ChemBuyersGuide.com

+1-212-348-5610

Chemical Search


























C/D/N Isotopes Inc.




Country: Canada

C/D/N Isotopes Inc.
88 Leacock Street
Pointe-Claire, Quebec
Canada H9R 1H1


Phone: (800) 565-4696
Phone 2: (514) 697-6254
FAX: (514) 697-6148
E-Mail:E-Mail this Supplier




http://www.cdnisotopes.com

Since 1993, C/D/N Isotopes has been a leading manufacturer of deuterium stable labeled compounds, providing our customers with superior quality and exceptional service. Researchers in all branches of science and medicine, from around the world, depend on us as the company for deuterium labeled compounds.

We have more than 3000 products in stock. As a result, we are able to ship most products within 24 to 48 hours after receipt of order. In fact, 98% of our orders are filled from stock.

The majority of the products listed on our website are manufactured exclusively by C/D/N Isotopes. Over the years, we have developed and expanded our expertise in the preparation of deuterated compounds, and we are continuously adding new products.

Most new products are the direct result of inquiries from our customers. Our extensive Custom Synthesis capabilities allow us to develop the products that our customers need, in a timely manner and at a reasonable price. Our Quality Control ensures that the isotopic enrichment and chemical purity of our products meet the highest standards.

Our courteous and helpful Customer Service professionals are available to assist you with all your stable labeled product requirements.


Product List: 3,036

PON:Page:1 | 2 | 3 |


 


Products for C/D/N Isotopes Inc.

Δ8,9-DEHYDRO-17β-ESTRADIOL-16,16,17-D3
D-5175
MW: 273.39
97 atom % D
Δ8,9-DEHYDROESTRONE-16,16-D2
D-5174
MW: 270.37
96 atom % D
α,α′-DIBROMO- P -XYLENE-D8
CAS:74903-77-8
Formula: C6D4(CD2Br)2
D-6542
MW: 272.01
98 atom % D
α,α,α-TRICHLOROTOLUENE-D5
CAS:93232-45-2
Formula: C6D5CCl3
D-6533
MW: 200.51
99 atom % D
α,α,α-TRIFLUOROTOLUENE-D5
CAS:164112-72-5
Formula: C6D5CF3
D-5716
MW: 151.14
99 atom % D
α-1,2,3,4,5,6-HEXACHLOROCYCLOHEXANE-D6
CAS:86194-41-4
Formula: C6Cl6D6
D-3009
MW: 296.87
99 atom % D
α-AMINO- ISO -BUTYRIC-D6 ACID (DIMETHYL-D6)
CAS:50348-93-1
Formula: (CD3)2C(NH2)COOH
D-6773
MW: 109.16
99 atom % D
α-HYDROXYMETOPROLOL (UNLABELLED) (MIXTURE OF STEREOISOMERS)
CAS:56392-16-6
X-5681
MW: 283.37
--
α-HYDROXYMETOPROLOL-D7 ( ISO -PROPYL-D7) (MIXTURE OF STEREOISOMERS)
CAS:1276197-39-7
D-7159
MW: 290.41
99 atom % D
α-METHYLSTYRENE-D10 (STABILIZED WITH HYDROQUINONE)
CAS:10362-82-0
Formula: C6D5C(CD3)=CD2
D-5333
MW: 128.24
98 atom % D
α-TERPINEOL-D3 (PROPYL METHYL-D3)
CAS:203633-12-9
D-2707
MW: 157.27
98 atom % D
β-ALANINE-2,2,3,3-D4
CAS:116173-67-2
Formula: H2NCD2CD2COOH
D-6498
MW: 93.12
98 atom % D
β-IMINODI(PROPIONIC-2,2,3,3-D4 ACID)
CAS:1219803-81-2
Formula: HN(CD2CD2COOH)2
D-6861
MW: 169.21
98 atom % D
γ-1,2,3,4,5,6-HEXACHLOROCYCLOHEXANE-D6
CAS:60556-82-3
Formula: C6Cl6D6
D-3010
MW: 296.87
99 atom % D
δ-VALEROLACTONE-3,3,4,4-D4
CAS:42932-61-6
D-5271
MW: 104.14
98 atom % D
ε-CAPROLACTAM-D10
CAS:169297-53-4
D-5253
MW: 123.22
98 atom % D
ε-CAPROLACTONE-3,3,4,4,5,5-D6
CAS:1219802-08-0
D-6111
MW: 120.18
99 atom % D
( E )-MYCOPHENOLATE MOFETIL-D4 (MORPHOLINYLETHYL-D4)
CAS:1132748-21-0
D-7150
MW: 437.52
99 atom % D
( E , Z )-METHOMYL-D3 (N-METHYL-D3)
CAS:1398109-07-3
D-7454
MW: 165.22
99 atom % D
( R )-(-)-3-QUINUCLIDINOL-2,2,3,6,6,7,7-D7
D-7569
MW: 134.23
98 atom % D
( R )-(-)-ATOMOXETINE-D5 HCL (PHENYL-D5)
D-7502
MW: 296.85
98 atom % D
( R )-(-)-METALAXYL-D6 (2,6-DIMETHYL-D6)
CAS:1398112-32-7
D-7345
MW: 285.37
99 atom % D
( R )-(-)-PHENYLEPHRINE-2,4,6-D3 HCL
CAS:1276197-50-2
D-6658
MW: 206.69
97 atom % D
( R )-3-AMINO(PIPERIDINE-3-D1)-2,6-DIONE HCL
D-7495
MW: 165.6
96 atom % D
( RS )-MALIC-2,3,3-D3 ACID
CAS:104596-63-6
Formula: HOOCCD2CD(OH)COOH
D-2122
MW: 137.11
98 atom % D
( S )-(+)-2-AMINO-1-PROPANOL-3,3,3-D3
CAS:352438-84-7
Formula: CD3CH(NH2)CH2OH
D-5164
MW: 78.13
99 atom % D
( S )-(+)-PREGABALIN-D4 (AMINOMETHYL-D2; HEXANOIC-2,2-D2 ACID)
CAS:1276197-54-6
D-6921
MW: 163.25
98 atom % D
( S )-(+)-REPAGLINIDE-D5 (ETHOXY-D5)
CAS:1217709-85-7
D-7124
MW: 457.62
99 atom % D
( S )-(-)-CARBIDOPA-D3 H2O (RING-D3)
Formula: (HO)2C6D3CH2C(CH3)(NHNH2)COOH
D-6406
MW: 247.27
98 atom % D
( S )-(-)-MALIC-2,3,3-D3 ACID
CAS:59652-74-3
Formula: HOOCCD2CD(OH)COOH
D-6626
MW: 137.11
98 atom % D
( S )-(-)-OFLOXACIN-D3 (N-METHYL-D3)
D-7516
MW: 364.39
99 atom % D
( S )-(-)-VALSARTAN-D8 (VALINE-D8)
CAS:1089736-72-0
D-6842
MW: 443.57
98 atom % D
( S )-(-)-VERAPAMIL-D3 HCL (N-METHYL-D3)
CAS:1398112-33-8
D-7403
MW: 494.09
99 atom % D
( S )-3-AMINO(PIPERIDINE-3-D1)-2,6-DIONE HCL
CAS:1398112-31-6
D-7459
MW: 165.6
94 atom % D
( S )-PRAMIPEXOLE-D7 2HCL (N-PROPYL-D7)
D-7499
MW: 291.29
99 atom % D
(±)- CIS -SERTRALINE-D3 HCL (N-METHYL-D3)
CAS:1217741-83-7
D-7402
MW: 345.71
99 atom % D
(±)- P -OCTOPAMINE-α,β,β-D3 HCL
CAS:1219803-62-9
Formula: HOC6H4CD(OH)CD2NH2
D-1774
MW: 192.66
98 atom % D
(±)- SEC -BUTYL-1,1,1-D3 ALCOHOL
CAS:53716-61-3
Formula: CH3CH2CH(OH)CD3
D-1064
MW: 77.14
99 atom % D
(±)- SEC -BUTYL-3,3,4,4,4-D5 ALCOHOL
CAS:75749-92-7
Formula: CD3CD2CH(OH)CH3
D-1063
MW: 79.15
99 atom % D
(±)- SEC -BUTYL-D9 ALCOHOL
CAS:1202864-22-9
Formula: CD3CD2CD(OH)CD3
D-5841
MW: 83.18
98 atom % D
(±)- TRANS -SERTRALINE-D3 HCL (N-METHYL-D3)
CAS:1330180-66-9
D-7473
MW: 345.71
99 atom % D
(±)-(1-BROMOETHYL-2,2,2-D3)BENZENE
CAS:23088-42-8
Formula: C6H5CH(Br)CD3
D-6134
MW: 188.08
98 atom % D
(±)-1,2-BIS-HEXADECANOYL-3-CHLOROPROPANE-D5-DIOL
CAS:1185057-55-9
D-7429
MW: 592.4
98 atom % D
(±)-1,2-DIBROMOPROPANE-D6
CAS:51209-47-3
Formula: CD3CD(Br)CD2Br
D-1712
MW: 207.93
98 atom % D
(±)-1,2-DICHLOROPROPANE-D6
CAS:93952-08-0
Formula: CD3CDClCD2Cl
D-2363
MW: 119.02
98 atom % D
(±)-1,2-ISOPROPYLIDENEGLYCEROL-1,1,2,3,3-D5
CAS:74300-14-4
D-7596
MW: 137.19
98 atom % D
(±)-1,2-PROPANE-1,1,2-D3-DIAMINE
Formula: CH3CD(NH2)CD2NH2
D-7562
MW: 77.14
99 atom % D
(±)-1,2-PROPANE-D6-DIOL
CAS:52910-80-2
Formula: CD3CD(OH)CD2OH
D-1507
MW: 82.13
98 atom % D
(±)-1,2-PROPANEDIOL-(OD)2
CAS:58161-11-8
Formula: CH3CH(OD)CH2OD
D-386
MW: 78.11
98 atom % D
(±)-1,2-PROPANEDIOL-D8
CAS:80156-55-4
Formula: CD3CD(OD)CD2OD
D-1656
MW: 84.14
98 atom % D
(±)-1,2-PROPYLENE-3,3,3-D3 OXIDE (STABILIZED WITH HYDROQUINONE)
CAS:2245-32-1
D-83
MW: 61.1
99 atom % D
(±)-1,2-PROPYLENE-D6 CARBONATE
CAS:202480-74-8
D-5545
MW: 108.13
98 atom % D
(±)-1,2-PROPYLENE-D6 OXIDE (STABILIZED WITH HYDROQUINONE)
CAS:202468-69-7
D-1915
MW: 64.12
98 atom % D
(±)-1,4-DITHIOTHREITOL-1,1,2,3,4,4-D6
Formula: HSCD2CD(OH)CD(OH)CD2SH
D-6631
MW: 160.27
98 atom % D
(±)-1,4-DITHIOTHREITOL-D10
CAS:302912-05-6
Formula: DSCD2CD(OD)CD(OD)CD2SD
D-3931
MW: 164.3
97 atom % D
(±)-1-AMINO-2-PHENYL-D5-PROPANE-2,3,3,3-D4
D-7595
MW: 144.26
98 atom % D
(±)-1-AMINO-2-PROPANOL-1,1,2,3,3,3-D6
CAS:1219795-13-7
Formula: CD3CD(OH)CD2NH2
D-6277
MW: 81.15
98 atom % D
(±)-1-BROMO-2-ETHYL-3-METHYL-D3-BUTANE-3,4,4,4-D4
CAS:1219805-84-1
Formula: (CD3)2CDCH(CH2CH3)CH2Br
D-6383
MW: 186.14
99 atom % D
(±)-1-PHENYL-D5-ETHANOL
CAS:90162-45-1
Formula: C6D5CH(OH)CH3
D-737
MW: 127.19
98 atom % D
(±)-1-PHENYLETHAN-1,2,2,2-D4-OL
CAS:90162-44-0
Formula: C6H5CD(OH)CD3
D-739
MW: 126.19
98 atom % D
(±)-1-PHENYLETHAN-1-D1-OL
CAS:3101-96-0
Formula: C6H5CD(OH)CH3
D-2124
MW: 123.17
98 atom % D
(±)-1-PHENYLETHAN-2,2,2-D3-OL
CAS:17537-32-5
Formula: C6H5CH(OH)CD3
D-627
MW: 125.18
98 atom % D
(±)-1-PHENYLETHANOL-D10
CAS:219586-41-1
Formula: C6D5CD(OD)CD3
D-1912
MW: 132.23
98 atom % D
(±)-18-METHYL-D3-EICOSANOIC ACID
Formula: CH3CH2CH(CD3)(CH2)16COOH
D-7533
MW: 329.58
99 atom % D
(±)-2-(2,4-DICHLOROPHENOXY-D3)PROPIONIC ACID
CAS:1219803-66-3
D-7117
MW: 238.08
98 atom % D
(±)-2-(4-CHLORO-2-METHYLPHENOXY-D3)PROPIONIC ACID
CAS:352431-15-3
D-5321
MW: 217.67
98 atom % D
(±)-2-(ETHYL-D5-AMINO)PROPIOPHENONE HCL
CAS:1189879-32-0
Formula: C6H5COCH(CH3)NHCD2CD3•HCl
D-7094
MW: 218.74
99 atom % D
(±)-2-AMINOHEXANE-1,1,1,2,3,3-D6
CAS:1219802-28-4
Formula: CH3CH2CH2CD2CD(NH2)CD3
D-6783
MW: 107.23
98 atom % D
(±)-2-BROMOBUTANE-D9
CAS:202392-72-1
Formula: CD3CD2CD(Br)CD3
D-5906
MW: 146.07
99 atom % D
(±)-2-BROMOBUTYRIC-2,3,3,4,4,4-D6 ACID
CAS:1219799-08-2
Formula: CD3CD2CD(Br)COOH
D-5580
MW: 173.04
98 atom % D
(±)-2-BROMOPROPIONIC-2,3,3,3-D4 ACID
CAS:60153-93-7
Formula: CD3CD(Br)COOH
D-5598
MW: 157
98 atom % D
(±)-2-BROMOPROPIONIC-3,3,3-D3 ACID
Formula: CD3CH(Br)COOH
D-7676
MW: 155.99
98 atom % D
(±)-2-CHLOROBUTANE-D9
CAS:175540-77-9
Formula: CD3CD2CD(Cl)CD3
D-6683
MW: 101.62
98 atom % D
(±)-2-CHLOROBUTYRIC-2,3,3,4,4,4-D6 ACID
CAS:1219802-13-7
Formula: CD3CD2CD(Cl)COOH
D-5600
MW: 128.59
98 atom % D
(±)-2-CHLOROPROPIONYL-2,3,3,3-D4 CHLORIDE
CAS:1219794-98-5
Formula: CD3CD(Cl)COCl
D-6198
MW: 130.99
98 atom % D
(±)-2-ETHYLHEXANOIC-D15 ACID
CAS:352431-38-0
Formula: CD3(CD2)3CD(CD2CD3)COOH
D-5246
MW: 159.3
98 atom % D
(±)-2-ETHYLHEXYL-D17 ACETATE
CAS:1219802-70-6
Formula: CD3(CD2)3CD(CD2CD3)CD2OCOCH3<
D-6583
MW: 189.37
98 atom % D
(±)-2-ETHYLHEXYL-D17 ALCOHOL
CAS:202480-75-9
Formula: CD3(CD2)3CD(CD2CD3)CD2OH
D-5247
MW: 147.33
98 atom % D
(±)-2-HYDROXYHEXANOIC-6,6,6-D3 ACID
CAS:1219798-84-1
Formula: CD3CH2CH2CH2CH(OH)COOH
D-6443
MW: 135.18
99 atom % D
(±)-2-IODOBUTANE-D9 (STABILIZED WITH COPPER)
CAS:1219795-41-1
Formula: CD3CD2CD(l)CD3
D-5900
MW: 193.07
99 atom % D
(±)-2-METHYL-2,4-PENTANE-D12-DIOL
CAS:284474-72-2
Formula: CD3CD(OH)CD2C(CD3)2OH
D-5825
MW: 130.25
98 atom % D
(±)-2-METHYL-D3-BUTYRIC ACID
CAS:95926-92-4
Formula: CH3CH2CH(CD3)COOH
D-7535
MW: 105.15
99 atom % D
(±)-2-METHYL-D3-PIPERAZINE-2,3,3,5,5,6,6-D7
D-6622
MW: 110.22
99 atom % D
(±)-2-METHYL-D3-SUCCINIC-2,3,3-D3 ACID
CAS:347840-08-8
Formula: HOOCCD(CD3)CD2COOH
D-3588
MW: 138.15
98 atom % D
(±)-2-METHYLBUTYRIC-D9 ACID
CAS:352431-44-8
Formula: CD3CD2CD(CD3)COOH
D-5267
MW: 111.19
98 atom % D
(±)-2-METHYLBUTYRYL-D9 CHLORIDE
CAS:1219795-10-4
Formula: CD3CD2CD(CD3)COCl
D-5463
MW: 129.63
98 atom % D
(±)-2-METHYLPIPERAZINE-2,3,3,5,5,6,6-D7
CAS:1219802-98-8
D-6609
MW: 107.21
98 atom % D
(±)-2-PENTYL-1,1,1,3,3-D5 ALCOHOL
CAS:14629-70-0
Formula: CH3CH2CD2CH(OH)CD3
D-5139
MW: 93.18
98 atom % D
(±)-3-(2-METHOXY-D3-PHENOXY)-1,2-PROPANEDIOL
CAS:1189924-85-3
D-5793
MW: 201.24
99 atom % D
(±)-3-(4-METHYLBENZYLIDINE-D4)CAMPHOR
CAS:1219806-41-3
D-6964
MW: 258.4
98 atom % D
(±)-3-AMINO- ISO -BUTYRIC-2,3,3-D3 ACID
CAS:1219803-65-2
Formula: H2NCD2CD(CH3)COOH
D-7229
MW: 106.14
98 atom % D
(±)-3-CHLORO-1,2-PROPANE-D5-DIOL
CAS:342611-01-2
Formula: ClCD2CD(OH)CD2OH
D-1842
MW: 115.57
98 atom % D
(±)-3-METHYLOCTANE-D20
CAS:345909-08-2
Formula: CD3(CD2)4CD(CD3)CD2CD3
D-3024
MW: 148.38
98 atom % D
(±)-3-METHYLPENTANOIC-D11 ACID
Formula: CD3CD2CD(CD3)CD2COOH
D-7619
MW: 127.23
99 atom % D
(±)-3-PYRROLIDINOL-2,2,3,4,4-D5
CAS:1219805-52-3
D-5661
MW: 92.15
97 atom % D
(±)-3-QUINUCLIDINOL-2,2,3,6,6,7,7-D7
D-7560
MW: 134.23
99 atom % D
(±)-4-HYDROXY-3-METHOXY-D3-MANDELIC ACID
CAS:74495-70-8
D-3919
MW: 201.19
99 atom % D
(±)-4-HYDROXY-3-METHOXYMANDELIC-α-D1 ACID
CAS:53587-34-1
Formula: HO(CH3O)C6H3CD(OH)COOH
D-1845
MW: 199.18
93 atom % D
(±)-4-HYDROXYPROPRANOLOL HCL (UNLABELLED)
CAS:14133-90-5
X-4329
MW: 311.81
--
(±)-4-HYDROXYPROPRANOLOL-D7 HCL ( ISO -PROPYL-D7)
CAS:1219804-03-1
D-5579
MW: 318.85
99 atom % D
(±)-7-METHYL-D3-NONANOIC ACID
Formula: CH3CH2CH(CD3)(CH2)5COOH
D-7534
MW: 175.29
99 atom % D
(±)-ACEBUTOLOL-D7 ( ISO -PROPYL-D7)
D-7506
MW: 343.47
99 atom % D
(±)-ALBUTEROL-D3 (3-HYDROXYMETHYL-D2; α-D1)
CAS:1219798-60-3
D-5921
MW: 242.33
98 atom % D
(±)-ALFUZOSIN-D7 HCL (TETRAHYDROFUROYL-D7)
CAS:1276197-14-8
D-7228
MW: 432.96
98 atom % D
(±)-AMBRISENTAN-D3 (METHOXY-D3)
CAS:1189479-60-4
D-7366
MW: 381.45
99 atom % D
(±)-AMLODIPINE-D4 MALEATE (2-CHLOROPHENYL-D4)
D-7346
MW: 528.98
98 atom % D
(±)-ATENOLOL-D7 ( ISO -PROPYL-D7)
CAS:29122-68-7
Formula: (CD3)2CDNHCH2CH(OH)CH2OC6H4CH
D-6202
MW: 273.38
98 atom % D
(±)-ATOMOXETINE-D5 HCL (PHENYL-D5)
CAS:1398065-95-6
D-7503
MW: 296.85
98 atom % D
(±)-ATROPINE-D3 (N-METHYL-D3)
CAS:1276197-36-4
D-1861
MW: 292.39
99 atom % D
(±)-BENZOIN-D10 (DIPHENYL-D10)
CAS:56830-64-9
Formula: C6D5COCH(OH)C6D5
D-5839
MW: 222.31
98 atom % D
(±)-BETAXOLOL-D7 HCL (N- ISO -PROPYL-D7)
CAS:1219802-92-2
D-7097
MW: 350.94
99 atom % D
(±)-BISOPROLOL-D7 HEMIFUMARATE ( ISO -PROPYL-D7)
D-7507
MW: 390.52
99 atom % D
(±)-BUPIVACAINE-D9 (BUTYL-D9)
CAS:474668-57-0
D-6933
MW: 297.49
98 atom % D
(±)-BUPROPION-D9 HCL ( TERT -BUTYL-D9)
CAS:1189725-26-5
D-6834
MW: 285.26
99 atom % D
(±)-CARAZOLOL-D7 ( ISO -PROPYL-D7)
CAS:1173021-02-7
D-7525
MW: 305.43
99 atom % D
(±)-CARAZOLOL-D7 HCL ( ISO -PROPYL-D7)
CAS:1276197-44-4
D-7327
MW: 341.89
99 atom % D
(±)-CARBINOXAMINE-D6 MALEATE (N,N-DIMETHYL-D6)
D-7564
MW: 412.9
98 atom % D
(±)-CARVEDILOL-D4 (ETHYL-D4)
CAS:1133705-56-2
D-6828
MW: 410.5
99 atom % D
(±)-CETIRIZINE-D4 (ETHOXY-D4)
CAS:1219803-84-5
D-6100
MW: 392.92
99 atom % D
(±)-CHLOROPHACINONE-D4 (INDANEDIONE-4,5,6,7-D4)
CAS:1219805-75-0
D-7082
MW: 378.85
99 atom % D
(±)-CHLORPHENIRAMINE-D6 MALEATE (N,N-DIMETHYL-D6)
CAS:1219806-45-7
D-6639
MW: 396.9
98 atom % D
(±)-CITALOPRAM-D4 HBR (4-FLUOROPHENYL-D4)
CAS:1219803-58-3
D-6822
MW: 409.33
98 atom % D
(±)-CLENBUTEROL-D9 (TRIMETHYL-D9)
CAS:129138-58-5
D-4287
MW: 286.25
99 atom % D
(±)-COTININE-2,4,5,6-D4 (PYRIDINE-D4)
CAS:350818-68-7
D-5097
MW: 180.24
98 atom % D
(±)-COTININE-D3 (N-METHYL-D3)
CAS:110952-70-0
D-3518
MW: 179.24
98 atom % D
(±)-DESVENLAFAXINE-D6 SUCCINATE HYDRATE (N,N-DIMETHYL-D6)
D-7379
MW: 405.52
99 atom % D
(±)-DONEPEZIL-D4 HCL (BIS-METHYLENE-D4)
CAS:1219798-88-5
D-6365
MW: 419.98
99 atom % D
(±)-DULOXETINE-D5 OXALATE (N-METHYL-D3; PROPANAMINE-D2)
D-7125
MW: 392.48
99 atom % D
(±)-EPICHLOROHYDRIN-2-D1 (STABILIZED WITH HYDROQUINONE)
CAS:70735-27-2
D-5370
MW: 93.53
98 atom % D
(±)-EPICHLOROHYDRIN-D5 (STABILIZED WITH HYDROQUINONE)
CAS:69533-54-6
D-1194
MW: 97.56
98 atom % D
(±)-EPINEPHRINE-2,5,6,α,β,β-D6
CAS:1219803-77-6
D-6632
MW: 189.24
98 atom % D
(±)-EPINEPHRINE-D3 (N-METHYL-D3)
CAS:1189977-29-4
D-6633
MW: 186.22
99 atom % D
(±)-ETODOLAC-D3 (1-ETHYL-2,2,2-D3)
CAS:1276197-46-6
D-7296
MW: 290.38
99 atom % D
(±)-FELODIPINE-D3 (2,3-DICHLOROPHENYL-D3)
CAS:1219795-30-8
D-7175
MW: 387.28
99 atom % D
(±)-FENBUCONAZOLE-D5 (PHENYL-D5)
CAS:1398066-06-2
D-7388
MW: 341.85
99 atom % D
(±)-FLUOXETINE-D5 HCL (PHENYL-D5)
CAS:1173020-43-3
D-5749
MW: 350.82
99 atom % D
(±)-FLUOXETINE-D5 OXALATE (PHENYL-D5)
CAS:1219804-82-6
D-5740
MW: 404.4
99 atom % D
(±)-FLURBIPROFEN-D5 (PHENYL-D5)
CAS:215175-76-1
D-7405
MW: 249.3
99 atom % D
(±)-GLYCERYL-1,1,2,3,3-D5 1-MONOOLEATE
CAS:565183-24-6
D-7610
MW: 361.58
98 atom % D
(±)-GLYCIDOL-1,1,2,3,3-D5
CAS:1246819-20-4
D-7483
MW: 79.11
98 atom % D
(±)-IBUPROFEN-D3 (α-METHYL-D3)
CAS:121662-14-4
D-6119
MW: 209.3
99 atom % D
(±)-IBUPROFEN-D3, SODIUM SALT (α-METHYL-D3)
CAS:1219805-09-0
D-6873
MW: 231.28
99 atom % D
(±)-IMAZALIL-D5 SULFATE (ALLYLOXY-D5)
CAS:1398065-92-3
D-7406
MW: 400.29
98 atom % D
(±)-IPRATROPIUM-D3 BROMIDE (N-METHYL-D3)
Formula: 97% chemical purity
D-6923
MW: 415.38
99 atom % D
(±)-KETOCONAZOLE-D4 (PIPERAZINE-3,3,5,5-D4) ( CIS -ISOMERS)
D-7488
MW: 535.46
98 atom % D
(±)-KETOPROFEN-D3 (α-METHYL-D3)
CAS:159490-55-8
D-6887
MW: 257.3
98 atom % D
(±)-KETOPROFEN-D4 (PROPIONIC-D4 ACID)
CAS:1219805-29-4
D-6837
MW: 258.31
99 atom % D
(±)-LINALOOL-D3 (VINYL-D3)
CAS:1216673-02-7
D-6961
MW: 157.27
99 atom % D
(±)-MANDELIC-2,3,4,5,6-D5 ACID
CAS:70838-71-0
Formula: C6D5CH(OH)COOH
D-6354
MW: 157.18
98 atom % D
(±)-METANEPHRINE-α,β,β-D3 HCL
CAS:1085333-94-3
D-1841
MW: 236.71
98 atom % D
(±)-METANEPHRINE-D3 HCL (N-METHYL-D3)
CAS:1215507-88-2
D-6688
MW: 236.71
99 atom % D
(±)-METHOCARBAMOL-D3 (METHOXY-D3)
CAS:1346600-86-9
D-7508
MW: 244.26
99 atom % D
(±)-METOLACHLOR-D6 (PROPYL-D6)
CAS:1219803-97-0
D-5647
MW: 289.83
98 atom % D
(±)-METOPROLOL-D7 HCL ( ISO -PROPYL-D7)
CAS:1219798-61-4
D-6682
MW: 310.87
99 atom % D
(±)-MEVALONOLACTONE-4,4,5,5,6,6,6-D7
CAS:347840-19-1
D-3743
MW: 137.19
98 atom % D
(±)-MEVALONOLACTONE-4,4,5,5-D4
CAS:349553-98-6
D-4130
MW: 134.17
98 atom % D
(±)-MEVALONOLACTONE-D3 (METHYL-D3)
CAS:61219-76-9
D-3050
MW: 133.16
99 atom % D
(±)-MIANSERIN-D3 HCL (METHYL-D3)
CAS:1219804-97-3
D-7162
MW: 303.85
99 atom % D
(±)-MICONAZOLE-D5 NITRATE (2,4-DICHLOROBENZYLOXY-D5)
CAS:1398065-80-9
D-7343
MW: 484.14
98 atom % D
(±)-MYCLOBUTANIL-D9 (BUTYL-D9)
D-7682
MW: 297.83
99 atom % D
(±)-N′-NITROSONORNICOTINE-2,4,5,6-D4 (PYRIDINE-D4)
CAS:66148-19-4
D-4141
MW: 181.23
98 atom % D
(±)-N-(2,6-DIMETHYLPHENYL)-1- ISO -PROPYL-D7-2-PIPERIDINECARBOXAMIDE
CAS:1276197-11-5
D-6992
MW: 281.45
99 atom % D
(±)-N-2-METHYLBUTYRYL-D9-GLYCINE
CAS:1219798-77-2
Formula: CD3CD2CD(CD3)CONHCH2COOH
D-6709
MW: 168.24
98 atom % D
(±)-N-2-METHYLBUTYRYLGLYCINE-2,2-D2
Formula: CH3CH2CH(CH3)CONHCD2COOH
D-6708
MW: 161.2
98 atom % D
(±)-NAPROXEN-D3 (α-METHYL-D3)
CAS:958293-77-1
D-6523
MW: 233.28
99 atom % D
(±)-NICOTINE-2,4,5,6-D4 (PYRIDINE-D4)
CAS:350818-69-8
D-5098
MW: 166.26
98 atom % D
(±)-NICOTINE-D3 (N-METHYL-D3)
CAS:69980-24-1
D-3519
MW: 165.25
99 atom % D
(±)-NICOTINE-D7 (N-METHYL-D3; PYRIDINE-D4)
CAS:1219805-86-3
D-6500
MW: 169.28
98 atom % D
(±)-NISOLDIPINE-D4 (2-NITROPHENYL-D4)
CAS:1219795-47-7
D-6186
MW: 392.44
99 atom % D
(±)-NOREPINEPHRINE-2,5,6,α,β,β-D6 HCL
CAS:1219803-04-9
D-6634
MW: 211.67
99 atom % D
(±)-NORFLUOXETINE-D5 HCL (PROPYL-1,1,2,2,3-D5)
CAS:1185132-92-6
D-6023
MW: 336.8
98 atom % D
(±)-NORMETANEPHRINE-α,β,β-D3 HCL
CAS:1085333-97-6
D-1640
MW: 222.68
98 atom % D
(±)-NORNICOTINE-2,4,5,6-D4 (PYRIDINE-D4)
CAS:66148-18-3
D-4174
MW: 152.23
98 atom % D
(±)-O-DESMETHYLNAPROXEN-D3 (α-METHYL-D3)
CAS:1122399-99-8
D-7674
MW: 219.25
99 atom % D
(±)-ONDANSETRON-D5 (METHYLIMIDAZOLE-D5)
CAS:1219798-86-3
D-6623
MW: 298.4
97 atom % D
(±)-OXYBUTYNIN-D11 HCL (CYCLOHEXYL-D11)
CAS:1185151-95-4
D-6104
MW: 405.02
99 atom % D
(±)-OXYPHENBUTAZONE-D9 ( N -BUTYL-D9)
CAS:1189693-23-9
D-7297
MW: 333.43
99 atom % D
(±)-PENCONAZOLE-D7 (PENTYL-3,3,4,4,5,5,5-D7)
D-7681
MW: 291.23
98 atom % D
(±)-PHENOXYBENZAMINE-D5 HCL (BENZYL-2,3,4,5,6-D5)
CAS:1398065-71-8
D-7367
MW: 345.32
99 atom % D
(±)-PINDOLOL-D7 ( ISO -PROPYL-D7)
CAS:1185031-19-9
D-7538
MW: 255.37
99 atom % D
(±)-PIOGLITAZONE-D4 (PHENYL-D4)
CAS:1134163-29-3
D-7378
MW: 360.46
98 atom % D
(±)-PRASUGREL-D3 (ACETATE-D3)
CAS:1127253-02-4
D-7536
MW: 376.46
99 atom % D
(±)-PROMETHAZINE-D4 HCL (PHENOTHIAZINE-1,3,7,9-D4)
CAS:1173018-74-0
D-7144
MW: 324.9
98 atom % D
(±)-PROPAFENONE-D5 HCL (PROPYL-2,2,3,3,3-D5)
CAS:1398066-02-8
D-7463
MW: 382.94
98 atom % D
(±)-PROPAFENONE-D7 HCL (PROPYL-D7)
CAS:1219799-06-0
D-7013
MW: 384.95
99 atom % D
(±)-PROPRANOLOL-D7 (RING-D7)
CAS:344298-99-3
D-2386
MW: 266.39
97 atom % D
(±)-PYRIPROXYFEN-D4 (PYRIDYL-D4)
D-7693
MW: 325.4
99 atom % D
(±)-QUIZALOFOP-ETHYL-D3 (PROPIONATE-3,3,3-D3)
CAS:1398065-84-3
D-7391
MW: 375.83
98 atom % D
(±)-RACTOPAMINE-D3 HCL (2-HYDROXYETHYL-1,1,2-D3)
CAS:1219794-72-5
D-6839
MW: 340.86
97 atom % D
(±)-RACTOPAMINE-D6 HCL (1-METHYL-D3;PROPYL-1,2,2-D3)
CAS:1276197-17-1
D-7295
MW: 343.88
99 atom % D
(±)-RANOLAZINE-D8 2HCL (PIPERAZINE-D8)
CAS:1219802-60-4
D-7014
MW: 508.51
98 atom % D
(±)-ROPIVACAINE-D7 (PROPYL-D7)
CAS:1392208-04-6
D-6934
MW: 281.45
98 atom % D
(±)-SALMETEROL-D3 (3-HYDROXYMETHYL-D2; α-D1)
CAS:497063-94-2
D-6187
MW: 418.59
98 atom % D
(±)-SOTALOL-D7 HCL ( ISO -PROPYL-D7)
CAS:1398065-65-0
D-7411
MW: 315.87
99 atom % D
(±)-TARTARIC-2,3-D2 ACID
CAS:91469-46-4
Formula: HOOCCD(OH)CD(OH)COOH
D-5343
MW: 152.1
98 atom % D
(±)-TEBUCONAZOLE-D4 (4-CHLOROPHENYL-D4)
D-7563
MW: 311.85
98 atom % D
(±)-TERCONAZOLE-D4 (PIPERAZINE-2,2,6,6-D4) ( CIS -ISOMERS)
D-7517
MW: 536.49
98 atom % D
(±)-TETRAHYDRO-2-FUROIC-D7 ACID
CAS:1219798-42-1
D-6662
MW: 123.16
98 atom % D
(±)-THALIDOMIDE-D4 (PHENYL-D4)
CAS:1219177-18-0
D-6840
MW: 262.26
98 atom % D
(±)-THIORIDAZINE-D3 HCL (N-METHYL-D3)
CAS:1189928-36-6
D-7643
MW: 410.05
98 atom % D
(±)-TOLTERODINE-D14 TARTRATE [N,N-DI( ISO -PROPYL-D7)]
D-7006
MW: 489.67
98 atom % D
(±)-TRAMADOL-D6 HCL (N,N-DIMETHYL-D6) ( CIS/TRANS MIXTURE)
CAS:1189374-50-2
D-6990
MW: 305.88
99 atom % D
(±)-TRANYLCYPROMINE-D5 HCL (PHENYL-D5)
CAS:107077-98-5
D-6824
MW: 174.68
98 atom % D
(±)-TRIADIMEFON-D4 (4-CHLOROPHENYL-D4)
D-7683
MW: 297.78
98 atom % D
(±)-TRIMIPRAMINE-D3 MALEATE (N-METHYL-D3)
CAS:1185245-93-5
D-6762
MW: 413.53
99 atom % D
(±)-VELNACRINE-1,2,2-D3 MALEATE
CAS:1219806-48-0
D-7200
MW: 333.36
99 atom % D (also 12%-4,4-d2)
(±)-VENLAFAXINE-D6 HCL (N,N-DIMETHYL-D6)
CAS:1062606-12-5
D-6826
MW: 319.9
99 atom % D
(±)-VERAPAMIL-D3 HCL (N-METHYL-D3)
D-7546
MW: 494.09
99 atom % D
(±)-WARFARIN-D5 (PHENYL-D5)
CAS:75472-93-4
D-7080
MW: 313.36
99 atom % D
(+)- CIS -DILTIAZEM-D3 HCL (ACETOXY-D3)
CAS:1217860-13-3
D-7375
MW: 454
99 atom % D
(-)-2-METHYL-D3-ISOBORNEOL
CAS:135441-89-3
D-6241
MW: 171.3
99 atom % D
(-)-NORELGESTROMIN-2,2,4,6,6,10-D6
CAS:1263184-13-9
D-6942
MW: 333.5
99 atom % D
(-)-NORGESTREL-2,2,4,6,6,10-D6
D-6159
MW: 318.49
98 atom % D
(1 S ,3′ R )-SOLIFENACIN-D7 HCL (2′,2′,3′,6′,6′,7′,7′-D7)
D-7570
MW: 405.97
98 atom % D
(2 R )-LACOSAMIDE-D3 (O-METHYL-D3)
CAS:1217689-95-6
D-7271
MW: 253.32
99 atom % D
(2 S ,2′ S )-ETHAMBUTOL-D10 (1,1,1′,1′,2,2′-D6; ETHYLENE-D4)
CAS:1129526-24-4
D-7356
MW: 214.37
99 atom % D
(2 S ,2′ S )-ETHAMBUTOL-D4 (ETHYLENE-D4)
CAS:1129526-19-7
D-7365
MW: 208.34
99 atom % D
(2,4,5-TRICHLOROPHENOXY-D2) ACETIC-2,2-D2 ACID
CAS:358731-37-0
D-5553
MW: 259.51
99 atom % D
(2,4-DICHLOROPHENOXY-D3) ACETIC ACID
CAS:202480-67-9
D-5750
MW: 224.06
98 atom % D
(2,4-DICHLOROPHENOXY-D3) ACETIC-2,2-D2 ACID
CAS:352438-69-8
D-5121
MW: 226.07
98 atom % D
(2,6-DICHLOROPHENYL)ACETIC-2,2-D2 ACID
CAS:1219803-63-0
D-7141
MW: 207.05
98 atom % D
(2-BROMOETHYL)BENZENE-D5
CAS:35845-64-8
Formula: C6D5CH2CH2Br
D-4317
MW: 190.09
99 atom % D
(2-CHLOROPHENYL)DIPHENYL-D5-METHANOL
CAS:1219802-30-8
D-6582
MW: 299.81
99 atom % D
(2-ETHOXY-D5-PHENOXY) ACETIC ACID
D-7542
MW: 201.23
99 atom % D
(25 RS )-26-HYDROXYCHOLESTEROL-24,24,26,26-D4
D-6879
MW: 406.68
98 atom % D
(3,4,5-TRIMETHOXYPHENYL) ACETIC-2,2-D2 ACID
CAS:344299-45-2
Formula: (CH3O)3C6H2CD2COOH
D-2144
MW: 228.24
97 atom % D
(3,4-DIHYDROXYPHENYL-D3) ACETIC-2,2-D2 ACID
CAS:60696-39-1
D-1642
MW: 173.18
98 atom % D
(3,4-DIMETHOXYPHENYL) ACETIC-2,2-D2 ACID
CAS:19031-58-4
Formula: (CH3O)2C6H3CD2COOH
D-1941
MW: 198.21
98 atom % D
(4- N -NONYLPHENOXY) ACETIC-2,2-D2 ACID
CAS:1219798-75-0
Formula: CH3(CH2)8C6H4OCD2COOH
D-6492
MW: 280.4
98 atom % D
(4-CARBOXYBUTYL-2,2,3,3-D4) TRIPHENYLPHOSPHONIUM BROMIDE
CAS:42932-63-8
Formula: HOOCCH2(CD2)2CH2P(C6H5)3D-2192
MW: 447.34
98 atom % D
(4-CHLORO-2-METHYLPHENOXY-D3) ACETIC ACID
CAS:352431-14-2
D-5320
MW: 203.64
98 atom % D
(4-FLUOROPHENYL)ACETIC-2,2-D2 ACID
CAS:113715-48-3
Formula: FC6H4CD2COOH
D-7230
MW: 156.15
98 atom % D (also 10% 3,5-d2)
(4-HYDROXY-3-METHOXYPHENYL) ACETIC-2,2-D2 ACID
CAS:53587-33-0
Formula: HO(CH3O)C6H3CD2COOH
D-1543
MW: 184.19
98 atom % D
(4-HYDROXY-3-METHOXYPHENYL-D3) ACETIC-2,2-D2 ACID
CAS:53587-32-9
Formula: HO(CH3O)C6D3CD2COOH
D-7304
MW: 187.21
99 atom % D
(5-CARBOXYPENTYL-2,2,3,3,4,4-D6) TRIPHENYLPHOSPHONIUM BROMIDE
Formula: HOOCCH2(CD23CH2P(C6H5)3Br
D-7311
MW: 463.38
99 atom % D
(6 R ,12A R )-TADALAFIL-D3 (N-METHYL-D3)
CAS:960226-55-5
D-7476
MW: 392.43
99 atom % D
(BROMOMETHYL)CYCLOHEXANE-D11
CAS:1219794-79-2
Formula: C6D11CH2Br
D-5903
MW: 188.15
98 atom % D
(BROMOMETHYL)CYCLOPROPANE-2,2,3,3-D4
CAS:1219805-93-2
D-7222
MW: 139.03
99 atom % D
(BROMOMETHYL-D2)CYCLOPROPANE-1-D1
CAS:1219799-17-3
Formula: C3H4DCD2Br
D-5982
MW: 138.02
98 atom % D
1,1,1,2-TETRACHLOROETHANE-D2
CAS:117164-18-8
Formula: ClCD2CCl3
D-5059
MW: 169.86
98 atom % D
1,1,1-TRICHLORO-2,2-BIS(4-CHLOROPHENYL-D4)ETHANE
CAS:93952-18-2
Formula: (ClC6D4)2CHCCl3
D-3006
MW: 362.54
99 atom % D (also 20% deuterated at the 2-position)
1,1,1-TRICHLORO-2-(2-CHLOROPHENYL-D4)-2-(4-CHLOROPHENYL-D4)ETHANE
CAS:221899-88-3
Formula: ClC6D4CH(CCl3)C6D4Cl
D-6380
MW: 362.54
98 atom % D
1,1,1-TRICHLOROETHANE-D3
CAS:2747-58-2
Formula: CD3CCl3
D-1150
MW: 136.42
98 atom % D
1,1,2,2-TETRACHLOROETHANE-D2
CAS:33685-54-0
Formula: Cl2CDCDCl2
D-1416
MW: 169.86
99.6 atom % D
1,1,2-TRICHLOROETHANE-D3
CAS:171086-93-4
Formula: ClCD2CDCl2
D-2409
MW: 136.42
99 atom % D
1,1-CYCLOPROPANE-2,2,3,3-D4-DICARBOXYLIC ACID
CAS:136503-99-6
D-6439
MW: 134.12
99 atom % D
1,1-DICHLORO-2,2-BIS(4-CHLOROPHENYL-D4)ETHANE
CAS:93952-20-6
Formula: (ClC6D4)2CHCHCl2
D-3004
MW: 328.09
99 atom % D
1,1-DICHLORO-2,2-BIS(4-CHLOROPHENYL-D4)ETHYLENE
CAS:93952-19-3
Formula: (ClC6D4)2C=CCl2
D-3005
MW: 326.08
99 atom % D
1,1-DICHLOROETHANE-2,2,2-D3
CAS:56912-77-7
Formula: CD3CHCl2
D-1152
MW: 101.98
98 atom % D
1,1-DICHLOROETHYLENE-D2 (STABILIZED WITH HYDROQUINONE)
CAS:22280-73-5
Formula: CD2=CCl2
D-2201
MW: 98.96
98 atom % D
1,1-DIMETHYL-D6-HYDRAZINE HCL
CAS:1219804-14-4
Formula: (CD3)2NNH2•HCl
D-6677
MW: 102.6
98 atom % D
1,1-DIMETHYL-D6-SULFAMIDE
CAS:1189689-95-9
Formula: H2NSO2N(CD3)2
D-6849
MW: 130.19
99 atom % D
1,1-DIMETHYL-D6-UREA
CAS:1219802-32-0
Formula: H2NCON(CD3)2
D-6218
MW: 94.15
99 atom % D
1,1-DIMETHYLHYDRAZINE-D8 DCL
CAS:1219802-85-3
Formula: (CD3)2NND2•DCl
D-6600
MW: 105.61
98 atom % D
1,10-DECANE-D20-DIOL
CAS:347841-78-5
Formula: HO(CD2)10OH
D-3250
MW: 194.4
98 atom % D
1,10-DECANEDIOIC-2,2,9,9-D4 ACID
CAS:339080-77-2
Formula: HOOCCD2(CH2)6CD2COOH
D-1065
MW: 206.27
98 atom % D
1,10-DECANEDIOIC-D16 ACID
CAS:73351-71-0
Formula: HOOC(CD2)8COOH
D-3449
MW: 218.35
98 atom % D
1,10-DIBROMODECANE-D20
CAS:150017-88-2
Formula: Br(CD2)10Br
D-2659
MW: 320.2
98 atom % D
1,10-PHENANTHROLINE-D8
CAS:90412-47-8
D-2799
MW: 188.26
97 atom % D
1,12-DIBROMODODECANE-D24
CAS:1044544-84-4
Formula: Br(CD2)12Br
D-5873
MW: 352.28
98 atom % D
1,12-DODECANE-D24-DIOL
CAS:1219802-88-6
Formula: HO(CD2)12OH
D-6571
MW: 226.48
98 atom % D
1,12-DODECANEDIOIC-2,2,11,11-D4 ACID
CAS:97543-02-7
Formula: HOOCCD2(CH2)8CD2COOH
D-5089
MW: 234.33
98 atom % D
1,12-DODECANEDIOIC-D20 ACID
CAS:89613-32-1
Formula: HOOC(CD2)10COOH
D-2537
MW: 250.43
98 atom % D
1,14-TETRADECANEDIOIC-D24 ACID
CAS:130348-88-8
Formula: HOOC(CD2)12COOH
D-5074
MW: 282.5
98 atom % D
1,16-HEXADECANEDIOIC-D28 ACID
CAS:130348-90-2
Formula: HOOC(CD2)14COOH
D-5186
MW: 314.58
99 atom % D
1,2,3,4-TETRACHLOROBENZENE-D2
CAS:2199-73-7
Formula: C6D2Cl4
D-5869
MW: 217.91
98 atom % D
1,2,3,4-TETRAMETHYLBENZENE-D14
CAS:350818-60-9
Formula: C6D2(CD3)4
D-5061
MW: 148.31
98 atom % D
1,2,3,5-TETRACHLOROBENZENE-D2
CAS:2199-74-8
Formula: C6D2Cl4
D-5870
MW: 217.91
98 atom % D
1,2,3,5-TETRAMETHYLBENZENE-D14
CAS:1219795-11-5
Formula: C6D2(CD3)4
D-938
MW: 148.31
98 atom % D
1,2,3-TRICHLOROBENZENE-D3
CAS:3907-98-0
Formula: C6D3Cl3
D-2511
MW: 184.47
98 atom % D
1,2,3-TRICHLOROPROPANE-D5
CAS:203578-27-2
Formula: ClCD2CD(Cl)CD2Cl
D-6044
MW: 152.46
98 atom % D
1,2,4,5-BENZENETETRACARBOXYLIC ACID-D6
CAS:344298-79-9
D-2440
MW: 260.19
98 atom % D
1,2,4,5-BENZENETETRACARBOXYLIC DIANHYDRIDE-D2
CAS:106426-63-5
D-3393
MW: 220.13
98 atom % D
1,2,4,5-TETRACHLOROBENZENE-D2
CAS:1198-57-8
Formula: C6D2Cl4
D-1290
MW: 217.91
98 atom % D
1,2,4,5-TETRAMETHYLBENZENE-3,6-D2
CAS:1859-01-4
Formula: C6D2(CH3)4
D-2269
MW: 136.23
98 atom % D
1,2,4,5-TETRAMETHYLBENZENE-D14
CAS:15502-50-8
Formula: C6D2(CD3)4
D-269
MW: 148.31
98 atom % D
1,2,4-TRIAZOLE-D3
CAS:43088-92-2
D-5453
MW: 72.08
98 atom % D
1,2,4-TRICHLOROBENZENE-D3
CAS:2199-72-6
Formula: C6D3Cl3
D-2706
MW: 184.47
98 atom % D
1,2,4-TRIMETHYLBENZENE-D12
CAS:350818-61-0
Formula: (CD3)3C6D3
D-5062
MW: 132.27
98 atom % D
1,2-BENZENE-D4-DIAMINE
CAS:291765-93-0
Formula: C6D4(NH2)2
D-5981
MW: 112.17
98 atom % D
1,2-BENZENEDIAMINE-D8
CAS:1219798-78-3
Formula: C6D4(ND2)2
D-5965
MW: 116.19
98 atom % D
1,2-CYCLOHEXANE-D10-DIAMINE( CIS/TRANS ,MIXTURE)
D-6058
MW: 124.25
98 atom % D
1,2-DICHLOROBENZENE-D4
CAS:2199-69-1
Formula: C6D4Cl2
D-1191
MW: 151.03
99 atom % D
1,2-DICHLOROETHANE-D4
CAS:17060-07-0
Formula: ClCD2CD2Cl
D-103
MW: 102.98
99 atom % D
1,2-DICHLOROETHYLENE-D2( CIS/TRANS ,MIXTURE)
CAS:15075-90-8
Formula: CDCl=CDCl
D-2526
MW: 98.96
98 atom % D
1,2-DIHYDROXYBENZENE-D6
CAS:202656-22-2
Formula: C6D4(OD)2
D-5290
MW: 116.15
98 atom % D
1,2-DIMETHOXY-D6-BENZENE
CAS:24658-24-0
Formula: C6H4(OCD3)2
D-5427
MW: 144.2
99 atom % D
1,2-DIMETHOXYBENZENE-3,4,5,6-D4
CAS:126840-15-1
Formula: C6D4(OCH3)2
D-1193
MW: 142.19
98 atom % D
1,2-DIMETHOXYBENZENE-4,5-D2
CAS:203645-56-1
Formula: C6H2D2(OCH3)2
D-4086
MW: 140.18
98 atom % D
1,2-DIMETHOXYBENZENE-D10
CAS:362049-43-2
Formula: C6D4(OCD3)2
D-5428
MW: 148.23
99 atom % D
1,2-DIPHENYLETHANE-D14
CAS:94371-89-8
Formula: C6D5(CD2)2C6D5
D-1233
MW: 196.35
98 atom % D
1,2-ETHANE-D4-DITHIOL
CAS:100189-81-9
Formula: HSCD2CD2SH
D-5163
MW: 98.21
99 atom % D
1,3,5(10)-ESTRATRIENE-17α-ETHYL-D5-3,17β-DIOL 3-METHYL ETHER
D-6742
MW: 319.5
98 atom % D
1,3,5-BENZENE-2,4,6-D3-TRICARBOXYLIC ACID
CAS:62790-27-6
Formula: C6D3(COOH)3
D-6597
MW: 213.16
98 atom % D
1,3,5-TRIBROMOBENZENE-D3
CAS:52921-77-4
Formula: C6D3Br3
D-6980
MW: 317.82
99 atom % D
1,3,5-TRICHLOROBENZENE-D3
CAS:1198-60-3
Formula: C6D3Cl3
D-687
MW: 184.47
98 atom % D
1,3,5-TRIMETHYLBENZENE-2,4,6-D3
CAS:38574-14-0
Formula: (CH3)3C6D3
D-1140
MW: 123.21
98 atom % D
1,3,5-TRIMETHYLBENZENE-D12
CAS:69441-16-3
Formula: (CD3)3C6D3
D-2911
MW: 132.27
98 atom % D
1,3-BENZENEDIAMINE-D8
CAS:770735-58-5
Formula: C6D4(ND)2
D-3914
MW: 116.19
97 atom % D
1,3-BUTADIENE-1,1,4,4-D4 (GAS) (STABILIZED WITH HYDROQUINONE)
CAS:10545-58-1
Formula: CD2=CHCH=CD2
D-232
MW: 58.11
98 atom % D
1,3-BUTADIENE-2,3-D2 (GAS) (STABILIZED WITH HYDROQUINONE)
CAS:30475
Formula: CH2=CDCD=CH2
D-3482
MW: 56.1
98 atom % D
1,3-BUTADIENE-D6 (GAS) (STABILIZED WITH HYDROQUINONE)
CAS:1441-56-1
Formula: CD2=CDCD=CD2
D-97
MW: 60.13
98 atom % D
1,3-DI- ISO -PROPYLBENZENE-D18
CAS:1398065-59-2
Formula: [(CD3)2CD]2C6D4
D-7363
MW: 180.38
99 atom % D
1,3-DIBROMO-5-FLUOROBENZENE-D3
CAS:1219805-87-4
Formula: Br2C6D3F
D-7217
MW: 256.91
98 atom % D
1,3-DIBROMOPROPANE-1,1,3,3-D4
CAS:64528-94-5
Formula: BrCD2CH2CD2Br
D-999
MW: 205.91
98 atom % D
1,3-DIBROMOPROPANE-D6
CAS:120404-22-0
Formula: BrCD2CD2CD2Br
D-1818
MW: 207.92
99 atom % D
1,3-DICHLORO- ISO -PROPYL-D5 ALCOHOL
CAS:1173020-20-6
Formula: ClCD2CD(OH)CD2Cl
D-5033
MW: 134.02
98 atom % D
1,3-DICHLOROACETONE-D4
CAS:350818-52-9
Formula: ClCD2COCD2Cl
D-5030
MW: 130.99
98 atom % D
1,3-DICHLOROBENZENE-D4
CAS:2199-70-4
Formula: C6D4Cl2
D-2405
MW: 151.03
98 atom % D
1,3-DICHLOROPROPENE-D4( CIS/TRANS ,MIXTURE)
CAS:202656-23-3
Formula: ClCD2CD=CDCl
D-2669
MW: 115
98 atom % D
1,3-DIETHYLBENZENE-2,4,5,6-D4
CAS:1219803-29-8
Formula: C6D4(CH2CH3)2
D-6307
MW: 138.25
98 atom % D
1,3-DIETHYLBENZENE-D14
CAS:1219803-40-3
Formula: C6D4(CD2CD3)2
D-6308
MW: 148.31
98 atom % D
1,3-DIFLUOROBENZENE-D4
CAS:1173022-08-6
Formula: C6D4F2
D-7612
MW: 118.18
98 atom % D
1,3-DIHYDROXYBENZENE-D6
CAS:70938-00-0
Formula: C6D4(OD)2
D-1792
MW: 116.15
98 atom % D
1,3-DIMETHOXY-D6-BENZENE
CAS:16469-85-5
Formula: C6H4(OCD3)2
D-5430
MW: 144.2
99 atom % D
1,3-DIMETHOXYBENZENE-2,4,5,6-D4
CAS:362049-44-3
Formula: C6D4(OCH3)2
D-5429
MW: 142.19
98 atom % D
1,3-DIMETHOXYBENZENE-D10
CAS:340257-57-0
Formula: C6D4(OCD3)2
D-1421
MW: 148.23
99 atom % D
1,3-DINITROBENZENE-D4
CAS:54247-05-1
Formula: C6D4(NO2)2
D-1937
MW: 172.13
98 atom % D
1,3-DIPHENYL-D10-UREA
CAS:108009-46-7
Formula: (C6D5NH)2CO
D-7664
MW: 222.31
99 atom % D
1,3-PROPANE-1,1,3,3-D4-DIAMINE
CAS:347840-13-5
Formula: H2NCD2CH2CD2NH2
D-3731
MW: 78.15
99 atom % D
1,3-PROPANE-1,1,3,3-D4-DIAMINE 2HCL
CAS:193945-44-7
Formula: H2NCD2CH2CD2NH2•2HCl
D-5663
MW: 151.07
99 atom % D
1,3-PROPANE-2,2-D2-DIAMINE
CAS:352438-78-9
Formula: H2NCH2CD2CH2NH2
D-5148
MW: 76.14
98 atom % D
1,3-PROPANE-2,2-D2-DIAMINE 2HCL
CAS:352438-79-0
Formula: H2NCH2CD2CH2NH2•2HCl
D-5150
MW: 149.06
99 atom % D
1,3-PROPANE-2,2-D2-DIOL
CAS:38645-14-6
Formula: HOCH2CD2CH2OH
D-5651
MW: 78.11
98 atom % D
1,3-PROPANE-D6-DIAMINE
CAS:90375-98-7
Formula: H2NCD2CD2CD2NH2
D-5960
MW: 80.16
98 atom % D
1,3-PROPANE-D6-DIAMINE 2HCL
CAS:65898-86-4
Formula: H2NCD2CD2CD2NH2•2HCl
D-5964
MW: 153.08
98 atom % D
1,3-PROPANE-D6-DIOL
CAS:284474-77-7
Formula: HOCD2CD2CD2OH
D-253
MW: 82.13
98 atom % D
1,3-PROPANE-D6-DITHIOL
CAS:1219803-51-6
Formula: HSCD2CD2CD2SH
D-6043
MW: 114.25
98 atom % D
1,3-PROPANEDIOL-D8
CAS:285978-25-8
Formula: DOCD2CD2CD2OD
D-2150
MW: 84.14
98 atom % D
1,3-PROPYLENE-D6 THIOUREA
CAS:1219802-05-7
D-5959
MW: 122.22
98 atom % D
1,4-ANDROSTADIEN-3,17-DIONE-6-METHYLENE-16,16-D2
D-7050
MW: 298.42
98 atom % D
1,4-BENZENE-D4-DIAMINE
CAS:119516-83-5
Formula: C6D4(NH2)2
D-3789
MW: 112.17
98 atom % D
1,4-BENZENEDIAMINE-D8
CAS:153200-73-8
Formula: C6D4(ND2)2
D-3394
MW: 116.19
98 atom % D
1,4-BENZOQUINONE-D4
CAS:2237-14-1
D-5194
MW: 112.12
98 atom % D
1,4-BUTANE-2,2,3,3-D4-DIAMINE 2HCL
CAS:88972-24-1
Formula: H2NCH2CD2CD2CH2NH2•2HCl
D-5401
MW: 165.1
98 atom % D
1,4-BUTANE-D8-DIAMINE
CAS:709608-92-4
Formula: H2NCD2CD2CD2CD2NH2
D-6360
MW: 96.2
98 atom % D
1,4-BUTANE-D8-DIAMINE 2HCL
CAS:284665-22-1
Formula: H2NCD2CD2CD2CD2NH2•2HCl
D-3980
MW: 169.12
98 atom % D
1,4-BUTANE-D8-DITHIOL
CAS:1219805-46-5
Formula: HS(CD2)4SH
D-6208
MW: 130.29
99 atom % D
1,4-CYCLOHEXANE-D10-DIAMINE( CIS/TRANS ,MIXTURE)
CAS:1219802-80-8
D-6137
MW: 124.25
98 atom % D
1,4-DIAZABICYCLO[2.2.2]OCTANE-D12
CAS:119451-78-4
D-6858
MW: 124.25
98 atom % D
1,4-DIBROMOBENZENE-D4
CAS:4165-56-4
Formula: C6D4Br2
D-634
MW: 239.93
99 atom % D
1,4-DIBROMOBUTANE-1,1,4,4-D4
CAS:36684-45-4
Formula: BrCD2(CH2)2CD2Br
D-6504
MW: 219.94
98 atom % D
1,4-DIBROMOBUTANE-2,2,3,3-D4
CAS:52089-63-1
Formula: BrCH2(CD2)2CH2Br
D-1232
MW: 219.94
98 atom % D
1,4-DIBROMOBUTANE-D8
CAS:68375-92-8
Formula: Br(CD2)4Br
D-52
MW: 223.96
99 atom % D
1,4-DICHLOROBENZENE-D4
CAS:3855-82-1
Formula: C6D4Cl2
D-1034
MW: 151.03
98 atom % D
1,4-DICHLOROBUTANE-D8
CAS:83547-96-0
Formula: Cl(CD2)4Cl
D-942
MW: 135.06
99 atom % D
1,4-DIETHYLBENZENE-2,3,5,6-D4
CAS:923561-79-9
Formula: C6D4(CH2CH3)2
D-6309
MW: 138.25
98 atom % D
1,4-DIETHYLBENZENE-D14
CAS:1219803-64-1
Formula: C6D4(CD2CD3)2
D-6310
MW: 148.31
98 atom % D
1,4-DIMETHOXYBENZENE-D10
CAS:74079-00-8
Formula: C6D4(OCD3)2
D-5177
MW: 148.23
98 atom % D
1,4-NAPHTHOQUINONE-D6
CAS:26473-08-5
D-5803
MW: 164.19
98 atom % D
1,4-PREGNADIEN-11β,17α,21-TRIOL-3,20-DIONE-2,4,6,6,21,21-D6
D-6447
MW: 366.48
98 atom % D
1,4-PREGNADIEN-17α,21-DIOL-3,11,20-TRIONE-2,4,6α,9,12,12,21,21-D8
D-7418
MW: 366.48
98 atom % D
1,4-PREGNADIEN-6α-METHYL-11β,17α,21-TRIOL-3,20-DIONE-21,21-D2
D-6007
MW: 376.49
95 atom % D
1,5-DIBROMOPENTANE-1,1,5,5-D4
CAS:1219803-90-3
Formula: BrCD2(CH2)3CD2Br
D-6071
MW: 233.97
99 atom % D
1,5-DIBROMOPENTANE-D10
CAS:1219802-90-0
Formula: Br(CD2)5Br
D-6113
MW: 240
98 atom % D
1,5-DINITRONAPHTHALENE-D6
CAS:1219804-48-4
D-5813
MW: 224.21
99 atom % D
1,5-PENTANE-1,1,5,5-D4-DIAMINE
CAS:95596-35-3
Formula: H2NCD2(CH2)3CD2NH2
D-6025
MW: 106.2
98 atom % D
1,5-PENTANE-D10-DIOL
CAS:1219804-42-8
Formula: HO(CD2)5OH
D-5584
MW: 114.21
98 atom % D
1,6-DIBROMOHEXANE-D12
CAS:169397-96-0
Formula: Br(CD2)6Br
D-3766
MW: 256.04
98 atom % D
1,6-HEXANE-1,1,6,6-D4-DIAMINE
CAS:115797-49-4
Formula: H2NCD2(CH2)4CD2NH2
D-323
MW: 120.23
98 atom % D
1,6-HEXANE-1,1,6,6-D4-DIOL
CAS:6843-76-1
Formula: HOCD2(CH2)4CD2OH
D-6321
MW: 122.2
98 atom % D
1,8-DIMETHYLNAPHTHALENE-D12
CAS:104489-29-4
D-4117
MW: 168.3
98 atom % D
1,8-OCTANEDIOIC-2,2,7,7-D4 ACID
CAS:19031-57-3
Formula: HOOCCD2(CH2)4CD2COOH
D-2008
MW: 178.22
98 atom % D
1,8-OCTANEDIOIC-D12 ACID
CAS:169397-99-3
Formula: HOOC(CD2)6COOH
D-5338
MW: 186.27
98 atom % D
1,9-DIBROMONONANE-D18
CAS:150017-89-3
Formula: Br(CD2)9Br
D-2868
MW: 304.16
98 atom % D
1,9-NONANE-2,2,3,3,4,4,5,5,6,6,7,7,8,8-D14-DIOL
CAS:1219805-89-6
Formula: HOCH2(CD2)7CH2OH
D-7223
MW: 174.34
98 atom % D
1,9-NONANEDIOIC-D14 ACID
CAS:119176-67-9
Formula: HOOC(CD2)7COOH
D-3280
MW: 202.31
98 atom % D
1-(2-METHOXY-D3-PHENYLAZO) -2-NAPHTHOL
CAS:1398109-09-5
D-7361
MW: 281.33
99 atom % D
1-AMINOADAMANTANE-2,2,2′,2′,2″,2″-D6
CAS:1219805-53-4
D-7085
MW: 157.29
98 atom % D (also 9% 3,3',3''-d3 and 17% 4,4,4',4',4'',4''-d6)
1-AMINOCYCLOPROPANE-2,2,3,3-D4-CARBOXYLIC ACID
CAS:84392-07-4
D-6292
MW: 105.13
98 atom % D
1-AMINONAPHTHALENE-D7
CAS:78832-53-8
D-5835
MW: 150.23
98 atom % D
1-AMINONAPHTHALENE-D9
CAS:78832-56-1
D-6685
MW: 152.24
98 atom % D
1-BOC-4-(2-HYDROXYETHYL-D4) PIPERAZINE
CAS:1219802-10-4
D-7109
MW: 234.33
99 atom % D
1-BROMO-2,3,5-TRICHLOROBENZENE-D2
CAS:1219803-86-7
Formula: C6D2BrCl3
D-6847
MW: 262.36
98 atom % D
1-BROMO-2,3-DICHLOROBENZENE-D3
CAS:1219805-59-0
Formula: BrC6D3Cl2
D-7176
MW: 228.92
99 atom % D
1-BROMO-2,4-DIFLUOROBENZENE-D3
CAS:1219803-87-8
Formula: BrC6D3F2
D-6946
MW: 196.01
98 atom % D
1-BROMO-2,5-DIFLUOROBENZENE-D3
CAS:1219795-54-6
Formula: BrC6D3F2
D-6473
MW: 196.01
98 atom % D
1-BROMO-2,6-DIFLUOROBENZENE-D3
CAS:1219803-73-2
Formula: BrC6D3F2
D-6064
MW: 196.01
98 atom % D
1-BROMO-2-CHLOROETHANE-D4
CAS:1219795-52-4
Formula: ClCD2CD2Br
D-6445
MW: 147.44
98 atom % D
1-BROMO-2-ETHYLHEXANE-D17
CAS:1398065-97-8
Formula: CD3(CD2)3CD(CD2CD3)CD2Br
D-7471
MW: 210.23
98 atom % D
1-BROMO-2-METHYL-D3-PROPANE-2,3,3,3-D4
CAS:344299-41-8
Formula: (CD3)2CDCH2Br
D-2119
MW: 144.06
98 atom % D
1-BROMO-2-METHYLPROPANE-3,3,3-D3
CAS:344299-42-9
Formula: CD3CH(CH3)CH2Br
D-2120
MW: 140.04
99 atom % D
1-BROMO-2-METHYLPROPANE-D9
CAS:1080497-35-3
Formula: (CD3)2CDCD2Br
D-5927
MW: 146.07
98 atom % D
1-BROMO-3,4-DIFLUOROBENZENE-D3
CAS:1219799-14-0
Formula: BrC6D3F2
D-6474
MW: 196.01
98 atom % D
1-BROMO-3,5-DICHLOROBENZENE-D3
CAS:1219803-83-4
Formula: BrC6D3Cl2
D-6060
MW: 228.92
98 atom % D
1-BROMO-3,5-DIFLUOROBENZENE-D3
CAS:1219798-73-8
Formula: BrC6D3F2
D-6475
MW: 196.01
98 atom % D
1-BROMO-3-CHLORO-5-FLUOROBENZENE-D3
CAS:1219805-00-1
Formula: BrC6D3(Cl)F
D-7220
MW: 212.46
98 atom % D
1-BROMO-3-CHLOROPROPANE-D6
CAS:1173018-46-6
Formula: Cl(CD2)3Br
D-2519
MW: 163.47
98 atom % D
1-BROMO-4-CHLOROBUTANE-D8
CAS:1219803-72-1
Formula: Cl(CD2)4Br
D-6809
MW: 179.51
99 atom % D
1-BROMOBUTANE-1,1,2,2-D4
CAS:1219805-80-7
Formula: CH3CH2CD2CD2Br
D-6294
MW: 141.04
99 atom % D
1-BROMOBUTANE-2,2,3,3,4,4,4-D7
CAS:223487-53-4
Formula: CD3CD2CD2CH2Br
D-6881
MW: 144.06
98 atom % D
1-BROMOBUTANE-2,2-D2
CAS:55724-40-8
Formula: CH3CH2CD2CH2Br
D-6572
MW: 139.03
99 atom % D
1-BROMOBUTANE-3,3,4,4,4-D5
CAS:1219805-37-4
Formula: CD3CD2CH2CH2Br
D-5889
MW: 142.05
98 atom % D
1-BROMOBUTANE-4,4,4-D3
CAS:55724-42-0
Formula: CD3CH2CH2CH2Br
D-1872
MW: 140.04
99 atom % D
1-BROMOBUTANE-D9
CAS:98195-36-9
Formula: CD3CD2CD2CD2Br
D-1172
MW: 146.07
98 atom % D
1-BROMODECANE-1,1,2,2-D4
CAS:1219805-58-9
Formula: CH3(CH2)7CD2CD2Br
D-6295
MW: 225.2
98 atom % D
1-BROMODECANE-10,10,10-D3
CAS:284474-47-1
Formula: CD3(CH2)9Br
D-3972
MW: 224.2
99 atom % D
1-BROMODECANE-9,9,10,10,10-D5
CAS:1219802-02-4
Formula: CD3CD2(CH2)8Br
D-5890
MW: 226.21
98 atom % D
1-BROMODECANE-D21
CAS:98195-39-2
Formula: CD3(CD2)9Br
D-517
MW: 242.31
98 atom % D
1-BROMODODECANE-12,12,12-D3
CAS:204259-68-7
Formula: CD3(CH2)11Br
D-3973
MW: 252.25
99 atom % D
1-BROMODODECANE-D25
CAS:204259-66-5
Formula: CD3(CD2)11Br
D-3979
MW: 274.39
98 atom % D
1-BROMOEICOSANE-20,20,20-D3
CAS:202480-72-6
Formula: CD3(CH2)19Br
D-5252
MW: 364.47
99 atom % D
1-BROMOEICOSANE-D41
CAS:202480-71-5
Formula: CD3(CD2)19Br
D-4016
MW: 402.7
98 atom % D
1-BROMOHEPTANE-1-D1
CAS:38007-40-8
Formula: CH3(CH2)5CHDBr
D-7219
MW: 180.11
99 atom % D
1-BROMOHEPTANE-5,5,6,6,7,7,7-D7
CAS:1219802-55-7
Formula: CD3(CD2)2(CH2)4Br
D-6781
MW: 186.14
98 atom % D
1-BROMOHEPTANE-6,6,7,7,7-D5
CAS:1219805-66-9
Formula: CD3CD2(CH2)5Br
D-5754
MW: 184.13
99 atom % D
1-BROMOHEPTANE-7,7,7-D3
CAS:344253-18-5
Formula: CD3(CH2)6Br
D-5215
MW: 182.12
99 atom % D
1-BROMOHEPTANE-D15
CAS:98195-42-7
Formula: CD3(CD2)6Br
D-1724
MW: 194.19
98 atom % D
1-BROMOHEXADECANE-1,1,2,2-D4
CAS:1219805-65-8
Formula: CH3(CH2)13CD2CD2Br
D-6402
MW: 309.37
98 atom % D
1-BROMOHEXADECANE-16,16,16-D3
CAS:284474-40-4
Formula: CD3(CH2)15Br
D-3986
MW: 308.36
99 atom % D
1-BROMOHEXADECANE-D33
CAS:284474-41-5
Formula: CD3(CD2)15Br
D-4000
MW: 338.54
98 atom % D
1-BROMOHEXANE-1,1,2,2-D4
CAS:1219802-83-1
Formula: CH3(CH2)3CD2CD2Br
D-7121
MW: 169.1
98 atom % D
1-BROMOHEXANE-1,1-D2
CAS:78904-38-8
Formula: CH3(CH2)4CD2Br
D-7164
MW: 167.08
99 atom % D
1-BROMOHEXANE-2,2,3,3,4,4,5,5,6,6,6-D11
CAS:2159-17-3
Formula: CD3(CD2)4CH2Br
D-6509
MW: 176.14
98 atom % D
1-BROMOHEXANE-4,4,5,5,6,6,6-D7
CAS:1276197-43-3
Formula: CD3CD2CD2(CH2)3Br
D-7332
MW: 172.12
98 atom % D
1-BROMOHEXANE-6,6,6-D3
CAS:350818-70-1
Formula: CD3(CH2)5Br
D-5100
MW: 168.09
99 atom % D
1-BROMOHEXANE-D13
CAS:130131-94-1
Formula: CD3(CD2)5Br
D-1723
MW: 178.15
98 atom % D
1-BROMONAPHTHALENE-D7
CAS:37621-57-1
D-7254
MW: 214.11
99 atom % D
1-BROMONONANE-6,6,7,7-D4
CAS:1219805-44-3
Formula: CH3CH2(CD2)2(CH2)5Br
D-6296
MW: 211.18
98 atom % D
1-BROMONONANE-9,9,9-D3
CAS:1219799-20-8
Formula: CD3(CH2)8Br
D-5387
MW: 210.17
99 atom % D
1-BROMONONANE-D19
CAS:1219805-90-9
Formula: CD3(CD2)8Br
D-1726
MW: 226.27
98 atom % D
1-BROMOOCTADECANE-18,18,18-D3
CAS:349553-85-1
Formula: CD3(CH2)17Br
D-3997
MW: 336.41
99 atom % D
1-BROMOOCTADECANE-D37
CAS:187826-28-4
Formula: CD3(CD2)17Br
D-3945
MW: 370.62
98 atom % D
1-BROMOOCTANE-1,1-D2
CAS:86423-34-9
Formula: CH3(CH2)6CD2Br
D-3476
MW: 195.14
99 atom % D
1-BROMOOCTANE-3,3,4,4-D4
CAS:1219803-37-8
Formula: CH3(CH2)3(CD2)2(CH2)2Br
D-7133
MW: 197.15
98 atom % D
1-BROMOOCTANE-8,8,8-D3
CAS:69373-25-7
Formula: CD3(CH2)7Br
D-5101
MW: 196.14
99 atom % D
1-BROMOOCTANE-D17
CAS:126840-36-6
Formula: CD3(CD2)7Br
D-1725
MW: 210.23
98 atom % D
1-BROMOPENTADECANE-1,1,2,2-D4
CAS:1219798-87-4
Formula: CH3(CH2)12CD2CD2Br
D-6459
MW: 295.34
98 atom % D
1-BROMOPENTADECANE-15,15,15-D3
CAS:1219805-83-0
Formula: CD3(CH2)14Br
D-5705
MW: 294.33
99 atom % D
1-BROMOPENTADECANE-D31
CAS:349553-93-1
Formula: CD3(CD2)14Br
D-4019
MW: 322.5
98 atom % D
1-BROMOPENTANE-1,1,2,2-D4
CAS:1219803-61-8
Formula: CH3(CH2)2(CD2)2Br
D-6638
MW: 155.07
99 atom % D
1-BROMOPENTANE-1,1-D2
CAS:77734-75-9
Formula: CH3(CH2)3CD2Br
D-6065
MW: 153.06
99 atom % D
1-BROMOPENTANE-1-D1
CAS:148404-92-6
Formula: CH3(CH2)3CHDBr
D-6932
MW: 152.05
98 atom % D
1-BROMOPENTANE-2,2,3,3,4,4,5,5,5-D9
CAS:156673-70-0
Formula: CD3(CD2)3CH2Br
D-6767
MW: 160.1
98 atom % D
1-BROMOPENTANE-4,4,5,5,5-D5
CAS:83418-34-2
Formula: CD3CD2(CH2)3Br
D-6629
MW: 156.07
99 atom % D
1-BROMOPENTANE-5,5,5-D3
CAS:75736-50-4
Formula: CD3(CH2)4Br
D-3977
MW: 154.06
99 atom % D
1-BROMOPENTANE-D11
CAS:126840-21-9
Formula: CD3(CD2)4Br
D-1722
MW: 162.11
98 atom % D
1-BROMOPROPANE-1,1,2,2-D4
CAS:163400-21-3
Formula: CH3CD2CD2Br
D-403
MW: 127.02
98 atom % D
1-BROMOPROPANE-1,1,3,3,3-D5
CAS:163400-20-2
Formula: CD3CH2CD2Br
D-343
MW: 128.02
98 atom % D
1-BROMOPROPANE-1,1-D2
CAS:40422-05-7
Formula: CH3CH2CD2Br
D-158
MW: 125
99 atom % D
1-BROMOPROPANE-1-D1
CAS:43217-00-1
Formula: CH3CH2CDHBr
D-7257
MW: 124
99 atom % D
1-BROMOPROPANE-2,2,3,3,3-D5
CAS:61066-67-9
Formula: CD3CD2CH2Br
D-225
MW: 128.02
98 atom % D
1-BROMOPROPANE-2,2-D2
CAS:40422-15-9
Formula: CH3CD2CH2Br
D-82
MW: 125
98 atom % D
1-BROMOPROPANE-3,3,3-D3
CAS:61809-88-9
Formula: CD3CH2CH2Br
D-256
MW: 126.01
99 atom % D
1-BROMOPROPANE-D7
CAS:61909-26-0
Formula: CD3CD2CD2Br
D-310
MW: 130.03
98 atom % D
1-BROMOTETRADECANE-1,1,2,2-D4
CAS:1219798-81-8
Formula: CH3(CH2)11CD2CD2Br
D-6510
MW: 281.31
98 atom % D
1-BROMOTETRADECANE-14,14,14-D3
CAS:347840-09-9
Formula: CD3(CH2)13Br
D-3603
MW: 280.31
99 atom % D
1-BROMOTETRADECANE-D29
CAS:347841-80-9
Formula: CD3(CD2)13Br
D-3297
MW: 306.46
98 atom % D
1-BROMOTRIDECANE-1,1,2,2-D4
CAS:284474-45-9
Formula: CH3(CH2)10CD2CD2Br
D-6460
MW: 267.28
98 atom % D
1-BROMOTRIDECANE-D27
CAS:349553-91-9
Formula: CD3(CD2)12Br
D-4011
MW: 290.43
98 atom % D
1-BROMOUNDECANE-1,1,2,2-D4
CAS:1219802-82-0
Formula: CH3(CH2)8(CD2)2Br
D-6751
MW: 239.23
98 atom % D
1-BROMOUNDECANE-11,11,11-D3
CAS:1219805-63-6
Formula: CD3(CH2)10Br
D-6357
MW: 238.23
98 atom % D
1-BROMOUNDECANE-D23
CAS:349553-92-0
Formula: CD3(CD2)10Br
D-4014
MW: 258.35
98 atom % D
1-BUTANE-D9-SULFONYL CHLORIDE
CAS:1219794-70-3
Formula: CD3(CD2)3SO2Cl
D-6021
MW: 165.68
98 atom % D
1-BUTANE-D9-THIOL
CAS:352431-09-5
Formula: CD3(CD2)3SH
D-5311
MW: 99.24
98 atom % D
1-BUTENE-1,1-D2 (GAS)
CAS:26119-76-6
Formula: CH3CH2CH=CD2
D-567
MW: 58.12
98 atom % D
1-BUTENE-4,4,4-D3 (GAS)
CAS:23086-03-5
Formula: CD3CH2CH=CH2
D-1452
MW: 59.13
99 atom % D
1-BUTYNE-3,3,4,4,4-D5 (GAS)
CAS:60173-50-4
Formula: CD3CD2C≡CH
D-7555
MW: 59.12
99 atom % D
1-CHLORO-2,4-DINITROBENZENE-D3
CAS:347840-12-4
Formula: ClC6D3(NO2)2
D-3702
MW: 205.57
98 atom % D
1-CHLOROADAMANTANE-D15
CAS:352431-55-1
D-5303
MW: 185.77
98 atom % D
1-CHLOROBUTANE-D9
CAS:175540-76-8
Formula: CD3CD2CD2CD2Cl
D-1085
MW: 101.62
98 atom % D
1-CHLOROHEXADECANE-D33
CAS:352431-13-1
Formula: CD3(CD2)15Cl
D-5319
MW: 294.09
98 atom % D
1-CHLOROHEXANE-D13
CAS:1219798-45-4
Formula: CD3(CD2)5Cl
D-6476
MW: 133.7
98 atom % D
1-CHLOROOCTANE-D17
CAS:1219803-93-6
Formula: CD3(CD2)7Cl
D-6697
MW: 165.78
98 atom % D
1-CHLOROPROPANE-1,1-D2
CAS:125640-23-5
Formula: CH3CH2CD2Cl
D-5931
MW: 80.55
98 atom % D
1-CHLOROPROPANE-D7
CAS:761374-88-3
Formula: CD3CD2CD2Cl
D-6477
MW: 85.58
98 atom % D
1-DODECANE-D25-THIOL
CAS:869563-00-8
Formula: CD3(CD2)11SH
D-6743
MW: 227.55
98 atom % D
1-HEPTYNE-6,6,7,7,7-D5
CAS:83418-35-3
Formula: CD3CD2CH2CH2CH2C≡CH
D-6628
MW: 101.2
99 atom % D
1-HEXADECANE-D33-THIOL
CAS:218956-22-0
Formula: CD3(CD2)15SH
D-6820
MW: 291.71
98 atom % D
1-HEXANE-D13-THIOL
CAS:1142922-50-6
Formula: CD3(CD2)5SH
D-6419
MW: 131.32
98 atom % D
1-HYDROXYPYRENE-D9
CAS:132603-37-3
D-6040
MW: 227.31
98 atom % D
1-IODOBUTANE-2,2,3,3,4,4,4-D7
Formula: CD3CD2CD2CH2I
D-7652
MW: 191.06
98 atom % D
1-IODOBUTANE-D9 (STABILIZED WITH COPPER)
CAS:59012-24-7
Formula: CD3(CD2)3I
D-1230
MW: 193.07
98 atom % D
1-IODOOCTANE-1,1-D2 (STABILIZED WITH COPPER)
CAS:89232-08-6
Formula: CH3(CH2)6CD2I
D-5831
MW: 242.14
98 atom % D
1-IODOOCTANE-D17 (STABILIZED WITH COPPER)
CAS:340256-37-3
Formula: CD3(CD2)7I
D-1235
MW: 257.23
98 atom % D
1-IODOPENTANE-5,5,5-D3
CAS:920502-31-4
Formula: CD3(CH2)4I
D-6490
MW: 201.06
98 atom % D
1-IODOPROPANE-1,1,2,2-D4 (STABILIZED WITH COPPER)
CAS:1219804-45-1
Formula: CH3CD2CD2l
D-4228
MW: 174.02
98 atom % D
1-IODOPROPANE-1,1,3,3,3-D5 (STABILIZED WITH COPPER)
CAS:1219794-94-1
Formula: CD3CH2CD2I
D-4229
MW: 175.02
98 atom % D
1-IODOPROPANE-1,1-D2 (STABILIZED WITH COPPER)
CAS:25493-14-5
Formula: CH3CH2CD2I
D-36
MW: 172.01
99 atom % D
1-IODOPROPANE-2,2,3,3,3-D5 (STABILIZED WITH COPPER)
CAS:1095269-04-7
Formula: CD3CD2CH2l
D-196
MW: 175.02
98 atom % D
1-IODOPROPANE-2,2-D2 (STABILIZED WITH COPPER)
CAS:25493-15-6
Formula: CH3CD2CH2I
D-328
MW: 172.01
98 atom % D
1-IODOPROPANE-3,3,3-D3 (STABILIZED WITH COPPER)
CAS:25493-16-7
Formula: CD3CH2CH2I
D-4198
MW: 173.01
99 atom % D
1-IODOPROPANE-D7 (STABILIZED WITH COPPER)
CAS:59012-23-6
Formula: CD3(CD2)2I
D-1237
MW: 177.04
98 atom % D
1-METHYL-D3- L -TRYPTOPHAN
D-6971
MW: 221.27
99 atom % D
1-METHYL-D3-5-MERCAPTO-1,2,3,4-TETRAZOLE
CAS:345909-96-8
D-2797
MW: 119.16
99 atom % D
1-METHYL-D3-IMIDAZOLE
CAS:16650-76-3
D-6925
MW: 85.12
99 atom % D
1-METHYLIMIDAZOLE-D3 (RING-D3)
CAS:4166-68-1
D-6425
MW: 85.12
98 atom % D
1-METHYLIMIDAZOLE-D6
CAS:285978-27-0
D-6926
MW: 88.14
98 atom % D
1-METHYLNAPHTHALENE-D10
CAS:38072-94-5
D-1300
MW: 152.26
98 atom % D
1-NAPHTHOL-2,3,4,5,6,7,8-D7
CAS:124251-84-9
Formula: C10D7OH
D-5050
MW: 151.22
98 atom % D
1-NAPHTHOL-D8
CAS:207569-03-7
Formula: C10D7OD
D-2391
MW: 152.22
98 atom % D
1-NITRONAPHTHALENE-D7
CAS:80789-77-1
D-5797
MW: 180.21
98 atom % D
1-NITROPYRENE-D9
CAS:93487-20-8
D-5234
MW: 256.31
98 atom % D
1-O-OCTYL-D17-β- D -GLUCOPYRANOSIDE
CAS:129522-81-2
D-5260
MW: 309.48
98 atom % D
1-OCTADECANE-D37-THIOL
CAS:668433-57-6
Formula: CD3(CD2)17SH
D-6744
MW: 323.78
98 atom % D
1-OCTANE-D17-THIOL
CAS:226999-68-4
Formula: CD3(CD2)7SH
D-6581
MW: 163.39
98 atom % D
1-PENTENE-4,4,5,5,5-D5
CAS:80820-43-5
Formula: CD3CD2CH2CH=CH2
D-5747
MW: 75.16
99 atom % D
1-PHENYL-1-BUTYNE-3,3,4,4,4-D5
CAS:1219803-38-9
Formula: C6H5C≡CCD2CD3
D-6806
MW: 135.22
99 atom % D
1-PHENYL-D5-AZO-2-NAPHTHOL
CAS:752211-63-5
D-6611
MW: 253.31
98 atom % D
1-PHENYLDODECANE-D30
CAS:352431-29-9
Formula: C6D5(CD2)11CD3
D-5230
MW: 276.62
98 atom % D
1-PHENYLPENTADECANE-D36
CAS:352431-31-3
Formula: C6D5(CD2)14CD3
D-5231
MW: 324.74
98 atom % D
1-PROPANE-D7-THIOL
CAS:1219803-52-7
Formula: CD3CD2CD2SH
D-6804
MW: 83.2
98 atom % D
1-PROPANETHIOL-SD
CAS:64071-73-4
Formula: CH3CH2CH2SD
D-222
MW: 77.16
98 atom % D
16α-HYDROXY-17β-ESTRADIOL-2,4,17-D3
CAS:79037-36-8
D-5384
MW: 291.4
98 atom % D
16α-HYDROXY-17β-ESTRADIOL-2,4-D2
CAS:53866-32-3
D-5279
MW: 290.4
98 atom % D
16β-HYDROXY-17β-ESTRADIOL-2,4-D2
CAS:366495-94-5
D-5551
MW: 290.4
98 atom % D
16-(5α)-ANDROSTEN-3-ONE-2,2,4,4-D4
D-7051
MW: 276.45
98 atom % D
16-KETO-17β-ESTRADIOL-2,4,15,15,17-D5
D-5809
MW: 291.4
95 atom % D
17α-ESTRADIOL-2,4-D2
CAS:81586-94-9
D-5431
MW: 274.4
98 atom % D
17α-ETHYNYL-13C2-ESTRADIOL
C-4277
MW: 298.43
99 atom % 13C
17α-ETHYNYLESTRADIOL-16,16-D2 3-METHYL ETHER
D-5990
MW: 312.45
97 atom % D
17α-ETHYNYLESTRADIOL-2,4,16,16-D4
CAS:350820-06-3
D-4319
MW: 300.43
98 atom % D
17α-ETHYNYLESTRADIOL-2,4,16,16-D4 3-METHYL ETHER
D-6142
MW: 314.46
98 atom % D
17α-HYDROXYPREGNENOLONE-21,21,21-D3
CAS:105078-92-0
D-5329
MW: 335.5
97 atom % D
17β-DIHYDROEQUILENIN-4,16,16-D3
D-5659
MW: 271.37
96 atom % D
17β-DIHYDROEQUILIN-16,16,17-D3
CAS:350820-03-0
D-4260
MW: 273.4
98 atom % D
17β-DIHYDROEQUILIN-2,4,16,16,17-D5
D-5833
MW: 275.4
98 atom % D
17β-DIHYDROEQUILIN-2,4,16,16-D4
CAS:350819-99-7
D-4187
MW: 274.39
98 atom % D
17β-ESTRADIOL-16,16,17-D3
CAS:79037-37-9
D-2325
MW: 275.4
98 atom % D
17β-ESTRADIOL-16,16,17-D3 3-BENZOATE
CAS:1192354-74-7
D-7054
MW: 379.51
98 atom % D
17β-ESTRADIOL-16,16-D2
CAS:3188-46-3
D-5433
MW: 274.4
98 atom % D
17β-ESTRADIOL-2,4,16,16,17-D5
CAS:221093-45-4
D-5403
MW: 277.42
98 atom % D
17β-ESTRADIOL-2,4,16,16-D4
CAS:66789-03-5
D-4318
MW: 276.41
98 atom % D
17β-ESTRADIOL-2,4,16,16-D4 17-PENTANOATE
D-7189
MW: 360.53
98 atom % D
17β-ESTRADIOL-2,4-D2
CAS:53866-33-4
D-5432
MW: 274.4
98 atom % D
1H-BENZOTRIAZOLE-4,5,6,7-D4
CAS:1185072-03-0
D-7358
MW: 123.15
99 atom % D
2′,3,4-TRICHLOROBIPHENYL-3′,4′,5′,6′-D4
D-7042
MW: 261.57
98 atom % D
2′,3,5-TRICHLOROBIPHENYL-3′,4′,5′,6′-D4
D-7043
MW: 261.57
98 atom % D
2′-DEOXYURIDINE-5,6-D2
CAS:40632-23-3
D-5352
MW: 230.22
98 atom % D
2′-FLUORODEOXYURIDINE-5,6-D2
CAS:362049-50-1
D-5455
MW: 248.21
98 atom % D
2,2′,3,4,5,5′-HEXACHLOROBIPHENYL-3′,4′,6′-D3
CAS:1219798-51-2
D-6913
MW: 363.9
99 atom % D
2,2′,4,5,5′-PENTACHLOROBIPHENYL-3′,4′,6′-D3
CAS:1219794-68-9
D-6901
MW: 329.45
98 atom % D
2,2′,4,6,6′-PENTACHLOROBIPHENYL-3′,4′,5′-D3
CAS:1219794-64-5
D-6902
MW: 329.45
98 atom % D
2,2′,5,5′-TETRACHLOROBIPHENYL-3,4,6-D3
CAS:1219794-74-7
Formula: C6D3Cl2C6H3Cl2
D-6896
MW: 295.01
98 atom % D
2,2′,5-TRICHLOROBIPHENYL-3,4,4′,6,6′-D5
D-7036
MW: 262.58
98 atom % D
2,2′-DINAPHTHYL-D14
CAS:210487-05-1
D-5746
MW: 268.42
99 atom % D
2,2′-DIPYRIDYL-D8
CAS:32190-42-4
D-1467
MW: 164.24
98 atom % D
2,2,4-TRIMETHYLPENTANE-D18
CAS:51685-57-5
Formula: (CD3)3CCD2CD(CD3)2
D-2010
MW: 132.34
98 atom % D
2,2,6,6-TETRAMETHYLPIPERIDINE-D18-1-OXYL
CAS:205679-68-1
D-7184
MW: 174.36
98 atom % D
2,2-BIS(HYDROXYMETHYL-D2) PROPIONIC-3,3,3-D3 ACID
CAS:1219802-03-5
Formula: (HOCD2)2C(CD3)COOH
D-5483
MW: 141.17
99 atom % D
2,2-DIMETHYLBUTYRIC-D11 ACID
CAS:1219804-04-2
Formula: CD3CD2C(CD3)2COOH
D-5843
MW: 127.23
98 atom % D
2,2-DIMETHYLPROPANE-D12 (GAS)
CAS:5152-54-5
Formula: (CD3)4C
D-105
MW: 84.22
98 atom % D
2,3′,4′,5-TETRACHLOROBIPHENYL-3,4,6-D3
CAS:1219794-77-0
Formula: Cl2C6D3C6H3Cl2
D-6897
MW: 295.01
98 atom % D
2,3′,5-TRICHLOROBIPHENYL-2′,3,4,4′,6,6′-D6
D-7039
MW: 263.58
99 atom % D
2,3,3′,4,4′,5-HEXACHLOROBIPHENYL-2′,6,6′-D3
CAS:1219798-44-3
D-6914
MW: 363.9
98 atom % D
2,3,3′,4,5,5′-HEXACHLOROBIPHENYL-2′,4′,6′-D3
CAS:1219798-69-2
D-6915
MW: 363.9
98 atom % D
2,3,4′-TRICHLOROBIPHENYL-2′,3′,5′,6′-D4
D-7038
MW: 261.57
98 atom % D
2,3,4,4′,5-PENTACHLOROBIPHENYL-2′,3′,5′,6′-D4
CAS:1219799-24-2
D-6912
MW: 330.46
98 atom % D
2,3,4,5,6-PENTACHLOROBIPHENYL-2′,3′,4′,5′,6′-D5
CAS:1219798-92-1
Formula: C6Cl5C6D5
D-6493
MW: 331.47
98 atom % D
2,3,4-TRICHLOROBIPHENYL-2′,3′,4′,5′,6′-D5
CAS:1219805-70-5
D-7037
MW: 262.58
99 atom % D
2,3,4-TRIHYDROXYBENZOPHENONE-2′,3′,4′,5′,6′-D5
Formula: (HO)3C6H2COC6D5
D-7646
MW: 235.25
98 atom % D
2,3,5,6-TETRACHLOROANILINE-D3
CAS:1219806-05-9
Formula: Cl4C6DND2
D-6911
MW: 233.93
99 atom % D
2,3,5,6-TETRACHLOROBIPHENYL-2′,3′,4′,5′,6′-D5
CAS:1219794-80-5
Formula: C6HCl4C6D5
D-6941
MW: 297.02
98 atom % D
2,3,5-TRIMETHYLPHENOL-D11
CAS:362049-46-5
Formula: (CD3)3C6D2OH
D-5441
MW: 147.26
98 atom % D
2,3,6-TRICHLOROANISOLE-D3(METHOXY-D3)
CAS:1219798-64-7
Formula: Cl3C6H2OCD3
D-5951
MW: 214.49
99 atom % D
2,3,6-TRICHLOROPHENOL-4,5-D2
CAS:93951-81-6
Formula: Cl3C6D2OH
D-2934
MW: 199.46
97 atom % D
2,3,6-TRIMETHYLPHENOL-D11
CAS:347841-83-2
Formula: (CD3)3C6D2OH
D-3384
MW: 147.26
98 atom % D
2,3-BUTANE-1,1,1,4,4,4-D6-DIOL(MIXTURE,OF,STEREOISOMERS)
CAS:344750-80-7
Formula: CD3CH(OH)CH(OH)CD3
D-3233
MW: 96.16
98 atom % D
2,3-BUTANE-D8-DIOL(MIXTURE,OF,STEREOISOMERS)
CAS:347841-77-4
Formula: CD3CD(OH)CD(OH)CD3
D-3234
MW: 98.17
98 atom % D
2,3-BUTANEDIONE-D6
CAS:22026-37-5
Formula: CD3COCOCD3
D-3232
MW: 92.13
98 atom % D
2,3-DICHLOROBENZOIC-D3 ACID
CAS:1126107-18-3
Formula: Cl2C6D3COOH
D-6480
MW: 194.03
98 atom % D
2,3-DICHLOROTOLUENE-4,5,6-D3
CAS:1219798-57-8
Formula: Cl2C6D3CH3
D-6481
MW: 164.05
98 atom % D
2,3-DIMETHYLPENTANE-D16
CAS:1219795-08-0
Formula: CD3CD2CD(CD3)CD(CD3)2
D-6997
MW: 116.3
99 atom % D
2,3-DIMETHYLPYRIDINE-D9
CAS:350818-65-4
D-5078
MW: 116.21
98 atom % D
2,3-PENTANEDIONE-1,1,1,4,4-D5
CAS:352431-46-0
Formula: CH3CD2COCOCD3
D-5268
MW: 105.15
98 atom % D
2,4′,5-TRICHLOROBIPHENYL-2′,3′,5′,6′-D4
Formula: Cl2C6H3C6ClD4
D-6892
MW: 261.57
98 atom % D
2,4′-DICHLOROBIPHENYL-D8
CAS:1219795-19-3
D-6917
MW: 231.15
98 atom % D
2,4,4′-TRICHLOROBIPHENYL-2′,3′,5′,6′-D4
D-6994
MW: 261.57
98 atom % D
2,4,5-TRICHLOROANILINE-D4
CAS:1219804-61-1
Formula: Cl3C6D2ND2
D-6996
MW: 200.49
98 atom % D
2,4,5-TRICHLOROBIPHENYL-2′,3′,4′,5′,6′-D5
CAS:1276197-33-1
D-7040
MW: 262.58
99 atom % D
2,4,5-TRICHLOROPHENOL-3,6-D2
CAS:93951-82-7
Formula: Cl3C6D2OH
D-2935
MW: 199.46
98 atom % D
2,4,6-TRIBROMOANISOLE-D5
CAS:1219795-33-1
Formula: Br3C6D2OCD3
D-5678
MW: 349.86
99 atom % D
2,4,6-TRIBROMOPHENOL-3,5-D2
CAS:1219795-42-2
Formula: Br3C6D2OH
D-5656
MW: 332.81
99 atom % D
2,4,6-TRICHLOROANISOLE-D5
CAS:352439-08-8
Formula: Cl3C6D2OCD3
D-5216
MW: 216.51
98 atom % D
2,4,6-TRICHLOROBIPHENYL-2′,3′,4′,5′,6′-D5
CAS:1219794-85-0
Formula: Cl3C6H2C6D5
D-6938
MW: 262.58
98 atom % D
2,4,6-TRICHLOROPHENOL-3,5-D2
CAS:93951-80-5
Formula: Cl3C6D2OH
D-2279
MW: 199.46
98 atom % D
2,4,6-TRIMETHYLPHENOL-D11
CAS:362049-45-4
Formula: (CD3)3C6D2OH
D-5443
MW: 147.26
98 atom % D
2,4,6-TRIMETHYLPYRIDINE-D11
CAS:1219805-54-5
Formula: (CD3)3C5D2N
D-6254
MW: 132.25
98 atom % D
2,4-DIAMINOTOLUENE-α,α,α-D3
CAS:71111-08-5
Formula: CD3C6H3(NH2)2
D-5472
MW: 125.19
98 atom % D
2,4-DIBROMOPHENOL-3,5,6-D3
CAS:1219805-97-6
Formula: Br2C6D3OH
D-5640
MW: 254.92
98 atom % D
2,4-DICHLOROBENZOIC-D3 ACID
CAS:1398065-99-0
Formula: Cl2C6D3COOH
D-7342
MW: 194.03
98 atom % D
2,4-DICHLOROPHENOL-3,5,6-D3
CAS:93951-74-7
Formula: Cl2C6D3OH
D-2281
MW: 166.02
98 atom % D
2,4-DICHLOROTOLUENE-3,5,6-D3
CAS:1398065-47-8
Formula: Cl2C6D3CH3
D-7341
MW: 164.05
98 atom % D
2,4-DIFLUOROBENZOIC-D3 ACID
CAS:1219804-63-3
Formula: F2C6D3COOH
D-6953
MW: 161.12
98 atom % D
2,4-DIFLUOROTOLUENE-3,5,6-D3
CAS:1219798-79-4
Formula: CH3C6D3F2
D-7172
MW: 131.14
99 atom % D
2,4-DIHYDROXYBENZOPHENONE-2′,3′,4′,5′,6′-D5
CAS:91586-06-0
Formula: (HO)2C6H3COC6D5
D-7645
MW: 219.25
98 atom % D
2,4-DIMETHYL-D6-ANILINE
CAS:1071170-27-8
Formula: (CD3)2C6H3NH2
D-7387
MW: 127.22
98 atom % D
2,4-DIMETHYL-D6-ANILINE HCL
CAS:1219805-38-5
Formula: (CD3)2C6H3NH2•HCl
D-5684
MW: 163.68
99 atom % D
2,4-DIMETHYL-D6-NITROBENZENE
CAS:1398065-58-1
Formula: (CD3)2C6H3NO2
D-7386
MW: 157.2
98 atom % D
2,4-DIMETHYLANILINE-D11
CAS:1398065-83-2
Formula: (CD3)2C6D3ND2
D-7355
MW: 132.25
99 atom % D
2,4-DIMETHYLPHENOL-3,5,6-D3
CAS:93951-75-8
Formula: (CH3)2C6D3OH
D-2284
MW: 125.18
98 atom % D
2,4-DIMETHYLPHENOL-D10
CAS:1219794-86-1
Formula: (CD3)2C6D3OD
D-6311
MW: 132.23
98 atom % D
2,4-DINITROTOLUENE-α,α,α-D3
CAS:70786-68-4
Formula: (NO2)2C6H3CD3
D-5093
MW: 185.15
98 atom % D
2,4-DINITROTOLUENE-3,5,6-D3
CAS:93951-68-9
Formula: (NO2)2C6D3CH3
D-2407
MW: 185.15
98 atom % D
2,5-DI-( TERT -BUTYL-D9)-4-METHOXYPHENOL-3,6-D2
CAS:1219802-07-9
D-6274
MW: 256.48
98 atom % D
2,5-DICHLOROANILINE-3,4,6-D3
CAS:783321-80-2
Formula: Cl2C6D3NH2
D-6479
MW: 165.04
98 atom % D
2,5-DICHLOROBIPHENYL-2′,3′,4′,5′,6′-D5
CAS:1219804-50-8
Formula: Cl2C6H3C6D5
D-6895
MW: 228.13
99 atom % D
2,5-DICHLOROPHENOL-3,4,6-D3
CAS:1219803-68-5
Formula: Cl2C6D3OH
D-6641
MW: 166.02
98 atom % D
2,5-DIFLUOROBENZOIC-D3 ACID
CAS:1219798-63-6
Formula: F2C6D3COOH
D-6484
MW: 161.12
98 atom % D
2,5-HEXANEDIONE-D10
CAS:97135-07-4
Formula: CD3COCD2CD2COCD3
D-2296
MW: 124.2
98 atom % D
2,6,10,14-TETRAMETHYLPENTADECANE-D40
CAS:16416-35-6
Formula: C19D40
D-909
MW: 308.77
98 atom % D
2,6,10,15,19,23-HEXAMETHYLTETRACOSANE-D62
CAS:16514-83-3
Formula: C30D62
D-958
MW: 485.2
98 atom % D
2,6-DI- ISO -PROPYLPHENOL-D18
CAS:1189467-93-3
Formula: [(CD3)2CD]2C6D3OD
D-6546
MW: 196.38
98 atom % D
2,6-DI- TERT -BUTYL-4-METHYLPHENOL-D24
CAS:1219805-92-1
D-5751
MW: 244.5
98 atom % D
2,6-DI-( TERT -BUTYL-D1)-4-METHYL-D3-PHENOL-3,5-D2
CAS:1219805-62-5
D-5566
MW: 227.4
95 atom % D
2,6-DI-( TERT -BUTYL-D9)-4-METHOXYPHENOL-3,5-D2
CAS:1219799-34-4
D-6748
MW: 256.48
98 atom % D
2,6-DI-( TERT -BUTYL-D9)-4-METHYLPHENOL-3,5-D2,OD
CAS:64502-99-4
D-1765
MW: 241.48
98 atom % D
2,6-DIAMINOTOLUENE-α,α,α-D3
CAS:362049-58-9
Formula: CD3C6H3(NH2)2
D-5473
MW: 125.19
97 atom % D
2,6-DIBROMOPHENOL-3,4,5-D3
CAS:1219803-14-1
Formula: Br2C6D3OH
D-4349
MW: 254.92
98 atom % D
2,6-DICHLOROANILINE-3,4,5-D3
CAS:77435-48-4
Formula: Cl2C6D3NH2
D-3311
MW: 165.04
98 atom % D
2,6-DICHLOROBENZAMIDE-3,4,5-D3
CAS:1219804-28-0
D-6700
MW: 193.05
98 atom % D
2,6-DICHLOROBENZOIC-D3 ACID
CAS:1219805-50-1
Formula: Cl2C6D3COOH
D-5707
MW: 194.03
98 atom % D
2,6-DICHLOROBIPHENYL-2′,3′,4′,5′,6′-D5
CAS:1276197-38-6
D-7033
MW: 228.13
99 atom % D
2,6-DICHLOROTOLUENE-3,4,5-D3
CAS:358731-95-0
Formula: Cl2C6D3CH3
D-5567
MW: 164.05
98 atom % D
2,6-DIETHYLANILINE-D15
CAS:285132-89-0
Formula: (CD3CD2)2C6D3ND2
D-3023
MW: 164.33
97 atom % D
2,6-DIFLUOROBENZOIC-D3 ACID
CAS:1219804-21-3
Formula: F2C6D3COOH
D-6073
MW: 161.12
98 atom % D
2,6-DIMETHYL-D6-ANILINE
CAS:919785-81-2
Formula: (CD3)2C6H3NH2
D-6578
MW: 127.22
98 atom % D
2,6-DIMETHYL-D6-NITROBENZENE
CAS:285138-83-2
Formula: (CD3)2C6H3NO2
D-3380
MW: 157.2
98 atom % D
2,6-DIMETHYLANILINE-D11
CAS:1092805-08-7
Formula: (CD3)2C6D3ND2
D-6757
MW: 132.25
98 atom % D
2,6-DIMETHYLNAPHTHALENE-D12
CAS:350820-12-1
D-4362
MW: 168.3
98 atom % D
2,6-DIMETHYLPHENOL-3,4,5-D3,OD
CAS:285132-85-6
Formula: (CH3)2C6D3OD
D-5367
MW: 126.19
98 atom % D
2,6-DIMETHYLPYRIDINE-D9
CAS:135742-47-1
D-5540
MW: 116.21
98 atom % D
2,6-DINITROTOLUENE-α,α,α-D3
CAS:93951-90-7
Formula: (NO2)2C6H3CD3
D-2359
MW: 185.15
98 atom % D
2- ISO -PROPYL-D7-5-METHYL-D3-PHENOL-3,4,6-D3
CAS:1219798-93-2
D-6717
MW: 163.3
98 atom % D
2- TERT -BUTYLAMINO-D9-4-CHLORO-6-CYCLOPROPYLAMINO-1,3,5-TRIAZINE
CAS:1189419-70-2
D-7151
MW: 250.78
99 atom % D
2-(3,4-DIHYDROXYPHENYL) ETHYL-1,1,2,2-D4-AMINE HCL
CAS:203633-19-6
Formula: (HO)2C6H3CD2CD2NH2•HCl
D-1540
MW: 193.67
98 atom % D
2-(3,4-DIHYDROXYPHENYL) ETHYL-1,1-D2-AMINE HCL
CAS:83008-33-7
Formula: (HO)2C6H3CH2CD2NH2•HCl
D-1492
MW: 191.65
98 atom % D
2-(3,4-DIHYDROXYPHENYL) ETHYL-1-13C-AMINE HCL
CAS:335081-04-4
Formula: (HO)2C6H3CH213CH2NH2
C-4095
MW: 190.65
99 atom % 13C
2-(3,4-DIHYDROXYPHENYL) ETHYL-1-13C-AMINE-15N HCL
CAS:369656-74-6
Formula: (HO)2C6H3CH213CH215NHM-4221
MW: 191.66
99 atom % 13C; 99 atom % 15N
2-(3,4-DIHYDROXYPHENYL) ETHYL-2,2-D2-AMINE HCL
CAS:27160-01-6
Formula: (HO)2C6H3CD2CH2NH2•HCl
D-1493
MW: 191.65
98 atom % D
2-(3,4-DIHYDROXYPHENYL-13C6) ETHYLAMINE HCL
CAS:335080-94-9
Formula: (HO)213C6H3CH2CH2NH2
C-3334
MW: 195.7
99 atom % 13C
2-(3,4-DIHYDROXYPHENYL-D3) ETHYLAMINE HCL
CAS:53587-30-7
Formula: (HO)2C6D3CH2CH2NH2•HCl
D-1702
MW: 192.66
98 atom % D
2-(3,4-DIMETHOXY-D6-PHENYL) ETHYL-1,1,2,2-D4-AMINE HCL
CAS:1398065-73-0
Formula: (CD3O)2C6H3CD2CD2NH2 HC
D-7423
MW: 227.76
99 atom % D
2-(3,4-DIMETHOXYPHENYL) -N-METHYL-D3-ETHYLAMINE
CAS:152561-88-1
Formula: (CH3O)2C6H4CH2CH2NHCD3
D-7530
MW: 198.28
99 atom % D
2-(3,4-DIMETHOXYPHENYL) ETHYL-1,1-D2-AMINE
CAS:37699-47-1
Formula: (CH3O)2C6H3CH2CD2NH2
D-1563
MW: 183.25
98 atom % D
2-(3-ETHOXY-4-METHOXY-D3-PHENYL) ETHYL-1,1,2,2-D4-AMINE HCL
CAS:1398065-60-5
D-7377
MW: 238.76
99 atom % D
2-(3-ETHOXY-4-METHOXYPHENYL) ETHYL-1,1,2,2-D4-AMINE HCL
CAS:1398066-01-7
D-7376
MW: 235.75
99 atom % D
2-(4-HYDROXY-3-METHOXYPHENYL) ETHYL-1,1,2,2-D4-AMINE HCL
CAS:1216788-76-9
D-2210
MW: 207.69
98 atom % D
2-(4-HYDROXYPHENYL) ETHYL-1,1,2,2-D4-AMINE HCL
CAS:1189884-47-6
Formula: HOC6H4CD2CD2NH2•HCl
D-1651
MW: 177.67
98 atom % D
2-(4-METHYLPHENYL)PROPANE-D14
CAS:93952-03-5
Formula: CD3C6D4CD(CD3)2
D-2709
MW: 148.31
98 atom % D
2-(4-NITROPHENYL-D4)PROPANE
CAS:1219803-36-7
Formula: O2NC6D4CH(CH3)2
D-6574
MW: 169.22
98 atom % D
2-(N-BENZYL-N-METHYL)AMINOETHANOL-1,1,2,2-D4
CAS:1219803-10-7
Formula: C6H5CH2N(CH3)CD2CD2OH
D-7166
MW: 169.26
99 atom % D
2-(N-MORPHOLINO)ETHANESULFONIC ACID-D13
CAS:352534-94-2
D-6122
MW: 208.31
98 atom % D
2-(PROPYL-1,1-D2)PENTANOIC-3,3-D2 ACID
CAS:87745-17-3
Formula: (CH3CH2CD2)2CHCOOH
D-2546
MW: 148.24
99 atom % D
2-(PROPYL-2,2-D2)PENTANOIC-4,4-D2 ACID
CAS:345909-03-7
Formula: (CH3CD2CH2)2CHCOOH
D-2884
MW: 148.24
99 atom % D
2-(PROPYL-3,3,3-D3)PENTANOIC-5,5,5-D3 ACID
CAS:87745-18-4
Formula: (CD3CH2CH2)2CHCOOH
D-2538
MW: 150.25
99 atom % D
2-ACETOXYBENZOIC-3,4,5,6-D4 ACID
CAS:97781-16-3
Formula: CH3COOC6D4COOH
D-6290
MW: 184.18
98 atom % D
2-AMINO-2-METHYL-D3-PROPANE-1,1,1,3,3,3-D6
CAS:1514149
Formula: (CD3)3CNH2
D-355
MW: 82.19
99 atom % D
2-AMINO-2-METHYL-D3-PROPANE-1,1,1,3,3,3-D6 HBR
CAS:134071-63-9
Formula: (CD3)3CNH2•HBr
D-6886
MW: 163.1
99 atom % D
2-AMINO-4,6-DIMETHOXY-D6-PYRIMIDINE
CAS:1219803-92-5
D-7135
MW: 161.19
99 atom % D
2-AMINO-5-CHLOROPYRIDINE-3,4,6-D3
CAS:1093384-99-6
D-6691
MW: 131.58
98 atom % D
2-AMINOBIPHENYL-D9
CAS:344298-97-1
Formula: C6D5C6D4NH2
D-2331
MW: 178.28
98 atom % D
2-AMINOETHANE-D4-SULFINIC ACID
CAS:352438-83-6
Formula: H2NCD2CD2SO2H
D-5158
MW: 113.17
95 atom % D
2-AMINOETHANE-D4-SULFONIC ACID
CAS:342611-14-7
Formula: H2NCD2CD2SO3H
D-1971
MW: 129.17
99 atom % D
2-AMINOETHANE-D4-THIOL HCL
CAS:1219805-04-5
Formula: HSCD2CD2NH2•HCl
D-6501
MW: 117.63
99 atom % D
2-AMINOFLUORENE-D11
CAS:347841-44-5
D-3804
MW: 192.3
98 atom % D
2-AMINONAPHTHALENE-D7
CAS:93951-94-1
D-191
MW: 150.23
98 atom % D
2-AMINOPYRIDINE-D6
CAS:203784-57-0
Formula: D2NC5D4N
D-3508
MW: 100.15
98 atom % D
2-BROMO-2-METHYL-D3-PROPIONIC-D3 ACID
CAS:1219795-23-9
Formula: (CD3)2C(Br)COOH
D-5923
MW: 173.04
99 atom % D
2-BROMO-2-METHYLPROPANE-D9
CAS:42310-83-8
Formula: (CD3)3CBr
D-2199
MW: 146.07
98 atom % D
2-BROMO-4′-FLUOROACETOPHENONE-2′,3′,5′,6′-D4
CAS:1219803-30-1
Formula: FC6D4COCH2Br
D-7031
MW: 221.06
94 atom % D
2-BROMOCHLOROBENZENE-D4
CAS:1219795-51-3
Formula: BrC6D4Cl
D-6444
MW: 195.48
98 atom % D
2-BROMOETHANOL-1,1,2,2-D4
CAS:81764-55-8
Formula: BrCD2CD2OH
D-1913
MW: 128.99
99 atom % D
2-BROMOETHYL-D4-AMINE HBR
CAS:918633-70-2
Formula: BrCD2CD2NH2•HBr
D-6671
MW: 208.92
98 atom % D
2-BROMOFLUOROBENZENE-D4
CAS:50592-35-3
Formula: BrC6D4F
D-5926
MW: 179.02
98 atom % D
2-BROMONITROBENZENE-D4
CAS:1020720-09-5
Formula: BrC6D4NO2
D-6130
MW: 206.03
98 atom % D
2-BROMOPROPANE-1,1,1,2-D4
CAS:1219799-22-0
Formula: CH3CD(Br)CD3
D-5983
MW: 127.02
99 atom % D
2-BROMOPROPANE-1,1,1,3,3,3-D6
CAS:52809-76-4
Formula: (CD3)2CHBr
D-793
MW: 129.03
99 atom % D
2-BROMOPROPANE-1,1,1-D3
CAS:688361-45-7
Formula: CD3CH(Br)CH3
D-5928
MW: 126.01
98 atom % D
2-BROMOPROPANE-2-D1
CAS:4067-80-5
Formula: (CH3)2CDBr
D-1890
MW: 124
98 atom % D
2-BROMOPROPANE-D7
CAS:39091-63-9
Formula: (CD3)2CDBr
D-751
MW: 130.04
99 atom % D
2-BROMOPYRIDINE-D4
CAS:70766-71-1
D-6032
MW: 162.02
98 atom % D
2-BROMOTOLUENE-3,4,5,6-D4
CAS:56444-57-6
Formula: BrC6D4CH3
D-6403
MW: 175.06
98 atom % D
2-BROMOTOLUENE-D7
CAS:1185306-95-9
Formula: BrC6D4CD3
D-6404
MW: 178.08
98 atom % D
2-BUTANONE 2,4-DINITROPHENYLHYDRAZONE-3,5,6-D3
CAS:259824-58-3
Formula: CH3CH2C(CH3)=NNHC6D3(NO2)2D-7602
MW: 255.25
99 atom % D
2-BUTANONE-1,1,1,3,3-D5
CAS:24313-50-6
Formula: CH3CD2COCD3
D-293
MW: 77.14
98 atom % D
2-BUTANONE-4,4,4-D3
CAS:53389-26-7
Formula: CD3CH2COCH3
D-2402
MW: 75.12
99 atom % D
2-BUTANONE-D8
CAS:350820-09-6
Formula: CD3CD2COCD3
D-4331
MW: 80.16
98 atom % D
2-BUTENE-1,1,1-D3 (GAS) ( CIS/TRANS MIXTURE)
CAS:116008-90-3
Formula: CH3CH=CHCD3
D-5156
MW: 59.13
99 atom % D
2-BUTENE-D8 (GAS) ( CIS/TRANS MIXTURE)
CAS:6157-20-6
Formula: CD3CD=CDCD3
D-98
MW: 64.16
98 atom % D
2-BUTOXYETHANOL-1,1,2,2-D4
CAS:1219803-96-9
Formula: CH3CH2CH2CH2OCD2CD2OH
D-6947
MW: 122.2
99 atom % D
2-CHLORO-2-METHYLPROPANE-D9
CAS:918-20-7
Formula: (CD3)3CCl
D-99
MW: 101.62
99 atom % D
2-CHLORO-N,N-DIETHYLETHYL-D4-AMINE HCL
CAS:1219805-94-3
Formula: (CH3CH2)2NCD2CD2Cl•HCl
D-6193
MW: 176.12
99 atom % D
2-CHLORO-N,N-DIMETHYL-D6-ETHYLAMINE HCL
CAS:97941-91-8
Formula: ClCH2CH2N(CD3)2•HCl
D-6526
MW: 150.08
98 atom % D
2-CHLOROACETAMIDE-D4
CAS:122775-20-6
Formula: ClCD2COND2
D-135
MW: 97.54
99 atom % D
2-CHLOROANILINE-4,6-D2
CAS:347840-10-2
Formula: ClC6H2D2NH2
D-3700
MW: 129.59
98 atom % D
2-CHLOROANILINE-D6
CAS:1276197-37-5
Formula: ClC6D4ND2
D-7280
MW: 133.61
98 atom % D
2-CHLOROANISOLE-D3 (METHYL-D3)
CAS:1398065-46-7
Formula: ClC6H4OCD3
D-7374
MW: 145.6
99 atom % D
2-CHLOROBENZALDEHYDE-3,4,5,6-D4
CAS:1093351-46-2
Formula: ClC6D4CHO
D-7308
MW: 144.59
98 atom % D
2-CHLOROBENZOIC-D4 ACID
CAS:1219795-28-4
Formula: ClC6D4COOH
D-5955
MW: 160.59
98 atom % D
2-CHLOROBIPHENYL-2′,3′,4′,5′,6′-D5
CAS:51624-35-2
Formula: ClC6H4C6D5
D-3011
MW: 193.69
98 atom % D
2-CHLOROETHYL-D4-AMINE HCL
CAS:172333-26-5
Formula: ClCD2CD2NH2•HCl
D-6877
MW: 120.01
98 atom % D
2-CHLORONAPHTHALENE-D7
CAS:93951-84-9
D-2462
MW: 169.66
98 atom % D
2-CHLOROPHENOL-3,4,5,6-D4
CAS:93951-73-6
Formula: ClC6D4OH
D-2280
MW: 132.58
98 atom % D
2-CHLOROPROPANE-1,1,1,3,3,3-D6
CAS:23197-02-6
Formula: (CD3)2CHCl
D-4252
MW: 84.58
98 atom % D
2-CHLOROPROPANE-1,1,1-D3
CAS:137832-55-4
Formula: CH3CH(Cl)CD3
D-5634
MW: 81.56
98 atom % D
2-CHLOROPROPANE-2-D1
CAS:53778-42-0
Formula: (CH3)2CDCl
D-4253
MW: 79.55
98 atom % D
2-CHLOROPROPANE-D7
CAS:55956-02-0
Formula: (CD3)2CDCl
D-5106
MW: 85.58
99 atom % D
2-CHLOROPYRIDINE-D4
CAS:1001003-94-6
Formula: C5D4NCl
D-6213
MW: 117.57
99 atom % D
2-CHLOROTOLUENE-3,4,5,6-D4
CAS:362049-57-8
Formula: ClC6D4CH3
D-5470
MW: 130.61
98 atom % D
2-CHLOROTOLUENE-D7
CAS:84344-05-8
Formula: ClC6D4CD3
D-6408
MW: 133.63
98 atom % D
2-CYANOPYRIDINE-D4
CAS:1219795-17-1
Formula: C5D4NCN
D-6376
MW: 108.14
99 atom % D
2-CYCLOPROPYLETHYL-1,1,2,2-D4-AMINE
CAS:1219795-00-2
D-7001
MW: 89.17
98 atom % D
2-ETHOXY-D5-PHENOL
CAS:117320-30-6
Formula: CD3CD2OC6H4OH
D-7541
MW: 143.2
99 atom % D
2-ETHOXYETHANOL-1,1,2,2-D4
CAS:1219805-07-8
Formula: CH3CH2OCD2CD2OH
D-6139
MW: 94.15
98 atom % D
2-ETHYL-α,α-D2-PYRAZINE-3,5,6-D3
CAS:1276197-45-5
D-7325
MW: 113.17
98 atom % D
2-ETHYL-6-METHYLANILINE-D13
CAS:1219794-93-0
D-5919
MW: 148.29
98 atom % D
2-ETHYL-D5-NAPHTHALENE
CAS:1219805-14-7
D-7199
MW: 161.26
99 atom % D
2-ETHYLPHENOL-D10
CAS:721429-63-6
Formula: CD3CD2C6D4OD
D-7181
MW: 132.23
99 atom % D
2-FLUOROANILINE-4,6-D2,ND2
CAS:1219804-77-9
Formula: FC6H2D2ND2
D-6903
MW: 115.14
98 atom % D
2-FLUOROBENZOIC-D4 ACID
CAS:646502-89-8
Formula: FC6D4COOH
D-5991
MW: 144.14
98 atom % D
2-FLUOROTOLUENE-α,α,α-D3
CAS:25319-49-7
Formula: CD3C6H4F
D-1673
MW: 113.15
98 atom % D
2-FLUOROTOLUENE-α-D1
CAS:17359-78-3
Formula: CH2DC6H4F
D-7625
MW: 111.14
98 atom % D
2-FUROIC-D3 ACID
CAS:40073-83-4
D-5791
MW: 115.1
98 atom % D
2-HEPTANONE-1,1,1,3,3-D5
CAS:24588-56-5
Formula: CH3(CH2)3CD2COCD3
D-2516
MW: 119.22
98 atom % D
2-HEXANONE-1,1,1,3,3-D5
CAS:4840-82-8
Formula: CH3(CH2)2CD2COCD3
D-1632
MW: 105.19
98 atom % D
2-HYDROXY-1,4-NAPHTHOQUINONE-5,6,7,8-D4
D-7550
MW: 178.18
98 atom % D
2-HYDROXY-17β-ESTRADIOL-1,4,16,16,17-D5
CAS:221093-33-0
D-5552
MW: 293.42
98 atom % D
2-HYDROXY-2-METHYL-D3-PROPIONIC-3,3,3-D3 ACID
CAS:40662-45-1
Formula: (CD3)2C(OH)COOH
D-6605
MW: 110.14
98 atom % D
2-HYDROXY-4-METHOXYBENZOPHENONE-2′,3′,4′,5′,6′-D5
CAS:1219798-54-5
D-7066
MW: 233.28
99 atom % D
2-HYDROXYATRAZINE-D5 (ETHYL-D5)
CAS:1276197-25-1
D-7318
MW: 202.27
99 atom % D
2-HYDROXYBENZOIC ACID-D6
CAS:285979-87-5
Formula: DOC6D4COOD
D-1156
MW: 144.16
98 atom % D
2-HYDROXYBENZOIC-3,4,5,6-D4 ACID
CAS:78646-17-0
Formula: HOC6D4COOH
D-6322
MW: 142.15
98 atom % D
2-HYDROXYESTRONE-1,4,16,16-D4
CAS:81586-97-2
D-5806
MW: 290.39
98 atom % D
2-IODO-2-METHYLPROPANE-D9 (STABILIZED WITH COPPER)
CAS:61207-61-2
Formula: (CD3)3CI
D-1225
MW: 193.07
98 atom % D
2-IODOPROPANE-1,1,1,3,3,3-D6 (STABILIZED WITH COPPER)
CAS:39091-64-0
Formula: (CD3)2CHI
D-369
MW: 176.03
98 atom % D
2-IODOPROPANE-2-D1 (STABILIZED WITH COPPER)
CAS:95927-03-0
Formula: (CH3)2CDI
D-4194
MW: 171
98 atom % D
2-IODOPROPANE-D7 (STABILIZED WITH COPPER)
CAS:101927-33-7
Formula: (CD3)2CDI
D-5250
MW: 177.04
98 atom % D
2-ISOBUTYL-3-METHOXY-D3-PYRAZINE
CAS:588732-63-2
D-5975
MW: 169.24
99 atom % D
2-ISOPROPYL-3-METHOXY-D3-PYRAZINE
CAS:588732-60-9
D-6905
MW: 155.21
99 atom % D
2-MERCAPTO-5-METHOXYBENZIMIDAZOLE-4,6,7-D3
CAS:1219804-80-4
D-6263
MW: 183.24
98 atom % D
2-MERCAPTOBENZIMIDAZOLE-4,5,6,7-D4
CAS:931581-17-8
D-6097
MW: 154.22
98 atom % D
2-MERCAPTOETHANOL-1,1,2,2-D4
CAS:284474-53-9
Formula: HSCD2CD2OH
D-5330
MW: 82.15
98 atom % D
2-MERCAPTOETHANOL-D6
CAS:203645-37-8
Formula: DSCD2CD2OD
D-4213
MW: 84.17
98 atom % D
2-METHOXY-17β-ESTRADIOL-1,4,16,16,17-D5
CAS:358731-34-7
D-5550
MW: 307.44
98 atom % D
2-METHOXY-4,5-DIHYDRO-1 H -IMIDAZOLE (UNLABELLED)
CAS:28118-54-9
X-6491
MW: 100.12
--
2-METHOXY-4,5-DIHYDRO-1 H -IMIDAZOLE-4,4,5,5-D4
CAS:402788-68-5
D-6120
MW: 104.14
99 atom % D
2-METHOXY-4-METHYLPHENOL-3,5,6-D3,OD
CAS:20189-08-6
D-6963
MW: 142.19
98 atom % D
2-METHOXY-D3-ACETIC ACID
CAS:345910-00-1
Formula: CD3OCH2COOH
D-2854
MW: 93.1
98 atom % D
2-METHOXY-D3-ANILINE
CAS:1398066-00-6
Formula: CD3OC6H4NH2
D-7362
MW: 126.17
99 atom % D
2-METHOXY-D3-ANILINE-3,4,5,6-D4
CAS:1219803-70-9
Formula: CD3OC6D4NH2
D-6174
MW: 130.2
99 atom % D
2-METHOXY-D3-BENZALDEHYDE
CAS:56248-49-8
Formula: CD3OC6H4CHO
D-5966
MW: 139.17
99 atom % D
2-METHOXY-D3-ETHANOL
CAS:97840-77-2
Formula: CD3OCH2CH2OH
D-2855
MW: 79.11
98 atom % D
2-METHOXY-D3-ETHANOL-1,1,2,2-D4
CAS:108152-85-8
Formula: CD3OCD2CD2OH
D-3396
MW: 83.14
98 atom % D
2-METHOXY-D3-PHENOL
CAS:74495-69-5
Formula: CD3OC6H4OH
D-5968
MW: 127.16
99 atom % D
2-METHOXY-D3-PHENOL-3,4,5,6-D4
CAS:1065473-05-3
Formula: CD3OC6D4OH
D-6154
MW: 131.18
98 atom % D
2-METHOXY-D3-PYRAZINE
CAS:32046-21-2
D-7324
MW: 113.13
99 atom % D
2-METHOXYESTRONE-1,4,16,16-D4
CAS:949885-90-9
D-5804
MW: 304.42
99 atom % D
2-METHOXYETHANOL-1,1,2,2-D4
CAS:138667-25-1
Formula: CH3OCD2CD2OH
D-2856
MW: 80.12
98 atom % D
2-METHOXYNAPHTHALENE-1,3,4,5,6,7,8-D7
CAS:1219795-25-1
D-6271
MW: 165.24
98 atom % D
2-METHOXYPHENOL-3,4,5,6-D4
CAS:7329-52-4
Formula: CH3OC6D4OH
D-6153
MW: 128.16
98 atom % D
2-METHOXYPHENOL-3,4,5,6-D4,OD
CAS:20189-11-1
Formula: CH3OC6D4OD
D-6184
MW: 129.17
98 atom % D
2-METHOXYTOLUENE-α,α,α-D3
CAS:258832-47-2
Formula: CH3OC6H4CD3
D-6985
MW: 125.18
99 atom % D
2-METHYL-1,4-NAPHTHOQUINONE-D8
CAS:478171-80-1
D-5421
MW: 180.23
98 atom % D
2-METHYL-1-PHENYLPROPANE-D14
CAS:350818-58-5
Formula: C6D5CD2CD(CD3)2
D-5049
MW: 148.31
98 atom % D
2-METHYL-2-PROPANE-D9-THIOL
CAS:99224-24-5
Formula: (CD3)3CSH
D-2644
MW: 99.24
99 atom % D
2-METHYL-D3-1,4-NAPHTHOQUINONE
CAS:5172-16-7
D-5116
MW: 175.2
98 atom % D
2-METHYL-D3-2-PROPYL-1,3-PROPANEDIOL
CAS:1185023-23-7
Formula: CD3C(CH2OH)2CH2CH2CH3
D-7152
MW: 135.22
99 atom % D
2-METHYL-D3-3-BUTYN-1,1,1-D3-2-OL
CAS:57444-27-6
Formula: HC≡CC(CD3)2OH
D-6586
MW: 90.15
98 atom % D
2-METHYL-D3-CITRIC ACID (RACEMATE)
CAS:146764-58-1
Formula: HOOCCH2C(OH)(COOH)CH(CD3)COOH
D-4162
MW: 209.17
99 atom % D
2-METHYL-D3-PROPANE-1,1,1,3,3,3-D6 (GAS)
CAS:13275-39-3
Formula: (CD3)3CH
D-281
MW: 67.18
98 atom % D
2-METHYL-D3-PROPENE (GAS)
CAS:110597-10-9
Formula: (CD3)(CH3)C=CH2
D-5332
MW: 59.13
99 atom % D
2-METHYL-D3-PROPENE-3,3,3-D3 (GAS)
CAS:1560-62-9
Formula: (CD3)2C=CH2
D-71
MW: 62.14
98 atom % D
2-METHYL-D3-PROPIONIC ACID
CAS:95926-99-1
Formula: CH3CH(CD3)COOH
D-5897
MW: 91.12
99 atom % D
2-METHYL-D3-PROPIONIC-3,3,3-D3 ACID
CAS:29054-08-8
Formula: (CD3)2CHCOOH
D-5228
MW: 94.14
98 atom % D
2-METHYL-D3-PROPIONITRILE-3,3,3-D3
CAS:174736-88-0
Formula: CD3CH(CD3)CN
D-7519
MW: 75.14
99 atom % D
2-METHYL-D3-PROPYL ALCOHOL
CAS:95927-04-1
Formula: CH3CH(CD3)CH2OH
D-5902
MW: 77.14
99 atom % D
2-METHYL-D3-PROPYL-2,3,3,3-D4 ALCOHOL
CAS:1219804-53-1
Formula: (CD3)2CDCH2OH
D-5739
MW: 81.17
98 atom % D
2-METHYL-D3-PROPYL-3,3,3-D3 ALCOHOL
CAS:72182-69-5
Formula: (CD3)2CHCH2OH
D-151
MW: 80.16
98 atom % D
2-METHYL-D3-PYRIDINE
CAS:10259-19-5
Formula: C5H4NCD3
D-5795
MW: 96.15
98 atom % D
2-METHYLADENINE HEMISULFATE (UNLABELLED)
CAS:74873-18-0
X-6289
MW: 198.19
--
2-METHYLBUTANE-D12
CAS:13351-96-7
Formula: CD3CD2CD(CD3)2
D-630
MW: 84.22
98 atom % D
2-METHYLCITRIC ACID (RACEMATE) (UNLABELLED)
CAS:6061-96-7
Formula: HOOCCH2C(OH)(COOH)CH(CH3)COOH
X-4176
MW: 206.15
--
2-METHYLFURAN-D6 (STABILIZED WITH BHT)
CAS:1398065-93-4
D-7512
MW: 88.14
98 atom % D
2-METHYLIMIDAZOLE-D6
CAS:1173022-19-9
D-5386
MW: 88.14
98 atom % D
2-METHYLNAPHTHALENE-D10
CAS:7297-45-2
D-354
MW: 152.26
98 atom % D
2-METHYLPENTANE-D14
CAS:284487-65-6
Formula: CD3CD2CD2CD(CD3)2
D-5435
MW: 100.26
98 atom % D
2-METHYLPROPANE-2-D1 (GAS)
CAS:13183-68-1
Formula: (CH3)3CD
D-25
MW: 59.13
98 atom % D
2-METHYLPROPANE-D10 (GAS)
CAS:19170-96-8
Formula: (CD3)3CD
D-190
MW: 68.18
98 atom % D
2-METHYLPROPENE-1,1-D2 (GAS)
CAS:1560-59-4
Formula: (CH3)2C=CD2
D-414
MW: 58.12
98 atom % D
2-METHYLPROPENE-D8 (GAS)
CAS:20762-54-3
Formula: (CD3)2C=CD2
D-217
MW: 64.16
99 atom % D
2-METHYLPROPIONIC-2-D1 ACID
CAS:19136-93-7
Formula: (CH3)2CDCOOH
D-6426
MW: 89.11
99 atom % D
2-METHYLPROPIONIC-D7 ACID
CAS:223134-74-5
Formula: (CD3)2CDCOOH
D-1969
MW: 95.15
98 atom % D
2-METHYLPROPYL ALCOHOL-OD
CAS:14848-63-6
Formula: (CH3)2CH2OD
D-7241
MW: 75.13
98 atom % D
2-METHYLPROPYL-2-D1 ALCOHOL
CAS:20440-13-5
Formula: (CH3)2CDCH2OH
D-6427
MW: 75.13
98 atom % D
2-METHYLPROPYL-D9 ALCOHOL
CAS:850209-54-0
Formula: (CD3)2CDCD2OH
D-1675
MW: 83.18
98 atom % D
2-METHYLPROPYL-D9-AMINE
CAS:1146967-64-7
Formula: (CD3)2CDCD2NH2
D-5938
MW: 82.19
98 atom % D
2-METHYLPROPYL-D9-AMINE HCL
CAS:1219799-03-7
Formula: (CD3)2CDCD2NH2•HCl
D-5963
MW: 118.65
98 atom % D
2-METHYLPYRAZINE-D6
CAS:1219804-84-8
D-7246
MW: 100.15
99 atom % D
2-METHYLPYRIDINE-D7
CAS:93951-93-0
Formula: CD3C5D4N
D-2320
MW: 100.17
98 atom % D
2-NAPHTHOL-1,3,4,5,6,7,8-D7
CAS:78832-54-9
Formula: C10D7OH
D-5051
MW: 151.22
98 atom % D
2-NAPHTHOL-D8
CAS:78832-61-8
Formula: C10D7OD
D-5648
MW: 152.22
98 atom % D
2-NITROANILINE-3,4,5,6-D4
CAS:204244-80-4
Formula: O2NC6D4NH2
D-5437
MW: 142.15
98 atom % D
2-NITROANILINE-4,6-D2
CAS:1276197-41-1
D-7284
MW: 140.14
99 atom % D
2-NITROBENZOIC-D4 ACID
CAS:855997-63-6
Formula: O2NC6D4COOH
D-7316
MW: 171.15
98 atom % D
2-NITROBENZONITRILE-D4
CAS:1219795-50-2
Formula: O2NC6D4CN
D-5895
MW: 152.15
99 atom % D
2-NITROBIPHENYL-D9
CAS:38537-53-0
Formula: C6D5C6D4NO2
D-5052
MW: 208.26
98 atom % D
2-NITROFLUORENE-D9
CAS:128008-87-7
D-5233
MW: 220.27
98 atom % D
2-NITROPHENOL-3,4,5,6-D4
CAS:93951-78-1
Formula: O2NC6D4OH
D-2290
MW: 143.13
98 atom % D
2-NITROPROPANE-1,1,1,3,3,3-D6
CAS:52809-86-6
Formula: (CD3)2CHNO2
D-5393
MW: 95.13
98 atom % D
2-NITROTOLUENE-α,α,α-D3
CAS:70786-67-3
Formula: CD3C6H4NO2
D-6507
MW: 140.16
99 atom % D
2-NITROTOLUENE-3,4,5,6-D4
CAS:115049-76-8
Formula: CH3C6D4NO2
D-7313
MW: 141.16
99 atom % D
2-NITROTOLUENE-D7
CAS:84344-04-7
Formula: CD3C6D4NO2
D-7689
MW: 144.18
99 atom % D
2-NONANONE-1,1,1,3,3-D5
CAS:1398065-76-3
Formula: CH3(CH2)5CD2COCD3
D-7439
MW: 147.27
98 atom % D
2-OXOPIPERAZINE-3,3,5,5,6,6-D6
CAS:1219803-71-0
D-6904
MW: 106.16
98 atom % D
2-PENTANONE-1,1,1,3,3-D5
CAS:24313-49-3
Formula: CH3CH2CD2COCD3
D-219
MW: 91.16
98 atom % D
2-PHENOXYETHYL-1,1,2,2-D4 ALCOHOL
CAS:1219804-65-5
Formula: C6H5OCD2CD2OH
D-5605
MW: 142.19
98 atom % D
2-PHENOXYETHYL-1,1-D2 ALCOHOL
CAS:21273-38-1
Formula: C6H5OCH2CD2OH
D-5603
MW: 140.18
98 atom % D
2-PHENYL-D5-ETHAN-1,1,2,2-D4-OL
CAS:42950-74-3
Formula: C6D5CD2CD2OH
D-5480
MW: 131.22
98 atom % D
2-PHENYL-D5-ETHANOL
CAS:35845-63-7
Formula: C6D5CH2CH2OH
D-5479
MW: 127.2
98 atom % D
2-PHENYL-D5-ETHYL ISOTHIOCYANATE
CAS:912627-98-6
Formula: C6D5CH2CH2NCS
D-7251
MW: 168.27
98 atom % D
2-PHENYL-D5-ETHYLAMINE
CAS:912627-99-7
Formula: C6D5CH2CH2NH2
D-5798
MW: 126.21
99 atom % D
2-PHENYL-D5-PROPANE
CAS:97095-85-7
Formula: C6D5CH(CH3)2
D-6570
MW: 125.22
98 atom % D
2-PHENYLETHAN-1,1,2,2-D4-OL
CAS:107473-33-6
Formula: C6H5CD2CD2OH
D-5478
MW: 126.19
98 atom % D
2-PHENYLETHYL ACETATE-D3
CAS:1219805-43-2
Formula: C6H5CH2CH2OCOCD3
D-7233
MW: 167.22
99 atom % D
2-PHENYLETHYL-1,1,2,2-D4-AMINE
CAS:87620-08-4
Formula: C6H5CD2CD2NH2
D-1518
MW: 125.21
98 atom % D
2-PHENYLETHYL-D9-AMINE
CAS:342611-05-6
Formula: C6D5CD2CD2NH2
D-1919
MW: 130.24
98 atom % D
2-PHENYLPROPANE-1,1,1,2,3,3,3-D7
CAS:20201-28-9
Formula: C6H5CD(CD3)2
D-681
MW: 127.24
98 atom % D
2-PHENYLPROPANE-1,1,1,3,3,3-D6
CAS:20201-29-0
Formula: C6H5CH(CD3)2
D-680
MW: 126.23
98 atom % D
2-PHENYLPROPANE-2-D1
CAS:4019-54-9
Formula: C6H5CD(CH3)2
D-679
MW: 121.2
97 atom % D
2-PHENYLPROPANE-D12
CAS:97732-82-6
Formula: C6D5CD(CD3)2
D-3574
MW: 132.27
98 atom % D
2-PICOLINIC-D4 ACID
CAS:284487-61-2
D-5289
MW: 127.14
98 atom % D
2-PROPANE-D7-THIOL
CAS:1219803-56-1
Formula: (CD3)2CDSH
D-6042
MW: 83.2
98 atom % D
2-PROPYLPENTANOIC-D15 ACID
CAS:362049-65-8
Formula: (CD3CD2CD2)2CDCOOH
D-5491
MW: 159.3
98 atom % D
2-PYRIDYLACETIC-α,α-D2 ACID-OD DCL
CAS:1219802-51-3
D-7089
MW: 117.62
98 atom % D
2-PYRROLIDINONE-3,3,4,4,5,5-D6
CAS:70607-84-0
D-2200
MW: 91.14
98 atom % D
24( RS )-HYDROXYCHOLESTEROL-25,26,26,26,27,27,27-D7
CAS:144154-78-9
D-6878
MW: 409.7
99 atom % D
25-HYDROXYCHOLESTEROL-26,26,26,27,27,27-D6
CAS:88247-69-2
D-6774
MW: 408.7
99 atom % D
3′,4′-DIBENZYLOXYACETO-D3-PHENONE
CAS:344299-53-2
Formula: (C6H5CH2O)2C6H3COCD3
D-2277
MW: 335.42
97 atom % D
3′,4′-DICHLOROPROPIONANILIDE-2,2,3,3,3-D5
CAS:1398065-82-1
Formula: Cl2C6H3NHCOCD2CD3
D-7430
MW: 223.11
98 atom % D
3′,4′-DIMETHOXYACETOPHENONE-D3 (METHYL-D3)
CAS:350818-54-1
Formula: (CH3O)2C6H3COCD3
D-5037
MW: 183.22
98 atom % D
3′-METHOXYACETOPHENONE-2′,4′,5′,6′-D4
CAS:1219798-58-9
Formula: CH3OC6D4COCH3
D-7252
MW: 154.2
99 atom % D
3,3′,4,4′-TETRACHLOROBIPHENYL-D6
CAS:93952-23-9
D-3013
MW: 298.03
98 atom % D
3,3′-DICHLOROBENZIDINE-D6 (RINGS-D6)
CAS:93951-91-8
Formula: H2N(Cl)C6D3C6D3(Cl)NH2
D-2703
MW: 259.17
98 atom % D
3,4′,5-TRICHLOROBIPHENYL-2′,3′,5′,6′-D4
D-7045
MW: 261.57
98 atom % D
3,4,4′-TRICHLOROBIPHENYL-2′,3′,5′,6′-D4
D-7044
MW: 261.57
98 atom % D
3,4,5-TRICHLOROBIPHENYL-2′,3′,4′,5′,6′-D5
CAS:93952-22-8
Formula: Cl3C6H2C6D5
D-3012
MW: 262.58
98 atom % D
3,4,5-TRIHYDROXYBENZOIC-2,6-D2 ACID
CAS:294660-92-7
Formula: (HO)3C6D2COOH
D-2728
MW: 172.13
98 atom % D
3,4,5-TRIMETHOXY-D9-BENZOIC ACID
CAS:84759-05-7
Formula: (CD3O)3C6H2COOH
D-7661
MW: 221.26
99 atom % D
3,4,5-TRIMETHOXY-D9-BENZYL ALCOHOL
CAS:1219805-74-9
Formula: (CD3O)3C6H2CH2OH
D-6173
MW: 207.27
99 atom % D
3,4,5-TRIMETHOXYBENZALDEHYDE-D3(4-METHOXY-D3)
CAS:1219805-17-0
D-6560
MW: 199.22
99 atom % D
3,4-(METHYLENEDIOXY) PHENOL-2,5,6-D3;OD
CAS:1219798-37-4
D-7091
MW: 142.15
98 atom % D
3,4-DICHLOROANILINE-2,6-D2
CAS:1219803-22-1
Formula: Cl2C6HD2NH2
D-5426
MW: 164.03
99 atom % D
3,4-DICHLOROBENZOIC-D3 ACID
CAS:350818-53-0
Formula: Cl2C6D3COOH
D-5031
MW: 194.03
98 atom % D
3,4-DICHLOROBIPHENYL-2′,3′,4′,5′,6′-D5
CAS:1276197-19-3
D-7034
MW: 228.13
99 atom % D
3,4-DICHLOROTOLUENE-2,5,6-D3
CAS:1219795-29-5
Formula: Cl2C6D3CH3
D-6358
MW: 164.05
98 atom % D
3,4-DIFLUOROBENZOIC-D3 ACID
CAS:1219798-70-5
Formula: F2C6D3COOH
D-6485
MW: 161.12
98 atom % D
3,4-DIMETHOXYPHENYLACETONITRILE-α,α-D2
CAS:1219803-34-5
Formula: (CH3O)2C6H3CD2CN
D-1644
MW: 179.21
98 atom % D
3,4-DIMETHYLPHENOL-2,5,6-D3,OD
CAS:1219803-55-0
Formula: (CH3)2C6D3OD
D-5368
MW: 126.19
98 atom % D
3,5-DIBROMO-4-HYDROXYBENZONITRILE-2,6-D2
CAS:1219798-95-4
Formula: HO(Br2)C6D2CN
D-6531
MW: 278.93
98 atom % D
3,5-DIBROMOPYRIDINE-D3
CAS:1219799-05-9
Formula: C5D3Br2N
D-5737
MW: 239.91
98 atom % D
3,5-DICHLOROANILINE-2,4,6-D3
CAS:1219795-03-5
Formula: Cl2C6D3NH2
D-7015
MW: 165.04
98 atom % D
3,5-DICHLOROBENZOIC-D3 ACID
CAS:1219803-99-2
Formula: Cl2C6D3COOH
D-6059
MW: 194.03
98 atom % D
3,5-DICHLOROBIPHENYL-2′,3′,4′,5′,6′-D5
CAS:1276197-28-4
D-7035
MW: 228.13
99 atom % D
3,5-DICHLOROPHENOL-2,4,6-D3
CAS:124286-06-2
Formula: Cl2C6D3OH
D-7283
MW: 166.02
99 atom % D
3,5-DIFLUOROBENZOIC-D3 ACID
CAS:934397-71-4
Formula: F2C6D3COOH
D-6486
MW: 161.12
98 atom % D
3,5-DIMETHOXY-D6-4-HYDROXYBENZOIC ACID
CAS:84759-06-8
D-7484
MW: 204-21
99 atom % D
3,5-DIMETHYL-D6-CYCLOHEXANONE-3,4,4,5-D4(MIXTURE,OF,ISOMERS)
CAS:1219804-55-3
D-7194
MW: 136.26
98 atom % D
3,5-DIMETHYL-D6-PHENOL
CAS:133604-75-8
Formula: (CD3)2C6H3OH
D-5672
MW: 128.2
98 atom % D
3,5-DIMETHYLBENZOIC-D9 ACID
CAS:1335014-65-7
Formula: (CD3)2C6D3COOH
D-7436
MW: 159.23
98 atom % D
3,5-DIMETHYLPHENOL-2,4,6-D3,OD
CAS:1219803-59-4
Formula: (CH3)2C6D3OD
D-5369
MW: 126.19
98 atom % D
3,5-DIMETHYLPHENOL-D10
CAS:1192812-51-3
Formula: (CD3)2C6D3OD
D-6465
MW: 132.23
98 atom % D
3,6-DICHLORO-2-METHOXY-D3-BENZOIC ACID
CAS:349553-95-3
Formula: Cl2C6H2(OCD3)COOH
D-4085
MW: 224.06
99 atom % D
3- ISO -PROPYLPHENOL-D12
CAS:1219805-35-2
Formula: (CD3)2CDC6D4OD
D-5864
MW: 148.27
98 atom % D
3-(3,4-DIMETHOXY-D6-PHENYL) PROPIONIC-2,2,3,3-D4 ACID
CAS:1398065-72-9
D-7441
MW: 220-29
99 atom % D
3-(3-ETHOXY-4-METHOXYPHENYL) PROPIONIC-2,2,3,3-D4 ACID
CAS:1398065-51-4
D-7420
MW: 228.28
98 atom % D
3-(CYCLOHEXYLAMINO) -1-PROPANESULFONIC-D17 ACID
CAS:1219804-15-5
Formula: C6D11NHCD2CD2CD2SO3H
D-6875
MW: 238.42
98 atom % D
3-(DIMETHYL-D6-AMINO)-1-PROPYLAMINE
CAS:1219802-71-7
Formula: (CD3)2N(CH2)3NH2
D-6815
MW: 108.22
99 atom % D
3-(METHYL-D3-NITROSOAMINO)PROPIONITRILE
CAS:1276197-15-9
Formula: CD3N(NO2)CH2CH2CN
D-7314
MW: 132.14
99 atom % D
3-(METHYLTHIO)PROPIONALDEHYDE-2,2-D2
Formula: CH3SCH2CD2CHO
D-7685
MW: 106.18
98 atom % D
3-(N-MORPHOLINO)PROPANESULFONIC ACID-D15
CAS:1219799-30-0
D-6627
MW: 224.35
98 atom % D
3-(TRIFLUOROMETHYL)ANILINE-2,4,5,6-D4
CAS:1219802-14-8
Formula: CF3C6D4NH2
D-6441
MW: 165.15
98 atom % D
3-(TRIFLUOROMETHYL)PHENOL-2,4,6-D3,OD
CAS:1219798-47-6
Formula: CF3C6HD3OD
D-6664
MW: 166.14
98 atom % D
3-AMINOBENZOIC-2,4,5,6-D4 ACID
CAS:78399-79-8
Formula: H2NC6D4COOH
D-7653
MW: 141.16
99 atom % D
3-AMINOPENTANE-2,2,3,4,4-D5
CAS:1219802-43-3
Formula: (CH3CD2)2CDNH2
D-6017
MW: 92.19
98 atom % D
3-AMINOPROPANE-D6-SULFONIC ACID
CAS:1131576-06-1
Formula: H2NCD2CD2CD2SO3H
D-5159
MW: 145.21
98 atom % D
3-AMINOPROPIONAMIDE-2,2,3,3-D4 HCL
CAS:1276197-35-3
Formula: H2NCD2CD2CONH2•HCl
D-7282
MW: 128.59
98 atom % D
3-AMINOPYRIDINE-D6
CAS:1219805-61-4
Formula: D2NC5D4N
D-5702
MW: 100.15
98 atom % D
3-BENZYLOXYBENZALDEHYDE-α-D1
CAS:1219805-34-1
Formula: C6H5CH2OC6H4CDO
D-1663
MW: 213.25
98 atom % D
3-BROMO-1-PROPANOL-1,1,2,2,3,3-D6
CAS:284474-43-7
Formula: BrCD2CD2CD2OH
D-6297
MW: 145.03
98 atom % D
3-BROMOPROPIONIC-2,2,3,3-D4 ACID
CAS:1219799-25-3
Formula: BrCD2CD2COOH
D-5599
MW: 157
98 atom % D
3-BROMOPYRIDINE-D4
CAS:66148-14-9
D-6066
MW: 162.02
98 atom % D
3-BROMOTOLUENE-2,4,6-D3
CAS:1219805-60-3
Formula: BrC6HD3CH3
D-6298
MW: 174.05
98 atom % D
3-BROMOTOLUENE-D7
CAS:1185318-69-7
Formula: BrC6D4CD3
D-6287
MW: 178.08
98 atom % D
3-CHLORO-N,N-DIMETHYL-D6-PROPYLAMINE HCL
CAS:1219799-04-8
Formula: Cl(CH2)3N(CD3)2•HCl
D-6540
MW: 164.11
98 atom % D
3-CHLOROANILINE-2,4,6-D3
CAS:347840-11-3
Formula: ClC6HD3NH2
D-3701
MW: 130.59
98 atom % D
3-CHLOROBENZOIC-D4 ACID
Formula: ClC6D4COOH
D-7594
MW: 160.59
98 atom % D
3-CHLOROPROPIONIC-2,2,3,3-D4 ACID
CAS:1219802-17-1
Formula: ClCD2CD2COOH
D-5602
MW: 112.55
98 atom % D
3-CHLOROPYRIDINE-D4
CAS:1001003-95-7
Formula: ClC5D4N
D-6899
MW: 117.57
98 atom % D
3-CHLOROTOLUENE-2,4,6-D3
CAS:1219803-79-8
Formula: ClC6HD3CH3
D-6409
MW: 129.6
98 atom % D
3-CHLOROTOLUENE-D7
CAS:1219804-88-2
Formula: ClC6D4CD3
D-6410
MW: 133.63
98 atom % D
3-CYANOBENZYL-D6 BROMIDE
CAS:1219802-21-7
Formula: BrCD2C6D4CN
D-5568
MW: 202.08
98 atom % D
3-ETHYL-D5-TOLUENE
CAS:1398065-64-9
Formula: CD3CD2C6H4CH3
D-7458
MW: 125.22
99 atom % D
3-FLUOROANILINE-2,4,6-D3,ND2
CAS:1398065-56-9
Formula: FC6HD3ND2
D-7497
MW: 116.15
99 atom % D
3-FLUOROBENZALDEHYDE 2,4-DINITROPHENYLHYDRAZONE-3,5,6-D3
Formula: FC6H4CH=NNHC6D3(NO2)2
D-7605
MW: 307.26
99 atom % D
3-FLUOROTOLUENE-α,α,α-D3
CAS:4202-92-0
Formula: CD3C6H4F
D-5879
MW: 113.15
99 atom % D
3-FLUOROTOLUENE-α-D1
Formula: CH2DC6H4F
D-7626
MW: 111.14
98 atom % D
3-HYDROXY-1,5-PENTANEDIOIC-2,2,3,4,4-D5 ACID
CAS:1219805-72-7
Formula: HOOCCD2CD(OH)CD2COOH
D-6391
MW: 153.15
98 atom % D
3-HYDROXY-3-METHYL-D3-PENTANEDIOIC ACID
CAS:59060-36-5
Formula: HOOCCH2C(OH)(CD3)CH2COOH
D-3772
MW: 165.16
99 atom % D
3-ISOBUTYL-1-METHYL-D3-2-PYRAZINONE
CAS:1219805-28-3
D-6054
MW: 169.24
99 atom % D
3-METHOXY-D3-BENZALDEHYDE
CAS:1219795-07-9
Formula: CD3OC6H4CHO
D-6273
MW: 139.17
99 atom % D
3-METHOXYTOLUENE-α,α,α-D3
CAS:20369-34-0
Formula: CH3OC6H4CD3
D-6686
MW: 125.18
99 atom % D
3-METHYL-1-BUTYL-1,1,2,2-D4 ALCOHOL
CAS:1219795-21-7
Formula: (CH3)2CHCD2CD2OH
D-6235
MW: 92.17
98 atom % D
3-METHYL-1-BUTYL-1,1-D2 ALCOHOL
CAS:70907-83-4
Formula: (CH3)2CHCH2CD2OH
D-6233
MW: 90.16
98 atom % D
3-METHYL-1-BUTYL-D11 ALCOHOL
CAS:170678-50-9
Formula: (CD3)2CDCD2CD2OH
D-6234
MW: 99.22
98 atom % D
3-METHYL-D3-4-NITROPHENOL-2,5,6-D3
CAS:1219803-89-0
D-6242
MW: 159.17
98 atom % D
3-METHYL-D3-BUTYRIC-3,4,4,4-D4 ACID
CAS:1219805-32-9
Formula: (CD3)2CDCH2COOH
D-6966
MW: 109.18
98 atom % D
3-METHYL-D3-INDOLE
CAS:111399-60-1
D-7372
MW: 134.2
99 atom % D
3-METHYL-D3-PYRIDINE
CAS:10259-17-3
Formula: C5H4NCD3
D-5796
MW: 96.15
98 atom % D
3-METHYL-D3-THIOPHENE
CAS:108343-10-8
D-6799
MW: 101.18
99 atom % D
3-METHYLBUTYL ACETATE-D3
CAS:1219804-75-7
Formula: (CH3)2CHCH2CH2OCOCD3
D-7231
MW: 133.2
99 atom % D
3-METHYLBUTYRALDEHYDE-2,2-D2
CAS:352431-47-1
Formula: (CH3)2CHCD2CHO
D-5269
MW: 88.15
98 atom % D
3-METHYLBUTYRIC-2,2-D2 ACID
CAS:95927-02-9
Formula: (CH3)2CHCD2COOH
D-6236
MW: 104.15
98 atom % D
3-METHYLBUTYRIC-D9 ACID
CAS:344298-81-3
Formula: (CD3)2CDCD2COOH
D-2454
MW: 111.19
98 atom % D
3-METHYLBUTYRYL-D9 CHLORIDE
CAS:1219803-46-9
Formula: (CD3)2CDCD2COCl
D-6608
MW: 129.63
98 atom % D
3-METHYLINDOLE-D8,NH
CAS:697807-03-7
D-7371
MW: 139.23
99 atom % D
3-METHYLPENTANE-D14
CAS:20586-83-8
Formula: CD3CD2CD(CD3)CD2CD3
D-189
MW: 100.26
98 atom % D
3-METHYLPENTANEDIOIC-2,2,4,4-D4 ACID
CAS:1219798-68-1
Formula: CH3CH(CD2COOH)2
D-6723
MW: 150.17
98 atom % D
3-METHYLPYRIDINE-D7
CAS:202529-13-3
Formula: CD3C5D4N
D-5256
MW: 100.17
98 atom % D
3-NITROANILINE-2,4,5,6-D4
CAS:115044-52-5
Formula: O2NC6D4NH2
D-5438
MW: 142.15
98 atom % D
3-NITROBENZOIC-D4 ACID
CAS:78399-78-7
Formula: O2NC6D4COOH
D-6440
MW: 171.15
98 atom % D
3-NITROBENZYL ALCOHOL-OD
CAS:117897-59-3
Formula: O2NC6H4CH2OD
D-3746
MW: 154.14
98 atom % D
3-NITROBENZYL-D6 ALCOHOL
CAS:1219795-18-2
Formula: O2NC6D4CD2OH
D-6328
MW: 159.17
99 atom % D
3-NITROFLUORANTHENE-D9
D-4358
MW: 256.31
98 atom % D
3-OLEOYLESTRONE-2,4,16,16-D4
CAS:443791-75-1
D-6348
MW: 538.84
98 atom % D
3-PENTANONE-1,1,1,5,5,5-D6
CAS:53389-25-6
Formula: CD3CH2COCH2CD3
D-6555
MW: 92.17
98 atom % D
3-PENTANONE-2,2,4,4-D4
CAS:6400-97-1
Formula: CH3CD2COCD2CH3
D-6018
MW: 90.16
98 atom % D
3-PENTANONE-D10
CAS:54927-77-4
Formula: CD3CD2COCD2CD3
D-74
MW: 96.19
98 atom % D
3-PENTYL-2,2,3,4,4-D5 ALCOHOL
CAS:144032-75-7
Formula: CH3CD2CD(OH)CD2CH3
D-7087
MW: 93.18
98 atom % D
3-PYRIDYLACETIC-α,α-D2 ACID-OD DCL
CAS:1219802-37-5
D-7106
MW: 177.62
98 atom % D
4′-AMINOACETANILIDE-2′,3′,5′,6′-D4
CAS:1219802-76-2
Formula: H2NC6D4NHCOCH3
D-6617
MW: 154.2
98 atom % D
4′-BROMOACETOPHENONE-D7
CAS:1219805-88-5
Formula: BrC6D4COCD3
D-5629
MW: 206.09
98 atom % D
4′-CHLOROACETOPHENONE-2′,3′,5′,6′-D4
CAS:284474-50-6
Formula: ClC6D4COCH3
D-5379
MW: 158.62
98 atom % D
4′-CHLOROACETOPHENONE-D7
CAS:1174565-85-5
Formula: ClC6D4COCD3
D-5380
MW: 161.64
98 atom % D
4′-HYDROXYDICLOFENAC-D4 (PHENYL-D4-ACETIC)
CAS:254762-27-1
D-7426
MW: 316.18
86 atom % D
4′-METHYLACETOPHENONE-D10
CAS:358730-83-3
D-5495
MW: 144.24
98 atom % D
4′-NITROACETANILIDE-2′,3′,5′,6′-D4
CAS:68239-25-8
Formula: O2NC6D4NHCOCH3
D-6621
MW: 184.19
99 atom % D
4,4′-DIBROMOBIPHENYL-D8
CAS:80523-79-1
Formula: BrC6D4C6D4Br
D-5556
MW: 320.05
99 atom % D
4,4′-DICHLOROBENZOPHENONE-D8
CAS:1219806-01-5
Formula: (ClC6D4)2CO
D-5642
MW: 259.16
98 atom % D
4,4′-DICHLOROBIPHENYL-D8
CAS:1219805-77-2
Formula: ClC6D4C6D4Cl
D-6918
MW: 231.15
98 atom % D
4,4′-DIHYDROXYBIPHENYL-D8 (RINGS-D8)
CAS:612480-60-1
Formula: HOC6D4C6D4OH
D-5363
MW: 194.26
98 atom % D
4,4′-DIMETHOXYBENZOPHENONE-D8 (RINGS-D8)
CAS:350818-55-2
Formula: (CH3OC6D4)2CO
D-5038
MW: 250.32
98 atom % D
4,4′-DINITROCARBANILIDE-D8 (RINGS-D8)
CAS:1156508-87-0
D-7384
MW: 310.29
98 atom % D
4,4′-DIPYRIDYL-D8
CAS:132125-39-4
D-5073
MW: 164.24
98 atom % D
4,4′-METHYLENE-D2-DIANILINE
CAS:215590-72-0
Formula: H2NC6H4CD2C6H4NH2
D-6239
MW: 200.28
98 atom % D
4,4′-METHYLENEDIANILINE-2,2′,6,6′,N,N,N′,N′-D8
CAS:1219795-26-2
Formula: D2NC6H2D2CH2C6H2D2
D-6240
MW: 206.32
98 atom % D
4,6-DINITRO-2-METHYL-D3-PHENOL
CAS:1219804-69-9
Formula: (NO2)2(CD3)C6H2OH
D-6987
MW: 201.15
98 atom % D
4,6-DINITRO-2-METHYLPHENOL-3,5-D2
CAS:93951-76-9
Formula: (NO2)2(CH3)C6D2OH
D-2357
MW: 200.15
98 atom % D
4,6-PREGNADIEN-6-METHYL-16-METHYLENE-17-OL-3,20-DIONE-2,2-D2 ACETATE
D-7190
MW: 398.54
98 atom % D
4,6-PREGNADIEN-6-METHYL-17α-OL-3,20-DIONE ACETATE-D3
D-7188
MW: 387.53
99 atom % D
4,6-PREGNADIEN-6-METHYL-17α-OL-3,20-DIONE-2,2,21,21,21-D5
D-7253
MW: 347.51
99 atom % D
4- ISO -PROPYLANILINE-2,3,5,6-D4
CAS:1219804-95-1
Formula: (CH3)2CHC6D4NH2
D-5593
MW: 139.23
98 atom % D
4- ISO -PROPYLPHENOL-D12
CAS:1219805-27-2
Formula: (CD3)2CDC6D4OD
D-5865
MW: 148.27
98 atom % D
4- N -BUTYL-D9-ANILINE
CAS:1219794-78-1
Formula: CD3(CD2)3C6H4NH2
D-6210
MW: 158.29
98 atom % D
4- N -BUTYLANILINE-2,3,5,6-D4,ND2
CAS:1219794-75-8
Formula: CH3(CH2)3C6D4ND2
D-6209
MW: 155.27
98 atom % D
4- N -BUTYLANILINE-D15
CAS:1219794-89-4
Formula: CD3(CD2)3C6D4ND2
D-6211
MW: 164.33
98 atom % D
4- N -BUTYLANISOLE-2,3,5,6-D4
CAS:1219804-78-0
Formula: CH3CH2CH2CH2C6D4OCH3
D-6109
MW: 168.27
98 atom % D
4- N -BUTYLPHENOL-2,3,5,6-D4,OD
CAS:1219795-04-6
Formula: CH3CH2CH2CH2C6D4OD
D-5930
MW: 155.25
98 atom % D
4- N -NONYLPHENOL-2,3,5,6-D4,OD
CAS:358730-95-7
Formula: CH3(CH2)8C6D4OD
D-5510
MW: 225.38
98 atom % D
4- N -OCTYL-D17-ANISOLE
CAS:1219794-56-5
Formula: CD3(CD2)7C6H4OCH3
D-6108
MW: 237.46
98 atom % D
4- N -OCTYL-D17-PHENOL
CAS:1219794-55-4
Formula: CD3(CD2)7C6H4OH
D-6102
MW: 223.43
98 atom % D
4- N -PENTYL-D11-PHENOL
CAS:1219805-30-7
Formula: CD3(CD2)4C6H4OH
D-5858
MW: 175.31
98 atom % D
4- N -PENTYLOXYBENZALDEHYDE-α-D1
CAS:342611-09-0
Formula: CH3(CH2)4OC6H4CDO
D-1961
MW: 193.26
98 atom % D
4- N -PENTYLPHENOL-2,3,5,6-D4,OD
CAS:126839-95-0
Formula: CH3(CH2)4C6D4OD
D-5857
MW: 169.28
98 atom % D
4- N -PENTYLPHENOL-D16
CAS:1219805-40-9
Formula: CD3(CD2)4C6D4OD
D-5859
MW: 180.34
98 atom % D
4- N -PROPYLPHENOL-D12
CAS:352431-21-1
Formula: CD3(CD2)2C6D4OD
D-5342
MW: 148.27
98 atom % D
4- TERT -BUTYL-D9-PHENOL-2,3,5,6-D4
CAS:225386-58-3
Formula: (CD3)3CC6D4OH
D-6069
MW: 163.3
99 atom % D
4- TERT -BUTYLANILINE-D15
CAS:1219794-71-4
Formula: (CD3)3CC6D4ND2
D-5925
MW: 164.33
98 atom % D
4- TERT -BUTYLBENZOIC-D13 ACID
Formula: (CD3)3CC6D4COOH
D-7697
MW: 191.31
99 atom % D
4-( N -BUTYLAMINO-2,2,3,3,4,4,4-D7)BENZOIC ACID
CAS:1219803-44-7
Formula: CD3CD2CD2CH2NHC6H4COOH
D-7171
MW: 200.29
95 atom % D
4-(2,4-DICHLOROPHENOXY-D3) BUTYRIC ACID
CAS:1219802-46-6
D-6585
MW: 252.11
98 atom % D
4-(2-HYDROXYETHYL-D4) MORPHOLINE
CAS:1185052-90-7
D-6610
MW: 135.2
99 atom % D
4-(4-CHLORO-2-METHYLPHENOXY-D3) BUTYRIC ACID
CAS:1219803-42-5
D-7118
MW: 231.69
98 atom % D
4-(ETHOXYMETHYL) ANISOLE-2,3,5,6-D4
CAS:1219799-15-1
Formula: CH3OC6D4CH2OCH2CH3
D-6519
MW: 170.24
98 atom % D
4-(METHYL-D3-AMINO)BUTYRIC-2,2,3,3,4,4-D6 ACID HCL
CAS:1219805-36-3
Formula: CD3NH(CD2)3COOH•HCl
D-6784
MW: 162.66
99 atom % D
4-(N-METHYL-N-NITROSOAMINO)-1-(3-PYRIDYL-D4)-1-BUTANONE
CAS:764661-24-7
D-4152
MW: 211.26
98 atom % D
4-(TRIFLUOROMETHYL)ANILINE-2,3,5,6-D4
CAS:1219795-48-8
Formula: CF3C6D4NH2
D-5606
MW: 165.15
98 atom % D
4-ACETAMIDOBENZENE-D4-SULFONYL CHLORIDE
CAS:77435-44-0
Formula: CH3CONHC6D4SO2Cl
D-7394
MW: 237.69
98 atom % D
4-AMINO-2,2,6,6-TETRAMETHYLPIPERIDINE-D17-1-OXYL
CAS:70588-04-4
D-2781
MW: 188.37
98 atom % D
4-AMINO-2,2,6,6-TETRAMETHYLPIPERIDINE-D17;1-15N-1-OXYL
CAS:97461-87-5
M-2782
MW: 189.37
99 atom % 15N; 98 atom % D
4-AMINO-N,N-DIMETHYL-D6-ANILINE
CAS:1398066-19-7
Formula: (CD3)2NC6H4NH2
D-7479
MW: 142.23
98 atom % D
4-AMINOBENZOIC-2,3,5,6-D4 ACID
CAS:350820-01-8
Formula: H2NC6D4COOH
D-4209
MW: 141.16
98 atom % D
4-AMINOBIPHENYL-D9
CAS:344298-96-0
Formula: C6D5C6D4NH2
D-2638
MW: 178.28
98 atom % D
4-AMINOBUTYRIC-2,2,3,3,4,4-D6 ACID
CAS:70607-85-1
Formula: H2NCD2CD2CD2COOH
D-1828
MW: 109.16
99 atom % D
4-AMINOBUTYRIC-2,2-D2 ACID
CAS:67910-98-9
Formula: H2NCH2CH2CD2COOH
D-1731
MW: 105.13
98 atom % D
4-AMINOBUTYRIC-4,4-D2 ACID
CAS:107022-06-0
Formula: H2NCD2CH2CH2COOH
D-6846
MW: 105.13
98 atom % D
4-AMINOPHENOL-D7
CAS:285132-88-9
Formula: D2NC6D4OD
D-5022
MW: 116.17
97 atom % D
4-AMINOPIPERIDINE-3,3,4,5,5-D5
CAS:1219803-60-7
D-6062
MW: 105.19
98 atom % D
4-AMINOPYRIDINE-D6
CAS:45498-20-2
Formula: D2NC5D4N
D-5114
MW: 100.15
98 atom % D
4-ANDROSTEN-11β-OL-3,17-DIONE-2,2,4,6,6,16,16-D7
D-6128
MW: 309.46
98 atom % D
4-ANDROSTEN-17α-OL-3-ONE-2,2,4,6,6-D5
CAS:165195-35-7
D-6535
MW: 293.46
98 atom % D
4-BROMO-α,α,α-TRIFLUOROTOLUENE-D4
CAS:1219799-09-3
Formula: BrC6D4CF3
D-7137
MW: 229.03
98 atom % D
4-BROMO-1-BUTANOL-1,1,2,2,3,3,4,4-D8
CAS:136091-68-4
Formula: BrCD2CD2CD2CD2OH
D-5704
MW: 161.07
99 atom % D
4-BROMOANILINE-2,3,5,6-D4
CAS:61357-76-4
Formula: BrC6D4NH2
D-5318
MW: 176.05
98 atom % D
4-BROMOANISOLE-2,3,5,6-D4
CAS:152404-45-0
Formula: BrC6D4OCH3
D-5703
MW: 191.06
98 atom % D
4-BROMOANISOLE-D3 (METHYL-D3)
CAS:100835-59-4
Formula: BrC6H4OCD3
D-7197
MW: 190.05
99 atom % D
4-BROMOBENZOIC-D4 ACID
CAS:787624-24-2
Formula: BrC6D4COOH
D-6293
MW: 205.04
99 atom % D
4-BROMOBENZONITRILE-D4
CAS:771534-56-6
Formula: BrC6D4CN
D-6400
MW: 186.04
99 atom % D
4-BROMOBENZYL-2,3,5,6-D4 BROMIDE
Formula: BrC6D4CH2Br
D-7540
MW: 253.96
99 atom % D