Phone (USA) +1 212-348-5610
Whatsapp: +1 516-336-9307
WeChat: chembuyersguide
Chemical Search

C/D/N Isotopes Inc.

Country: Canada

C/D/N Isotopes Inc.
88 Leacock Street
Pointe-Claire, Quebec
Canada H9R 1H1

Phone: (800) 565-4696
Phone 2: (514) 697-6254
FAX: (514) 697-6148
E-Mail:E-Mail this Supplier

Since 1993, C/D/N Isotopes has been a leading manufacturer of deuterium stable labeled compounds, providing our customers with superior quality and exceptional service. Researchers in all branches of science and medicine, from around the world, depend on us as the company for deuterium labeled compounds.

We have more than 3000 products in stock. As a result, we are able to ship most products within 24 to 48 hours after receipt of order. In fact, 98% of our orders are filled from stock.

The majority of the products listed on our website are manufactured exclusively by C/D/N Isotopes. Over the years, we have developed and expanded our expertise in the preparation of deuterated compounds, and we are continuously adding new products.

Most new products are the direct result of inquiries from our customers. Our extensive Custom Synthesis capabilities allow us to develop the products that our customers need, in a timely manner and at a reasonable price. Our Quality Control ensures that the isotopic enrichment and chemical purity of our products meet the highest standards.

Our courteous and helpful Customer Service professionals are available to assist you with all your stable labeled product requirements.

Product List: 3,033

PON:Page:1 |2 |3 |


Products for C/D/N Isotopes Inc.

MW: 273.39
97 atom % D
MW: 270.37
96 atom % D
Formula: C6D4(CD2Br)2
MW: 272.01
98 atom % D
Formula: C6D5CCl3
MW: 200.51
99 atom % D
Formula: C6D5CF3
MW: 151.14
99 atom % D
Formula: C6Cl6D6
MW: 296.87
99 atom % D
Formula: (CD3)2C(NH2)COOH
MW: 109.16
99 atom % D
MW: 283.37
MW: 290.41
99 atom % D
Formula: C6D5C(CD3)=CD2
MW: 128.24
98 atom % D
MW: 157.27
98 atom % D
Formula: H2NCD2CD2COOH
MW: 93.12
98 atom % D
Formula: HN(CD2CD2COOH)2
MW: 169.21
98 atom % D
Formula: C6Cl6D6
MW: 296.87
99 atom % D
MW: 104.14
98 atom % D
MW: 123.22
98 atom % D
MW: 120.18
99 atom % D
MW: 437.52
99 atom % D
MW: 165.22
99 atom % D
( R )-(-)-3-QUINUCLIDINOL-2,2,3,6,6,7,7-D7
MW: 134.23
98 atom % D
MW: 296.85
98 atom % D
( R )-(-)-METALAXYL-D6 (2,6-DIMETHYL-D6)
MW: 285.37
99 atom % D
( R )-(-)-PHENYLEPHRINE-2,4,6-D3 HCL
MW: 206.69
97 atom % D
MW: 165.6
96 atom % D
( RS )-MALIC-2,3,3-D3 ACID
MW: 137.11
98 atom % D
( S )-(+)-2-AMINO-1-PROPANOL-3,3,3-D3
Formula: CD3CH(NH2)CH2OH
MW: 78.13
99 atom % D
MW: 163.25
98 atom % D
MW: 457.62
99 atom % D
( S )-(-)-CARBIDOPA-D3 H2O (RING-D3)
Formula: (HO)2C6D3CH2C(CH3)(NHNH2)COOH
MW: 247.27
98 atom % D
( S )-(-)-MALIC-2,3,3-D3 ACID
MW: 137.11
98 atom % D
MW: 364.39
99 atom % D
MW: 443.57
98 atom % D
MW: 494.09
99 atom % D
MW: 165.6
94 atom % D
MW: 291.29
99 atom % D
MW: 345.71
99 atom % D
(±)- P -OCTOPAMINE-α,β,β-D3 HCL
Formula: HOC6H4CD(OH)CD2NH2
MW: 192.66
98 atom % D
(±)- SEC -BUTYL-1,1,1-D3 ALCOHOL
Formula: CH3CH2CH(OH)CD3
MW: 77.14
99 atom % D
(±)- SEC -BUTYL-3,3,4,4,4-D5 ALCOHOL
Formula: CD3CD2CH(OH)CH3
MW: 79.15
99 atom % D
Formula: CD3CD2CD(OH)CD3
MW: 83.18
98 atom % D
MW: 345.71
99 atom % D
Formula: C6H5CH(Br)CD3
MW: 188.08
98 atom % D
MW: 592.4
98 atom % D
Formula: CD3CD(Br)CD2Br
MW: 207.93
98 atom % D
Formula: CD3CDClCD2Cl
MW: 119.02
98 atom % D
MW: 137.19
98 atom % D
Formula: CH3CD(NH2)CD2NH2
MW: 77.14
99 atom % D
Formula: CD3CD(OH)CD2OH
MW: 82.13
98 atom % D
Formula: CH3CH(OD)CH2OD
MW: 78.11
98 atom % D
Formula: CD3CD(OD)CD2OD
MW: 84.14
98 atom % D
MW: 61.1
99 atom % D
MW: 108.13
98 atom % D
MW: 64.12
98 atom % D
MW: 160.27
98 atom % D
MW: 164.3
97 atom % D
MW: 144.26
98 atom % D
Formula: CD3CD(OH)CD2NH2
MW: 81.15
98 atom % D
Formula: (CD3)2CDCH(CH2CH3)CH2Br
MW: 186.14
99 atom % D
Formula: C6D5CH(OH)CH3
MW: 127.19
98 atom % D
Formula: C6H5CD(OH)CD3
MW: 126.19
98 atom % D
Formula: C6H5CD(OH)CH3
MW: 123.17
98 atom % D
Formula: C6H5CH(OH)CD3
MW: 125.18
98 atom % D
Formula: C6D5CD(OD)CD3
MW: 132.23
98 atom % D
Formula: CH3CH2CH(CD3)(CH2)16COOH
MW: 329.58
99 atom % D
MW: 238.08
98 atom % D
MW: 217.67
98 atom % D
Formula: C6H5COCH(CH3)NHCD2CD3•HCl
MW: 218.74
99 atom % D
Formula: CH3CH2CH2CD2CD(NH2)CD3
MW: 107.23
98 atom % D
Formula: CD3CD2CD(Br)CD3
MW: 146.07
99 atom % D
(±)-2-BROMOBUTYRIC-2,3,3,4,4,4-D6 ACID
Formula: CD3CD2CD(Br)COOH
MW: 173.04
98 atom % D
Formula: CD3CD(Br)COOH
MW: 157
98 atom % D
Formula: CD3CH(Br)COOH
MW: 155.99
98 atom % D
Formula: CD3CD2CD(Cl)CD3
MW: 101.62
98 atom % D
(±)-2-CHLOROBUTYRIC-2,3,3,4,4,4-D6 ACID
Formula: CD3CD2CD(Cl)COOH
MW: 128.59
98 atom % D
Formula: CD3CD(Cl)COCl
MW: 130.99
98 atom % D
Formula: CD3(CD2)3CD(CD2CD3)COOH
MW: 159.3
98 atom % D
Formula: CD3(CD2)3CD(CD2CD3)CD2OCOCH3<
MW: 189.37
98 atom % D
Formula: CD3(CD2)3CD(CD2CD3)CD2OH
MW: 147.33
98 atom % D
MW: 135.18
99 atom % D
Formula: CD3CD2CD(l)CD3
MW: 193.07
99 atom % D
Formula: CD3CD(OH)CD2C(CD3)2OH
MW: 130.25
98 atom % D
Formula: CH3CH2CH(CD3)COOH
MW: 105.15
99 atom % D
MW: 110.22
99 atom % D
MW: 138.15
98 atom % D
Formula: CD3CD2CD(CD3)COOH
MW: 111.19
98 atom % D
Formula: CD3CD2CD(CD3)COCl
MW: 129.63
98 atom % D
MW: 107.21
98 atom % D
(±)-2-PENTYL-1,1,1,3,3-D5 ALCOHOL
Formula: CH3CH2CD2CH(OH)CD3
MW: 93.18
98 atom % D
MW: 201.24
99 atom % D
MW: 258.4
98 atom % D
Formula: H2NCD2CD(CH3)COOH
MW: 106.14
98 atom % D
Formula: ClCD2CD(OH)CD2OH
MW: 115.57
98 atom % D
Formula: CD3(CD2)4CD(CD3)CD2CD3
MW: 148.38
98 atom % D
MW: 127.23
99 atom % D
MW: 92.15
97 atom % D
MW: 134.23
99 atom % D
MW: 201.19
99 atom % D
MW: 199.18
93 atom % D
MW: 311.81
MW: 318.85
99 atom % D
Formula: CH3CH2CH(CD3)(CH2)5COOH
MW: 175.29
99 atom % D
MW: 343.47
99 atom % D
MW: 242.33
98 atom % D
MW: 432.96
98 atom % D
MW: 381.45
99 atom % D
MW: 528.98
98 atom % D
MW: 273.38
98 atom % D
MW: 296.85
98 atom % D
MW: 292.39
99 atom % D
Formula: C6D5COCH(OH)C6D5
MW: 222.31
98 atom % D
MW: 350.94
99 atom % D
MW: 390.52
99 atom % D
MW: 297.49
98 atom % D
MW: 285.26
99 atom % D
MW: 305.43
99 atom % D
MW: 341.89
99 atom % D
MW: 412.9
98 atom % D
MW: 410.5
99 atom % D
MW: 392.92
99 atom % D
MW: 378.85
99 atom % D
MW: 396.9
98 atom % D
MW: 409.33
98 atom % D
MW: 286.25
99 atom % D
(±)-COTININE-2,4,5,6-D4 (PYRIDINE-D4)
MW: 180.24
98 atom % D
MW: 179.24
98 atom % D
MW: 405.52
99 atom % D
MW: 419.98
99 atom % D
MW: 392.48
99 atom % D
MW: 93.53
98 atom % D
MW: 97.56
98 atom % D
MW: 189.24
98 atom % D
MW: 186.22
99 atom % D
(±)-ETODOLAC-D3 (1-ETHYL-2,2,2-D3)
MW: 290.38
99 atom % D
MW: 387.28
99 atom % D
MW: 341.85
99 atom % D
MW: 350.82
99 atom % D
MW: 404.4
99 atom % D
MW: 249.3
99 atom % D
(±)-GLYCERYL-1,1,2,3,3-D5 1-MONOOLEATE
MW: 361.58
98 atom % D
MW: 79.11
98 atom % D
MW: 209.3
99 atom % D
MW: 231.28
99 atom % D
MW: 400.29
98 atom % D
Formula: 97% chemical purity
MW: 415.38
99 atom % D
MW: 535.46
98 atom % D
MW: 257.3
98 atom % D
MW: 258.31
99 atom % D
MW: 157.27
99 atom % D
(±)-MANDELIC-2,3,4,5,6-D5 ACID
Formula: C6D5CH(OH)COOH
MW: 157.18
98 atom % D
MW: 236.71
98 atom % D
MW: 236.71
99 atom % D
MW: 244.26
99 atom % D
MW: 289.83
98 atom % D
MW: 310.87
99 atom % D
MW: 137.19
98 atom % D
MW: 134.17
98 atom % D
MW: 133.16
99 atom % D
MW: 303.85
99 atom % D
MW: 484.14
98 atom % D
MW: 297.83
99 atom % D
MW: 181.23
98 atom % D
MW: 281.45
99 atom % D
MW: 168.24
98 atom % D
MW: 161.2
98 atom % D
MW: 233.28
99 atom % D
(±)-NICOTINE-2,4,5,6-D4 (PYRIDINE-D4)
MW: 166.26
98 atom % D
MW: 165.25
99 atom % D
MW: 169.28
98 atom % D
MW: 392.44
99 atom % D
(±)-NOREPINEPHRINE-2,5,6,α,β,β-D6 HCL
MW: 211.67
99 atom % D
MW: 336.8
98 atom % D
MW: 222.68
98 atom % D
MW: 152.23
98 atom % D
MW: 219.25
99 atom % D
MW: 298.4
97 atom % D
MW: 405.02
99 atom % D
MW: 333.43
99 atom % D
(±)-PENCONAZOLE-D7 (PENTYL-3,3,4,4,5,5,5-D7)
MW: 291.23
98 atom % D
MW: 345.32
99 atom % D
MW: 255.37
99 atom % D
MW: 360.46
98 atom % D
MW: 376.46
99 atom % D
MW: 324.9
98 atom % D
(±)-PROPAFENONE-D5 HCL (PROPYL-2,2,3,3,3-D5)
MW: 382.94
98 atom % D
MW: 384.95
99 atom % D
MW: 266.39
97 atom % D
MW: 325.4
99 atom % D
MW: 375.83
98 atom % D
MW: 340.86
97 atom % D
MW: 343.88
99 atom % D
MW: 508.51
98 atom % D
MW: 281.45
98 atom % D
MW: 418.59
98 atom % D
MW: 315.87
99 atom % D
MW: 152.1
98 atom % D
MW: 311.85
98 atom % D
MW: 536.49
98 atom % D
MW: 123.16
98 atom % D
MW: 262.26
98 atom % D
MW: 410.05
98 atom % D
MW: 489.67
98 atom % D
MW: 305.88
99 atom % D
MW: 174.68
98 atom % D
MW: 297.78
98 atom % D
MW: 413.53
99 atom % D
MW: 333.36
99 atom % D (also 12%-4,4-d2)
MW: 319.9
99 atom % D
MW: 494.09
99 atom % D
MW: 313.36
99 atom % D
MW: 454
99 atom % D
MW: 171.3
99 atom % D
MW: 333.5
99 atom % D
MW: 318.49
98 atom % D
(1 S ,3′ R )-SOLIFENACIN-D7 HCL (2′,2′,3′,6′,6′,7′,7′-D7)
MW: 405.97
98 atom % D
MW: 253.32
99 atom % D
(2 S ,2′ S )-ETHAMBUTOL-D10 (1,1,1′,1′,2,2′-D6; ETHYLENE-D4)
MW: 214.37
99 atom % D
MW: 208.34
99 atom % D
MW: 259.51
99 atom % D
MW: 224.06
98 atom % D
MW: 226.07
98 atom % D
MW: 207.05
98 atom % D
Formula: C6D5CH2CH2Br
MW: 190.09
99 atom % D
MW: 299.81
99 atom % D
MW: 201.23
99 atom % D
(25 RS )-26-HYDROXYCHOLESTEROL-24,24,26,26-D4
MW: 406.68
98 atom % D
Formula: (CH3O)3C6H2CD2COOH
MW: 228.24
97 atom % D
MW: 173.18
98 atom % D
Formula: (CH3O)2C6H3CD2COOH
MW: 198.21
98 atom % D
Formula: CH3(CH2)8C6H4OCD2COOH
MW: 280.4
98 atom % D
Formula: HOOCCH2(CD2)2CH2P(C6H5)3D-2192
MW: 447.34
98 atom % D
MW: 203.64
98 atom % D
Formula: FC6H4CD2COOH
MW: 156.15
98 atom % D (also 10% 3,5-d2)
Formula: HO(CH3O)C6H3CD2COOH
MW: 184.19
98 atom % D
Formula: HO(CH3O)C6D3CD2COOH
MW: 187.21
99 atom % D
Formula: HOOCCH2(CD23CH2P(C6H5)3Br
MW: 463.38
99 atom % D
MW: 392.43
99 atom % D
Formula: C6D11CH2Br
MW: 188.15
98 atom % D
MW: 139.03
99 atom % D
Formula: C3H4DCD2Br
MW: 138.02
98 atom % D
Formula: ClCD2CCl3
MW: 169.86
98 atom % D
Formula: (ClC6D4)2CHCCl3
MW: 362.54
99 atom % D (also 20% deuterated at the 2-position)
Formula: ClC6D4CH(CCl3)C6D4Cl
MW: 362.54
98 atom % D
Formula: CD3CCl3
MW: 136.42
98 atom % D
Formula: Cl2CDCDCl2
MW: 169.86
99.6 atom % D
Formula: ClCD2CDCl2
MW: 136.42
99 atom % D
MW: 134.12
99 atom % D
Formula: (ClC6D4)2CHCHCl2
MW: 328.09
99 atom % D
Formula: (ClC6D4)2C=CCl2
MW: 326.08
99 atom % D
Formula: CD3CHCl2
MW: 101.98
98 atom % D
Formula: CD2=CCl2
MW: 98.96
98 atom % D
Formula: (CD3)2NNH2•HCl
MW: 102.6
98 atom % D
Formula: H2NSO2N(CD3)2
MW: 130.19
99 atom % D
Formula: H2NCON(CD3)2
MW: 94.15
99 atom % D
Formula: (CD3)2NND2•DCl
MW: 105.61
98 atom % D
Formula: HO(CD2)10OH
MW: 194.4
98 atom % D
1,10-DECANEDIOIC-2,2,9,9-D4 ACID
MW: 206.27
98 atom % D
Formula: HOOC(CD2)8COOH
MW: 218.35
98 atom % D
Formula: Br(CD2)10Br
MW: 320.2
98 atom % D
MW: 188.26
97 atom % D
Formula: Br(CD2)12Br
MW: 352.28
98 atom % D
Formula: HO(CD2)12OH
MW: 226.48
98 atom % D
1,12-DODECANEDIOIC-2,2,11,11-D4 ACID
MW: 234.33
98 atom % D
Formula: HOOC(CD2)10COOH
MW: 250.43
98 atom % D
Formula: HOOC(CD2)12COOH
MW: 282.5
98 atom % D
Formula: HOOC(CD2)14COOH
MW: 314.58
99 atom % D
Formula: C6D2Cl4
MW: 217.91
98 atom % D
Formula: C6D2(CD3)4
MW: 148.31
98 atom % D
Formula: C6D2Cl4
MW: 217.91
98 atom % D
Formula: C6D2(CD3)4
MW: 148.31
98 atom % D
Formula: C6D3Cl3
MW: 184.47
98 atom % D
Formula: ClCD2CD(Cl)CD2Cl
MW: 152.46
98 atom % D
MW: 260.19
98 atom % D
MW: 220.13
98 atom % D
Formula: C6D2Cl4
MW: 217.91
98 atom % D
Formula: C6D2(CH3)4
MW: 136.23
98 atom % D
Formula: C6D2(CD3)4
MW: 148.31
98 atom % D
MW: 72.08
98 atom % D
Formula: C6D3Cl3
MW: 184.47
98 atom % D
Formula: (CD3)3C6D3
MW: 132.27
98 atom % D
Formula: C6D4(NH2)2
MW: 112.17
98 atom % D
Formula: C6D4(ND2)2
MW: 116.19
98 atom % D
MW: 124.25
98 atom % D
Formula: C6D4Cl2
MW: 151.03
99 atom % D
Formula: ClCD2CD2Cl
MW: 102.98
99 atom % D
Formula: CDCl=CDCl
MW: 98.96
98 atom % D
Formula: C6D4(OD)2
MW: 116.15
98 atom % D
Formula: C6H4(OCD3)2
MW: 144.2
99 atom % D
Formula: C6D4(OCH3)2
MW: 142.19
98 atom % D
Formula: C6H2D2(OCH3)2
MW: 140.18
98 atom % D
Formula: C6D4(OCD3)2
MW: 148.23
99 atom % D
Formula: C6D5(CD2)2C6D5
MW: 196.35
98 atom % D
Formula: HSCD2CD2SH
MW: 98.21
99 atom % D
MW: 319.5
98 atom % D
Formula: C6D3(COOH)3
MW: 213.16
98 atom % D
Formula: C6D3Br3
MW: 317.82
99 atom % D
Formula: C6D3Cl3
MW: 184.47
98 atom % D
Formula: (CH3)3C6D3
MW: 123.21
98 atom % D
Formula: (CD3)3C6D3
MW: 132.27
98 atom % D
Formula: C6D4(ND)2
MW: 116.19
97 atom % D
Formula: CD2=CHCH=CD2
MW: 58.11
98 atom % D
Formula: CH2=CDCD=CH2
MW: 56.1
98 atom % D
Formula: CD2=CDCD=CD2
MW: 60.13
98 atom % D
Formula: [(CD3)2CD]2C6D4
MW: 180.38
99 atom % D
Formula: Br2C6D3F
MW: 256.91
98 atom % D
Formula: BrCD2CH2CD2Br
MW: 205.91
98 atom % D
Formula: BrCD2CD2CD2Br
MW: 207.92
99 atom % D
Formula: ClCD2CD(OH)CD2Cl
MW: 134.02
98 atom % D
Formula: ClCD2COCD2Cl
MW: 130.99
98 atom % D
Formula: C6D4Cl2
MW: 151.03
98 atom % D
Formula: ClCD2CD=CDCl
MW: 115
98 atom % D
Formula: C6D4(CH2CH3)2
MW: 138.25
98 atom % D
Formula: C6D4(CD2CD3)2
MW: 148.31
98 atom % D
Formula: C6D4F2
MW: 118.18
98 atom % D
Formula: C6D4(OD)2
MW: 116.15
98 atom % D
Formula: C6H4(OCD3)2
MW: 144.2
99 atom % D
Formula: C6D4(OCH3)2
MW: 142.19
98 atom % D
Formula: C6D4(OCD3)2
MW: 148.23
99 atom % D
Formula: C6D4(NO2)2
MW: 172.13
98 atom % D
Formula: (C6D5NH)2CO
MW: 222.31
99 atom % D
Formula: H2NCD2CH2CD2NH2
MW: 78.15
99 atom % D
Formula: H2NCD2CH2CD2NH2•2HCl
MW: 151.07
99 atom % D
Formula: H2NCH2CD2CH2NH2
MW: 76.14
98 atom % D
Formula: H2NCH2CD2CH2NH2•2HCl
MW: 149.06
99 atom % D
Formula: HOCH2CD2CH2OH
MW: 78.11
98 atom % D
Formula: H2NCD2CD2CD2NH2
MW: 80.16
98 atom % D
Formula: H2NCD2CD2CD2NH2•2HCl
MW: 153.08
98 atom % D
Formula: HOCD2CD2CD2OH
MW: 82.13
98 atom % D
Formula: HSCD2CD2CD2SH
MW: 114.25
98 atom % D
Formula: DOCD2CD2CD2OD
MW: 84.14
98 atom % D
MW: 122.22
98 atom % D
MW: 298.42
98 atom % D
Formula: C6D4(NH2)2
MW: 112.17
98 atom % D
Formula: C6D4(ND2)2
MW: 116.19
98 atom % D
MW: 112.12
98 atom % D
1,4-BUTANE-2,2,3,3-D4-DIAMINE 2HCL
Formula: H2NCH2CD2CD2CH2NH2•2HCl
MW: 165.1
98 atom % D
Formula: H2NCD2CD2CD2CD2NH2
MW: 96.2
98 atom % D
Formula: H2NCD2CD2CD2CD2NH2•2HCl
MW: 169.12
98 atom % D
Formula: HS(CD2)4SH
MW: 130.29
99 atom % D
MW: 124.25
98 atom % D
MW: 124.25
98 atom % D
Formula: C6D4Br2
MW: 239.93
99 atom % D
Formula: BrCD2(CH2)2CD2Br
MW: 219.94
98 atom % D
Formula: BrCH2(CD2)2CH2Br
MW: 219.94
98 atom % D
Formula: Br(CD2)4Br
MW: 223.96
99 atom % D
Formula: C6D4Cl2
MW: 151.03
98 atom % D
Formula: Cl(CD2)4Cl
MW: 135.06
99 atom % D
Formula: C6D4(CH2CH3)2
MW: 138.25
98 atom % D
Formula: C6D4(CD2CD3)2
MW: 148.31
98 atom % D
Formula: C6D4(OCD3)2
MW: 148.23
98 atom % D
MW: 164.19
98 atom % D
MW: 366.48
98 atom % D
MW: 366.48
98 atom % D
MW: 376.49
95 atom % D
Formula: BrCD2(CH2)3CD2Br
MW: 233.97
99 atom % D
Formula: Br(CD2)5Br
MW: 240
98 atom % D
MW: 224.21
99 atom % D
Formula: H2NCD2(CH2)3CD2NH2
MW: 106.2
98 atom % D
Formula: HO(CD2)5OH
MW: 114.21
98 atom % D
Formula: Br(CD2)6Br
MW: 256.04
98 atom % D
Formula: H2NCD2(CH2)4CD2NH2
MW: 120.23
98 atom % D
Formula: HOCD2(CH2)4CD2OH
MW: 122.2
98 atom % D
MW: 168.3
98 atom % D
MW: 178.22
98 atom % D
Formula: HOOC(CD2)6COOH
MW: 186.27
98 atom % D
Formula: Br(CD2)9Br
MW: 304.16
98 atom % D
Formula: HOCH2(CD2)7CH2OH
MW: 174.34
98 atom % D
Formula: HOOC(CD2)7COOH
MW: 202.31
98 atom % D
MW: 281.33
99 atom % D
MW: 157.29
98 atom % D (also 9% 3,3',3''-d3 and 17% 4,4,4',4',4'',4''-d6)
MW: 105.13
98 atom % D
MW: 150.23
98 atom % D
MW: 152.24
98 atom % D
MW: 234.33
99 atom % D
Formula: C6D2BrCl3
MW: 262.36
98 atom % D
Formula: BrC6D3Cl2
MW: 228.92
99 atom % D
Formula: BrC6D3F2
MW: 196.01
98 atom % D
Formula: BrC6D3F2
MW: 196.01
98 atom % D
Formula: BrC6D3F2
MW: 196.01
98 atom % D
Formula: ClCD2CD2Br
MW: 147.44
98 atom % D
Formula: CD3(CD2)3CD(CD2CD3)CD2Br
MW: 210.23
98 atom % D
Formula: (CD3)2CDCH2Br
MW: 144.06
98 atom % D
Formula: CD3CH(CH3)CH2Br
MW: 140.04
99 atom % D
Formula: (CD3)2CDCD2Br
MW: 146.07
98 atom % D
Formula: BrC6D3F2
MW: 196.01
98 atom % D
Formula: BrC6D3Cl2
MW: 228.92
98 atom % D
Formula: BrC6D3F2
MW: 196.01
98 atom % D
Formula: BrC6D3(Cl)F
MW: 212.46
98 atom % D
Formula: Cl(CD2)3Br
MW: 163.47
98 atom % D
Formula: Cl(CD2)4Br
MW: 179.51
99 atom % D
Formula: CH3CH2CD2CD2Br
MW: 141.04
99 atom % D
Formula: CD3CD2CD2CH2Br
MW: 144.06
98 atom % D
Formula: CH3CH2CD2CH2Br
MW: 139.03
99 atom % D
Formula: CD3CD2CH2CH2Br
MW: 142.05
98 atom % D
Formula: CD3CH2CH2CH2Br
MW: 140.04
99 atom % D
Formula: CD3CD2CD2CD2Br
MW: 146.07
98 atom % D
Formula: CH3(CH2)7CD2CD2Br
MW: 225.2
98 atom % D
Formula: CD3(CH2)9Br
MW: 224.2
99 atom % D
Formula: CD3CD2(CH2)8Br
MW: 226.21
98 atom % D
Formula: CD3(CD2)9Br
MW: 242.31
98 atom % D
Formula: CD3(CH2)11Br
MW: 252.25
99 atom % D
Formula: CD3(CD2)11Br
MW: 274.39
98 atom % D
Formula: CD3(CH2)19Br
MW: 364.47
99 atom % D
Formula: CD3(CD2)19Br
MW: 402.7
98 atom % D
Formula: CH3(CH2)5CHDBr
MW: 180.11
99 atom % D
Formula: CD3(CD2)2(CH2)4Br
MW: 186.14
98 atom % D
Formula: CD3CD2(CH2)5Br
MW: 184.13
99 atom % D
Formula: CD3(CH2)6Br
MW: 182.12
99 atom % D
Formula: CD3(CD2)6Br
MW: 194.19
98 atom % D
Formula: CH3(CH2)13CD2CD2Br
MW: 309.37
98 atom % D
Formula: CD3(CH2)15Br
MW: 308.36
99 atom % D
Formula: CD3(CD2)15Br
MW: 338.54
98 atom % D
Formula: CH3(CH2)3CD2CD2Br
MW: 169.1
98 atom % D
Formula: CH3(CH2)4CD2Br
MW: 167.08
99 atom % D
Formula: CD3(CD2)4CH2Br
MW: 176.14
98 atom % D
Formula: CD3CD2CD2(CH2)3Br
MW: 172.12
98 atom % D
Formula: CD3(CH2)5Br
MW: 168.09
99 atom % D
Formula: CD3(CD2)5Br
MW: 178.15
98 atom % D
MW: 214.11
99 atom % D
Formula: CH3CH2(CD2)2(CH2)5Br
MW: 211.18
98 atom % D
Formula: CD3(CH2)8Br
MW: 210.17
99 atom % D
Formula: CD3(CD2)8Br
MW: 226.27
98 atom % D
Formula: CD3(CH2)17Br
MW: 336.41
99 atom % D
Formula: CD3(CD2)17Br
MW: 370.62
98 atom % D
Formula: CH3(CH2)6CD2Br
MW: 195.14
99 atom % D
Formula: CH3(CH2)3(CD2)2(CH2)2Br
MW: 197.15
98 atom % D
Formula: CD3(CH2)7Br
MW: 196.14
99 atom % D
Formula: CD3(CD2)7Br
MW: 210.23
98 atom % D
Formula: CH3(CH2)12CD2CD2Br
MW: 295.34
98 atom % D
Formula: CD3(CH2)14Br
MW: 294.33
99 atom % D
Formula: CD3(CD2)14Br
MW: 322.5
98 atom % D
Formula: CH3(CH2)2(CD2)2Br
MW: 155.07
99 atom % D
Formula: CH3(CH2)3CD2Br
MW: 153.06
99 atom % D
Formula: CH3(CH2)3CHDBr
MW: 152.05
98 atom % D
Formula: CD3(CD2)3CH2Br
MW: 160.1
98 atom % D
Formula: CD3CD2(CH2)3Br
MW: 156.07
99 atom % D
Formula: CD3(CH2)4Br
MW: 154.06
99 atom % D
Formula: CD3(CD2)4Br
MW: 162.11
98 atom % D
Formula: CH3CD2CD2Br
MW: 127.02
98 atom % D
Formula: CD3CH2CD2Br
MW: 128.02
98 atom % D
Formula: CH3CH2CD2Br
MW: 125
99 atom % D
Formula: CH3CH2CDHBr
MW: 124
99 atom % D
Formula: CD3CD2CH2Br
MW: 128.02
98 atom % D
Formula: CH3CD2CH2Br
MW: 125
98 atom % D
Formula: CD3CH2CH2Br
MW: 126.01
99 atom % D
Formula: CD3CD2CD2Br
MW: 130.03
98 atom % D
Formula: CH3(CH2)11CD2CD2Br
MW: 281.31
98 atom % D
Formula: CD3(CH2)13Br
MW: 280.31
99 atom % D
Formula: CD3(CD2)13Br
MW: 306.46
98 atom % D
Formula: CH3(CH2)10CD2CD2Br
MW: 267.28
98 atom % D
Formula: CD3(CD2)12Br
MW: 290.43
98 atom % D
Formula: CH3(CH2)8(CD2)2Br
MW: 239.23
98 atom % D
Formula: CD3(CH2)10Br
MW: 238.23
98 atom % D
Formula: CD3(CD2)10Br
MW: 258.35
98 atom % D
Formula: CD3(CD2)3SO2Cl
MW: 165.68
98 atom % D
Formula: CD3(CD2)3SH
MW: 99.24
98 atom % D
1-BUTENE-1,1-D2 (GAS)
Formula: CH3CH2CH=CD2
MW: 58.12
98 atom % D
1-BUTENE-4,4,4-D3 (GAS)
Formula: CD3CH2CH=CH2
MW: 59.13
99 atom % D
1-BUTYNE-3,3,4,4,4-D5 (GAS)
Formula: CD3CD2C≡CH
MW: 59.12
99 atom % D
Formula: ClC6D3(NO2)2
MW: 205.57
98 atom % D
MW: 185.77
98 atom % D
Formula: CD3CD2CD2CD2Cl
MW: 101.62
98 atom % D
Formula: CD3(CD2)15Cl
MW: 294.09
98 atom % D
Formula: CD3(CD2)5Cl
MW: 133.7
98 atom % D
Formula: CD3(CD2)7Cl
MW: 165.78
98 atom % D
Formula: CH3CH2CD2Cl
MW: 80.55
98 atom % D
Formula: CD3CD2CD2Cl
MW: 85.58
98 atom % D
Formula: CD3(CD2)11SH
MW: 227.55
98 atom % D
Formula: CD3CD2CH2CH2CH2C≡CH
MW: 101.2
99 atom % D
Formula: CD3(CD2)15SH
MW: 291.71
98 atom % D
Formula: CD3(CD2)5SH
MW: 131.32
98 atom % D
MW: 227.31
98 atom % D
Formula: CD3CD2CD2CH2I
MW: 191.06
98 atom % D
Formula: CD3(CD2)3I
MW: 193.07
98 atom % D
Formula: CH3(CH2)6CD2I
MW: 242.14
98 atom % D
Formula: CD3(CD2)7I
MW: 257.23
98 atom % D
Formula: CD3(CH2)4I
MW: 201.06
98 atom % D
Formula: CH3CD2CD2l
MW: 174.02
98 atom % D
Formula: CD3CH2CD2I
MW: 175.02
98 atom % D
Formula: CH3CH2CD2I
MW: 172.01
99 atom % D
Formula: CD3CD2CH2l
MW: 175.02
98 atom % D
Formula: CH3CD2CH2I
MW: 172.01
98 atom % D
Formula: CD3CH2CH2I
MW: 173.01
99 atom % D
Formula: CD3(CD2)2I
MW: 177.04
98 atom % D
MW: 221.27
99 atom % D
MW: 119.16
99 atom % D
MW: 85.12
99 atom % D
MW: 85.12
98 atom % D
MW: 88.14
98 atom % D
MW: 152.26
98 atom % D
Formula: C10D7OH
MW: 151.22
98 atom % D
Formula: C10D7OD
MW: 152.22
98 atom % D
MW: 180.21
98 atom % D
MW: 256.31
98 atom % D
MW: 309.48
98 atom % D
Formula: CD3(CD2)17SH
MW: 323.78
98 atom % D
Formula: CD3(CD2)7SH
MW: 163.39
98 atom % D
Formula: CD3CD2CH2CH=CH2
MW: 75.16
99 atom % D
Formula: C6H5C≡CCD2CD3
MW: 135.22
99 atom % D
MW: 253.31
98 atom % D
Formula: C6D5(CD2)11CD3
MW: 276.62
98 atom % D
Formula: C6D5(CD2)14CD3
MW: 324.74
98 atom % D
Formula: CD3CD2CD2SH
MW: 83.2
98 atom % D
Formula: CH3CH2CH2SD
MW: 77.16
98 atom % D
MW: 291.4
98 atom % D
MW: 290.4
98 atom % D
MW: 290.4
98 atom % D
MW: 276.45
98 atom % D
MW: 291.4
95 atom % D
MW: 274.4
98 atom % D
MW: 298.43
99 atom % 13C
MW: 312.45
97 atom % D
MW: 300.43
98 atom % D
MW: 314.46
98 atom % D
MW: 335.5
97 atom % D
MW: 271.37
96 atom % D
MW: 273.4
98 atom % D
MW: 275.4
98 atom % D
MW: 274.39
98 atom % D
MW: 275.4
98 atom % D
17β-ESTRADIOL-16,16,17-D3 3-BENZOATE
MW: 379.51
98 atom % D
MW: 274.4
98 atom % D
MW: 277.42
98 atom % D
MW: 276.41
98 atom % D
17β-ESTRADIOL-2,4,16,16-D4 17-PENTANOATE
MW: 360.53
98 atom % D
MW: 274.4
98 atom % D
MW: 123.15
99 atom % D
MW: 261.57
98 atom % D
MW: 261.57
98 atom % D
MW: 230.22
98 atom % D
MW: 248.21
98 atom % D
MW: 363.9
99 atom % D
MW: 329.45
98 atom % D
MW: 329.45
98 atom % D
Formula: C6D3Cl2C6H3Cl2
MW: 295.01
98 atom % D
MW: 262.58
98 atom % D
MW: 268.42
99 atom % D
MW: 164.24
98 atom % D
Formula: (CD3)3CCD2CD(CD3)2
MW: 132.34
98 atom % D
MW: 174.36
98 atom % D
Formula: (HOCD2)2C(CD3)COOH
MW: 141.17
99 atom % D
Formula: CD3CD2C(CD3)2COOH
MW: 127.23
98 atom % D
Formula: (CD3)4C
MW: 84.22
98 atom % D
Formula: Cl2C6D3C6H3Cl2
MW: 295.01
98 atom % D
MW: 263.58
99 atom % D
MW: 363.9
98 atom % D
MW: 363.9
98 atom % D
MW: 261.57
98 atom % D
MW: 330.46
98 atom % D
Formula: C6Cl5C6D5
MW: 331.47
98 atom % D
MW: 262.58
99 atom % D
Formula: (HO)3C6H2COC6D5
MW: 235.25
98 atom % D
Formula: Cl4C6DND2
MW: 233.93
99 atom % D
Formula: C6HCl4C6D5
MW: 297.02
98 atom % D
Formula: (CD3)3C6D2OH
MW: 147.26
98 atom % D
Formula: Cl3C6H2OCD3
MW: 214.49
99 atom % D
Formula: Cl3C6D2OH
MW: 199.46
97 atom % D
Formula: (CD3)3C6D2OH
MW: 147.26
98 atom % D
Formula: CD3CH(OH)CH(OH)CD3
MW: 96.16
98 atom % D
Formula: CD3CD(OH)CD(OH)CD3
MW: 98.17
98 atom % D
Formula: CD3COCOCD3
MW: 92.13
98 atom % D
Formula: Cl2C6D3COOH
MW: 194.03
98 atom % D
Formula: Cl2C6D3CH3
MW: 164.05
98 atom % D
Formula: CD3CD2CD(CD3)CD(CD3)2
MW: 116.3
99 atom % D
MW: 116.21
98 atom % D
Formula: CH3CD2COCOCD3
MW: 105.15
98 atom % D
Formula: Cl2C6H3C6ClD4
MW: 261.57
98 atom % D
MW: 231.15
98 atom % D
MW: 261.57
98 atom % D
Formula: Cl3C6D2ND2
MW: 200.49
98 atom % D
MW: 262.58
99 atom % D
Formula: Cl3C6D2OH
MW: 199.46
98 atom % D
Formula: Br3C6D2OCD3
MW: 349.86
99 atom % D
Formula: Br3C6D2OH
MW: 332.81
99 atom % D
Formula: Cl3C6D2OCD3
MW: 216.51
98 atom % D
Formula: Cl3C6H2C6D5
MW: 262.58
98 atom % D
Formula: Cl3C6D2OH
MW: 199.46
98 atom % D
Formula: (CD3)3C6D2OH
MW: 147.26
98 atom % D
Formula: (CD3)3C5D2N
MW: 132.25
98 atom % D
Formula: CD3C6H3(NH2)2
MW: 125.19
98 atom % D
Formula: Br2C6D3OH
MW: 254.92
98 atom % D
Formula: Cl2C6D3COOH
MW: 194.03
98 atom % D
Formula: Cl2C6D3OH
MW: 166.02
98 atom % D
Formula: Cl2C6D3CH3
MW: 164.05
98 atom % D
Formula: F2C6D3COOH
MW: 161.12
98 atom % D
Formula: CH3C6D3F2
MW: 131.14
99 atom % D
Formula: (HO)2C6H3COC6D5
MW: 219.25
98 atom % D
Formula: (CD3)2C6H3NH2
MW: 127.22
98 atom % D
Formula: (CD3)2C6H3NH2•HCl
MW: 163.68
99 atom % D
Formula: (CD3)2C6H3NO2
MW: 157.2
98 atom % D
Formula: (CD3)2C6D3ND2
MW: 132.25
99 atom % D
Formula: (CH3)2C6D3OH
MW: 125.18
98 atom % D
Formula: (CD3)2C6D3OD
MW: 132.23
98 atom % D
Formula: (NO2)2C6H3CD3
MW: 185.15
98 atom % D
Formula: (NO2)2C6D3CH3
MW: 185.15
98 atom % D
MW: 256.48
98 atom % D
Formula: Cl2C6D3NH2
MW: 165.04
98 atom % D
Formula: Cl2C6H3C6D5
MW: 228.13
99 atom % D
Formula: Cl2C6D3OH
MW: 166.02
98 atom % D
Formula: F2C6D3COOH
MW: 161.12
98 atom % D
MW: 124.2
98 atom % D
Formula: C19D40
MW: 308.77
98 atom % D
Formula: C30D62
MW: 485.2
98 atom % D
Formula: [(CD3)2CD]2C6D3OD
MW: 196.38
98 atom % D
MW: 244.5
98 atom % D
MW: 227.4
95 atom % D
MW: 256.48
98 atom % D
MW: 241.48
98 atom % D
Formula: CD3C6H3(NH2)2
MW: 125.19
97 atom % D
Formula: Br2C6D3OH
MW: 254.92
98 atom % D
Formula: Cl2C6D3NH2
MW: 165.04
98 atom % D
MW: 193.05
98 atom % D
Formula: Cl2C6D3COOH
MW: 194.03
98 atom % D
MW: 228.13
99 atom % D
Formula: Cl2C6D3CH3
MW: 164.05
98 atom % D
Formula: (CD3CD2)2C6D3ND2
MW: 164.33
97 atom % D
Formula: F2C6D3COOH
MW: 161.12
98 atom % D
Formula: (CD3)2C6H3NH2
MW: 127.22
98 atom % D
Formula: (CD3)2C6H3NO2
MW: 157.2
98 atom % D
Formula: (CD3)2C6D3ND2
MW: 132.25
98 atom % D
MW: 168.3
98 atom % D
Formula: (CH3)2C6D3OD
MW: 126.19
98 atom % D
MW: 116.21
98 atom % D
Formula: (NO2)2C6H3CD3
MW: 185.15
98 atom % D
MW: 163.3
98 atom % D
MW: 250.78
99 atom % D
Formula: (HO)2C6H3CD2CD2NH2•HCl
MW: 193.67
98 atom % D
Formula: (HO)2C6H3CH2CD2NH2•HCl
MW: 191.65
98 atom % D
Formula: (HO)2C6H3CH213CH2NH2
MW: 190.65
99 atom % 13C
Formula: (HO)2C6H3CH213CH215NHM-4221
MW: 191.66
99 atom % 13C; 99 atom % 15N
Formula: (HO)2C6H3CD2CH2NH2•HCl
MW: 191.65
98 atom % D
Formula: (HO)213C6H3CH2CH2NH2
MW: 195.7
99 atom % 13C
Formula: (HO)2C6D3CH2CH2NH2•HCl
MW: 192.66
98 atom % D
Formula: (CD3O)2C6H3CD2CD2NH2 HC
MW: 227.76
99 atom % D
Formula: (CH3O)2C6H4CH2CH2NHCD3
MW: 198.28
99 atom % D
Formula: (CH3O)2C6H3CH2CD2NH2
MW: 183.25
98 atom % D
MW: 238.76
99 atom % D
MW: 235.75
99 atom % D
MW: 207.69
98 atom % D
Formula: HOC6H4CD2CD2NH2•HCl
MW: 177.67
98 atom % D
Formula: CD3C6D4CD(CD3)2
MW: 148.31
98 atom % D
Formula: O2NC6D4CH(CH3)2
MW: 169.22
98 atom % D
Formula: C6H5CH2N(CH3)CD2CD2OH
MW: 169.26
99 atom % D
MW: 208.31
98 atom % D
Formula: (CH3CH2CD2)2CHCOOH
MW: 148.24
99 atom % D
Formula: (CH3CD2CH2)2CHCOOH
MW: 148.24
99 atom % D
2-(PROPYL-3,3,3-D3)PENTANOIC-5,5,5-D3 ACID
Formula: (CD3CH2CH2)2CHCOOH
MW: 150.25
99 atom % D
MW: 184.18
98 atom % D
Formula: (CD3)3CNH2
MW: 82.19
99 atom % D
2-AMINO-2-METHYL-D3-PROPANE-1,1,1,3,3,3-D6 HBR
Formula: (CD3)3CNH2•HBr
MW: 163.1
99 atom % D
MW: 161.19
99 atom % D
MW: 131.58
98 atom % D
Formula: C6D5C6D4NH2
MW: 178.28
98 atom % D
Formula: H2NCD2CD2SO2H
MW: 113.17
95 atom % D
Formula: H2NCD2CD2SO3H
MW: 129.17
99 atom % D
Formula: HSCD2CD2NH2•HCl
MW: 117.63
99 atom % D
MW: 192.3
98 atom % D
MW: 150.23
98 atom % D
Formula: D2NC5D4N
MW: 100.15
98 atom % D
Formula: (CD3)2C(Br)COOH
MW: 173.04
99 atom % D
Formula: (CD3)3CBr
MW: 146.07
98 atom % D
Formula: FC6D4COCH2Br
MW: 221.06
94 atom % D
Formula: BrC6D4Cl
MW: 195.48
98 atom % D
Formula: BrCD2CD2OH
MW: 128.99
99 atom % D
Formula: BrCD2CD2NH2•HBr
MW: 208.92
98 atom % D
Formula: BrC6D4F
MW: 179.02
98 atom % D
Formula: BrC6D4NO2
MW: 206.03
98 atom % D
Formula: CH3CD(Br)CD3
MW: 127.02
99 atom % D
Formula: (CD3)2CHBr
MW: 129.03
99 atom % D
Formula: CD3CH(Br)CH3
MW: 126.01
98 atom % D
Formula: (CH3)2CDBr
MW: 124
98 atom % D
Formula: (CD3)2CDBr
MW: 130.04
99 atom % D
MW: 162.02
98 atom % D
Formula: BrC6D4CH3
MW: 175.06
98 atom % D
Formula: BrC6D4CD3
MW: 178.08
98 atom % D
Formula: CH3CH2C(CH3)=NNHC6D3(NO2)2D-7602
MW: 255.25
99 atom % D
Formula: CH3CD2COCD3
MW: 77.14
98 atom % D
Formula: CD3CH2COCH3
MW: 75.12
99 atom % D
Formula: CD3CD2COCD3
MW: 80.16
98 atom % D
Formula: CH3CH=CHCD3
MW: 59.13
99 atom % D
Formula: CD3CD=CDCD3
MW: 64.16
98 atom % D
MW: 122.2
99 atom % D
Formula: (CD3)3CCl
MW: 101.62
99 atom % D
Formula: (CH3CH2)2NCD2CD2Cl•HCl
MW: 176.12
99 atom % D
Formula: ClCH2CH2N(CD3)2•HCl
MW: 150.08
98 atom % D
Formula: ClCD2COND2
MW: 97.54
99 atom % D
Formula: ClC6H2D2NH2
MW: 129.59
98 atom % D
Formula: ClC6D4ND2
MW: 133.61
98 atom % D
Formula: ClC6H4OCD3
MW: 145.6
99 atom % D
Formula: ClC6D4CHO
MW: 144.59
98 atom % D
Formula: ClC6D4COOH
MW: 160.59
98 atom % D
Formula: ClC6H4C6D5
MW: 193.69
98 atom % D
Formula: ClCD2CD2NH2•HCl
MW: 120.01
98 atom % D
MW: 169.66
98 atom % D
Formula: ClC6D4OH
MW: 132.58
98 atom % D
Formula: (CD3)2CHCl
MW: 84.58
98 atom % D
Formula: CH3CH(Cl)CD3
MW: 81.56
98 atom % D
Formula: (CH3)2CDCl
MW: 79.55
98 atom % D
Formula: (CD3)2CDCl
MW: 85.58
99 atom % D
Formula: C5D4NCl
MW: 117.57
99 atom % D
Formula: ClC6D4CH3
MW: 130.61
98 atom % D
Formula: ClC6D4CD3
MW: 133.63
98 atom % D
Formula: C5D4NCN
MW: 108.14
99 atom % D
MW: 89.17
98 atom % D
Formula: CD3CD2OC6H4OH
MW: 143.2
99 atom % D
Formula: CH3CH2OCD2CD2OH
MW: 94.15
98 atom % D
MW: 113.17
98 atom % D
MW: 148.29
98 atom % D
MW: 161.26
99 atom % D
Formula: CD3CD2C6D4OD
MW: 132.23
99 atom % D
Formula: FC6H2D2ND2
MW: 115.14
98 atom % D
Formula: FC6D4COOH
MW: 144.14
98 atom % D
Formula: CD3C6H4F
MW: 113.15
98 atom % D
Formula: CH2DC6H4F
MW: 111.14
98 atom % D
MW: 115.1
98 atom % D
Formula: CH3(CH2)3CD2COCD3
MW: 119.22
98 atom % D
Formula: CH3(CH2)2CD2COCD3
MW: 105.19
98 atom % D
MW: 178.18
98 atom % D
MW: 293.42
98 atom % D
Formula: (CD3)2C(OH)COOH
MW: 110.14
98 atom % D
MW: 233.28
99 atom % D
MW: 202.27
99 atom % D
Formula: DOC6D4COOD
MW: 144.16
98 atom % D
Formula: HOC6D4COOH
MW: 142.15
98 atom % D
MW: 290.39
98 atom % D
Formula: (CD3)3CI
MW: 193.07
98 atom % D
Formula: (CD3)2CHI
MW: 176.03
98 atom % D
Formula: (CH3)2CDI
MW: 171
98 atom % D
Formula: (CD3)2CDI
MW: 177.04
98 atom % D
MW: 169.24
99 atom % D
MW: 155.21
99 atom % D
MW: 183.24
98 atom % D
MW: 154.22
98 atom % D
Formula: HSCD2CD2OH
MW: 82.15
98 atom % D
Formula: DSCD2CD2OD
MW: 84.17
98 atom % D
MW: 307.44
98 atom % D
MW: 100.12
MW: 104.14
99 atom % D
MW: 142.19
98 atom % D
Formula: CD3OCH2COOH
MW: 93.1
98 atom % D
Formula: CD3OC6H4NH2
MW: 126.17
99 atom % D
Formula: CD3OC6D4NH2
MW: 130.2
99 atom % D
Formula: CD3OC6H4CHO
MW: 139.17
99 atom % D
Formula: CD3OCH2CH2OH
MW: 79.11
98 atom % D
Formula: CD3OCD2CD2OH
MW: 83.14
98 atom % D
Formula: CD3OC6H4OH
MW: 127.16
99 atom % D
Formula: CD3OC6D4OH
MW: 131.18
98 atom % D
MW: 113.13
99 atom % D
MW: 304.42
99 atom % D
Formula: CH3OCD2CD2OH
MW: 80.12
98 atom % D
MW: 165.24
98 atom % D
Formula: CH3OC6D4OH
MW: 128.16
98 atom % D
Formula: CH3OC6D4OD
MW: 129.17
98 atom % D
Formula: CH3OC6H4CD3
MW: 125.18
99 atom % D
MW: 180.23
98 atom % D
Formula: C6D5CD2CD(CD3)2
MW: 148.31
98 atom % D
Formula: (CD3)3CSH
MW: 99.24
99 atom % D
MW: 175.2
98 atom % D
Formula: CD3C(CH2OH)2CH2CH2CH3
MW: 135.22
99 atom % D
Formula: HC≡CC(CD3)2OH
MW: 90.15
98 atom % D
MW: 209.17
99 atom % D
2-METHYL-D3-PROPANE-1,1,1,3,3,3-D6 (GAS)
Formula: (CD3)3CH
MW: 67.18
98 atom % D
Formula: (CD3)(CH3)C=CH2
MW: 59.13
99 atom % D
Formula: (CD3)2C=CH2
MW: 62.14
98 atom % D
Formula: CH3CH(CD3)COOH
MW: 91.12
99 atom % D
Formula: (CD3)2CHCOOH
MW: 94.14
98 atom % D
Formula: CD3CH(CD3)CN
MW: 75.14
99 atom % D
Formula: CH3CH(CD3)CH2OH
MW: 77.14
99 atom % D
Formula: (CD3)2CDCH2OH
MW: 81.17
98 atom % D
Formula: (CD3)2CHCH2OH
MW: 80.16
98 atom % D
Formula: C5H4NCD3
MW: 96.15
98 atom % D
MW: 198.19
Formula: CD3CD2CD(CD3)2
MW: 84.22
98 atom % D
MW: 206.15
MW: 88.14
98 atom % D
MW: 88.14
98 atom % D
MW: 152.26
98 atom % D
Formula: CD3CD2CD2CD(CD3)2
MW: 100.26
98 atom % D
Formula: (CH3)3CD
MW: 59.13
98 atom % D
Formula: (CD3)3CD
MW: 68.18
98 atom % D
Formula: (CH3)2C=CD2
MW: 58.12
98 atom % D
Formula: (CD3)2C=CD2
MW: 64.16
99 atom % D
Formula: (CH3)2CDCOOH
MW: 89.11
99 atom % D
Formula: (CD3)2CDCOOH
MW: 95.15
98 atom % D
Formula: (CH3)2CH2OD
MW: 75.13
98 atom % D
Formula: (CH3)2CDCH2OH
MW: 75.13
98 atom % D
Formula: (CD3)2CDCD2OH
MW: 83.18
98 atom % D
Formula: (CD3)2CDCD2NH2
MW: 82.19
98 atom % D
Formula: (CD3)2CDCD2NH2•HCl
MW: 118.65
98 atom % D
MW: 100.15
99 atom % D
Formula: CD3C5D4N
MW: 100.17
98 atom % D
Formula: C10D7OH
MW: 151.22
98 atom % D
Formula: C10D7OD
MW: 152.22
98 atom % D
Formula: O2NC6D4NH2
MW: 142.15
98 atom % D
MW: 140.14
99 atom % D
Formula: O2NC6D4COOH
MW: 171.15
98 atom % D
Formula: O2NC6D4CN
MW: 152.15
99 atom % D
Formula: C6D5C6D4NO2
MW: 208.26
98 atom % D
MW: 220.27
98 atom % D
Formula: O2NC6D4OH
MW: 143.13
98 atom % D
Formula: (CD3)2CHNO2
MW: 95.13
98 atom % D
Formula: CD3C6H4NO2
MW: 140.16
99 atom % D
Formula: CH3C6D4NO2
MW: 141.16
99 atom % D
Formula: CD3C6D4NO2
MW: 144.18
99 atom % D
Formula: CH3(CH2)5CD2COCD3
MW: 147.27
98 atom % D
MW: 106.16
98 atom % D
Formula: CH3CH2CD2COCD3
MW: 91.16
98 atom % D
Formula: C6H5OCD2CD2OH
MW: 142.19
98 atom % D
Formula: C6H5OCH2CD2OH
MW: 140.18
98 atom % D
Formula: C6D5CD2CD2OH
MW: 131.22
98 atom % D
Formula: C6D5CH2CH2OH
MW: 127.2
98 atom % D
Formula: C6D5CH2CH2NCS
MW: 168.27
98 atom % D
Formula: C6D5CH2CH2NH2
MW: 126.21
99 atom % D
Formula: C6D5CH(CH3)2
MW: 125.22
98 atom % D
Formula: C6H5CD2CD2OH
MW: 126.19
98 atom % D
Formula: C6H5CH2CH2OCOCD3
MW: 167.22
99 atom % D
Formula: C6H5CD2CD2NH2
MW: 125.21
98 atom % D
Formula: C6D5CD2CD2NH2
MW: 130.24
98 atom % D
Formula: C6H5CD(CD3)2
MW: 127.24
98 atom % D
Formula: C6H5CH(CD3)2
MW: 126.23
98 atom % D
Formula: C6H5CD(CH3)2
MW: 121.2
97 atom % D
Formula: C6D5CD(CD3)2
MW: 132.27
98 atom % D
MW: 127.14
98 atom % D
Formula: (CD3)2CDSH
MW: 83.2
98 atom % D
Formula: (CD3CD2CD2)2CDCOOH
MW: 159.3
98 atom % D
MW: 117.62
98 atom % D
MW: 91.14
98 atom % D
24( RS )-HYDROXYCHOLESTEROL-25,26,26,26,27,27,27-D7
MW: 409.7
99 atom % D
MW: 408.7
99 atom % D
Formula: (C6H5CH2O)2C6H3COCD3
MW: 335.42
97 atom % D
Formula: Cl2C6H3NHCOCD2CD3
MW: 223.11
98 atom % D
Formula: (CH3O)2C6H3COCD3
MW: 183.22
98 atom % D
Formula: CH3OC6D4COCH3
MW: 154.2
99 atom % D
MW: 298.03
98 atom % D
Formula: H2N(Cl)C6D3C6D3(Cl)NH2
MW: 259.17
98 atom % D
MW: 261.57
98 atom % D
MW: 261.57
98 atom % D
Formula: Cl3C6H2C6D5
MW: 262.58
98 atom % D
Formula: (HO)3C6D2COOH
MW: 172.13
98 atom % D
Formula: (CD3O)3C6H2COOH
MW: 221.26
99 atom % D
Formula: (CD3O)3C6H2CH2OH
MW: 207.27
99 atom % D
MW: 199.22
99 atom % D
MW: 142.15
98 atom % D
Formula: Cl2C6HD2NH2
MW: 164.03
99 atom % D
Formula: Cl2C6D3COOH
MW: 194.03
98 atom % D
MW: 228.13
99 atom % D
Formula: Cl2C6D3CH3
MW: 164.05
98 atom % D
Formula: F2C6D3COOH
MW: 161.12
98 atom % D
Formula: (CH3O)2C6H3CD2CN
MW: 179.21
98 atom % D
Formula: (CH3)2C6D3OD
MW: 126.19
98 atom % D
Formula: HO(Br2)C6D2CN
MW: 278.93
98 atom % D
Formula: C5D3Br2N
MW: 239.91
98 atom % D
Formula: Cl2C6D3NH2
MW: 165.04
98 atom % D
Formula: Cl2C6D3COOH
MW: 194.03
98 atom % D
MW: 228.13
99 atom % D
Formula: Cl2C6D3OH
MW: 166.02
99 atom % D
Formula: F2C6D3COOH
MW: 161.12
98 atom % D
MW: 204-21
99 atom % D
MW: 136.26
98 atom % D
Formula: (CD3)2C6H3OH
MW: 128.2
98 atom % D
Formula: (CD3)2C6D3COOH
MW: 159.23
98 atom % D
Formula: (CH3)2C6D3OD
MW: 126.19
98 atom % D
Formula: (CD3)2C6D3OD
MW: 132.23
98 atom % D
Formula: Cl2C6H2(OCD3)COOH
MW: 224.06
99 atom % D
Formula: (CD3)2CDC6D4OD
MW: 148.27
98 atom % D
MW: 220-29
99 atom % D
MW: 228.28
98 atom % D
Formula: C6D11NHCD2CD2CD2SO3H
MW: 238.42
98 atom % D
Formula: (CD3)2N(CH2)3NH2
MW: 108.22
99 atom % D
Formula: CD3N(NO2)CH2CH2CN
MW: 132.14
99 atom % D
Formula: CH3SCH2CD2CHO
MW: 106.18
98 atom % D
MW: 224.35
98 atom % D
Formula: CF3C6D4NH2
MW: 165.15
98 atom % D
Formula: CF3C6HD3OD
MW: 166.14
98 atom % D
Formula: H2NC6D4COOH
MW: 141.16
99 atom % D
Formula: (CH3CD2)2CDNH2
MW: 92.19
98 atom % D
Formula: H2NCD2CD2CD2SO3H
MW: 145.21
98 atom % D
Formula: H2NCD2CD2CONH2•HCl
MW: 128.59
98 atom % D
Formula: D2NC5D4N
MW: 100.15
98 atom % D
Formula: C6H5CH2OC6H4CDO
MW: 213.25
98 atom % D
Formula: BrCD2CD2CD2OH
MW: 145.03
98 atom % D
Formula: BrCD2CD2COOH
MW: 157
98 atom % D
MW: 162.02
98 atom % D
Formula: BrC6HD3CH3
MW: 174.05
98 atom % D
Formula: BrC6D4CD3
MW: 178.08
98 atom % D
Formula: Cl(CH2)3N(CD3)2•HCl
MW: 164.11
98 atom % D
Formula: ClC6HD3NH2
MW: 130.59
98 atom % D
Formula: ClC6D4COOH
MW: 160.59
98 atom % D
Formula: ClCD2CD2COOH
MW: 112.55
98 atom % D
Formula: ClC5D4N
MW: 117.57
98 atom % D
Formula: ClC6HD3CH3
MW: 129.6
98 atom % D
Formula: ClC6D4CD3
MW: 133.63
98 atom % D
Formula: BrCD2C6D4CN
MW: 202.08
98 atom % D
Formula: CD3CD2C6H4CH3
MW: 125.22
99 atom % D
Formula: FC6HD3ND2
MW: 116.15
99 atom % D
Formula: FC6H4CH=NNHC6D3(NO2)2
MW: 307.26
99 atom % D
Formula: CD3C6H4F
MW: 113.15
99 atom % D
Formula: CH2DC6H4F
MW: 111.14
98 atom % D
MW: 153.15
98 atom % D
MW: 165.16
99 atom % D
MW: 169.24
99 atom % D
Formula: CD3OC6H4CHO
MW: 139.17
99 atom % D
Formula: CH3OC6H4CD3
MW: 125.18
99 atom % D
Formula: (CH3)2CHCD2CD2OH
MW: 92.17
98 atom % D
Formula: (CH3)2CHCH2CD2OH
MW: 90.16
98 atom % D
Formula: (CD3)2CDCD2CD2OH
MW: 99.22
98 atom % D
MW: 159.17
98 atom % D
Formula: (CD3)2CDCH2COOH
MW: 109.18
98 atom % D
MW: 134.2
99 atom % D
Formula: C5H4NCD3
MW: 96.15
98 atom % D
MW: 101.18
99 atom % D
Formula: (CH3)2CHCH2CH2OCOCD3
MW: 133.2
99 atom % D
Formula: (CH3)2CHCD2CHO
MW: 88.15
98 atom % D
Formula: (CH3)2CHCD2COOH
MW: 104.15
98 atom % D
Formula: (CD3)2CDCD2COOH
MW: 111.19
98 atom % D
Formula: (CD3)2CDCD2COCl
MW: 129.63
98 atom % D
MW: 139.23
99 atom % D
Formula: CD3CD2CD(CD3)CD2CD3
MW: 100.26
98 atom % D
Formula: CH3CH(CD2COOH)2
MW: 150.17
98 atom % D
Formula: CD3C5D4N
MW: 100.17
98 atom % D
Formula: O2NC6D4NH2
MW: 142.15
98 atom % D
Formula: O2NC6D4COOH
MW: 171.15
98 atom % D
Formula: O2NC6H4CH2OD
MW: 154.14
98 atom % D
Formula: O2NC6D4CD2OH
MW: 159.17
99 atom % D
MW: 256.31
98 atom % D
MW: 538.84
98 atom % D
Formula: CD3CH2COCH2CD3
MW: 92.17
98 atom % D
Formula: CH3CD2COCD2CH3
MW: 90.16
98 atom % D
Formula: CD3CD2COCD2CD3
MW: 96.19
98 atom % D
3-PENTYL-2,2,3,4,4-D5 ALCOHOL
Formula: CH3CD2CD(OH)CD2CH3
MW: 93.18
98 atom % D
MW: 177.62
98 atom % D
Formula: H2NC6D4NHCOCH3
MW: 154.2
98 atom % D
Formula: BrC6D4COCD3
MW: 206.09
98 atom % D
Formula: ClC6D4COCH3
MW: 158.62
98 atom % D
Formula: ClC6D4COCD3
MW: 161.64
98 atom % D
MW: 316.18
86 atom % D
MW: 144.24
98 atom % D
Formula: O2NC6D4NHCOCH3
MW: 184.19
99 atom % D
Formula: BrC6D4C6D4Br
MW: 320.05
99 atom % D
Formula: (ClC6D4)2CO
MW: 259.16
98 atom % D
Formula: ClC6D4C6D4Cl
MW: 231.15
98 atom % D
Formula: HOC6D4C6D4OH
MW: 194.26
98 atom % D
Formula: (CH3OC6D4)2CO
MW: 250.32
98 atom % D
MW: 310.29
98 atom % D
MW: 164.24
98 atom % D
Formula: H2NC6H4CD2C6H4NH2
MW: 200.28
98 atom % D
Formula: D2NC6H2D2CH2C6H2D2
MW: 206.32
98 atom % D
Formula: (NO2)2(CD3)C6H2OH
MW: 201.15
98 atom % D
Formula: (NO2)2(CH3)C6D2OH
MW: 200.15
98 atom % D
MW: 398.54
98 atom % D
MW: 387.53
99 atom % D
MW: 347.51
99 atom % D
Formula: (CH3)2CHC6D4NH2
MW: 139.23
98 atom % D
Formula: (CD3)2CDC6D4OD
MW: 148.27
98 atom % D
Formula: CD3(CD2)3C6H4NH2
MW: 158.29
98 atom % D
4- N -BUTYLANILINE-2,3,5,6-D4,ND2
Formula: CH3(CH2)3C6D4ND2
MW: 155.27
98 atom % D
Formula: CD3(CD2)3C6D4ND2
MW: 164.33
98 atom % D
4- N -BUTYLANISOLE-2,3,5,6-D4
Formula: CH3CH2CH2CH2C6D4OCH3
MW: 168.27
98 atom % D
4- N -BUTYLPHENOL-2,3,5,6-D4,OD
Formula: CH3CH2CH2CH2C6D4OD
MW: 155.25
98 atom % D
4- N -NONYLPHENOL-2,3,5,6-D4,OD
Formula: CH3(CH2)8C6D4OD
MW: 225.38
98 atom % D
Formula: CD3(CD2)7C6H4OCH3
MW: 237.46
98 atom % D
Formula: CD3(CD2)7C6H4OH
MW: 223.43
98 atom % D
Formula: CD3(CD2)4C6H4OH
MW: 175.31
98 atom % D
Formula: CH3(CH2)4OC6H4CDO
MW: 193.26
98 atom % D
4- N -PENTYLPHENOL-2,3,5,6-D4,OD
Formula: CH3(CH2)4C6D4OD
MW: 169.28
98 atom % D
Formula: CD3(CD2)4C6D4OD
MW: 180.34
98 atom % D
Formula: CD3(CD2)2C6D4OD
MW: 148.27
98 atom % D
4- TERT -BUTYL-D9-PHENOL-2,3,5,6-D4
Formula: (CD3)3CC6D4OH
MW: 163.3
99 atom % D
Formula: (CD3)3CC6D4ND2
MW: 164.33
98 atom % D
Formula: (CD3)3CC6D4COOH
MW: 191.31
99 atom % D
4-( N -BUTYLAMINO-2,2,3,3,4,4,4-D7)BENZOIC ACID
MW: 200.29
95 atom % D
MW: 252.11
98 atom % D
MW: 135.2
99 atom % D
MW: 231.69
98 atom % D
Formula: CH3OC6D4CH2OCH2CH3
MW: 170.24
98 atom % D
Formula: CD3NH(CD2)3COOH•HCl
MW: 162.66
99 atom % D
MW: 211.26
98 atom % D
Formula: CF3C6D4NH2
MW: 165.15
98 atom % D
Formula: CH3CONHC6D4SO2Cl
MW: 237.69
98 atom % D
MW: 188.37
98 atom % D
MW: 189.37
99 atom % 15N; 98 atom % D
Formula: (CD3)2NC6H4NH2
MW: 142.23
98 atom % D
Formula: H2NC6D4COOH
MW: 141.16
98 atom % D
Formula: C6D5C6D4NH2
MW: 178.28
98 atom % D
4-AMINOBUTYRIC-2,2,3,3,4,4-D6 ACID
MW: 109.16
99 atom % D
MW: 105.13
98 atom % D
MW: 105.13
98 atom % D
Formula: D2NC6D4OD
MW: 116.17
97 atom % D
MW: 105.19
98 atom % D
Formula: D2NC5D4N
MW: 100.15
98 atom % D
MW: 309.46
98 atom % D
MW: 293.46
98 atom % D
Formula: BrC6D4CF3
MW: 229.03
98 atom % D
Formula: BrCD2CD2CD2CD2OH
MW: 161.07
99 atom % D
Formula: BrC6D4NH2
MW: 176.05
98 atom % D
Formula: BrC6D4OCH3
MW: 191.06
98 atom % D
Formula: BrC6H4OCD3
MW: 190.05
99 atom % D
Formula: BrC6D4COOH
MW: 205.04
99 atom % D
Formula: BrC6D4CN
MW: 186.04
99 atom % D
Formula: BrC6D4CH2Br
MW: 253.96
99 atom % D