Phone (USA) +1 212-348-5610
Whatsapp: +1 516-336-9307
WeChat: chembuyersguide
Chemical Search
 


























BLD Pharmatech Ltd.




Country: China

BLD Pharmatech Ltd.
488 Taoqiao Road, Building 5, 5F
HuiNan Town, Pudong New Area,
Shanghai 201203, China


Phone: +86-21-61629022
E-Mail:E-Mail this Supplier

Contact: sales team

http://www.bldpharm.com

BLD Pharmatech Ltd.

Page: Home | 1 | 2 | 3 | 4 | 5 | 6 | 7 | 8 | 9 | 10 | 11 | 12 | 13 | 14 | 15 | 16 | 17 | 18 | 19 | 20 | 21 | 22 | 23 | 24 | 25 | 26 | 27 | 28 | 29 | 30 | 31 | 32 | 33 | 34 | 35 | 36 | 37 | 38 | 39 | 40 | 41 | 42 | 43 | 44 | 45 | 46 | 47 | 48 | 49 | 50 | 51 | 52 | 53 | 54 | 55 | 56 | 57 | 58 | 59 | 60 | 61 | 62 | 63 | 64 | 65 | 66 | 67 | 68 | 69 | 70 | 71 | 72 | 73 | 74 | 75 | 76 | 77 | 78 | 79 | 80 | 81 | 82 | 83 | 84 | 85 | 86 | 87 | 88 | 89 | 90 | 91 | 92 | 93 | 94 | 95 | 96 | 97 | 98 | 99 | 100 | 101 | 102 | 103 | 104 | 105 | 106 | 107 | 108 | 109 | 110 | 111 | 112 | 113 | 114 | 115 | 116 | 117 | 118 | 119 | 120 | 121 | 122 | 123 | 124 | 125 | 126 | 127 | 128 | 129 | 130 | 131 | 132 | 133 | 134 | 135 | 136 | 137 | 138 | 139 | 140 | 141 | 142 | 143 | 144 | 145 | 146 | 147 | 148 | 149 | 150 | 151 | 152 | 153 | 154 | 155 | 156 | 157 | 158 | 159 | 160 | 161 | 162 | 163 | 164 | 165 | 166 | 167 | 168 | 169 | 170 | 171 | 172 | 173 | 174 | 175 | 176 | 177 | 178 | 179 | 180 | 181 | 182 | 183 | 184 | 185 | 186 | 187 | 188 | 189 | 190 | 191 | 192 | 193 | 194 | 195 | 196 | 197 | 198 | 199 | 200 | 201 | 202 | 203 | 204 | 205 | 206 | 207 | 208 | 209 | 210 | 211 | 212 | 213 | 214 | 215 | 216 | 217 | 218 | 219 | 220 | 221 | 222 | 223 | 224 | 225 | 226 | 227 | 228 | 229 | 230 | 231 | 232 | 233 | 234 | 235 | 236 | 237 | 238 | 239 | 240 | 241 | 242 | 243 | 244 | 245 | 246 | 247 | 248 | 249 | 250 | 251 | 252 | 253 | 254 | 255 | 256 | 257 | 258 | 259 | 260 | 261 | 262 | 263 | 264 | 265 | 266 | 267 | 268 | 269 | 270 | 271 | 272 | 273 | 274 | 275 | 276 | 277 | 278 | 279 | 280 | 281 | 282 | 283 | 284 | 285 | 286 | 287 | 288 | 289 | 290 | 291 | 292 | 293 | 294 | 295 | 296 | 297 | 298 | 299 | 300 | 301 | 302 | 303 | 304 | 305 | 306 | 307 | 308 | 309 | 310 | 311 | 312 | 313 | 314 | 315 | 316 | 317 | 318 | 319 | 320 | 321 | 322 | 323 | 324 |
 


Product List

2,4-DICHLORO-7-TOSYL-7H-PYRROLO[2,3-D]PYRIMIDINE
CAS:934524-10-4
Formula: O=S(N1C=CC2=C(Cl)N=C(Cl)N=C21)(C3=CC=C(C)C=C3)=O
BD166283
97+%
MFCD13193624
2,4-DICHLORO-7H-PYRROLO[2,3-D]PYRIMIDINE
CAS:90213-66-4
Formula: ClC1=C2C(NC=C2)=NC(Cl)=N1
BD29862
97%
MFCD08059278
2,4-DICHLORO-7H-PYRROLO[2,3-D]PYRIMIDINE-5-CARBALDEHYDE
CAS:1638767-57-3
Formula: O=CC1=CNC2=NC(Cl)=NC(Cl)=C21
BD330376
95+%
MFCD26516404
2,4-DICHLORO-7H-PYRROLO[2,3-D]PYRIMIDINE-5-CARBONITRILE
CAS:1379367-43-7
Formula: N#CC1=CNC2=NC(Cl)=NC(Cl)=C21
BD300930
95+%
MFCD12828241
2,4-DICHLORO-7H-PYRROLO[2,3-D]PYRIMIDINE-5-CARBOXYLIC ACID
CAS:1638768-02-1
Formula: O=C(C1=CNC2=NC(Cl)=NC(Cl)=C21)O
BD445796
97%
MFCD27987438
2,4-DICHLORO-7H-PYRROLO[2,3-D]PYRIMIDINE-6-CARBOXYLIC ACID
CAS:1638760-72-1
Formula: O=C(C1=CC2=C(Cl)N=C(Cl)N=C2N1)O
BD445647
97%
MFCD25372087
2,4-DICHLORO-7H-PYRROLO[2,3-H]QUINAZOLINE
CAS:1186401-17-1
Formula: ClC1=C2C=CC(NC=C3)=C3C2=NC(Cl)=N1
BD00748167
97%
MFCD20482840
2,4-DICHLORO-8-(TRIFLUOROMETHOXY)QUINAZOLINE
CAS:959237-48-0
Formula: FC(F)(F)OC1=CC=CC2=C(Cl)N=C(Cl)N=C12
BD260957
95+%
MFCD09954875
2,4-DICHLORO-8-(TRIFLUOROMETHYL)QUINAZOLINE
CAS:959237-52-6
Formula: FC(C1=CC=CC2=C(Cl)N=C(Cl)N=C12)(F)F
BD260063
97%
MFCD09954877
2,4-DICHLORO-8-FLUORO-6,7-DIMETHOXYQUINAZOLINE
CAS:1515883-85-8
Formula: COC1=C(F)C2=NC(Cl)=NC(Cl)=C2C=C1OC
BD00803719
97%
2,4-DICHLORO-8-FLUOROQUINAZOLINE
CAS:959237-64-0
Formula: FC1=CC=CC2=C(Cl)N=C(Cl)N=C12
BD162997
95%
MFCD09954886
2,4-DICHLORO-8-FLUOROQUINOLINE
CAS:1422498-86-9
Formula: FC1=C2N=C(Cl)C=C(Cl)C2=CC=C1
BD587088
97%
MFCD22103408
2,4-DICHLORO-8-IODOQUINAZOLINE
CAS:959237-40-2
Formula: ClC1=NC2=C(I)C=CC=C2C(Cl)=N1
BD238490
95+%
MFCD09954873
2,4-DICHLORO-8-METHOXY-7-METHYLQUINAZOLINE
CAS:956100-67-7
Formula: CC1=C(OC)C2=NC(Cl)=NC(Cl)=C2C=C1
BD747871
97%
2,4-DICHLORO-8-METHOXYQUINAZOLINE
CAS:61948-60-5
Formula: COC1=CC=CC2=C(Cl)N=C(Cl)N=C12
BD66730
97%
MFCD09954882
2,4-DICHLORO-8-METHOXYQUINOLINE
CAS:32608-29-0
Formula: COC1=C2N=C(Cl)C=C(Cl)C2=CC=C1
BD33215
98%
MFCD07644554
2,4-DICHLORO-8-METHYLQUINAZOLINE
CAS:39576-83-5
Formula: CC1=CC=CC2=C(Cl)N=C(Cl)N=C12
BD258788
97%
MFCD11849266
2,4-DICHLORO-8-METHYLQUINOLINE
CAS:102878-20-6
Formula: CC1=C2N=C(Cl)C=C(Cl)C2=CC=C1
BD304940
95+%
MFCD01108969
2,4-DICHLORO-8-NITROQUINAZOLINE
CAS:174566-19-9
Formula: O=[N+](C1=CC=CC2=C(Cl)N=C(Cl)N=C12)[O-]
BD587351
97%
MFCD22561791
2,4-DICHLORO-8-NITROQUINOLINE
CAS:N/A
Formula: O=[N+](C1=C2N=C(Cl)C=C(Cl)C2=CC=C1)[O-]
BD00784297
97%
n/a
2,4-DICHLORO-BENZENEBUTANOL
CAS:112749-63-0
Formula: OCCCCC1=CC=C(Cl)C=C1Cl
BD00781557
95%
2,4-DICHLORO-BENZENEPROPANAMINE
CAS:147498-88-2
Formula: NCCCC1=CC=C(Cl)C=C1Cl
BD00802743
95%
MFCD07374090
2,4-DICHLORO-D-PHENYLALANINE
CAS:114872-98-9
Formula: ClC1=C(C[C@@H](N)C(=O)O)C=CC(=C1)Cl
BD17624
97%
MFCD01860873
2,4-DICHLORO-N'-(2-CHLOROACETYL)BENZOHYDRAZIDE
CAS:184877-74-5
Formula: O=C(NNC(CCl)=O)C1=CC=C(Cl)C=C1Cl
BD201369
95+%
MFCD02580953
2,4-DICHLORO-N'-[2-(1H-1,2,4-TRIAZOL-1-YL)ETHANIMIDOYL]BENZOHYDRAZIDE
CAS:338405-19-9
Formula: O=C(NNC(CN1N=CN=C1)=N)C2=CC=C(Cl)C=C2Cl
BD00900608
90%
MFCD00172029
2,4-DICHLORO-N'-HYDROXYBENZIMIDAMIDE
CAS:22179-80-2
Formula: N/C(C1=CC=C(Cl)C=C1Cl)=N\O
BD66776
97%
MFCD00178762
2,4-DICHLORO-N,N-DIETHYLBENZAMIDE
CAS:24309-78-2
Formula: CCN(C(C1=C(C=C(C=C1)Cl)Cl)=O)CC
BD00836691
95%
2,4-DICHLORO-N,N-DIMETHYLBENZAMIDE
CAS:6333-36-4
Formula: CN(C(C1=C(C=C(C=C1)Cl)Cl)=O)C
BD00750501
95%
MFCD01211891
2,4-DICHLORO-N,N-DIMETHYLPYRIMIDIN-5-AMINE
CAS:5298-50-0
Formula: CN(C)C1=CN=C(Cl)N=C1Cl
BD251126
95+%
2,4-DICHLORO-N,N-DIMETHYLPYRIMIDINE-5-CARBOXAMIDE
CAS:1160066-14-7
Formula: O=C(N(C)C)C1C(Cl)=NC(Cl)=NC=1
BD00787693
95%
2,4-DICHLORO-N-(2,6-DICHLOROPHENYL)PYRIMIDINE-5-CARBOXAMIDE
CAS:835633-83-5
Formula: O=C(C1=CN=C(Cl)N=C1Cl)NC2=C(Cl)C=CC=C2Cl
BD268634
95+%
MFCD26400049
2,4-DICHLORO-N-(2,6-DIMETHYLPHENYL)PYRIMIDINE-5-CARBOXAMIDE
CAS:835633-82-4
Formula: O=C(C1=CN=C(Cl)N=C1Cl)NC2=C(C)C=CC=C2C
BD268633
95+%
MFCD25953444
2,4-DICHLORO-N-(2-HYDROXYETHYL)BENZAMIDE
CAS:20656-08-0
Formula: O=C(NCCO)C1=CC=C(Cl)C=C1Cl
BD11667
95%
MFCD00141691
2,4-DICHLORO-N-(2-HYDROXYPROPYL)BENZAMIDE
CAS:947888-99-5
Formula: O=C(NCC(O)C)C1=CC=C(Cl)C=C1Cl
BD273504
97%
MFCD09204430
2,4-DICHLORO-N-(2-METHYLBENZYL)ANILINE
CAS:940367-72-6
Formula: CC1=CC=CC=C1CNC2=CC=C(Cl)C=C2Cl
BD193886
97%
MFCD10687636
2,4-DICHLORO-N-(3-{IMIDAZO[1,2-A]PYRIMIDIN-2-YL}PHENYL)BENZAMIDE
CAS:861210-38-0
Formula: O=C(NC1=CC=CC(C2=CN3C=CC=NC3=N2)=C1)C4=CC=C(Cl)C=C4Cl
BD00886278
90%
MFCD03848426
2,4-DICHLORO-N-(5-NITRO-2-THIAZOLYL)BENZAMIDE
CAS:69819-40-5
Formula: O=C(NC1=NC=C([N+]([O-])=O)S1)C2=CC=C(Cl)C=C2Cl
BD00783940
95%
MFCD01213301
2,4-DICHLORO-N-(PIPERIDIN-2-YLMETHYL)BENZENESULFONAMIDE HYDROCHLORIDE
CAS:1353948-07-8
Formula: O=S(C1=CC=C(Cl)C=C1Cl)(NCC2NCCCC2)=O.[H]Cl
BD288631
95+%
MFCD21098951
2,4-DICHLORO-N-(PIPERIDIN-3-YL)BENZENESULFONAMIDE HYDROCHLORIDE
CAS:1353958-62-9
Formula: O=S(C1=CC=C(Cl)C=C1Cl)(NC2CNCCC2)=O.[H]Cl
BD288807
95+%
MFCD21098921
2,4-DICHLORO-N-(PYRROLIDIN-2-YLMETHYL)ANILINE HYDROCHLORIDE
CAS:1177352-12-3
Formula: ClC1=CC=C(C(Cl)=C1)NCC2NCCC2.[H]Cl
BD562626
97%
2,4-DICHLORO-N-(PYRROLIDIN-2-YLMETHYL)BENZENESULFONAMIDE HYDROCHLORIDE
CAS:1353958-35-6
Formula: O=S(C1=CC=C(Cl)C=C1Cl)(NCC2NCCC2)=O.[H]Cl
BD288654
95+%
MFCD21098898
2,4-DICHLORO-N-[(1Z,3E)-2-[3-CHLORO-5-(TRIFLUOROMETHYL)PYRIDIN-2-YL]-3-{[(2,6-DICHLOROPHENYL)METHOXY]IMINO}PROP-1-EN-1-YL]ANILINE
CAS:320420-29-9
Formula: ClC1=C(CO/N=C/C(C2=NC=C(C(F)(F)F)C=C2Cl)=C\NC3=CC=C(Cl)C=C3Cl)C(Cl)=CC=C1
BD00899980
90% mix TBC as stabilizer
MFCD00172194
2,4-DICHLORO-N-[4-(2,4-DICHLOROBENZOYLOXY)-2-METHYLPHENYL]BENZAMIDE
CAS:1363166-08-8
Formula: O=C(NC1=CC=C(OC(C2=CC=C(Cl)C=C2Cl)=O)C=C1C)C3=CC=C(Cl)C=C3Cl
BD317326
95+%
MFCD21641332
2,4-DICHLORO-N-[4-(PYRROLIDIN-1-YL)PHENYL]BENZAMIDE
CAS:251097-22-0
Formula: O=C(NC1=CC=C(N2CCCC2)C=C1)C3=CC=C(Cl)C=C3Cl
BD00885109
90%
MFCD00173020
2,4-DICHLORO-N-{5-METHYL-10-OXO-2-OXA-9-AZATRICYCLO[9.4.0.0^{3,8}]PENTADECA-1(11),3(8),4,6,12,14-HEXAEN-13-YL}BENZAMIDE
CAS:866152-18-3
Formula: O=C(NC1=CC=C(OC2=CC(C)=CC=C2NC3=O)C3=C1)C4=CC=C(Cl)C=C4Cl
BD00960995
90%
n/a
2,4-DICHLORO-N-CYCLOPENTYLBENZAMIDE
CAS:301226-05-1
Formula: ClC1=CC=C(C(Cl)=C1)C(NC2CCCC2)=O
BD00860108
95%
MFCD00751465
2,4-DICHLORO-N-CYCLOPROPYL-N-(PIPERIDIN-4-YLMETHYL)BENZENESULFONAMIDE HYDROCHLORIDE
CAS:1353965-80-6
Formula: O=S(C1=CC=C(Cl)C=C1Cl)(N(C2CC2)CC3CCNCC3)=O.[H]Cl
BD289011
95+%
MFCD21098914
2,4-DICHLORO-N-CYCLOPROPYLPYRIMIDINE-5-CARBOXAMIDE
CAS:1017464-37-7
Formula: O=C(C1=CN=C(Cl)N=C1Cl)NC2CC2
BD605533
95%
MFCD09863925
2,4-DICHLORO-N-ETHYLANILINE
CAS:35113-89-4
Formula: CCNC1=CC=C(Cl)C=C1Cl
BD28467
96%
MFCD06658422
2,4-DICHLORO-N-ETHYLBENZAMIDE
CAS:66896-66-0
Formula: CCNC(C1=CC=C(C=C1Cl)Cl)=O
BD00835166
95%
MFCD00460594
2,4-DICHLORO-N-HYDROXYBENZIMIDOYL CHLORIDE
CAS:29203-60-9
Formula: Cl/C(C1=CC=C(Cl)C=C1Cl)=N\O
BD66777
97%
MFCD00192643
2,4-DICHLORO-N-ISOPROPYL-N-(PYRROLIDIN-2-YLMETHYL)BENZENESULFONAMIDE
CAS:1353980-76-3
Formula: O=S(C1=CC=C(Cl)C=C1Cl)(N(C(C)C)CC2NCCC2)=O
BD289019
95+%
MFCD21098915
2,4-DICHLORO-N-METHOXY-N-METHYLBENZAMIDE
CAS:646528-36-1
Formula: CON(C)C(=O)C1=C(Cl)C=C(Cl)C=C1
BD201460
95+%
MFCD08689759
2,4-DICHLORO-N-METHYL-N-(PIPERIDIN-3-YL)BENZENESULFONAMIDE HYDROCHLORIDE
CAS:1353947-18-8
Formula: O=S(C1=CC=C(Cl)C=C1Cl)(N(C)C2CNCCC2)=O.[H]Cl
BD289036
95+%
MFCD21098943
2,4-DICHLORO-N-METHYLANILINE
CAS:35113-88-3
Formula: CNC1=CC=C(Cl)C=C1Cl
BD142745
98%
MFCD00052853
2,4-DICHLORO-N-METHYLPYRIMIDINE-5-CARBOXAMIDE
CAS:39714-33-5
Formula: O=C(NC)C1C(Cl)=NC(Cl)=NC=1
BD00760714
95%
n/a
2,4-DICHLORO-N-NEOPENTYLANILINE
CAS:1040690-09-2
Formula: CC(C)(C)CNC1=CC=C(Cl)C=C1Cl
BD193917
97%
MFCD10687661
2,4-DICHLORO-N-PHENETHYLPYRIMIDINE-5-CARBOXAMIDE
CAS:927176-99-6
Formula: O=C(C1=CN=C(Cl)N=C1Cl)NCCC2=CC=CC=C2
BD268636
95+%
2,4-DICHLORO-PYRIMIDINE-5-CARBOXYLIC ACID-TERT-BUTYLAMIDE
CAS:389606-35-3
Formula: O=C(C1=CN=C(Cl)N=C1Cl)NC(C)(C)C
BD268632
95+%
2,4-DICHLOROBENZALDEHYDE
CAS:874-42-0
Formula: O=CC1=CC=C(Cl)C=C1Cl
BD66742
98%
MFCD00003305
2,4-DICHLOROBENZAMIDE
CAS:2447-79-2
Formula: O=C(N)C1=CC=C(Cl)C=C1Cl
BD4330
95+%
MFCD00007974
2,4-DICHLOROBENZENE-1,3,5-TRIOL
CAS:101328-98-7
Formula: OC1=C(Cl)C(O)=C(Cl)C(O)=C1
BD01140825
97%
MFCD23700877
2,4-DICHLOROBENZENE-1,3-DIOL
CAS:16606-61-4
Formula: OC1=CC=C(Cl)C(O)=C1Cl
BD328596
95+%
MFCD13152136
2,4-DICHLOROBENZENEBUTANOIC ACID
CAS:66648-64-4
Formula: O=C(O)CCCC1=CC=C(Cl)C=C1Cl
BD00799992
95%
2,4-DICHLOROBENZENESULFONAMIDE
CAS:20532-15-4
Formula: O=S(C1=CC=C(Cl)C=C1Cl)(N)=O
BD323462
97%
MFCD03094617
2,4-DICHLOROBENZENESULFONYL CHLORIDE
CAS:16271-33-3
Formula: O=S(C1=CC=C(Cl)C=C1Cl)(Cl)=O
BD3147
98%
MFCD00052712
2,4-DICHLOROBENZENETHIOL
CAS:1122-41-4
Formula: SC1=CC=C(Cl)C=C1Cl
BD66815
97%
MFCD00041421
2,4-DICHLOROBENZIMIDAMIDE
CAS:63124-43-6
Formula: N=C(N)C1=CC=C(Cl)C=C1Cl
BD66745
95+%
MFCD09745492
2,4-DICHLOROBENZIMIDAMIDE HYDROCHLORIDE
CAS:154505-50-7
Formula: N=C(N)C1=CC=C(Cl)C=C1Cl.[H]Cl
BD27628
98%
MFCD04114461
2,4-DICHLOROBENZO[4,5]THIENO[3,2-D]PYRIMIDINE
CAS:160199-05-3
Formula: ClC1=C2C(C3=CC=CC=C3S2)=NC(Cl)=N1
BD00931214
95%
MFCD13190347
2,4-DICHLOROBENZO[G]QUINAZOLINE
CAS:33987-01-8
Formula: ClC1=C2C=C3C(C=CC=C3)=CC2=NC(Cl)=N1
BD294223
95+%
2,4-DICHLOROBENZOFURO[3,2-D]PYRIMIDINE
CAS:160199-95-1
Formula: ClC1=C(OC2=CC=CC=C23)C3=NC(Cl)=N1
BD00792722
97%
MFCD13190348
2,4-DICHLOROBENZOHYDRAZIDE
CAS:5814-06-2
Formula: O=C(NN)C1=CC=C(Cl)C=C1Cl
BD4548
98%
MFCD00025113
2,4-DICHLOROBENZOIC ACID
CAS:50-84-0
Formula: C1=CC(=CC(=C1C(O)=O)Cl)Cl
BD21089
98%
MFCD00002414
2,4-DICHLOROBENZONITRILE
CAS:6574-98-7
Formula: C1=CC(=CC(=C1C#N)Cl)Cl
BD4037
96%
MFCD00016373
2,4-DICHLOROBENZOTHIAZOLE
CAS:3622-30-8
Formula: C1=C(C2=C(C=C1)SC(=N2)Cl)Cl
BD20442
95+%
MFCD00127716
2,4-DICHLOROBENZOYLACETONITRILE
CAS:39528-61-5
Formula: N#CCC(C1=CC=C(Cl)C=C1Cl)=O
BD79171
95+%
MFCD02657976
2,4-DICHLOROBENZYL IMIDOTHIOCARBAMATE HYDROCHLORIDE
CAS:72214-67-6
Formula: NC(SCC1=CC=C(C=C1Cl)Cl)=N.Cl
BD00826610
95%
MFCD00035047
2,4-DICHLOROCINNAMIC ACID
CAS:1201-99-6
Formula: O=C(O)/C=C/C1=CC=C(Cl)C=C1Cl
BD7236
97%
n/a
2,4-DICHLOROFURO[2,3-D]PYRIMIDINE
CAS:1000577-84-3
Formula: ClC1=C2C(OC=C2)=NC(Cl)=N1
BD159768
95+%
MFCD09878674
2,4-DICHLOROFURO[3,2-D]PYRIMIDINE
CAS:956034-07-4
Formula: ClC1=NC2=C(C(=N1)Cl)OC=C2
BD158273
97%
MFCD11520866
2,4-DICHLOROFURO[3,4-D]PYRIMIDIN-7(5H)-ONE
CAS:15783-48-9
Formula: O=C1OCC2=C(Cl)N=C(Cl)N=C21
BD238980
95%
MFCD18072502
2,4-DICHLOROIMIDAZO[5,1-F][1,2,4]TRIAZINE
CAS:1086398-79-9
Formula: ClC1=NC(Cl)=NN2C1=CN=C2
BD160302
97%
MFCD11501352
2,4-DICHLOROISOPHTHALONITRILE
CAS:19846-21-0
Formula: N#CC1=CC=C(Cl)C(C#N)=C1Cl
BD284402
95+%
MFCD01656997
2,4-DICHLORONAPHTHALEN-1-AMINE
CAS:29242-87-3
Formula: NC1=C2C=CC=CC2=C(Cl)C=C1Cl
BD748533
97%
2,4-DICHLORONAPHTHALEN-1-OL
CAS:2050-76-2
Formula: OC1=C(Cl)C=C(Cl)C2=C1C=CC=C2
BD66618
95%
MFCD00003931
2,4-DICHLORONICOTINALDEHYDE
CAS:134031-24-6
Formula: ClC1=C(C=O)C(=CC=N1)Cl
BD66802
98%
MFCD07437909
2,4-DICHLORONICOTINAMIDE
CAS:70593-56-5
Formula: O=C(N)C1=C(Cl)N=CC=C1Cl
BD219930
95+%
MFCD20694970
2,4-DICHLORONICOTINC ACID
CAS:262423-77-8
Formula: C1=CN=C(C(=C1Cl)C(=O)O)Cl
BD32940
98%
MFCD06796292
2,4-DICHLORONICOTINONITRILE
CAS:180995-12-4
Formula: N#CC1=C(Cl)N=CC=C1Cl
BD66629
98%
MFCD09750302
2,4-DICHLOROPHENETHYL ALCOHOL
CAS:81156-68-5
Formula: ClC1=CC=C(C(Cl)=C1)CCO
BD42039
98%
MFCD00192010
2,4-DICHLOROPHENYL 4-PHENYL-5-(TRIFLUOROMETHYL)THIOPHENE-2-CARBOXYLATE
CAS:256348-21-7
Formula: O=C(C1=CC(C2=CC=CC=C2)=C(C(F)(F)F)S1)OC3=CC=C(Cl)C=C3Cl
BD258320
95+%
MFCD00110255
2,4-DICHLOROPHENYL BUTYRATE
CAS:32351-66-9
Formula: CCCC(OC1=CC=C(Cl)C=C1Cl)=O
BD128071
97%
MFCD01751791
2,4-DICHLOROPHENYL ETHYL CARBONATE
CAS:22876-28-4
Formula: O=C(OC1=CC=C(Cl)C=C1Cl)OCC
BD66789
95+%
MFCD08056625
2,4-DICHLOROPHENYLACETIC ACID
CAS:19719-28-9
Formula: C1=C(C(=CC=C1Cl)CC(O)=O)Cl
BD10944
98%
MFCD00004318
2,4-DICHLOROPHENYLACETONE
CAS:93457-07-9
Formula: CC(CC1=CC=C(Cl)C=C1Cl)=O
BD66794
MFCD00210405
2,4-DICHLOROPHENYLACETYLENE
CAS:75717-77-0
Formula: C#CC1=CC=C(Cl)C=C1Cl
BD290925
97+%
MFCD11655752
2,4-DICHLOROPHENYLBORONIC ACID
CAS:68716-47-2
Formula: C1=CC(=CC(=C1B(O)O)Cl)Cl
BD22193
98%
MFCD00013930
2,4-DICHLOROPHENYLISOCYANTAE
CAS:2612-57-9
Formula: ClC1=CC=C(N=C=O)C(Cl)=C1
BD4042
95%
MFCD00002001
2,4-DICHLOROPHENYLISOTHIOCYANATE
CAS:6590-96-1
Formula: ClC1=CC=C(N=C=S)C(Cl)=C1
BD66791
95%
MFCD00037827
2,4-DICHLOROPHENYLSULFONYLETHANOL
CAS:107737-90-6
Formula: OCCS(=O)(C1=CC=C(Cl)C=C1Cl)=O
BD322409
95+%
MFCD03789219
2,4-DICHLOROPHENYLTHIOETHANOL
CAS:73927-27-2
Formula: OCCSC1=CC=C(Cl)C=C1Cl
BD324142
95+%
MFCD01727971
2,4-DICHLOROPTERIDINE
CAS:98138-05-7
Formula: ClC1=C2N=CC=NC2=NC(Cl)=N1
BD23305
95%
MFCD09743914
2,4-DICHLOROPYRIDIN-3-OL
CAS:405141-76-6
Formula: OC1=C(Cl)C=CN=C1Cl
BD212863
95+%
MFCD14155863
2,4-DICHLOROPYRIDINE
CAS:26452-80-2
Formula: C1=C(C=C(N=C1)Cl)Cl
BD2535
98%
MFCD00955618
2,4-DICHLOROPYRIDINE-5-BORONIC ACID PINACOL ESTER
CAS:1622217-00-8
Formula: ClC1=CC(Cl)=NC=C1B2OC(C)(C)C(C)(C)O2
BD00828040
96%
2,4-DICHLOROPYRIDO[2,3-D]PYRIDAZIN-5(6H)-ONE
CAS:1390657-40-5
Formula: O=C1C2=C(Cl)C=C(Cl)N=C2C=NN1
BD329509
95+%
MFCD23163508
2,4-DICHLOROPYRIDO[2,3-D]PYRIMIDINE
CAS:126728-20-9
Formula: ClC1=NC2=C(C=CC=N2)C(Cl)=N1
BD31684
98%
MFCD07644627
2,4-DICHLOROPYRIDO[3',2':4,5]FURO[3,2-D]PYRIMIDINE
CAS:1268241-74-2
Formula: ClC1=C(OC2=NC=CC=C23)C3=NC(Cl)=N1
BD748626
97%
MFCD22572868
2,4-DICHLOROPYRIDO[3,2-D]PYRIMIDINE
CAS:39551-54-7
Formula: ClC1=NC2=C(C(=N1)Cl)N=CC=C2
BD66804
97%
MFCD11046863
2,4-DICHLOROPYRIDO[3,4-D]PYRIMIDINE
CAS:908240-50-6
Formula: ClC1=NC2=C(C=CN=C2)C(Cl)=N1
BD158274
96%
MFCD10699461
2,4-DICHLOROPYRIMIDIN-5-AMINE
Formula: NC1=CN=C(Cl)N=C1Cl
BD00914903
95%
n/a
2,4-DICHLOROPYRIMIDIN-5-AMINE HYDROCHLORIDE
CAS:2007908-73-6
Formula: NC1=CN=C(Cl)N=C1Cl.[H]Cl
BD750922
97%
MFCD29038815
2,4-DICHLOROPYRIMIDIN-5-OL
CAS:1395037-19-0
Formula: OC1=CN=C(Cl)N=C1Cl
BD587040
97%
MFCD22570332
2,4-DICHLOROPYRIMIDINE
CAS:3934-20-1
Formula: ClC1=NC(Cl)=NC=C1
BD9378
98%
MFCD00006061
2,4-DICHLOROPYRIMIDINE-5-CARBALDEHYDE
CAS:871254-61-4
Formula: ClC1=NC(Cl)=C(C=O)C=N1
BD210578
98%
MFCD11112096
2,4-DICHLOROPYRIMIDINE-5-CARBOHYDRAZIDE
CAS:1379317-74-4
Formula: O=C(C1=CN=C(Cl)N=C1Cl)NN
BD586969
97%
MFCD18904534
2,4-DICHLOROPYRIMIDINE-5-CARBONITRILE
CAS:3177-24-0
Formula: ClC1=NC=C(C(=N1)Cl)C#N
BD66656
95%
MFCD09746248
2,4-DICHLOROPYRIMIDINE-5-CARBOXYLIC ACID
CAS:37131-89-8
Formula: ClC1=NC=C(C(=N1)Cl)C(=O)O
BD66686
97+%
MFCD09999133
2,4-DICHLOROPYRIMIDINE-5-CARBOXYLIC ACID AMIDE
CAS:1240390-28-6
Formula: O=C(C1=CN=C(Cl)N=C1Cl)N
BD215188
97%
MFCD16658133
2,4-DICHLOROPYRIMIDINE-5-SULFONYLCHLORIDE
CAS:23920-08-3
Formula: O=S(C1=CN=C(Cl)N=C1Cl)(Cl)=O
BD66807
95% NIA
MFCD09042631
2,4-DICHLOROPYRROLO[2,1-F][1,2,4]TRIAZIN-6-AMINE
CAS:1823364-13-1
Formula: NC1=CN2N=C(Cl)N=C(Cl)C2=C1
BD441595
95%
MFCD27991657
2,4-DICHLOROPYRROLO[2,1-F][1,2,4]TRIAZINE
CAS:918538-05-3
Formula: ClC1=NC(Cl)=NN2C1=CC=C2
BD149947
95+%
MFCD11044885
2,4-DICHLOROPYRROLO[2,1-F][1,2,4]TRIAZINE-7-CARBOXYLIC ACID
CAS:1784036-68-5
Formula: O=C(C1=CC=C2C(Cl)=NC(Cl)=NN21)O
BD00793703
97%
2,4-DICHLOROQUINAZOLIN-6-OL
CAS:464927-05-7
Formula: OC1=CC2=C(Cl)N=C(Cl)N=C2C=C1
BD293673
95+%
MFCD18378807
2,4-DICHLOROQUINAZOLINE
CAS:607-68-1
Formula: C1=CC2=C(C=C1)N=C(N=C2Cl)Cl
BD41848
97+%
MFCD00091950
2,4-DICHLOROQUINAZOLINE-5-CARBONITRILE
CAS:1823921-32-9
Formula: N#CC1=CC=CC2=NC(Cl)=NC(Cl)=C12
BD260167
95+%
2,4-DICHLOROQUINAZOLINE-6-CARBONITRILE
CAS:150449-98-2
Formula: N#CC1=CC2=C(Cl)N=C(Cl)N=C2C=C1
BD162841
95+%
MFCD12400768
2,4-DICHLOROQUINAZOLINE-7-CARBONITRILE
CAS:864292-40-0
Formula: ClC1=NC2=CC(=CC=C2C(Cl)=N1)C#N
BD162960
95+%
MFCD12400766
2,4-DICHLOROQUINOLIN-3-AMINE
CAS:1414786-90-5
Formula: NC1=C(Cl)C2=CC=CC=C2N=C1Cl
BD270986
95+%
MFCD27997206
2,4-DICHLOROQUINOLIN-5-AMINE
CAS:N/A
Formula: NC1=C2C(Cl)=CC(Cl)=NC2=CC=C1
BD00809070
97%
n/a
2,4-DICHLOROQUINOLIN-6-AMINE
CAS:N/A
Formula: NC1=CC=C2N=C(Cl)C=C(Cl)C2=C1
BD00787899
97%
n/a
2,4-DICHLOROQUINOLIN-7-AMINE
CAS:N/A
Formula: NC1=CC=C2C(Cl)=CC(Cl)=NC2=C1
BD00784800
97%
n/a
2,4-DICHLOROQUINOLIN-8-AMINE
CAS:N/A
Formula: NC1=C2N=C(Cl)C=C(Cl)C2=CC=C1
BD00803737
97%
n/a
2,4-DICHLOROQUINOLINE
CAS:703-61-7
Formula: ClC1=NC2=C(C=CC=C2)C(Cl)=C1
BD11462
98%
MFCD00023939
2,4-DICHLOROQUINOLINE-3-CARBONITRILE
CAS:69875-54-3
Formula: N#CC1=C(Cl)C2=CC=CC=C2N=C1Cl
BD315817
95+%
MFCD00206427
2,4-DICHLOROTHIAZOLE
CAS:4175-76-2
Formula: ClC1=NC(=CS1)Cl
BD20754
97%
MFCD08691358
2,4-DICHLOROTHIAZOLE-5-CARBOXYLIC ACID
CAS:62019-56-1
Formula: O=C(C1=C(Cl)N=C(Cl)S1)O
BD107432
95+%
MFCD09909676
2,4-DICHLOROTHIENO[2,3-D]PYRIMIDINE
CAS:18740-39-1
Formula: ClC1=NC2=C(C(=N1)Cl)C=CS2
BD19044
98%
MFCD09743991
2,4-DICHLOROTHIENO[3,2-D]PYRIMIDINE
CAS:16234-14-3
Formula: ClC1=C2C(C=CS2)=NC(Cl)=N1
BD25036
95%
MFCD08448158
2,4-DICHLOROTHIENO[3,4-D]PYRIMIDINE
CAS:36948-21-7
Formula: ClC1=NC(Cl)=NC2=CSC=C21
BD315579
95+%
MFCD10000792
2,4-DICHLOROTHIOBENZAMIDE
CAS:2775-38-4
Formula: NC(=S)C1=C(Cl)C=C(Cl)C=C1
BD4341
97%
MFCD00173930
2,4-DICYCLOPROPYL-6-(PIPERAZIN-1-YL)PYRIMIDINE
CAS:1713462-67-9
Formula: C1(C2CC2)=NC(N3CCNCC3)=CC(C4CC4)=N1
BD623167
97%
2,4-DICYCLOPROPYLBENZALDEHYDE
CAS:1245645-99-1
Formula: O=CC1=CC=C(C2CC2)C=C1C3CC3
BD164927
95+%
MFCD17677327
2,4-DICYCLOPROPYLBUT-3-YN-2-OL
CAS:67538-92-5
Formula: CC(C#CC1CC1)(C2CC2)O
BD00857899
95%
MFCD18064639
2,4-DIETHOXY-6-METHYLPYRIMIDINE
CAS:55816-92-7
Formula: CC1=CC(OCC)=NC(OCC)=N1
BD425845
96%
MFCD00090782
2,4-DIETHOXY-7-METHYLQUINOLINE
CAS:443687-61-4
Formula: CC1C=C2C(C(=CC(=N2)OCC)OCC)=CC=1
BD00773117
95+%
n/a
2,4-DIETHOXYBENZALDEHYDE
CAS:22924-16-9
Formula: O=CC1=CC=C(OCC)C=C1OCC
BD13270
97%
MFCD00995010
2,4-DIETHOXYBENZOIC ACID
CAS:19074-30-7
Formula: O=C(O)C1=CC=C(OCC)C=C1OCC
BD188555
97%
MFCD03427022
2,4-DIETHOXYPYRIMIDINE
CAS:20461-60-3
Formula: CCOC1=NC(OCC)=NC=C1
BD262697
95+%
MFCD00056029
2,4-DIETHYL 1-(2-OXO-2-PHENYLETHYL)-1H-IMIDAZOLE-2,4-DICARBOXYLATE
CAS:1638612-75-5
Formula: O=C(C1=NC(C(OCC)=O)=CN1CC(C2=CC=CC=C2)=O)OCC
BD00915435
90%
MFCD28155226
2,4-DIETHYL 1-[2-(4-METHOXYPHENYL)-2-OXOETHYL]-1H-IMIDAZOLE-2,4-DICARBOXYLATE
CAS:1638612-95-9
Formula: O=C(C1=NC(C(OCC)=O)=CN1CC(C2=CC=C(OC)C=C2)=O)OCC
BD00909987
90%
MFCD28155227
2,4-DIETHYL 1-BENZYLAZETIDINE-2,4-DICARBOXYLATE
CAS:2103745-47-5
Formula: O=C(C1N(CC2=CC=CC=C2)C(C(OCC)=O)C1)OCC
BD00784497
2,4-DIETHYL-1,5-PENTANEDIOL
CAS:57987-55-0
Formula: OCC(CC)CC(CC)CO
BD66825
MFCD01861285
2,4-DIETHYL-6-METHYLBENZENE-1,3-DIAMINE
CAS:2095-02-5
Formula: NC1=C(C)C=C(CC)C(N)=C1CC
BD124778
95%
MFCD00036113
2,4-DIETHYL-9H-THIOXANTHEN-9-ONE
CAS:82799-44-8
Formula: CCC1=CC(CC)=C2SC3=C(C=CC=C3)C(=O)C2=C1
BD17113
97%
MFCD00082910
2,4-DIETHYLBENZENE-1,3,5-TRIOL
CAS:55380-53-5
Formula: OC1=C(CC)C(O)=CC(O)=C1CC
BD00824274
97%
MFCD24715792
2,4-DIETHYLBENZENE-1,3-DIAMINE
CAS:36394-50-0
Formula: CCC1=CC=C(N)C(CC)=C1N
BD233356
95+%
MFCD20712226
2,4-DIETHYLBENZENE-1,3-DIOL
CAS:52959-33-8
Formula: OC1=CC=C(CC)C(O)=C1CC
BD66824
95+%
MFCD06410806
2,4-DIETHYLBENZOIC ACID
CAS:104175-23-7
Formula: O=C(O)C1=CC=C(CC)C=C1CC
BD447977
97%
MFCD20641288
2,4-DIETHYLHEPTAN-1-OL
CAS:80192-55-8
Formula: CCCC(CC)CC(CC)CO
BD232821
95+%
MFCD00009709
2,4-DIETHYLPENTANEDIOIC ACID
CAS:27899-21-4
Formula: O=C(O)C(CC)CC(CC)C(O)=O
BD66829
97%
MFCD04117827
2,4-DIETHYLPYRIMIDINE
CAS:857990-28-4
Formula: CCC1=NC(CC)=NC=C1
BD317662
97%
MFCD22423156
2,4-DIFLUORO-1,1-BIPHENYL
CAS:37847-52-2
Formula: FC1=CC=C(C2=CC=CC=C2)C(F)=C1
BD41642
97%
MFCD00042515
2,4-DIFLUORO-1,3,5-TRIMETHYLBENZENE
CAS:392-61-0
Formula: CC1=C(F)C(C)=C(F)C(C)=C1
BD285060
95%
MFCD18074339
2,4-DIFLUORO-1,3,5-TRIMETHYLBENZENE
CAS:79348-72-4
Formula: CC1C=C(C)C(F)=C(C)C=1F
BD00742813
95+%
MFCD18074339
2,4-DIFLUORO-1-(4-IODOPHENOXY)-BENZENE
CAS:851199-61-6
Formula: FC1=CC=C(OC2=CC=C(I)C=C2)C(F)=C1
BD00848304
95%
MFCD18207466
2,4-DIFLUORO-1-(ISOCYANO(TOSYL)METHYL)BENZENE
CAS:660431-66-3
Formula: O=S(C(C1=CC=C(F)C=C1F)[N+]#[C-])(C2=CC=C(C)C=C2)=O
BD170781
95+%
MFCD07390260
2,4-DIFLUORO-1-(METHYLSULFONYL)BENZENE
CAS:236739-02-9
Formula: O=S(C1=CC=C(F)C=C1F)(C)=O
BD66898
95+%
MFCD03789188
2,4-DIFLUORO-1-(PROP-1-EN-2-YL)BENZENE
CAS:156570-11-5
Formula: C=C(C1=CC=C(F)C=C1F)C
BD252538
95% mix TBC as stabilizer
MFCD18825239
2,4-DIFLUORO-1-(SULFINYLAMINO)BENZENE
CAS:88785-38-0
Formula: FC1=CC(F)=C(N=S=O)C=C1
BD00825438
95%
MFCD22042401
2,4-DIFLUORO-1-(TRIFLUOROMETHYL)BENZENE
CAS:64248-61-9
Formula: FC(C1=CC=C(F)C=C1F)(F)F
BD66866
97%
MFCD04972808
2,4-DIFLUORO-1-ISOPROPOXYBENZENE
CAS:203059-83-0
Formula: CC(OC1=CC=C(F)C=C1F)C
BD217751
95+%
MFCD00070792
2,4-DIFLUORO-1-METHOXYBENZENE
CAS:452-10-8
Formula: COC1=C(F)C=C(F)C=C1
BD66853
98%
MFCD00010731
2,4-DIFLUORO-1-METHYL-3-(2-METHYLPROPOXY)-5-NITROBENZENE
CAS:1881329-62-9
Formula: CC(COC1=C(C(C)=CC([N+]([O-])=O)=C1F)F)C
BD00855564
95%
2,4-DIFLUORO-1-METHYLBENZENE
CAS:452-76-6
Formula: CC1=CC=C(F)C=C1F
BD33690
97%
MFCD00000332
2,4-DIFLUORO-1-NITROBENZENE
CAS:446-35-5
Formula: FC1=CC=C([N+]([O-])=O)C(F)=C1
BD3178
98%
MFCD00007050
2,4-DIFLUORO-1-VINYLBENZENE
CAS:399-53-1
Formula: FC1=CC=C(C=C)C(F)=C1
BD33556
95% mix TBC as stabilizer
MFCD00142824
2,4-DIFLUORO-1H-INDOLE
CAS:1934422-22-6
Formula: FC1=CC=CC2=C1C=C(F)N2
BD284583
95+%
MFCD24565868
2,4-DIFLUORO-2'-MORPHOLINOMETHYL BENZOPHENONE
CAS:898751-13-8
Formula: O=C(C1=CC=CC=C1CN2CCOCC2)C3=CC=C(F)C=C3F
BD309993
95+%
MFCD03842446
2,4-DIFLUORO-2'-PIPERIDINOMETHYL BENZOPHENONE
CAS:898773-75-6
Formula: O=C(C1=CC=CC=C1CN2CCCCC2)C3=CC=C(F)C=C3F
BD311908
95+%
MFCD03842503
2,4-DIFLUORO-2'-PYRROLIDINOMETHYL BENZOPHENONE
CAS:898775-03-6
Formula: O=C(C1=CC=CC=C1CN2CCCC2)C3=CC=C(F)C=C3F
BD312005
95+%
MFCD03842560
2,4-DIFLUORO-2'-THIOMORPHOLINOMETHYL BENZOPHENONE
CAS:898782-41-7
Formula: O=C(C1=CC=CC=C1CN2CCSCC2)C3=CC=C(F)C=C3F
BD312689
95+%
MFCD03842787
2,4-DIFLUORO-3'-(1,3-DIOXOLAN-2-YL)BENZOPHENONE
CAS:898759-63-2
Formula: O=C(C1=CC=CC(C2OCCO2)=C1)C3=CC=C(F)C=C3F
BD310684
95+%
MFCD07699989
2,4-DIFLUORO-3'-MORPHOLINOMETHYL BENZOPHENONE
CAS:898792-28-4
Formula: O=C(C1=CC=CC(CN2CCOCC2)=C1)C3=CC=C(F)C=C3F
BD313612
95+%
MFCD03841937
2,4-DIFLUORO-3'-PIPERIDINOMETHYL BENZOPHENONE
CAS:898793-58-3
Formula: O=C(C1=CC=CC(CN2CCCCC2)=C1)C3=CC=C(F)C=C3F
BD313742
95+%
MFCD03841994
2,4-DIFLUORO-3'-PYRROLIDINOMETHYL BENZOPHENONE
CAS:898770-86-0
Formula: O=C(C1=CC=CC(CN2CCCC2)=C1)C3=CC=C(F)C=C3F
BD311698
95+%
MFCD03842051
2,4-DIFLUORO-3'-THIOMORPHOLINOMETHYL BENZOPHENONE
CAS:898787-93-4
Formula: O=C(C1=CC=CC(CN2CCSCC2)=C1)C3=CC=C(F)C=C3F
BD313200
95+%
MFCD03842276
2,4-DIFLUORO-3,5-DIMETHOXYBENZOIC ACID
CAS:1003709-80-5
Formula: COC1=CC(C(O)=O)=C(F)C(OC)=C1F
BD161247
95%
MFCD09839225
2,4-DIFLUORO-3-(2-METHYLPROPOXY)PHENOL
CAS:1881328-45-5
Formula: CC(COC1=C(C=CC(O)=C1F)F)C
BD00831870
95%
2,4-DIFLUORO-3-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)BENZALDEHYDE
CAS:N/A
Formula: O=CC1=CC=C(F)C(B2OC(C)(C)C(C)(C)O2)=C1F
BD00775766
95%
2,4-DIFLUORO-3-(PROPAN-2-YLOXY)PHENOL
CAS:1881295-08-4
Formula: CC(OC1=C(C=CC(O)=C1F)F)C
BD00846840
95%
2,4-DIFLUORO-3-(TRIFLUOROMETHOXY)ANILINE
CAS:153338-24-0
Formula: NC1=CC=C(F)C(OC(F)(F)F)=C1F
BD247186
95+%
MFCD19440811
2,4-DIFLUORO-3-(TRIFLUOROMETHOXY)BENZOIC ACID
CAS:1119454-13-5
Formula: O=C(O)C1=CC=C(F)C(OC(F)(F)F)=C1F
BD257997
95+%
2,4-DIFLUORO-3-(TRIFLUOROMETHOXY)BENZONITRILE
CAS:1806314-81-7
Formula: N#CC1=CC=C(F)C(OC(F)(F)F)=C1F
BD480672
97%
MFCD28791003
2,4-DIFLUORO-3-(TRIFLUOROMETHYL)ANILINE
CAS:123973-26-2
Formula: NC1C(F)=C(C(F)(F)F)C(F)=CC=1
BD00710180
95%
MFCD09261074
2,4-DIFLUORO-3-(TRIFLUOROMETHYL)BENZALDEHYDE
CAS:134099-30-2
Formula: O=CC1=CC=C(F)C(C(F)(F)F)=C1F
BD294095
98%
MFCD12404958
2,4-DIFLUORO-3-(TRIFLUOROMETHYL)BENZOIC ACID
CAS:157337-81-0
Formula: OC(=O)C1=C(F)C(=C(F)C=C1)C(F)(F)F
BD238807
98%
MFCD12827981
2,4-DIFLUORO-3-(TRIFLUOROMETHYL)BENZONITRILE
CAS:1440535-21-6
Formula: N#CC1=CC=C(F)C(C(F)(F)F)=C1F
BD473602
96%
MFCD24850039
2,4-DIFLUORO-3-(TRIFLUOROMETHYL)BENZYL BROMIDE
CAS:1445995-80-1
Formula: FC(C1=C(F)C(CBr)=CC=C1F)(F)F
BD00787033
97%
MFCD25541882
2,4-DIFLUORO-3-(TRIFLUOROMETHYL)STYRENE
CAS:1432075-80-3
Formula: C=CC1=CC=C(F)C(C(F)(F)F)=C1F
BD00789327
97% mix TBC as stabilizer
2,4-DIFLUORO-3-FORMYLBENZONITRILE
CAS:149489-14-5
Formula: N#CC1=CC=C(F)C(C=O)=C1F
BD315311
98%
MFCD09907858
2,4-DIFLUORO-3-HYDROXYBENZALDEHYDE
CAS:192927-69-8
Formula: O=CC1=CC=C(F)C(O)=C1F
BD223823
95+%
MFCD12405741
2,4-DIFLUORO-3-HYDROXYBENZOIC ACID
CAS:91659-08-4
Formula: OC(=O)C1=C(F)C(O)=C(F)C=C1
BD23387
95+%
MFCD06797839
2,4-DIFLUORO-3-IODOANILINE
CAS:1437316-91-0
Formula: NC1=CC=C(F)C(I)=C1F
BD468954
97%
MFCD28789174
2,4-DIFLUORO-3-IODOPYRIDINE
CAS:837364-88-2
Formula: IC1=C(F)C=CN=C1F
BD165748
98%
MFCD09029861
2,4-DIFLUORO-3-ISOPROPOXYPHENYLBORONIC ACID
CAS:1451390-95-6
Formula: OB(C1=CC=C(F)C(OC(C)C)=C1F)O
BD326668
98%
MFCD19981529
2,4-DIFLUORO-3-METHOXY-1-METHYL-5-NITROBENZENE
CAS:1881331-96-9
Formula: COC1=C(C(C)=CC([N+]([O-])=O)=C1F)F
BD00840910
95%
2,4-DIFLUORO-3-METHOXY-5-METHYLPHENOL
CAS:1422360-16-4
Formula: COC1=C(C(O)=CC(C)=C1F)F
BD00872618
95%
2,4-DIFLUORO-3-METHOXYANILINE
CAS:886499-08-7
Formula: NC1=CC=C(F)C(OC)=C1F
BD293285
97%
MFCD04115929
2,4-DIFLUORO-3-METHOXYBENZALDEHYDE
CAS:870837-66-4
Formula: COC1=C(F)C=CC(C=O)=C1F
BD235640
98+%
MFCD04115930
2,4-DIFLUORO-3-METHOXYBENZAMIDE
CAS:479091-06-0
Formula: O=C(N)C1=CC=C(F)C(OC)=C1F
BD308179
95+%
MFCD04115931
2,4-DIFLUORO-3-METHOXYBENZOIC ACID
CAS:178974-97-5
Formula: COC1=C(F)C=CC(C(O)=O)=C1F
BD5928
97%
MFCD02258905
2,4-DIFLUORO-3-METHOXYBENZONITRILE
CAS:220353-20-8
Formula: N#CC1=CC=C(F)C(OC)=C1F
BD10894
98%
MFCD04115932
2,4-DIFLUORO-3-METHOXYBENZOYL CHLORIDE
CAS:221221-11-0
Formula: O=C(Cl)C1=CC=C(F)C(OC)=C1F
BD319678
95+%
MFCD04115933
2,4-DIFLUORO-3-METHOXYBENZYLAMINE
CAS:717094-51-4
Formula: NCC1=CC=C(F)C(OC)=C1F
BD308643
95+%
MFCD04115935
2,4-DIFLUORO-3-METHOXYCINNAMIC ACID
CAS:886499-22-5
Formula: O=C(O)/C=C/C1=CC=C(F)C(OC)=C1F
BD309526
95+%
MFCD04115937
2,4-DIFLUORO-3-METHOXYPHENOL
CAS:886499-27-0
Formula: OC1=CC=C(F)C(OC)=C1F
BD309527
95+%
MFCD04115938
2,4-DIFLUORO-3-METHYL-5-NITROANILINE
CAS:112822-77-2
Formula: NC1=CC([N+]([O-])=O)=C(F)C(C)=C1F
BD332902
95+%
MFCD16620287
2,4-DIFLUORO-3-METHYLANILINE
CAS:76350-70-4
Formula: NC1=CC=C(F)C(C)=C1F
BD247187
96%
MFCD09261073
2,4-DIFLUORO-3-METHYLBENZALDEHYDE
CAS:847502-88-9
Formula: O=CC1=CC=C(F)C(C)=C1F
BD66837
97%
MFCD07777152
2,4-DIFLUORO-3-METHYLBENZOIC ACID
CAS:112857-68-8
Formula: FC1=C(C(=O)O)C=CC(=C1C)F
BD41189
95%
MFCD03265223
2,4-DIFLUORO-3-METHYLBENZONITRILE
CAS:847502-87-8
Formula: N#CC1=CC=C(F)C(C)=C1F
BD42055
95%
MFCD07777155
2,4-DIFLUORO-3-METHYLBENZYL ALCOHOL
CAS:847502-91-4
Formula: CC1=C(F)C(CO)=CC=C1F
BD00796362
95%
2,4-DIFLUORO-3-METHYLBENZYLAMINE
CAS:847502-90-3
Formula: NCC1=CC=C(F)C(C)=C1F
BD309322
95%
MFCD08275293
2,4-DIFLUORO-3-NITROBENZONITRILE
CAS:1186194-75-1
Formula: N#CC1=CC=C(F)C([N+]([O-])=O)=C1F
BD333191
95%
MFCD11226536
2,4-DIFLUORO-3-NITROPHENOL
CAS:1803809-58-6
Formula: OC1=CC=C(F)C([N+]([O-])=O)=C1F
BD478127
98%
MFCD28790770
2,4-DIFLUORO-3-NITROPYRIDINE
CAS:60186-14-3
Formula: O=[N+](C1=C(F)C=CN=C1F)[O-]
BD251137
97%
MFCD18802742
2,4-DIFLUORO-3-PROPOXYPHENOL
CAS:1881288-81-8
Formula: CCCOC1=C(C=CC(O)=C1F)F
BD00833467
95%
2,4-DIFLUORO-4'-(1,3-DIOXOLAN-2-YL)BENZOPHENONE
CAS:898760-76-4
Formula: O=C(C1=CC=C(C2OCCO2)C=C1)C3=CC=C(F)C=C3F
BD310773
95+%
MFCD07700040
2,4-DIFLUORO-4'-MORPHOLINOMETHYL BENZOPHENONE
CAS:898770-65-5
Formula: O=C(C1=CC=C(CN2CCOCC2)C=C1)C3=CC=C(F)C=C3F
BD311677
95+%
MFCD03841425
2,4-DIFLUORO-4'-PIPERIDINOMETHYL BENZOPHENONE
CAS:898775-63-8
Formula: O=C(C1=CC=C(CN2CCCCC2)C=C1)C3=CC=C(F)C=C3F
BD312061
95+%
MFCD03841482
2,4-DIFLUORO-4'-PYRROLIDINOMETHYL BENZOPHENONE
CAS:898776-89-1
Formula: O=C(C1=CC=C(CN2CCCC2)C=C1)C3=CC=C(F)C=C3F
BD312181
95+%
MFCD03841539
2,4-DIFLUORO-4'-THIOMORPHOLINOMETHYL BENZOPHENONE
CAS:898783-20-5
Formula: O=C(C1=CC=C(CN2CCSCC2)C=C1)C3=CC=C(F)C=C3F
BD312765
95+%
MFCD03841766
2,4-DIFLUORO-5-(3-METHYLBUTOXY)PHENOL
CAS:1881328-55-7
Formula: CC(CCOC1=C(C=C(C(O)=C1)F)F)C
BD00819443
95%
2,4-DIFLUORO-5-(METHOXYCARBONYL)PHENYLBORONIC ACID
Formula: OB(C1=CC(C(OC)=O)=C(F)C=C1F)O
BD00828022
95%
2,4-DIFLUORO-5-(PROPAN-2-YLOXY)PHENOL
CAS:1881320-89-3
Formula: CC(OC1=C(C=C(C(O)=C1)F)F)C
BD00870518
95%
2,4-DIFLUORO-5-(TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)BENZALDEHYDE
CAS:2129629-03-2
Formula: CC1(OB(C2=C(C=C(C(C=O)=C2)F)F)OC1(C)C)C
BD00896837
96%
2,4-DIFLUORO-5-(TRIFLUOROMETHOXY)ANILINE
CAS:123572-59-8
Formula: NC1=CC(OC(F)(F)F)=C(F)C=C1F
BD227880
97%
MFCD16658808
2,4-DIFLUORO-5-(TRIFLUOROMETHYL)ANILINE
CAS:261944-56-3
Formula: NC1=CC(C(F)(F)F)=C(F)C=C1F
BD4238
97%
MFCD01631613
2,4-DIFLUORO-5-(TRIFLUOROMETHYL)BENZALDEHYDE
CAS:134099-31-3
Formula: O=CC1=CC(C(F)(F)F)=C(F)C=C1F
BD00773370
97%
MFCD27664920
2,4-DIFLUORO-5-(TRIFLUOROMETHYL)BENZOIC ACID
CAS:261945-01-1
Formula: O=C(O)C1=CC(C(F)(F)F)=C(F)C=C1F
BD00806531
97%
2,4-DIFLUORO-5-(TRIFLUOROMETHYL)BENZONITRILE
CAS:261945-18-0
Formula: N#CC1=CC(C(F)(F)F)=C(F)C=C1F
BD488122
97%
MFCD01631621
2,4-DIFLUORO-5-(TRIFLUOROMETHYL)BENZYL ALCOHOL
CAS:1936257-01-0
Formula: FC(C1=C(F)C=C(F)C(CO)=C1)(F)F
BD00776803
97%
2,4-DIFLUORO-5-(TRIFLUOROMETHYL)BENZYL BROMIDE
CAS:1934665-18-5
Formula: FC(C1=C(F)C=C(F)C(CBr)=C1)(F)F
BD00799888
97%
2,4-DIFLUORO-5-BROMOPHENYLBORONIC ACID PIANCOL ESTER
CAS:1419602-18-8
Formula: CC1(C)OB(OC1(C)C)C1=CC(Br)=C(F)C=C1F
BD00843879
95%
MFCD24039984
2,4-DIFLUORO-5-FORMYLBENZONITRILE
CAS:633327-10-3
Formula: N#CC1=CC(C=O)=C(F)C=C1F
BD294806
95+%
MFCD19440211
2,4-DIFLUORO-5-HYDROXYBENZALDEHYDE
CAS:1806330-57-3
Formula: O=CC1=CC(O)=C(C=C1F)F
BD00954335
95%
MFCD24539281
2,4-DIFLUORO-5-IODOANISOLE
CAS:1936250-49-5
Formula: COC1=CC(I)=C(F)C=C1F
BD00794868
97%
2,4-DIFLUORO-5-IODOBENZALDEHYDE
CAS:1097626-30-6
Formula: O=CC1=CC(I)=C(F)C=C1F
BD454147
97%
MFCD28789181
2,4-DIFLUORO-5-IODOBENZOIC ACID
CAS:161531-51-7
Formula: OC(=O)C1=C(F)C=C(F)C(I)=C1
BD236566
95+%
MFCD11226506
2,4-DIFLUORO-5-IODOBENZYL BROMIDE
CAS:2022670-54-6
Formula: IC1=C(F)C=C(F)C(CBr)=C1
BD00792607
97%
2,4-DIFLUORO-5-IODOPHENOL
CAS:1935521-44-0
Formula: OC1=CC(I)=C(F)C=C1F
BD00772118
97%
2,4-DIFLUORO-5-IODOPYRIDINE
CAS:837364-89-3
Formula: IC1=CN=C(F)C=C1F
BD218292
95+%
MFCD09029864
2,4-DIFLUORO-5-ISOBUTOXYPHENYLBORONIC ACID
CAS:2096331-54-1
Formula: CC(CCOC1=C(C=C(C(B(O)O)=C1)F)F)C
BD00953913
98%
n/a
2,4-DIFLUORO-5-METHOXYANILINE
CAS:98446-51-6
Formula: NC1=CC(OC)=C(F)C=C1F
BD196773
95+%
MFCD08689699
2,4-DIFLUORO-5-METHOXYBENZALDEHYDE
CAS:177034-25-2
Formula: O=CC1=CC(OC)=C(F)C=C1F
BD317437
97%
MFCD24539280
2,4-DIFLUORO-5-METHOXYPHENYLBORONIC ACID
CAS:1395417-65-8
Formula: OB(C1=CC(OC)=C(F)C=C1F)O
BD326378
98%
MFCD21609510
2,4-DIFLUORO-5-METHYL-3-(2-METHYLPROPOXY)PHENOL
CAS:1881329-28-7
Formula: CC(COC1=C(C(C)=CC(O)=C1F)F)C
BD00860303
95%
2,4-DIFLUORO-5-METHYLANILINE
CAS:1378579-56-6
Formula: NC1=CC(C)=C(F)C=C1F
BD443392
97%
MFCD14583001
2,4-DIFLUORO-5-METHYLBENZALDEHYDE
CAS:315204-36-5
Formula: CC1=CC(C=O)=C(F)C=C1F
BD228204
95+%
MFCD12196967
2,4-DIFLUORO-5-METHYLBENZOIC ACID
CAS:367954-99-2
Formula: FC1=C(C(=O)O)C=C(C(=C1)F)C
BD42232
97%
MFCD09835285
2,4-DIFLUORO-5-METHYLBENZONITRILE
CAS:329314-68-3
Formula: CC1=CC(C#N)=C(F)C=C1F
BD41602
98%
MFCD09835341
2,4-DIFLUORO-5-METHYLPYRIMIDINE
CAS:96548-89-9
Formula: CC1=CN=C(F)N=C1F
BD553240
97%
MFCD18449336
2,4-DIFLUORO-5-NITRO-BENZOYLCHLORIDE
CAS:221560-09-4
Formula: O=C(C1=CC([N+]([O-])=O)=C(C=C1F)F)Cl
BD00934144
97%
MFCD12406792
2,4-DIFLUORO-5-NITROANILINE
CAS:123344-02-5
Formula: NC1=CC([N+]([O-])=O)=C(F)C=C1F
BD257853
98%
MFCD04038395
2,4-DIFLUORO-5-NITROBENZAMIDE
CAS:1097799-57-9
Formula: O=C(N)C1=CC([N+]([O-])=O)=C(F)C=C1F
BD480150
97%
MFCD11646048
2,4-DIFLUORO-5-NITROBENZENESULFONYL CHLORIDE
CAS:1780-83-2
Formula: O=S(C1=CC([N+]([O-])=O)=C(F)C=C1F)(Cl)=O
BD326886
95+%
MFCD06655595
2,4-DIFLUORO-5-NITROBENZENOL
CAS:N/A
Formula: OC1=CC([N+]([O-])=O)=C(F)C=C1F
BD199665
2,4-DIFLUORO-5-NITROBENZOIC ACID
CAS:153775-33-8
Formula: OC(=O)C1=C(F)C=C(F)C(=C1)[N+]([O-])=O
BD66843
97%
MFCD04115713
2,4-DIFLUORO-5-NITROBENZONITRILE
CAS:67152-20-9
Formula: [O-][N+](=O)C1=CC(C#N)=C(F)C=C1F
BD66845
98%
MFCD07772030
2,4-DIFLUORO-5-NITROPHENOL
CAS:113512-57-5
Formula: OC1=CC([N+]([O-])=O)=C(F)C=C1F
BD226145
97%
MFCD08443942
2,4-DIFLUORO-5-NITROPHENYL ETHYL CARBONATE
CAS:1379610-42-0
Formula: O=C(OC1=CC([N+]([O-])=O)=C(F)C=C1F)OCC
BD00879368
95%
MFCD22375446
2,4-DIFLUORO-5-NITROPHENYL PROPIONATE
CAS:924868-80-4
Formula: CCC(OC1=CC([N+]([O-])=O)=C(F)C=C1F)=O
BD199664
97%
MFCD08443941
2,4-DIFLUORO-5-NITROPYRIDINE
CAS:60186-15-4
Formula: [O-][N+](=O)C1=CN=C(F)C=C1F
BD216512
96%
MFCD18802741
2,4-DIFLUORO-5-NITROPYRIDINE
CAS:60186-15-4
Formula: [O-][N+](=O)C1=CN=C(F)C=C1F
BD00808047
75% mix25%Sulfolane
MFCD18802741
2,4-DIFLUORO-5-NITROTOLUENE
CAS:179011-38-2
Formula: O=[N+](C1=C(F)C=C(F)C(C)=C1)[O-]
BD256790
96%
MFCD16620288
2,4-DIFLUORO-5-PROPOXYPHENOL
CAS:1881295-35-7
Formula: CCCOC1=C(C=C(C(O)=C1)F)F
BD00841176
95%
2,4-DIFLUORO-6-((2-FLUORO-4-IODOPHENYL)AMINO)BENZOIC ACID
CAS:934665-14-2
Formula: O=C(O)C1=C(NC2=CC=C(I)C=C2F)C=C(F)C=C1F
BD269711
95+%
2,4-DIFLUORO-6-((TRIMETHYLSILYL)ETHYNYL)ANILINE
CAS:684250-21-3
Formula: NC1=C(C#C[Si](C)(C)C)C=C(F)C=C1F
BD241342
95+%
MFCD09029951
2,4-DIFLUORO-6-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)ANILINE
CAS:1415568-78-3
Formula: NC1=C(B2OC(C)(C)C(C)(C)O2)C=C(F)C=C1F
BD329681
95%
MFCD28291811
2,4-DIFLUORO-6-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PHENOL
CAS:1451391-16-4
Formula: OC1=C(B2OC(C)(C)C(C)(C)O2)C=C(F)C=C1F
BD326670
98%
MFCD16996285
2,4-DIFLUORO-6-HYDROXYBENZALDEHYDE
CAS:136516-64-8
Formula: O=CC1=C(O)C=C(F)C=C1F
BD212993
97%
MFCD03701048
2,4-DIFLUORO-6-HYDROXYBENZOIC ACID
CAS:189283-54-3
Formula: O=C(O)C1=C(O)C=C(F)C=C1F
BD244177
96%
MFCD06203215
2,4-DIFLUORO-6-HYDROXYBENZONITRILE
CAS:1261793-35-4
Formula: N#CC1=C(O)C=C(F)C=C1F
BD449811
97%
MFCD18394850
2,4-DIFLUORO-6-IODOANILINE
CAS:582319-15-1
Formula: NC1=C(F)C=C(F)C=C1I
BD238834
95+%
MFCD08059536
2,4-DIFLUORO-6-IODOPHENOL
CAS:551002-42-7
Formula: OC1=C(I)C=C(F)C=C1F
BD304200
95+%
MFCD00466295
2,4-DIFLUORO-6-METHOXYBENZALDEHYDE
CAS:608515-57-7
Formula: O=CC1=C(OC)C=C(F)C=C1F
BD334768
95%
MFCD20486219
2,4-DIFLUORO-6-METHOXYBENZONITRILE
CAS:1240518-41-5
Formula: N#CC1=C(OC)C=C(F)C=C1F
BD469695
95%
MFCD20486220
2,4-DIFLUORO-6-METHYLPYRIDINE
CAS:83261-73-8
Formula: CC1=CC(F)=CC(F)=N1
BD241270
95+%
MFCD16610831
2,4-DIFLUORO-6-METHYLPYRIMIDINE
CAS:696-80-0
Formula: CC1N=C(F)N=C(F)C=1
BD00753248
95+%
MFCD18377655
2,4-DIFLUORO-6-NITROANILINE
CAS:364-30-7
Formula: NC1=C(F)C=C(F)C=C1[N+]([O-])=O
BD66847
98%
MFCD00034058
2,4-DIFLUORO-6-NITROPHENOL
CAS:364-31-8
Formula: OC1=C([N+]([O-])=O)C=C(F)C=C1F
BD3180
97%
MFCD03094186
2,4-DIFLUORO-BENZENEBUTANOL
CAS:1342602-90-7
Formula: OCCCCC1=CC=C(F)C=C1F
BD00780644
95%
2,4-DIFLUORO-BENZENEPROPANAMINE
CAS:377084-64-5
Formula: NCCCC1=CC=C(F)C=C1F
BD00772443
95%
MFCD07374092
2,4-DIFLUORO-D-HOMOPHENYLALANINE
CAS:1260608-31-8
Formula: N[C@H](CCC1=CC=C(F)C=C1F)C(O)=O
BD00775013
95%
2,4-DIFLUORO-L-HOMOPHENYLALANINE
CAS:1260593-30-3
Formula: N[C@@H](CCC1=CC=C(F)C=C1F)C(O)=O
BD00793712
95%
2,4-DIFLUORO-N,N-DIMETHYLANILINE
CAS:78409-21-9
Formula: CN(C)C1=CC=C(F)C=C1F
BD66883
95+%
MFCD04116330
2,4-DIFLUORO-N-(2-METHOXY-5-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PYRIDIN-3-YL)BENZENESULFONAMIDE
CAS:1083326-73-1
Formula: O=S(C1=CC=C(F)C=C1F)(NC2=CC(B3OC(C)(C)C(C)(C)O3)=CN=C2OC)=O
BD252539
95+%
MFCD12923393
2,4-DIFLUORO-N-(2-NITROPHENYL)ANILINE
CAS:500302-20-5
Formula: O=[N+](C1=CC=CC=C1NC2=CC=C(F)C=C2F)[O-]
BD334467
95+%
MFCD10567165
2,4-DIFLUORO-N-ISOPROPYLANILINE
CAS:124703-94-2
Formula: CC(NC1=CC=C(F)C=C1F)C
BD00836357
95%
2,4-DIFLUORO-N-METHOXY-N-METHYLBENZAMIDE
CAS:198967-25-8
Formula: CON(C)C(=O)C1=C(F)C=C(F)C=C1
BD66885
96%
MFCD02684298
2,4-DIFLUORO-N-METHYLANILINE
CAS:138564-16-6
Formula: CNC1=CC=C(F)C=C1F
BD66886
96%
MFCD00042472
2,4-DIFLUORO-N-METHYLANILINE HYDROCHLORIDE
CAS:1187386-15-7
Formula: CNC1=CC=C(F)C=C1F.[H]Cl
BD255848
98%
MFCD11110410
2,4-DIFLUORO-PHENYLTHIOACETIC ACID
CAS:773108-57-9
Formula: OC(CC1=CC=C(F)C=C1F)=S
BD324176
95+%
MFCD06208194
2,4-DIFLUOROANILINE
CAS:367-25-9
Formula: NC1=CC=C(F)C=C1F
BD3382
97%
MFCD00007648
2,4-DIFLUOROBENZALDEHYDE
CAS:1550-35-2
Formula: O=CC1=CC=C(F)C=C1F
BD32080
96%
MFCD00010326
2,4-DIFLUOROBENZALDEHYDE OXIME
CAS:247092-11-1
Formula: FC1=CC=C(C(F)=C1)/C=N/O
BD66855
95+%
MFCD03265384
2,4-DIFLUOROBENZAMIDE
CAS:85118-02-1
Formula: O=C(N)C1=CC=C(F)C=C1F
BD10358
98%
MFCD00015547
2,4-DIFLUOROBENZAMIDOXIME
CAS:883022-90-0
Formula: N/C(C1=CC=C(F)C=C1F)=N\O
BD309438
95+%
MFCD05864461
2,4-DIFLUOROBENZENE-1,3-DIOL
CAS:195136-71-1
Formula: OC1=CC=C(F)C(O)=C1F
BD66903
95%
MFCD09836234
2,4-DIFLUOROBENZENE-1-SULFONYL CHLORIDE
CAS:13918-92-8
Formula: O=S(C1=CC=C(F)C=C1F)(Cl)=O
BD3152
98%
MFCD00042481
2,4-DIFLUOROBENZENEETHANOL
CAS:81228-02-6
Formula: OCCC1=CC=C(F)C=C1F
BD00806516
95%
MFCD00142823
2,4-DIFLUOROBENZENESULFONAMIDE
CAS:13656-60-5
Formula: O=S(C1=CC=C(F)C=C1F)(N)=O
BD66858
98+%
MFCD01320743
2,4-DIFLUOROBENZIMIDAMIDE
CAS:885957-21-1
Formula: N=C(N)C1=CC=C(F)C=C1F
BD259443
95+%
MFCD05662976
2,4-DIFLUOROBENZIMIDAMIDE HYDROCHLORIDE
CAS:1170536-00-1
Formula: N=C(C1=CC=C(F)C=C1F)N.[H]Cl
BD492926
98%
MFCD04114445
2,4-DIFLUOROBENZOHYDRAZIDE
CAS:118737-62-5
Formula: O=C(NN)C1=CC=C(F)C=C1F
BD4623
98%
MFCD00173685
2,4-DIFLUOROBENZOIC ACID
CAS:1583-58-0
Formula: C1=CC(=CC(=C1C(O)=O)F)F
BD4216
98%
MFCD00011670
2,4-DIFLUOROBENZONITRILE
CAS:3939-09-1
Formula: FC1=CC(F)=C(C#N)C=C1
BD66862
98%
MFCD00009826
2,4-DIFLUOROBENZOTHIOAMIDE
CAS:175276-92-3
Formula: S=C(N)C1=CC=C(F)C=C1F
BD66904
95+%
MFCD00085011
2,4-DIFLUOROBENZOYL CHLORIDE
CAS:72482-64-5
Formula: O=C(Cl)C1=CC=C(F)C=C1F
BD34742
98%
MFCD00000658
2,4-DIFLUOROBENZOYLFORMIC ACID
CAS:79477-89-7
Formula: O=C(C(C1=CC=C(F)C=C1F)=O)O
BD00787605
95%
MFCD11179637
2,4-DIFLUOROBENZYL ALCOHOL
CAS:56456-47-4
Formula: OCC1=CC=C(F)C=C1F
BD10444
96%
MFCD00009983
2,4-DIFLUOROBENZYLMETHYLSULFONE
CAS:25195-44-2
Formula: CS(=O)(CC1=C(C=C(C=C1)F)F)=O
BD00845456
95%
MFCD06798023
2,4-DIFLUOROBENZYLSULFONAMIDE
CAS:1001026-56-7
Formula: O=S(CC1=CC=C(F)C=C1F)(N)=O
BD322269
95+%
MFCD09800677
2,4-DIFLUOROIODOBENZENE
CAS:2265-93-2
Formula: IC1=CC=C(F)C=C1F
BD9775
98%
MFCD00040151
2,4-DIFLUORONICOTINALDEHYDE
CAS:1227564-60-4
Formula: O=CC1=C(F)N=CC=C1F
BD260322
95+%
MFCD16610838
2,4-DIFLUORONICOTINAMIDE
CAS:1823943-65-2
Formula: O=C(N)C1=C(F)N=CC=C1F
BD260325
95+%
2,4-DIFLUORONICOTINIC ACID
CAS:849937-90-2
Formula: O=C(O)C1=C(F)N=CC=C1F
BD261929
95+%
MFCD09031030
2,4-DIFLUORONICOTINONITRILE
CAS:1807275-54-2
Formula: N#CC1=C(F)N=CC=C1F
BD260326
95+%
2,4-DIFLUOROPHENETHYL BROMIDE
CAS:214618-54-9
Formula: FC1=CC=C(C(F)=C1)CCBr
BD00791837
95%
MFCD11846542
2,4-DIFLUOROPHENOL
CAS:367-27-1
Formula: OC1=CC=C(F)C=C1F
BD33414
98%
MFCD00009715
2,4-DIFLUOROPHENYL 4-(CHLOROMETHYL)BENZOATE
CAS:219500-09-1
Formula: O=C(OC1=CC=C(F)C=C1F)C2=CC=C(CCl)C=C2
BD66889
97%
2,4-DIFLUOROPHENYL CHLOROFORMATE
CAS:400900-00-7
Formula: O=C(Cl)OC1=CC=C(F)C=C1F
BD00981833
95%
MFCD24141121
2,4-DIFLUOROPHENYL ISOCYANIDE
CAS:428818-83-1
Formula: FC1=CC=C(C(F)=C1)[N+]#[C-]
BD00852938
96%
MFCD02664628
2,4-DIFLUOROPHENYL TRIFLUOROMETHANESULFONATE
CAS:264135-49-1
Formula: FC1=CC(F)=C(C=C1)OS(=O)(C(F)(F)F)=O
BD00840495
95%
MFCD07784321
2,4-DIFLUOROPHENYLACETIC ACID
CAS:81228-09-3
Formula: O=C(O)CC1=CC=C(F)C=C1F
BD5919
98%
MFCD00009999
2,4-DIFLUOROPHENYLACETYL CHLORIDE
CAS:141060-00-6
Formula: O=C(Cl)CC1=CC=C(F)C=C1F
BD323214
95%
MFCD08458139
2,4-DIFLUOROPHENYLBORONIC ACID
CAS:144025-03-6
Formula: C1=C(F)C=CC(=C1F)B(O)O
BD9873
97%
MFCD01318998
2,4-DIFLUOROPHENYLBORONIC ACID MIDA ESTER
Formula: CN1CC(OB(C2=CC=C(C=C2F)F)OC(C1)=O)=O
BD00818748
95%
MFCD26142776
2,4-DIFLUOROPHENYLSULFONYLETHANOL
CAS:688763-15-7
Formula: OCCS(=O)(C1=CC=C(F)C=C1F)=O
BD324066
95+%
MFCD03789227
2,4-DIFLUOROPHENYLTHIOETHANOL
CAS:688762-79-0
Formula: OCCSC1=CC=C(F)C=C1F
BD324061
95+%
MFCD03789207
2,4-DIFLUOROPYRIDIN-3(4H)-IMINE
CAS:1211528-95-8
Formula: N=C1C(F)=NC=CC1F
BD586228
97%
MFCD16606148
2,4-DIFLUOROPYRIDINE
CAS:34941-90-7
Formula: FC1=CC(F)=NC=C1
BD41622
98%
MFCD04114162
2,4-DIFLUOROTHIOPHENOL
CAS:1996-44-7
Formula: SC1=CC=C(F)C=C1F
BD32511
97%
MFCD00203477
2,4-DIHYDRO-2,6-NAPHTHYRIDINE-1,3-DIONE
CAS:2232-79-3
Formula: O=C1CC2=C(C=CN=C2)C(=O)N1
BD00848425
95%
MFCD20729100
2,4-DIHYDRO-5-(4-FLUOROPHENYL)-2-PHENYL-3H-PYRAZOL-3-ONE
CAS:575455-54-8
Formula: O=C1N(C2=CC=CC=C2)N=C(C3=CC=C(F)C=C3)C1
BD163305
95+%
MFCD09749464
2,4-DIHYDRO-5-(4-METHOXYPHENYL)-2-PHENYL-3H-PYRAZOL-3-ONE
CAS:454439-84-0
Formula: O=C1N(C2=CC=CC=C2)N=C(C3=CC=C(OC)C=C3)C1
BD163281
95+%
MFCD07809087
2,4-DIHYDROCHROMENO[4,3-C]PYRAZOLE
CAS:74618-03-4
Formula: C12=NNC=C1COC3=C2C=CC=C3
BD200276
95+%
MFCD05256136
2,4-DIHYDROCHROMENO[4,3-C]PYRAZOLE-3-CARBOXYLIC ACID
CAS:909091-78-7
Formula: O=C(C1=C(COC2=C3C=CC=C2)C3=NN1)O
BD316082
95+%
MFCD27982009
2,4-DIHYDROSPIRO[1,5-BENZODIOXEPINE-3,1'-CYCLOPROPANE]-6-BORONIC ACID
CAS:2096335-53-2
Formula: OB(C1=C2OCC3(COC2=CC=C1)CC3)O
BD00935872
98%
MFCD20441817
2,4-DIHYDROXY-3,3-DIMETHYLBUTANAMIDE
CAS:4417-86-1
Formula: O=C(N)C(O)C(C)(C)CO
BD66916
95+%
MFCD00825730
2,4-DIHYDROXY-3,6-DIMETHYLBENZOIC ACID
CAS:4707-46-4
Formula: CC1=CC(O)=C(C)C(O)=C1C(O)=O
BD66917
95+%
MFCD00239340
2,4-DIHYDROXY-3-METHOXYBENZALDEHYDE
CAS:58922-29-5
Formula: O=CC1=CC=C(O)C(OC)=C1O
BD626366
97%
MFCD19301266
2,4-DIHYDROXY-3-METHYLBENZALDEHYDE
CAS:6248-20-0
Formula: C1=CC(=C(C(=C1C=O)O)C)O
BD21858
98%
MFCD00156883
2,4-DIHYDROXY-3-METHYLBENZOHYDRAZIDE
CAS:1142211-15-1
Formula: O=C(NN)C1=CC=C(O)C(C)=C1O
BD177224
95+%
MFCD12028428
2,4-DIHYDROXY-3-NITROPYRIDINE
CAS:89282-12-2
Formula: OC1=NC=CC(=C1[N+](=O)[O-])O
BD66923
98%
MFCD01075671
2,4-DIHYDROXY-5,6,7,8-TETRAHYDROQUINAZOLINE-6-CARBOXYLIC ACID
CAS:5439-88-3
Formula: O=C(C1CC2=C(O)N=C(O)N=C2CC1)O
BD335741
95+%
MFCD23378423
2,4-DIHYDROXY-5,6-DIMETHYLPYRIMIDINE
CAS:26305-13-5
Formula: CC1=C(NC(=O)NC1=O)C
BD101766
97%
MFCD00010708
2,4-DIHYDROXY-5-IODOBENZALDEHYDE
CAS:131088-03-4
Formula: O=CC1=CC(I)=C(O)C=C1O
BD265339
95+%
2,4-DIHYDROXY-5-IODOBENZOIC ACID
CAS:1121-90-0
Formula: O=C(O)C1=CC(I)=C(O)C=C1O
BD292509
95+%
MFCD00707810
2,4-DIHYDROXY-5-ISOPROPYLBENZOIC ACID
CAS:1184181-48-3
Formula: O=C(O)C1=CC(C(C)C)=C(O)C=C1O
BD304287
97%
MFCD16996083
2,4-DIHYDROXY-5-METHOXYBENZALDEHYDE
CAS:51061-83-7
Formula: O=CC1=CC(OC)=C(O)C=C1O
BD267132
95+%
MFCD07626333
2,4-DIHYDROXY-5-METHOXYPYRIMIDINE
CAS:6623-81-0
Formula: COC1=CNC(=O)NC1=O
BD2750
96%
MFCD00187903
2,4-DIHYDROXY-5-METHYLBENZALDEHYDE
CAS:39828-37-0
Formula: O=CC1=CC(C)=C(O)C=C1O
BD691876
95%
MFCD24673936
2,4-DIHYDROXY-5-NITROBENZALDEHYDE
CAS:53844-98-7
Formula: O=CC1=CC([N+]([O-])=O)=C(O)C=C1O
BD66931
97%
MFCD06009697
2,4-DIHYDROXY-5-NITROBENZOIC ACID
CAS:13722-96-8
Formula: O=C(O)C1=CC([N+]([O-])=O)=C(O)C=C1O
BD233869
95+%
MFCD08693128
2,4-DIHYDROXY-6-METHOXYQUINOLINE
CAS:14300-45-9
Formula: OC2=NC1=CC=C(C=C1C(=C2)O)OC
BD31915
97%
MFCD01463812
2,4-DIHYDROXY-6-METHYLBENZALDEHYDE
CAS:487-69-4
Formula: O=CC1=C(C)C=C(O)C=C1O
BD227235
98%
MFCD00033852
2,4-DIHYDROXY-6-METHYLNICOTINAMIDE
CAS:68373-65-9
Formula: O=C(N)C1=C(O)N=C(C)C=C1O
BD248716
95+%
2,4-DIHYDROXY-6-METHYLNICOTINIC ACID
CAS:846557-80-0
Formula: O=C(O)C1=C(O)N=C(C)C=C1O
BD66938
96%
MFCD06657553
2,4-DIHYDROXY-6-METHYLNICOTINONITRILE
CAS:67643-17-8
Formula: N#CC1=C(O)N=C(C)C=C1O
BD335015
95%
MFCD11847535
2,4-DIHYDROXY-6-METHYLPYRIMIDINE-5-CARBOXYLIC ACID
CAS:51622-67-4
Formula: O=C(C1=C(C)N=C(O)N=C1O)O
BD284687
95+%
MFCD18449364
2,4-DIHYDROXY-6-TRIFLUOROMETHYLPYRIMIDINE
CAS:672-45-7
Formula: O=C1NC(=CC(=O)N1)C(F)(F)F
BD2556
95+%
MFCD01011762
2,4-DIHYDROXY-7-METHYLQUINOLINE-3-CARBOXYLIC ACID
CAS:N/A
Formula: O=C(O)C1C(O)=NC2C(=CC=C(C=2)C)C=1O
BD00761366
95%
2,4-DIHYDROXY-N-(2-HYDROXYETHYL)BENZAMIDE
CAS:24207-41-8
Formula: O=C(NCCO)C1=CC=C(O)C=C1O
BD6856
95+%
MFCD00002835
2,4-DIHYDROXYACETOPHENONE
CAS:89-84-9
Formula: CC(C1=CC=C(O)C=C1O)=O
BD40444
98%
MFCD00002279
2,4-DIHYDROXYBENZALDEHYDE
CAS:95-01-2
Formula: O=CC1=CC=C(O)C=C1O
BD35500
98%
MFCD00011686
2,4-DIHYDROXYBENZALDEHYDE OXIME
CAS:5399-68-8
Formula: OC1=CC=C(C(O)=C1)/C=N/O
BD66945
97%
MFCD00016410
2,4-DIHYDROXYBENZAMIDE
CAS:3147-45-3
Formula: NC(=O)C1=C(O)C=C(O)C=C1
BD7921
98%
MFCD00064913
2,4-DIHYDROXYBENZOHYDRAZIDE
CAS:13221-86-8
Formula: O=C(NN)C1=CC=C(O)C=C1O
BD66948
95%
MFCD00017053
2,4-DIHYDROXYBENZOIC ACID
CAS:89-86-1
Formula: O=C(O)C1=CC=C(O)C=C1O
BD23045
98%
MFCD00002451
2,4-DIHYDROXYBENZONITRILE
CAS:64419-24-5
Formula: N#CC1=CC=C(O)C=C1O
BD10392
98%
MFCD02261931
2,4-DIHYDROXYBUTANOIC ACID
CAS:1518-62-3
Formula: O=C(O)C(O)CCO
BD224160
95+%
2,4-DIHYDROXYISOPHTHALALDEHYDE
CAS:3328-71-0
Formula: O=CC1=CC=C(O)C(C=O)=C1O
BD66947
95+%
MFCD09032324
2,4-DIHYDROXYPROPIOPHENONE
CAS:5792-36-9
Formula: CCC(C1=CC=C(O)C=C1O)=O
BD66960
97+%
MFCD00002280
2,4-DIHYDROXYPYRIDO[2,3-D]PYRIMIDINE
CAS:N/A
Formula: OC1=C(C=CC=N2)C2=NC(O)=N1
BD36824
2,4-DIHYDROXYPYRIDO[3,2-D]PYRIMIDINE
CAS:37538-68-4
Formula: OC1=NC2=C(N=CC=C2)C(O)=N1
BD162889
98%
MFCD18070985
2,4-DIHYDROXYPYRIMIDINE-5-CARBOXYLIC ACID
CAS:23945-44-0
Formula: O=C(C1=CN=C(O)N=C1O)O
BD19584
98%
MFCD00075737
2,4-DIHYDROXYPYRIMIDINE-5-CARBOXYLIC ACID
CAS:23945-44-0
Formula: O=C(C1=CN=C(O)N=C1O)O
BD156181
97+%
MFCD00075737
2,4-DIHYDROXYQUINAZOLINE-5-CARBONITRILE
CAS:1823958-91-3
Formula: N#CC1=CC=CC2=NC(O)=NC(O)=C12
BD260168
95+%
MFCD27922742
2,4-DIHYDROXYQUINAZOLINE-6-CARBONITRILE
CAS:1334331-27-9
Formula: N#CC1=CC2=C(O)N=C(O)N=C2C=C1
BD260506
95+%
2,4-DIHYDROXYQUINAZOLINE-7-CARBOXYLIC ACID
CAS:864293-00-5
Formula: O=C(C1=CC2=NC(O)=NC(O)=C2C=C1)O
BD167394
95+%
MFCD11868316
2,4-DIHYDROXYQUINOLINE-3-CARBALDEHYDE
CAS:529-89-5
Formula: O=CC1=C(O)C2=CC=CC=C2N=C1O
BD66918
97%
2,4-DIIODO-1-METHYL-1H-IMIDAZOLE
CAS:71794-53-1
Formula: CN1C=C(I)N=C1I
BD269512
96%
2,4-DIIODO-1H-IMIDAZOLE
CAS:19198-80-2
Formula: IC1=CNC(I)=N1
BD66965
95+%
MFCD09800593
2,4-DIIODO-3-METHYLANILINE
CAS:860751-94-6
Formula: NC1=CC=C(I)C(C)=C1I
BD281774
95+%
2,4-DIIODO-5-METHOXYANILINE
CAS:117832-18-5
Formula: NC1=CC(OC)=C(I)C=C1I
BD296236
95+%
MFCD13186706
2,4-DIIODO-5-METHYLANILINE
CAS:117832-10-7
Formula: NC1=CC(C)=C(I)C=C1I
BD281773
95+%
2,4-DIIODO-6-([METHYL(1-METHYLPIPERIDIN-4-YL)AMINO]METHYL)PHENOL
CAS:415932-24-0
Formula: CN(C1CCN(CC1)C)CC2=CC(I)=CC(I)=C2O
BD00809093
95%
MFCD01653255
2,4-DIIODO-6-METHYLANILINE
CAS:117832-09-4
Formula: NC1=C(C)C=C(I)C=C1I
BD66966
95+%
MFCD09033135
2,4-DIIODO-6-METHYLNICOTINONITRILE
CAS:1823894-28-5
Formula: N#CC1=C(I)N=C(C)C=C1I
BD279637
95+%
2,4-DIIODO-6-NITROANILINE
CAS:116529-49-8
Formula: NC1=C([N+]([O-])=O)C=C(I)C=C1I
BD01056346
97%
MFCD03931845
2,4-DIIODOANILINE
CAS:533-70-0
Formula: NC1=CC=C(I)C=C1I
BD33985
95+%
MFCD01851096
2,4-DIIODONICOTINONITRILE
CAS:827616-54-6
Formula: N#CC1=C(I)N=CC=C1I
BD66969
95+%
MFCD09037454
2,4-DIIODOOXAZOLE
CAS:1037597-73-1
Formula: IC1=COC(I)=N1
BD225793
97%
MFCD18785731
2,4-DIIODOPHENOL
CAS:2012-29-5
Formula: OC1=CC=C(I)C=C1I
BD00861046
95%
MFCD01707535
2,4-DIIODOPYRIDIN-3-OL
CAS:750638-97-2
Formula: OC1=C(I)C=CN=C1I
BD248539
95+%
2,4-DIIODOPYRIDINE
CAS:83674-71-9
Formula: IC1=CC(I)=NC=C1
BD66968
95+%
MFCD07437917
2,4-DIIODOPYRIMIDINE
CAS:262353-34-4
Formula: IC1=NC=CC(=N1)I
BD159560
95+%
MFCD09743716
2,4-DIISOPROPYLBENZENE-1,3-DIAMINE
CAS:133681-71-7
Formula: NC1=CC=C(C(C)C)C(N)=C1C(C)C
BD233318
95+%
MFCD20701825
2,4-DIISOPROPYLDIBENZO[B,D]FURAN-3-AMINE
CAS:1332881-95-4
Formula: NC1=C(C(C)C)C=C2C(OC3=CC=CC=C23)=C1C(C)C
BD262615
95+%
2,4-DIISOPROPYLPHENOL
CAS:2934-05-6
Formula: OC1=CC=C(C(C)C)C=C1C(C)C
BD66971
95+%
MFCD01707536
2,4-DIMETHANESULFONYLBENZONITRILE
CAS:1951441-77-2
Formula: N#CC1=CC=C(S(=O)(C)=O)C=C1S(=O)(C)=O
BD00799975
95%
2,4-DIMETHOXY-1,3,5-TRIAZINE
CAS:1898-72-2
Formula: COC1=NC=NC(OC)=N1
BD582437
97%
MFCD20257908
2,4-DIMETHOXY-1-(2-NITROVINYL)BENZENE
CAS:1891-10-7
Formula: O=[N+](/C=C/C1=CC=C(OC)C=C1OC)[O-]
BD0115
95+%
MFCD00015922
2,4-DIMETHOXY-1-FLUOROBENZENE
CAS:17715-70-7
Formula: FC1=CC=C(OC)C=C1OC
BD66973
99%
MFCD00042265
2,4-DIMETHOXY-1-METHYLBENZENE
CAS:38064-90-3
Formula: CC1=CC=C(OC)C=C1OC
BD67024
97%
MFCD00010749
2,4-DIMETHOXY-1-NAPHTHALDEHYDE
CAS:75965-84-3
Formula: O=CC1=C2C=CC=CC2=C(OC)C=C1OC
BD571483
97%
MFCD30185873
2,4-DIMETHOXY-1-NITROBENZENE
CAS:4920-84-7
Formula: COC1=CC(OC)=C(C=C1)[N+]([O-])=O
BD66974
98%
MFCD00024210
2,4-DIMETHOXY-3-METHYL-5-NITROANILINE
CAS:704877-30-5
Formula: NC1=CC([N+]([O-])=O)=C(OC)C(C)=C1OC
BD177225
97%
MFCD05858391
2,4-DIMETHOXY-3-METHYLBENZALDEHYDE
CAS:7149-92-0
Formula: O=CC1=CC=C(OC)C(C)=C1OC
BD12038
97%
MFCD00011489
2,4-DIMETHOXY-3-METHYLBENZOIC ACID
CAS:81574-49-4
Formula: COC1=C(C(OC)=C(C(O)=O)C=C1)C
BD00844422
95%
MFCD06203276
2,4-DIMETHOXY-3-OXO-N-PHENYLBUTANAMIDE
CAS:16715-79-0
Formula: O=C(NC1=CC=CC=C1)C(OC)C(COC)=O
BD66989
95%
MFCD00043929
2,4-DIMETHOXY-5,6-DIMETHYLPYRIMIDINE
CAS:120129-83-1
Formula: COC1=NC(OC)=C(C)C(C)=N1
BD232674
95+%
MFCD22987595
2,4-DIMETHOXY-5-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PYRIDINE
CAS:2223053-94-7
Formula: CC1(C)C(C)(C)OB(C2=CN=C(OC)C=C2OC)O1
BD00820921
97%
n/a
2,4-DIMETHOXY-5-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PYRIMIDINE
CAS:936250-17-8
Formula: CC1(C)C(C)(C)OB(C2=CN=C(OC)N=C2OC)O1
BD66982
96%
MFCD06795654
2,4-DIMETHOXY-5-METHYLPYRIDINE
CAS:1227574-94-8
Formula: CC1=CN=C(OC)C=C1OC
BD472509
97%
MFCD16610897
2,4-DIMETHOXY-5-NITROBENZOIC ACID
CAS:90564-41-3
Formula: O=C(O)C1=CC([N+]([O-])=O)=C(OC)C=C1OC
BD262474
98%
MFCD12173036
2,4-DIMETHOXY-5-NITROPYRIDINE
CAS:607373-84-2
Formula: O=[N+](C1=CN=C(OC)C=C1OC)[O-]
BD220993
97%
MFCD09907962
2,4-DIMETHOXY-5-NITROPYRIMIDINE
CAS:30561-07-0
Formula: O=[N+](C1=CN=C(OC)N=C1OC)[O-]
BD517154
97%
MFCD00726922
2,4-DIMETHOXY-5-PHENYLPYRIMIDINE
CAS:685866-81-3
Formula: COC1=NC(OC)=NC=C1C2=CC=CC=C2
BD583200
98%
MFCD18074208
2,4-DIMETHOXY-5H-PYRROLO[3,2-D]PYRIMIDINE
CAS:84538-40-9
Formula: COC1=NC2=C(NC=C2)C(OC)=N1
BD218317
98%
MFCD12406107
2,4-DIMETHOXY-6-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)BENZALDEHYDE
CAS:1265360-45-9
Formula: O=CC1=C(B2OC(C)(C)C(C)(C)O2)C=C(OC)C=C1OC
BD239700
98%
MFCD22192538
2,4-DIMETHOXY-6-(PIPERAZIN-1-YL)PYRIMIDINE
CAS:38539-75-2
Formula: COC1=NC(OC)=NC(N2CCNCC2)=C1
BD625108
97%
2,4-DIMETHOXY-6-(TRIFLUOROMETHYL)PYRIDINE
CAS:1227588-22-8
Formula: FC(C1=CC(OC)=CC(OC)=N1)(F)F
BD480186
97%
MFCD16610905
2,4-DIMETHOXY-6-(TRIFLUOROMETHYL)PYRIMIDINE
CAS:76513-87-6
Formula: FC(C1=CC(OC)=NC(OC)=N1)(F)F
BD260009
95+%
2,4-DIMETHOXY-6-METHYL-5-NITROPYRIMIDINE
CAS:30561-09-2
Formula: O=[N+]([O-])C1C(OC)=NC(OC)=NC=1C
BD00702549
95+%
n/a
2,4-DIMETHOXY-6-METHYLBENZALDEHYDE
CAS:7149-90-8
Formula: O=CC1=C(C)C=C(OC)C=C1OC
BD12039
97%
MFCD00033851
2,4-DIMETHOXY-6-METHYLNICOTINONITRILE
CAS:1450662-05-1
Formula: N#CC1=C(OC)N=C(C)C=C1OC
BD442995
97%
MFCD28359302
2,4-DIMETHOXY-6-METHYLPYRIDINE
CAS:40334-96-1
Formula: CC1=CC(OC)=CC(OC)=N1
BD452938
97%
MFCD16610898
2,4-DIMETHOXY-6-METHYLPYRIMIDIN-5-AMINE
CAS:84538-45-4
Formula: NC1C(OC)=NC(OC)=NC=1C
BD00773233
95+%
n/a
2,4-DIMETHOXY-6-METHYLPYRIMIDINE
CAS:7781-23-9
Formula: CC1=CC(OC)=NC(OC)=N1
BD247735
98%
MFCD00458122
2,4-DIMETHOXY-6-METHYLPYRIMIDINE-5-CARBOXYLIC ACID
CAS:106852-32-8
Formula: O=C(C1=C(C)N=C(OC)N=C1OC)O
BD284689
95+%
MFCD20644919
2,4-DIMETHOXY-7-METHYLQUINOLINE
CAS:406205-07-0
Formula: CC1C=C2C(C(=CC(=N2)OC)OC)=CC=1
BD00746635
95+%
n/a
2,4-DIMETHOXY-7H-PYRROLO[2,3-D]PYRIMIDINE
CAS:90057-09-3
Formula: COC1=C2C(NC=C2)=NC(OC)=N1
BD218318
95+%
2,4-DIMETHOXY-D-HOMOPHENYLALANINE
CAS:1260592-42-4
Formula: N[C@H](CCC1=CC=C(OC)C=C1OC)C(O)=O
BD00788802
95%
2,4-DIMETHOXY-L-HOMOPHENYLALANINE
CAS:1260588-05-3
Formula: N[C@@H](CCC1=CC=C(OC)C=C1OC)C(O)=O
BD00817693
95%
2,4-DIMETHOXYANILINE
CAS:2735-04-8
Formula: NC1=CC=C(OC)C=C1OC
BD66991
98%
MFCD00008371
2,4-DIMETHOXYBENZALDEHYDE
CAS:613-45-6
Formula: O=CC1=CC=C(OC)C=C1OC
BD21781
98%
MFCD00003311
2,4-DIMETHOXYBENZALDEHYDE OXIME
CAS:31874-34-7
Formula: O/N=C/C1=CC=C(OC)C=C1OC
BD66993
95%
MFCD00082783
2,4-DIMETHOXYBENZENE-1-SULFONYL CHLORIDE
CAS:63624-28-2
Formula: COC1=CC(OC)=C(C=C1)S(Cl)(=O)=O
BD66997
90%
MFCD00060683
2,4-DIMETHOXYBENZENESULFONAMIDE
CAS:51770-71-9
Formula: O=S(C1=CC=C(OC)C=C1OC)(N)=O
BD66996
96%
MFCD06147001
2,4-DIMETHOXYBENZENESULFONOHYDRAZIDE
CAS:73737-06-1
Formula: O=S(C1=CC=C(OC)C=C1OC)(NN)=O
BD177226
97%
MFCD03423367
2,4-DIMETHOXYBENZIMIDAMIDE
CAS:32048-19-4
Formula: N=C(N)C1=CC=C(OC)C=C1OC
BD66994
95+%
MFCD05663022
2,4-DIMETHOXYBENZIMIDAMIDE HYDROCHLORIDE
CAS:131947-81-4
Formula: N=C(N)C1=CC=C(OC)C=C1OC.[H]Cl
BD66995
98%
MFCD04114426
2,4-DIMETHOXYBENZOHYDRAZIDE
CAS:103956-10-1
Formula: O=C(NN)C1=CC=C(OC)C=C1OC
BD275167
95+%
MFCD01001348
2,4-DIMETHOXYBENZOIC ACID
CAS:91-52-1
Formula: C1=C(OC)C=CC(=C1OC)C(O)=O
BD6714
97%
MFCD00002434
2,4-DIMETHOXYBENZOIC ACID ETHYL ESTER
CAS:81722-07-8
Formula: CCOC(C1=CC=C(C=C1OC)OC)=O
BD00955195
95%
MFCD02149437
2,4-DIMETHOXYBENZONITRILE
CAS:4107-65-7
Formula: COC1=CC(OC)=C(C=C1)C#N
BD7784
98%
MFCD00001786
2,4-DIMETHOXYBENZOTHIOAMIDE
CAS:23822-07-3
Formula: S=C(N)C1=CC=C(OC)C=C1OC
BD11295
95+%
MFCD04973328
2,4-DIMETHOXYBENZOYL CHLORIDE
CAS:39828-35-8
Formula: O=C(Cl)C1=CC=C(OC)C=C1OC
BD33549
97+%
MFCD00017527
2,4-DIMETHOXYIODOBENZENE
CAS:20469-63-0
Formula: COC1=CC(OC)=C(I)C=C1
BD32585
98%
MFCD00059268
2,4-DIMETHOXYPHENETHYL ETHYL OXALATE
CAS:1443353-34-1
Formula: O=C(OCCC1=CC=C(OC)C=C1OC)C(OCC)=O
BD510405
97%
MFCD15145521
2,4-DIMETHOXYPHENOL
CAS:13330-65-9
Formula: COC1=C(C=CC(=C1)OC)O
BD67011
97%
MFCD00060637
2,4-DIMETHOXYPHENYLACETIC ACID
CAS:6496-89-5
Formula: O=C(O)CC1=CC=C(OC)C=C1OC
BD12061
94%
MFCD00183328
2,4-DIMETHOXYPHENYLBORONIC ACID
CAS:133730-34-4
Formula: OB(C1=CC=C(OC)C=C1OC)O
BD5277
98%
MFCD01074590
2,4-DIMETHOXYPHENYLISOCYANATE
CAS:84370-87-6
Formula: COC1=CC=C(N=C=O)C(OC)=C1
BD67012
95%
MFCD00002005
2,4-DIMETHOXYPHENYLISOCYANIDE
CAS:1984-21-0
Formula: COC1=CC(OC)=C([N+]#[C-])C=C1
BD00817700
95%
MFCD04117585
2,4-DIMETHOXYPHENYLISOTHIOCYANATE
CAS:33904-03-9
Formula: COC1=CC=C(N=C=S)C(OC)=C1
BD7791
MFCD00041058
2,4-DIMETHOXYPYRIDIN-3-AMINE
CAS:217096-31-6
Formula: NC1=C(OC)C=CN=C1OC
BD330900
95+%
MFCD18255875
2,4-DIMETHOXYPYRIDINE
CAS:18677-43-5
Formula: COC1=CC(OC)=NC=C1
BD27883
98%
MFCD01646187
2,4-DIMETHOXYPYRIMIDIN-5-AMINE
CAS:14048-15-8
Formula: NC1=CN=C(OC)N=C1OC
BD262574
95+%
MFCD12546337
2,4-DIMETHOXYPYRIMIDINE
CAS:3551-55-1
Formula: C1=NC(=NC(=C1)OC)OC
BD3698
97%
MFCD00056028
2,4-DIMETHOXYPYRIMIDINE-5-BORONIC ACID
CAS:89641-18-9
Formula: COC1=NC(OC)=C(C=N1)B(O)O
BD3728
97%
MFCD01318985
2,4-DIMETHOXYPYRIMIDINE-5-CARBALDEHYDE
CAS:52606-02-7
Formula: O=CC1=CN=C(OC)N=C1OC
BD104119
97%
MFCD00132992
2,4-DIMETHOXYPYRIMIDINE-5-CARBONITRILE
CAS:14445-57-9
Formula: N#CC1=CN=C(OC)N=C1OC
BD326643
97%
MFCD24448829
2,4-DIMETHOXYPYRIMIDINE-5-CARBOXYLIC ACID
CAS:110821-07-3
Formula: O=C(C1=CN=C(OC)N=C1OC)O
BD211290
95+%
MFCD03232921
2,4-DIMETHOXYQUINAZOLINE-6-CARBONITRILE
CAS:1823776-39-1
Formula: N#CC1=CC2=C(OC)N=C(OC)N=C2C=C1
BD272304
95+%
2,4-DIMETHOXYQUINOLINE
CAS:40335-00-0
Formula: COC1=CC(OC)=NC2=CC=CC=C12
BD328548
95+%
MFCD27950422
2,4-DIMETHOXYQUINOLINE-3-CARBALDEHYDE
CAS:51179-18-1
Formula: O=CC1=C(OC)C2=CC=CC=C2N=C1OC
BD328584
95+%
MFCD25964010
2,4-DIMETHOXYTHIOPHENOL
CAS:18906-37-1
Formula: SC1=CC=C(OC)C=C1OC
BD183339
97%
MFCD04973436
2,4-DIMETHYL (2R,4R)-1-BENZYLAZETIDINE-2,4-DICARBOXYLATE
CAS:1807933-83-0
Formula: O=C([C@@H]1N(CC2=CC=CC=C2)[C@@H](C(OC)=O)C1)OC
BD00768919
MFCD28063993
2,4-DIMETHYL 1-BENZYLAZETIDINE-2,4-DICARBOXYLATE
CAS:186752-06-7
Formula: O=C(C1N(CC2=CC=CC=C2)C(C(OC)=O)C1)OC
BD00779396
MFCD30180301
2,4-DIMETHYL(1,3-DIOXOLAN-2-YLMETHYL)BENZENE
CAS:898759-33-6
Formula: CC1=CC=C(CC2OCCO2)C(C)=C1
BD310655
95+%
MFCD04117664
2,4-DIMETHYL-[1,1'-BIPHENYL]-3-AMINE
CAS:83011-75-0
Formula: NC1=C(C)C(C2=CC=CC=C2)=CC=C1C
BD318424
95+%
n/a
2,4-DIMETHYL-1,2,3,4-TETRAHYDROISOQUINOLINE
CAS:20666-00-6
Formula: CC1CN(C)CC2=C1C=CC=C2
BD764268
97%
2,4-DIMETHYL-1,2,3,4-TETRAHYDROQUINOLINE
CAS:19343-79-4
Formula: CC1CC(C)NC2=C1C=CC=C2
BD270444
95+%
MFCD18448809
2,4-DIMETHYL-1,3-DIOXANE
CAS:766-20-1
Formula: CC1OC(C)OCC1
BD67028
MFCD00023821
2,4-DIMETHYL-1,3-THIAZOLE-5-SULFONYLCHLORIDE
CAS:80466-80-4
Formula: O=S(C1=C(C)N=C(C)S1)(Cl)=O
BD9590
97%
MFCD00052746
2,4-DIMETHYL-1-(METHYLSULFONYL)BENZENE
CAS:6462-28-8
Formula: O=S(C1=CC=C(C)C=C1C)(C)=O
BD215983
95+%
MFCD03789175
2,4-DIMETHYL-1-(SULFINYLAMINO)BENZENE
CAS:56911-12-7
Formula: CC1=CC=C(C(C)=C1)N=S=O
BD00836450
95%
MFCD26792665
2,4-DIMETHYL-1-(TRIMETHOXYMETHYL)BENZENE
CAS:133473-80-0
Formula: COC(C1=CC=C(C)C=C1C)(OC)OC
BD269390
95+%
2,4-DIMETHYL-1-HEPTENE
CAS:19549-87-2
Formula: C=C(C)CC(C)CCC
BD67033
MFCD00059250
2,4-DIMETHYL-1-HEXENE
CAS:16746-87-5
Formula: C=C(C)CC(C)CC
BD67034
MFCD00048655
2,4-DIMETHYL-1-PENTENE
CAS:2213-32-3
Formula: C=C(C)CC(C)C
BD67039
95%
MFCD00039854
2,4-DIMETHYL-1-VINYLBENZENE
CAS:2234-20-0
Formula: C=CC1=CC=C(C)C=C1C
BD67136
97% (stabilized with TBC)
MFCD00014937
2,4-DIMETHYL-1H-IMIDAZOL-5-AMINE
CAS:27802-66-0
Formula: NC1=C(C)N=C(C)N1
BD587549
97%
MFCD18800973
2,4-DIMETHYL-1H-IMIDAZOL-5-AMINE HYDROCHLORIDE
CAS:50774-58-8
Formula: NC1=C(C)N=C(C)N1.[H]Cl
BD587751
97%
2,4-DIMETHYL-1H-IMIDAZOLE-5-CARBALDEHYDE
CAS:68282-52-0
Formula: CC1=NC(C)=C(N1)C=O
BD237074
95+%
MFCD19300742
2,4-DIMETHYL-1H-IMIDAZOLE-5-CARBOXYLIC ACID
CAS:84255-24-3
Formula: O=C(C1=C(C)N=C(C)N1)O
BD285485
95+%
MFCD08668292
2,4-DIMETHYL-1H-INDOLE
CAS:10299-61-3
Formula: CC1=CC=CC2=C1C=C(C)N2
BD263176
96%
MFCD09701270
2,4-DIMETHYL-1H-PYRROLE
CAS:625-82-1
Formula: CC1=CNC(C)=C1
BD41881
97%
MFCD00192088
2,4-DIMETHYL-1H-PYRROLE-3-CARBONITRILE
CAS:26187-28-0
Formula: N#CC1=C(C)NC=C1C
BD218796
95+%
MFCD12923811
2,4-DIMETHYL-1H-PYRROLO[2,3-B]PYRIDINE
CAS:1190313-73-5
Formula: CC1=CC=NC2=C1C=C(C)N2
BD333254
95+%
MFCD03425552
2,4-DIMETHYL-1H-PYRROLO[3,2-C]PYRIDINE
CAS:1190313-94-0
Formula: CC1=NC=CC2=C1C=C(C)N2
BD561449
97%
2,4-DIMETHYL-2'-METHOXYBENZOPHENONE
CAS:750633-50-2
Formula: O=C(C1=CC=CC=C1OC)C2=CC=C(C)C=C2C
BD309061
95+%
MFCD01311510
2,4-DIMETHYL-2'-MORPHOLINOMETHYL BENZOPHENONE
CAS:898750-47-5
Formula: O=C(C1=CC=CC=C1CN2CCOCC2)C3=CC=C(C)C=C3C
BD309949
95+%
MFCD03842424
2,4-DIMETHYL-2'-PIPERIDINOMETHYL BENZOPHENONE
CAS:898773-24-5
Formula: O=C(C1=CC=CC=C1CN2CCCCC2)C3=CC=C(C)C=C3C
BD311878
95+%
MFCD03842481
2,4-DIMETHYL-2'-PYRROLIDINOMETHYL BENZOPHENONE
CAS:898774-59-9
Formula: O=C(C1=CC=CC=C1CN2CCCC2)C3=CC=C(C)C=C3C
BD311962
95+%
MFCD03842538
2,4-DIMETHYL-2'-THIOMORPHOLINOMETHYL BENZOPHENONE
CAS:898781-84-5
Formula: O=C(C1=CC=CC=C1CN2CCSCC2)C3=CC=C(C)C=C3C
BD312649
95+%
MFCD03842765
2,4-DIMETHYL-2,3-DIHYDRO-1-BENZOFURAN-5-CARBOXYLIC ACID
CAS:898746-74-2
Formula: O=C(O)C1=CC=C2OC(CC2=C1C)C
BD00930544
95%
n/a
2,4-DIMETHYL-2,3-DIHYDROTHIENO[3,2-C]QUINOLINE-8-CARBOXYLIC ACID
CAS:364338-44-3
Formula: O=C(C1=CC=C2N=C(C)C(CC(C)S3)=C3C2=C1)O
BD554253
97%
MFCD01143285
2,4-DIMETHYL-2,4-PENTANEDIOL
CAS:24892-49-7
Formula: CC(O)(C)CC(O)(C)C
BD67040
MFCD00012306
2,4-DIMETHYL-2-PENTENE
CAS:625-65-0
Formula: CC(C)=CC(C)C
BD67043
95%
MFCD00026435
2,4-DIMETHYL-2H-1,2,3-TRIAZOLE
CAS:60166-44-1
Formula: CC1=NN(C)N=C1
BD256567
95+%
2,4-DIMETHYL-2H-BENZO[E][1,2,4]THIADIAZIN-3(4H)-ONE 1,1-DIOXIDE
CAS:13338-03-9
Formula: O=C(N(C)C1=CC=CC=C12)N(C)S2(=O)=O
BD331762
95+%
MFCD09878050
2,4-DIMETHYL-2H-PYRAZOLO[3,4-B]PYRIDIN-6(7H)-ONE
CAS:73810-75-0
Formula: O=C1C=C(C)C2=CN(C)N=C2N1
BD516419
97%
MFCD09834156
2,4-DIMETHYL-3'-(1,3-DIOXOLAN-2-YL)BENZOPHENONE
CAS:898779-33-4
Formula: O=C(C1=CC=CC(C2OCCO2)=C1)C3=CC=C(C)C=C3C
BD312408
95+%
MFCD07699967
2,4-DIMETHYL-3'-METHOXYBENZOPHENONE
CAS:750633-70-6
Formula: O=C(C1=CC=CC(OC)=C1)C2=CC=C(C)C=C2C
BD309079
95+%
MFCD01311542
2,4-DIMETHYL-3'-MORPHOLINOMETHYL BENZOPHENONE
CAS:898765-56-5
Formula: O=C(C1=CC=CC(CN2CCOCC2)=C1)C3=CC=C(C)C=C3C
BD311189
95+%
MFCD03841915
2,4-DIMETHYL-3'-PIPERIDINOMETHYL BENZOPHENONE
CAS:898793-11-8
Formula: O=C(C1=CC=CC(CN2CCCCC2)=C1)C3=CC=C(C)C=C3C
BD313695
95+%
MFCD03841972
2,4-DIMETHYL-3'-PYRROLIDINOMETHYL BENZOPHENONE
CAS:898770-37-1
Formula: O=C(C1=CC=CC(CN2CCCC2)=C1)C3=CC=C(C)C=C3C
BD311649
95+%
MFCD03842029
2,4-DIMETHYL-3'-THIOMORPHOLINOMETHYL BENZOPHENONE
CAS:898763-13-8
Formula: O=C(C1=CC=CC(CN2CCSCC2)=C1)C3=CC=C(C)C=C3C
BD310947
95+%
MFCD03842254
2,4-DIMETHYL-3-(1H-TETRAZOL-1-YL)BENZENESULFONAMIDE
CAS:704875-75-2
Formula: O=S(C1=CC=C(C)C(N2N=NN=C2)=C1C)(N)=O
BD507457
97%
MFCD05857993
2,4-DIMETHYL-3-(2-OXOPYRROLIDIN-1-YL)BENZENE-1-SULFONYL CHLORIDE
CAS:331256-61-2
Formula: O=S(C1=CC=C(C)C(N2C(CCC2)=O)=C1C)(Cl)=O
BD318123
95+%
MFCD00440730
2,4-DIMETHYL-3-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PYRIDINE
CAS:1421252-89-2
Formula: CC1(C)C(C)(C)OB(C2=C(C)C=CN=C2C)O1
BD290349
95+%
MFCD18712537
2,4-DIMETHYL-3-CYCLOHEXENECARBOXALDEHYDE
CAS:68039-49-6
Formula: CC1=CC(C)C(C=O)CC1
BD67049
95%
MFCD00169841
2,4-DIMETHYL-3-ETHYL-1H-PYRROLE
CAS:517-22-6
Formula: CC1=CNC(C)=C1CC
BD5401
95%
MFCD00005222
2,4-DIMETHYL-3-NITROBENZOIC ACID
CAS:39053-47-9
Formula: O=C(O)C1=CC=C(C)C([N+]([O-])=O)=C1C
BD449860
95%
MFCD08693503
2,4-DIMETHYL-3-NITROBENZONITRILE
CAS:39053-46-8
Formula: N#CC1=CC=C(C)C([N+]([O-])=O)=C1C
BD449861
97%
MFCD08693500
2,4-DIMETHYL-3-NITROPYRIDINE
CAS:1074-76-6
Formula: CC1=NC=CC(C)=C1[N+]([O-])=O
BD67061
98%
MFCD08235269
2,4-DIMETHYL-3-OXO-3,4-DIHYDRO-2H-BENZO[B][1,4]OXAZINE-6-CARBOXYLIC ACID
CAS:1092352-74-3
Formula: O=C(C1=CC=C(C(N2C)=C1)OC(C)C2=O)O
BD201747
95+%
MFCD11553054
2,4-DIMETHYL-3-OXO-3,4-DIHYDRO-2H-BENZO[B][1,4]OXAZINE-7-CARBOXYLIC ACID
CAS:1092352-50-5
Formula: O=C(C1=CC=C(N2C)C(OC(C)C2=O)=C1)O
BD201630
95+%
MFCD11553039
2,4-DIMETHYL-4'-(1,3-DIOXOLAN-2-YL)BENZOPHENONE
CAS:898760-19-5
Formula: O=C(C1=CC=C(C2OCCO2)C=C1)C3=CC=C(C)C=C3C
BD310738
95+%
MFCD07700018
2,4-DIMETHYL-4'-METHOXYBENZOPHENONE
CAS:57800-66-5
Formula: O=C(C1=CC=C(OC)C=C1)C2=CC=C(C)C=C2C
BD308395
95+%
MFCD01311572
2,4-DIMETHYL-4'-MORPHOLINOMETHYL BENZOPHENONE
CAS:898770-05-3
Formula: O=C(C1=CC=C(CN2CCOCC2)C=C1)C3=CC=C(C)C=C3C
BD311617
95+%
MFCD03841403
2,4-DIMETHYL-4'-PIPERIDINOMETHYL BENZOPHENONE
CAS:898771-49-8
Formula: O=C(C1=CC=C(CN2CCCCC2)C=C1)C3=CC=C(C)C=C3C
BD311760
95+%
MFCD03841460
2,4-DIMETHYL-4'-PYRROLIDINOMETHYL BENZOPHENONE
CAS:898776-44-8
Formula: O=C(C1=CC=C(CN2CCCC2)C=C1)C3=CC=C(C)C=C3C
BD312140
95+%
MFCD03841517
2,4-DIMETHYL-4'-THIOMORPHOLINOMETHYL BENZOPHENONE
CAS:898782-73-5
Formula: O=C(C1=CC=C(CN2CCSCC2)C=C1)C3=CC=C(C)C=C3C
BD312718
95+%
MFCD03841744
2,4-DIMETHYL-4-(PYRIDIN-3-YL)-4,5-DIHYDRO-1H-IMIDAZOL-5-ONE
CAS:2085689-68-3
Formula: O=C1C(C2=CC=CN=C2)(C)N=C(C)N1
BD00908368
90%
MFCD30717709
2,4-DIMETHYL-4H-THIENO[3,2-B]PYRROLE-5-CARBOXYLIC ACID
CAS:903173-34-2
Formula: O=C(C1=CC2=C(C=C(C)S2)N1C)O
BD569525
97%
MFCD14796108
2,4-DIMETHYL-5,6,7,8-TETRAHYDROQUINAZOLINE
CAS:88268-23-9
Formula: CC1=C2CCCCC2=NC(C)=N1
BD748670
97%
MFCD18801046
2,4-DIMETHYL-5-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)-BENZENAMINE
CAS:1126367-54-1
Formula: CC1=CC(C)=C(B2OC(C)(C(C)(O2)C)C)C=C1N
BD00825583
95%
2,4-DIMETHYL-5-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PYRIDINE
CAS:1622217-32-6
Formula: CC1(C)C(C)(C)OB(C2=CN=C(C)C=C2C)O1
BD625947
97%
MFCD18719934
2,4-DIMETHYL-5-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)THIAZOLE
CAS:859833-13-9
Formula: CC1(C)C(C)(C)OB(C2=C(C)N=C(C)S2)O1
BD165401
96%
MFCD07783649
2,4-DIMETHYL-5-(METHYLSULFONYL)ANILINE
CAS:849035-63-8
Formula: NC1=CC(S(=O)(C)=O)=C(C)C=C1C
BD11381
95%
MFCD04037922
2,4-DIMETHYL-5-NITROANILINE
CAS:2124-47-2
Formula: NC1=CC([N+]([O-])=O)=C(C)C=C1C
BD67072
97%
MFCD00025199
2,4-DIMETHYL-5-NITROBENZOIC ACID
CAS:220504-75-6
Formula: O=C(O)C1=CC([N+]([O-])=O)=C(C)C=C1C
BD215982
98%
MFCD01463419
2,4-DIMETHYL-5-NITROBENZONITRILE
CAS:625112-44-9
Formula: N#CC1=CC([N+]([O-])=O)=C(C)C=C1C
BD455172
97%
MFCD16875749
2,4-DIMETHYL-5-NITROBENZOTRIFLUORIDE
CAS:261945-82-8
Formula: CC1=CC(C)=C(C=C1[N+]([O-])=O)C(F)(F)F
BD67073
95+%
MFCD01631630
2,4-DIMETHYL-5-NITROPHENOL
CAS:14969-00-7
Formula: OC1=CC([N+]([O-])=O)=C(C)C=C1C
BD330087
95+%
MFCD00667776
2,4-DIMETHYL-5-NITROPYRIDINE
CAS:1074-99-3
Formula: O=[N+](C1=CN=C(C)C=C1C)[O-]
BD92882
97%
MFCD05982051
2,4-DIMETHYL-5-VINYLTHIAZOLE
CAS:65505-18-2
Formula: C=CC1=C(C)N=C(C)S1
BD246245
95% mix TBC as stabilizer
MFCD00792504
2,4-DIMETHYL-6,7,8,9-TETRAHYDRO-5H-CYCLOHEPTA[D]PYRIMIDINE
CAS:138722-72-2
Formula: CC1=C(CCCCC2)C2=NC(C)=N1
BD748672
97%
MFCD30607253
2,4-DIMETHYL-6,7-DIHYDRO-5H-CYCLOPENTA[D]PYRIMIDINE
CAS:88268-24-0
Formula: CC1=C(CCC2)C2=NC(C)=N1
BD551167
97%
MFCD27957817
2,4-DIMETHYL-6-((2-METHYLALLYL)OXY)BENZALDEHYDE
CAS:1708169-96-3
Formula: O=CC1=C(OCC(C)=C)C=C(C)C=C1C
BD621936
97%
2,4-DIMETHYL-6-((3-METHYLCYCLOBUTYL)METHOXY)BENZALDEHYDE
CAS:1707393-26-7
Formula: O=CC1=C(OCC2CC(C)C2)C=C(C)C=C1C
BD620626
97%
2,4-DIMETHYL-6-((TETRAHYDROFURAN-2-YL)METHOXY)BENZALDEHYDE
CAS:1710853-45-4
Formula: O=CC1=C(OCC2OCCC2)C=C(C)C=C1C
BD623090
97%
2,4-DIMETHYL-6-(1H-PYRAZOL-3-YL)PHENOL
CAS:288401-54-7
Formula: OC1=C(C)C=C(C)C=C1C2=NNC=C2
BD0530
97%
MFCD03424540
2,4-DIMETHYL-6-(2-PIPERIDINYLMETHYL)PYRIDINE
CAS:526183-28-8
Formula: CC1=CC(C)=NC(CC2NCCCC2)=C1
BD327409
95+%
MFCD05190116
2,4-DIMETHYL-6-(2-PYRROLIDINYLMETHYL)PYRIDINE
CAS:524674-46-2
Formula: CC1=CC(C)=NC(CC2NCCC2)=C1
BD327406
95+%
MFCD05189306
2,4-DIMETHYL-6-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)ANILINE
CAS:2121514-04-1
Formula: CC1=CC(C)=C(N)C(B2OC(C)(C)C(C)(C)O2)=C1
BD00819363
97%
MFCD17215215
2,4-DIMETHYL-6-(PIPERAZIN-1-YL)PYRIMIDINE
CAS:887686-65-9
Formula: CC1=NC(C)=NC(N2CCNCC2)=C1
BD506561
97%
MFCD07365286
2,4-DIMETHYL-6-(TRIFLUOROMETHYL)PYRIDINE
CAS:749256-94-8
Formula: FC(C1=CC(C)=CC(C)=N1)(F)F
BD765567
97%
2,4-DIMETHYL-6-[(MORPHOLIN-4-YL)METHYL]PHENOL HYDROCHLORIDE
CAS:1052543-29-9
Formula: OC1=C(CN2CCOCC2)C=C(C)C=C1C.[H]Cl
BD00918548
90%
MFCD05974977
2,4-DIMETHYL-6-NITROANILINE
CAS:1635-84-3
Formula: NC1=C([N+]([O-])=O)C=C(C)C=C1C
BD5187
97%
MFCD00007739
2,4-DIMETHYL-6-NITROBENZOIC ACID
CAS:1379173-92-8
Formula: O=C(O)C1=C([N+]([O-])=O)C=C(C)C=C1C
BD460297
96%
MFCD09999741
2,4-DIMETHYL-6-NITROPHENOL
CAS:14452-34-7
Formula: OC1=C([N+]([O-])=O)C=C(C)C=C1C
BD6532
98%
MFCD00191633
2,4-DIMETHYL-6-PHENYLPYRIMIDINE
CAS:64571-30-8
Formula: CC1=NC(C)=NC(C2=CC=CC=C2)=C1
BD541869
97%
MFCD18449351
2,4-DIMETHYL-6-PROPOXYBENZALDEHYDE
CAS:1710301-86-2
Formula: O=CC1=C(OCCC)C=C(C)C=C1C
BD622748
97%
2,4-DIMETHYL-6-PROPOXYBENZONITRILE
CAS:1708037-50-6
Formula: N#CC1=C(OCCC)C=C(C)C=C1C
BD621765
97%
2,4-DIMETHYL-7,8,9,10-TETRAHYDROPYRIDO[4',3':3,4]PYRAZOLO[1,5-A]PYRIMIDINE
CAS:1706464-23-4
Formula: CC1=CC(C)=NC2=C3CNCCC3=NN12
BD620116
97%
2,4-DIMETHYL-7-(NAPHTHALEN-2-YL)PYRROLO[1,2-A]PYRIMIDINE-8-CARBONITRILE
CAS:338400-99-0
Formula: N#CC1=C2N=C(C)C=C(C)N2C=C1C3=CC=C4C=CC=CC4=C3
BD00876417
90%
MFCD00974202
2,4-DIMETHYL-8-HYDROXYQUINOLINE
CAS:115310-98-0
Formula: CC1=NC2=C(C=CC=C2O)C(C)=C1
BD41197
97%
MFCD09743812
2,4-DIMETHYL-N,N-DIPHENYLANILINE
CAS:1228-80-4
Formula: CC1=CC(C)=C(C=C1)N(C1=CC=CC=C1)C1=CC=CC=C1
BD67146
95+%
MFCD09030600
2,4-DIMETHYL-N-(O-TOLYL)ANILINE
CAS:155960-55-7
Formula: CC1=CC=CC=C1NC2=CC=C(C)C=C2C
BD01160690
95%
n/a
2,4-DIMETHYL-N-(PYRROLIDIN-2-YLMETHYL)ANILINE HYDROCHLORIDE
CAS:1177348-08-1
Formula: CC1=CC=C(NCC2NCCC2)C(C)=C1.[H]Cl
BD562605
97%
2,4-DIMETHYL-N-PHENYL-N-(P-TOLYL)ANILINE
CAS:1071935-18-6
Formula: CC1=CC=C(N(C2=CC=CC=C2)C3=CC=C(C)C=C3C)C=C1
BD247630
95+%
MFCD17015627
2,4-DIMETHYL-N-PHENYLANILINE
CAS:25078-04-0
Formula: CC1=CC=C(C(C)=C1)NC2=CC=CC=C2
BD67108
98%
MFCD08275461
2,4-DIMETHYL-PYRIMIDINE-5-CARBOXYLIC ACID
CAS:74356-36-8
Formula: CC1=NC(C)=C(C=N1)C(O)=O
BD34803
98%
MFCD07391755
2,4-DIMETHYLACETOPHENON
CAS:89-74-7
Formula: CC(=O)C1=C(C)C=C(C)C=C1
BD67085
95%
MFCD00003571
2,4-DIMETHYLANILINE HYDROCHLORIDE
CAS:21436-96-4
Formula: NC1=CC=C(C)C=C1C.[H]Cl
BD5291
98%
MFCD00060209
2,4-DIMETHYLANISOLE
CAS:6738-23-4
Formula: CC1=CC=C(OC)C(C)=C1
BD34578
98+%
MFCD00008377
2,4-DIMETHYLAZETIDINE
CAS:1314908-41-2
Formula: CC1CC(C)N1
BD00800736
97+%
MFCD19226351
2,4-DIMETHYLAZETIDINE HYDROCHLORIDE
CAS:1803606-22-5
Formula: CC1CC(C)N1.[H]Cl
BD00755362
97%
MFCD28063959
2,4-DIMETHYLBENZALDEHYDE
CAS:15764-16-6
Formula: O=CC1=CC=C(C)C=C1C
BD67092
95+%
MFCD00003340
2,4-DIMETHYLBENZAMIDE
CAS:73258-94-3
Formula: O=C(N)C1=CC=C(C)C=C1C
BD324135
95+%
MFCD11643208
2,4-DIMETHYLBENZENE-1,3-DIAMINE
CAS:13438-26-1
Formula: CC1=C(N)C(C)=C(N)C=C1
BD233319
95+%
MFCD00130059
2,4-DIMETHYLBENZENE-1-SULFONYL CHLORIDE
CAS:609-60-9
Formula: O=S(C1=CC=C(C)C=C1C)(Cl)=O
BD11171
95%
MFCD00156143
2,4-DIMETHYLBENZENESULFONAMIDE
CAS:7467-12-1
Formula: O=S(C1=CC=C(C)C=C1C)(N)=O
BD188688
97%
MFCD00460793
2,4-DIMETHYLBENZENESULFONIC ACID MONOHYDRATE
CAS:58811-92-0
Formula: O=S(C1=CC=C(C)C=C1C)(O)=O.[H]O[H]
BD140560
98%
MFCD00673743
2,4-DIMETHYLBENZENESULFONOHYDRAZIDE
CAS:18626-10-3
Formula: O=S(C1=CC=C(C)C=C1C)(NN)=O
BD177229
97%
MFCD03423366
2,4-DIMETHYLBENZENETHIOL
CAS:13616-82-5
Formula: SC1=CC=C(C)C=C1C
BD10660
98%
MFCD00010019
2,4-DIMETHYLBENZIMIDAMIDE
CAS:885957-73-3
Formula: N=C(N)C1=CC=C(C)C=C1C
BD285924
95+%
MFCD05662999
2,4-DIMETHYLBENZO[D]THIAZOLE
CAS:5262-63-5
Formula: CC1=NC2=C(S1)C=CC=C2C
BD236614
95+%
MFCD03161856
2,4-DIMETHYLBENZO[H]QUINOLIN-10-OL
CAS:1350296-64-8
Formula: OC1=CC=CC2=CC=C3C(C)=CC(C)=NC3=C21
BD00977883
95%
n/a
2,4-DIMETHYLBENZO[H]QUINOLINE
CAS:605-67-4
Formula: CC1=CC(C)=NC2=C3C=CC=CC3=CC=C12
BD00938863
95%
MFCD00819750
2,4-DIMETHYLBENZOIC ACID
CAS:611-01-8
Formula: C1=CC(=CC(=C1C(O)=O)C)C
BD6659
95+%
MFCD00002480
2,4-DIMETHYLBENZONITRILE
CAS:21789-36-6
Formula: N#CC1=CC=C(C)C=C1C
BD67098
98%
MFCD00016377
2,4-DIMETHYLBENZOTHIOAMIDE
CAS:57182-70-4
Formula: S=C(C1=CC=C(C)C=C1C)N
BD67093
97%
MFCD06386700
2,4-DIMETHYLBENZOXAZOLE
CAS:72692-90-1
Formula: CC1=C2N=C(C)OC2=CC=C1
BD273822
97%
MFCD21641329
2,4-DIMETHYLBENZOYLCHLORIDE
CAS:21900-42-5
Formula: O=C(Cl)C1=CC=C(C)C=C1C
BD67100
97%
MFCD00798005
2,4-DIMETHYLBENZYLAMINE
CAS:94-98-4
Formula: NCC1=CC=C(C)C=C1C
BD35487
98%
MFCD00025575
2,4-DIMETHYLBENZYLCHLORIDE
CAS:824-55-5
Formula: CC1=CC=C(C(C)=C1)CCl
BD35019
MFCD00015556
2,4-DIMETHYLBROMOBENZENE
CAS:583-70-0
Formula: CC1=CC=C(Br)C(C)=C1
BD95279
98%
MFCD00000071
2,4-DIMETHYLCYCLOHEXAN-1-ONE
CAS:823-55-2
Formula: O=C1C(C)CC(C)CC1
BD01073545
95%
MFCD11502468
2,4-DIMETHYLFURAN-3-CARBOXYLIC ACID
CAS:15058-72-7
Formula: O=C(C1=C(C)OC=C1C)O
BD558268
97%
MFCD08692087
2,4-DIMETHYLHEPTAN-3-ONE
CAS:18641-71-9
Formula: CC(C)C(C(C)CCC)=O
BD67057
95+%
MFCD00027146
2,4-DIMETHYLIMIDAZO[1,5-A]PYRIMIDINE-8-CARBOXAMIDE
CAS:55418-16-1
Formula: O=C(C1=C(N2C=N1)N=C(C)C=C2C)N
BD00935484
95%
MFCD14705769
2,4-DIMETHYLIMIDAZOLE
CAS:930-62-1
Formula: C1=C([NH]C(=N1)C)C
BD67113
96%
MFCD00022365
2,4-DIMETHYLMORPHOLINE HYDROCHLORIDE
CAS:59256-84-7
Formula: CN1CC(C)OCC1.[H]Cl
BD283924
95+%
2,4-DIMETHYLNAPHTHALEN-1-AMINE
CAS:51671-03-5
Formula: NC1=C2C=CC=CC2=C(C)C=C1C
BD272457
95+%
MFCD20691448
2,4-DIMETHYLNICOTINALDEHYDE
CAS:168072-32-0
Formula: O=CC1=C(C)N=CC=C1C
BD157660
95+%
MFCD11100698
2,4-DIMETHYLNICOTINAMIDE
CAS:72692-96-7
Formula: O=C(N)C1=C(C)N=CC=C1C
BD250804
95+%
MFCD09752319
2,4-DIMETHYLNICOTINIC ACID HYDROCHLORIDE
CAS:133897-06-0
Formula: O=C(O)C1=C(C)N=CC=C1C.[H]Cl
BD67065
98%
MFCD04972426
2,4-DIMETHYLOCTANE
CAS:4032-94-4
Formula: CC(C)CC(C)CCCC
BD00799091
97%
2,4-DIMETHYLOXAZOLE
CAS:7208-05-1
Formula: CC1=COC(C)=N1
BD105600
98%
MFCD00234124
2,4-DIMETHYLOXAZOLE-5-CARBALDEHYDE
CAS:69062-86-8
Formula: CC1=NC(C)=C(O1)C=O
BD29426
97%
MFCD06738688
2,4-DIMETHYLOXAZOLE-5-CARBOHYDRAZIDE
CAS:89598-65-2
Formula: O=C(C1=C(C)N=C(C)O1)NN
BD173257
95+%
MFCD12827519
2,4-DIMETHYLOXAZOLE-5-CARBOXYLIC ACID
CAS:2510-37-4
Formula: CC1=NC(C)=C(O1)C(O)=O
BD167638
95+%
MFCD06011090
2,4-DIMETHYLPENT-2-ENOIC ACID
CAS:66634-97-7
Formula: CC(C)/C=C(C)/C(O)=O
BD67044
97%
MFCD00209505
2,4-DIMETHYLPENT-4-EN-2-OL
CAS:19781-53-4
Formula: CC(O)(C)CC(C)=C
BD67068
94+%
MFCD00039615
2,4-DIMETHYLPENT-4-ENOIC ACID
CAS:56639-98-6
Formula: C=C(CC(C(=O)O)C)C
BD00730893
95%
MFCD19228771
2,4-DIMETHYLPENTAN-3-AMINE
CAS:4083-57-2
Formula: CC(C)C(N)C(C)C
BD278928
97+%
MFCD00015041
2,4-DIMETHYLPENTAN-3-AMINE HYDROCHLORIDE
CAS:4083-58-3
Formula: CC(C)C(N)C(C)C.[H]Cl
BD297822
97%
MFCD22392217
2,4-DIMETHYLPENTAN-3-OL
CAS:600-36-2
Formula: CC(C)C(O)C(C)C
BD01123773
98%
MFCD00008921
2,4-DIMETHYLPENTAN-3-ONE OXIME
CAS:1113-74-2
Formula: CC(C(C(C)C)=NO)C
BD00851920
95%
MFCD00182586
2,4-DIMETHYLPHENYLACETIC ACID
CAS:6331-04-0
Formula: O=C(O)CC1=CC=C(C)C=C1C
BD0153
98%
MFCD02664685
2,4-DIMETHYLPHENYLBORONIC ACID
CAS:55499-44-0
Formula: CC1=C(C=CC(=C1)C)B(O)O
BD5258
98%
MFCD02683101
2,4-DIMETHYLPHENYLHYDRAZINE HYDROCHLORIDE
CAS:60480-83-3
Formula: [H]Cl.NNC1=CC=C(C)C=C1C
BD5367
97%
MFCD00013381
2,4-DIMETHYLPHENYLISOTHIOCYANATE
CAS:39842-01-8
Formula: CC1=CC=C(N=C=S)C(C)=C1
BD11733
95%
MFCD00022054
2,4-DIMETHYLPIPERIDIN-4-OL
CAS:1550821-91-4
Formula: OC1(C)CC(C)NCC1
BD00797106
MFCD26722605
2,4-DIMETHYLPIPERIDINE HYDROCHLORIDE
CAS:91846-47-8
Formula: CC1CC(C)NCC1.[H]Cl
BD67251
97%
MFCD10687193
2,4-DIMETHYLPYRAZOLO[1,5-A]PYRIMIDIN-5(4H)-ONE
CAS:N/A
Formula: O=C1N(C)C2=CC(C)=NN2C=C1
BD753992
97%
2,4-DIMETHYLPYRIDIN-3-AMINE
CAS:1073-21-8
Formula: CC1=NC=CC(C)=C1N
BD83730
98%
MFCD08235192
2,4-DIMETHYLPYRIDIN-3-OL
CAS:27296-76-0
Formula: OC1=C(C)C=CN=C1C
BD67060
98%
MFCD08235268
2,4-DIMETHYLPYRIDINE-3-BORONIC ACID
CAS:1029654-16-7
Formula: OB(C1=C(C)C=CN=C1C)O
BD168616
95+%
MFCD07437923
2,4-DIMETHYLPYRIDINE-3-CARBOXYLIC ACID
CAS:55314-30-2
Formula: O=C(C1=C(C)C=CN=C1C)O
BD29038
95%
MFCD03265250
2,4-DIMETHYLPYRIMIDIN-5-AMINE
CAS:35733-53-0
Formula: NC1=CN=C(C)N=C1C
BD20416
98%
MFCD09608073
2,4-DIMETHYLPYRIMIDIN-5-OL
CAS:412003-95-3
Formula: OC1=CN=C(C)N=C1C
BD227081
98%
MFCD18072447
2,4-DIMETHYLPYRIMIDINE
CAS:14331-54-5
Formula: CC1=NC(C)=NC=C1
BD250211
95+%
MFCD01646156
2,4-DIMETHYLPYRIMIDINE-5-CARBALDEHYDE
CAS:933702-51-3
Formula: O=CC1=CN=C(C)N=C1C
BD584922
97%
MFCD09863206
2,4-DIMETHYLPYRIMIDINE-5-CARBOXAMIDE
CAS:53554-30-6
Formula: O=C(C1=CN=C(C)N=C1C)N
BD587773
97%
2,4-DIMETHYLPYRIMIDO[1,2-B]INDAZOLE
CAS:54167-66-7
Formula: CC1=CC(C)=NC2=C3C=CC=CC3=NN21
BD01032794
95%
MFCD00856894
2,4-DIMETHYLPYRROLE-3-CARBOXYLIC ACID
CAS:17106-13-7
Formula: O=C(C1=C(C)NC=C1C)O
BD67133
98%
MFCD09750426
2,4-DIMETHYLPYRROLIDINE HYDROCHLORIDE
CAS:1333946-75-0
Formula: CC1CC(C)NC1.[H]Cl
BD440319
97%
MFCD19982526
2,4-DIMETHYLPYRROLO[1,2-A]PYRIMIDINE-8-CARBOXYLIC ACID
CAS:1919049-95-8
Formula: O=C(C1=C2N=C(C)C=C(C)N2C=C1)O
BD00823871
97%
2,4-DIMETHYLQUINAZOLIN-8-OL
CAS:17056-97-2
Formula: OC1=CC=CC2=C(C)N=C(C)N=C12
BD330467
95+%
MFCD24715406
2,4-DIMETHYLQUINAZOLINE
CAS:703-63-9
Formula: C1=CC=CC2=C1N=C(N=C2C)C
BD210603
95+%
MFCD18449069
2,4-DIMETHYLQUINOLINE
CAS:1198-37-4
Formula: CC1=CC(C)=NC2=CC=CC=C12
BD0480
98%
MFCD00006760
2,4-DIMETHYLQUINOLINE-3-CARBOXYLIC ACID
CAS:104785-55-9
Formula: O=C(C1=C(C)C2=CC=CC=C2N=C1C)O
BD67135
95+%
MFCD07324847
2,4-DIMETHYLQUINOLINE-7-CARBOXYLIC ACID
CAS:936074-38-3
Formula: O=C(C1=CC=C2C(C)=CC(C)=NC2=C1)O
BD173430
95+%
MFCD09261473
2,4-DIMETHYLTHIAZOL-5-AMINE
CAS:856568-04-2
Formula: NC1=C(C)N=C(C)S1
BD251214
95+%
MFCD16669939
2,4-DIMETHYLTHIAZOLE
CAS:541-58-2
Formula: C1=C(N=C(C)S1)C
BD9619
96%
MFCD00014509
2,4-DIMETHYLTHIAZOLE-5-CARBALDEHYDE
CAS:95453-54-6
Formula: O=CC1=C(C)N=C(C)S1
BD67030
97%
MFCD03407320
2,4-DIMETHYLTHIAZOLE-5-CARBOHYDRAZIDE
CAS:99357-25-2
Formula: O=C(C1=C(C)N=C(C)S1)NN
BD67141
97%
MFCD00832910
2,4-DIMETHYLTHIAZOLE-5-CARBOXYLIC ACID
CAS:53137-27-2
Formula: O=C(C1=C(C)N=C(C)S1)O
BD10000
98%
MFCD00052943
2,4-DIMETHYLTHIAZOLE-5-SULFONAMIDE
CAS:80466-90-6
Formula: O=S(C1=C(C)N=C(C)S1)(N)=O
BD549023
97%
MFCD00178766
2,4-DIMETHYLTHIOPHENE
CAS:638-00-6
Formula: CC1=CSC(C)=C1
BD67142
95+%
MFCD00130082
2,4-DIMETHYLTHIOPHENE-3-CARBALDEHYDE
CAS:63826-85-7
Formula: O=CC1=C(SC=C1C)C
BD00932524
95%
MFCD24675951
2,4-DIMETHYLTHIOPHENE-3-CARBOXYLIC ACID
CAS:503308-96-1
Formula: O=C(C1=C(C)SC=C1C)O
BD537801
97%
MFCD18819341
2,4-DIMORPHOLINOANILINE
CAS:436088-92-5
Formula: NC1=CC=C(N2CCOCC2)C=C1N3CCOCC3
BD188188
95+%
MFCD03274726
2,4-DINITRO-1-(PROPAN-2-YLOXY)BENZENE
CAS:10242-16-7
Formula: CC(OC1=CC=C([N+]([O-])=O)C=C1[N+]([O-])=O)C
BD00843954
95%
2,4-DINITROBENZALDEHYDE
CAS:528-75-6
Formula: O=CC1=CC=C([N+]([O-])=O)C=C1[N+]([O-])=O
BD10317
98%
MFCD00013376
2,4-DINITROBENZENESULFONAMIDE
CAS:73901-01-6
Formula: NS(=O)(=O)C1=C(C=C(C=C1)[N+]([O-])=O)[N+]([O-])=O
BD236897
98%
MFCD09733471
2,4-DINITROPHENYLETHYLALCOHOL
CAS:4836-69-5
Formula: OCCC1=CC=C(C=C1[N+]([O-])=O)[N+]([O-])=O
BD67148
95%
MFCD09991672
2,4-DINTROBENZENESULFONICACIDSODIUMSALT
CAS:885-62-1
Formula: O=S(C1=CC=C([N+]([O-])=O)C=C1[N+]([O-])=O)([O-])=O.[Na+]
BD3195
MFCD00007471
2,4-DIOXO-1,2,3,4-TETRAHYDROPYRIDO[2,3-D]PYRIMIDINE-6-SULFONYL CHLORIDE
CAS:1384431-51-9
Formula: O=S(C1=CN=C(C(C(N2)=O)=C1)NC2=O)(Cl)=O
BD00783335
97%
MFCD22056455
2,4-DIOXO-1,2,3,4-TETRAHYDROPYRIMIDINE-5-CARBALDEHYDE
CAS:1195-08-0
Formula: O=CC1=CNC(=O)NC1=O
BD2615
95%
MFCD00192185
2,4-DIOXO-1,2,3,4-TETRAHYDROPYRIMIDINE-5-CARBONITRILE
CAS:4425-56-3
Formula: N#CC1=CNC(NC1=O)=O
BD41691
98%
MFCD00051958
2,4-DIOXO-1,2,3,4-TETRAHYDROPYRIMIDINE-5-SULFONYL CHLORIDE
CAS:28485-18-9
Formula: O=S(C1=CNC(NC1=O)=O)(Cl)=O
BD67196
95+%
MFCD06655485
2,4-DIOXO-1,2,3,4-TETRAHYDROPYRIMIDO[4,5-B]QUINOLINE-5-CARBOXYLIC ACID
CAS:500300-26-5
Formula: O=C(C1=C(C(N2)=O)C(NC2=O)=NC3=CC=CC=C13)O
BD625472
97%
2,4-DIOXO-1,2,3,4-TETRAHYDROQUINAZOLINE-5-CARBOXYLIC ACID
CAS:5715-10-6
Formula: OC(=O)C1=C2C(=O)NC(=O)NC2=CC=C1
BD239478
95+%
MFCD16622795
2,4-DIOXO-1,2,3,4-TETRAHYDROQUINAZOLINE-6-CARBOXAMIDE
CAS:263010-13-5
Formula: O=C(C1=CC2=C(NC(NC2=O)=O)C=C1)N
BD260170
95+%
2,4-DIOXO-1,2,3,4-TETRAHYDROQUINAZOLINE-6-CARBOXYLIC ACID
CAS:1821028-80-1
Formula: O=C(C1=CC2=C(NC(NC2=O)=O)C=C1)O
BD435270
97%
MFCD20039830
2,4-DIOXO-1,2,3,4-TETRAHYDROQUINAZOLINE-6-SULFONYL CHLORIDE
CAS:56044-12-3
Formula: O=S(C1=CC2=C(NC(NC2=O)=O)C=C1)(Cl)=O
BD183804
95%
MFCD07186482
2,4-DIOXO-1,2,3,4-TETRAHYDROQUINAZOLINE-7-CARBONITRILE
CAS:864292-20-6
Formula: N#CC1=CC(NC(N2)=O)=C(C=C1)C2=O
BD247375
95+%
MFCD20729918
2,4-DIOXO-1,2,3,4-TETRAHYDROQUINAZOLINE-8-CARBONITRILE
CAS:1150617-69-8
Formula: O=C1NC(=O)C2=CC=CC(C#N)=C2N1
BD227924
95+%
MFCD12024545
2,4-DIOXO-1,3-DIAZASPIRO[4.5]DECANE-7-CARBOXYLIC ACID
CAS:26629-10-7
Formula: O=C(C(CCC1)CC1(NC(N2)=O)C2=O)O
BD624460
97%
2,4-DIOXO-1,3-DIPROPYL-1,2,3,4-TETRAHYDROPYRIDO[2,3-D]PYRIMIDINE-6-SULFONYL CHLORIDE
CAS:1334149-34-6
Formula: O=S(C1=CN=C(C(C(N2CCC)=O)=C1)N(CCC)C2=O)(Cl)=O
BD00801470
97%
MFCD19686414
2,4-DIOXO-1-(3-(TRIFLUOROMETHYL)PHENYL)-1,2,3,4-TETRAHYDROPYRIMIDINE-5-CARBONITRILE
CAS:75838-24-3
Formula: O=C(N1)N(C2=CC=CC(C(F)(F)F)=C2)C=C(C#N)C1=O
BD103726
95+%
MFCD00203322
2,4-DIOXO-1-PHENYL-1,2,3,4-TETRAHYDROPYRIMIDINE-5-CARBONITRILE
CAS:6275-84-9
Formula: O=C1NC(=O)C(=CN1C1=CC=CC=C1)C#N
BD67197
95+%
MFCD00172909
2,4-DIOXO-1-PHENYL-1,2,3,4-TETRAHYDROPYRIMIDINE-5-CARBOXYLIC ACID
CAS:N/A
Formula: O=C(C1=CN(C2=CC=CC=C2)C(NC1=O)=O)O
BD00800543
95%
2,4-DIOXO-2,4-DIHYDRO-1H-BENZO[D][1,3]OXAZINE-6-CARBOXYLIC ACID
CAS:77423-13-3
Formula: OC(=O)C1=CC2=C(NC(=O)OC2=O)C=C1
BD42012
95+%
MFCD08704695
2,4-DIOXO-2,4-DIHYDRO-1H-BENZO[D][1,3]OXAZINE-7-CARBOXYLIC ACID
CAS:77423-14-4
Formula: OC(=O)C1=CC2=C(C=C1)C(=O)OC(=O)N2
BD11477
96%
MFCD00798181
2,4-DIOXO-2,4-DIHYDRO-1H-BENZO[D][1,3]OXAZINE-8-CARBOXYLIC ACID
CAS:167902-99-0
Formula: OC(=O)C1=CC=CC2=C1NC(=O)OC2=O
BD201982
95+%
MFCD09865033
2,4-DIOXO-3-[(THIOPHEN-2-YL)METHYL]-1,2,3,4-TETRAHYDROQUINAZOLINE-7-CARBOXYLIC ACID
CAS:1232780-68-5
Formula: O=C(C1=CC(NC(N2CC3=CC=CS3)=O)=C(C=C1)C2=O)O
BD00910519
95%
MFCD14703531
2,4-DIOXO-4-(4-(PIPERIDIN-1-YL)PHENYL)BUTANOIC ACID
CAS:394655-15-3
Formula: O=C(O)C(CC(C1=CC=C(N2CCCCC2)C=C1)=O)=O
BD67200
97%
2,4-DIOXO-4-PHENYLBUTANOIC ACID
CAS:5817-92-5
Formula: O=C(O)C(CC(C1=CC=CC=C1)=O)=O
BD319079
98%
MFCD00456054
2,4-DIOXO-6-PHENYLHEXANOIC ACID
CAS:64165-16-8
Formula: O=C(O)C(CC(CCC1=CC=CC=C1)=O)=O
BD249644
95+%
2,4-DIOXO-N-PHENYLPENTANAMIDE
CAS:503300-35-4
Formula: CC(=O)CC(=O)C(=O)NC1=CC=CC=C1
BD219439
95+%
2,4-DIPHENYL-1H-PYRROLE
CAS:3274-56-4
Formula: C1(C2=CC=CC=C2)=CC(C3=CC=CC=C3)=CN1
BD67218
97%
MFCD00958534
2,4-DIPHENYL-1H-PYRROLE-3-CARBONITRILE
CAS:59009-62-0
Formula: N#CC1=C(C2=CC=CC=C2)NC=C1C3=CC=CC=C3
BD269130
95+%
MFCD02380383
2,4-DIPHENYL-5,6,7,8-TETRAHYDROCHROMENYLIUM TRIFLUOROMETHANESULFONATE
CAS:81128-01-0
Formula: O=S(C(F)(F)F)([O-])=O.C1(C2=CC=CC=C2)=CC(C3=CC=CC=C3)=C4CCCCC4=[O+]1
BD67212
97%
MFCD00051892
2,4-DIPHENYL-5,6,7,8-TETRAHYDROQUINAZOLINE
CAS:20954-93-2
Formula: C1(C2=CC=CC=C2)=NC(C3=CC=CC=C3)=C4CCCCC4=N1
BD748671
97%
MFCD00592422
2,4-DIPHENYL-6,7-DIHYDRO-5H-CYCLOPENTA[D]PYRIMIDINE
CAS:138722-71-1
Formula: C1(C2=CC=CC=C2)=NC(C3=CC=CC=C3)=C(CCC4)C4=N1
BD748669
97%
MFCD00483273
2,4-DIPHENYL-6-(4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PHENYL)-1,3,5-TRIAZINE
CAS:1219956-23-6
Formula: CC1(C)C(C)(C)OB(C2=CC=C(C3=NC(C4=CC=CC=C4)=NC(C5=CC=CC=C5)=N3)C=C2)O1
BD291505
98%
MFCD29918901
2,4-DIPHENYLOXAZOL-5(4H)-ONE
CAS:28687-81-2
Formula: O=C1C(C2=CC=CC=C2)N=C(C3=CC=CC=C3)O1
BD492928
97%
MFCD02127278
2,4-DIPHENYLOXAZOLE
CAS:838-41-5
Formula: C1(C2=CC=CC=C2)=NC(C3=CC=CC=C3)=CO1
BD67216
99%
MFCD00016890
2,4-DIPHENYLPHTHALAZIN-1(2H)-ONE
CAS:36503-83-0
Formula: O=C1N(C2=CC=CC=C2)N=C(C3=CC=CC=C3)C4=C1C=CC=C4
BD625001
97%
MFCD00115995
2,4-DIPHENYLPYRIDINE
CAS:26274-35-1
Formula: C1(C2=CC=CC=C2)=NC=CC(C3=CC=CC=C3)=C1
BD67217
98%
MFCD00972966
2,4-DIPHENYLPYRROLIDINE
CAS:39995-87-4
Formula: C1(C2=CC=CC=C2)NCC(C3=CC=CC=C3)C1
BD207381
95+%
MFCD13562920
2,4-DIPHENYLPYRYLIUM TETRAFLUOROBORATE
CAS:N/A
Formula: F[B-](F)(F)F.C1(C2=CC=CC=C2)=CC(C3=CC=CC=C3)=CC=[O+]1
BD337690
95%
n/a
2,4-DIPHENYLTHIAZOLE
CAS:1826-14-8
Formula: C1(C2=CC=CC=C2)=NC(C3=CC=CC=C3)=CS1
BD257419
95+%
MFCD01849209
2,4-DITRIFLUOROMETHYLANILINE
CAS:367-71-5
Formula: NC1=CC=C(C(F)(F)F)C=C1C(F)(F)F
BD66451
95%
MFCD00236209
2,4-DITRIFLUOROMETHYLPHENOL
CAS:908848-70-4
Formula: OC1=CC=C(C(F)(F)F)C=C1C(F)(F)F
BD00762041
97%
MFCD13185349
2,4-HEPTADECADIYNOICACID
CAS:64034-02-2
Formula: CCCCCCCCCCCCC#CC#CC(O)=O
BD67235
MFCD00060064
2,4-HEPTADIEN-6-ONE
CAS:3916-64-1
Formula: C/C=C/C=C/C(C)=O
BD67237
(stabilized with HQ)
2,4-HEXADIEN-1-OL
CAS:111-28-4
Formula: C/C=C/C=C/CO
BD00842895
98% GC
2,4-HEXANEDIONE
CAS:3002-24-2
Formula: CC(CC(CC)=O)=O
BD67249
97%
MFCD00009318
2,4-OCTADIEN-1-OL, (2E,4Z)-
CAS:56904-85-9
Formula: CCC/C=C\C=C\CO
BD67261
95%
n/a
2,4-PENTANEDIOL
CAS:625-69-4
Formula: CC(O)CC(O)C
BD67269
95%
MFCD00004549
2,4-PENTANEDIOL, 1,5-DICHLORO-, (2R,4R)-
CAS:136030-28-9
Formula: O[C@@H](CCl)C[C@H](CCl)O
BD00949417
95%
MFCD30335051
2,4-PENTANEDIONE, 3-AMINO-, HCL
CAS:5440-20-0
Formula: CC(C(C(C)=O)N)=O.[H]Cl
BD00925500
95%
MFCD09971783
2,4-PENTANEDIONEDIOXIME
CAS:2157-56-4
Formula: C/C(C/C(C)=N/O)=N\O
BD2432
2,4-PIPERIDINEDICARBOXYLIC ACID
CAS:85819-03-0
Formula: O=C(C1NCCC(C(O)=O)C1)O
BD306875
95+%
MFCD12026391
2,4-PYRIMIDINEDIAMINE WITH LINKER
CAS:1430089-64-7
Formula: NCCCNC1=CC=C(NC2=NC=CC(NC3=NNC(C4CC4)=C3)=N2)C=C1
BD449969
98+%
MFCD28385887
2,4-PYRIMIDINEDICARBOXYLIC ACID
CAS:37645-41-3
Formula: O=C(C1=NC=CC(C(O)=O)=N1)O
BD211630
95+%
2,4-THIAZOLIDINEDIONE
CAS:2295-31-0
Formula: O=C1SCC(N1)=O
BD9326
97%
MFCD00005478
2,4-UNDECADIEN-1-OL
CAS:59376-58-8
Formula: CCCCCC/C=C/C=C/CO
BD67282
2,5,5-TRIMETHYL-2-PHENYLMORPHOLINE
CAS:1017419-75-8
Formula: CC1(COC(C)(CN1)C2=CC=CC=C2)C
BD00960945
95%
MFCD09901650
2,5,5-TRIMETHYLMORPHOLINE
CAS:938374-22-2
Formula: CC1CNC(C)(CO1)C
BD00843346
95%
MFCD09722891
2,5,5-TRIMETHYLMORPHOLINE 4-METHYLBENZENESULFONATE
Formula: CC1OCC(C)(NC1)C
BD00840732
95%
2,5,6,7-TETRAHYDRO-PYRAZOLO[4,3-B]PYRIDINE-4-CARBOXYLIC ACID BENZYL ESTER
CAS:1935120-59-4
Formula: O=C(N1CCCC2=NNC=C12)OCC3=CC=CC=C3
BD00897060
95%
MFCD28348687
2,5,6-TRIAMINOPYRIMIDIN-4(3H)-ONE
CAS:1004-75-7
Formula: O=C1NC(N)=NC(N)=C1N
BD220079
95+%
MFCD00217058
2,5,6-TRIAMINOPYRIMIDIN-4(3H)-ONE DIHYDROCHLORIDE
CAS:51324-37-9
Formula: Cl.Cl.NC1C(=O)N=C(N)N=C1N
BD223096
95%
MFCD00142115
2,5,6-TRIAMINOPYRIMIDIN-4(3H)-ONE SULFATE
CAS:35011-47-3
Formula: O=C1NC(N)=NC(N)=C1N.O=S(O)(O)=O
BD220080
95+%
MFCD00012785
2,5,6-TRIAMINOPYRIMIDIN-4(3H)-ONE SULFATE(1:X)
CAS:39267-74-8
Formula: O=C1NC(N)=NC(N)=C1N.O=S(O)(O)=O
BD220087
95%
MFCD27664806
2,5,6-TRIAMINOPYRIMIDIN-4-OL
CAS:N/A
Formula: OC1=NC(N)=NC(N)=C1N
BD109297
95+%
2,5,6-TRIAMINOPYRIMIDIN-4-YL HYDROGEN SULFATE
CAS:1603-02-7
Formula: NC1=NC(OS(O)(=O)=O)=C(N)C(N)=N1
BD220088
95%
MFCD00039040
2,5,6-TRIAMINOPYRIMIDINE-4(3H)-THIONE
CAS:54-19-3
Formula: S=C1NC(N)=NC(N)=C1N
BD282734
95+%
2,5,6-TRICHLORO-1H-BENZO[D]IMIDAZOLE
CAS:16865-11-5
Formula: ClC1=C(Cl)C=C2C(NC(Cl)=N2)=C1
BD67291
98%
MFCD09835289
2,5,6-TRICHLORO-3-METHYLPYRIMIDIN-4(3H)-ONE
CAS:1821308-45-5
Formula: O=C1N(C)C(Cl)=NC(Cl)=C1Cl
BD01111951
98%
MFCD30470569
2,5,6-TRICHLORO-4-METHYLNICOTINIC ACID
CAS:294876-53-2
Formula: O=C(O)C1=C(Cl)N=C(Cl)C(Cl)=C1C
BD260749
95+%
MFCD01240480
2,5,6-TRICHLORO-4-METHYLNICOTINONITRILE
CAS:63195-39-1
Formula: ClC1=NC(=C(C(=C1C#N)C)Cl)Cl
BD163315
98%
MFCD09754021
2,5,6-TRICHLORO-4-PROPYLNICOTINONITRILE
CAS:63195-40-4
Formula: N#CC1=C(Cl)N=C(Cl)C(Cl)=C1CCC
BD284535
95+%
2,5,6-TRICHLORO-N,N-DIMETHYLNICOTINAMIDE
CAS:N/A
Formula: O=C(C1C=C(Cl)C(Cl)=NC=1Cl)N(C)C
BD00772280
95%
2,5,6-TRICHLORO-N-METHYLNICOTINAMIDE
CAS:N/A
Formula: O=C(C1C=C(Cl)C(Cl)=NC=1Cl)NC
BD00803764
95%
2,5,6-TRICHLOROBENZO[D]THIAZOLE
CAS:120258-61-9
Formula: ClC1C=C2C(N=C(S2)Cl)=CC=1Cl
BD00765347
95+%
MFCD09749269
2,5,6-TRICHLORONICOTINALDEHYDE
CAS:55304-74-0
Formula: O=CC1=C(Cl)N=C(Cl)C(Cl)=C1
BD754078
97%
2,5,6-TRICHLORONICOTINAMIDE
CAS:142266-62-4
Formula: O=C(N)C1=C(Cl)N=C(Cl)C(Cl)=C1
BD237000
97%
MFCD22493418
2,5,6-TRICHLORONICOTINIC ACID
CAS:54718-39-7
Formula: OC(=O)C1=CC(Cl)=C(Cl)N=C1Cl
BD236969
97%
MFCD02070018
2,5,6-TRICHLORONICOTINOHYDRAZIDE
CAS:58584-91-1
Formula: O=C(C1C=C(Cl)C(Cl)=NC=1Cl)NN
BD00741972
95+%
MFCD30528066
2,5,6-TRICHLORONICOTINONITRILE
CAS:40381-92-8
Formula: N#CC1=C(Cl)N=C(Cl)C(Cl)=C1
BD218290
95+%
MFCD17392884
2,5,6-TRICHLOROPYRIDIN-3-AMINE
CAS:55304-76-2
Formula: NC1=CC(Cl)=C(Cl)N=C1Cl
BD248792
95+%
MFCD20714285
2,5,6-TRICHLOROPYRIMIDIN-4-AMINE
CAS:28969-60-0
Formula: NC1=NC(Cl)=NC(Cl)=C1Cl
BD93616
98%
MFCD09744035
2,5,6-TRICHLOROQUINAZOLINE
CAS:67092-21-1
Formula: ClC1=C(Cl)C2=CN=C(Cl)N=C2C=C1
BD633828
97%
MFCD30471468
2,5,6-TRIFLUORONICOTINIC ACID
CAS:773109-19-6
Formula: O=C(O)C1=C(F)N=C(F)C(F)=C1
BD67294
97%
MFCD04973022
2,5,6-TRIFLUORONICOTINONITRILE
CAS:870065-73-9
Formula: N#CC1=C(F)N=C(F)C(F)=C1
BD67295
98%
MFCD04973023
2,5,6-TRIFLUOROPYRIDINE-3,4-DIAMINE
CAS:6256-96-8
Formula: NC1=C(N)C(F)=C(F)N=C1F
BD216517
95+%
MFCD18803121
2,5,6-TRIMETHOXYNICOTINALDEHYDE
CAS:124769-08-0
Formula: COC1=CC(C=O)=C(N=C1OC)OC
BD00849710
95%
MFCD21609480
2,5,6-TRIMETHOXYNICOTINIC ACID
CAS:1364917-20-3
Formula: O=C(O)C1=C(OC)N=C(OC)C(OC)=C1
BD00883050
95%
MFCD21609481
2,5,6-TRIMETHOXYNICOTINONITRILE
CAS:1383788-46-2
Formula: COC1=CC(C#N)=C(N=C1OC)OC
BD00827943
95%
2,5,6-TRIMETHOXYPYRIDIN-3-OL
CAS:1383788-45-1
Formula: COC1=CC(O)=C(N=C1OC)OC
BD00836000
95%
2,5,6-TRIMETHYL-2,3-DIHYDRO-1H-INDEN-1-ONE
CAS:89044-51-9
Formula: O=C1C(C)CC2=C1C=C(C)C(C)=C2
BD272737
95+%
MFCD19443327
2,5,6-TRIMETHYL-3-OXO-2,3-DIHYDROPYRIDAZINE-4-CARBONITRILE
CAS:60296-04-0
Formula: N#CC1=C(C)C(C)=NN(C)C1=O
BD00833595
97%
MFCD09802094
2,5,6-TRIMETHYL-3-OXO-2,3-DIHYDROPYRIDAZINE-4-CARBOTHIOAMIDE
CAS:114698-30-5
Formula: S=C(C1=C(C)C(C)=NN(C)C1=O)N
BD00798870
97%
MFCD09802116
2,5,6-TRIMETHYL-3-OXO-2,3-DIHYDROPYRIDAZINE-4-CARBOXYLIC ACID
CAS:106838-00-0
Formula: O=C(C1=C(C)C(C)=NN(C)C1=O)O
BD00817817
97%
MFCD06447046
2,5,6-TRIMETHYL-4H,7H-[1,2,4]TRIAZOLO[1,5-A]PYRIMIDIN-7-ONE
CAS:879624-34-7
Formula: O=C1C(C)=C(C)NC2=NC(C)=NN12
BD00819015
95%
MFCD07157457
2,5,6-TRIMETHYLBENZO[D]OXAZOLE
CAS:19219-98-8
Formula: CC1=C(C)C=C2N=C(C)OC2=C1
BD0091
98%
MFCD00022849
2,5,6-TRIMETHYLBENZO[D]THIAZOLE
CAS:5683-41-0
Formula: CC1=C(C)C=C2N=C(C)SC2=C1
BD67299
95+%
MFCD00128832
2,5,6-TRIMETHYLPYRIMIDIN-4-OL
CAS:89943-15-7
Formula: OC1=NC(C)=NC(C)=C1C
BD279371
95+%
MFCD07357440
2,5,7-TRIAZASPIRO[3.4]OCTAN-6-ONE
CAS:1392210-92-2
Formula: O=C(NC1)NC21CNC2
BD329520
95+%
MFCD22372582
2,5,7-TRIAZASPIRO[3.4]OCTAN-6-ONE HYDROCHLORIDE
CAS:1609406-92-9
Formula: O=C(NC1)NC21CNC2.[H]Cl
BD565603
97%
MFCD26959074
2,5,7-TRIAZASPIRO[3.4]OCTAN-8-ONE HYDROCHLORIDE
CAS:686344-68-3
Formula: O=C1NCNC21CNC2.[H]Cl
BD163807
95+%
MFCD12755759
2,5,7-TRIAZASPIRO[3.4]OCTANE-6,8-DIONE HYDROCHLORIDE
CAS:1026796-27-9
Formula: O=C(NC1=O)NC21CNC2.[H]Cl
BD314075
95+%
MFCD20688617
2,5,7-TRICHLORO-3-FLUORO-1,6-NAPHTHYRIDINE
CAS:N/A
Formula: ClC1=NC(Cl)=CC2=NC(Cl)=C(F)C=C21
BD01156243
97%
n/a
2,5,7-TRICHLOROBENZO[D]THIAZOLE
CAS:898747-75-6
Formula: ClC1=NC2=C(S1)C(Cl)=CC(Cl)=C2
BD236620
95+%
MFCD08459005
2,5,7-TRICHLOROTHIAZOLO[4,5-D]PYRIMIDINE
CAS:122970-50-7
Formula: ClC1=C(SC(Cl)=N2)C2=NC(Cl)=N1
BD281276
95+%
2,5,7-TRIMETHYL-1H-INDOLE-3-CARBALDEHYDE
CAS:88611-38-5
Formula: O=CC1=C(C)NC2=C1C=C(C)C=C2C
BD195290
97%
MFCD07643235
2,5,7-TRIMETHYL-2,3-DIHYDRO-1H-INDEN-1-ONE
CAS:65001-59-4
Formula: CC1CC2=CC(C)=CC(C)=C2C1=O
BD67304
95+%
MFCD09030781
2,5,7-TRIMETHYL-3-PHENYLPYRAZOLO[1,5-A]PYRIMIDINE
CAS:138628-46-3
Formula: CC1=CC(C)=NC2=C(C3=CC=CC=C3)C(C)=NN12
BD584231
97%
MFCD00750794
2,5,7-TRIMETHYL-3H-IMIDAZO[4,5-B]PYRIDINE
CAS:N/A
Formula: CC1C=C(C)N=C2NC(=NC=12)C
BD00735449
95%
2,5,7-TRIMETHYL-4,5,6,7-TETRAHYDROPYRAZOLO[1,5-A]PYRIMIDINE
CAS:174469-70-6
Formula: CC1CC(C)NC2=CC(C)=NN12
BD264147
95+%
MFCD09332629
2,5,7-TRIMETHYLPYRAZOLO[1,5-A]PYRIMIDINE-3-CARBOXYLIC ACID
CAS:1158269-53-4
Formula: O=C(C1=C2N=C(C)C=C(C)N2N=C1C)O
BD279010
95+%
MFCD12197249
2,5,7-TRIMETHYLQUINOLIN-8-OL
CAS:6759-80-4
Formula: CC1=NC2=C(C=C1)C(C)=CC(C)=C2O
BD225848
95+%
MFCD00168977
2,5,7-TRIMETHYLQUINOLIN-8-OL 1-OXIDE
CAS:6854-17-7
Formula: CC1=CC(C)=C2C=CC(C)=[N+](C2=C1O)[O-]
BD00825071
95%
MFCD00168980
2,5,8,11,14,17,20,23,26,29,32,35-DODECAOXAHEPTATRIACONTANE-37-THIOL
CAS:134874-49-0
Formula: COCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCS
BD00846591
95%
MFCD21363241
2,5,8,11,14,17,20,23,26,29,32-UNDECAOXATETRATRIACONTAN-34-AMINE
CAS:854601-60-8
Formula: COCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCN
BD434644
95+%
MFCD27977521
2,5,8,11,14,17,20,23,26,29,32-UNDECAOXATETRATRIACONTAN-34-YL 4-METHYLBENZENESULFONATE
CAS:936499-78-4
Formula: O=S(C1=CC=C(C)C=C1)(OCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOC)=O
BD757620
97%
MFCD30471984
2,5,8,11,14,17,20,23,26,29-DECAOXAHENTRIACONTAN-31-OL
CAS:27425-92-9
Formula: COCCOCCOCCOCCOCCOCCOCCOCCOCCOCCO
BD262364
95%
MFCD06797087
2,5,8,11,14,17,20,23,26-NONAOXAOCTACOSAN-28-AMINE
CAS:211859-73-3
Formula: COCCOCCOCCOCCOCCOCCOCCOCCOCCN
BD434549
95+%
MFCD16619283
2,5,8,11,14,17,20,23,26-NONAOXAOCTACOSAN-28-OL
CAS:6048-68-6
Formula: COCCOCCOCCOCCOCCOCCOCCOCCOCCO
BD262363
93%
MFCD06797148
2,5,8,11,14,17,20,23,26-NONAOXAOCTACOSANE-28-THIOL
CAS:651042-84-1
Formula: COCCOCCOCCOCCOCCOCCOCCOCCOCCS
BD434611
95+%
MFCD16619329
2,5,8,11,14,17,20,23-OCTAOXAHEXACOSAN-26-OIC ACID
CAS:1093647-41-6
Formula: COCCOCCOCCOCCOCCOCCOCCOCCC(O)=O
BD434518
95%
MFCD13184957
2,5,8,11,14,17,20,23-OCTAOXAPENTACOSAN-25-AMINE
CAS:869718-81-0
Formula: COCCOCCOCCOCCOCCOCCOCCOCCN
BD434645
95+%
MFCD13184961
2,5,8,11,14,17,20,23-OCTAOXAPENTACOSAN-25-OL
CAS:25990-96-9
Formula: COCCOCCOCCOCCOCCOCCOCCOCCO
BD212984
96%
MFCD06797152
2,5,8,11,14,17,20,23-OCTAOXAPENTACOSANE-25-THIOL
CAS:651042-83-0
Formula: COCCOCCOCCOCCOCCOCCOCCOCCS
BD434610
95+%
MFCD16619328
2,5,8,11,14,17,20-HEPTAOXADOCOSAN-22-AMINE
CAS:170572-38-0
Formula: COCCOCCOCCOCCOCCOCCOCCN
BD434538
95+%
2,5,8,11,14,17,20-HEPTAOXATRICOSAN-23-OIC ACID
CAS:874208-91-0
Formula: COCCOCCOCCOCCOCCOCCOCCC(O)=O
BD434649
95+%
MFCD20926396
2,5,8,11,14,17-HEXAOXAICOSAN-20-OIC ACID
CAS:1347750-72-4
Formula: COCCOCCOCCOCCOCCOCCC(O)=O
BD00885685
95%
MFCD20926383
2,5,8,11,14,17-HEXAOXANONADECAN-19-AMINE
CAS:184357-46-8
Formula: COCCOCCOCCOCCOCCOCCN
BD434540
95+%
MFCD16619273
2,5,8,11,14,17-HEXAOXANONADECAN-19-OL
CAS:23601-40-3
Formula: COCCOCCOCCOCCOCCOCCO
BD133156
98%
MFCD00045996
2,5,8,11,14,17-HEXAOXANONADECANE-19-THIOL
CAS:441771-60-4
Formula: COCCOCCOCCOCCOCCOCCS
BD434581
95+%
MFCD16619311
2,5,8,11,14,17-HEXAOXAOCTADECANE
CAS:1191-87-3
Formula: COCCOCCOCCOCCOCCOC
BD304163
95+%
MFCD00055429
2,5,8,11,14-PENTAOXABICYCLO[13.4.0]NONADECA-1(15),16,18-TRIENE-17-CARBALDEHYDE
CAS:60835-73-6
Formula: O=CC(C=C1)=CC2=C1OCCOCCOCCOCCO2
BD634346
98%
MFCD00192180
2,5,8,11,14-Pentaoxaheptadec-16-yne
CAS:1101668-39-6
Formula: COCCOCCOCCOCCOCC#C
BD00775138
98% GC
MFCD28155212
2,5,8,11,14-PENTAOXAHEPTADECAN-17-OIC ACID
CAS:81836-43-3
Formula: COCCOCCOCCOCCOCCC(O)=O
BD434637
98%
MFCD20926398
2,5,8,11,14-PENTAOXAHEXADECAN-16-AMINE
CAS:5498-83-9
Formula: COCCOCCOCCOCCOCCN
BD434599
95+%
MFCD27977523
2,5,8,11,14-PENTAOXAHEXADECAN-16-YL 4-METHYLBENZENESULFONATE
CAS:80755-67-5
Formula: O=S(C1=CC=C(C)C=C1)(OCCOCCOCCOCCOCCOC)=O
BD00937052
95%
n/a
2,5,8,11,14-PENTAOXAHEXADECANE-16-THIOL
CAS:524030-00-0
Formula: COCCOCCOCCOCCOCCS
BD434594
95+%
MFCD16619320
2,5,8,11,14-PENTAOXAOCTADECANE
CAS:76058-48-5
Formula: COCCOCCOCCOCCOCCCC
BD628896
97%
2,5,8,11,14-PENTAOXAPENTADECANE
CAS:143-24-8
Formula: COCCOCCOCCOCCOC
BD153379
97%
MFCD00008505
2,5,8,11-TETRA-TERT-BUTYLPERYLENE
CAS:80663-92-9
Formula: CC(C1=CC2=C(C(C3=C4C5=CC(C(C)(C)C)=CC4=CC(C(C)(C)C)=C3)=CC(C(C)(C)C)=C2)C5=C1)(C)C
BD00821768
97% HPLC
MFCD09835379
2,5,8,11-TETRAMETHYL-1,4,7,10-TETRAAZACYCLODODECANE
CAS:494751-27-8
Formula: CC1NCC(C)NCC(C)NCC(C)NC1
BD226538
98%
MFCD22421604
2,5,8,11-TETRAOXADODECANE
CAS:112-49-2
Formula: COCCOCCOCCOC
BD155228
95% (stabilized with BHT)
MFCD00008504
2,5,8,11-TETRAOXATETRADECAN-14-AL
CAS:197513-96-5
Formula: COCCOCCOCCOCCC=O
BD632799
97%
2,5,8,11-TETRAOXATETRADECAN-14-OIC ACID
CAS:67319-28-2
Formula: COCCOCCOCCOCCC(O)=O
BD434617
95+%
MFCD11041124
2,5,8,11-TETRAOXATETRADECAN-14-OL
CAS:145526-76-7
Formula: COCCOCCOCCOCCCO
BD00999303
95%
MFCD26911025
2,5,8,11-TETRAOXATRIDECAN-13-OIC ACID
CAS:16024-60-5
Formula: COCCOCCOCCOCC(O)=O
BD00961888
95%
MFCD25959645
2,5,8,11-TETRAOXATRIDECAN-13-OL
CAS:23783-42-8
Formula: COCCOCCOCCOCCO
BD7139
98%
MFCD00041756
2,5,8,11-TETRAOXATRIDECAN-13-YL 4-METHYLBENZENESULFONATE
CAS:62921-76-0
Formula: O=S(C1=CC=C(C)C=C1)(OCCOCCOCCOCCOC)=O
BD768012
95%
MFCD11041134
2,5,8,11-TETRAOXATRIDECANE-13-THIOL
CAS:52190-55-3
Formula: COCCOCCOCCOCCS
BD67308
95+%
MFCD07778621
2,5,8-TRICHLOROQUINAZOLINE
CAS:67092-22-2
Formula: ClC1=CC=C(Cl)C2=CN=C(Cl)N=C12
BD633830
97%
MFCD30471469
2,5,8-TRIMETHOXY-4-METHYLQUINOLIN-6-AMINE
CAS:49584-51-2
Formula: NC1=CC(OC)=C2N=C(OC)C=C(C)C2=C1OC
BD625444
97%
2,5,8-TRIMETHYL-[1,2,4]TRIAZOLO[1,5-A]PYRAZINE
CAS:54410-76-3
Formula: CC1=NC=C(C)N2C1=NC(C)=N2
BD249597
95+%
MFCD18971092
2,5,8-TRIMETHYLQUINOLINE
CAS:102871-69-2
Formula: CC1=C2N=C(C)C=CC2=C(C)C=C1
BD282757
95+%
MFCD09787532
2,5-ANHYDRO-D-MANNITOL
CAS:41107-82-8
Formula: O[C@@H]1[C@@H](CO)O[C@H](CO)[C@H]1O
BD67313
97%
MFCD00012443
2,5-BIS(2,2'-BIPYRIDIN-6-YL)-1,1-DIMETHYL-3,4-DIPHENYLSILOLE
CAS:350042-00-1
Formula: C[Si]1(C)C(C2=CC=CC(C3=NC=CC=C3)=N2)=C(C4=CC=CC=C4)C(C5=CC=CC=C5)=C1C6=CC=CC(C7=NC=CC=C7)=N6
BD00800203
98% HPLC,N
2,5-BIS(2,2,2-TRIFLUOROETHOXY)-N'-[3-(TRIFLUOROMETHYL)BENZOYL]BENZOHYDRAZIDE
CAS:477872-45-0
Formula: O=C(NNC(C1=CC=CC(C(F)(F)F)=C1)=O)C2=CC(OCC(F)(F)F)=CC=C2OCC(F)(F)F
BD00858367
90%
MFCD02083380
2,5-BIS(2,2,2-TRIFLUOROETHOXY)ANILINE
CAS:66300-37-6
Formula: NC1=CC(OCC(F)(F)F)=CC=C1OCC(F)(F)F
BD334971
95+%
MFCD28291791
2,5-BIS(2,2,2-TRIFLUOROETHOXY)BENZENE-1-SULFONYL CHLORIDE
CAS:152457-95-9
Formula: O=S(C1=CC(OCC(F)(F)F)=CC=C1OCC(F)(F)F)(Cl)=O
BD12573
95%
MFCD00052841
2,5-BIS(2,2,2-TRIFLUOROETHOXY)BENZOHYDRAZIDE
CAS:50778-75-1
Formula: O=C(NN)C1=CC(OCC(F)(F)F)=CC=C1OCC(F)(F)F
BD12936
95+%
MFCD00221192
2,5-BIS(2,2,2-TRIFLUOROETHOXY)BENZOIC ACID
CAS:35480-52-5
Formula: OC(=O)C1=C(OCC(F)(F)F)C=CC(OCC(F)(F)F)=C1
BD20400
98%
MFCD00221424
2,5-BIS(2,4,4-TRIMETHYLPENTAN-2-YL)BENZENE-1,4-DIOL
CAS:903-19-5
Formula: OC1=CC(C(CC(C)(C)C)(C)C)=C(O)C=C1C(CC(C)(C)C)(C)C
BD67320
95%
MFCD00128797
2,5-BIS(2-ETHYLHEXYL)-3,6-BIS(5''-HEXYL-[2,2':5',2''-TERTHIOPHEN]-5-YL)PYRROLO[3,4-C]PYRROLE-1,4(2H,5H)-DIONE
CAS:1093468-95-1
Formula: O=C1N(CC(CC)CCCC)C(C2=CC=C(C3=CC=C(C4=CC=C(CCCCCC)S4)S3)S2)=C5C1=C(C6=CC=C(C7=CC=C(C8=CC=C(CCCCCC)S8
BD449023
97%
MFCD16621139
2,5-BIS(2-ETHYLHEXYL)-3,6-BIS(5-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)THIOPHEN-2-YL)PYRROLO[3,4-C]PYRROLE-1,4(2H,5H)-DIONE
CAS:1269004-46-7
Formula: O=C1N(CC(CC)CCCC)C(C2=CC=C(B3OC(C)(C)C(C)(C)O3)S2)=C4C1=C(C5=CC=C(B6OC(C)(C)C(C)(C)O6)S5)N(CC(CC)CCC
BD262608
95+%
2,5-BIS(2-ETHYLHEXYL)-3,6-BIS(5-(TRIMETHYLSTANNYL)THIOPHEN-2-YL)PYRROLO[3,4-C]PYRROLE-1,4(2H,5H)-DIONE
CAS:1392422-47-7
Formula: O=C1N(CC(CC)CCCC)C(C2=CC=C([Sn](C)(C)C)S2)=C3C1=C(C4=CC=C([Sn](C)(C)C)S4)N(CC(CC)CCCC)C3=O
BD293567
95+%
MFCD29919054
2,5-BIS(2-ETHYLHEXYL)-3,6-DI(THIOPHEN-2-YL)PYRROLO[3,4-C]PYRROLE-1,4(2H,5H)-DIONE
CAS:1185885-86-2
Formula: O=C1N(CC(CC)CCCC)C(C2=CC=CS2)=C3C1=C(C4=CC=CS4)N(CC(CC)CCCC)C3=O
BD254710
95+%
MFCD22200076
2,5-BIS(2-OCTYLDODECYL)-3,6-DI(THIOPHEN-2-YL)PYRROLO[3,4-C]PYRROLE-1,4(2H,5H)-DIONE
CAS:1267540-02-2
Formula: O=C1N(CC(CCCCCCCC)CCCCCCCCCC)C(C2=CC=CS2)=C3C1=C(C4=CC=CS4)N(CC(CCCCCCCC)CCCCCCCCCC)C3=O
BD318473
95+%
MFCD29919383
2,5-BIS(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)FURAN
CAS:476004-83-8
Formula: CC1(C)C(C)(C)OB(C2=CC=C(B3OC(C)(C)C(C)(C)O3)O2)O1
BD01072598
97%
MFCD11504967
2,5-BIS(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)THIENO[3,2-B]THIOPHENE
CAS:924894-85-9
Formula: CC1(C)C(C)(C)OB(C(S2)=CC3=C2C=C(B4OC(C)(C)C(C)(C)O4)S3)O1
BD226625
97%
MFCD22200472
2,5-BIS(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)THIOPHENE
CAS:175361-81-6
Formula: CC1(C)C(C)(C)OB(C2=CC=C(B3OC(C)(C)C(C)(C)O3)S2)O1
BD273711
97%
MFCD09800563
2,5-BIS(4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PHENYL)-1,3,4-OXADIAZOLE
CAS:1116122-85-0
Formula: CC1(C)C(C)(C)OB(C2=CC=C(C3=NN=C(C4=CC=C(B5OC(C)(C)C(C)(C)O5)C=C4)O3)C=C2)O1
BD303076
95+%
MFCD25460334
2,5-BIS(4-BROMOPHENYL)-1,1-DIMETHYL-3,4-DIPHENYLSILOLE
CAS:866769-99-5
Formula: C[Si]1(C)C(C2=CC=C(Br)C=C2)=C(C3=CC=CC=C3)C(C4=CC=CC=C4)=C1C5=CC=C(Br)C=C5
BD00801406
95% GC
2,5-BIS(4-BROMOPHENYL)-1,3,4-OXADIAZOLE
CAS:19542-05-3
Formula: BrC1=CC=C(C2=NN=C(C3=CC=C(Br)C=C3)O2)C=C1
BD303060
95%
MFCD00020715
2,5-BIS(4-CHLOROPHENYL)-1,3,4-OXADIAZOLE
CAS:2491-90-9
Formula: ClC1=CC=C(C2=NN=C(C3=CC=C(Cl)C=C3)O2)C=C1
BD67340
95+%
MFCD00050998
2,5-BIS(4-DIETHYLAMINOPHENYL)-1,3,4-OXADIAZOLE
CAS:1679-98-7
Formula: CCN(C1=CC=C(C2=NN=C(C3=CC=C(N(CC)CC)C=C3)O2)C=C1)CC
BD306194
99+%
MFCD00010070
2,5-BIS(4-FLUOROPHENYL)THIOPHENE-3-CARBONITRILE
CAS:908588-07-8
Formula: N#CC1=C(C2=CC=C(F)C=C2)SC(C3=CC=C(F)C=C3)=C1
BD00816098
95%
MFCD30188515
2,5-BIS(5-(TERT-BUTYL)BENZO[D]OXAZOL-2-YL)THIOPHENE
CAS:7128-64-5
Formula: CC(C)(C)C1=CC2=C(OC(=N2)C2=CC=C(S2)C2=NC3=C(O2)C=CC(=C3)C(C)(C)C)C=C1
BD22336
98%
MFCD00005774
2,5-BIS(BENZYLOXY)BENZALDEHYDE
CAS:6109-54-2
Formula: O=CC1=CC(OCC2=CC=CC=C2)=CC=C1OCC3=CC=CC=C3
BD182530
97+%
MFCD02380367
2,5-BIS(BENZYLOXY)BENZOIC ACID
CAS:67127-91-7
Formula: O=C(O)C1=CC(OCC2=CC=CC=C2)=CC=C1OCC3=CC=CC=C3
BD34573
98%
MFCD00156981
2,5-BIS(BROMOMETHYL)TEREPHTHALONITRILE
CAS:64746-04-9
Formula: N#CC1=CC(CBr)=C(C#N)C=C1CBr
BD01110965
97%
n/a
2,5-BIS(CHLOROMETHYL)THIOPHENE
CAS:28569-48-4
Formula: ClCC1=CC=C(CCl)S1
BD247159
95%
MFCD18071600
2,5-BIS(ETHYLAMINO)NICOTINONITRILE
CAS:1346809-31-1
Formula: N#CC1=C(NCC)N=CC(NCC)=C1
BD252541
95+%
MFCD19688662
2,5-BIS(HEXYLOXY)TEREPHTHALALDEHYDE
CAS:151903-52-5
Formula: O=CC1=CC(OCCCCCC)=C(C=O)C=C1OCCCCCC
BD01139984
98%
2,5-BIS(METHYLSULFONYL)BENZONITRILE
CAS:1820608-13-6
Formula: N#CC1=CC(S(=O)(C)=O)=CC=C1S(=O)(C)=O
BD452469
98%
MFCD28096642
2,5-BIS(METHYLTHIO)PYRIMIDINE
CAS:1510108-85-6
Formula: CSC1=CN=C(SC)N=C1
BD00937843
95%
MFCD30222298
2,5-BIS(MORPHOLINOMETHYL)-1,4-PHENYLENE DIACETATE
CAS:1865-04-9
Formula: CC(OC1=CC(CN2CCOCC2)=C(OC(C)=O)C=C1CN3CCOCC3)=O
BD240885
95+%
MFCD22683207
2,5-BIS(OCTYLOXY)TEREPHTHALALDEHYDE
CAS:123440-34-6
Formula: O=CC1=CC(OCCCCCCCC)=C(C=O)C=C1OCCCCCCCC
BD01186343
98%
2,5-BIS(TRIETHOXYSILYL)THIOPHENE
CAS:40190-22-5
Formula: CCO[Si](C1=CC=C([Si](OCC)(OCC)OCC)S1)(OCC)OCC
BD251995
95+%
MFCD25976449
2,5-BIS(TRIFLUOROMETHYL)-1,3,4-OXADIAZOLE
CAS:1868-48-0
Formula: FC(C1=NN=C(C(F)(F)F)O1)(F)F
BD2148
97%
n/a
2,5-BIS(TRIFLUOROMETHYL)-1H-BENZO[D]IMIDAZOLE
CAS:399-69-9
Formula: FC(C1=CC=C2NC(C(F)(F)F)=NC2=C1)(F)F
BD248475
95+%
2,5-BIS(TRIFLUOROMETHYL)ANILINE
CAS:328-93-8
Formula: C1=C(C(=CC=C1C(F)(F)F)C(F)(F)F)N
BD5773
98%
MFCD00074940
2,5-BIS(TRIFLUOROMETHYL)BENZALDEHYDE
CAS:395-64-2
Formula: O=CC1=CC(C(F)(F)F)=CC=C1C(F)(F)F
BD7165
97%
MFCD00674087
2,5-BIS(TRIFLUOROMETHYL)BENZENE-1-SULFONYL CHLORIDE
CAS:351003-22-0
Formula: O=S(C1=CC(C(F)(F)F)=CC=C1C(F)(F)F)(Cl)=O
BD67361
97%
MFCD03094042
2,5-BIS(TRIFLUOROMETHYL)BENZENEBORONIC ACID
CAS:196083-18-8
Formula: OB(C1=CC(C(F)(F)F)=CC=C1C(F)(F)F)O
BD67360
98%
MFCD04038223
2,5-BIS(TRIFLUOROMETHYL)BENZENESULFONAMIDE
CAS:951625-11-9
Formula: O=S(C1=CC(C(F)(F)F)=CC=C1C(F)(F)F)(N)=O
BD188768
98%
MFCD09475420
2,5-BIS(TRIFLUOROMETHYL)BENZOIC ACID
CAS:42580-42-7
Formula: O=C(O)C1=CC(C(F)(F)F)=CC=C1C(F)(F)F
BD7168
98%
MFCD00013249
2,5-BIS(TRIFLUOROMETHYL)BENZONITRILE
CAS:51012-27-2
Formula: N#CC1=CC(C(F)(F)F)=CC=C1C(F)(F)F
BD67363
95+%
MFCD03094423
2,5-BIS(TRIFLUOROMETHYL)BENZOYLCHLORIDE
CAS:393-82-8
Formula: O=C(Cl)C1=CC(C(F)(F)F)=CC=C1C(F)(F)F
BD67364
MFCD00074997
2,5-BIS(TRIFLUOROMETHYL)BENZYLAMINE
CAS:771582-21-9
Formula: NCC1=CC(C(F)(F)F)=CC=C1C(F)(F)F
BD00838912
98%
2,5-BIS(TRIFLUOROMETHYL)CINNAMIC ACID
CAS:312619-48-0
Formula: O=C(O)/C=C/C1=CC(C(F)(F)F)=CC=C1C(F)(F)F
BD307869
95+%
MFCD00799486
2,5-BIS(TRIFLUOROMETHYL)FLUOROBENZENE
CAS:887268-08-8
Formula: FC(C1=CC=C(C(F)(F)F)C(F)=C1)(F)F
BD309562
95%
MFCD03412236
2,5-BIS(TRIFLUOROMETHYL)PHENOL
CAS:779-88-4
Formula: OC1=CC(C(F)(F)F)=CC=C1C(F)(F)F
BD10847
98%
MFCD04973414
2,5-BIS(TRIFLUOROMETHYL)PYRIDINE
CAS:20857-44-7
Formula: FC(C1=CN=C(C(F)(F)F)C=C1)(F)F
BD318972
95+%
MFCD00128906
2,5-BIS(TRIFLUOROMETHYL)PYRROLIDINE
CAS:1240526-63-9
Formula: FC(C1CCC(C(F)(F)F)N1)(F)F
BD01082073
95%
MFCD16547763
2,5-BIS(TRIMETHYLSILYL)THIAZOLE
CAS:79265-34-2
Formula: C[Si](C1=CN=C([Si](C)(C)C)S1)(C)C
BD67378
95%
MFCD09800395
2,5-BIS(TRIMETHYLSTANNYL)THIENO[3,2-B]THIOPHENE
CAS:469912-82-1
Formula: C[Sn](C(S1)=CC2=C1C=C([Sn](C)(C)C)S2)(C)C
BD305825
98%
MFCD22200503
2,5-BIS-(TRIFLUOROMETHYL)PYRAZINE
CAS:1365988-35-7
Formula: FC(C1=CN=C(C(F)(F)F)C=N1)(F)F
BD323148
95+%
MFCD21602144
2,5-BIS[(4-BUTOXYBENZOYL)OXY]-BENZOIC ACID
CAS:205689-93-6
Formula: O=C(O)C1=CC(OC(C2=CC=C(OCCCC)C=C2)=O)=CC=C1OC(C3=CC=C(OCCCC)C=C3)=O
BD00794869
95%
2,5-BIS[(4-NITROBENZYL)THIO]-1,3,4-THIADIAZOLE
CAS:101291-96-7
Formula: [O-][N+](C1=CC=C(C=C1)CSC2=NN=C(S2)SCC3=CC=C([N+]([O-])=O)C=C3)=O
BD00845695
95%
MFCD00361561
2,5-BIS[(DIMETHYLAMINO)METHYL]CYCLOPENTANONE
CAS:13290-51-2
Formula: O=C1C(CN(C)C)CCC1CN(C)C
BD171263
95+%
MFCD01210808
2,5-Bis[(trimethylsilyl)ethynyl]thieno[3,2-b]thiophene
CAS:139896-65-4
Formula: C[Si](C#CC(S1)=CC2=C1C=C(C#C[Si](C)(C)C)S2)(C)C
BD00780219
98% GC
2,5-BIS[(TRIMETHYLSILYL)ETHYNYL]THIOPHENE
CAS:79109-69-6
Formula: C[Si](C#CC1=CC=C(C#C[Si](C)(C)C)S1)(C)C
BD00797924
96% GC
MFCD18207392
2,5-BIS[[(TRANS-4-PENTYLCYCLOHEXYL)CARBONYL]OXY]BENZOIC ACID
CAS:360053-41-4
Formula: O=C(O)C1=CC(OC([C@H]2CC[C@H](CCCCC)CC2)=O)=CC=C1OC([C@H]3CC[C@H](CCCCC)CC3)=O
BD00797313
95%
2,5-BIS[[4-(DECYLOXY)BENZOYL]OXY]BENZOIC ACID
CAS:1448589-33-0
Formula: O=C(O)C1=CC(OC(C2=CC=C(OCCCCCCCCCC)C=C2)=O)=CC=C1OC(C3=CC=C(OCCCCCCCCCC)C=C3)=O
BD00774860
95%
2,5-BISPIPERIDIN-1-YLMETHYLBENZENE-1,4-DIOL
CAS:1753-68-0
Formula: OC1=CC(N2CCCCC2)=C(O)C(C)=C1N3CCCCC3
BD323388
95+%
MFCD00185950
2,5-DI([1,1'-BIPHENYL]-4-YL)-1,3,4-OXADIAZOLE
CAS:2043-06-3
Formula: C1(C2=CC=C(C3=CC=CC=C3)C=C2)=NN=C(C4=CC=C(C5=CC=CC=C5)C=C4)O1
BD67337
97%
MFCD00042666
2,5-DI([1,1'-BIPHENYL]-4-YL)THIOPHENE
CAS:56316-86-0
Formula: C1(C2=CC=C(C3=CC=CC=C3)C=C2)=CC=C(C4=CC=C(C5=CC=CC=C5)C=C4)S1
BD331654
95+%
2,5-DI(2-THIENYL)-1H-PYRROLE
CAS:89814-62-0
Formula: C1(C2=CC=CS2)=CC=C(C3=CC=CS3)N1
BD322191
95+%
2,5-DI(NAPHTHALEN-1-YL)-1,3,4-OXADIAZOLE
CAS:905-62-4
Formula: C1(C2=C3C=CC=CC3=CC=C2)=NN=C(C4=C5C=CC=CC5=CC=C4)O1
BD67325
97%
MFCD00045582
2,5-DI(THIOPHEN-2-YL)THIENO[3,2-B]THIOPHENE
CAS:21210-90-2
Formula: C1(C=C(C2=CC=CS2)S3)=C3C=C(C4=CC=CS4)S1
BD262634
94%
MFCD11114556
2,5-DI-TERT-BUTYL PYRIDINE-2,5-DICARBOXYLATE
CAS:1414029-44-9
Formula: O=C(C1=NC=C(C(OC(C)(C)C)=O)C=C1)OC(C)(C)C
BD326476
98%
MFCD22574962
2,5-DI-TERT-BUTYL-1H-PYRROLE
CAS:3760-56-3
Formula: CC(C1=CC=C(C(C)(C)C)N1)(C)C
BD67895
95+%
MFCD00233173
2,5-DI-TERT-BUTYLANILINE
CAS:21860-03-7
Formula: NC1=CC(C(C)(C)C)=CC=C1C(C)(C)C
BD67897
95%
MFCD00010338
2,5-DI-TERT-BUTYLCYCLOHEXA-2,5-DIENE-1,4-DIONE
CAS:2460-77-7
Formula: O=C(C(C(C)(C)C)=C1)C=C(C(C)(C)C)C1=O
BD67900
98%
MFCD00019442
2,5-DI-TERT-BUTYLFURAN
CAS:4789-40-6
Formula: CC(C1=CC=C(C(C)(C)C)O1)(C)C
BD268849
95+%
2,5-DI-TERT-BUTYLHYDROQUINONE
CAS:88-58-4
Formula: C1=C(O)C(=CC(=C1C(C)(C)C)O)C(C)(C)C
BD22988
98%
MFCD00008825
2,5-DI-TERT-PENTYLBENZENE-1,4-DIOL
CAS:79-74-3
Formula: OC1=CC(C(C)(C)CC)=C(O)C=C1C(C)(C)CC
BD67894
93%
MFCD00027029
2,5-DI-TERT-PENTYLCYCLOHEXA-2,5-DIENE-1,4-DIONE
CAS:4584-63-8
Formula: O=C1C(C(C)(C)CC)=CC(C(C(C)(C)CC)=C1)=O
BD67893
95%
MFCD00142843
2,5-DIACETOXYHEXANE
CAS:10299-35-1
Formula: CC(OC(C)=O)CCC(OC(C)=O)C
BD00780608
98% GC
MFCD09038521
2,5-DIACETOXYTOLUENE
CAS:717-27-1
Formula: CC1=CC(OC(C)=O)=CC=C1OC(C)=O
BD0548
MFCD00061098
2,5-DIAMINEPYRIMIDINE
CAS:22715-27-1
Formula: C1=C(N)C=NC(=N1)N
BD41477
95%
MFCD00129726
2,5-DIAMINO-2-METHYLPENTANOIC ACID HYDROCHLORIDE
CAS:52372-32-4
Formula: O=C(O)C(C)(N)CCCN.[H]Cl
BD67386
97%
MFCD00012916
2,5-DIAMINO-3-BROMOBENZONITRILE
CAS:82997-65-7
Formula: N#CC1=CC(N)=CC(Br)=C1N
BD327776
95+%
MFCD22205744
2,5-DIAMINO-3-CHLOROBENZONITRILE
CAS:82997-64-6
Formula: N#CC1=CC(N)=CC(Cl)=C1N
BD67387
97%
MFCD08704820
2,5-DIAMINO-4,6-DICHLOROPYRIMIDINE
CAS:55583-59-0
Formula: ClC1=C(N)C(Cl)=NC(N)=N1
BD9440
98%
MFCD00792652
2,5-DIAMINO-4,6-DIHYDROXYPYRIMIDINE HYDROCHLORIDE
CAS:56830-58-1
Formula: Cl.NC1=NC(O)=C(N)C(O)=N1
BD2319
98%
MFCD00082893
2,5-DIAMINO-6-NITROQUINAZOLIN-4(3H)-ONE
CAS:103884-20-4
Formula: OC1=C2C(N)=C([N+]([O-])=O)C=CC2=NC(N)=N1
BD633821
97%
MFCD30471464
2,5-DIAMINO-9H-FLUOREN-9-ONE
CAS:46487-37-0
Formula: O=C1C2=C(C3=C1C=CC=C3N)C=CC(N)=C2
BD625387
97%
2,5-DIAMINOADIPIC ACID DIHYDROCHLORIDE
CAS:52408-04-5
Formula: O=C(O)C(N)CCC(N)C(O)=O.[H]Cl.[H]Cl
BD33920
95+%
MFCD09836090
2,5-DIAMINOBENZENE-1,3-DISULFONIC ACID
CAS:6409-48-9
Formula: O=S(C1=CC(N)=CC(S(=O)(O)=O)=C1N)(O)=O
BD67382
95+%
MFCD06200774
2,5-DIAMINOBENZENE-1,4-DIOL DIHYDROCHLORIDE
CAS:24171-03-7
Formula: OC1=CC(N)=C(O)C=C1N.[H]Cl.[H]Cl
BD67384
95+%
MFCD00239416
2,5-DIAMINOBENZENE-1,4-DISULFONIC ACID
CAS:7139-89-1
Formula: O=S(C1=CC(N)=C(S(=O)(O)=O)C=C1N)(O)=O
BD54804
97%
MFCD00272406
2,5-DIAMINOBENZENE-1,4-DITHIOL DIHYDROCHLORIDE
CAS:75464-52-7
Formula: SC1=CC(N)=C(S)C=C1N.[H]Cl.[H]Cl
BD3716
97%
MFCD00142835
2,5-DIAMINOBENZENESULFONAMIDE
CAS:20896-44-0
Formula: O=S(C1=CC(N)=CC=C1N)(N)=O
BD261177
97%
MFCD16618593
2,5-DIAMINOBENZENESULFONIC ACID
CAS:88-45-9
Formula: O=S(C1=CC(N)=CC=C1N)(O)=O
BD35286
95+%
MFCD00007904
2,5-DIAMINOBENZOIC ACID
CAS:610-74-2
Formula: NC1=CC(C(O)=O)=C(N)C=C1
BD4954
97%
MFCD00127689
2,5-DIAMINOBENZOIC ACID DIHYDROCHLORIDE
CAS:1158259-09-6
Formula: O=C(O)C1=CC(N)=CC=C1N.[H]Cl.[H]Cl
BD408546
96%
MFCD01596222
2,5-DIAMINOBENZONITRILE
CAS:14346-13-5
Formula: N#CC1=CC(N)=CC=C1N
BD4803
97%
MFCD00077966
2,5-DIAMINONICOTINONITRILE
CAS:1184645-19-9
Formula: N#CC1=C(N)N=CC(N)=C1
BD586087
97%
MFCD12768824
2,5-DIAMINOPHENOL DIHYDROCHLORIDE
CAS:89691-80-5
Formula: OC1=CC(N)=CC=C1N.[H]Cl.[H]Cl
BD414855
95+%
MFCD00035513
2,5-DIAMINOPYRIDINE DIHYDROCHLORIDE
CAS:26878-35-3
Formula: NC1=CN=C(N)C=C1.[H]Cl.[H]Cl
BD19851
97%
MFCD00040818
2,5-DIAMINOPYRIDINE HYDROCHLORIDE
CAS:119261-84-6
Formula: NC1=CN=C(N)C=C1.[H]Cl
BD216688
95+%
MFCD09753741
2,5-DIAMINOPYRIMIDIN-4(3H)-ONE
CAS:77994-12-8
Formula: O=C1NC(N)=NC=C1N
BD271107
95+%
MFCD18427067
2,5-DIAMINOPYRIMIDINE-4,6-DIOL
CAS:40769-69-5
Formula: NC1=NC(O)=C(N)C(O)=N1
BD5435
95+%
MFCD02094729
2,5-DIAMINOPYRIMIDINE-4-CARBOXYLIC ACID
CAS:1260859-20-8
Formula: O=C(C1=NC(N)=NC=C1N)O
BD222354
95+%
MFCD13193549
2,5-DIAMINOTEREPHTHALIC ACID
CAS:945-30-2
Formula: O=C(O)C1=CC(N)=C(C(O)=O)C=C1N
BD221961
95+%
MFCD00464161
2,5-DIAMINOTEREPHTHALONITRILE
CAS:75636-88-3
Formula: N#CC1=CC(N)=C(C#N)C=C1N
BD546082
97%
MFCD18806057
2,5-DIAMINOTHIAZOLO[4,5-D]PYRIMIDIN-7(6H)-ONE
CAS:22288-77-3
Formula: NC1=NC2=C(S1)C(=O)NC(N)=N2
BD237686
95+%
MFCD09753539
2,5-DIAZABICYCLO[2.2.1]HEPTANE
CAS:672-28-6
Formula: C1(C2)NCC2NC1
BD254130
MFCD08693700
2,5-DIAZABICYCLO[2.2.1]HEPTANE DIHYDROCHLORIDE
CAS:89487-38-7
Formula: [H]Cl.[H]Cl.C1(C2)NCC2NC1
BD33927
98%
MFCD26142215
2,5-DIAZABICYCLO[2.2.2]OCTANE
CAS:658-24-2
Formula: C1(CC2)NCC2NC1
BD225959
95+%
MFCD08694643
2,5-DIAZABICYCLO[2.2.2]OCTANE DIHYDROCHLORIDE
CAS:1192-92-3
Formula: C1(CC2)NCC2NC1.[H]Cl.[H]Cl
BD268704
96%
MFCD11506237
2,5-DIAZABICYCLO[2.2.2]OCTANE-3,6-DIONE
CAS:1004-98-4
Formula: O=C(C1N2)NC(CC1)C2=O
BD317197
95+%
MFCD18086974
2,5-DIAZABICYCLO[4.1.0]HEPTANE
CAS:87640-95-7
Formula: C12NCCNC1C2
BD00811291
97%
n/a
2,5-DIAZABICYCLO[4.2.0]OCTANE BIS(2,2,2-TRIFLUOROACETATE)
CAS:936706-47-7
Formula: O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.C12NCCNC1CC2
BD00801737
97%
2,5-DIAZASPIRO[3.4]OCTAN-6-ONE
CAS:1373028-77-3
Formula: O=C(CC1)NC21CNC2
BD570341
97%
MFCD22209694
2,5-DIAZASPIRO[3.4]OCTAN-6-ONE HYDROCHLORIDE
CAS:1630906-86-3
Formula: O=C(CC1)NC21CNC2.[H]Cl
BD300631
95+%
2,5-DIBENZYLIDENECYCLOPENTANONE
CAS:895-80-7
Formula: O=C1/C(CC/C1=C\C2=CC=CC=C2)=C/C3=CC=CC=C3
BD67414
98%
2,5-DIBENZYLOCTAHYDROPYRROLO[3,4-C]PYRROLE
CAS:165894-00-8
Formula: N1(CC2=CC=CC=C2)CC(CN(CC3=CC=CC=C3)C4)C4C1
BD249386
98%
2,5-DIBENZYLTETRAHYDROPYRROLO[3,4-C]PYRROLE-1,3(2H,3AH)-DIONE
CAS:165893-99-2
Formula: O=C(C1C2CN(CC3=CC=CC=C3)C1)N(CC4=CC=CC=C4)C2=O
BD27701
95+%
MFCD09037882
2,5-DIBROMO-[1,2,4]TRIAZOLO[1,5-A]PYRIDINE
CAS:1214901-64-0
Formula: BrC1=CC=CC2=NC(Br)=NN12
BD245331
95+%
MFCD20527883
2,5-DIBROMO-1,1,3,4-TETRAPHENYLSILOLE
CAS:200068-36-6
Formula: BrC1=C(C2=CC=CC=C2)C(C3=CC=CC=C3)=C(Br)[Si]1(C4=CC=CC=C4)C5=CC=CC=C5
BD00808783
98% GC
2,5-DIBROMO-1,1-DIMETHYL-3,4-DIPHENYLSILOLE
CAS:686290-22-2
Formula: C[Si]1(C)C(Br)=C(C2=CC=CC=C2)C(C3=CC=CC=C3)=C1Br
BD00754962
98% GC
2,5-DIBROMO-1,3,4-THIADIAZOLE
CAS:55981-29-8
Formula: BrC1=NN=C(Br)S1
BD223435
98%
MFCD00466397
2,5-DIBROMO-1,3-DICHLOROBENZENE
CAS:19393-97-6
Formula: ClC1=C(Br)C(Cl)=CC(Br)=C1
BD254348
95+%
MFCD07780709
2,5-DIBROMO-1,3-DIFLUOROBENZENE
CAS:128259-71-2
Formula: FC1=C(Br)C(F)=CC(Br)=C1
BD260769
98%
MFCD07783665
2,5-DIBROMO-1,3-DIMETHYLBENZENE
CAS:100189-84-2
Formula: CC1=CC(Br)=CC(C)=C1Br
BD67458
98%
MFCD00079745
2,5-DIBROMO-1,4-DIMETHYL-1H-IMIDAZOLE
CAS:850429-58-2
Formula: CC1=C(Br)N(C)C(Br)=N1
BD67419
98%
MFCD06659900
2,5-DIBROMO-1-(ETHOXYMETHYL)-4-NITRO-1H-IMIDAZOLE
CAS:1100750-08-0
Formula: O=[N+]([O-])C1=C(N(C(Br)=N1)COCC)Br
BD00949711
95+%
MFCD11877990
2,5-DIBROMO-1-CHLORO-3-FLUOROBENZENE
CAS:1000572-88-2
Formula: FC1=C(Br)C(Cl)=CC(Br)=C1
BD224247
97%
MFCD09878162
2,5-DIBROMO-1-METHYL-1H-IMIDAZOLE
CAS:53857-59-3
Formula: CN1C(Br)=CN=C1Br
BD67420
96%
MFCD01632217
2,5-DIBROMO-1-METHYL-1H-IMIDAZOLE-4-CARBONITRILE
CAS:1799420-96-4
Formula: N#CC1=C(Br)N(C)C(Br)=N1
BD297513
95+%
MFCD28805512
2,5-DIBROMO-1-TRITYL-1H-IMIDAZOLE
CAS:850429-53-7
Formula: BrC1=CN=C(Br)N1C(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4
BD67421
95%
MFCD04115731
2,5-DIBROMO-1H-IMIDAZOL-4-AMINE
CAS:1029720-13-5
Formula: NC1N=C(Br)NC=1Br
BD00752178
95+%
MFCD10001383
2,5-DIBROMO-1H-IMIDAZOLE
CAS:64591-03-3
Formula: BrC1=CN=C(Br)N1
BD66598
97%
MFCD02179517
2,5-DIBROMO-3,4,6-TRIFLUOROANILINE
CAS:232267-32-2
Formula: NC1=C(F)C(Br)=C(F)C(F)=C1Br
BD67422
95+%
MFCD01862003
2,5-DIBROMO-3,4,6-TRIFLUOROPHENOL
CAS:5510-39-4
Formula: OC1=C(F)C(Br)=C(F)C(F)=C1Br
BD257972
95+%
MFCD01861999
2,5-DIBROMO-3,4-DIHYDROXYBENZALDEHYDE
CAS:70625-28-4
Formula: O=CC1=CC(Br)=C(O)C(O)=C1Br
BD583903
97%
2,5-DIBROMO-3,4-DIMETHOXYBENZALDEHYDE
CAS:854660-03-0
Formula: O=CC1=CC(Br)=C(OC)C(OC)=C1Br
BD583905
97%
2,5-DIBROMO-3,4-DIMETHYL-THIOPHENE
CAS:74707-05-4
Formula: CC1=C(Br)SC(Br)=C1C
BD00833255
95%
MFCD13193229
2,5-DIBROMO-3,4-DINITROTHIOPHENE
CAS:52431-30-8
Formula: O=[N+](C1=C(Br)SC(Br)=C1[N+]([O-])=O)[O-]
BD67423
97%
MFCD00015537
2,5-DIBROMO-3,6-DIFLUOROANILINE
CAS:702640-60-6
Formula: NC1=C(F)C(Br)=CC(F)=C1Br
BD462962
97%
MFCD20484398
2,5-DIBROMO-3,6-DIFLUOROBENZALDEHYDE
CAS:1263377-10-1
Formula: O=CC1=C(F)C(Br)=CC(F)=C1Br
BD460671
97%
MFCD18379858
2,5-DIBROMO-3,6-DIFLUOROBENZAMIDE
CAS:1803713-73-6
Formula: O=C(N)C1=C(F)C(Br)=CC(F)=C1Br
BD485600
97%
MFCD28783322
2,5-DIBROMO-3,6-DIFLUOROBENZENE-1-SULFONYL CHLORIDE
CAS:207853-66-5
Formula: O=S(C1=C(F)C(Br)=CC(F)=C1Br)(Cl)=O
BD67425
95+%
MFCD00052364
2,5-DIBROMO-3,6-DIFLUOROBENZOIC ACID
CAS:1263376-61-9
Formula: O=C(O)C1=C(F)C(Br)=CC(F)=C1Br
BD468846
97%
MFCD18379859
2,5-DIBROMO-3,6-DIFLUOROBENZONITRILE
CAS:1806347-47-6
Formula: N#CC1=C(F)C(Br)=CC(F)=C1Br
BD461374
97%
MFCD28783420
2,5-DIBROMO-3,6-DIHYDROXYCYCLOHEXA-2,5-DIENE-1,4-DIONE
CAS:4370-59-6
Formula: O=C1C(Br)=C(O)C(C(Br)=C1O)=O
BD118722
95%
MFCD00058956
2,5-DIBROMO-3,6-DIMETHYLPYRIDINE
CAS:38749-93-8
Formula: CC1=C(Br)C=C(C)C(Br)=N1
BD248787
97%
MFCD00234281
2,5-DIBROMO-3-(2-ETHYLHEXYL)THIOPHENE
CAS:444177-63-3
Formula: CCCCC(CC)CC1=C(Br)SC(Br)=C1
BD254712
95+%
MFCD26743583
2,5-DIBROMO-3-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PYRIDINE
CAS:852228-17-2
Formula: BrC1=CN=C(Br)C(B(OC2(C)C)OC2(C)C)=C1
BD161577
95+%
MFCD08689613
2,5-DIBROMO-3-(BROMOMETHYL)PYRIDINE
CAS:61686-65-5
Formula: BrCC1=CC(Br)=CN=C1Br
BD284420
95+%
2,5-DIBROMO-3-(CHLOROMETHYL)PYRIDINE
CAS:N/A
Formula: ClCC1C(Br)=NC=C(Br)C=1
BD00738094
95%
2,5-DIBROMO-3-(DIFLUOROMETHYL)PYRIDIN-4-OL
CAS:1806838-73-2
Formula: OC1=C(C(F)F)C(Br)=NC=C1Br
BD489288
97%
MFCD25486085
2,5-DIBROMO-3-(ETHOXYCARBONYL)BENZOIC ACID
CAS:N/A
Formula: O=C(C1C(Br)=C(C(=O)OCC)C=C(Br)C=1)O
BD00750158
95%
2,5-DIBROMO-3-(METHOXYCARBONYL)BENZOIC ACID
CAS:N/A
Formula: O=C(C1C(Br)=C(C(=O)OC)C=C(Br)C=1)O
BD00770270
95%
2,5-DIBROMO-3-(TRIFLUOROMETHYL)PYRIDINE
CAS:79623-39-5
Formula: FC(C1=CC(Br)=CN=C1Br)(F)F
BD168963
97%
MFCD13185530
2,5-DIBROMO-3-BUTYLTHIOPHENE
CAS:116971-10-9
Formula: CCCCC1=C(Br)SC(Br)=C1
BD10624
97%
MFCD00672012
2,5-DIBROMO-3-CHLORO-4-METHYLPYRIDINE
CAS:1335050-94-6
Formula: CC1=C(Cl)C(Br)=NC=C1Br
BD258885
95+%
MFCD26743695
2,5-DIBROMO-3-CHLOROPYRAZINE
CAS:21943-16-8
Formula: ClC1=NC(Br)=CN=C1Br
BD215437
95+%
MFCD18250179
2,5-DIBROMO-3-CHLOROPYRIDINE
CAS:160599-70-2
Formula: ClC1=CC(Br)=CN=C1Br
BD32147
98%
MFCD08277306
2,5-DIBROMO-3-CYCLOHEXYLTHIOPHENE
CAS:302912-44-3
Formula: BrC1=CC(C2CCCCC2)=C(Br)S1
BD341904
97%
MFCD02683539
2,5-DIBROMO-3-DECYLTHIOPHENE
CAS:158956-23-1
Formula: CCCCCCCCCCC1=C(Br)SC(Br)=C1
BD5693
97%
MFCD00274314
2,5-DIBROMO-3-DODECYLTHIOPHENE
CAS:148256-63-7
Formula: CCCCCCCCCCCCC1=C(Br)SC(Br)=C1
BD8819
98%
MFCD00274315
2,5-DIBROMO-3-ETHYLTHIOPHENE
CAS:53119-57-6
Formula: CCC1=C(Br)SC(Br)=C1
BD247025
95+%
MFCD20486051
2,5-DIBROMO-3-FLUOROPYRIDINE
CAS:156772-60-0
Formula: FC1=CC(Br)=CN=C1Br
BD18605
98%
MFCD06659497
2,5-DIBROMO-3-HEXADECYLTHIOPHENE
CAS:178452-13-6
Formula: CCCCCCCCCCCCCCCCC1=C(Br)SC(Br)=C1
BD00826067
96% GC
2,5-DIBROMO-3-HEXYLTHIOPHENE
CAS:116971-11-0
Formula: CCCCCCC1=C(Br)SC(Br)=C1
BD0220
98%
MFCD00274313
2,5-DIBROMO-3-IODOPYRIDINE
CAS:1214383-63-7
Formula: IC1=CC(Br)=CN=C1Br
BD260510
95+%
MFCD13185519
2,5-DIBROMO-3-METHOXYBENZALDEHYDE
CAS:856767-02-7
Formula: O=CC1=CC(Br)=CC(OC)=C1Br
BD00839128
95%
MFCD27756695
2,5-DIBROMO-3-METHOXYPYRAZINE
CAS:489431-66-5
Formula: COC1=NC(Br)=CN=C1Br
BD158276
95+%
MFCD09909711
2,5-DIBROMO-3-METHOXYPYRIDINE
CAS:1142191-57-8
Formula: COC1=CC(Br)=CN=C1Br
BD197172
97%
MFCD12026746
2,5-DIBROMO-3-METHYLFURAN
CAS:89284-16-2
Formula: CC1=C(Br)OC(Br)=C1
BD238751
97%
MFCD11870160
2,5-DIBROMO-3-METHYLPYRAZINE
CAS:1260672-37-4
Formula: CC1=NC(Br)=CN=C1Br
BD302144
95+%
MFCD18250173
2,5-DIBROMO-3-METHYLPYRIDINE
CAS:3430-18-0
Formula: C1=C(Br)C=NC(=C1C)Br
BD3321
98%
MFCD02093085
2,5-DIBROMO-3-METHYLTHIOPHENE
CAS:13191-36-1
Formula: CC1=C(Br)SC(Br)=C1
BD67434
97%
MFCD00015470
2,5-DIBROMO-3-NITROPYRAZINE
CAS:1245645-88-8
Formula: O=[N+](C1=NC(Br)=CN=C1Br)[O-]
BD163047
95+%
MFCD18072686
2,5-DIBROMO-3-NITROPYRIDINE
CAS:15862-37-0
Formula: C1=C([N+]([O-])=O)C(=NC=C1Br)Br
BD18636
98%
MFCD09266223
2,5-DIBROMO-3-NITROTHIOPHENE
CAS:2160-51-2
Formula: O=[N+](C1=C(Br)SC(Br)=C1)[O-]
BD67436
95+%
MFCD06660778
2,5-DIBROMO-3-OCTYLTHIOPHENE
CAS:149703-84-4
Formula: CCCCCCCCC1=C(Br)SC(Br)=C1
BD0905
98%
MFCD00672013
2,5-DIBROMO-3-TETRADECYLTHIOPHENE
CAS:160096-74-2
Formula: CCCCCCCCCCCCCCC1=C(Br)SC(Br)=C1
BD00801958
97% GC
2,5-DIBROMO-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PYRIDINE
CAS:1451391-18-6
Formula: CC1(C)C(C)(C)OB(C2=CC(Br)=NC=C2Br)O1
BD217551
95+%
MFCD13181637
2,5-DIBROMO-4-(4-METHOXYPHENOXY)PYRIMIDINE
CAS:1298101-41-3
Formula: COC1=CC=C(OC2=NC(Br)=NC=C2Br)C=C1
BD269037
95+%
2,5-DIBROMO-4-(CHLOROMETHYL)THIAZOLE
CAS:934236-33-6
Formula: ClCC1=C(Br)SC(Br)=N1
BD248855
95+%
MFCD09265499
2,5-DIBROMO-4-(DIFLUOROMETHYL)PYRIDIN-3-OL
CAS:1806878-60-3
Formula: OC1=C(C(F)F)C(Br)=CN=C1Br
BD469848
97%
MFCD25486087
2,5-DIBROMO-4-(TRIFLUOROMETHYL)PYRIDINE
CAS:1099597-94-0
Formula: FC(C1=CC(Br)=NC=C1Br)(F)F
BD194601
97%
MFCD10699123