE DIHYDRATE
CAS:1195245-72-7
Formula: CC1=CC(C)=NC(C)=N1.[H]O[H].[H]O[H]
BD322625
95+%
MFCD13188536
2,4,6-TRIMETHYLANILINE
CAS:88-05-1
Formula: CC1=CC(C)=C(N)C(C)=C1
BD66322
98%
MFCD00007740
2,4,6-TRIMETHYLBENZALDEHYDE
CAS:487-68-3
Formula: O=CC1=C(C)C=C(C)C=C1C
BD41720
95%
MFCD00003341
2,4,6-TRIMETHYLBENZENE-1,3,5-TRICARBALDEHYDE
CAS:119198-88-8
Formula: O=CC1=C(C(C=O)=C(C(C=O)=C1C)C)C
BD00824195
95%
MFCD00981925
2,4,6-TRIMETHYLBENZENE-1,3-DISULFONYL DICHLORIDE
CAS:68985-08-0
Formula: O=S(C1=C(C)C=C(C)C(S(=O)(Cl)=O)=C1C)(Cl)=O
BD67253
98%
MFCD00009796
2,4,6-TRIMETHYLBENZENESULFINAMIDE
CAS:137280-49-0
Formula: O=S(N)C1C(C)=CC(C)=CC=1C
BD00743000
95+%
MFCD20620960
2,4,6-TRIMETHYLBENZENESULFINIC ACID
CAS:59057-35-1
Formula: O=S(C1=C(C)C=C(C)C=C1C)O
BD349356
95+%
MFCD03940230
2,4,6-TRIMETHYLBENZENESULFONAMIDE
CAS:4543-58-2
Formula: O=S(C1=C(C)C=C(C)C=C1C)(N)=O
BD115570
96%
MFCD00463245
2,4,6-TRIMETHYLBENZENESULFONIC ACID
CAS:3453-83-6
Formula: O=S(C1=C(C)C=C(C)C=C1C)(O)=O
BD218889
95+%
MFCD00007482
2,4,6-TRIMETHYLBENZENESULFONIC ACID DIHYDRATE
CAS:835617-36-2
Formula: O=S(C1=C(C)C=C(C)C=C1C)(O)=O.[H]O[H].[H]O[H]
BD627550
97%
MFCD00149535
2,4,6-TRIMETHYLBENZENESULFONOHYDRAZIDE
CAS:16182-15-3
Formula: O=S(C1=C(C)C=C(C)C=C1C)(NN)=O
BD7001
95%
MFCD00007585
2,4,6-TRIMETHYLBENZOIC ACID
CAS:480-63-7
Formula: O=C(O)C1=C(C)C=C(C)C=C1C
BD20979
98%
MFCD00002481
2,4,6-TRIMETHYLBENZONITRILE
CAS:2571-52-0
Formula: N#CC1=C(C)C=C(C)C=C1C
BD66328
98%
MFCD00016378
2,4,6-TRIMETHYLBENZOYL CHLORIDE
CAS:938-18-1
Formula: O=C(Cl)C1=C(C)C=C(C)C=C1C
BD66331
97%
MFCD00013650
2,4,6-TRIMETHYLBROMOBENZENE
CAS:576-83-0
Formula: CC1=C(Br)C(C)=CC(C)=C1
BD41814
98%
MFCD00000073
2,4,6-TRIMETHYLIODOBENZENE
CAS:4028-63-1
Formula: CC1=C(I)C(C)=CC(C)=C1
BD6780
98%
MFCD00013707
2,4,6-TRIMETHYLPHENOL
CAS:527-60-6
Formula: OC1=C(C)C=C(C)C=C1C
BD66342
98%
MFCD00002235
2,4,6-TRIMETHYLPHENYLBORONIC ACID
CAS:5980-97-2
Formula: OB(C1=C(C)C=C(C)C=C1C)O
BD6930
97%
MFCD00236060
2,4,6-TRIMETHYLPHENYLGLYOXAL HYDRATE
CAS:142751-35-7
Formula: O.CC1=C(C(=CC(=C1)C)C)C(=O)C=O
BD66346
95+%
MFCD08705863
2,4,6-TRIMETHYLPHENYLISOCYANATE
CAS:2958-62-5
Formula: CC1=C(N=C=O)C(C)=CC(C)=C1
BD66343
MFCD00019909
2,4,6-TRIMETHYLPHENYLISOTHIOCYANATE
CAS:6095-82-5
Formula: CC1=C(N=C=S)C(C)=CC(C)=C1
BD66344
97%
MFCD00022055
2,4,6-TRIMETHYLPYRIDIN-3-AMINE
CAS:51467-70-0
Formula: NC1=C(C)C=C(C)N=C1C
BD66349
95%
MFCD05257015
2,4,6-TRIMETHYLPYRIDINE
CAS:108-75-8
Formula: CC1=CC(C)=CC(C)=N1
BD17226
98%
MFCD00006338
2,4,6-TRIMETHYLPYRIDINIUM P-TOLUENESULFONATE
CAS:59229-09-3
Formula: CC1=NC(C)=CC(C)=C1.CC2=CC=C(S(=O)(O)=O)C=C2
BD5289
98%
MFCD00012810
2,4,6-TRIMETHYLPYRIMIDIN-5-OL
CAS:71267-12-4
Formula: OC1=C(C)N=C(C)N=C1C
BD277203
95+%
MFCD00466668
2,4,6-TRIMETHYLPYRIMIDINE-5-CARBOXYLIC ACID
CAS:108397-75-7
Formula: O=C(C1=C(C)N=C(C)N=C1C)O
BD250711
95+%
MFCD11040459
2,4,6-TRIPHENOXY-1,3,5-TRIAZINE
CAS:1919-48-8
Formula: C1(OC2=CC=CC=C2)=NC(OC3=CC=CC=C3)=NC(OC4=CC=CC=C4)=N1
BD66364
95+%
MFCD00006048
2,4,6-TRIPHENYL-1,3,5,2,4,6-TRIAZATRIBORINANE
CAS:976-28-3
Formula: B1(C2=CC=CC=C2)NB(C3=CC=CC=C3)NB(C4=CC=CC=C4)N1
BD66367
95+%
MFCD01321236
2,4,6-TRIPHENYL-1,3,5,2,4,6-TRIOXATRIBORINANE
CAS:3262-89-3
Formula: B1(C2=CC=CC=C2)OB(C3=CC=CC=C3)OB(C4=CC=CC=C4)O1
BD155693
98%
MFCD00014587
2,4,6-TRIPHENYL-1,3,5-TRIAZINE
CAS:493-77-6
Formula: C1(C2=CC=CC=C2)=NC(C3=CC=CC=C3)=NC(C4=CC=CC=C4)=N1
BD1298
99%
MFCD00006051
2,4,6-TRIPHENYLPYRIDINE
CAS:580-35-8
Formula: C1(C2=CC=CC=C2)=NC(C3=CC=CC=C3)=CC(C4=CC=CC=C4)=C1
BD1534
98%
MFCD00014630
2,4,6-TRIPHENYLPYRIMIDINE
CAS:1666-86-0
Formula: C1(C2=CC=CC=C2)=NC(C3=CC=CC=C3)=CC(C4=CC=CC=C4)=N1
BD626924
97%
n/a
2,4,6-TRIPHENYLPYRYLIUM HYDROGENSULFATE
CAS:51071-75-1
Formula: [O-]S(=O)(O)=O.C1(C2=CC=CC=C2)=CC(C3=CC=CC=C3)=CC(C4=CC=CC=C4)=[O+]1
BD66371
97%
MFCD00012002
2,4,6-TRIPHENYLPYRYLIUM TETRAFLUOROBORATE
CAS:448-61-3
Formula: F[B-](F)(F)F.C1(C2=CC=CC=C2)=CC(C3=CC=CC=C3)=CC(C4=CC=CC=C4)=[O+]1
BD66372
95%
MFCD00012001
2,4,6-TRIPHENYLPYRYLIUM TRIFLUOROMETHANESULFONATE
CAS:70962-62-8
Formula: O=S(C(F)(F)F)([O-])=O.C1(C2=CC=CC=C2)=CC(C3=CC=CC=C3)=CC(C4=CC=CC=C4)=[O+]1
BD66373
97%
MFCD00051894
2,4,6-TRIS(2,4,6-TRIBROMOPHENOXY)-1,3,5-TRIAZINE
CAS:25713-60-4
Formula: BrC1=C(OC2=NC(OC3=C(Br)C=C(Br)C=C3Br)=NC(OC4=C(Br)C=C(Br)C=C4Br)=N2)C(Br)=CC(Br)=C1
BD7915
98%
MFCD03092948
2,4,6-TRIS(2-BROMOPHENYL)-1,3,5-TRIAZINE
CAS:1690315-37-7
Formula: BrC1=CC=CC=C1C2=NC(C3=CC=CC=C3Br)=NC(C4=CC=CC=C4Br)=N2
BD328249
95+%
MFCD28964711
2,4,6-TRIS(3,4,5-TRIFLUOROPHENYL)-1,3,5,2,4,6-TRIOXATRIBORINANE
CAS:223440-94-6
Formula: FC1=C(F)C(F)=CC(B2OB(C3=CC(F)=C(F)C(F)=C3)OB(C4=CC(F)=C(F)C(F)=C4)O2)=C1
BD66379
95+%
MFCD03844809
2,4,6-TRIS(3,4-DICHLOROPHENYL)BOROXIN
CAS:1133798-41-0
Formula: ClC1=CC=C(B2OB(C3=CC=C(C(Cl)=C3)Cl)OB(C4=CC=C(C(Cl)=C4)Cl)O2)C=C1Cl
BD00848761
95%
MFCD10000954
2,4,6-TRIS(3,4-DIFLUOROPHENYL)BOROXIN
CAS:1456935-98-0
Formula: FC1=CC=C(B2OB(C3=CC=C(C(F)=C3)F)OB(C4=CC=C(C(F)=C4)F)O2)C=C1F
BD00847103
95%
MFCD10000965
2,4,6-TRIS(3-BROMOPHENYL)-1,3,5-TRIAZINE
CAS:890148-78-4
Formula: BrC1=CC(C2=NC(C3=CC=CC(Br)=C3)=NC(C4=CC=CC(Br)=C4)=N2)=CC=C1
BD322188
95+%
MFCD28964709
2,4,6-TRIS(4-(1H-IMIDAZOL-1-YL)PHENYL)-1,3,5-TRIAZINE
CAS:1009564-95-7
Formula: C1(C2=CC=C(N3C=CN=C3)C=C2)=NC(C4=CC=C(N5C=CN=C5)C=C4)=NC(C6=CC=C(N7C=CN=C7)C=C6)=N1
BD763441
97%
2,4,6-TRIS(4-BROMOPHENYL)-1,3,5-TRIAZINE
CAS:30363-03-2
Formula: BrC1=CC=C(C2=NC(C3=CC=C(Br)C=C3)=NC(C4=CC=C(Br)C=C4)=N2)C=C1
BD33129
95%
MFCD04116312
2,4,6-TRIS(4-ETHYNYLPHENYL)-1,3,5-TRIAZINE
CAS:425629-22-7
Formula: C#CC1=CC=C(C2=NC(C3=CC=C(C#C)C=C3)=NC(C4=CC=C(C#C)C=C4)=N2)C=C1
BD01159842
98%
2,4,6-TRIS(4-FLUOROPHENYL)-1,3,5,2,4,6-TRIOXATRIBORINANE
CAS:448-59-9
Formula: FC1=CC=C(B2OB(C3=CC=C(F)C=C3)OB(C4=CC=C(F)C=C4)O2)C=C1
BD434141
97%
MFCD02093496
2,4,6-TRIS(4-METHOXYPHENYL)PYRYLIUM TETRAFLUOROBORATE
CAS:580-34-7
Formula: COC1=CC=C(C2=[O+]C(C3=CC=C(OC)C=C3)=CC(C4=CC=C(OC)C=C4)=C2)C=C1.F[B-](F)(F)F
BD425353
97+%
MFCD00160229
2,4,6-TRIS(BENZYLOXY)-1,3,5-TRIAZINE
CAS:7285-83-8
Formula: C1(OCC2=CC=CC=C2)=NC(OCC3=CC=CC=C3)=NC(OCC4=CC=CC=C4)=N1
BD292917
95+%
MFCD23143155
2,4,6-TRIS(DIFLUOROMETHYL)-1,3,5-TRIAZINE
CAS:369-22-2
Formula: FC(C1=NC(C(F)F)=NC(C(F)F)=N1)F
BD00866799
95%
MFCD08059507
2,4,6-TRIS(DIMETHYLAMINOMETHYL)PHENOL
CAS:90-72-2
Formula: OC1=C(CN(C)C)C=C(CN(C)C)C=C1CN(C)C
BD66389
80%
MFCD00008330
2,4,6-TRIS(M-TERPHENYL-5'-YL)BOROXIN
CAS:909407-14-3
Formula: B1(C2=CC(C3=CC=CC=C3)=CC(C4=CC=CC=C4)=C2)OB(C5=CC(C6=CC=CC=C6)=CC(C7=CC=CC=C7)=C5)OB(C8=CC(C9=CC=CC=
BD00822618
95%
MFCD04038427
2,4,6-TRIS(METHYLTHIO)-1,3,5-TRIAZINE
CAS:5759-58-0
Formula: CSC1=NC(SC)=NC(SC)=N1
BD66391
MFCD01678800
2,4,6-TRIS(PERFLUOROHEPTYL)-1,3,5-TRIAZINE
CAS:21674-38-4
Formula: FC(C1=NC(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)=NC(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C
BD66393
MFCD00042439
2,4,6-TRIS(PERFLUOROPENTYL)-S-TRIAZINE
CAS:23790-50-3
Formula: FC(F)(C(F)(C(F)(C(F)(C(F)(C1=NC(C(F)(C(F)(C(F)(C(F)(C(F)(F)F)F)F)F)F)=NC(C(F)(C(F)(C(F)(C(F)(C(F)(F)
BD00821745
95%
MFCD18074371
2,4,6-TRIS(PERFLUOROPHENYL)-1,3,5-TRIAZINE
CAS:160248-96-4
Formula: FC1=C(F)C(F)=C(F)C(F)=C1C2=NC(C3=C(F)C(F)=C(F)C(F)=C3F)=NC(C4=C(F)C(F)=C(F)C(F)=C4F)=N2
BD00806357
95%
MFCD31704949
2,4,6-TRIS(TRICHLOROMETHYL)-1,3,5-TRIAZINE
CAS:6542-67-2
Formula: ClC(C1=NC(C(Cl)(Cl)Cl)=NC(C(Cl)(Cl)Cl)=N1)(Cl)Cl
BD66396
MFCD00023177
2,4,6-TRIS(TRIFLUOROMETHYL)-1,3,5-TRIAZINE
CAS:368-66-1
Formula: FC(C1=NC(C(F)(F)F)=NC(C(F)(F)F)=N1)(F)F
BD66397
95+%
MFCD00042436
2,4,6-TRIS(TRIFLUOROMETHYL)BENZOICACID
CAS:25753-26-8
Formula: O=C(O)C1=C(C(F)(F)F)C=C(C(F)(F)F)C=C1C(F)(F)F
BD66400
MFCD08669642
2,4,6-TRIS[BIS(METHOXYMETHYL)AMINO]-1,3,5-TRIAZINE
CAS:3089-11-0
Formula: COCN(C1=NC(N(COC)COC)=NC(N(COC)COC)=N1)COC
BD66402
98%
MFCD00047342
2,4,6-TRIVINYLCYCLOTRIBOROXANE PYRIDINE COMPLEX
CAS:2149634-75-1
Formula: C=CB1OB(OB(O1)C=C)C=C.C2=CN=CC=C2
BD00755422
97% mix TBC as stabilizer
MFCD03839940
2,4,6-TRIVINYLCYCLOTRIBOROXANEPYRIDINECOMPLEX
CAS:95010-17-6
Formula: [C-]([B+3](N1=CC=CC=C1)1[O-]B(C=C)OB(C=C)[O-]1)=C
BD448840
97% mix TBC as stabilizer
n/a
2,4,7,8,9-PENTA-O-ACETYL N-ACETYLNEURAMINIC ACID
CAS:4887-11-0
Formula: O=C(O)[C@]1(O[C@H]([C@@H]([C@H](C1)OC(C)=O)NC(C)=O)[C@@H]([C@@H](COC(C)=O)OC(C)=O)OC(C)=O)OC(C)=O
BD244389
95+%
MFCD18643103
2,4,7,9-TETRACHLORO-1,10-PHENANTHROLINE
CAS:167946-48-7
Formula: ClC1=CC(Cl)=C(C=CC2=C(Cl)C=C(Cl)N=C32)C3=N1
BD330451
98%
MFCD28291911
2,4,7,9-TETRAMETHYL-5-DECYNE-4,7-DIOL
CAS:126-86-3
Formula: CC(C)CC(C)(O)C#CC(C)(O)CC(C)C
BD17905
97%
MFCD00008942
2,4,7,9-TETRAMETHYLBENZO[B][1,8]NAPHTHYRIDIN-5-AMINE
CAS:309726-06-5
Formula: NC1=C2C(C)=CC(C)=NC2=NC3=C(C)C=C(C)C=C31
BD177222
97%
MFCD01871983
2,4,7-TRIBROMOBENZO[D]THIAZOLE
CAS:898747-98-3
Formula: BrC1=C(SC(Br)=N2)C2=C(Br)C=C1
BD249033
95+%
MFCD08459013
2,4,7-TRICHLORO-5H-PYRROLO[3,2-D]PYRIMIDINE
CAS:1923177-10-9
Formula: ClC1=CNC2=C(Cl)N=C(Cl)N=C21
BD266567
95+%
MFCD22398070
2,4,7-TRICHLORO-6-FLUOROQUINAZOLINE
CAS:174566-16-6
Formula: FC1=CC2=C(Cl)N=C(Cl)N=C2C=C1Cl
BD00781111
2,4,7-TRICHLOROBENZO[D]THIAZOLE
CAS:898747-91-6
Formula: ClC1=NC2=C(S1)C(Cl)=CC=C2Cl
BD236622
95+%
MFCD04971824
2,4,7-TRICHLOROPYRIDO[2,3-D]PYRIMIDINE
CAS:938443-20-0
Formula: ClC1=NC2=C(C=C1)C(Cl)=NC(Cl)=N2
BD158866
95+%
MFCD11109463
2,4,7-TRICHLOROPYRIDO[3,2-D]PYRIMIDINE
CAS:1260663-38-4
Formula: ClC1C=NC2C(=NC(=NC=2Cl)Cl)C=1
BD00750611
95%
MFCD18250467
2,4,7-TRICHLOROPYRIDO[4,3-D]PYRIMIDINE
CAS:N/A
Formula: ClC1N=CC2C(=NC(=NC=2Cl)Cl)C=1
BD00751266
95%
2,4,7-TRICHLOROQUINAZOLINE
CAS:6625-94-1
Formula: ClC1=CC2=NC(Cl)=NC(Cl)=C2C=C1
BD66416
98%
MFCD09954887
2,4,7-TRICHLOROQUINOLINE
CAS:1677-49-2
Formula: ClC1=CC=C2C(Cl)=CC(Cl)=NC2=C1
BD227254
97%
MFCD00830403
2,4,7-TRICHLOROTHIENO[3,2-D]PYRIMIDINE
CAS:41102-27-6
Formula: ClC1=CSC2=C(Cl)N=C(Cl)N=C21
BD250615
95+%
MFCD12962877
2,4,7-TRIMETHYL-1H-INDENE
CAS:144284-76-4
Formula: CC1=CC2=C(C)C=CC(C)=C2C1
BD237484
98%
MFCD09835222
2,4,7-TRIMETHYL-1H-INDOLE-3-CARBALDEHYDE
CAS:883547-98-6
Formula: O=CC1=C(C)NC2=C1C(C)=CC=C2C
BD187717
97%
MFCD08144095
2,4,7-TRIMETHYL-2,3-DIHYDRO-1H-INDEN-1-ONE
CAS:89044-50-8
Formula: CC1CC2=C(C)C=CC(C)=C2C1=O
BD237535
95+%
MFCD09835216
2,4,7-TRIMETHYLBENZO[B][1,8]NAPHTHYRIDIN-5(10H)-ONE
CAS:82756-19-2
Formula: O=C1C2=CC(C)=CC=C2NC3=C1C(C)=CC(C)=N3
BD554134
97%
MFCD01892214
2,4,8,10-TETRAOXASPIRO[5.5]UNDECANE-3,9-DIYLBIS(2-METHYLPROPANE-2,1-DIYL) BIS(3-(3-(TERT-BUTYL)-4-HYDROXY-5-METHYLPHENYL)PROPANOATE)
CAS:90498-90-1
Formula: CC(C1OCC2(COC(C(C)(C)COC(CCC3=CC(C)=C(O)C(C(C)(C)C)=C3)=O)OC2)CO1)(C)COC(CCC4=CC(C)=C(O)C(C(C)(C)C)=
BD152277
98+%
MFCD09838745
2,4,8-TRICHLORO-6-FLUOROQUINAZOLINE
CAS:1702815-70-0
Formula: FC1=CC2=C(Cl)N=C(Cl)N=C2C(Cl)=C1
BD753978
97%
2,4,8-TRICHLORO-7-METHOXYQUINOLINE
CAS:893620-26-3
Formula: COC1=CC=C2C(Cl)=CC(Cl)=NC2=C1Cl
BD150089
95+%
MFCD06654791
2,4,8-TRICHLOROPYRIDO[3,4-D]PYRIMIDINE
CAS:1470249-17-2
Formula: ClC1=NC=CC2=C(Cl)N=C(Cl)N=C21
BD443950
95%
MFCD29059233
2,4,8-TRICHLOROQUINAZOLINE
CAS:62484-29-1
Formula: ClC1=CC=CC2=C1N=C(Cl)N=C2Cl
BD165783
97%
MFCD09954870
2,4,8-TRICHLOROQUINOLINE
CAS:1695-58-5
Formula: ClC1=C2N=C(Cl)C=C(Cl)C2=CC=C1
BD618876
97%
2,4,8-TRIMETHYL-1,2,3,4-TETRAHYDROQUINOLINE HYDROBROMIDE
CAS:1050556-42-7
Formula: CC1CC(C2=CC=CC(C)=C2N1)C.Br
BD00848634
95%
MFCD08582794
2,4-BIPYRIDINE
CAS:581-47-5
Formula: C1(C2=CC=NC=C2)=NC=CC=C1
BD12714
97%
MFCD00006217
2,4-BIS((DODECYLTHIO)METHYL)-6-METHYLPHENOL
CAS:110675-26-8
Formula: OC1=C(C)C=C(CSCCCCCCCCCCCC)C=C1CSCCCCCCCCCCCC
BD756013
97%
MFCD11973660
2,4-BIS((TERT-BUTOXYCARBONYL)AMINO)BUTANOIC ACID
CAS:130853-32-6
Formula: O=C(O)C(NC(OC(C)(C)C)=O)CCNC(OC(C)(C)C)=O
BD218674
96%
MFCD11858325
2,4-BIS((TRIMETHYLSILYL)OXY)PYRIMIDINE
CAS:10457-14-4
Formula: C[Si](OC1=NC(O[Si](C)(C)C)=NC=C1)(C)C
BD66466
98%
MFCD00054760
2,4-BIS(2-PHENYLPROPAN-2-YL)PHENOL
CAS:2772-45-4
Formula: OC1=CC=C(C(C)(C2=CC=CC=C2)C)C=C1C(C)(C3=CC=CC=C3)C
BD66432
97%
MFCD00191242
2,4-BIS(4-METHOXYPHENYL)-4-OXOBUTANENITRILE
CAS:23073-04-3
Formula: N#CC(C1=CC=C(OC)C=C1)CC(C2=CC=C(OC)C=C2)=O
BD509788
97%
MFCD01083067
2,4-BIS(BENZYLOXY)-5-(5,5-DIMETHYL-1,3,2-DIOXABORINAN-2-YL)PYRIMIDINE
CAS:1072944-91-2
Formula: CC1(C)COB(C2=CN=C(OCC3=CC=CC=C3)N=C2OCC4=CC=CC=C4)OC1
BD255907
95+%
MFCD09037496
2,4-BIS(BENZYLOXY)-5-(PROP-1-EN-2-YL)BENZOIC ACID
CAS:912545-09-6
Formula: O=C(C1=CC(C(C)=C)=C(C=C1OCC2=CC=CC=C2)OCC3=CC=CC=C3)O
BD00856460
95%
MFCD28965491
2,4-BIS(BENZYLOXY)-5-BROMOBENZOIC ACID
CAS:912545-10-9
Formula: O=C(C1=CC(Br)=C(C=C1OCC2=CC=CC=C2)OCC3=CC=CC=C3)O
BD00948074
95%
MFCD27979073
2,4-BIS(BENZYLOXY)-5-BROMOPYRIMIDINE
CAS:41244-53-5
Formula: C1=NC(=NC(=C1Br)OCC2=CC=CC=C2)OCC3=CC=CC=C3
BD60565
96%
MFCD00267932
2,4-BIS(BENZYLOXY)-5-ISOPROPYLBENZALDEHYDE
CAS:959466-51-4
Formula: O=CC1=CC(C(C)C)=C(OCC2=CC=CC=C2)C=C1OCC3=CC=CC=C3
BD262077
95+%
MFCD24849960
2,4-BIS(BENZYLOXY)-6-CHLORO-1,3,5-TRIAZINE
CAS:851030-18-7
Formula: ClC1=NC(OCC2=CC=CC=C2)=NC(OCC3=CC=CC=C3)=N1
BD00807377
95% HPLC,T
2,4-BIS(BENZYLOXY)PYRIMIDIN-5-YLBORONIC ACID
CAS:70523-24-9
Formula: OB(O)C1=CN=C(OCC2=CC=CC=C2)N=C1OCC1=CC=CC=C1
BD16857
95+%
MFCD01318938
2,4-BIS(BENZYLOXY)PYRIMIDINE
CAS:7306-79-8
Formula: C1(OCC2=CC=CC=C2)=NC=CC(OCC3=CC=CC=C3)=N1
BD66433
98%
MFCD06798236
2,4-BIS(CHLOROMETHYL)-1,3,5-TRIMETHYLBENZENE
CAS:1585-17-7
Formula: CC1=C(CCl)C(C)=C(CCl)C(C)=C1
BD13222
MFCD00013681
2,4-BIS(DIMETHYLAMINO)THIAZOLE-5-CARBALDEHYDE
CAS:1417172-00-9
Formula: O=CC1=C(N(C)C)N=C(N(C)C)S1
BD510102
97%
MFCD24540235
2,4-BIS(METHOXYMETHOXY)-1-METHYLBENZENE
CAS:1380698-48-5
Formula: CC1=CC=C(OCOC)C=C1OCOC
BD243855
95+%
MFCD24847831
2,4-BIS(METHYLSULFONYL)BENZALDEHYDE
CAS:1845690-57-4
Formula: O=CC1=CC=C(S(=O)(C)=O)C=C1S(=O)(C)=O
BD455267
96%
MFCD28962763
2,4-BIS(METHYLTHIO)PYRIMIDINE
CAS:5909-26-2
Formula: CSC1=NC(SC)=NC=C1
BD447577
97%
MFCD18974850
2,4-BIS(METHYLTHIO)PYRIMIDINE-5-CARBALDEHYDE
CAS:1372096-40-6
Formula: O=CC1=CN=C(SC)N=C1SC
BD582205
97%
MFCD21647862
2,4-BIS(METHYLTHIO)PYRIMIDINE-5-CARBOXYLIC ACID
CAS:6299-27-0
Formula: O=C(C1=CN=C(SC)N=C1SC)O
BD583110
97%
MFCD21647861
2,4-BIS(METHYLTHIO)QUINAZOLINE
CAS:48141-61-3
Formula: CSC1=C2C=CC=CC2=NC(SC)=N1
BD00978876
95%
MFCD27924318
2,4-BIS(TERT-BUTYL)-6-NITROPHENOL
CAS:20039-94-5
Formula: OC1=C([N+]([O-])=O)C=C(C(C)(C)C)C=C1C(C)(C)C
BD00811001
97%
MFCD00026282
2,4-BIS(TRICHLOROMETHYL)-6-METHYL-1,3,5-TRIAZINE
CAS:949-42-8
Formula: CC1=NC(C(Cl)(Cl)Cl)=NC(C(Cl)(Cl)Cl)=N1
BD66449
MFCD00023178
2,4-BIS(TRIFLUOROMETHYL)-5,6,7,8-TETRAHYDROPYRIDO-[3,4-D]PYRIMIDINE HYDROCHLORIDE
CAS:911636-86-7
Formula: FC(C1=C2C(CNCC2)=NC(C(F)(F)F)=N1)(F)F.[H]Cl
BD316091
95+%
MFCD23106428
2,4-BIS(TRIFLUOROMETHYL)BENZALDEHYDE
CAS:59664-42-5
Formula: O=CC1=CC=C(C(F)(F)F)C=C1C(F)(F)F
BD7164
97%
MFCD00083535
2,4-BIS(TRIFLUOROMETHYL)BENZAMIDE
CAS:53130-45-3
Formula: O=C(N)C1=CC=C(C(F)(F)F)C=C1C(F)(F)F
BD66453
95+%
MFCD00083536
2,4-BIS(TRIFLUOROMETHYL)BENZOIC ACID
CAS:32890-87-2
Formula: O=C(O)C1=CC=C(C(F)(F)F)C=C1C(F)(F)F
BD7166
95+%
MFCD00042496
2,4-BIS(TRIFLUOROMETHYL)BENZONITRILE
CAS:177952-38-4
Formula: N#CC1=CC=C(C(F)(F)F)C=C1C(F)(F)F
BD7153
98%
MFCD00061225
2,4-BIS(TRIFLUOROMETHYL)BENZOYL CHLORIDE
CAS:53130-43-1
Formula: O=C(Cl)C1=CC=C(C(F)(F)F)C=C1C(F)(F)F
BD7149
98%
MFCD00061227
2,4-BIS(TRIFLUOROMETHYL)BENZYLAMINE
CAS:286010-20-6
Formula: NCC1=CC=C(C(F)(F)F)C=C1C(F)(F)F
BD307812
95+%
MFCD06212780
2,4-BIS(TRIFLUOROMETHYL)CINNAMIC ACID
CAS:773129-10-5
Formula: O=C(O)/C=C/C1=CC=C(C(F)(F)F)C=C1C(F)(F)F
BD309146
95+%
MFCD06205287
2,4-BIS(TRIFLUOROMETHYL)IMIDAZO[1,2-A][1,8]NAPHTHYRIDINE-8-CARBOXYLIC ACID
CAS:439094-96-9
Formula: OC(=O)C1=CN2C(C=CC3=C2N=C(C=C3C(F)(F)F)C(F)(F)F)=N1
BD225963
95+%
MFCD03425718
2,4-BIS(TRIFLUOROMETHYL)NITROBENZENE
CAS:224044-97-7
Formula: FC(C1=CC=C([N+]([O-])=O)C(C(F)(F)F)=C1)(F)F
BD00805724
97%
MFCD13185347
2,4-BIS(TRIFLUOROMETHYL)PHENYLACETIC ACID
CAS:177952-39-5
Formula: O=C(O)CC1=CC=C(C(F)(F)F)C=C1C(F)(F)F
BD0373
97%
MFCD00042492
2,4-BIS(TRIFLUOROMETHYL)PHENYLBORONIC ACID
CAS:153254-09-2
Formula: OB(O)C1=CC=C(C=C1C(F)(F)F)C(F)(F)F
BD27613
98%
MFCD01631349
2,4-BIS(TRIFLUOROMETHYL)PYRIMIDINE-5-CARBOXYLIC ACID
CAS:188781-46-6
Formula: O=C(C1=CN=C(C(F)(F)F)N=C1C(F)(F)F)O
BD182259
95+%
MFCD10697912
2,4-BIS(TRIFLUOROMETHYL)TOLUENE
CAS:136664-96-5
Formula: CC1=CC=C(C(F)(F)F)C=C1C(F)(F)F
BD307297
95+%
MFCD00792411
2,4-BIS[8-HYDROXY-1,1,7,7-TETRAMETHYLJULOLIDIN-9-YL]SQUARAINE
CAS:358727-55-6
Formula: CC1(C)CCN2CCC(C)(C)C3=CC([C+]4[C+]([O-])C(C5=C([O-])C6=C7N(CCC6(C)C)CCC(C)(C)C7=C5)=C4O)=C([O-])C1=C
BD01069578
98%
MFCD28386094
2,4-DECADIEN-1-OL
CAS:14507-02-9
Formula: CCCCC/C=C/C=C/CO
BD66476
2,4-DI([1,1'-BIPHENYL]-3-YL)-6-CHLORO-1,3,5-TRIAZINE
CAS:1205748-61-3
Formula: ClC1=NC(C2=CC(C3=CC=CC=C3)=CC=C2)=NC(C4=CC(C5=CC=CC=C5)=CC=C4)=N1
BD635459
97%
MFCD30536777
2,4-DI([1,1'-BIPHENYL]-4-YL)-6-CHLORO-1,3,5-TRIAZINE
CAS:182918-13-4
Formula: ClC1=NC(C2=CC=C(C3=CC=CC=C3)C=C2)=NC(C4=CC=C(C5=CC=CC=C5)C=C4)=N1
BD627668
97%
MFCD27979765
2,4-DI(PIPERIDIN-1-YL)ANILINE
CAS:436096-88-7
Formula: NC1=CC=C(N2CCCCC2)C=C1N3CCCCC3
BD554097
97%
MFCD03446197
2,4-DI(PIPERIDIN-1-YL)QUINAZOLINE
CAS:28708-93-2
Formula: C1(N2CCCCC2)=NC(N3CCCCC3)=C4C=CC=CC4=N1
BD624528
97%
2,4-DI(PYRROLIDIN-1-YL)PYRIMIDIN-5-AMINE
CAS:1706447-19-9
Formula: NC1=CN=C(N2CCCC2)N=C1N3CCCC3
BD619521
97%
2,4-DI-TERT-BUTOXYPYRIMIDINE-5-CARBALDEHYDE
CAS:172949-72-3
Formula: O=CC1=CN=C(OC(C)(C)C)N=C1OC(C)(C)C
BD217776
95+%
MFCD13181620
2,4-DI-TERT-BUTYL-1-METHOXYBENZENE
CAS:17177-98-9
Formula: COC1=CC=C(C(C)(C)C)C=C1C(C)(C)C
BD249392
95+%
2,4-DI-TERT-BUTYL-5-(4-OXO-1,4-DIHYDROQUINOLINE-3-CARBOXAMIDO)PHENYL METHYL CARBONATE
CAS:1246213-45-5
Formula: O=C(OC1=CC(NC(C2=CNC3=C(C=CC=C3)C2=O)=O)=C(C(C)(C)C)C=C1C(C)(C)C)OC
BD632317
97%
2,4-DI-TERT-BUTYL-5-FLUOROPHENOL
CAS:2923-83-3
Formula: OC1=CC(F)=C(C=C1C(C)(C)C)C(C)(C)C
BD00862653
95%
MFCD30828817
2,4-DI-TERT-BUTYL-5-NITROPHENOL
CAS:873055-57-3
Formula: OC1=CC([N+]([O-])=O)=C(C(C)(C)C)C=C1C(C)(C)C
BD249779
95+%
MFCD11052606
2,4-DI-TERT-BUTYL-5-NITROPHENYL METHYL CARBONATE
CAS:873055-55-1
Formula: O=C(OC1=CC([N+]([O-])=O)=C(C(C)(C)C)C=C1C(C)(C)C)OC
BD249778
97%
MFCD11113067
2,4-DI-TERT-BUTYL-6-(((2-((3,5-DI-TERT-BUTYL-2-METHYLBENZYL)(METHYL)AMINO)ETHYL)(METHYL)AMINO)METHYL)PHENOL
CAS:886362-16-9
Formula: OC1=C(CN(CCN(CC2=CC(C(C)(C)C)=CC(C(C)(C)C)=C2C)C)C)C=C(C(C)(C)C)C=C1C(C)(C)C
BD200944
95+%
MFCD08056682
2,4-DI-TERT-BUTYL-6-(5-CHLORO-2H-BENZO[D][1,2,3]TRIAZOL-2-YL)PHENOL
CAS:3864-99-1
Formula: CC(C)(C)C1=CC(=C(O)C(=C1)N1N=C2C=CC(Cl)=CC2=N1)C(C)(C)C
BD20587
98%
MFCD00059706
2,4-DI-TERT-BUTYL-6-CHLORO-1,3,5-TRIAZINE
CAS:73084-03-4
Formula: ClC1=NC(C(C)(C)C)=NC(C(C)(C)C)=N1
BD336623
95+%
MFCD28991904
2,4-DI-TERT-BUTYL-6-CHLOROPYRIMIDINE
CAS:69050-89-1
Formula: ClC1=CC(C(C)(C)C)=NC(C(C)(C)C)=N1
BD00987660
95%
MFCD00234810
2,4-DI-TERT-BUTYLANILINE
CAS:2909-84-4
Formula: NC1=CC=C(C(C)(C)C)C=C1C(C)(C)C
BD331178
95+%
MFCD02683807
2,4-DI-TERT-BUTYLPHENOL
CAS:96-76-4
Formula: OC1=CC=C(C(C)(C)C)C=C1C(C)(C)C
BD67226
98%
MFCD00008828
2,4-DI-TERT-BUTYLPHENYL METHYL CARBONATE
CAS:873055-54-0
Formula: O=C(OC1=CC=C(C(C)(C)C)C=C1C(C)(C)C)OC
BD632732
97%
2,4-DI-TERT-PENTYLPHENOL
CAS:120-95-6
Formula: OC1=CC=C(C(C)(C)CC)C=C1C(C)(C)CC
BD67228
98%
MFCD00041929
2,4-DIAMINO-3-CHLOROPHENOL
CAS:13297-01-3
Formula: NC1=C(Cl)C(N)=C(O)C=C1
BD239376
95+%
MFCD20695851
2,4-DIAMINO-4-OXOBUTANOIC ACID HYDRATE
CAS:69833-18-7
Formula: O=C(O)C(N)CC(N)=O.[H]O[H]
BD303918
95+%
MFCD00151039
2,4-DIAMINO-5-(2,4-DICHLOROBENZYL)PYRIMIDINE
CAS:65321-42-8
Formula: ClC1=CC=C(C(Cl)=C1)CC2=CN=C(N)N=C2N
BD324006
95+%
MFCD09877840
2,4-DIAMINO-5-(3,4-DICHLOROBENZYL)PYRIMIDINE
CAS:30077-58-8
Formula: ClC1=CC=C(C=C1Cl)CC2=CN=C(N)N=C2N
BD323597
95+%
MFCD09877843
2,4-DIAMINO-5-(3-FLUOROBENZYL)PYRIMIDINE
CAS:69945-57-9
Formula: FC1=CC(CC2=CN=C(N)N=C2N)=CC=C1
BD324081
95+%
MFCD09877842
2,4-DIAMINO-5-(3-METHOXYBENZYL)PYRIMIDINE
CAS:59481-28-6
Formula: COC1=CC(CC2=CN=C(N)N=C2N)=CC=C1
BD323931
95+%
MFCD01759054
2,4-DIAMINO-5-(4-FLUOROBENZYL)PYRIMIDINE
CAS:836-06-6
Formula: FC1=CC=C(C=C1)CC2=CN=C(N)N=C2N
BD324228
95+%
MFCD09877841
2,4-DIAMINO-5-(4-METHOXYBENZYL)PYRIMIDINE
CAS:20285-70-5
Formula: COC1=CC=C(C=C1)CC2=CN=C(N)N=C2N
BD323455
95+%
MFCD00447269
2,4-DIAMINO-5-(4-NITROBENZYL)PYRIMIDINE
CAS:69945-52-4
Formula: O=[N+](C1=CC=C(C=C1)CC2=CN=C(N)N=C2N)[O-]
BD324080
95+%
MFCD09877846
2,4-DIAMINO-5-FLUOROTOLUENE
CAS:141922-20-5
Formula: NC1=CC(N)=C(C=C1C)F
BD00949334
95%
MFCD19203769
2,4-DIAMINO-5-PYRIMIDINEMETHANOL
CAS:42310-45-2
Formula: NC1=NC=C(CO)C(N)=N1
BD41684
95+%
MFCD06410821
2,4-DIAMINO-6-CHLOROPYRIMIDINE-5-CARBONITRILE
CAS:900456-21-5
Formula: N#CC1=C(Cl)N=C(N)N=C1N
BD00775506
97%
2,4-DIAMINO-6-ETHOXYPYRIMIDINE
CAS:116436-03-4
Formula: CCOC1=CC(N)=NC(N)=N1
BD41200
97%
MFCD09031077
2,4-DIAMINO-6-HYDROXY-5-NITROSOPYRIMIDINE
CAS:2387-48-6
Formula: O=NC1=C(O)N=C(N)N=C1N
BD66518
MFCD00023263
2,4-DIAMINO-6-HYDROXYPYRIMIDINE-5-CARBALDEHYDE
CAS:88075-70-1
Formula: O=CC1=C(O)N=C(N)N=C1N
BD183610
95+%
MFCD03181315
2,4-DIAMINO-6-METHOXYPYRIMIDINE
CAS:3270-97-1
Formula: COC1=CC(N)=NC(N)=N1
BD41601
97%
MFCD02091088
2,4-DIAMINO-6-METHYL-5-NITROPYRIMIDINE
CAS:2829-59-6
Formula: CC1=NC(N)=NC(N)=C1[N+]([O-])=O
BD238499
95+%
MFCD00047377
2,4-DIAMINO-6-METHYLQUINAZOLINE
CAS:1955-61-9
Formula: CC1=CC2=C(N)N=C(N)N=C2C=C1
BD323439
95+%
MFCD06411664
2,4-DIAMINO-6-PHENYL-1,3,5-TRIAZINE
CAS:91-76-9
Formula: NC1=NC(C2=CC=CC=C2)=NC(N)=N1
BD23115
95%
MFCD00023187
2,4-DIAMINO-6-PIPERIDINOPYRIMIDINE
CAS:24867-26-3
Formula: NC1=NC(N)=NC(=C1)N1CCCCC1
BD41497
98%
MFCD04973589
2,4-DIAMINO-7-(5-METHYL-2-FURYL)-7,8-DIHYDROQUINAZOLIN-5(6H)-ONE
CAS:1428139-13-2
Formula: CC1=CC=C(C2CC(C3=C(N=C(N=C3N)N)C2)=O)O1
BD00848222
95%
MFCD27937019
2,4-DIAMINO-7-(5-METHYL-2-THIENYL)-7,8-DIHYDROQUINAZOLIN-5(6H)-ONE
CAS:1428139-86-9
Formula: CC1=CC=C(C2CC(C3=C(N=C(N=C3N)N)C2)=O)S1
BD00855818
95%
MFCD27937043
2,4-DIAMINO-7-BROMOQUINAZOLINE
CAS:137553-43-6
Formula: NC1=NC(N)=C2C=CC(Br)=CC2=N1
BD110338
95%
MFCD08706214
2,4-DIAMINOAZOBENZENEHYDROCHLORIDE
CAS:532-82-1
Formula: NC1=CC=C(/N=N/C2=CC=CC=C2)C(N)=C1.[H]Cl
BD66538
2,4-DIAMINOBENZALDEHYDE
CAS:98276-57-4
Formula: O=CC1=CC=C(N)C=C1N
BD258098
98%
MFCD02094162
2,4-DIAMINOBENZENESULFONIC ACID
CAS:88-63-1
Formula: O=S(C1=CC=C(N)C=C1N)(O)=O
BD66539
98%
MFCD00035772
2,4-DIAMINOBENZOIC ACID
CAS:611-03-0
Formula: O=C(O)C1=CC=C(N)C=C1N
BD270147
98%
MFCD00189383
2,4-DIAMINOBENZOIC ACID DIHYDROCHLORIDE
CAS:61566-58-3
Formula: O=C(O)C1=CC=C(N)C=C1N.[H]Cl.[H]Cl
BD331671
95+%
MFCD03844784
2,4-DIAMINOBUTANOIC ACID
CAS:305-62-4
Formula: O=C(O)C(N)CCN
BD33137
95+%
MFCD00025612
2,4-DIAMINOBUTANOIC ACID DIHYDROBROMIDE
CAS:1956306-48-1
Formula: O=C(O)C(N)CCN.[H]Br.[H]Br
BD446210
97%
MFCD27997531
2,4-DIAMINOBUTANOIC ACID HYDROCHLORIDE
CAS:19391-83-4
Formula: O=C(O)C(N)CCN.[H]Cl
BD250138
95+%
n/a
2,4-DIAMINOISOINDOLE-1,3-DIONE
CAS:121433-36-1
Formula: O=C1N(N)C(C2=C1C=CC=C2N)=O
BD325155
95%
MFCD20695051
2,4-DIAMINONICOTINAMIDE
CAS:1379323-59-7
Formula: O=C(N)C1=C(N)N=CC=C1N
BD256534
95+%
2,4-DIAMINONICOTINIC ACID
CAS:1393582-16-5
Formula: O=C(O)C1=C(N)N=CC=C1N
BD256533
95+%
MFCD22547251
2,4-DIAMINONICOTINONITRILE
CAS:860442-85-9
Formula: N#CC1=C(N)N=CC=C1N
BD256535
95+%
2,4-DIAMINOPHENOL
CAS:95-86-3
Formula: OC1=CC=C(N)C=C1N
BD231755
95+%
MFCD00025290
2,4-DIAMINOPHENOL DIHYDROCHLORIDE
CAS:137-09-7
Formula: OC1=CC=C(N)C=C1N.[H]Cl.[H]Cl
BD66546
97%
MFCD00012979
2,4-DIAMINOPHENOL SULFATE
CAS:934477-93-7
Formula: OS(O)(=O)=O.NC1=CC(N)=C(O)C=C1
BD66547
95+%
MFCD01321156
2,4-DIAMINOPTERIDINE-6-CARBOXYLIC ACID
CAS:716-74-5
Formula: O=C(C1=NC2=C(N)N=C(N)N=C2N=C1)O
BD335155
95+%
MFCD24479860
2,4-DIAMINOPYRIMIDIN-5-OL
CAS:70035-83-5
Formula: NC1=NC(N)=C(O)C=N1
BD238010
95+%
MFCD18377677
2,4-DIAMINOPYRIMIDIN-5-OL DIHYDROCHLORIDE
CAS:141124-58-5
Formula: OC1=CN=C(N)N=C1N.[H]Cl.[H]Cl
BD303737
95+%
n/a
2,4-DIAMINOPYRIMIDINE-5-CARBONITRILE
CAS:16462-27-4
Formula: C1=C(C(=NC(=N1)N)N)C#N
BD27694
95%
MFCD00085600
2,4-DIAMINOPYRIMIDINE-5-CARBOXALDEHYDE
CAS:20781-06-0
Formula: NC1=NC=C(C=O)C(N)=N1
BD28010
95+%
MFCD04973412
2,4-DIAMINOPYRIMIDINE-5-CARBOXAMIDE
CAS:66131-74-6
Formula: O=C(C1=CN=C(N)N=C1N)N
BD569627
97%
MFCD20695001
2,4-DIAMINOPYRIMIDINE-5-CARBOXAMIDE 3HCL
Formula: OC(C1=CNC(NC1=N)=N)=N.Cl.Cl.Cl
BD00859077
95%
2,4-DIAMINOPYRIMIDINE-5-CARBOXYLIC ACID
CAS:18588-61-9
Formula: O=C(C1=CN=C(N)N=C1N)O
BD211557
97%
MFCD09878517
2,4-DIBENZYLOXY BENZALDEHYDE
CAS:13246-46-3
Formula: O=CC1=CC=C(OCC2=CC=CC=C2)C=C1OCC3=CC=CC=C3
BD314832
96%
MFCD00022024
2,4-DIBENZYLOXYBENZYL ALCOHOL
CAS:33617-58-2
Formula: OCC1=CC=C(OCC2=CC=CC=C2)C=C1OCC3=CC=CC=C3
BD317525
97%
MFCD08456666
2,4-DIBROMO-1,3,5-TRIFLUOROBENZENE
CAS:363-69-9
Formula: FC1=C(Br)C(F)=C(Br)C(F)=C1
BD445509
97%
MFCD11845962
2,4-DIBROMO-1,5-DIFLUORO-3-NITROBENZENE
CAS:144450-58-8
Formula: O=[N+](C1=C(Br)C(F)=CC(F)=C1Br)[O-]
BD297143
95+%
MFCD22681519
2,4-DIBROMO-1,5-DIMETHYL-1H-IMIDAZOLE
CAS:850429-57-1
Formula: CC1=C(Br)N=C(Br)N1C
BD66558
98%
MFCD06659899
2,4-DIBROMO-1,7-NAPHTHYRIDINE
CAS:54920-77-3
Formula: BrC1=CC(Br)=NC2=CN=CC=C12
BD334606
95+%
MFCD18971591
2,4-DIBROMO-1,8-NAPHTHYRIDINE
CAS:54569-27-6
Formula: BrC1=CC(Br)=NC2=NC=CC=C12
BD267682
97%
MFCD14705080
2,4-DIBROMO-1-(2-BROMOETHOXY)BENZENE
CAS:76429-66-8
Formula: BrCCOC1=CC=C(Br)C=C1Br
BD290142
95+%
MFCD20400597
2,4-DIBROMO-1-(2-BROMOETHYL)BENZENE
CAS:59216-17-0
Formula: BrCCC1C(Br)=CC(Br)=CC=1
BD00722822
95+%
n/a
2,4-DIBROMO-1-(2-METHOXYETHOXY)BENZENE
CAS:1257665-05-6
Formula: COCCOC1=CC=C(Br)C=C1Br
BD242825
98%
MFCD18087723
2,4-DIBROMO-1-(PROPAN-2-YLOXY)BENZENE
CAS:859182-57-3
Formula: CC(OC1=CC=C(C=C1Br)Br)C
BD00860830
95%
2,4-DIBROMO-1-(TERT-BUTOXY)BENZENE
CAS:1261988-70-8
Formula: CC(OC1=CC=C(Br)C=C1Br)(C)C
BD242829
98%
MFCD18311889
2,4-DIBROMO-1-(TRIFLUOROMETHOXY)BENZENE
CAS:1840-97-7
Formula: FC(F)(F)OC1=CC=C(Br)C=C1Br
BD582415
98%
MFCD20233323
2,4-DIBROMO-1-(TRIFLUOROMETHYL)BENZENE
CAS:7657-10-5
Formula: FC(C1=CC=C(Br)C=C1Br)(F)F
BD320911
95+%
MFCD12547853
2,4-DIBROMO-1-CHLOROBENZENE
CAS:29604-75-9
Formula: ClC1=CC=C(Br)C=C1Br
BD248572
95+%
MFCD11845901
2,4-DIBROMO-1-ETHOXYBENZENE
CAS:38751-57-4
Formula: CCOC1=C(C=C(C=C1)Br)Br
BD00832044
95%
2,4-DIBROMO-1-FLUOROBENZENE
CAS:1435-53-6
Formula: FC1=CC=C(Br)C=C1Br
BD9738
95%
MFCD00000283
2,4-DIBROMO-1-IODOBENZENE
CAS:19393-94-3
Formula: BrC1=CC(Br)=C(I)C=C1
BD234210
97%
MFCD09753709
2,4-DIBROMO-1-METHOXYBENZENE
CAS:21702-84-1
Formula: COC1=CC=C(Br)C=C1Br
BD66589
98%
MFCD00000079
2,4-DIBROMO-1-METHOXYNAPHTHALENE
CAS:28768-94-7
Formula: COC1=C2C=CC=CC2=C(Br)C=C1Br
BD350406
95+%
MFCD00087951
2,4-DIBROMO-1-METHYL-1H-IMIDAZOLE
CAS:53857-60-6
Formula: CN1C=C(Br)N=C1Br
BD66559
98%
MFCD06659906
2,4-DIBROMO-1-METHYL-5-NITRO-1H-IMIDAZOLE
CAS:162759-90-2
Formula: O=[N+](C1=C(Br)N=C(Br)N1C)[O-]
BD66560
95+%
2,4-DIBROMO-1-METHYLBENZENE
CAS:31543-75-6
Formula: C1=C(C(=CC=C1Br)C)Br
BD33177
97%
MFCD00052985
2,4-DIBROMO-1-NITROBENZENE
CAS:51686-78-3
Formula: O=[N+](C1=CC=C(Br)C=C1Br)[O-]
BD66600
97%
MFCD02660416
2,4-DIBROMO-1-TRITYL-1H-IMIDAZOLE
CAS:871269-06-6
Formula: BrC1=CN(C(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4)C(Br)=N1
BD230796
98%
MFCD07363849
2,4-DIBROMO-10,11-DIHYDRO-5-AZATETRAPHENE
CAS:865658-90-8
Formula: BrC1=CC(Br)=CC2=C(C=C3C(C=CCC3)=C4)C4=CN=C21
BD00907866
90%
MFCD03618064
2,4-DIBROMO-1H-BENZO[D]IMIDAZOLE
CAS:1379312-49-8
Formula: BrC1=C2C(NC(Br)=N2)=CC=C1
BD586965
97%
2,4-DIBROMO-3,5,6-TRIFLUOROPHENOL
CAS:28520-20-9
Formula: OC1=C(F)C(F)=C(Br)C(F)=C1Br
BD285188
95+%
2,4-DIBROMO-3,5,6-TRIMETHYLANILINE
CAS:857595-61-0
Formula: NC1=C(C)C(C)=C(Br)C(C)=C1Br
BD281771
95+%
2,4-DIBROMO-3,5-DICHLOROFLUOROBENZENE
CAS:1160574-34-4
Formula: ClC1=C(Br)C(Cl)=C(Br)C(F)=C1
BD322529
95+%
MFCD11845893
2,4-DIBROMO-3,5-DIFLUOROANILINE
CAS:883549-00-6
Formula: NC1=CC(F)=C(Br)C(F)=C1Br
BD35265
98%
MFCD06797746
2,4-DIBROMO-3,5-DIMETHYLANILINE
CAS:125756-94-7
Formula: NC1=CC(C)=C(Br)C(C)=C1Br
BD322951
95+%
MFCD11846008
2,4-DIBROMO-3,5-DIMETHYLTHIOPHENE
CAS:63862-00-0
Formula: CC1=C(Br)C(C)=C(Br)S1
BD66566
95+%
MFCD11226511
2,4-DIBROMO-3,6-DICHLOROANILINE
CAS:27761-65-5
Formula: NC1=C(Cl)C=C(Br)C(Cl)=C1Br
BD66567
97%
MFCD00025156
2,4-DIBROMO-3,6-DICHLOROFLUOROBENZENE
CAS:1160574-63-9
Formula: ClC1=C(F)C(Br)=C(Cl)C(Br)=C1
BD322535
95+%
MFCD11845911
2,4-DIBROMO-3,6-DIFLUOROANILINE
CAS:1000577-86-5
Formula: NC1=C(F)C=C(Br)C(F)=C1Br
BD320593
98%
MFCD09878118
2,4-DIBROMO-3,6-DIFLUOROBENZALDEHYDE
CAS:1160573-62-5
Formula: O=CC1=C(F)C=C(Br)C(F)=C1Br
BD320815
95+%
MFCD11845988
2,4-DIBROMO-3,6-DIMETHYLANILINE
CAS:26829-89-0
Formula: NC1=C(C)C=C(Br)C(C)=C1Br
BD257952
95+%
MFCD08689499
2,4-DIBROMO-3-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PHENOL
CAS:1256781-61-9
Formula: CC1(C)OB(OC1(C)C)C1=C(Br)C=CC(O)=C1Br
BD234537
95+%
MFCD17215824
2,4-DIBROMO-3-(DIFLUOROMETHOXY)BENZOIC ACID
CAS:223595-28-6
Formula: O=C(O)C1=CC=C(Br)C(OC(F)F)=C1Br
BD10812
95+%
MFCD07368629
2,4-DIBROMO-3-CHLORO-6-ETHOXYANILINE
CAS:1706444-61-2
Formula: NC1=C(OCC)C=C(Br)C(Cl)=C1Br
BD619390
97%
2,4-DIBROMO-3-CHLORO-6-METHOXYANILINE
CAS:860586-90-9
Formula: NC1=C(OC)C=C(Br)C(Cl)=C1Br
BD331816
95+%
MFCD11655717
2,4-DIBROMO-3-CHLOROPYRIDINE
CAS:861024-77-3
Formula: ClC1=C(Br)C=CN=C1Br
BD284325
95+%
MFCD00233992
2,4-DIBROMO-3-FLUORO-6-NITROPHENOL
CAS:2924-30-3
Formula: OC1=C(Br)C(F)=C(Br)C=C1[N+]([O-])=O
BD240032
98%
MFCD20441783
2,4-DIBROMO-3-FLUOROANILINE
CAS:1253889-53-0
Formula: NC1=CC=C(Br)C(F)=C1Br
BD286609
98%
MFCD18382558
2,4-DIBROMO-3-IODOPYRIDINE
CAS:1353056-48-0
Formula: IC1=C(Br)C=CN=C1Br
BD284456
95+%
2,4-DIBROMO-3-ISOPROPYL-6-METHYLPHENOL
CAS:70454-10-3
Formula: OC1=C(C)C=C(Br)C(C(C)C)=C1Br
BD66571
95+%
MFCD02571954
2,4-DIBROMO-3-METHOXYANILINE
CAS:853953-36-3
Formula: NC1=CC=C(Br)C(OC)=C1Br
BD293286
95+%
2,4-DIBROMO-3-METHYL-6-NITROBENZOIC ACID
CAS:1820608-82-9
Formula: O=C(O)C1=C([N+]([O-])=O)C=C(Br)C(C)=C1Br
BD455118
95%
MFCD28143929
2,4-DIBROMO-3-METHYLANILINE
CAS:80948-78-3
Formula: NC1=CC=C(Br)C(C)=C1Br
BD281769
95+%
MFCD12547774
2,4-DIBROMO-3-METHYLPYRIDINE
CAS:128071-93-2
Formula: CC1=C(Br)C=CN=C1Br
BD216385
95+%
MFCD11044316
2,4-DIBROMO-3-NITRO-BENZOIC ACID METHYL ESTER
CAS:2065250-45-3
Formula: COC(C1=CC=C(C([N+]([O-])=O)=C1Br)Br)=O
BD00833294
95%
MFCD30529889
2,4-DIBROMO-3-NITROPYRIDINE
CAS:121263-10-3
Formula: O=[N+](C1=C(Br)C=CN=C1Br)[O-]
BD66572
97%
MFCD09750299
2,4-DIBROMO-3A,4,7,7A-TETRAHYDRO-1H-4,7-METHANOINDENE-1,8-DIONE
CAS:32846-64-3
Formula: O=C1C(Br)=CC2C(C3=O)(Br)C=CC3C12
BD379923
97%
MFCD05664459
2,4-DIBROMO-5,6-DICHLOROPYRIDIN-3-OL
CAS:1345472-11-8
Formula: OC1=C(Br)C(Cl)=C(Cl)N=C1Br
BD325743
98%
MFCD20441930
2,4-DIBROMO-5-(((TERT-BUTYLDIMETHYLSILYL)OXY)METHYL)THIAZOLE
CAS:870063-21-1
Formula: C[Si](OCC1=C(Br)N=C(Br)S1)(C(C)(C)C)C
BD266909
95+%
2,4-DIBROMO-5-(TRIFLUOROMETHYL)-1H-IMIDAZOLE
CAS:81654-02-6
Formula: FC(C1=C(Br)N=C(Br)N1)(F)F
BD66574
95+%
MFCD08458161
2,4-DIBROMO-5-(TRIFLUOROMETHYL)ANILINE
CAS:24115-24-0
Formula: NC1=CC(C(F)(F)F)=C(Br)C=C1Br
BD182308
95%
MFCD12547852
2,4-DIBROMO-5-CHLORO-1-METHYLIMIDAZOLE
CAS:2302-22-9
Formula: CN1C(Cl)=C(Br)N=C1Br
BD327036
95%
MFCD29035394
2,4-DIBROMO-5-CHLOROOCTAFLUOROPENTANONITRILE
CAS:240800-52-6
Formula: FC(F)(Cl)C(F)(Br)C(F)(F)C(F)(Br)C(F)(F)C#N
BD66575
95%
MFCD08461581
2,4-DIBROMO-5-CHLOROPYRIDINE
CAS:875232-70-5
Formula: ClC1=CN=C(Br)C=C1Br
BD284316
97%
MFCD00235151
2,4-DIBROMO-5-FLUORO-3-NITROPYRIDINE
CAS:884494-91-1
Formula: O=[N+](C1=C(Br)C(F)=CN=C1Br)[O-]
BD36808
95+%
MFCD05662393
2,4-DIBROMO-5-FLUOROANILINE
CAS:1000578-04-0
Formula: NC1=CC(F)=C(Br)C=C1Br
BD322263
98+%
MFCD09878124
2,4-DIBROMO-5-FLUOROBENZOIC ACID
CAS:173410-26-9
Formula: O=C(O)C1=CC(F)=C(Br)C=C1Br
BD240729
95+%
MFCD23135587
2,4-DIBROMO-5-FLUOROCHLOROBENZENE
CAS:1000578-11-9
Formula: FC1=C(Br)C=C(Br)C(Cl)=C1
BD322264
95+%
MFCD09878127
2,4-DIBROMO-5-FLUOROPHENYLBORONIC ACID
CAS:N/A
Formula: OB(C1=CC(F)=C(Br)C=C1Br)O
BD00803334
95%
2,4-DIBROMO-5-FLUOROPHENYLBORONIC ACID PINCOL ESTER
CAS:N/A
Formula: OB(C1=CC(F)=C(Br)C=C1Br)OC2(CCC3CC2C3(C)C)C
BD00777147
95%
2,4-DIBROMO-5-FLUOROPYRIDINE
CAS:1256805-06-7
Formula: FC1=CN=C(Br)C=C1Br
BD256462
95+%
MFCD11114541
2,4-DIBROMO-5-FLUOROPYRIMIDINE
CAS:1372096-33-7
Formula: FC1=CN=C(Br)N=C1Br
BD318311
95+%
MFCD21647860
2,4-DIBROMO-5-FLUOROTHIOANISOLE
CAS:1314987-31-9
Formula: CSC1=CC(F)=C(Br)C=C1Br
BD325651
98%
MFCD19684123
2,4-DIBROMO-5-HYDROXYBENZALDEHYDE
CAS:3111-51-1
Formula: O=CC1=CC(O)=C(Br)C=C1Br
BD287837
99%
2,4-DIBROMO-5-HYDROXYBENZOIC ACID
CAS:14348-39-1
Formula: O=C(O)C1=CC(O)=C(Br)C=C1Br
BD226658
95+%
MFCD22421625
2,4-DIBROMO-5-ISOPROPYLTHIAZOLE
CAS:1823346-89-9
Formula: CC(C1=C(Br)N=C(Br)S1)C
BD266551
95+%
2,4-DIBROMO-5-METHOXYANILINE
CAS:35736-52-8
Formula: NC1=CC(OC)=C(Br)C=C1Br
BD304043
95+%
MFCD08282833
2,4-DIBROMO-5-METHOXYBENZALDEHYDE
CAS:99615-74-4
Formula: O=CC1=CC(OC)=C(Br)C=C1Br
BD556343
99%
MFCD27935321
2,4-DIBROMO-5-METHOXYPYRIDINE
CAS:84539-48-0
Formula: COC1C(Br)=CC(Br)=NC=1
BD00756088
98%
MFCD18257700
2,4-DIBROMO-5-METHYL-1H-IMIDAZOLE
CAS:N/A
Formula: CC1=C(Br)N=C(Br)N1
BD439303
97%
MFCD18083749
2,4-DIBROMO-5-METHYLANILINE
CAS:67643-51-0
Formula: NC1=CC(C)=C(Br)C=C1Br
BD281768
95+%
MFCD00234284
2,4-DIBROMO-5-METHYLPYRIDINE
CAS:79055-50-8
Formula: CC1=CN=C(Br)C=C1Br
BD232002
98%
MFCD11100634
2,4-DIBROMO-5-METHYLPYRIMIDINE
CAS:494194-61-5
Formula: CC1=CN=C(Br)N=C1Br
BD537154
97%
MFCD18205976
2,4-DIBROMO-5-METHYLTHIAZOLE
CAS:1206708-88-4
Formula: CC1=C(Br)N=C(Br)S1
BD241229
98%
MFCD23135672
2,4-DIBROMO-5-NITRO-BENZOIC ACID
CAS:2065250-44-2
Formula: OC(C1=CC([N+]([O-])=O)=C(C=C1Br)Br)=O
BD00859052
95%
MFCD30529887
2,4-DIBROMO-5-NITRO-BENZOIC ACID METHYL ESTER
CAS:2065250-43-1
Formula: COC(C1=CC([N+]([O-])=O)=C(C=C1Br)Br)=O
BD00841110
95%
MFCD30529888
2,4-DIBROMO-5-NITROPYRIDINE
CAS:4487-57-4
Formula: O=[N+](C1=CN=C(Br)C=C1Br)[O-]
BD66577
98%
MFCD09832226
2,4-DIBROMO-6-(1-PHENYLETHYL)ANILINE
CAS:869497-59-6
Formula: NC1=C(C(C2=CC=CC=C2)C)C=C(Br)C=C1Br
BD281772
95+%
2,4-DIBROMO-6-(BROMOMETHYL)PHENOL
CAS:4186-54-3
Formula: OC1=C(Br)C=C(Br)C=C1CBr
BD4295
98%
MFCD00059612
2,4-DIBROMO-6-(DIFLUOROMETHYL)PYRIDINE
CAS:1806773-10-3
Formula: FC(C1=CC(Br)=CC(Br)=N1)F
BD473001
97%
MFCD25476736
2,4-DIBROMO-6-(TERT-BUTYL)PHENOL
CAS:15460-12-5
Formula: OC1=C(C(C)(C)C)C=C(Br)C=C1Br
BD330187
95+%
MFCD00463268
2,4-DIBROMO-6-(TRIFLUOROMETHOXY)ANILINE
CAS:886499-87-2
Formula: NC1=C(OC(F)(F)F)C=C(Br)C=C1Br
BD320234
95+%
MFCD07369998
2,4-DIBROMO-6-(TRIFLUOROMETHYL)ANILINE
CAS:71757-14-7
Formula: NC1=C(C(F)(F)F)C=C(Br)C=C1Br
BD4108
96%
MFCD00178769
2,4-DIBROMO-6-(TRIFLUOROMETHYL)PYRIDIN-3-AMINE
CAS:1214365-67-9
Formula: NC1=C(Br)C=C(C(F)(F)F)N=C1Br
BD168855
98%
MFCD15478037
2,4-DIBROMO-6-(TRIFLUOROMETHYL)PYRIDINE
CAS:1211539-45-5
Formula: FC(C1=CC(Br)=CC(Br)=N1)(F)F
BD264754
95+%
MFCD16610769
2,4-DIBROMO-6-CHLORO-3-METHYLANILINE
CAS:1195139-59-3
Formula: NC1=C(Cl)C=C(Br)C(C)=C1Br
BD321181
98%
MFCD20233408
2,4-DIBROMO-6-CHLORO-5-METHYLPYRIDIN-3-AMINE
CAS:1864051-77-3
Formula: NC1=C(Br)C(C)=C(Cl)N=C1Br
BD466931
95%
MFCD29035416
2,4-DIBROMO-6-CHLOROANILINE
CAS:874-18-0
Formula: NC1=C(Cl)C=C(Br)C=C1Br
BD3204
98%
MFCD00031419
2,4-DIBROMO-6-CHLOROPHENOL
CAS:4526-56-1
Formula: OC1=C(Cl)C=C(Br)C=C1Br
BD556250
97%
MFCD00029692
2,4-DIBROMO-6-CHLOROPYRIDIN-3-AMINE
CAS:1299607-83-2
Formula: NC1=C(Br)C=C(Cl)N=C1Br
BD259059
95+%
MFCD18803481
2,4-DIBROMO-6-CHLOROPYRIDIN-3-OL
CAS:1232433-08-7
Formula: OC1=C(Br)C=C(Cl)N=C1Br
BD586342
95%
2,4-DIBROMO-6-CHLOROPYRIDINE
CAS:1206249-48-0
Formula: BrC1=CC(Br)=CC(Cl)=N1
BD457996
97%
MFCD14582028
2,4-DIBROMO-6-ETHOXY-3-METHYLANILINE
CAS:1706453-46-4
Formula: NC1=C(OCC)C=C(Br)C(C)=C1Br
BD619804
97%
2,4-DIBROMO-6-ETHYLANILINE
CAS:81100-30-3
Formula: NC1=C(CC)C=C(Br)C=C1Br
BD320817
95+%
MFCD11846035
2,4-DIBROMO-6-FLUOROANILINE
CAS:141474-37-5
Formula: NC1=C(Br)C=C(Br)C=C1F
BD3205
98%
MFCD00042230
2,4-DIBROMO-6-FLUOROBENZALDEHYDE
CAS:205683-34-7
Formula: FC1=CC(Br)=CC(Br)=C1C=O
BD234607
98%
MFCD03094089
2,4-DIBROMO-6-FLUOROBENZOIC ACID
CAS:183065-69-2
Formula: OC(=O)C1=C(Br)C=C(Br)C=C1F
BD217777
95+%
MFCD03094087
2,4-DIBROMO-6-FLUOROBENZONITRILE
CAS:1393585-66-4
Formula: N#CC1=C(F)C=C(Br)C=C1Br
BD450108
97%
MFCD22377850
2,4-DIBROMO-6-FLUOROBENZOYL CHLORIDE
CAS:497181-20-1
Formula: O=C(Cl)C1=C(F)C=C(Br)C=C1Br
BD00841814
97%
MFCD03094088
2,4-DIBROMO-6-FLUOROPHENOL
CAS:576-86-3
Formula: OC1=C(Br)C=C(Br)C=C1F
BD66581
98%
MFCD00042233
2,4-DIBROMO-6-FLUOROPYRIDIN-3-OL
CAS:1421602-80-3
Formula: OC1=C(Br)C=C(F)N=C1Br
BD289444
95+%
MFCD28125603
2,4-DIBROMO-6-FLUOROPYRIDINE
CAS:1622844-17-0
Formula: FC1=CC(Br)=CC(Br)=N1
BD455543
97%
MFCD28055251
2,4-DIBROMO-6-IODOPYRIDINE
CAS:1806295-81-7
Formula: IC1=CC(Br)=CC(Br)=N1
BD481447
97%
MFCD28785019
2,4-DIBROMO-6-ISOPROPYLANILINE
CAS:81090-45-1
Formula: NC1=C(C(C)C)C=C(Br)C=C1Br
BD324206
95+%
MFCD11845854
2,4-DIBROMO-6-METHOXY-3-METHYLANILINE
CAS:1706433-51-3
Formula: NC1=C(OC)C=C(Br)C(C)=C1Br
BD619096
97%
2,4-DIBROMO-6-METHOXYANILINE
CAS:88149-47-7
Formula: NC1=C(OC)C=C(Br)C=C1Br
BD242824
95+%
MFCD11977394
2,4-DIBROMO-6-METHOXYBENZALDEHYDE
CAS:856766-93-3
Formula: O=CC1=C(C=C(C=C1Br)Br)OC
BD00850837
95%
MFCD30829262
2,4-DIBROMO-6-METHOXYPYRIDINE
CAS:117873-73-1
Formula: COC1=CC(Br)=CC(Br)=N1
BD477106
97%
MFCD28657787
2,4-DIBROMO-6-METHYL-3-NITROANILINE
CAS:117824-53-0
Formula: NC1=C(C)C=C(Br)C([N+]([O-])=O)=C1Br
BD320816
95+%
MFCD11846026
2,4-DIBROMO-6-METHYL-3-NITROPYRIDINE
CAS:706789-62-0
Formula: O=[N+](C1=C(Br)C=C(C)N=C1Br)[O-]
BD248713
95+%
MFCD20040426
2,4-DIBROMO-6-METHYLPHENOL
CAS:609-22-3
Formula: OC1=C(C)C=C(Br)C=C1Br
BD92750
98%
MFCD00152390
2,4-DIBROMO-6-METHYLPYRIDIN-3-AMINE
CAS:706789-26-6
Formula: NC1=C(Br)C=C(C)N=C1Br
BD230626
95+%
MFCD07774092
2,4-DIBROMO-6-METHYLPYRIDIN-3-OL
CAS:23003-29-4
Formula: CC1=CC(Br)=C(O)C(Br)=N1
BD66570
95+%
MFCD09753265
2,4-DIBROMO-6-METHYLPYRIDINE
CAS:79055-52-0
Formula: CC1=CC(Br)=CC(Br)=N1
BD220037
95%
MFCD09909845
2,4-DIBROMO-6-METHYLQUINOLINE
CAS:139719-21-4
Formula: CC1=CC=C2N=C(Br)C=C(Br)C2=C1
BD587041
97%
2,4-DIBROMO-6-NITROANILINE
CAS:827-23-6
Formula: NC1=C([N+]([O-])=O)C=C(Br)C=C1Br
BD66585
95+%
MFCD00012107
2,4-DIBROMO-6-NITROPHENOL
CAS:15969-09-2
Formula: OC1=C([N+]([O-])=O)C=C(Br)C=C1Br
BD66586
95+%
MFCD00024232
2,4-DIBROMO-6H,7H,8H,9H,10H,11H-CYCLOOCTA[B]QUINOLINE
CAS:861206-09-9
Formula: BrC1=C2N=C3C(CCCCCC3)=CC2=CC(Br)=C1
BD00862669
90%
MFCD03617934
2,4-DIBROMO-6H,7H,8H,9H,10H-CYCLOHEPTA[B]QUINOLINE
CAS:861206-08-8
Formula: BrC1=C2N=C3C(CCCCC3)=CC2=CC(Br)=C1
BD00875681
90%
MFCD03617933
2,4-DIBROMO-7-METHYLQUINOLINE
CAS:2089316-09-4
Formula: CC1C=C2C(C(=CC(=N2)Br)Br)=CC=1
BD00726394
95+%
n/a
2,4-DIBROMO-8-METHYLQUINOLINE
CAS:260972-99-4
Formula: CC1=C2N=C(Br)C=C(Br)C2=CC=C1
BD587518
97%
2,4-DIBROMO-9-METHOXY-10,11-DIHYDRO-5-AZATETRAPHENE
CAS:865658-91-9
Formula: COC1=CC2=CC3=CN=C4C(C=C(Br)C=C4Br)=C3C=C2CC1
BD00852687
90%
MFCD03848485
2,4-DIBROMOBENZALDEHYDE
CAS:5629-98-1
Formula: O=CC1=CC=C(Br)C=C1Br
BD231690
98%
MFCD13185489
2,4-DIBROMOBENZENE-1,3,5-TRIOL
CAS:84743-75-9
Formula: OC1=CC(O)=C(Br)C(O)=C1Br
BD286225
97%
MFCD22056139
2,4-DIBROMOBENZENE-1-SULFONYL CHLORIDE
CAS:72256-95-2
Formula: O=S(C1=CC=C(Br)C=C1Br)(Cl)=O
BD3097
98%
MFCD03093759
2,4-DIBROMOBENZENETHIOL
CAS:70009-86-8
Formula: SC1=CC=C(Br)C=C1Br
BD01056260
95%
MFCD00068900
2,4-DIBROMOBENZO[D]THIAZOLE
CAS:887589-19-7
Formula: BrC1=C2N=C(Br)SC2=CC=C1
BD249040
95+%
MFCD07783779
2,4-DIBROMOBENZOIC ACID
CAS:611-00-7
Formula: C1=CC(=CC(=C1C(O)=O)Br)Br
BD66591
97%
MFCD00234253
2,4-DIBROMOBENZONITRILE
CAS:78222-69-2
Formula: N#CC1=CC=C(Br)C=C1Br
BD463509
98%
MFCD13185491
2,4-DIBROMOBENZOYL CHLORIDE
CAS:59615-16-6
Formula: O=C(Cl)C1=CC=C(Br)C=C1Br
BD308430
95+%
MFCD18379779
2,4-DIBROMOBUTANOIC ACID
CAS:63164-16-9
Formula: O=C(O)C(Br)CCBr
BD66595
95%
MFCD01632493
2,4-DIBROMOBUTYRYLCHLORIDE
CAS:82820-87-9
Formula: O=C(Cl)C(Br)CCBr
BD163831
90%
MFCD01862994
2,4-DIBROMODIBENZO[B,D]FURAN-3-AMINE
CAS:133953-35-2
Formula: NC1=C(Br)C=C2C(OC3=CC=CC=C23)=C1Br
BD262685
95+%
MFCD13187662
2,4-DIBROMOFURAN
CAS:32460-06-3
Formula: BrC1=COC(Br)=C1
BD251957
95+%
MFCD10570029
2,4-DIBROMOMESITYLENE
CAS:6942-99-0
Formula: CC1=C(Br)C(C)=C(Br)C(C)=C1
BD66599
98%
MFCD00013525
2,4-DIBROMONAPHTHALEN-1-AMINE
CAS:20191-76-8
Formula: NC1=C2C=CC=CC2=C(Br)C=C1Br
BD315440
97%
MFCD00155345
2,4-DIBROMONAPHTHALEN-1-OL
CAS:2050-49-9
Formula: OC1=C2C=CC=CC2=C(Br)C=C1Br
BD66561
97%
MFCD00059130
2,4-DIBROMONICOTINALDEHYDE
CAS:128071-91-0
Formula: O=CC1=C(Br)N=CC=C1Br
BD289442
97%
MFCD10574708
2,4-DIBROMONICOTINIC ACID
CAS:1269291-41-9
Formula: O=C(O)C1=C(Br)N=CC=C1Br
BD473178
97%
MFCD18262257
2,4-DIBROMONICOTINONITRILE
CAS:1152617-14-5
Formula: N#CC1=C(Br)N=CC=C1Br
BD279636
98%
MFCD22041881
2,4-DIBROMOPENTANE
CAS:19398-53-9
Formula: CC(Br)CC(Br)C
BD66601
MFCD00039176
2,4-DIBROMOPHENOL
CAS:615-58-7
Formula: OC1=C(Br)C=C(Br)C=C1
BD66602
98%
MFCD00002149
2,4-DIBROMOPHENYL GLYCIDYL ETHER
CAS:20217-01-0
Formula: BrC1=CC=C(OCC2CO2)C(Br)=C1
BD00822400
90% GC
MFCD13194826
2,4-DIBROMOPYRIDIN-3-AMINE
CAS:102249-45-6
Formula: NC1=C(Br)C=CN=C1Br
BD66568
97+%
MFCD00234046
2,4-DIBROMOPYRIDIN-3-OL
CAS:129611-31-0
Formula: OC1=C(Br)C=CN=C1Br
BD295987
95+%
MFCD11044315
2,4-DIBROMOPYRIDINE
CAS:58530-53-3
Formula: C1=C(N=CC=C1Br)Br
BD21610
98%
MFCD01859720
2,4-DIBROMOPYRIMIDINE
CAS:3921-01-5
Formula: BrC1=NC=CC(=N1)Br
BD106771
95%
MFCD06798232
2,4-DIBROMOQUINAZOLINE
CAS:872998-61-3
Formula: BrC2=NC1=CC=CC=C1C(=N2)Br
BD158266
95+%
MFCD09909697
2,4-DIBROMOQUINOLINE
CAS:20151-40-0
Formula: BrC1=NC2=C(C=CC=C2)C(Br)=C1
BD66607
96%
MFCD00837761
2,4-DIBROMOTHIAZOLE
CAS:4175-77-3
Formula: C1=C(N=C(Br)S1)Br
BD17158
98%
MFCD01318994
2,4-DIBROMOTHIAZOLE-5-CARBALDEHYDE
CAS:139669-95-7
Formula: BrC1=NC(=C(S1)C=O)Br
BD158267
97%
MFCD04117944
2,4-DIBROMOTHIAZOLE-5-CARBOXYLIC ACID
CAS:139669-96-8
Formula: BrC1=NC(=C(S1)C(=O)O)Br
BD107431
95+%
MFCD09909678
2,4-DIBROMOTHIAZOLE-5-METHANOL
CAS:170232-68-5
Formula: BrC1=NC(=C(S1)CO)Br
BD157601
95+%
MFCD09953521
2,4-DIBROMOTHIAZOLO[5,4-C]PYRIDINE
CAS:1439823-46-7
Formula: BrC1=NC=CC2=C1SC(Br)=N2
BD289900
95+%
MFCD22690828
2,4-DIBROMOTHIOPHENE
CAS:3140-92-9
Formula: BrC1=CC(Br)=CS1
BD2173
98%
MFCD00043889
2,4-DIBROMOTHIOPHENE-3-CARBALDEHYDE
CAS:1257070-67-9
Formula: O=CC1=C(Br)SC=C1Br
BD281557
95+%
2,4-DIBROMOTHIOPHENE-3-CARBONITRILE
CAS:1256651-68-9
Formula: N#CC1=C(Br)SC=C1Br
BD264593
95+%
2,4-DIBUTOXY-1-CHLOROBENZENE
CAS:194083-31-3
Formula: CCCCOC1=CC(OCCCC)=C(C=C1)Cl
BD00859347
95%
2,4-DIBUTOXY-1-NITROBENZENE
CAS:1167434-38-9
Formula: CCCCOC1=CC(OCCCC)=C([N+]([O-])=O)C=C1
BD00857047
95%
2,4-DIBUTOXYPHENOL
CAS:1881291-73-1
Formula: CCCCOC1=CC(OCCCC)=C(C=C1)O
BD00854907
95%
2,4-DICHLORO-1,3,5-TRIAZINE
CAS:2831-66-5
Formula: ClC1=NC=NC(Cl)=N1
BD33034
97%
MFCD04115347
2,4-DICHLORO-1,3,5-TRIFLUOROBENZENE
CAS:2368-53-8
Formula: FC1=C(Cl)C(F)=C(Cl)C(F)=C1
BD53989
97%
MFCD00012242
2,4-DICHLORO-1,5-DIIODO-3-METHOXYBENZENE
CAS:1221589-80-5
Formula: COC1=C(Cl)C(I)=CC(I)=C1Cl
BD00940508
95%
n/a
2,4-DICHLORO-1,5-NAPHTHYRIDINE
CAS:28252-82-6
Formula: ClC1=CC(Cl)=NC2=CC=CN=C12
BD224223
95+%
MFCD12828139
2,4-DICHLORO-1,6-NAPHTHYRIDINE
CAS:1422496-28-3
Formula: ClC1=CC(Cl)=NC2=CC=NC=C12
BD329786
95+%
MFCD26406905
2,4-DICHLORO-1,7-NAPHTHYRIDINE
CAS:54920-78-4
Formula: ClC1=CC(Cl)=NC2=CN=CC=C12
BD297512
95+%
MFCD23703292
2,4-DICHLORO-1,8-NAPHTHYRIDINE
CAS:59514-89-5
Formula: ClC1=CC(Cl)=C2C=CC=NC2=N1
BD66615
97%
MFCD00234380
2,4-DICHLORO-1-(((4-METHOXYBENZYL)OXY)METHYL)BENZENE
CAS:1956322-92-1
Formula: COC1=CC=C(C=C1)COCC2=CC=C(Cl)C=C2Cl
BD337538
95+%
MFCD29917082
2,4-DICHLORO-1-(2,2,2-TRIFLUOROETHYL)BENZENE
CAS:1092350-09-8
Formula: FC(F)(F)CC1=CC=C(Cl)C=C1Cl
BD320682
95+%
MFCD11100167
2,4-DICHLORO-1-(2,2-DIBROMOVINYL)BENZENE
CAS:212138-65-3
Formula: BrC(Br)=CC1=CC=C(Cl)C=C1Cl
BD338155
95% mix TBC as stabilizer
MFCD24842545
2,4-DICHLORO-1-(2-NITROPHENOXY)BENZENE
CAS:38461-29-9
Formula: ClC1=CC=C(OC2=CC=CC=C2[N+]([O-])=O)C(Cl)=C1
BD158369
95+%
MFCD00506394
2,4-DICHLORO-1-(2-NITROVINYL)BENZENE
CAS:18984-21-9
Formula: O=[N+](/C=C/C1=CC=C(Cl)C=C1Cl)[O-]
BD5706
95+%
MFCD00053063
2,4-DICHLORO-1-(3-FLUOROPHENYL)-5-(2,4,6-TRIFLUOROPHENYL)-1H-IMIDAZOLE
CAS:1146763-48-5
Formula: FC1=C(C2=C(Cl)N=C(Cl)N2C3=CC=CC(F)=C3)C(F)=CC(F)=C1
BD269514
95+%
2,4-DICHLORO-1-(4-CHLORO-2-METHOXYPHENOXY)BENZENE
CAS:4640-01-1
Formula: COC1=CC(Cl)=CC=C1OC2=CC=C(Cl)C=C2Cl
BD631863
97%
MFCD04039700
2,4-DICHLORO-1-(4-CHLORO-3-FLUOROPHENYL)-5-(2,6-DIFLUOROPHENYL)-1H-IMIDAZOLE
CAS:1146718-91-3
Formula: FC1=C(C2=C(Cl)N=C(Cl)N2C3=CC=C(Cl)C(F)=C3)C(F)=CC=C1
BD269515
95+%
2,4-DICHLORO-1-(4-CHLOROPHENYL)-5-(2,4,6-TRIFLUOROPHENYL)-1H-IMIDAZOLE
CAS:1146763-78-1
Formula: FC1=C(C2=C(Cl)N=C(Cl)N2C3=CC=C(Cl)C=C3)C(F)=CC(F)=C1
BD269516
95+%
2,4-DICHLORO-1-(4-CHLOROPHENYL)-5-(2,6-DIFLUOROPHENYL)-1H-IMIDAZOLE
CAS:1146717-90-9
Formula: FC1=C(C2=C(Cl)N=C(Cl)N2C3=CC=C(Cl)C=C3)C(F)=CC=C1
BD269513
95+%
2,4-DICHLORO-1-(4-IODOPHENOXYMETHYL)BENZENE
CAS:1284804-94-9
Formula: IC1=CC=C(OCC2=CC=C(Cl)C=C2Cl)C=C1
BD325591
98%
MFCD19444469
2,4-DICHLORO-1-(CHLOROMETHYL)BENZENE
CAS:94-99-5
Formula: ClCC1=CC=C(Cl)C=C1Cl
BD35498
98%
MFCD00000895
2,4-DICHLORO-1-(CYCLOPROPYLMETHOXY)BENZENE
CAS:1369900-00-4
Formula: ClC1=CC(Cl)=C(C=C1)OCC2CC2
BD00857399
95%
2,4-DICHLORO-1-(DICHLOROMETHYL)BENZENE
CAS:134-25-8
Formula: ClC1=CC=C(C(Cl)Cl)C(Cl)=C1
BD113270
97+%
MFCD00043967
2,4-DICHLORO-1-(ISOCYANO(TOSYL)METHYL)BENZENE
CAS:952727-77-4
Formula: ClC1=CC=C(C(Cl)=C1)C([N+]#[C-])S(=O)(C2=CC=C(C)C=C2)=O
BD159478
95+%
MFCD04114807
2,4-DICHLORO-1-(PROP-2-YN-1-YLOXY)BENZENE
CAS:17061-90-4
Formula: ClC1=CC(Cl)=C(OCC#C)C=C1
BD66613
95+%
MFCD02311548
2,4-DICHLORO-1-(SULFINYLAMINO)BENZENE
CAS:21250-19-1
Formula: ClC1=CC(Cl)=C(N=S=O)C=C1
BD00873854
95%
MFCD22042622
2,4-DICHLORO-1-(TRICHLOROMETHYL)BENZENE
CAS:13014-18-1
Formula: ClC(C1=CC=C(Cl)C=C1Cl)(Cl)Cl
BD66757
95+%
MFCD00018818
2,4-DICHLORO-1-(TRIFLUOROMETHOXY)BENZENE
CAS:451-85-4
Formula: FC(F)(F)OC1=CC=C(Cl)C=C1Cl
BD54003
97%
MFCD00041538
2,4-DICHLORO-1-(TRIFLUOROMETHYL)BENZENE
CAS:320-60-5
Formula: FC(C1=CC=C(Cl)C=C1Cl)(F)F
BD66758
98%
MFCD00000582
2,4-DICHLORO-1-FLUORO-3,5-DIMETHYLBENZENE
CAS:214774-61-5
Formula: CC1=C(Cl)C(C)=C(Cl)C(F)=C1
BD11021
95+%
MFCD04972785
2,4-DICHLORO-1-FLUORO-3-NITRO-5-(TRIFLUOROMETHYL)BENZENE
CAS:1221272-80-5
Formula: FC(C1=C(Cl)C([N+]([O-])=O)=C(Cl)C(F)=C1)(F)F
BD208103
95+%
MFCD14525530
2,4-DICHLORO-1-FLUOROBENZENE
CAS:1435-48-9
Formula: FC1=CC=C(Cl)C=C1Cl
BD66774
98%
MFCD00000580
2,4-DICHLORO-1-IODOBENZENE
CAS:29898-32-6
Formula: IC1=CC=C(Cl)C=C1Cl
BD33112
98%
MFCD00001035
2,4-DICHLORO-1-METHOXYBENZENE
CAS:553-82-2
Formula: COC1=CC=C(Cl)C=C1Cl
BD41796
98%
MFCD00044772
2,4-DICHLORO-1-METHYL-3-NITRO-5-(TRIFLUOROMETHYL)BENZENE
CAS:115571-69-2
Formula: FC(C1=C(Cl)C([N+]([O-])=O)=C(Cl)C(C)=C1)(F)F
BD10816
95+%
MFCD06658277
2,4-DICHLORO-1H-BENZO[D]IMIDAZOLE
CAS:15965-56-7
Formula: ClC1=C2C(NC(Cl)=N2)=CC=C1
BD217434
95+%
2,4-DICHLORO-1H-PYRROLO[3,2-D]PYRIMIDINE
CAS:1310680-17-1
Formula: ClC1=C2C(NC(Cl)=N1)=CC=N2
BD586671
95%
MFCD22460477
2,4-DICHLORO-2'-MORPHOLINOMETHYL BENZOPHENONE
CAS:898751-01-4
Formula: O=C(C1=CC=CC=C1CN2CCOCC2)C3=CC=C(Cl)C=C3Cl
BD309984
95+%
MFCD03842442
2,4-DICHLORO-2'-PIPERIDINOMETHYL BENZOPHENONE
CAS:898773-67-6
Formula: O=C(C1=CC=CC=C1CN2CCCCC2)C3=CC=C(Cl)C=C3Cl
BD311904
95+%
MFCD03842499
2,4-DICHLORO-2'-PYRROLIDINOMETHYL BENZOPHENONE
CAS:898774-95-3
Formula: O=C(C1=CC=CC=C1CN2CCCC2)C3=CC=C(Cl)C=C3Cl
BD311997
95+%
MFCD03842556
2,4-DICHLORO-2'-THIOMORPHOLINOMETHYL BENZOPHENONE
CAS:898782-29-1
Formula: O=C(C1=CC=CC=C1CN2CCSCC2)C3=CC=C(Cl)C=C3Cl
BD312681
95+%
MFCD03842783
2,4-DICHLORO-3'-(1,3-DIOXOLAN-2-YL)BENZOPHENONE
CAS:898759-52-9
Formula: O=C(C1=CC=CC(C2OCCO2)=C1)C3=CC=C(Cl)C=C3Cl
BD310674
95+%
MFCD07699985
2,4-DICHLORO-3'-MORPHOLINOMETHYL BENZOPHENONE
CAS:898792-19-3
Formula: O=C(C1=CC=CC(CN2CCOCC2)=C1)C3=CC=C(Cl)C=C3Cl
BD313603
95+%
MFCD03841933
2,4-DICHLORO-3'-PIPERIDINOMETHYL BENZOPHENONE
CAS:898793-50-5
Formula: O=C(C1=CC=CC(CN2CCCCC2)=C1)C3=CC=C(Cl)C=C3Cl
BD313734
95+%
MFCD03841990
2,4-DICHLORO-3'-PYRROLIDINOMETHYL BENZOPHENONE
CAS:898770-78-0
Formula: O=C(C1=CC=CC(CN2CCCC2)=C1)C3=CC=C(Cl)C=C3Cl
BD311690
95+%
MFCD03842047
2,4-DICHLORO-3'-THIOMORPHOLINOMETHYL BENZOPHENONE
CAS:898787-81-0
Formula: O=C(C1=CC=CC(CN2CCSCC2)=C1)C3=CC=C(Cl)C=C3Cl
BD313188
95+%
MFCD03842272
2,4-DICHLORO-3,5-DIFLUOROANILINE
CAS:50408-95-2
Formula: NC1=CC(F)=C(Cl)C(F)=C1Cl
BD230518
97%
MFCD12827974
2,4-DICHLORO-3,5-DIFLUORONITROBENZENE
CAS:774-19-6
Formula: FC1=C(Cl)C(F)=C(Cl)C([N+]([O-])=O)=C1
BD327717
98%
MFCD27578156
2,4-DICHLORO-3,5-DIFLUOROPHENOL
CAS:1394969-84-6
Formula: OC1=CC(F)=C(Cl)C(F)=C1Cl
BD326376
98%
MFCD23111013
2,4-DICHLORO-3,5-DIMETHYLANILINE
CAS:175283-44-0
Formula: NC1=CC(C)=C(Cl)C(C)=C1Cl
BD281764
95+%
MFCD20699495
2,4-DICHLORO-3,5-DIMETHYLPHENOL
CAS:133-53-9
Formula: OC1=CC(C)=C(Cl)C(C)=C1Cl
BD66622
98%
MFCD00019981
2,4-DICHLORO-3,6-DIMETHYLANILINE
CAS:854857-11-7
Formula: NC1=C(C)C=C(Cl)C(C)=C1Cl
BD281765
95+%
MFCD20700053
2,4-DICHLORO-3,6-DIMETHYLPYRIDINE
CAS:83791-90-6
Formula: CC1=CC(Cl)=C(C)C(Cl)=N1
BD212340
95+%
MFCD11113423
2,4-DICHLORO-3,6-DIMETHYLQUINOLINE
CAS:1936054-65-7
Formula: CC1=CC=C2N=C(Cl)C(C)=C(Cl)C2=C1
BD00795890
97%
2,4-DICHLORO-3-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PYRIDINE
CAS:1257651-49-2
Formula: CC1(C)C(C)(C)OB(C2=C(Cl)C=CN=C2Cl)O1
BD563666
97%
MFCD15144793
2,4-DICHLORO-3-(DICHLOROMETHYL)-1-FLUORO-5-(TRICHLOROMETHYL)BENZENE
CAS:214774-60-4
Formula: ClC(C1=C(Cl)C(C(Cl)Cl)=C(Cl)C(F)=C1)(Cl)Cl
BD452247
98%
MFCD27922135
2,4-DICHLORO-3-(TRIFLUOROMETHYL)ANILINE
CAS:1804908-04-0
Formula: NC1=CC=C(Cl)C(C(F)(F)F)=C1Cl
BD488174
97%
MFCD28787614
2,4-DICHLORO-3-(TRIFLUOROMETHYL)PYRIDINE
CAS:1186194-98-8
Formula: FC(F)(F)C1=C(Cl)C=CN=C1Cl
BD202108
98%
MFCD12547046
2,4-DICHLORO-3-AMINOPHENOL HYDROCHLORIDE
CAS:61693-43-4
Formula: OC1=CC=C(Cl)C(N)=C1Cl.[H]Cl
BD9906
98%
MFCD04112751
2,4-DICHLORO-3-CYANO-5-FLUOROBENZOIC ACID
CAS:117528-58-2
Formula: O=C(O)C1=CC(F)=C(Cl)C(C#N)=C1Cl
BD233866
98%
MFCD18801150
2,4-DICHLORO-3-CYANOPHENYLBORONIC ACID
CAS:957120-87-5
Formula: OB(C1=CC=C(Cl)C(C#N)=C1Cl)O
BD161612
98%
MFCD09800881
2,4-DICHLORO-3-ETHYL-1,5-DINITROBENZENE
CAS:725702-62-5
Formula: CCC1=C(C([N+]([O-])=O)=CC([N+]([O-])=O)=C1Cl)Cl
BD00839445
95%
MFCD06090872
2,4-DICHLORO-3-ETHYL-6-NITROPHENOL
CAS:99817-36-4
Formula: OC1=C([N+]([O-])=O)C=C(Cl)C(CC)=C1Cl
BD11026
98%
MFCD00270764
2,4-DICHLORO-3-ETHYNYL-1,5-DIMETHOXYBENZENE
CAS:1453211-48-7
Formula: COC1=C(Cl)C(C#C)=C(Cl)C(OC)=C1
BD00942641
95%
MFCD28129863
2,4-DICHLORO-3-FLUOROANILINE
CAS:443-93-6
Formula: NC1=CC=C(Cl)C(F)=C1Cl
BD231691
95+%
MFCD09864666
2,4-DICHLORO-3-FLUOROBENZALDEHYDE
CAS:1785621-05-7
Formula: O=CC1=CC=C(Cl)C(F)=C1Cl
BD449792
97%
MFCD26407306
2,4-DICHLORO-3-FLUOROBENZOIC ACID
CAS:915145-05-0
Formula: O=C(O)C1=CC=C(Cl)C(F)=C1Cl
BD207873
95+%
MFCD14707646
2,4-DICHLORO-3-FLUOROBENZONITRILE
CAS:161612-68-6
Formula: ClC1=C(C#N)C=CC(=C1F)Cl
BD10118
95+%
MFCD06658268
2,4-DICHLORO-3-FLUOROBROMOBENZENE
CAS:1000573-15-8
Formula: FC1=C(Cl)C(Br)=CC=C1Cl
BD306932
95+%
MFCD09878169
2,4-DICHLORO-3-FLUORONITROBENZENE
CAS:393-79-3
Formula: FC1=C(Cl)C([N+]([O-])=O)=CC=C1Cl
BD9724
98%
MFCD00042240
2,4-DICHLORO-3-FLUOROPYRIDINE
CAS:628691-85-0
Formula: FC1=C(Cl)C=CN=C1Cl
BD218625
97%
MFCD12196994
2,4-DICHLORO-3-HYDROXYBENZALDEHYDE
CAS:56962-13-1
Formula: O=CC1=CC=C(Cl)C(O)=C1Cl
BD224853
95+%
MFCD22199563
2,4-DICHLORO-3-HYDROXYBENZOIC ACID
CAS:91658-93-4
Formula: O=C(O)C1=CC=C(Cl)C(O)=C1Cl
BD457307
97%
MFCD23111011
2,4-DICHLORO-3-IODO-6-(TRIFLUOROMETHYL)PYRIDINE
CAS:1214330-65-0
Formula: FC(C1=CC(Cl)=C(I)C(Cl)=N1)(F)F
BD168966
97%
2,4-DICHLORO-3-IODOPYRIDINE
CAS:343781-36-2
Formula: IC1=C(Cl)C=CN=C1Cl
BD216920
98%
MFCD09033756
2,4-DICHLORO-3-METHOXYBENZOIC ACID
CAS:115382-33-7
Formula: O=C(O)C1=CC=C(Cl)C(OC)=C1Cl
BD332969
95%
MFCD26960583
2,4-DICHLORO-3-METHOXYPYRIDINE
CAS:405143-46-6
Formula: COC1=C(Cl)C=CN=C1Cl
BD565821
97%
MFCD16610791
2,4-DICHLORO-3-METHYL-6-NITROPHENOL
CAS:39549-27-4
Formula: OC1=C([N+]([O-])=O)C=C(Cl)C(C)=C1Cl
BD66722
95+%
MFCD00128090
2,4-DICHLORO-3-METHYLANILINE
CAS:19853-79-3
Formula: CC1=C(Cl)C=CC(N)=C1Cl
BD161257
98%
MFCD02334760
2,4-DICHLORO-3-METHYLBENZENE-1-SULFONYL CHLORIDE
CAS:69145-58-0
Formula: O=S(C1=CC=C(Cl)C(C)=C1Cl)(Cl)=O
BD279096
95+%
MFCD03208897
2,4-DICHLORO-3-METHYLBENZOIC ACID
CAS:83277-23-0
Formula: O=C(O)C1=CC=C(Cl)C(C)=C1Cl
BD161211
98%
MFCD16659660
2,4-DICHLORO-3-METHYLPYRIDINE
CAS:132097-09-7
Formula: ClC1=NC=CC(=C1C)Cl
BD18021
97%
MFCD09263623
2,4-DICHLORO-3-METHYLQUINOLINE
CAS:56857-97-7
Formula: CC1=C(Cl)C2=CC=CC=C2N=C1Cl
BD66635
95+%
2,4-DICHLORO-3-NITROBENZOIC ACID
CAS:39053-42-4
Formula: O=C(O)C1=CC=C(Cl)C([N+]([O-])=O)=C1Cl
BD250161
95+%
MFCD28787131
2,4-DICHLORO-3-NITROPHENOL
CAS:38902-87-3
Formula: OC1=CC=C(Cl)C([N+]([O-])=O)=C1Cl
BD20594
97%
MFCD08059572
2,4-DICHLORO-3-NITROPYRIDINE
CAS:5975-12-2
Formula: ClC1=NC=CC(=C1[N+](=O)[O-])Cl
BD66639
98%
MFCD09261088
2,4-DICHLORO-3-NITROQUINOLINE
CAS:132521-66-5
Formula: O=[N+](C1=C(Cl)C2=CC=CC=C2N=C1Cl)[O-]
BD66641
95+%
MFCD05666285
2,4-DICHLORO-4'-(1,3-DIOXOLAN-2-YL)BENZOPHENONE
CAS:898760-68-4
Formula: O=C(C1=CC=C(C2OCCO2)C=C1)C3=CC=C(Cl)C=C3Cl
BD310769
95+%
MFCD07700036
2,4-DICHLORO-4'-MORPHOLINOMETHYL BENZOPHENONE
CAS:898770-57-5
Formula: O=C(C1=CC=C(CN2CCOCC2)C=C1)C3=CC=C(Cl)C=C3Cl
BD311669
95+%
MFCD03841421
2,4-DICHLORO-4'-PIPERIDINOMETHYL BENZOPHENONE
CAS:898775-55-8
Formula: O=C(C1=CC=C(CN2CCCCC2)C=C1)C3=CC=C(Cl)C=C3Cl
BD312053
95+%
MFCD03841478
2,4-DICHLORO-4'-PYRROLIDINOMETHYL BENZOPHENONE
CAS:898776-81-3
Formula: O=C(C1=CC=C(CN2CCCC2)C=C1)C3=CC=C(Cl)C=C3Cl
BD312173
95+%
MFCD03841535
2,4-DICHLORO-4'-THIOMORPHOLINOMETHYL BENZOPHENONE
CAS:898783-12-5
Formula: O=C(C1=CC=C(CN2CCSCC2)C=C1)C3=CC=C(Cl)C=C3Cl
BD312757
95+%
MFCD03841762
2,4-DICHLORO-5,6,7,8-TETRAHYDROPTERIDINE
CAS:98142-36-0
Formula: ClC1=C2NCCNC2=NC(Cl)=N1
BD158268
95+%
MFCD11518934
2,4-DICHLORO-5,6,7,8-TETRAHYDROPYRIDO[3,4-D]PYRIMIDINE
CAS:1000578-08-4
Formula: ClC1=C2C(CNCC2)=NC(Cl)=N1
BD211539
95+%
MFCD09835496
2,4-DICHLORO-5,6,7,8-TETRAHYDROPYRIDO[3,4-D]PYRIMIDINE HYDROCHLORIDE
CAS:1187830-76-7
Formula: ClC1=C2C(CNCC2)=NC(Cl)=N1.[H]Cl
BD158269
95%
MFCD11518996
2,4-DICHLORO-5,6,7,8-TETRAHYDROPYRIDO[4,3-D]PYRIMIDINE
CAS:726697-13-8
Formula: ClC1=C(CNCC2)C2=NC(Cl)=N1
BD222180
95+%
MFCD10697104
2,4-DICHLORO-5,6,7,8-TETRAHYDROPYRIDO[4,3-D]PYRIMIDINE 2,2,2-TRIFLUOROACETATE
CAS:1172930-59-4
Formula: ClC1=C(CNCC2)C2=NC(Cl)=N1.O=C(O)C(F)(F)F
BD162812
95+%
MFCD11044887
2,4-DICHLORO-5,6,7,8-TETRAHYDROPYRIDO[4,3-D]PYRIMIDINE HYDROCHLORIDE
CAS:1208901-69-2
Formula: ClC1=C(CNCC2)C2=NC(Cl)=N1.[H]Cl
BD159735
95+%
MFCD12400762
2,4-DICHLORO-5,6,7,8-TETRAHYDROPYRIDO[4,3-D]PYRIMIDINE HYDROCHLORIDE(1:X)
CAS:635698-30-5
Formula: ClC1=C(CNCC2)C2=NC(Cl)=N1.[H]Cl
BD222179
95+%
n/a
2,4-DICHLORO-5,6,7,8-TETRAHYDROQUINAZOLINE
CAS:1127-85-1
Formula: ClC1=C2CCCCC2=NC(Cl)=N1
BD162796
97%
MFCD12400774
2,4-DICHLORO-5,6,7,8-TETRAHYDROQUINAZOLINE-6-CARBOXYLIC ACID
CAS:5458-56-0
Formula: O=C(C1CC2=C(Cl)N=C(Cl)N=C2CC1)O
BD222063
95+%
MFCD12198785
2,4-DICHLORO-5,6,7,8-TETRAHYDROQUINOLINE
CAS:858279-01-3
Formula: ClC1=NC2=C(CCCC2)C(Cl)=C1
BD228160
95%
MFCD23135262
2,4-DICHLORO-5,6,7-TRIMETHOXYQUINAZOLINE
CAS:61948-64-9
Formula: COC1=CC2=NC(Cl)=NC(Cl)=C2C(OC)=C1OC
BD334795
95+%
MFCD26406906
2,4-DICHLORO-5,6-DIHYDROBENZO[H]QUINAZOLINE
CAS:1186410-71-8
Formula: ClC1=C2CCC3=CC=CC=C3C2=NC(Cl)=N1
BD586096
97%
2,4-DICHLORO-5,6-DIHYDROTHIENO[2,3-D]PYRIMIDINE
CAS:74901-61-4
Formula: ClC1=C(CCS2)C2=NC(Cl)=N1
BD300492
95+%
2,4-DICHLORO-5,6-DIMETHYLPYRIMIDINE
CAS:1780-32-1
Formula: CC1=C(C)C(Cl)=NC(Cl)=N1
BD66652
97%
MFCD09910263
2,4-DICHLORO-5,6-DIMETHYLPYRROLO[2,1-F][1,2,4]TRIAZINE
CAS:N/A
Formula: CC1=CN2N=C(Cl)N=C(Cl)C2=C1C
BD00804225
97%
2,4-DICHLORO-5,6-DIMETHYLTHIENO[2,3-D]PYRIMIDINE
CAS:42518-42-3
Formula: CC1=C(C)C2=C(Cl)N=C(Cl)N=C2S1
BD268860
95+%
MFCD00807312
2,4-DICHLORO-5,7-DIFLUOROQUINAZOLINE
CAS:2383370-49-6
Formula: FC1C=C(F)C2C(=NC(=NC=2Cl)Cl)C=1
BD00753593
95%
MFCD30722697
2,4-DICHLORO-5,7-DIHYDROFURO[3,4-B]PYRIDINE
CAS:1086321-79-0
Formula: ClC1=C2C(COC2)=NC(Cl)=C1
BD00792753
97%
2,4-DICHLORO-5,7-DIHYDROFURO[3,4-D]PYRIMIDINE
CAS:848398-41-4
Formula: ClC1=C2C(COC2)=NC(Cl)=N1
BD163353
97%
MFCD13250060
2,4-DICHLORO-5,7-DIHYDROTHIENO[3,4-D]PYRIMIDINE
CAS:74901-71-6
Formula: ClC1=C2C(CSC2)=NC(Cl)=N1
BD295866
95+%
MFCD13250061
2,4-DICHLORO-5,7-DIHYDROTHIENO[3,4-D]PYRIMIDINE 6,6-DIOXIDE
CAS:1429639-72-4
Formula: ClC1=C2C(CS(C2)(=O)=O)=NC(Cl)=N1
BD00824640
97%
2,4-DICHLORO-5,7-DIMETHOXYQUINAZOLINE
CAS:N/A
Formula: COC1C=C(OC)C2C(=NC(=NC=2Cl)Cl)C=1
BD00759612
95%
n/a
2,4-DICHLORO-5,7-DIMETHOXYQUINOLINE
CAS:161648-76-6
Formula: COC1=CC(OC)=C2C(Cl)=CC(Cl)=NC2=C1
BD330269
95+%
MFCD26406907
2,4-DICHLORO-5,7-DIMETHYL-7H-PYRROLO[2,3-D]PYRIMIDINE
CAS:1638764-36-9
Formula: CN1C=C(C)C2=C(Cl)N=C(Cl)N=C21
BD753996
97%
2,4-DICHLORO-5-((2,6-DIMETHYLMORPHOLINO)SULFONYL)BENZOIC ACID
CAS:727674-93-3
Formula: O=C(O)C1=CC(S(=O)(N2CC(C)OC(C)C2)=O)=C(Cl)C=C1Cl
BD509792
97%
MFCD05860759
2,4-DICHLORO-5-((3-FLUOROBENZYL)OXY)ANILINE
CAS:439095-33-7
Formula: NC1=CC(OCC2=CC=CC(F)=C2)=C(Cl)C=C1Cl
BD200135
95+%
MFCD03425777
2,4-DICHLORO-5-((ETHYLTHIO)METHYL)PYRIMIDINE
CAS:108141-35-1
Formula: CCSCC1=CN=C(Cl)N=C1Cl
BD30106
96%
MFCD01631198
2,4-DICHLORO-5-(1H-PYRAZOL-1-YL)PYRIMIDINE
CAS:1260860-26-1
Formula: ClC1=NC(Cl)=NC=C1N2N=CC=C2
BD36809
95+%
MFCD11109898
2,4-DICHLORO-5-(2-(METHANESULFONYLAMINO)ETHOXY)PHENYLBORONIC ACID, PINACOL ESTER
CAS:2096338-42-8
Formula: O=S(NCCOC1=C(Cl)C=C(Cl)C(B2OC(C)(C)C(C)(C)O2)=C1)(C)=O
BD00811446
96%
MFCD18311892
2,4-DICHLORO-5-(2-FURYL)THIENO[2,3-D]PYRIMIDINE
CAS:1428141-39-2
Formula: ClC1=NC2=C(C(Cl)=N1)C(C3=CC=CO3)=CS2
BD00860353
95%
MFCD27936996
2,4-DICHLORO-5-(2-METHOXYETHOXY)ANILINE
CAS:339278-77-2
Formula: NC1=CC(OCCOC)=C(Cl)C=C1Cl
BD200093
95+%
MFCD00974413
2,4-DICHLORO-5-(2-THIENYL)THIENO[2,3-D]PYRIMIDINE
CAS:1428139-55-2
Formula: ClC1=NC2=C(C(Cl)=N1)C(C3=CC=CS3)=CS2
BD00857708
95%
MFCD27937021
2,4-DICHLORO-5-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PHENOL
CAS:1256360-32-3
Formula: OC1=CC(B2OC(C)(C)C(C)(C)O2)=C(Cl)C=C1Cl
BD273690
98%
2,4-DICHLORO-5-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PYRIMIDINE
CAS:1073354-24-1
Formula: CC1(C)C(C)(C)OB(C2=CN=C(Cl)N=C2Cl)O1
BD167423
95+%
MFCD06798268
2,4-DICHLORO-5-(4-METHOXYPHENYL)PYRIMIDINE
CAS:1523618-07-6
Formula: COC1=CC=C(C2=CN=C(Cl)N=C2Cl)C=C1
BD248109
95+%
2,4-DICHLORO-5-(CHLOROMETHYL)-3-METHYLPYRIDINE
CAS:1935891-21-6
Formula: CC1=C(Cl)C(CCl)=CN=C1Cl
BD753501
97%
2,4-DICHLORO-5-(CHLOROMETHYL)PYRIDINE
CAS:73998-96-6
Formula: ClCC1=CN=C(Cl)C=C1Cl
BD66649
95+%
MFCD04114263
2,4-DICHLORO-5-(CHLOROMETHYL)PYRIDINE HYDROCHLORIDE
CAS:N/A
Formula: ClCC1=CN=C(Cl)C=C1Cl.[H]Cl
BD751255
97%
2,4-DICHLORO-5-(CHLOROMETHYL)PYRIMIDINE
CAS:7627-38-5
Formula: ClCC1=CN=C(Cl)N=C1Cl
BD182607
95+%
MFCD10697639
2,4-DICHLORO-5-(CHLOROSULFONYL)BENZOIC ACID
CAS:3740-18-9
Formula: O=C(O)C1=CC(S(=O)(Cl)=O)=C(Cl)C=C1Cl
BD66650
95%
MFCD00486543
2,4-DICHLORO-5-(DIFLUOROMETHYL)PYRIDINE
CAS:1256833-30-3
Formula: FC(C1=CN=C(Cl)C=C1Cl)F
BD481543
97%
MFCD18257012
2,4-DICHLORO-5-(DIFLUOROMETHYL)THIAZOLE
CAS:105315-43-3
Formula: FC(C1=C(Cl)N=C(Cl)S1)F
BD68727
95+%
MFCD07779287
2,4-DICHLORO-5-(ETHOXYMETHYL)PYRIMIDINE
CAS:7627-39-6
Formula: CCOCC1=CN=C(Cl)N=C1Cl
BD214314
97%
MFCD18837148
2,4-DICHLORO-5-(IODOMETHYL)-6-METHYLPYRIMIDINE
CAS:873383-27-8
Formula: CC1=C(CI)C(Cl)=NC(Cl)=N1
BD269992
95+%
2,4-DICHLORO-5-(IODOMETHYL)PYRIMIDINE
CAS:7627-44-3
Formula: ICC1=CN=C(Cl)N=C1Cl
BD182608
95+%
MFCD12827832
2,4-DICHLORO-5-(METHOXYMETHYL)PYRIMIDINE
CAS:89380-14-3
Formula: COCC1=CN=C(Cl)N=C1Cl
BD214315
95+%
MFCD18837147
2,4-DICHLORO-5-(METHYLSULFONYL)-5H-PYRROLO[3,2-D]PYRIMIDINE
CAS:N/A
Formula: O=S(N1C=CC2=NC(Cl)=NC(Cl)=C21)(C)=O
BD753036
97%
2,4-DICHLORO-5-(METHYLTHIO)PYRIMIDINE
CAS:7401-98-1
Formula: CSC1=CN=C(Cl)N=C1Cl
BD301611
97%
MFCD22199809
2,4-DICHLORO-5-(N,N-DIMETHYLSULFAMOYL)BENZOIC ACID
CAS:4793-19-5
Formula: O=C(O)C1=CC(S(=O)(N(C)C)=O)=C(Cl)C=C1Cl
BD560740
97%
MFCD02766478
2,4-DICHLORO-5-(PROP-1-EN-2-YL)PYRIDINE
CAS:1622840-98-5
Formula: C=C(C1=CN=C(Cl)C=C1Cl)C
BD556810
97% mix TBC as stabilizer
MFCD28054765
2,4-DICHLORO-5-(PYRIDIN-2-YL)PYRIMIDINE
CAS:N/A
Formula: ClC1C(C2C=CC=CN=2)=CN=C(Cl)N=1
BD00746970
95%
2,4-DICHLORO-5-(PYRIDIN-3-YL)PYRIMIDINE
CAS:1214359-45-1
Formula: ClC1=NC(Cl)=NC=C1C2=CC=CN=C2
BD454806
97%
MFCD15475337
2,4-DICHLORO-5-(PYRIDIN-4-YL)PYRIMIDINE
CAS:1214382-49-6
Formula: ClC1=NC(Cl)=NC=C1C2=CC=NC=C2
BD454299
97%
MFCD15475338
2,4-DICHLORO-5-(PYRROLIDIN-1-YLSULFONYL)BENZOIC ACID
CAS:351336-24-8
Formula: O=C(O)C1=CC(S(=O)(N2CCCC2)=O)=C(Cl)C=C1Cl
BD624921
97%
MFCD01858904
2,4-DICHLORO-5-(TRIFLUOROMETHOXY)ANILINE
CAS:1598-42-1
Formula: NC1=CC(OC(F)(F)F)=C(Cl)C=C1Cl
BD258127
95+%
MFCD20485914
2,4-DICHLORO-5-(TRIFLUOROMETHOXY)PHENYLBORONIC ACID, PINACOL ESTER
CAS:N/A
Formula: FC(F)(F)OC1=C(Cl)C=C(Cl)C(B2OC(C)(C)C(C)(C)O2)=C1
BD00793651
97%
2,4-DICHLORO-5-(TRIFLUOROMETHYL)PYRIDINE
CAS:888327-38-6
Formula: FC(F)(F)C1=CN=C(Cl)C=C1Cl
BD207704
95+%
MFCD14525480
2,4-DICHLORO-5-(TRIFLUOROMETHYL)PYRIMIDINE
CAS:3932-97-6
Formula: FC(C1=CN=C(Cl)N=C1Cl)(F)F
BD33515
98%
MFCD03426408
2,4-DICHLORO-5-(TRIFLUOROMETHYL)QUINAZOLINE
CAS:134517-56-9
Formula: FC(C1=CC=CC2=NC(Cl)=NC(Cl)=C12)(F)F
BD259679
95+%
MFCD09954879
2,4-DICHLORO-5-(TRIFLUOROMETHYL)THIAZOLE
CAS:105315-48-8
Formula: FC(C1=C(Cl)N=C(Cl)S1)(F)F
BD272512
95+%
2,4-DICHLORO-5-CYANOTHIAZOLE
CAS:82554-18-5
Formula: ClC1=NC(=C(S1)C#N)Cl
BD208718
95+%
MFCD08669569
2,4-DICHLORO-5-CYCLOPROPYLPYRIMIDINE
CAS:1190379-86-2
Formula: ClC1=NC(Cl)=NC=C1C2CC2
BD584064
98%
MFCD18533532
2,4-DICHLORO-5-ETHOXYPYRIMIDINE
CAS:280582-25-4
Formula: CCOC1=CN=C(Cl)N=C1Cl
BD247077
95+%
MFCD21648476
2,4-DICHLORO-5-ETHYL-5H-PYRROLO[3,2-D]PYRIMIDINE
CAS:129872-82-8
Formula: CCN1C=CC2=NC(Cl)=NC(Cl)=C21
BD252532
95+%
MFCD17013034
2,4-DICHLORO-5-ETHYLPYRIMIDINE
CAS:34171-40-9
Formula: CCC1=C(Cl)N=C(Cl)N=C1
BD215121
97%
MFCD11040247
2,4-DICHLORO-5-FLUORO-3-FORMYLBENZOIC ACID
CAS:214774-58-0
Formula: O=C(O)C1=CC(F)=C(Cl)C(C=O)=C1Cl
BD66658
97%
MFCD04972784
2,4-DICHLORO-5-FLUORO-3-NITROBENZOIC ACID
CAS:106809-14-7
Formula: OC(=O)C1=C(Cl)C(=C(Cl)C(F)=C1)[N+]([O-])=O
BD3987
97%
MFCD03427137
2,4-DICHLORO-5-FLUORO-6-(TRIFLUOROMETHYL)PYRIMIDINE
CAS:96819-53-3
Formula: FC(C1=C(F)C(Cl)=NC(Cl)=N1)(F)F
BD264803
95+%
2,4-DICHLORO-5-FLUORO-6-IODOPYRIMIDINE
CAS:2135336-64-8
Formula: IC1=C(C(Cl)=NC(Cl)=N1)F
BD00864897
95%
MFCD31556168
2,4-DICHLORO-5-FLUORO-6-METHYLPYRIMIDINE
CAS:954220-98-5
Formula: CC1=C(F)C(Cl)=NC(Cl)=N1
BD231809
95+%
MFCD09863051
2,4-DICHLORO-5-FLUORO-7H-PYRROLO[2,3-D]PYRIMIDINE
CAS:1053228-29-7
Formula: FC1=CNC2=C1C(Cl)=NC(Cl)=N2
BD218231
98%
MFCD16249867
2,4-DICHLORO-5-FLUOROANILINE
CAS:348-64-1
Formula: NC1=CC(F)=C(Cl)C=C1Cl
BD9825
98%
MFCD03789114
2,4-DICHLORO-5-FLUOROBENZALDEHYDE
CAS:86522-91-0
Formula: O=CC1=CC(F)=C(Cl)C=C1Cl
BD66663
98%
MFCD01631379
2,4-DICHLORO-5-FLUOROBENZAMIDE
CAS:135748-33-3
Formula: NC(=O)C1=C(Cl)C=C(Cl)C(F)=C1
BD66664
97%
MFCD01631478
2,4-DICHLORO-5-FLUOROBENZENESULFONYL CHLORIDE
CAS:874773-65-6
Formula: O=S(C1=CC(F)=C(Cl)C=C1Cl)(Cl)=O
BD309418
95+%
MFCD03094452
2,4-DICHLORO-5-FLUOROBENZOIC ACID
CAS:86522-89-6
Formula: OC(=O)C1=C(Cl)C=C(Cl)C(F)=C1
BD4066
98%
MFCD00075281
2,4-DICHLORO-5-FLUOROBENZONITRILE
CAS:128593-93-1
Formula: N#CC1=CC(F)=C(Cl)C=C1Cl
BD10119
95+%
MFCD03840469
2,4-DICHLORO-5-FLUOROBENZOYLCHLORIDE
CAS:86393-34-2
Formula: O=C(Cl)C1=CC(F)=C(Cl)C=C1Cl
BD35164
MFCD00075341
2,4-DICHLORO-5-FLUOROBENZYL ALCOHOL
CAS:N/A
Formula: FC1=C(Cl)C=C(Cl)C(CO)=C1
BD182886
2,4-DICHLORO-5-FLUOROBENZYLAMINE
CAS:939980-28-6
Formula: NCC1=CC(F)=C(Cl)C=C1Cl
BD313950
95+%
MFCD06660211
2,4-DICHLORO-5-FLUOROBENZYLBROMIDE
CAS:261763-27-3
Formula: FC1=C(Cl)C=C(Cl)C(CBr)=C1
BD66668
MFCD01631381
2,4-DICHLORO-5-FLUOROPHENYLBORONIC ACID
CAS:1417914-09-0
Formula: OB(C1=CC(F)=C(Cl)C=C1Cl)O
BD326492
98%
MFCD19981520
2,4-DICHLORO-5-FLUOROPYRIDINE
CAS:189281-48-9
Formula: FC1=CN=C(Cl)C=C1Cl
BD218264
98%
MFCD18257011
2,4-DICHLORO-5-FLUOROPYRIMIDINE
CAS:2927-71-1
Formula: C1=C(C(=NC(=N1)Cl)Cl)F
BD20025
98%
MFCD00233551
2,4-DICHLORO-5-FLUOROQUINAZOLINE
CAS:87611-00-5
Formula: FC1=CC=CC2=C1C(Cl)=NC(Cl)=N2
BD162968
97%
MFCD09954883
2,4-DICHLORO-5-HYDROXYBENZALDEHYDE
CAS:56962-15-3
Formula: O=CC1=CC(O)=C(Cl)C=C1Cl
BD468822
95%
MFCD24674245
2,4-DICHLORO-5-IODO-6-(TRIFLUOROMETHYL)PYRIMIDINE
CAS:1823899-23-5
Formula: FC(C1=C(I)C(Cl)=NC(Cl)=N1)(F)F
BD265143
95+%
2,4-DICHLORO-5-IODO-6-METHYLPYRIMIDINE
CAS:96949-46-1
Formula: CC1=C(I)C(Cl)=NC(Cl)=N1
BD267773
98%
MFCD09056871
2,4-DICHLORO-5-IODO-7-((2-(TRIMETHYLSILYL)ETHOXY)METHYL)-7H-PYRROLO[2,3-D]PYRIMIDINE
CAS:1404364-72-2
Formula: C[Si](CCOCN1C=C(I)C2=C(Cl)N=C(Cl)N=C21)(C)C
BD750676
97%
2,4-DICHLORO-5-IODO-7-METHYL-7H-PYRROLO[2,3-D]PYRIMIDINE
CAS:2007910-59-8
Formula: CN1C=C(I)C2=C(Cl)N=C(Cl)N=C21
BD751950
97%
MFCD30189397
2,4-DICHLORO-5-IODO-7H-PYRROLO[2,3-D]PYRIMIDINE
CAS:1012785-51-1
Formula: ClC1=NC2=C(C(I)=CN2)C(Cl)=N1
BD209220
98%
MFCD13189364
2,4-DICHLORO-5-IODOBENZOIC ACID
CAS:959762-87-9
Formula: O=C(O)C1=CC(I)=C(Cl)C=C1Cl
BD567765
97%
MFCD24107210
2,4-DICHLORO-5-IODOPYRIDINE
CAS:343781-49-7
Formula: IC1=CN=C(Cl)C=C1Cl
BD160480
98%
MFCD09033755
2,4-DICHLORO-5-IODOPYRIMIDINE
CAS:13544-44-0
Formula: C1=C(I)C(=NC(=N1)Cl)Cl
BD2406
97%
MFCD01898087
2,4-DICHLORO-5-IODOQUINAZOLINE
CAS:959237-30-0
Formula: IC1=CC=CC2=NC(Cl)=NC(Cl)=C12
BD225421
95%
MFCD09954871
2,4-DICHLORO-5-ISOPROPYLPYRIMIDINE
CAS:514843-12-0
Formula: CC(C1=CN=C(Cl)N=C1Cl)C
BD254326
95+%
MFCD26405580
2,4-DICHLORO-5-METHOXY-6-VINYLPYRIMIDINE
CAS:1446253-03-7
Formula: C=CC1=C(OC)C(Cl)=NC(Cl)=N1
BD329974
95% mix TBC as stabilizer
MFCD28400798
2,4-DICHLORO-5-METHOXY-N-METHYLANILINE
CAS:1072945-55-1
Formula: CNC1=CC(OC)=C(Cl)C=C1Cl
BD230521
98%
MFCD11504829
2,4-DICHLORO-5-METHOXYANILINE
CAS:98446-49-2
Formula: NC1=CC(OC)=C(Cl)C=C1Cl
BD29962
98%
MFCD00974410
2,4-DICHLORO-5-METHOXYANILINE HYDROCHLORIDE
CAS:379229-30-8
Formula: NC1=CC(OC)=C(Cl)C=C1Cl.[H]Cl
BD290570
95+%
MFCD18968925
2,4-DICHLORO-5-METHOXYPHENOL
CAS:18113-13-8
Formula: OC1=CC(OC)=C(Cl)C=C1Cl
BD250266
97%
MFCD10699699
2,4-DICHLORO-5-METHOXYPHENYL METHANESULFONATE
CAS:1065074-74-9
Formula: CS(=O)(OC1=CC(OC)=C(Cl)C=C1Cl)=O
BD433802
98%
MFCD11053813
2,4-DICHLORO-5-METHOXYPYRIDINE
CAS:1227597-40-1
Formula: COC1=CN=C(Cl)C=C1Cl
BD208802
96%
2,4-DICHLORO-5-METHOXYPYRIMIDINE
CAS:19646-07-2
Formula: ClC1=NC=C(C(=N1)Cl)OC
BD9543
98%
MFCD02685670
2,4-DICHLORO-5-METHOXYQUINAZOLINE
CAS:61948-59-2
Formula: COC1=CC=CC2=NC(Cl)=NC(Cl)=C12
BD167290
97%
MFCD10697887
2,4-DICHLORO-5-METHYL-5H-PYRROLO[3,2-D]PYRIMIDINE
CAS:129872-81-7
Formula: CN1C=CC2=NC(Cl)=NC(Cl)=C12
BD158750
97%
MFCD12755925
2,4-DICHLORO-5-METHYL-7H-PYRROLO[2,3-D]PYRIMIDINE
CAS:1060815-86-2
Formula: CC1=CNC2=NC(Cl)=NC(Cl)=C21
BD161371
97%
MFCD13189357
2,4-DICHLORO-5-METHYLANILINE
CAS:17601-75-1
Formula: CC1=CC(N)=C(Cl)C=C1Cl
BD66678
98%
MFCD09833435
2,4-DICHLORO-5-METHYLBENZALDEHYDE
CAS:63525-12-2
Formula: O=CC1=CC(C)=C(Cl)C=C1Cl
BD320814
95+%
MFCD11845977
2,4-DICHLORO-5-METHYLBENZENETHIOL
CAS:28225-88-9
Formula: SC1=CC(C)=C(Cl)C=C1Cl
BD331140
95+%
MFCD00043991
2,4-DICHLORO-5-METHYLBENZOTRIFLUORIDE
CAS:115571-61-4
Formula: CC1=CC(=C(Cl)C=C1Cl)C(F)(F)F
BD10878
95+%
MFCD00190113
2,4-DICHLORO-5-METHYLFURO[2,3-D]PYRIMIDINE
CAS:1160994-79-5
Formula: CC1=COC2=NC(Cl)=NC(Cl)=C21
BD163042
95+%
MFCD12400767
2,4-DICHLORO-5-METHYLPHENOL
CAS:1124-07-8
Formula: OC1=CC(C)=C(Cl)C=C1Cl
BD332879
95%
MFCD11520109
2,4-DICHLORO-5-METHYLPYRIMIDINE
CAS:1780-31-0
Formula: CC1=CN=C(Cl)N=C1Cl
BD2589
98%
MFCD00023197
2,4-DICHLORO-5-METHYLQUINAZOLINE
CAS:78052-20-7
Formula: CC1=CC=CC2=NC(Cl)=NC(Cl)=C12
BD259940
95+%
MFCD11047029
2,4-DICHLORO-5-METHYLQUINOLINE
CAS:153749-71-4
Formula: CC1=C2C(Cl)=CC(Cl)=NC2=CC=C1
BD587256
97%
MFCD14715408
2,4-DICHLORO-5-METHYLTHIAZOLE
CAS:105315-39-7
Formula: CC1=C(Cl)N=C(Cl)S1
BD241230
95+%
MFCD11500764
2,4-DICHLORO-5-METHYLTHIENO[2,3-D]PYRIMIDINE
CAS:56844-38-3
Formula: CC1=CSC2=NC(Cl)=NC(Cl)=C21
BD162918
97%
MFCD09965519
2,4-DICHLORO-5-NITRO-6-(TRIFLUOROMETHYL)PYRIMIDINE
CAS:715-42-4
Formula: FC(C1=C([N+]([O-])=O)C(Cl)=NC(Cl)=N1)(F)F
BD01007898
95%
MFCD08436624
2,4-DICHLORO-5-NITROANILINE
CAS:34033-44-8
Formula: NC1=CC([N+]([O-])=O)=C(Cl)C=C1Cl
BD66683
95+%
MFCD00100120
2,4-DICHLORO-5-NITROBENZALDEHYDE
CAS:53581-87-6
Formula: O=CC1=CC([N+]([O-])=O)=C(Cl)C=C1Cl
BD233760
95+%
MFCD05625133
2,4-DICHLORO-5-NITROBENZOIC ACID
CAS:19861-62-2
Formula: O=C(O)C1=CC([N+]([O-])=O)=C(Cl)C=C1Cl
BD315437
98%
MFCD00456403
2,4-DICHLORO-5-NITROBENZOTRIFLUORIDE
CAS:400-70-4
Formula: FC(F)(F)C1=CC([N+]([O-])=O)=C(Cl)C=C1Cl
BD10116
98%
MFCD00007073
2,4-DICHLORO-5-NITROPHENOL
CAS:39489-77-5
Formula: OC1=CC([N+]([O-])=O)=C(Cl)C=C1Cl
BD3142
98%
MFCD03093072
2,4-DICHLORO-5-NITROPHENYL ETHYL CARBONATE
CAS:62969-41-9
Formula: O=C(OCC)OC1=CC([N+]([O-])=O)=C(Cl)C=C1Cl
BD736296
97%
2,4-DICHLORO-5-NITROPYRIDINE
CAS:4487-56-3
Formula: ClC1=NC=C(C(=C1)Cl)[N+](=O)[O-]
BD28761
98%
MFCD07368834
2,4-DICHLORO-5-NITROPYRIMIDINE
CAS:49845-33-2
Formula: C1=C(C(=NC(=N1)Cl)Cl)[N+](=O)[O-]
BD2407
97% (contains =10%DCM)
MFCD00127867
2,4-DICHLORO-5-NITROPYRIMIDINE COMPOUND WITH DICHLOROMETHANE
CAS:N/A
Formula: O=[N+](C1=CN=C(Cl)N=C1Cl)[O-].ClCCl
BD296886
90%
n/a
2,4-DICHLORO-5-NITROQUINOLINE
CAS:N/A
Formula: O=[N+](C1=C2C(Cl)=CC(Cl)=NC2=CC=C1)[O-]
BD00780880
97%
n/a
2,4-DICHLORO-5-NITROTHIAZOLE
CAS:107190-42-1
Formula: [O-][N+](=O)C1=C(Cl)N=C(Cl)S1
BD201410
95%
MFCD11131237
2,4-DICHLORO-5-PHENYLPYRIMIDINE
CAS:63558-77-0
Formula: ClC1=NC(Cl)=NC=C1C2=CC=CC=C2
BD219224
97%
MFCD14701757
2,4-DICHLORO-5-PHENYLTHIENO[2,3-D]PYRIMIDINE
CAS:76872-27-0
Formula: ClC1=C(C(C2=CC=CC=C2)=CS3)C3=NC(Cl)=N1
BD268863
95+%
MFCD16472312
2,4-DICHLORO-5-PICOLINE
CAS:56961-78-5
Formula: ClC1=NC=C(C(=C1)Cl)C
BD21532
98%
MFCD08704813
2,4-DICHLORO-5-PYRIMIDINECARBONYL CHLORIDE
CAS:2972-52-3
Formula: ClC1=NC=C(C(=N1)Cl)C(=O)Cl
BD33100
95%
MFCD09742432
2,4-DICHLORO-5-SULFAMOYLBENZOIC ACID
CAS:2736-23-4
Formula: O=C(O)C1=CC(S(=O)(N)=O)=C(Cl)C=C1Cl
BD10341
98%
MFCD00007931
2,4-DICHLORO-5-THIAZOLECARBOXALDEHYDE
CAS:92972-48-0
Formula: C1(=C(N=C(S1)Cl)Cl)C=O
BD23152
96%
MFCD00793013
2,4-DICHLORO-5-VINYLPYRIMIDINE
CAS:137500-15-3
Formula: C=CC1=CN=C(Cl)N=C1Cl
BD269422
95% mix TBC as stabilizer
MFCD25958636
2,4-DICHLORO-5H,7H,8H-PYRANO[4,3-D]PYRIMIDINE
CAS:944902-88-9
Formula: ClC1=C(COCC2)C2=NC(Cl)=N1
BD227892
95+%
MFCD10697126
2,4-DICHLORO-5H-PYRROLO[2,3-D]PYRIMIDIN-6(7H)-ONE
CAS:1520452-96-3
Formula: O=C1CC2=C(Cl)N=C(Cl)N=C2N1
BD300932
97%
MFCD27987437
2,4-DICHLORO-5H-PYRROLO[3,2-D]PYRIMIDINE
CAS:63200-54-4
Formula: ClC1=C(NC=C2)C2=NC(Cl)=N1
BD29284
98%
MFCD08059281
2,4-DICHLORO-5H-PYRROLO[3,2-D]PYRIMIDINE-6-CARBOXYLIC ACID
CAS:1781241-35-7
Formula: O=C(C1=CC2=NC(Cl)=NC(Cl)=C2N1)O
BD00799945
97%
2,4-DICHLORO-6,7,8,9-TETRAHYDRO-5H-CYCLOHEPTA[D]PYRIMIDINE
CAS:76780-96-6
Formula: ClC1=NC2=C(CCCCC2)C(Cl)=N1
BD219518
98%
MFCD19443839
2,4-DICHLORO-6,7,8,9-TETRAHYDRO-5H-PYRIMIDO[4,5-D]AZEPINE
CAS:781612-89-3
Formula: ClC1=NC2=C(CCNCC2)C(Cl)=N1
BD163824
95+%
MFCD11518933
2,4-DICHLORO-6,7,8,9-TETRAHYDRO-5H-PYRIMIDO[4,5-D]AZEPINE HYDROCHLORIDE
CAS:1269449-25-3
Formula: ClC1=C2C(CCNCC2)=NC(Cl)=N1.[H]Cl
BD158270
95+%
MFCD13191708
2,4-DICHLORO-6,7,8,9-TETRAHYDRO-5H-PYRIMIDO[4,5-D]AZEPINE XHYDROCHLORIDE
CAS:635698-50-9
Formula: ClC1=C2C(CCNCC2)=NC(Cl)=N1.[H]Cl
BD00988558
95+%
2,4-DICHLORO-6,7-DIFLUOROQUINAZOLINE
CAS:774212-69-0
Formula: FC1=CC2=NC(Cl)=NC(Cl)=C2C=C1F
BD66694
95+%
MFCD11044645
2,4-DICHLORO-6,7-DIHYDRO-5H-CYCLOPENTA[B]PYRIDINE
CAS:56946-65-7
Formula: ClC1=NC2=C(CCC2)C(Cl)=C1
BD241728
95%
MFCD15144700
2,4-DICHLORO-6,7-DIHYDRO-5H-CYCLOPENTA[B]PYRIDINE HYDROCHLORIDE
CAS:1187830-87-0
Formula: ClC1=C(CCC2)C2=NC(Cl)=C1.[H]Cl
BD224383
95+%
MFCD11846186
2,4-DICHLORO-6,7-DIHYDRO-5H-CYCLOPENTA[D]PYRIMIDINE
CAS:5466-43-3
Formula: C1(=NC(=NC2=C1CCC2)Cl)Cl
BD162915
97%
MFCD09750204
2,4-DICHLORO-6,7-DIHYDRO-5H-PYRROLO[3,4-D]PYRIMIDINE
CAS:785775-01-1
Formula: ClC1=C2C(CNC2)=NC(Cl)=N1
BD222747
95+%
MFCD13189458
2,4-DICHLORO-6,7-DIHYDRO-5H-PYRROLO[3,4-D]PYRIMIDINE HYDROCHLORIDE
CAS:1190927-74-2
Formula: ClC1=C2C(CNC2)=NC(Cl)=N1.[H]Cl
BD222748
95%
MFCD09835495
2,4-DICHLORO-6,7-DIHYDROTHIENO[3,2-D]PYRIMIDINE
CAS:74901-69-2
Formula: ClC1=C2C(CCS2)=NC(Cl)=N1
BD158271
98%
MFCD11109461
2,4-DICHLORO-6,7-DIMETHOXYQUINAZOLINE
CAS:27631-29-4
Formula: COC1=CC2=NC(Cl)=NC(Cl)=C2C=C1OC
BD0400
97%
MFCD00051733
2,4-DICHLORO-6,7-DIMETHOXYQUINOLINE
CAS:72407-17-1
Formula: COC1=C(OC)C=C2C(Cl)=CC(Cl)=NC2=C1
BD335185
95+%
MFCD18073200
2,4-DICHLORO-6,7-DIMETHYL-1,2,3,4-TETRAHYDROQUINAZOLINE
CAS:20197-84-6
Formula: CC1=CC2=C(C=C1C)C(Cl)NC(Cl)N2
BD286655
95+%
MFCD11520683
2,4-DICHLORO-6,7-DIMETHYL-5H-PYRROLO[3,2-D]PYRIMIDINE
CAS:1062517-28-5
Formula: CC1=C(C)NC2=C(Cl)N=C(Cl)N=C21
BD00933021
97%
2,4-DICHLORO-6,8-DIHYDRO-5H-PYRANO[3,4-D]PYRIMIDINE
CAS:1269461-25-7
Formula: ClC1=C2C(COCC2)=NC(Cl)=N1
BD266300
95+%
MFCD18452006
2,4-DICHLORO-6,8-DIHYDRO-5H-THIOPYRANO[3,4-D]PYRIMIDINE
CAS:1434142-20-7
Formula: ClC1=C2C(CSCC2)=NC(Cl)=N1
BD266297
95+%
MFCD26403975
2,4-DICHLORO-6-((4-FLUOROPHENOXY)METHYL)BENZALDEHYDE
CAS:886362-88-5
Formula: O=CC1=C(COC2=CC=C(F)C=C2)C=C(Cl)C=C1Cl
BD36811
97%
MFCD03840194
2,4-DICHLORO-6-(2,2,2-TRIFLUOROETHYL)THIENO[2,3-D]PYRIMIDINE
CAS:2055107-43-0
Formula: FC(F)(F)CC1=CC2=C(Cl)N=C(Cl)N=C2S1
BD00786483
2,4-DICHLORO-6-(2,2-DIFLUORO-PROPOXY)-PYRIMIDINE-5-CARBONITRILE
CAS:1965309-20-9
Formula: N#CC1=C(OCC(F)(F)C)N=C(Cl)N=C1Cl
BD00837321
97%
MFCD30181960
2,4-DICHLORO-6-(2-METHOXYPHENYL)PYRIMIDINE
CAS:1353856-29-7
Formula: COC1=CC=CC=C1C2=CC(Cl)=NC(Cl)=N2
BD260070
95+%
MFCD21099887
2,4-DICHLORO-6-(3-FLUOROPHENOXY)-1,3,5-TRIAZINE
CAS:112748-45-5
Formula: FC1=CC(OC2=NC(Cl)=NC(Cl)=N2)=CC=C1
BD408004
95+%
MFCD05154988
2,4-DICHLORO-6-(3-METHOXYPHENYL)PYRIMIDINE
CAS:850250-73-6
Formula: COC1=CC(C2=CC(Cl)=NC(Cl)=N2)=CC=C1
BD259710
95+%
2,4-DICHLORO-6-(4-ETHOXYPHENYL)PYRIMIDINE
CAS:881194-50-9
Formula: CCOC1=CC=C(C2=CC(Cl)=NC(Cl)=N2)C=C1
BD259709
95+%
MFCD20848871
2,4-DICHLORO-6-(4-FLUOROPHENOXY)-1,3,5-TRIAZINE
CAS:112748-46-6
Formula: FC1=CC=C(OC2=NC(Cl)=NC(Cl)=N2)C=C1
BD417506
95+%
MFCD00117397
2,4-DICHLORO-6-(4-FLUOROPHENYL)QUINAZOLINE
CAS:1003042-27-0
Formula: FC1=CC=C(C2=CC3=C(Cl)N=C(Cl)N=C3C=C2)C=C1
BD270744
95+%
MFCD26392893
2,4-DICHLORO-6-(4-METHOXYPHENYL)PYRIMIDINE
CAS:163263-91-0
Formula: COC1=CC=C(C2=CC(Cl)=NC(Cl)=N2)C=C1
BD248101
97%
MFCD18074237
2,4-DICHLORO-6-(6-(TRIFLUOROMETHYL)PYRIDIN-2-YL)-1,3,5-TRIAZINE
CAS:1446507-40-9
Formula: FC(C1=CC=CC(C2=NC(Cl)=NC(Cl)=N2)=N1)(F)F
BD682926
97%
2,4-DICHLORO-6-(6-CHLOROPYRIDIN-2-YL)-1,3,5-TRIAZINE
CAS:1446507-39-6
Formula: ClC1=CC=CC(C2=NC(Cl)=NC(Cl)=N2)=N1
BD632495
97%
2,4-DICHLORO-6-(CHLOROMETHYL)-5-METHYLPYRIMIDINE
CAS:430440-91-8
Formula: CC1=C(CCl)N=C(Cl)N=C1Cl
BD269989
95+%
MFCD24464048
2,4-DICHLORO-6-(CHLOROMETHYL)PYRIDINE
CAS:1256835-26-3
Formula: ClCC1N=C(Cl)C=C(Cl)C=1
BD00708292
95+%
n/a
2,4-DICHLORO-6-(DIFLUOROMETHYL)-5-IODOPYRIMIDINE
CAS:1706432-19-0
Formula: IC1=C(C(F)F)N=C(Cl)N=C1Cl
BD619034
97%
2,4-DICHLORO-6-(DIFLUOROMETHYL)-5-NITROPYRIMIDINE
CAS:1706444-57-6
Formula: O=[N+](C1=C(C(F)F)N=C(Cl)N=C1Cl)[O-]
BD619387
97%
2,4-DICHLORO-6-(DIFLUOROMETHYL)PYRIMIDINE
CAS:1706464-39-2
Formula: FC(C1=CC(Cl)=NC(Cl)=N1)F
BD620122
97%
2,4-DICHLORO-6-(METHOXYMETHYL)PYRIMIDINE
CAS:1037543-27-3
Formula: COCC1=NC(Cl)=NC(Cl)=C1
BD214317
95+%
MFCD18837152
2,4-DICHLORO-6-(METHYLAMINO)PYRIMIDINE-5-CARBALDEHYDE
CAS:1007197-30-9
Formula: O=CC1=C(NC)N=C(Cl)N=C1Cl
BD585775
97%
2,4-DICHLORO-6-(METHYLTHIO)-1,3,5-TRIAZINE
CAS:13705-05-0
Formula: CSC1=NC(Cl)=NC(Cl)=N1
BD223908
95+%
MFCD01679001
2,4-DICHLORO-6-(METHYLTHIO)-5-NITROPYRIMIDINE
CAS:1451885-60-1
Formula: O=[N+](C1=C(SC)N=C(Cl)N=C1Cl)[O-]
BD301420
95+%
MFCD27988082
2,4-DICHLORO-6-(METHYLTHIO)PYRIMIDIN-5-AMINE
CAS:1630906-59-0
Formula: NC1=C(SC)N=C(Cl)N=C1Cl
BD301421
95+%
MFCD27988083
2,4-DICHLORO-6-(PIPERIDIN-1-YL)PYRIMIDINE
CAS:213201-98-0
Formula: ClC1=NC(Cl)=NC(N2CCCCC2)=C1
BD252533
95+%
MFCD11520488
2,4-DICHLORO-6-(PYRROLIDIN-1-YL)PYRIMIDINE
CAS:154117-92-7
Formula: ClC1=NC(Cl)=NC(N2CCCC2)=C1
BD252534
95+%
MFCD11520487
2,4-DICHLORO-6-(TRIFLUOROMETHOXY)QUINOLINE
CAS:1422496-24-9
Formula: FC(F)(F)OC1=CC=C2N=C(Cl)C=C(Cl)C2=C1
BD00821684
99%
MFCD22103429
2,4-DICHLORO-6-(TRIFLUOROMETHYL)ANILINE
CAS:62593-17-3
Formula: NC1=C(C(F)(F)F)C=C(Cl)C=C1Cl
BD4147
97%
MFCD00174313
2,4-DICHLORO-6-(TRIFLUOROMETHYL)PYRIDIN-3-AMINE
CAS:1060815-21-5
Formula: FC(C1=CC(Cl)=C(N)C(Cl)=N1)(F)F
BD559923
97%
2,4-DICHLORO-6-(TRIFLUOROMETHYL)PYRIDINE
CAS:39891-02-6
Formula: FC(C1=CC(Cl)=CC(Cl)=N1)(F)F
BD232355
97%
MFCD10698621
2,4-DICHLORO-6-(TRIFLUOROMETHYL)PYRIDO[3,2-D]PYRIMIDINE
CAS:1260663-64-6
Formula: FC(C1=NC2=C(Cl)N=C(Cl)N=C2C=C1)(F)F
BD752010
97%
MFCD18250516
2,4-DICHLORO-6-(TRIFLUOROMETHYL)PYRIMIDIN-5-AMINE
CAS:2925-96-4
Formula: NC1=C(C(F)(F)F)N=C(Cl)N=C1Cl
BD624548
97%
MFCD08436625
2,4-DICHLORO-6-(TRIFLUOROMETHYL)PYRIMIDINE
CAS:16097-64-6
Formula: C1=C(N=C(Cl)N=C1Cl)C(F)(F)F
BD66692
98%
MFCD09910264
2,4-DICHLORO-6-(TRIFLUOROMETHYL)QUINAZOLINE
CAS:864291-30-5
Formula: FC(C1=CC2=C(Cl)N=C(Cl)N=C2C=C1)(F)F
BD162959
97%
MFCD09954876
2,4-DICHLORO-6-(TRIFLUOROMETHYL)QUINOLINE
CAS:852203-17-9
Formula: FC(C1=CC=C2N=C(Cl)C=C(Cl)C2=C1)(F)F
BD66693
98%
MFCD08234682
2,4-DICHLORO-6-CYCLOPROPYL-5,6,7,8-TETRAHYDROPYRIDO[4,3-D]PYRIMIDINE
CAS:1449117-31-0
Formula: ClC1=C(CN(C2CC2)CC3)C3=NC(Cl)=N1
BD266296
95+%
MFCD23704684
2,4-DICHLORO-6-CYCLOPROPYL-5-FLUOROPYRIMIDINE
CAS:1416438-39-5
Formula: FC1=C(C2CC2)N=C(Cl)N=C1Cl
BD00921441
95%
MFCD22690154
2,4-DICHLORO-6-CYCLOPROPYL-PYRIMIDINE
CAS:21573-07-9
Formula: ClC1=NC(Cl)=NC(C2CC2)=C1
BD00823042
97%
MFCD09750201
2,4-DICHLORO-6-ETHOXYPYRIMIDINE
CAS:858447-32-2
Formula: CCOC1=CC(Cl)=NC(Cl)=N1
BD252535
95+%
MFCD22681695
2,4-DICHLORO-6-ETHOXYQUINAZOLINE
CAS:2206320-30-9
Formula: CCOC1C=CC2C(=C(N=C(N=2)Cl)Cl)C=1
BD00784831
95%
MFCD31416911
2,4-DICHLORO-6-ETHYL-1,3,5-TRIAZINE
CAS:698-72-6
Formula: CCC1=NC(Cl)=NC(Cl)=N1
BD341710
95+%
MFCD15203623
2,4-DICHLORO-6-ETHYL-5-FLUOROPYRIMIDINE
CAS:137234-85-6
Formula: FC1=C(CC)N=C(Cl)N=C1Cl
BD254930
95+%
MFCD08458278
2,4-DICHLORO-6-ETHYL-7H-PYRROLO[2,3-D]PYRIMIDINE
CAS:1275608-17-7
Formula: CCC1=CC2=C(Cl)N=C(Cl)N=C2N1
BD283796
95+%
MFCD21609285
2,4-DICHLORO-6-ETHYLPYRIMIDINE
CAS:6554-65-0
Formula: CCC1=CC(Cl)=NC(Cl)=N1
BD231767
95+%
MFCD18916409
2,4-DICHLORO-6-ETHYNYLANILINE
CAS:684250-09-7
Formula: NC1=C(C#C)C=C(Cl)C=C1Cl
BD262005
95+%
MFCD09029969
2,4-DICHLORO-6-FLUORO-QUINOLINE
CAS:406204-74-8
Formula: FC1=CC=C2N=C(Cl)C=C(Cl)C2=C1
BD33606
97%
MFCD09261383
2,4-DICHLORO-6-FLUOROANILINE
CAS:3831-70-7
Formula: NC1=C(F)C=C(Cl)C=C1Cl
BD323718
95+%
MFCD20711026
2,4-DICHLORO-6-FLUOROBENZALDEHYDE
CAS:681435-09-6
Formula: FC1=CC(Cl)=CC(Cl)=C1C=O
BD216955
95+%
MFCD12404935
2,4-DICHLORO-6-FLUOROBENZENESULFONYL CHLORIDE
CAS:1242339-70-3
Formula: O=S(C1=C(F)C=C(Cl)C=C1Cl)(Cl)=O
BD322929
95+%
MFCD16817662
2,4-DICHLORO-6-FLUOROBENZOIC ACID
CAS:904285-09-2
Formula: O=C(O)C1=C(F)C=C(Cl)C=C1Cl
BD162122
95+%
MFCD12404936
2,4-DICHLORO-6-FLUOROBENZONITRILE
CAS:1349718-98-4
Formula: N#CC1=C(F)C=C(Cl)C=C1Cl
BD307285
95%
MFCD19686188
2,4-DICHLORO-6-FLUOROIODOBENZENE
CAS:1214333-91-1
Formula: FC1=C(I)C(Cl)=CC(Cl)=C1
BD322658
95+%
MFCD13194303
2,4-DICHLORO-6-FLUOROPHENOL
CAS:344-21-8
Formula: OC1=C(F)C=C(Cl)C=C1Cl
BD474269
97%
MFCD12405440
2,4-DICHLORO-6-FLUOROPYRIDO[2,3-D]PYRIMIDINE
CAS:1220518-09-1
Formula: FC1=CC2=C(Cl)N=C(Cl)N=C2N=C1
BD558508
97%
MFCD22575134
2,4-DICHLORO-6-FLUOROPYRIMIDINE
CAS:3833-57-6
Formula: FC1=CC(Cl)=NC(Cl)=N1
BD66696
95%
MFCD16619134
2,4-DICHLORO-6-FLUOROPYRROLO[2,1-F][1,2,4]TRIAZINE
CAS:N/A
Formula: FC1=CN2N=C(Cl)N=C(Cl)C2=C1
BD00830156
97%
2,4-DICHLORO-6-FLUOROQUINAZOLINE
CAS:134517-57-0
Formula: FC1=CC=C2N=C(Cl)N=C(Cl)C2=C1
BD66697
97+%
MFCD09954884
2,4-DICHLORO-6-FLUOROQUINOLINE-3-CARBONITRILE
CAS:881313-89-9
Formula: N#CC1=C(Cl)C2=CC(F)=CC=C2N=C1Cl
BD303095
95+%
MFCD26142690
2,4-DICHLORO-6-HYDROXYBENZALDEHYDE
CAS:78443-72-8
Formula: OC1=CC(Cl)=CC(Cl)=C1C=O
BD4156
98%
MFCD00016590
2,4-DICHLORO-6-HYDROXYBENZOIC ACID
CAS:99725-34-5
Formula: O=C(O)C1=C(O)C=C(Cl)C=C1Cl
BD324586
95+%
MFCD11203640
2,4-DICHLORO-6-IODOANILINE
CAS:697-90-5
Formula: NC1=C(Cl)C=C(Cl)C=C1I
BD227781
98%
MFCD08533279
2,4-DICHLORO-6-IODOPHENOL
CAS:2040-83-7
Formula: OC1=C(I)C=C(Cl)C=C1Cl
BD564147
97%
MFCD00086134
2,4-DICHLORO-6-IODOPYRROLO[2,1-F][1,2,4]TRIAZINE
CAS:1313738-97-4
Formula: IC1=CN2N=C(Cl)N=C(Cl)C2=C1
BD306622
95+%
MFCD19443923
2,4-DICHLORO-6-IODOQUINAZOLINE
CAS:74173-76-5
Formula: ClC1=NC2=C(C=C(I)C=C2)C(Cl)=N1
BD66701
95+%
MFCD08543451
2,4-DICHLORO-6-ISOPROPOXYPYRIMIDINE
CAS:1026787-89-2
Formula: CC(OC1=CC(Cl)=NC(Cl)=N1)C
BD252536
95+%
MFCD22681696
2,4-DICHLORO-6-ISOPROPYL-5H-PYRROLO[3,4-D]PYRIMIDIN-7(6H)-ONE
CAS:1079649-94-7
Formula: O=C1N(C(C)C)CC2=C(Cl)N=C(Cl)N=C21
BD247357
95+%
MFCD22571540
2,4-DICHLORO-6-ISOPROPYLPYRIMIDIN-5-AMINE
CAS:1523617-86-8
Formula: NC1=C(C(C)C)N=C(Cl)N=C1Cl
BD301410
95+%
2,4-DICHLORO-6-ISOPROPYLPYRIMIDINE
CAS:89938-05-6
Formula: CC(C1=CC(Cl)=NC(Cl)=N1)C
BD338671
95+%
MFCD18916412
2,4-DICHLORO-6-METHOXY-1,3,5-TRIAZINE
CAS:3638-04-8
Formula: COC1=NC(Cl)=NC(Cl)=N1
BD66702
97%
MFCD00128159
2,4-DICHLORO-6-METHOXY-1,5-NAPHTHYRIDINE
CAS:959990-35-3
Formula: COC1=CC=C2N=C(Cl)C=C(Cl)C2=N1
BD245547
95+%
MFCD18254964
2,4-DICHLORO-6-METHOXY-3-NITROQUINOLINE
CAS:259180-83-1
Formula: O=[N+](C1=C(Cl)C2=CC(OC)=CC=C2N=C1Cl)[O-]
BD624437
97%
2,4-DICHLORO-6-METHOXYANILINE
CAS:93839-14-6
Formula: COC1=CC(Cl)=CC(Cl)=C1N
BD228428
95+%
MFCD20693704
2,4-DICHLORO-6-METHOXYPYRIDINE
CAS:1227572-43-1
Formula: COC1=CC(Cl)=CC(Cl)=N1
BD228572
97%
MFCD16610793
2,4-DICHLORO-6-METHOXYPYRIMIDINE
CAS:43212-41-5
Formula: ClC1=NC(=CC(=N1)Cl)OC
BD169830
97%
MFCD00955635
2,4-DICHLORO-6-METHOXYQUINAZOLINE
CAS:105763-77-7
Formula: COC1=CC2=C(Cl)N=C(Cl)N=C2C=C1
BD66703
97%
MFCD09954880
2,4-DICHLORO-6-METHOXYQUINOLINE
CAS:70049-46-6
Formula: COC1=CC=C2N=C(Cl)C=C(Cl)C2=C1
BD36813
98%
MFCD03285967
2,4-DICHLORO-6-METHOXYQUINOLINE-3-CARBALDEHYDE
CAS:151772-24-6
Formula: O=CC1=C(Cl)C2=CC(OC)=CC=C2N=C1Cl
BD166895
95+%
MFCD11048980
2,4-DICHLORO-6-METHYL-1,3,5-TRIAZINE
CAS:1973-04-2
Formula: CC1=NC(Cl)=NC(Cl)=N1
BD223503
98%
MFCD15203622
2,4-DICHLORO-6-METHYL-3-NITROPYRIDINE
CAS:63897-12-1
Formula: O=[N+](C1=C(Cl)C=C(C)N=C1Cl)[O-]
BD66704
98%
MFCD00218548
2,4-DICHLORO-6-METHYL-5,6,7,8-TETRAHYDROPYRIDO[4,3-D]PYRIMIDINE
CAS:1350738-72-5
Formula: CN1CCC2=NC(Cl)=NC(Cl)=C2C1
BD266299
95+%
MFCD20502309
2,4-DICHLORO-6-METHYL-5-NITROPYRIMIDINE
CAS:13162-26-0
Formula: O=[N+](C1=C(C)N=C(Cl)N=C1Cl)[O-]
BD2536
98%
MFCD00023196
2,4-DICHLORO-6-METHYL-5H-PYRROLO[3,2-D]PYRIMIDINE
CAS:1196157-27-3
Formula: CC1=CC2=NC(Cl)=NC(Cl)=C2N1
BD252537
95+%
MFCD13190345
2,4-DICHLORO-6-METHYL-6H-PYRROLO[3,4-D]PYRIMIDINE
CAS:1357086-92-0
Formula: CN1C=C2N=C(Cl)N=C(Cl)C2=C1
BD272180
95+%
MFCD23106215
2,4-DICHLORO-6-METHYL-7H-PYRROLO[2,3-D]PYRIMIDINE
CAS:1192711-71-9
Formula: CC1=CC2=C(Cl)N=C(Cl)N=C2N1
BD159753
98%
MFCD13193622
2,4-DICHLORO-6-METHYLANILINE
CAS:30273-00-8
Formula: NC1=C(C)C=C(Cl)C=C1Cl
BD4752
97%
MFCD00044074
2,4-DICHLORO-6-METHYLBENZALDEHYDE
CAS:1416352-11-8
Formula: O=CC1=C(C)C=C(Cl)C=C1Cl
BD291511
95+%
MFCD22566289
2,4-DICHLORO-6-METHYLBENZENE-1-SULFONYL CHLORIDE
CAS:175278-26-9
Formula: O=S(C1=C(C)C=C(Cl)C=C1Cl)(Cl)=O
BD66711
95+%
MFCD00204179
2,4-DICHLORO-6-METHYLBENZOIC ACID
CAS:65410-80-2
Formula: O=C(O)C1=C(C)C=C(Cl)C=C1Cl
BD287827
95+%
MFCD06208457
2,4-DICHLORO-6-METHYLBENZONITRILE
CAS:175277-98-2
Formula: CC1=CC(Cl)=CC(Cl)=C1C#N
BD66712
97%
MFCD00052865
2,4-DICHLORO-6-METHYLNICOTINALDEHYDE
CAS:91591-72-9
Formula: O=CC1=C(Cl)N=C(C)C=C1Cl
BD66714
97%
2,4-DICHLORO-6-METHYLNICOTINAMIDE
CAS:70593-58-7
Formula: O=C(N)C1=C(Cl)N=C(C)C=C1Cl
BD241283
95+%
MFCD03409082
2,4-DICHLORO-6-METHYLNICOTINIC ACID
CAS:56022-07-2
Formula: CC1=CC(Cl)=C(C(O)=O)C(Cl)=N1
BD66715
95+%
MFCD03086007
2,4-DICHLORO-6-METHYLNICOTINONITRILE
CAS:38367-36-1
Formula: CC1=CC(Cl)=C(C#N)C(Cl)=N1
BD241284
98%
MFCD11847537
2,4-DICHLORO-6-METHYLPHENOL
CAS:1570-65-6
Formula: OC1=C(C)C=C(Cl)C=C1Cl
BD10429
97%
MFCD00019988
2,4-DICHLORO-6-METHYLPYRIDIN-3-AMINE
CAS:179056-98-5
Formula: CC1=CC(Cl)=C(N)C(Cl)=N1
BD120573
95+%
MFCD07774093
2,4-DICHLORO-6-METHYLPYRIDINE
CAS:42779-56-6
Formula: CC1=CC(Cl)=CC(Cl)=N1
BD66726
98%
MFCD08669834
2,4-DICHLORO-6-METHYLPYRIDO[3,2-D]PYRIMIDINE
CAS:30212-52-3
Formula: CC1=NC2=C(Cl)N=C(Cl)N=C2C=C1
BD331204
95+%
MFCD11878573
2,4-DICHLORO-6-METHYLPYRIMIDIN-5-AMINE
CAS:13162-27-1
Formula: CC1=NC(Cl)=NC(Cl)=C1N
BD66655
97%
MFCD08062586
2,4-DICHLORO-6-METHYLPYRIMIDINE
CAS:5424-21-5
Formula: CC1=CC(Cl)=NC(Cl)=N1
BD7917
98%
MFCD00006064
2,4-DICHLORO-6-METHYLPYRIMIDINE-5-CARBALDEHYDE
CAS:933686-24-9
Formula: CC1=NC(Cl)=NC(Cl)=C1C=O
BD241173
97%
MFCD23135664
2,4-DICHLORO-6-METHYLPYRIMIDINE-5-CARBONITRILE
CAS:56035-64-4
Formula: CC1=NC(Cl)=NC(Cl)=C1C#N
BD174228
95%
MFCD12198893
2,4-DICHLORO-6-METHYLPYRROLO[2,1-F][1,2,4]TRIAZINE
CAS:1552232-67-3
Formula: CC1=CN2N=C(Cl)N=C(Cl)C2=C1
BD00826182
97%
2,4-DICHLORO-6-METHYLQUINAZOLINE
CAS:39576-82-4
Formula: CC1=CC=C2N=C(Cl)N=C(Cl)C2=C1
BD162894
97%
MFCD10697888
2,4-DICHLORO-6-METHYLQUINOLINE
CAS:102878-18-2
Formula: CC1=CC=C2N=C(Cl)C=C(Cl)C2=C1
BD66719
97+%
MFCD02599423
2,4-DICHLORO-6-METHYLTHIENO[2,3-D]PYRIMIDINE
CAS:76872-23-6
Formula: CC1=CC2=C(Cl)N=C(Cl)N=C2S1
BD295223
96%
MFCD15144570
2,4-DICHLORO-6-METHYLTHIENO[3,2-D]PYRIMIDINE
CAS:35265-82-8
Formula: CC1=CC2=C(S1)C(Cl)=NC(Cl)=N2
BD222226
95+%
MFCD10000842
2,4-DICHLORO-6-MORPHOLINO-1,3,5-TRIAZINE
CAS:6601-22-5
Formula: C1(=NC(=NC(=N1)Cl)Cl)N2CCOCC2
BD66720
97%
MFCD00460178
2,4-DICHLORO-6-NITROANILINE
CAS:2683-43-4
Formula: NC1=C([N+]([O-])=O)C=C(Cl)C=C1Cl
BD3230
98%
MFCD00007664
2,4-DICHLORO-6-NITROPHENOL
CAS:609-89-2
Formula: OC1=C([N+]([O-])=O)C=C(Cl)C=C1Cl
BD66723
98%
MFCD00007101
2,4-DICHLORO-6-NITROPYRIDINE
CAS:1379337-73-1
Formula: O=[N+](C1=CC(Cl)=CC(Cl)=N1)[O-]
BD208320
97%
MFCD19707599
2,4-DICHLORO-6-NITROPYRROLO[2,1-F][1,2,4]TRIAZINE
CAS:1160995-45-8
Formula: O=[N+](C1=CN2N=C(Cl)N=C(Cl)C2=C1)[O-]
BD224469
95%
MFCD12400797
2,4-DICHLORO-6-NITROQUINAZOLINE
CAS:74173-77-6
Formula: O=[N+](C1=CC2=C(Cl)N=C(Cl)N=C2C=C1)[O-]
BD22451
97+%
MFCD08460251
2,4-DICHLORO-6-NITROQUINOLINE
CAS:408523-59-1
Formula: O=[N+](C1=CC=C2N=C(Cl)C=C(Cl)C2=C1)[O-]
BD66724
97%
MFCD08234680
2,4-DICHLORO-6-NITROQUINOLINE-3-CARBONITRILE
CAS:113944-49-3
Formula: N#CC1=C(Cl)C2=CC([N+]([O-])=O)=CC=C2N=C1Cl
BD629293
97%
MFCD29924208
2,4-DICHLORO-6-PHENOXY-1,3,5-TRIAZINE
CAS:4682-78-4
Formula: ClC1=NC(OC2=CC=CC=C2)=NC(Cl)=N1
BD340496
95+%
MFCD00458967
2,4-DICHLORO-6-PHENYL-1,3,5-TRIAZINE
CAS:1700-02-3
Formula: ClC1=NC(C2=CC=CC=C2)=NC(Cl)=N1
BD18822
98%
MFCD00047340
2,4-DICHLORO-6-PHENYL-5H-PYRROLO[3,2-D]PYRIMIDINE
CAS:237435-80-2
Formula: ClC1=NC2=C(NC(=C2)C2=CC=CC=C2)C(Cl)=N1
BD234105
95+%
MFCD17011879
2,4-DICHLORO-6-PHENYLPYRIMIDINE
CAS:26032-72-4
Formula: ClC1=NC(Cl)=NC(C2=CC=CC=C2)=C1
BD243741
97%
MFCD00234591
2,4-DICHLORO-6-PHENYLTHIENO[2,3-D]PYRIMIDINE
CAS:902765-47-3
Formula: ClC1=C(C=C(C2=CC=CC=C2)S3)C3=NC(Cl)=N1
BD282233
95+%
MFCD11046676
2,4-DICHLORO-6-PROPYL-6H-PYRROLO[3,4-D]PYRIMIDINE
CAS:1357086-93-1
Formula: CCCN1C=C2N=C(Cl)N=C(Cl)C2=C1
BD272187
95+%
2,4-DICHLORO-6-PROPYLPYRIMIDINE
CAS:89938-07-8
Formula: CCCC1=NC(Cl)=NC(Cl)=C1
BD237205
95+%
MFCD18803468
2,4-DICHLORO-6-PROPYLTHIENO[2,3-D]PYRIMIDINE
CAS:902765-62-2
Formula: CCCC1=CC2=C(Cl)N=C(Cl)N=C2S1
BD251920
95+%
MFCD26383623
2,4-DICHLORO-7,7-DIMETHYL-5,7-DIHYDROFURO[3,4-D]PYRIMIDINE
CAS:1260088-72-9
Formula: CC1(C)OCC2=C(Cl)N=C(Cl)N=C21
BD218612
97%
MFCD19688042
2,4-DICHLORO-7,7-DIMETHYL-5,7-DIHYDROTHIENO[3,4-D]PYRIMIDINE
CAS:1429639-86-0
Formula: ClC1=NC(Cl)=C2C(C(C)(SC2)C)=N1
BD00877147
95%
MFCD31556745
2,4-DICHLORO-7,7-DIMETHYL-5,7-DIHYDROTHIENO[3,4-D]PYRIMIDINE 6,6-DIOXIDE
CAS:1429639-87-1
Formula: ClC1=NC(Cl)=C2C(C(C)(S(C2)(=O)=O)C)=N1
BD00857322
95%
MFCD31556746
2,4-DICHLORO-7,8-DIHYDRO-5H-THIOPYRANO[4,3-D]PYRIMIDINE
CAS:181374-43-6
Formula: ClC1=C(CSCC2)C2=NC(Cl)=N1
BD224377
95%
MFCD11846185
2,4-DICHLORO-7,8-DIHYDRO-5H-THIOPYRANO[4,3-D]PYRIMIDINE 6,6-DIOXIDE
CAS:1187830-50-7
Formula: ClC1=C(CS2(=O)=O)C(CC2)=NC(Cl)=N1
BD224378
97%
MFCD12963841
2,4-DICHLORO-7,8-DIHYDRO-5H-THIOPYRANO[4,3-D]PYRIMIDINE 6-OXIDE
CAS:1312935-07-1
Formula: ClC1=C(CS2=O)C(CC2)=NC(Cl)=N1
BD264669
95+%
2,4-DICHLORO-7,8-DIHYDRO-6H-THIOPYRANO[3,2-D]PYRIMIDINE
CAS:87466-23-7
Formula: ClC1=C2C(CCCS2)=NC(Cl)=N1
BD162966
95+%
MFCD12400769
2,4-DICHLORO-7,8-DIHYDROPYRIDO[4,3-D]PYRIMIDIN-5(6H)-ONE
CAS:1393572-20-7
Formula: O=C1NCCC2=NC(Cl)=NC(Cl)=C21
BD266298
95+%
MFCD22544158
2,4-DICHLORO-7,8-DIHYDROQUINOLIN-5(6H)-ONE
CAS:1028330-50-8
Formula: O=C1C2=C(N=C(Cl)C=C2Cl)CCC1
BD556273
97%
MFCD18253894
2,4-DICHLORO-7,8-DIMETHOXYQUINOLINE
CAS:202824-49-5
Formula: COC1=C2N=C(Cl)C=C(Cl)C2=CC=C1OC
BD330772
95+%
MFCD26406913
2,4-DICHLORO-7-((2-(TRIMETHYLSILYL)ETHOXY)METHYL)-7H-PYRROLO[2,3-D]PYRIMIDINE
CAS:442847-52-1
Formula: C[Si](CCOCN1C=CC2=C(Cl)N=C(Cl)N=C21)(C)C
BD217309
95+%
MFCD08689864
2,4-DICHLORO-7-((2-(TRIMETHYLSILYL)ETHOXY)METHYL)-7H-PYRROLO[2,3-D]PYRIMIDINE-5-CARBOXYLIC ACID
CAS:950661-85-5
Formula: O=C(C1=CN(COCC[Si](C)(C)C)C2=NC(Cl)=NC(Cl)=C21)O
BD316200
95+%
MFCD17214387
2,4-DICHLORO-7-(2-FLUOROBENZYL)-7H-PYRROLO[2,3-D]PYRIMIDINE
CAS:1075205-27-4
Formula: FC1=CC=CC=C1CN2C=CC3=C(Cl)N=C(Cl)N=C32
BD284068
95+%
2,4-DICHLORO-7-(2-FLUOROETHYL)-7H-PYRROLO[2,3-D]PYRIMIDINE
CAS:1220517-99-6
Formula: FCCN1C=CC2=C(Cl)N=C(Cl)N=C21
BD283832
95+%
MFCD22575132
2,4-DICHLORO-7-(PHENYLSULFONYL)-7H-PYRROLO[2,3-D]PYRIMIDINE
CAS:1131992-22-7
Formula: O=S(N1C=CC2=C(Cl)N=C(Cl)N=C21)(C3=CC=CC=C3)=O
BD220883
95+%
2,4-DICHLORO-7-(PHENYLSULFONYL)-7H-PYRROLO[2,3-D]PYRIMIDINE-6-CARBOXYLIC ACID
CAS:1638768-44-1
Formula: O=C(C1=CC2=C(Cl)N=C(Cl)N=C2N1S(=O)(C3=CC=CC=C3)=O)O
BD445790
97%
MFCD27987429
2,4-DICHLORO-7-(TRIFLUOROMETHOXY)QUINAZOLINE
CAS:1160994-83-1
Formula: FC(F)(F)OC1=CC2=NC(Cl)=NC(Cl)=C2C=C1
BD163043
95+%
MFCD12400771
2,4-DICHLORO-7-(TRIFLUOROMETHYL)QUINAZOLINE
CAS:396-02-1
Formula: FC(C1=CC2=NC(Cl)=NC(Cl)=C2C=C1)(F)F
BD162895
95+%
MFCD09954878
2,4-DICHLORO-7-(TRIFLUOROMETHYL)THIENO[3,2-D]PYRIMIDINE
CAS:1442083-00-2
Formula: FC(C1=CSC2=C(Cl)N=C(Cl)N=C21)(F)F
BD00814131
2,4-DICHLORO-7-CYCLOPROPYL-7H-PYRROLO[2,3-D]PYRIMIDINE
CAS:1220518-04-6
Formula: ClC1=C2C(N(C3CC3)C=C2)=NC(Cl)=N1
BD283823
95+%
MFCD22575133
2,4-DICHLORO-7-FLUORO-5H-PYRROLO[3,2-D]PYRIMIDINE
CAS:1379307-68-2
Formula: FC1=CNC2=C(Cl)N=C(Cl)N=C21
BD266707
95+%
MFCD20257946
2,4-DICHLORO-7-FLUORO-6-METHOXYQUINAZOLINE
CAS:864292-37-5
Formula: COC1=CC2=C(Cl)N=C(Cl)N=C2C=C1F
BD300177
95+%
MFCD13192015
2,4-DICHLORO-7-FLUORO-6-NITROQUINAZOLINE
CAS:1007308-75-9
Formula: O=[N+](C1=CC2=C(Cl)N=C(Cl)N=C2C=C1F)[O-]
BD225307
95+%
MFCD11858255
2,4-DICHLORO-7-FLUORO-8-METHYLQUINAZOLINE
CAS:1039736-73-6
Formula: CC1=C(F)C=CC2=C(Cl)N=C(Cl)N=C12
BD270741
95+%
2,4-DICHLORO-7-FLUOROPYRIDO[4,3-D]PYRIMIDINE
CAS:N/A
Formula: FC1=CC2=NC(Cl)=NC(Cl)=C2C=N1
BD00791949
2,4-DICHLORO-7-FLUOROQUINAZOLINE
CAS:174566-15-5
Formula: FC1=CC2=NC(Cl)=NC(Cl)=C2C=C1
BD66727
95%
MFCD09954885
2,4-DICHLORO-7-IODO-5H-PYRROLO[3,2-D]PYRIMIDINE
CAS:928840-99-7
Formula: ClC1=NC2=C(NC=C2I)C(Cl)=N1
BD221825
95%
MFCD11109825
2,4-DICHLORO-7-IODOQUINAZOLINE
CAS:959237-34-4
Formula: IC1=CC2=NC(Cl)=NC(Cl)=C2C=C1
BD162996
95+%
MFCD09954872
2,4-DICHLORO-7-ISOPROPYL-7H-PYRROLO[2,3-D]PYRIMIDINE
CAS:1227635-12-2
Formula: CC(N1C=CC2=C(Cl)N=C(Cl)N=C21)C
BD314449
95+%
MFCD23106265
2,4-DICHLORO-7-METHOXY-6-NITROQUINAZOLINE
CAS:N/A
Formula: O=[N+](C1=CC2=C(Cl)N=C(Cl)N=C2C=C1OC)[O-]
BD753521
97%
2,4-DICHLORO-7-METHOXY-8-METHYL-QUINOLINE
CAS:1108659-32-0
Formula: CC1=C2N=C(Cl)C=C(Cl)C2=CC=C1OC
BD00790549
97%
MFCD12405607
2,4-DICHLORO-7-METHOXYQUINAZOLINE
CAS:62484-31-5
Formula: ClC2=NC1=CC(=CC=C1C(=N2)Cl)OC
BD66729
95+%
MFCD09954881
2,4-DICHLORO-7-METHOXYQUINOLINE
CAS:55934-22-0
Formula: COC1=CC=C2C(Cl)=CC(Cl)=NC2=C1
BD158272
95%
MFCD09475797
2,4-DICHLORO-7-METHYL-5,7-DIHYDROFURO[3,4-D]PYRIMIDINE
CAS:1429309-52-3
Formula: CC1OCC2=C(Cl)N=C(Cl)N=C21
BD289880
95+%
MFCD22690768
2,4-DICHLORO-7-METHYL-5,7-DIHYDROTHIENO[3,4-D]PYRIMIDINE
CAS:1429639-81-5
Formula: ClC1=NC(Cl)=C2C(C(SC2)C)=N1
BD00861924
95%
MFCD31556761
2,4-DICHLORO-7-METHYL-5,7-DIHYDROTHIENO[3,4-D]PYRIMIDINE 6,6-DIOXIDE
CAS:1429639-82-6
Formula: ClC1=NC(Cl)=C2C(C(S(C2)(=O)=O)C)=N1
BD00838497
95%
MFCD31556762
2,4-DICHLORO-7-METHYL-7H-PYRROLO[2,3-D]PYRIMIDINE
CAS:90213-67-5
Formula: CN1C=CC2=C(Cl)N=C(Cl)N=C21
BD219225
97%
MFCD13189421
2,4-DICHLORO-7-METHYL-7H-PYRROLO[2,3-D]PYRIMIDINE-6-CARBOXYLIC ACID
CAS:1638760-84-5
Formula: O=C(C1=CC2=C(Cl)N=C(Cl)N=C2N1C)O
BD445793
97%
MFCD27987432
2,4-DICHLORO-7-METHYLPYRROLO[2,1-F][1,2,4]TRIAZINE
CAS:1613751-73-7
Formula: CC1=CC=C2C(Cl)=NC(Cl)=NN21
BD00807548
2,4-DICHLORO-7-METHYLQUINAZOLINE
CAS:25171-19-1
Formula: CC1=CC=C2C(Cl)=NC(Cl)=NC2=C1
BD162864
97%
MFCD11858254
2,4-DICHLORO-7-METHYLQUINOLINE
CAS:102878-19-3
Formula: CC1=CC=C2C(Cl)=CC(Cl)=NC2=C1
BD585828
95%
MFCD22200007
2,4-DICHLORO-7-METHYLTHIENO[3,2-D]PYRIMIDINE
CAS:35265-83-9
Formula: ClC1=NC2=C(C(=N1)Cl)SC=C2C
BD170944
97+%
MFCD08061253
2,4-DICHLORO-7-NITROQUINAZOLINE
CAS:129112-65-8
Formula: O=[N+](C1=CC2=NC(Cl)=NC(Cl)=C2C=C1)[O-]
BD219429
95+%
MFCD18157742
2,4-DICHLORO-7-NITROQUINOLINE
CAS:N/A
Formula: O=[N+](C1=CC=C2C(Cl)=CC(Cl)=NC2=C1)[O-]
BD00781605
97%
n/a
2,4-DICHLORO-7-PHENYL-6,7-DIHYDRO-5H-CYCLOPENTA[D]PYRIMIDINE
CAS:1263868-24-1
Formula: ClC1=C(CCC2C3=CC=CC=C3)C2=NC(Cl)=N1
BD334242
95+%
MFCD21607364