HomeText SearchStructure Searche-Chemicals.comList Your CompanyContactAccountLogoff






























C/D/N Isotopes Inc.




Country: Canada

C/D/N Isotopes Inc.
88 Leacock Street
Pointe-Claire, Quebec
Canada H9R 1H1


Phone: (800) 565-4696
Phone 2: (514) 697-6254
FAX: (514) 697-6148
E-Mail:E-Mail this Supplier




http://www.cdnisotopes.com

Structure Search for C/D/N Isotopes Inc.

Since 1993, C/D/N Isotopes has been a leading manufacturer of deuterium stable labeled compounds, providing our customers with superior quality and exceptional service. Researchers in all branches of science and medicine, from around the world, depend on us as the company for deuterium labeled compounds.

We have more than 3000 products in stock. As a result, we are able to ship most products within 24 to 48 hours after receipt of order. In fact, 98% of our orders are filled from stock.

The majority of the products listed on our website are manufactured exclusively by C/D/N Isotopes. Over the years, we have developed and expanded our expertise in the preparation of deuterated compounds, and we are continuously adding new products.

Most new products are the direct result of inquiries from our customers. Our extensive Custom Synthesis capabilities allow us to develop the products that our customers need, in a timely manner and at a reasonable price. Our Quality Control ensures that the isotopic enrichment and chemical purity of our products meet the highest standards.

Our courteous and helpful Customer Service professionals are available to assist you with all your stable labeled product requirements.


Product List: 3,036

PON:Page:1 | 2 | 3 |


 


Products for C/D/N Isotopes Inc.

Δ8,9-DEHYDRO-17β-ESTRADIOL-16,16,17-D3
D-5175
MW: 273.39
97 atom % D
Δ8,9-DEHYDROESTRONE-16,16-D2
D-5174
MW: 270.37
96 atom % D
α,α′-DIBROMO-P-XYLENE-D8
CAS:74903-77-8
Formula: C6D4(CD2Br)2
D-6542
MW: 272.01
98 atom % D
α,α,α-TRICHLOROTOLUENE-D5
CAS:93232-45-2
Formula: C6D5CCl3
D-6533
MW: 200.51
99 atom % D
α,α,α-TRIFLUOROTOLUENE-D5
CAS:164112-72-5
Formula: C6D5CF3
D-5716
MW: 151.14
99 atom % D
α-1,2,3,4,5,6-HEXACHLOROCYCLOHEXANE-D6
CAS:86194-41-4
Formula: C6Cl6D6
D-3009
MW: 296.87
99 atom % D
α-AMINO-ISO-BUTYRIC-D6 ACID (DIMETHYL-D6)
CAS:50348-93-1
Formula: (CD3)2C(NH2)COOH
D-6773
MW: 109.16
99 atom % D
α-HYDROXYMETOPROLOL (UNLABELLED) (MIXTURE OF STEREOISOMERS)
CAS:56392-16-6
X-5681
MW: 283.37
--
α-HYDROXYMETOPROLOL-D7 (ISO-PROPYL-D7) (MIXTURE OF STEREOISOMERS)
CAS:1276197-39-7
D-7159
MW: 290.41
99 atom % D
α-METHYLSTYRENE-D10 (STABILIZED WITH HYDROQUINONE)
CAS:10362-82-0
Formula: C6D5C(CD3)=CD2
D-5333
MW: 128.24
98 atom % D
α-TERPINEOL-D3 (PROPYL METHYL-D3)
CAS:203633-12-9
D-2707
MW: 157.27
98 atom % D
β-ALANINE-2,2,3,3-D4
CAS:116173-67-2
Formula: H2NCD2CD2COOH
D-6498
MW: 93.12
98 atom % D
β-IMINODI(PROPIONIC-2,2,3,3-D4 ACID)
CAS:1219803-81-2
Formula: HN(CD2CD2COOH)2
D-6861
MW: 169.21
98 atom % D
γ-1,2,3,4,5,6-HEXACHLOROCYCLOHEXANE-D6
CAS:60556-82-3
Formula: C6Cl6D6
D-3010
MW: 296.87
99 atom % D
δ-VALEROLACTONE-3,3,4,4-D4
CAS:42932-61-6
D-5271
MW: 104.14
98 atom % D
ε-CAPROLACTAM-D10
CAS:169297-53-4
D-5253
MW: 123.22
98 atom % D
ε-CAPROLACTONE-3,3,4,4,5,5-D6
CAS:1219802-08-0
D-6111
MW: 120.18
99 atom % D
(±)-(1-BROMOETHYL-2,2,2-D3)BENZENE
CAS:23088-42-8
Formula: C6H5CH(Br)CD3
D-6134
MW: 188.08
98 atom % D
(±)-CIS-SERTRALINE-D3 HCL (N-METHYL-D3)
CAS:1217741-83-7
D-7402
MW: 345.71
99 atom % D
(±)-P-OCTOPAMINE-α,β,β-D3 HCL
CAS:1219803-62-9
Formula: HOC6H4CD(OH)CD2NH2
D-1774
MW: 192.66
98 atom % D
(±)-SEC-BUTYL-1,1,1-D3 ALCOHOL
CAS:53716-61-3
Formula: CH3CH2CH(OH)CD3
D-1064
MW: 77.14
99 atom % D
(±)-SEC-BUTYL-3,3,4,4,4-D5 ALCOHOL
CAS:75749-92-7
Formula: CD3CD2CH(OH)CH3
D-1063
MW: 79.15
99 atom % D
(±)-SEC-BUTYL-D9 ALCOHOL
CAS:1202864-22-9
Formula: CD3CD2CD(OH)CD3
D-5841
MW: 83.18
98 atom % D
(±)-TRANS-SERTRALINE-D3 HCL (N-METHYL-D3)
CAS:1330180-66-9
D-7473
MW: 345.71
99 atom % D
(±)-1,2-BIS-HEXADECANOYL-3-CHLOROPROPANE-D5-DIOL
CAS:1185057-55-9
D-7429
MW: 592.4
98 atom % D
(±)-1,2-DIBROMOPROPANE-D6
CAS:51209-47-3
Formula: CD3CD(Br)CD2Br
D-1712
MW: 207.93
98 atom % D
(±)-1,2-DICHLOROPROPANE-D6
CAS:93952-08-0
Formula: CD3CDClCD2Cl
D-2363
MW: 119.02
98 atom % D
(±)-1,2-ISOPROPYLIDENEGLYCEROL-1,1,2,3,3-D5
CAS:74300-14-4
D-7596
MW: 137.19
98 atom % D
(±)-1,2-PROPANE-1,1,2-D3-DIAMINE
Formula: CH3CD(NH2)CD2NH2
D-7562
MW: 77.14
99 atom % D
(±)-1,2-PROPANE-D6-DIOL
CAS:52910-80-2
Formula: CD3CD(OH)CD2OH
D-1507
MW: 82.13
98 atom % D
(±)-1,2-PROPANEDIOL-(OD)2
CAS:58161-11-8
Formula: CH3CH(OD)CH2OD
D-386
MW: 78.11
98 atom % D
(±)-1,2-PROPANEDIOL-D8
CAS:80156-55-4
Formula: CD3CD(OD)CD2OD
D-1656
MW: 84.14
98 atom % D
(±)-1,2-PROPYLENE-3,3,3-D3 OXIDE (STABILIZED WITH HYDROQUINONE)
CAS:2245-32-1
D-83
MW: 61.1
99 atom % D
(±)-1,2-PROPYLENE-D6 CARBONATE
CAS:202480-74-8
D-5545
MW: 108.13
98 atom % D
(±)-1,2-PROPYLENE-D6 OXIDE (STABILIZED WITH HYDROQUINONE)
CAS:202468-69-7
D-1915
MW: 64.12
98 atom % D
(±)-1,4-DITHIOTHREITOL-1,1,2,3,4,4-D6
Formula: HSCD2CD(OH)CD(OH)CD2SH
D-6631
MW: 160.27
98 atom % D
(±)-1,4-DITHIOTHREITOL-D10
CAS:302912-05-6
Formula: DSCD2CD(OD)CD(OD)CD2SD
D-3931
MW: 164.3
97 atom % D
(±)-1-AMINO-2-PHENYL-D5-PROPANE-2,3,3,3-D4
D-7595
MW: 144.26
98 atom % D
(±)-1-AMINO-2-PROPANOL-1,1,2,3,3,3-D6
CAS:1219795-13-7
Formula: CD3CD(OH)CD2NH2
D-6277
MW: 81.15
98 atom % D
(±)-1-BROMO-2-ETHYL-3-METHYL-D3-BUTANE-3,4,4,4-D4
CAS:1219805-84-1
Formula: (CD3)2CDCH(CH2CH3)CH2Br
D-6383
MW: 186.14
99 atom % D
(±)-1-PHENYL-D5-ETHANOL
CAS:90162-45-1
Formula: C6D5CH(OH)CH3
D-737
MW: 127.19
98 atom % D
(±)-1-PHENYLETHAN-1,2,2,2-D4-OL
CAS:90162-44-0
Formula: C6H5CD(OH)CD3
D-739
MW: 126.19
98 atom % D
(±)-1-PHENYLETHAN-1-D1-OL
CAS:3101-96-0
Formula: C6H5CD(OH)CH3
D-2124
MW: 123.17
98 atom % D
(±)-1-PHENYLETHAN-2,2,2-D3-OL
CAS:17537-32-5
Formula: C6H5CH(OH)CD3
D-627
MW: 125.18
98 atom % D
(±)-1-PHENYLETHANOL-D10
CAS:219586-41-1
Formula: C6D5CD(OD)CD3
D-1912
MW: 132.23
98 atom % D
(±)-18-METHYL-D3-EICOSANOIC ACID
Formula: CH3CH2CH(CD3)(CH2)16COOH
D-7533
MW: 329.58
99 atom % D
(±)-2-(2,4-DICHLOROPHENOXY-D3)PROPIONIC ACID
CAS:1219803-66-3
D-7117
MW: 238.08
98 atom % D
(±)-2-(4-CHLORO-2-METHYLPHENOXY-D3)PROPIONIC ACID
CAS:352431-15-3
D-5321
MW: 217.67
98 atom % D
(±)-2-(ETHYL-D5-AMINO)PROPIOPHENONE HCL
CAS:1189879-32-0
Formula: C6H5COCH(CH3)NHCD2CD3•HCl
D-7094
MW: 218.74
99 atom % D
(±)-2-AMINOHEXANE-1,1,1,2,3,3-D6
CAS:1219802-28-4
Formula: CH3CH2CH2CD2CD(NH2)CD3
D-6783
MW: 107.23
98 atom % D
(±)-2-BROMOBUTANE-D9
CAS:202392-72-1
Formula: CD3CD2CD(Br)CD3
D-5906
MW: 146.07
99 atom % D
(±)-2-BROMOBUTYRIC-2,3,3,4,4,4-D6 ACID
CAS:1219799-08-2
Formula: CD3CD2CD(Br)COOH
D-5580
MW: 173.04
98 atom % D
(±)-2-BROMOPROPIONIC-2,3,3,3-D4 ACID
CAS:60153-93-7
Formula: CD3CD(Br)COOH
D-5598
MW: 157
98 atom % D
(±)-2-BROMOPROPIONIC-3,3,3-D3 ACID
Formula: CD3CH(Br)COOH
D-7676
MW: 155.99
98 atom % D
(±)-2-CHLOROBUTANE-D9
CAS:175540-77-9
Formula: CD3CD2CD(Cl)CD3
D-6683
MW: 101.62
98 atom % D
(±)-2-CHLOROBUTYRIC-2,3,3,4,4,4-D6 ACID
CAS:1219802-13-7
Formula: CD3CD2CD(Cl)COOH
D-5600
MW: 128.59
98 atom % D
(±)-2-CHLOROPROPIONYL-2,3,3,3-D4 CHLORIDE
CAS:1219794-98-5
Formula: CD3CD(Cl)COCl
D-6198
MW: 130.99
98 atom % D
(±)-2-ETHYLHEXANOIC-D15 ACID
CAS:352431-38-0
Formula: CD3(CD2)3CD(CD2CD3)COOH
D-5246
MW: 159.3
98 atom % D
(±)-2-ETHYLHEXYL-D17 ACETATE
CAS:1219802-70-6
Formula: CD3(CD2)3CD(CD2CD3)CD2OCOCH3<
D-6583
MW: 189.37
98 atom % D
(±)-2-ETHYLHEXYL-D17 ALCOHOL
CAS:202480-75-9
Formula: CD3(CD2)3CD(CD2CD3)CD2OH
D-5247
MW: 147.33
98 atom % D
(±)-2-HYDROXYHEXANOIC-6,6,6-D3 ACID
CAS:1219798-84-1
Formula: CD3CH2CH2CH2CH(OH)COOH
D-6443
MW: 135.18
99 atom % D
(±)-2-IODOBUTANE-D9 (STABILIZED WITH COPPER)
CAS:1219795-41-1
Formula: CD3CD2CD(l)CD3
D-5900
MW: 193.07
99 atom % D
(±)-2-METHYL-2,4-PENTANE-D12-DIOL
CAS:284474-72-2
Formula: CD3CD(OH)CD2C(CD3)2OH
D-5825
MW: 130.25
98 atom % D
(±)-2-METHYL-D3-BUTYRIC ACID
CAS:95926-92-4
Formula: CH3CH2CH(CD3)COOH
D-7535
MW: 105.15
99 atom % D
(±)-2-METHYL-D3-PIPERAZINE-2,3,3,5,5,6,6-D7
D-6622
MW: 110.22
99 atom % D
(±)-2-METHYL-D3-SUCCINIC-2,3,3-D3 ACID
CAS:347840-08-8
Formula: HOOCCD(CD3)CD2COOH
D-3588
MW: 138.15
98 atom % D
(±)-2-METHYLBUTYRIC-D9 ACID
CAS:352431-44-8
Formula: CD3CD2CD(CD3)COOH
D-5267
MW: 111.19
98 atom % D
(±)-2-METHYLBUTYRYL-D9 CHLORIDE
CAS:1219795-10-4
Formula: CD3CD2CD(CD3)COCl
D-5463
MW: 129.63
98 atom % D
(±)-2-METHYLPIPERAZINE-2,3,3,5,5,6,6-D7
CAS:1219802-98-8
D-6609
MW: 107.21
98 atom % D
(±)-2-PENTYL-1,1,1,3,3-D5 ALCOHOL
CAS:14629-70-0
Formula: CH3CH2CD2CH(OH)CD3
D-5139
MW: 93.18
98 atom % D
(±)-3-(2-METHOXY-D3-PHENOXY)-1,2-PROPANEDIOL
CAS:1189924-85-3
D-5793
MW: 201.24
99 atom % D
(±)-3-(4-METHYLBENZYLIDINE-D4)CAMPHOR
CAS:1219806-41-3
D-6964
MW: 258.4
98 atom % D
(±)-3-AMINO-ISO-BUTYRIC-2,3,3-D3 ACID
CAS:1219803-65-2
Formula: H2NCD2CD(CH3)COOH
D-7229
MW: 106.14
98 atom % D
(±)-3-CHLORO-1,2-PROPANE-D5-DIOL
CAS:342611-01-2
Formula: ClCD2CD(OH)CD2OH
D-1842
MW: 115.57
98 atom % D
(±)-3-METHYLOCTANE-D20
CAS:345909-08-2
Formula: CD3(CD2)4CD(CD3)CD2CD3
D-3024
MW: 148.38
98 atom % D
(±)-3-METHYLPENTANOIC-D11 ACID
Formula: CD3CD2CD(CD3)CD2COOH
D-7619
MW: 127.23
99 atom % D
(±)-3-PYRROLIDINOL-2,2,3,4,4-D5
CAS:1219805-52-3
D-5661
MW: 92.15
97 atom % D
(±)-3-QUINUCLIDINOL-2,2,3,6,6,7,7-D7
D-7560
MW: 134.23
99 atom % D
(±)-4-HYDROXY-3-METHOXY-D3-MANDELIC ACID
CAS:74495-70-8
D-3919
MW: 201.19
99 atom % D
(±)-4-HYDROXY-3-METHOXYMANDELIC-α-D1 ACID
CAS:53587-34-1
Formula: HO(CH3O)C6H3CD(OH)COOH
D-1845
MW: 199.18
93 atom % D
(±)-4-HYDROXYPROPRANOLOL HCL (UNLABELLED)
CAS:14133-90-5
X-4329
MW: 311.81
--
(±)-4-HYDROXYPROPRANOLOL-D7 HCL (ISO-PROPYL-D7)
CAS:1219804-03-1
D-5579
MW: 318.85
99 atom % D
(±)-7-METHYL-D3-NONANOIC ACID
Formula: CH3CH2CH(CD3)(CH2)5COOH
D-7534
MW: 175.29
99 atom % D
(±)-ACEBUTOLOL-D7 (ISO-PROPYL-D7)
D-7506
MW: 343.47
99 atom % D
(±)-ALBUTEROL-D3 (3-HYDROXYMETHYL-D2; α-D1)
CAS:1219798-60-3
D-5921
MW: 242.33
98 atom % D
(±)-ALFUZOSIN-D7 HCL (TETRAHYDROFUROYL-D7)
CAS:1276197-14-8
D-7228
MW: 432.96
98 atom % D
(±)-AMBRISENTAN-D3 (METHOXY-D3)
CAS:1189479-60-4
D-7366
MW: 381.45
99 atom % D
(±)-AMLODIPINE-D4 MALEATE (2-CHLOROPHENYL-D4)
D-7346
MW: 528.98
98 atom % D
(±)-ATENOLOL-D7 (ISO-PROPYL-D7)
CAS:29122-68-7
Formula: (CD3)2CDNHCH2CH(OH)CH2OC6H4CH
D-6202
MW: 273.38
98 atom % D
(±)-ATOMOXETINE-D5 HCL (PHENYL-D5)
CAS:1398065-95-6
D-7503
MW: 296.85
98 atom % D
(±)-ATROPINE-D3 (N-METHYL-D3)
CAS:1276197-36-4
D-1861
MW: 292.39
99 atom % D
(±)-BENZOIN-D10 (DIPHENYL-D10)
CAS:56830-64-9
Formula: C6D5COCH(OH)C6D5
D-5839
MW: 222.31
98 atom % D
(±)-BETAXOLOL-D7 HCL (N-ISO-PROPYL-D7)
CAS:1219802-92-2
D-7097
MW: 350.94
99 atom % D
(±)-BISOPROLOL-D7 HEMIFUMARATE (ISO-PROPYL-D7)
D-7507
MW: 390.52
99 atom % D
(±)-BUPIVACAINE-D9 (BUTYL-D9)
CAS:474668-57-0
D-6933
MW: 297.49
98 atom % D
(±)-BUPROPION-D9 HCL (TERT-BUTYL-D9)
CAS:1189725-26-5
D-6834
MW: 285.26
99 atom % D
(±)-CARAZOLOL-D7 (ISO-PROPYL-D7)
CAS:1173021-02-7
D-7525
MW: 305.43
99 atom % D
(±)-CARAZOLOL-D7 HCL (ISO-PROPYL-D7)
CAS:1276197-44-4
D-7327
MW: 341.89
99 atom % D
(±)-CARBINOXAMINE-D6 MALEATE (N,N-DIMETHYL-D6)
D-7564
MW: 412.9
98 atom % D
(±)-CARVEDILOL-D4 (ETHYL-D4)
CAS:1133705-56-2
D-6828
MW: 410.5
99 atom % D
(±)-CETIRIZINE-D4 (ETHOXY-D4)
CAS:1219803-84-5
D-6100
MW: 392.92
99 atom % D
(±)-CHLOROPHACINONE-D4 (INDANEDIONE-4,5,6,7-D4)
CAS:1219805-75-0
D-7082
MW: 378.85
99 atom % D
(±)-CHLORPHENIRAMINE-D6 MALEATE (N,N-DIMETHYL-D6)
CAS:1219806-45-7
D-6639
MW: 396.9
98 atom % D
(±)-CITALOPRAM-D4 HBR (4-FLUOROPHENYL-D4)
CAS:1219803-58-3
D-6822
MW: 409.33
98 atom % D
(±)-CLENBUTEROL-D9 (TRIMETHYL-D9)
CAS:129138-58-5
D-4287
MW: 286.25
99 atom % D
(±)-COTININE-2,4,5,6-D4 (PYRIDINE-D4)
CAS:350818-68-7
D-5097
MW: 180.24
98 atom % D
(±)-COTININE-D3 (N-METHYL-D3)
CAS:110952-70-0
D-3518
MW: 179.24
98 atom % D
(±)-DESVENLAFAXINE-D6 SUCCINATE HYDRATE (N,N-DIMETHYL-D6)
D-7379
MW: 405.52
99 atom % D
(±)-DONEPEZIL-D4 HCL (BIS-METHYLENE-D4)
CAS:1219798-88-5
D-6365
MW: 419.98
99 atom % D
(±)-DULOXETINE-D5 OXALATE (N-METHYL-D3; PROPANAMINE-D2)
D-7125
MW: 392.48
99 atom % D
(±)-EPICHLOROHYDRIN-2-D1 (STABILIZED WITH HYDROQUINONE)
CAS:70735-27-2
D-5370
MW: 93.53
98 atom % D
(±)-EPICHLOROHYDRIN-D5 (STABILIZED WITH HYDROQUINONE)
CAS:69533-54-6
D-1194
MW: 97.56
98 atom % D
(±)-EPINEPHRINE-2,5,6,α,β,β-D6
CAS:1219803-77-6
D-6632
MW: 189.24
98 atom % D
(±)-EPINEPHRINE-D3 (N-METHYL-D3)
CAS:1189977-29-4
D-6633
MW: 186.22
99 atom % D
(±)-ETODOLAC-D3 (1-ETHYL-2,2,2-D3)
CAS:1276197-46-6
D-7296
MW: 290.38
99 atom % D
(±)-FELODIPINE-D3 (2,3-DICHLOROPHENYL-D3)
CAS:1219795-30-8
D-7175
MW: 387.28
99 atom % D
(±)-FENBUCONAZOLE-D5 (PHENYL-D5)
CAS:1398066-06-2
D-7388
MW: 341.85
99 atom % D
(±)-FLUOXETINE-D5 HCL (PHENYL-D5)
CAS:1173020-43-3
D-5749
MW: 350.82
99 atom % D
(±)-FLUOXETINE-D5 OXALATE (PHENYL-D5)
CAS:1219804-82-6
D-5740
MW: 404.4
99 atom % D
(±)-FLURBIPROFEN-D5 (PHENYL-D5)
CAS:215175-76-1
D-7405
MW: 249.3
99 atom % D
(±)-GLYCERYL-1,1,2,3,3-D5 1-MONOOLEATE
CAS:565183-24-6
D-7610
MW: 361.58
98 atom % D
(±)-GLYCIDOL-1,1,2,3,3-D5
CAS:1246819-20-4
D-7483
MW: 79.11
98 atom % D
(±)-IBUPROFEN-D3 (α-METHYL-D3)
CAS:121662-14-4
D-6119
MW: 209.3
99 atom % D
(±)-IBUPROFEN-D3, SODIUM SALT (α-METHYL-D3)
CAS:1219805-09-0
D-6873
MW: 231.28
99 atom % D
(±)-IMAZALIL-D5 SULFATE (ALLYLOXY-D5)
CAS:1398065-92-3
D-7406
MW: 400.29
98 atom % D
(±)-IPRATROPIUM-D3 BROMIDE (N-METHYL-D3)
Formula: 97% chemical purity
D-6923
MW: 415.38
99 atom % D
(±)-KETOCONAZOLE-D4 (PIPERAZINE-3,3,5,5-D4) (CIS-ISOMERS)
D-7488
MW: 535.46
98 atom % D
(±)-KETOPROFEN-D3 (α-METHYL-D3)
CAS:159490-55-8
D-6887
MW: 257.3
98 atom % D
(±)-KETOPROFEN-D4 (PROPIONIC-D4 ACID)
CAS:1219805-29-4
D-6837
MW: 258.31
99 atom % D
(±)-LINALOOL-D3 (VINYL-D3)
CAS:1216673-02-7
D-6961
MW: 157.27
99 atom % D
(±)-MANDELIC-2,3,4,5,6-D5 ACID
CAS:70838-71-0
Formula: C6D5CH(OH)COOH
D-6354
MW: 157.18
98 atom % D
(±)-METANEPHRINE-α,β,β-D3 HCL
CAS:1085333-94-3
D-1841
MW: 236.71
98 atom % D
(±)-METANEPHRINE-D3 HCL (N-METHYL-D3)
CAS:1215507-88-2
D-6688
MW: 236.71
99 atom % D
(±)-METHOCARBAMOL-D3 (METHOXY-D3)
CAS:1346600-86-9
D-7508
MW: 244.26
99 atom % D
(±)-METOLACHLOR-D6 (PROPYL-D6)
CAS:1219803-97-0
D-5647
MW: 289.83
98 atom % D
(±)-METOPROLOL-D7 HCL (ISO-PROPYL-D7)
CAS:1219798-61-4
D-6682
MW: 310.87
99 atom % D
(±)-MEVALONOLACTONE-4,4,5,5,6,6,6-D7
CAS:347840-19-1
D-3743
MW: 137.19
98 atom % D
(±)-MEVALONOLACTONE-4,4,5,5-D4
CAS:349553-98-6
D-4130
MW: 134.17
98 atom % D
(±)-MEVALONOLACTONE-D3 (METHYL-D3)
CAS:61219-76-9
D-3050
MW: 133.16
99 atom % D
(±)-MIANSERIN-D3 HCL (METHYL-D3)
CAS:1219804-97-3
D-7162
MW: 303.85
99 atom % D
(±)-MICONAZOLE-D5 NITRATE (2,4-DICHLOROBENZYLOXY-D5)
CAS:1398065-80-9
D-7343
MW: 484.14
98 atom % D
(±)-MYCLOBUTANIL-D9 (BUTYL-D9)
D-7682
MW: 297.83
99 atom % D
(±)-N′-NITROSONORNICOTINE-2,4,5,6-D4 (PYRIDINE-D4)
CAS:66148-19-4
D-4141
MW: 181.23
98 atom % D
(±)-N-(2,6-DIMETHYLPHENYL)-1-ISO-PROPYL-D7-2-PIPERIDINECARBOXAMIDE
CAS:1276197-11-5
D-6992
MW: 281.45
99 atom % D
(±)-N-2-METHYLBUTYRYL-D9-GLYCINE
CAS:1219798-77-2
Formula: CD3CD2CD(CD3)CONHCH2COOH
D-6709
MW: 168.24
98 atom % D
(±)-N-2-METHYLBUTYRYLGLYCINE-2,2-D2
Formula: CH3CH2CH(CH3)CONHCD2COOH
D-6708
MW: 161.2
98 atom % D
(±)-NAPROXEN-D3 (α-METHYL-D3)
CAS:958293-77-1
D-6523
MW: 233.28
99 atom % D
(±)-NICOTINE-2,4,5,6-D4 (PYRIDINE-D4)
CAS:350818-69-8
D-5098
MW: 166.26
98 atom % D
(±)-NICOTINE-D3 (N-METHYL-D3)
CAS:69980-24-1
D-3519
MW: 165.25
99 atom % D
(±)-NICOTINE-D7 (N-METHYL-D3; PYRIDINE-D4)
CAS:1219805-86-3
D-6500
MW: 169.28
98 atom % D
(±)-NISOLDIPINE-D4 (2-NITROPHENYL-D4)
CAS:1219795-47-7
D-6186
MW: 392.44
99 atom % D
(±)-NOREPINEPHRINE-2,5,6,α,β,β-D6 HCL
CAS:1219803-04-9
D-6634
MW: 211.67
99 atom % D
(±)-NORFLUOXETINE-D5 HCL (PROPYL-1,1,2,2,3-D5)
CAS:1185132-92-6
D-6023
MW: 336.8
98 atom % D
(±)-NORMETANEPHRINE-α,β,β-D3 HCL
CAS:1085333-97-6
D-1640
MW: 222.68
98 atom % D
(±)-NORNICOTINE-2,4,5,6-D4 (PYRIDINE-D4)
CAS:66148-18-3
D-4174
MW: 152.23
98 atom % D
(±)-O-DESMETHYLNAPROXEN-D3 (α-METHYL-D3)
CAS:1122399-99-8
D-7674
MW: 219.25
99 atom % D
(±)-ONDANSETRON-D5 (METHYLIMIDAZOLE-D5)
CAS:1219798-86-3
D-6623
MW: 298.4
97 atom % D
(±)-OXYBUTYNIN-D11 HCL (CYCLOHEXYL-D11)
CAS:1185151-95-4
D-6104
MW: 405.02
99 atom % D
(±)-OXYPHENBUTAZONE-D9 (N-BUTYL-D9)
CAS:1189693-23-9
D-7297
MW: 333.43
99 atom % D
(±)-PENCONAZOLE-D7 (PENTYL-3,3,4,4,5,5,5-D7)
D-7681
MW: 291.23
98 atom % D
(±)-PHENOXYBENZAMINE-D5 HCL (BENZYL-2,3,4,5,6-D5)
CAS:1398065-71-8
D-7367
MW: 345.32
99 atom % D
(±)-PINDOLOL-D7 (ISO-PROPYL-D7)
CAS:1185031-19-9
D-7538
MW: 255.37
99 atom % D
(±)-PIOGLITAZONE-D4 (PHENYL-D4)
CAS:1134163-29-3
D-7378
MW: 360.46
98 atom % D
(±)-PRASUGREL-D3 (ACETATE-D3)
CAS:1127253-02-4
D-7536
MW: 376.46
99 atom % D
(±)-PROMETHAZINE-D4 HCL (PHENOTHIAZINE-1,3,7,9-D4)
CAS:1173018-74-0
D-7144
MW: 324.9
98 atom % D
(±)-PROPAFENONE-D5 HCL (PROPYL-2,2,3,3,3-D5)
CAS:1398066-02-8
D-7463
MW: 382.94
98 atom % D
(±)-PROPAFENONE-D7 HCL (PROPYL-D7)
CAS:1219799-06-0
D-7013
MW: 384.95
99 atom % D
(±)-PROPRANOLOL-D7 (RING-D7)
CAS:344298-99-3
D-2386
MW: 266.39
97 atom % D
(±)-PYRIPROXYFEN-D4 (PYRIDYL-D4)
D-7693
MW: 325.4
99 atom % D
(±)-QUIZALOFOP-ETHYL-D3 (PROPIONATE-3,3,3-D3)
CAS:1398065-84-3
D-7391
MW: 375.83
98 atom % D
(±)-RACTOPAMINE-D3 HCL (2-HYDROXYETHYL-1,1,2-D3)
CAS:1219794-72-5
D-6839
MW: 340.86
97 atom % D
(±)-RACTOPAMINE-D6 HCL (1-METHYL-D3;PROPYL-1,2,2-D3)
CAS:1276197-17-1
D-7295
MW: 343.88
99 atom % D
(±)-RANOLAZINE-D8 2HCL (PIPERAZINE-D8)
CAS:1219802-60-4
D-7014
MW: 508.51
98 atom % D
(±)-ROPIVACAINE-D7 (PROPYL-D7)
CAS:1392208-04-6
D-6934
MW: 281.45
98 atom % D
(±)-SALMETEROL-D3 (3-HYDROXYMETHYL-D2; α-D1)
CAS:497063-94-2
D-6187
MW: 418.59
98 atom % D
(±)-SOTALOL-D7 HCL (ISO-PROPYL-D7)
CAS:1398065-65-0
D-7411
MW: 315.87
99 atom % D
(±)-TARTARIC-2,3-D2 ACID
CAS:91469-46-4
Formula: HOOCCD(OH)CD(OH)COOH
D-5343
MW: 152.1
98 atom % D
(±)-TEBUCONAZOLE-D4 (4-CHLOROPHENYL-D4)
D-7563
MW: 311.85
98 atom % D
(±)-TERCONAZOLE-D4 (PIPERAZINE-2,2,6,6-D4) (CIS-ISOMERS)
D-7517
MW: 536.49
98 atom % D
(±)-TETRAHYDRO-2-FUROIC-D7 ACID
CAS:1219798-42-1
D-6662
MW: 123.16
98 atom % D
(±)-THALIDOMIDE-D4 (PHENYL-D4)
CAS:1219177-18-0
D-6840
MW: 262.26
98 atom % D
(±)-THIORIDAZINE-D3 HCL (N-METHYL-D3)
CAS:1189928-36-6
D-7643
MW: 410.05
98 atom % D
(±)-TOLTERODINE-D14 TARTRATE [N,N-DI(ISO-PROPYL-D7)]
D-7006
MW: 489.67
98 atom % D
(±)-TRAMADOL-D6 HCL (N,N-DIMETHYL-D6) (CIS/TRANS MIXTURE)
CAS:1189374-50-2
D-6990
MW: 305.88
99 atom % D
(±)-TRANYLCYPROMINE-D5 HCL (PHENYL-D5)
CAS:107077-98-5
D-6824
MW: 174.68
98 atom % D
(±)-TRIADIMEFON-D4 (4-CHLOROPHENYL-D4)
D-7683
MW: 297.78
98 atom % D
(±)-TRIMIPRAMINE-D3 MALEATE (N-METHYL-D3)
CAS:1185245-93-5
D-6762
MW: 413.53
99 atom % D
(±)-VELNACRINE-1,2,2-D3 MALEATE
CAS:1219806-48-0
D-7200
MW: 333.36
99 atom % D (also 12%-4,4-d2)
(±)-VENLAFAXINE-D6 HCL (N,N-DIMETHYL-D6)
CAS:1062606-12-5
D-6826
MW: 319.9
99 atom % D
(±)-VERAPAMIL-D3 HCL (N-METHYL-D3)
D-7546
MW: 494.09
99 atom % D
(±)-WARFARIN-D5 (PHENYL-D5)
CAS:75472-93-4
D-7080
MW: 313.36
99 atom % D
(+)-CIS-DILTIAZEM-D3 HCL (ACETOXY-D3)
CAS:1217860-13-3
D-7375
MW: 454
99 atom % D
(-)-2-METHYL-D3-ISOBORNEOL
CAS:135441-89-3
D-6241
MW: 171.3
99 atom % D
(-)-NORELGESTROMIN-2,2,4,6,6,10-D6
CAS:1263184-13-9
D-6942
MW: 333.5
99 atom % D
(-)-NORGESTREL-2,2,4,6,6,10-D6
D-6159
MW: 318.49
98 atom % D
(E)-MYCOPHENOLATE MOFETIL-D4 (MORPHOLINYLETHYL-D4)
CAS:1132748-21-0
D-7150
MW: 437.52
99 atom % D
(E,Z)-METHOMYL-D3 (N-METHYL-D3)
CAS:1398109-07-3
D-7454
MW: 165.22
99 atom % D
(R)-(-)-3-QUINUCLIDINOL-2,2,3,6,6,7,7-D7
D-7569
MW: 134.23
98 atom % D
(R)-(-)-ATOMOXETINE-D5 HCL (PHENYL-D5)
D-7502
MW: 296.85
98 atom % D
(R)-(-)-METALAXYL-D6 (2,6-DIMETHYL-D6)
CAS:1398112-32-7
D-7345
MW: 285.37
99 atom % D
(R)-(-)-PHENYLEPHRINE-2,4,6-D3 HCL
CAS:1276197-50-2
D-6658
MW: 206.69
97 atom % D
(R)-3-AMINO(PIPERIDINE-3-D1)-2,6-DIONE HCL
D-7495
MW: 165.6
96 atom % D
(RS)-MALIC-2,3,3-D3 ACID
CAS:104596-63-6
Formula: HOOCCD2CD(OH)COOH
D-2122
MW: 137.11
98 atom % D
(S)-(+)-2-AMINO-1-PROPANOL-3,3,3-D3
CAS:352438-84-7
Formula: CD3CH(NH2)CH2OH
D-5164
MW: 78.13
99 atom % D
(S)-(+)-PREGABALIN-D4 (AMINOMETHYL-D2; HEXANOIC-2,2-D2 ACID)
CAS:1276197-54-6
D-6921
MW: 163.25
98 atom % D
(S)-(+)-REPAGLINIDE-D5 (ETHOXY-D5)
CAS:1217709-85-7
D-7124
MW: 457.62
99 atom % D
(S)-(-)-CARBIDOPA-D3 H2O (RING-D3)
Formula: (HO)2C6D3CH2C(CH3)(NHNH2)COOH
D-6406
MW: 247.27
98 atom % D
(S)-(-)-MALIC-2,3,3-D3 ACID
CAS:59652-74-3
Formula: HOOCCD2CD(OH)COOH
D-6626
MW: 137.11
98 atom % D
(S)-(-)-OFLOXACIN-D3 (N-METHYL-D3)
D-7516
MW: 364.39
99 atom % D
(S)-(-)-VALSARTAN-D8 (VALINE-D8)
CAS:1089736-72-0
D-6842
MW: 443.57
98 atom % D
(S)-(-)-VERAPAMIL-D3 HCL (N-METHYL-D3)
CAS:1398112-33-8
D-7403
MW: 494.09
99 atom % D
(S)-3-AMINO(PIPERIDINE-3-D1)-2,6-DIONE HCL
CAS:1398112-31-6
D-7459
MW: 165.6
94 atom % D
(S)-PRAMIPEXOLE-D7 2HCL (N-PROPYL-D7)
D-7499
MW: 291.29
99 atom % D
(1S,3′R)-SOLIFENACIN-D7 HCL (2′,2′,3′,6′,6′,7′,7′-D7)
D-7570
MW: 405.97
98 atom % D
(2,4,5-TRICHLOROPHENOXY-D2)ACETIC-2,2-D2 ACID
CAS:358731-37-0
D-5553
MW: 259.51
99 atom % D
(2,4-DICHLOROPHENOXY-D3)ACETIC ACID
CAS:202480-67-9
D-5750
MW: 224.06
98 atom % D
(2,4-DICHLOROPHENOXY-D3)ACETIC-2,2-D2 ACID
CAS:352438-69-8
D-5121
MW: 226.07
98 atom % D
(2,6-DICHLOROPHENYL)ACETIC-2,2-D2 ACID
CAS:1219803-63-0
D-7141
MW: 207.05
98 atom % D
(2-BROMOETHYL)BENZENE-D5
CAS:35845-64-8
Formula: C6D5CH2CH2Br
D-4317
MW: 190.09
99 atom % D
(2-CHLOROPHENYL)DIPHENYL-D5-METHANOL
CAS:1219802-30-8
D-6582
MW: 299.81
99 atom % D
(2-ETHOXY-D5-PHENOXY)ACETIC ACID
D-7542
MW: 201.23
99 atom % D
(2R)-LACOSAMIDE-D3 (O-METHYL-D3)
CAS:1217689-95-6
D-7271
MW: 253.32
99 atom % D
(2S,2′S)-ETHAMBUTOL-D10 (1,1,1′,1′,2,2′-D6; ETHYLENE-D4)
CAS:1129526-24-4
D-7356
MW: 214.37
99 atom % D
(2S,2′S)-ETHAMBUTOL-D4 (ETHYLENE-D4)
CAS:1129526-19-7
D-7365
MW: 208.34
99 atom % D
(25RS)-26-HYDROXYCHOLESTEROL-24,24,26,26-D4
D-6879
MW: 406.68
98 atom % D
(3,4,5-TRIMETHOXYPHENYL)ACETIC-2,2-D2 ACID
CAS:344299-45-2
Formula: (CH3O)3C6H2CD2COOH
D-2144
MW: 228.24
97 atom % D
(3,4-DIHYDROXYPHENYL-D3)ACETIC-2,2-D2 ACID
CAS:60696-39-1
D-1642
MW: 173.18
98 atom % D
(3,4-DIMETHOXYPHENYL)ACETIC-2,2-D2 ACID
CAS:19031-58-4
Formula: (CH3O)2C6H3CD2COOH
D-1941
MW: 198.21
98 atom % D
(4-N-NONYLPHENOXY)ACETIC-2,2-D2 ACID
CAS:1219798-75-0
Formula: CH3(CH2)8C6H4OCD2COOH
D-6492
MW: 280.4
98 atom % D
(4-CARBOXYBUTYL-2,2,3,3-D4)TRIPHENYLPHOSPHONIUM BROMIDE
CAS:42932-63-8
Formula: HOOCCH2(CD2)2CH2P(C6H5)3D-2192
MW: 447.34
98 atom % D
(4-CHLORO-2-METHYLPHENOXY-D3)ACETIC ACID
CAS:352431-14-2
D-5320
MW: 203.64
98 atom % D
(4-FLUOROPHENYL)ACETIC-2,2-D2 ACID
CAS:113715-48-3
Formula: FC6H4CD2COOH
D-7230
MW: 156.15
98 atom % D (also 10% 3,5-d2)
(4-HYDROXY-3-METHOXYPHENYL)ACETIC-2,2-D2 ACID
CAS:53587-33-0
Formula: HO(CH3O)C6H3CD2COOH
D-1543
MW: 184.19
98 atom % D
(4-HYDROXY-3-METHOXYPHENYL-D3)ACETIC-2,2-D2 ACID
CAS:53587-32-9
Formula: HO(CH3O)C6D3CD2COOH
D-7304
MW: 187.21
99 atom % D
(5-CARBOXYPENTYL-2,2,3,3,4,4-D6)TRIPHENYLPHOSPHONIUM BROMIDE
Formula: HOOCCH2(CD23CH2P(C6H5)3Br
D-7311
MW: 463.38
99 atom % D
(6R,12AR)-TADALAFIL-D3 (N-METHYL-D3)
CAS:960226-55-5
D-7476
MW: 392.43
99 atom % D
(BROMOMETHYL)CYCLOHEXANE-D11
CAS:1219794-79-2
Formula: C6D11CH2Br
D-5903
MW: 188.15
98 atom % D
(BROMOMETHYL)CYCLOPROPANE-2,2,3,3-D4
CAS:1219805-93-2
D-7222
MW: 139.03
99 atom % D
(BROMOMETHYL-D2)CYCLOPROPANE-1-D1
CAS:1219799-17-3
Formula: C3H4DCD2Br
D-5982
MW: 138.02
98 atom % D
CIS-ETHYLENE-1,2-D2 (GAS)
CAS:2813-62-9
Formula: CHD=CHD
D-274
MW: 30.07
98 atom % D
D-2-AMINOBUTYRIC-D6 ACID
CAS:1276197-57-9
Formula: CD3CD2CD(NH2)COOH
D-7012
MW: 109.16
98 atom % D
D-4-HYDROXYPHENYL-D4-ALANINE
CAS:944386-47-4
Formula: HOC6D4CH2CH(NH2)COOH
D-7498
MW: 185.22
99 atom % D
D-4-HYDROXYPHENYL-D4-ALANINE-2,3,3-D3
Formula: HOC6D4CD2CD(NH2)COOH
D-6857
MW: 188.23
98 atom % D
D-4-HYDROXYPHENYLALANINE-3,3-D2
CAS:1202064-22-9
Formula: HOC6H4CD2CH(NH2)COOH
D-7487
MW: 183.2
99 atom % D
D-ALANINE-2,3,3,3-D4
CAS:1202063-27-1
Formula: CD3CD(NH2)COOH
D-6346
MW: 93.12
98 atom % D
D-ALANINE-2,3,3,3-D4-N-T-BOC
Formula: CD3CD(NH-t-BOC)COOH
D-6666
MW: 193.23
98 atom % D
D-ALANINE-2,3,3,3-D4-N-FMOC
Formula: CD3CD(NH-FMOC)COOH
D-6667
MW: 315.36
98 atom % D
D-ALANINE-2-D1
CAS:56595-54-1
Formula: CH3CD(NH2)COOH
D-1274
MW: 90.1
97 atom % D
D-ALANINE-3,3,3-D3
CAS:177614-69-6
Formula: CD3CH(NH2)COOH
D-2560
MW: 92.11
99 atom % D
D-ALANINE-3,3,3-D3-N-T-BOC
CAS:177614-70-9
Formula: CD3CH(NH-t-BOC)COOH
D-5898
MW: 192.23
99 atom % D
D-ALANINE-3,3,3-D3-N-FMOC
Formula: CD3CH(NH-FMOC)COOH
D-6665
MW: 314.35
99 atom % D
D-ALANINE-D7
Formula: CD3CD(ND2)COOD
D-6347
MW: 96.14
98 atom % D
D-GLUCOSE-6,6-D2
CAS:18991-62-3
D-900
MW: 182.17
98 atom % D
D-GLUTAMIC-2,3,3,4,4-D5 ACID
CAS:14341-88-9
Formula: HOOCCD2CD2CD(NH2)COOH
D-6392
MW: 152.16
98 atom % D
D-LEUCINE-D10
CAS:271247-12-2
Formula: (CD3)2CDCD2CD(NH2)COOH
D-5607
MW: 141.24
98 atom % D
D-LYSINE-3,3,4,4,5,5,6,6-D8 2HCL
Formula: H2N(CD2)4CH(NH2)COOH•2HCl
D-6367
MW: 227.16
99 atom % D
D-LYSINE-4,4,5,5-D4 2HCL
Formula: H2NCH2(CD2)2CH2CH(NH2)COOH•2H
D-6689
MW: 223.14
98 atom % D
D-LYSINE-4,4,5,5-D4 HCL
Formula: H2BCH2(CD2)2CH2CH(NH2)COOH•HC
D-7334
MW: 186.67
98 atom % D
D-MANNITOL-1,1,2,3,4,5,6,6-D8
Formula: HOCD2CD(OH)CD(OH)CD(OH)CD(OH)CD2OH
D-7250
MW: 190.22
99 atom % D
D-METHIONINE-D3 (S-METHYL-D3)
CAS:284665-18-5
Formula: CD3SCH2CH2CH(NH2)COOH
D-2230
MW: 152.23
98 atom % D
D-METHIONINE-D3-N-FMOC (S-METHYL-D3)
Formula: CD3SCH2CH2CH(NH-FMOC)COOH
D-6624
MW: 374.47
98 atom % D
D-PHENYL-D5-ALANINE
CAS:362049-55-6
Formula: C6D5CH2CH(NH2)COOH
D-5466
MW: 170.22
99 atom % D
D-PHENYL-D5-ALANINE-2,3,3-D3
CAS:1202064-02-5
Formula: C6D5CD2CD(NH2)COOH
D-6584
MW: 173.24
98 atom % D
D-PHENYL-D5-ALANINE-N-T-BOC
CAS:1213661-19-8
Formula: C6D5CH2CH(NH-t-BOC)COOH
D-6332
MW: 270.34
99 atom % D
D-PHENYL-D5-ALANINE-N-FMOC
Formula: C6D5CH2CH(NH-FMOC)COOH
D-7677
MW: 392.46
99 atom % D
D-PROLINE-2,5,5-D3
D-7120
MW: 118.15
98 atom % D
D-PROLINE-2,5,5-D3-N-FMOC
D-7177
MW: 340.39
98 atom % D
D-TRYPTOPHAN-2′,4′,5′,6′,7′-D5 (INDOLE-D5)
CAS:1202359-57-6
D-7416
MW: 209.26
98 atom % D
D-VALINE-D8
CAS:116448-82-8
Formula: (CD3)2CDCD(NH2)COOH
D-5894
MW: 125.2
98 atom % D
DL-α-PHENYL-D5-GLYCINE
CAS:358731-96-1
Formula: C6D5CH(NH2)COOH
D-5570
MW: 156.2
98 atom % D
DL-(2-AMINO-2-CARBOXYETHYL)HOMOCYSTEINE-3,3,4,4-D4
CAS:146764-57-0
Formula: HOOCCH(NH2)CH2SCD2CD2CH(NH2)COOH
D-3349
MW: 226.28
98 atom % D
DL-2-AMINO-1,6-HEXANEDIOIC-2,5,5-D3 ACID
Formula: HOOCCD2CH2CH2CD(NH2)COOH
D-6024
MW: 164.18
98 atom % D
DL-2-AMINOBUTYRIC-D6 ACID
CAS:350820-17-6
Formula: CD3CD2CD(NH2)COOH
D-5010
MW: 109.16
98 atom % D
DL-2-PIPERIDINE-D9-CARBOXYLIC ACID
CAS:790612-94-1
D-5087
MW: 138.21
98 atom % D
DL-2-PYRROLIDINONE-3,3,4,4,5-D5-5-CARBOXYLIC ACID
CAS:352431-30-2
D-5351
MW: 134.15
98 atom % D
DL-4-HYDROXYPHENYL-2,6-D2-ALANINE-2-D1
CAS:73036-42-7
Formula: HOC6H2D2CH2CD(NH2)COOH
D-1612
MW: 184.21
98 atom % D
DL-4-HYDROXYPHENYL-D4-ALANINE-2,3,3-D3
CAS:402835-78-3
Formula: HOC6D4CD2CD(NH2)COOH
D-1690
MW: 188.23
98 atom % D
DL-4-HYDROXYPHENYLALANINE-3,3-D2
CAS:35693-18-6
Formula: HOC6H4CD2CH(NH2)COOH
D-1611
MW: 183.2
98 atom % D
DL-ALANINE-2,3,3,3-D4
CAS:53795-92-9
Formula: CD3CD(NH2)COOH
D-92
MW: 93.12
98 atom % D
DL-ALANINE-2-D1
CAS:31024-91-6
Formula: CH3CD(NH2)COOH
D-1457
MW: 90.1
98 atom % D
DL-ALANINE-2-D1-N-FMOC
Formula: CH3CD(NH-FMOC)COOH
D-7248
MW: 312.34
98 atom % D
DL-ALANINE-3,3,3-D3
CAS:53795-94-1
Formula: CD3CH(NH2)COOH
D-1462
MW: 92.11
99 atom % D
DL-ASPARTIC-2,3,3-D3 ACID
CAS:14341-75-4
Formula: HOOCCD2CD(NH2)COOH
D-1953
MW: 136.12
98 atom % D
DL-CARNITINE-D9 HCL (TRIMETHYL-D9)
CAS:1219386-75-0
Formula: HOOCCH2CH(OH)CH2N(CD3)3Cl
D-5780
MW: 206.72
99 atom % D
DL-CYSTINE-2,2′,3,3,3′,3′-D6
CAS:352431-53-9
Formula: [SCD2CD(NH2)COOH]2
D-5301
MW: 246.33
98 atom % D
DL-GLUTAMIC-2,3,3,4,4-D5 ACID
CAS:14341-79-8
Formula: HOOCCD2CD2CD(NH2)COOH
D-2193
MW: 152.16
98 atom % D
DL-GLUTAMIC-2,4,4-D3 ACID
CAS:96927-56-9
Formula: HOOCCD2CH2CD(NH2)COOH
D-1196
MW: 150.15
98 atom % D
DL-HISTIDINE-α,β,β-D3
CAS:344299-50-9
D-2272
MW: 158.17
98 atom % D
DL-HOMOCYSTEIC-3,3,4,4-D4 ACID H2O
Formula: HO3SCD2CD2CH(NH2)COOH•H2O
D-5646
MW: 205.22
98 atom % D
DL-HOMOCYSTEINE THIOLACTONE-3,3,4,4-D4 HCL
CAS:1219805-31-8
D-6150
MW: 157.65
98 atom % D
DL-HOMOCYSTEINE-3,3,4,4-D4
CAS:416845-90-4
Formula: HSCD2CD2CH(NH2)COOH
D-6452
MW: 139.21
98 atom % D
DL-HOMOCYSTINE-3,3,3′,3′,4,4,4′,4′-D8
CAS:108641-82-3
Formula: [HOOCCH(NH2)CD2CD2S]2
D-3030
MW: 276.39
98 atom % D
DL-LEUCINE-D10
CAS:29909-01-1
Formula: (CD3)2CDCD2CD(NH2)COOH
D-1101
MW: 141.24
98 atom % D
DL-LEUCINE-D10-N-FMOC
Formula: (CD3)2CDCD2CD(NH-FMOC)COOH
D-5753
MW: 363.48
98 atom % D
DL-LEUCINE-D7 (ISO-PROPYL-D7)
CAS:259225-40-6
Formula: (CD3)2CDCH2CH(NH2)COOH
D-1974
MW: 138.22
98 atom % D
DL-LYSINE-2,3,3,4,4,5,5,6,6-D9 2HCL
Formula: H2N(CD2)4CD(NH2)COOH•2HCl
D-6369
MW: 228.17
99 atom % D
DL-LYSINE-3,3,4,4,5,5,6,6-D8 2HCL
CAS:284664-87-5
Formula: H2N(CD2)4CH(NH2)COOH•2HCl
D-2715
MW: 227.16
98 atom % D
DL-LYSINE-4,4,5,5-D4 2HCL
CAS:284664-88-6
Formula: H2NCH2(CD2)2CH2CH(NH2)COOH•2H
D-2714
MW: 223.13
98 atom % D
DL-METHIONINE-2-D1
CAS:67866-74-4
Formula: CH3SCH2CH2CD(NH2)COOH
D-1111
MW: 150.21
98 atom % D
DL-METHIONINE-3,3,4,4-D4
CAS:93709-61-6
Formula: CH3SCD2CD2CH(NH2)COOH
D-3262
MW: 153.23
98 atom % D
DL-METHIONINE-D3 (S-METHYL-D3)
CAS:284665-20-9
Formula: CD3SCH2CH2CH(NH2)COOH
D-1506
MW: 152.23
98 atom % D
DL-PHENYL-D5-ALANINE
CAS:284664-89-7
Formula: C6D5CH2CH(NH2)COOH
D-1597
MW: 170.22
98 atom % D
DL-PHENYL-D5-ALANINE-2,3,3-D3
CAS:29909-00-0
Formula: C6D5CD2CD(NH2)COOH
D-1625
MW: 173.24
98 atom % D
DL-PHENYL-D5-ALANINE-3,3-D2
CAS:74228-83-4
Formula: C6D5CD2CH(NH2)COOH
D-1626
MW: 172.23
98 atom % D
DL-PHENYLALANINE-2-D1
CAS:14246-24-3
Formula: C6H5CH2CD(NH2)COOH
D-2003
MW: 166.2
98 atom % D
DL-PROLINE-2-D1
CAS:282729-06-0
D-1425
MW: 116.14
98 atom % D
DL-S-BENZYL-D5-MERCAPTURIC ACID (PHENYL-D5)
Formula: C6D5CH2SCH2CH(NHCOCH3)COOH
D-7183
MW: 258.35
99 atom % D
DL-S-PHENYL-D5-MERCAPTURIC ACID
Formula: C6D5SCH2CH(NHCOCH3)COOH
D-7182
MW: 244.32
98 atom % D
DL-S-PHENYLMERCAPTURIC-3,3-D2 ACID
Formula: C6H5SCD2CH(NHCOCH3)COOH
D-6046
MW: 241.3
99 atom % D
DL-SERINE-2,3,3-D3
CAS:70094-78-9
Formula: HOCD2CD(NH2)COOH
D-1583
MW: 108.11
98 atom % D
DL-TRYPTOPHAN-2,3,3-D3
CAS:340257-61-6
D-1551
MW: 207.25
98 atom % D
DL-TRYPTOPHAN-D8
CAS:1233395-85-1
Formula: C8D5NHCD2CD(NH2)COOH
D-1648
MW: 212.28
98 atom % D
DL-VALINE-2,3-D2
CAS:83181-79-7
Formula: (CH3)2CDCD(NH2)COOH
D-2920
MW: 119.16
98 atom % D
DL-VALINE-2-D1
CAS:14246-21-0
Formula: (CH3)2CHCD(NH2)COOH
D-2011
MW: 118.15
98 atom % D
DL-VALINE-3-D1
CAS:79168-24-4
Formula: (CH3)2CDCH(NH2)COOH
D-2976
MW: 118.15
98 atom % D
DL-VALINE-D8
CAS:203784-63-8
Formula: (CD3)2CDCD(NH2)COOH
D-1698
MW: 125.2
98 atom % D
ISO-BUTYL 4-HYDROXYBENZOATE-2,3,5,6-D4
CAS:1219805-33-0
Formula: HOC6D4COOCH2CH(CH3)2
D-7236
MW: 198.25
98 atom % D
ISO-PROPYL 4-HYDROXYBENZOATE-2,3,5,6-D4
CAS:1219798-72-7
Formula: HOC6D4COOCH(CH3)2
D-7239
MW: 184.23
98 atom % D
ISO-PROPYL ACETATE-D10
CAS:1398065-53-6
Formula: CD3COOCD(CD3)2
D-7474
MW: 112.19
99 atom % D
ISO-PROPYL ALCOHOL-D8
CAS:22739-76-0
Formula: (CD3)2CDOD
D-736
MW: 68.14
99 atom % D
ISO-PROPYL ALCOHOL-OD
CAS:3979-51-9
Formula: (CH3)2CHOD
D-255
MW: 61.1
98 atom % D
ISO-PROPYL-1,1,1,3,3,3-D6 ALCOHOL
CAS:3976-29-2
Formula: (CD3)2CHOH
D-309
MW: 66.13
99 atom % D
ISO-PROPYL-1,1,1,3,3,3-D6-AMINE
CAS:55432-59-2
Formula: (CD3)2CHNH2
D-5683
MW: 65.15
99 atom % D
ISO-PROPYL-1,1,1,3,3,3-D6-AMINE HCL
CAS:126794-59-0
Formula: (CD3)2CHNH2•HCl
D-5686
MW: 101.61
99 atom % D
ISO-PROPYL-2-D1 ALCOHOL
CAS:3972-26-7
Formula: (CH3)2CDOH
D-224
MW: 61.1
98 atom % D
ISO-PROPYL-D7 ALCOHOL
CAS:19214-96-1
Formula: (CD3)2CDOH
D-919
MW: 67.14
99 atom % D
ISO-PROPYL-D7-AMINE
CAS:106658-10-0
Formula: (CD3)2CDNH2
D-1380
MW: 66.15
99 atom % D
ISO-PROPYL-D7-AMINE HCL
CAS:106658-09-7
Formula: (CD3)2CDNH2•HCl
D-5193
MW: 102.61
99 atom % D
ISO-PROPYLAMINE-D9
CAS:1219794-73-6
Formula: (CD3)2CDND2
D-6927
MW: 68.17
98 atom % D
ISO-PROPYLAMINE-D9 DCL
CAS:1219798-50-1
Formula: (CD3)2CDND2•DCl
D-5743
MW: 105.63
98 atom % D
L-2-AMINOBUTYRIC-3,3-D2 ACID
CAS:352431-37-9
Formula: CH3CD2CH(NH2)COOH
D-5244
MW: 105.13
98 atom % D
L-2-AMINOBUTYRIC-D6 ACID
CAS:1276197-51-3
Formula: CD3CD2CD(NH2)COOH
D-6945
MW: 109.16
98 atom % D
L-2-AMINOPENTANOIC-4,4,5,5,5-D5 ACID
CAS:1202936-50-2
Formula: CD3CD2CH2CH(NH2)COOH
D-6568
MW: 122.18
98 atom % D
L-2-PYRROLIDINONE-3,3,4,4,5-D5-5-CARBOXYLIC ACID
CAS:1086136-22-2
D-3715
MW: 134.15
98 atom % D
L-3-(4-HYDROXY-3-METHOXY-D3-PHENYL)ALANINE
CAS:586954-09-8
D-6782
MW: 214.24
99 atom % D
L-4-HYDROXYPHENYL-2,6-D2-ALANINE
CAS:57746-15-3
Formula: HOC6H2D2CH2CH(NH2)COOH
D-2435
MW: 183.2
97 atom % D
L-4-HYDROXYPHENYL-2,6-D2-ALANINE-2-D1
CAS:71939-39-4
Formula: HOC6H2D2CH2CD(NH2)COOH
D-1840
MW: 184.2
98 atom % D
L-4-HYDROXYPHENYL-3,5-D2-ALANINE
CAS:30811-19-9
Formula: HOC6H2D2CH2CH(NH2)COOH
D-1677
MW: 183.2
98 atom % D
L-4-HYDROXYPHENYL-D4-ALANINE
CAS:62595-14-6
Formula: HOC6D4CH2CH(NH2)COOH
D-2599
MW: 185.22
98 atom % D
L-4-HYDROXYPHENYL-D4-ALANINE-2,3,3-D3
CAS:130551-49-4
Formula: HOC6D4CD2CD(NH2)COOH
D-1242
MW: 188.23
98 atom % D
L-4-HYDROXYPHENYL-D4-ALANINE-2-D1
CAS:1226919-57-8
Formula: HOC6D4CH2CD(NH2)COOH
D-7293
MW: 186.22
98 atom % D
L-4-HYDROXYPHENYLALANINE-3,3-D2
CAS:72963-27-0
Formula: HOC6H4CD2CH(NH2)COOH
D-5045
MW: 183.2
99 atom % D
L-ALANINE-2,3,3,3-D4
CAS:18806-29-6
Formula: CD3CD(NH2)COOH
D-1488
MW: 93.12
98 atom % D
L-ALANINE-2,3,3,3-D4-N-T-BOC
CAS:714964-61-1
Formula: CD3CD(NH-t-BOC)COOH
D-5722
MW: 193.24
98 atom % D
L-ALANINE-2,3,3,3-D4-N-FMOC
CAS:225101-69-9
Formula: CD3CD(NH-FMOC)COOH
D-5723
MW: 315.36
98 atom % D
L-ALANINE-2-D1
CAS:21386-65-2
Formula: CH3CD(NH2)COOH
D-902
MW: 90.1
98 atom % D
L-ALANINE-2-D1-N-T-BOC
CAS:88181-11-7
Formula: CH3CD(NH-t-BOC)COOH
D-3978
MW: 190.22
98 atom % D
L-ALANINE-2-D1-N-FMOC
CAS:225101-64-4
Formula: CH3CD(NH-FMOC)COOH
D-6127
MW: 312.34
98 atom % D
L-ALANINE-3,3,3-D3
CAS:63546-27-0
Formula: CD3CH(NH2)COOH
D-1297
MW: 92.11
99 atom % D
L-ALANINE-3,3,3-D3-N-T-BOC
CAS:161602-47-7
Formula: CD3CH(NH-t-BOC)COOH
D-3872
MW: 192.23
99 atom % D
L-ALANINE-3,3,3-D3-N-FMOC
CAS:284665-07-2
Formula: CD3CH(NH-FMOC)COOH
D-5721
MW: 314.35
99 atom % D
L-ALANINE-D7
CAS:74280-71-0
Formula: CD3CD(ND2)COOD
D-3709
MW: 96.14
98 atom % D
L-ALANINE-N,N,O-D3
CAS:19470-97-4
Formula: CH3CH(ND2)COOD
D-6192
MW: 92.11
99 atom % D
L-ASPARTIC-2,3,3-D3 ACID
CAS:3842-25-9
Formula: HOOCCD2CD(NH2)COOH
D-898
MW: 136.12
98 atom % D
L-CARNITINE-D3 HCL (N-METHYL-D3)
CAS:350818-62-1
Formula: HOOCCH2CH(OH)CH2N(CH3)2(CD3)Cl
D-5069
MW: 200.68
99 atom % D
L-CITRULLINE-2,3,3,4,4,5,5-D7
Formula: H2NCONH(CD2)3CD(NH2)COOH
D-7306
MW: 182.23
98 atom % D
L-DOPA-2,5,6-D3
CAS:53587-29-4
Formula: (HO)2C6D3CH2CH(NH2)COOH
D-1570
MW: 200.21
98 atom % D
L-GLUTAMIC-2,3,3,4,4-D5 ACID
CAS:2784-50-1
Formula: HOOCCD2CD2CD(NH2)COOH
D-899
MW: 152.16
98 atom % D
L-GLUTAMINE-2,3,3,4,4-D5
CAS:14341-78-7
Formula: H2NCOCD2CD2CD(NH2)COOH
D-2532
MW: 151.18
98 atom % D
L-HISTIDINE-D3 (α-D1; IMIDAZOLE-2,5-D2) HCL H2O
D-6679
MW: 212.65
98 atom % D (also 18% deuterated on β,β-d2 positions)
L-HOMOCYSTINE-3,3,3′,3′,4,4,4′,4′-D8
CAS:182755-41-5
Formula: [HOOCCH(NH2)CD2CD2S]2
D-7279
MW: 276.39
98 atom % D
L-ISOLEUCINE-2-D1
CAS:127290-60-2
Formula: CH3CH2CH(CH3)CD(NH2)COOH
D-6353
MW: 132.18
98 atom % D
L-LEUCINE-2-D1
CAS:89836-93-1
Formula: (CH3)2CHCH2CD(NH2)COOH
D-5937
MW: 132.18
98 atom % D
L-LEUCINE-3,3-D2
CAS:362049-59-0
Formula: (CH3)2CHCD2CH(NH2)COOH
D-5482
MW: 133.19
98 atom % D
L-LEUCINE-D10
CAS:106972-44-5
Formula: (CD3)2CDCD2CD(NH2)COOH
D-1078
MW: 141.24
98 atom % D
L-LEUCINE-D10-N-T-BOC H2O
Formula: (CD3)2CDCD2CD(NH-t-BOC)COOH•H2O
D-3989
MW: 259.36
98 atom % D
L-LEUCINE-D10-N-FMOC
CAS:1190594-22-9
Formula: (CD3)2CDCD2CD(NH-FMOC)COOH
D-5492
MW: 363.48
98 atom % D
L-LEUCINE-D3 (METHYL-D3)
CAS:87828-86-2
Formula: CH3CH(CD3)CH2CH(NH2)COOH
D-1973
MW: 134.19
99 atom % D
L-LEUCINE-D3-N-T-BOC H2O (METHYL-D3)
CAS:203645-42-5
Formula: CH3CH(CD3)CH2CH(NH-t-BOC)COOH•H2O
D-3981
MW: 252.32
99 atom % D
L-LEUCINE-D3-N-FMOC (METHYL-D3)
CAS:538372-74-6
Formula: CH3CH(CD3)CH2CH(NH-FMOC)COOH
D-5733
MW: 356.44
99 atom % D
L-LEUCINE-D7 (ISO-PROPYL-D7)
CAS:92751-17-2
Formula: (CD3)2CDCH2CH(NH2)COOH
D-2661
MW: 138.22
98 atom % D
L-LEUCINE-D7-N-T-BOC H2O (ISO-PROPYL-D7)
Formula: (CD3)2CDCH2CH(NH-t-BOC)COOH•H2O
D-6529
MW: 256.35
98 atom % D
L-LYSINE-2,3,3,4,4,5,5,6,6-D9 HCL
Formula: H2N(CD2)4CD(NH2)COOH•HCl
D-3836
MW: 191.71
99 atom % D
L-LYSINE-2,6,6-D3 HCL
Formula: H2NCD2(CH2)3CD(NH2)COOH•HCl
D-6275
MW: 185.67
98 atom % D
L-LYSINE-3,3,4,4,5,5,6,6-D8 HCL
CAS:344298-93-7
Formula: H2N(CD2)4CH(NH2)COOH•HCl
D-2555
MW: 190.7
99 atom % D
L-LYSINE-4,4,5,5-D4 HCL
CAS:284664-96-6
Formula: H2NCH2(CD2)2CH2CH(NH2)COOH•HC
D-2554
MW: 186.67
98 atom % D
L-LYSINE-4,4,5,5-D4-BIS-N-T-BOC
Formula: t-BOC-NHCH2(CD2)2CH2CH(NH-t-BOC)COOH
D-6796
MW: 350.45
98 atom % D
L-METHIONINE-3,3,4,4-D4
CAS:67866-75-5
Formula: CH3SCD2CD2CH(NH2)COOH
D-7086
MW: 153.23
98 atom % D
L-METHIONINE-D3 (S-METHYL-D3)
CAS:13010-53-2
Formula: CD3SCH2CH2CH(NH2)COOH
D-1292
MW: 152.23
98 atom % D
L-METHIONINE-D3 (S-METHYL-D3) METHYL-D3-SULFONIUM CHLORIDE
CAS:362049-54-5
Formula: (CD3)2SCH2CH2CH(NH2)COOH•Cl
D-5464
MW: 205.73
98 atom % D
L-METHIONINE-D3-N-FMOC (S-METHYL-D3)
CAS:502692-58-2
Formula: CD3SCH2CH2CH(NH-FMOC)COOH
D-6625
MW: 374.47
98 atom % D
L-ORNITHINE-2,3,3,4,4,5,5-D7 HCL
CAS:347841-40-1
Formula: H2N(CD2)3CD(NH2)COOH•HCl
D-7319
MW: 175.67
98 atom % D
L-PHENYL-D5-ALANINE
CAS:56253-90-8
Formula: C6D5CH2CH(NH2)COOH
D-1589
MW: 170.22
98 atom % D
L-PHENYL-D5-ALANINE-2,3,3-D3
CAS:17942-32-4
Formula: C6D5CD2CD(NH2)COOH
D-1241
MW: 173.24
98 atom % D
L-PHENYL-D5-ALANINE-2,3,3-D3-N-T-BOC
CAS:106881-07-6
Formula: C6D5CD2CD(NH-t-BOC)COOH
D-6333
MW: 273.36
98 atom % D
L-PHENYL-D5-ALANINE-2,3,3-D3-N-FMOC
CAS:1353853-39-0
Formula: C6D5CD2CD(NH-FMOC)COOH
D-6569
MW: 395.48
98 atom % D
L-PHENYL-D5-ALANINE-N-T-BOC
CAS:121695-40-7
Formula: C6D5CH2CH(NH-t-BOC)COOH
D-3995
MW: 270.34
98 atom % D
L-PHENYL-D5-ALANINE-N-FMOC
CAS:225918-67-2
Formula: C6D5CH2CH(NH-FMOC)COOH
D-6194
MW: 392.46
98 atom % D
L-PHENYLALANINE-3,3-D2
CAS:221346-31-2
Formula: C6H5CD2CH(NH2)COOH
D-2679
MW: 167.2
98 atom % D
L-PROLINAMIDE-2,5,5-D3
CAS:1276197-55-7
D-6884
MW: 117.17
98 atom % D
L-PROLINE-2,5,5-D3
CAS:65807-22-9
D-6266
MW: 118.15
98 atom % D
L-PROLINE-2,5,5-D3-N-FMOC
D-7565
MW: 340.39
98 atom % D
L-PROPOXYPHENE-D5 HCL (PROPIONYL-D5)
D-7590
MW: 380.97
98 atom % D
L-SERINE-2,3,3-D3
CAS:105591-10-4
Formula: HOCD2CD(NH2)COOH
D-1240
MW: 108.11
98 atom % D
L-SERINE-2,3,3-D3-N-T-BOC
Formula: HOCD2CD(NH-t-BOC)COOH
D-6619
MW: 208.22
98 atom % D
L-SERINE-2,3,3-D3-N-FMOC
CAS:1380308-48-4
Formula: HOCD2CD(NH-FMOC)COOH
D-6620
MW: 330.35
98 atom % D
L-SERINE-D7
CAS:56-45-1
Formula: DOCD2CD(ND2)COOD
D-6466
MW: 112.14
98 atom % D
L-THEANINE-D5 (N-ETHYL-D5)
CAS:1217451-85-8
Formula: CD3CD2NHCOCH2CH2CH(NH2)COOH
D-7269
MW: 179.23
99 atom % D
L-THREONINE-2,3-D2
CAS:1202936-45-5
Formula: CH3CD(OH)CD(NH2)COOH
D-6362
MW: 121.13
98 atom % D
L-TRYPTOPHAN-2′,4′,5′,6′,7′-D5 (INDOLE-D5)
CAS:62595-11-3
D-1522
MW: 209.26
98 atom % D
L-TRYPTOPHAN-2,3,3-D3
CAS:133519-78-5
D-7419
MW: 207.25
98 atom % D
L-VALINE-2-D1
CAS:77257-03-5
Formula: (CH3)2CHCD(NH2)COOH
D-5481
MW: 118.15
98 atom % D
L-VALINE-D8
CAS:35045-72-8
Formula: (CD3)2CDCD(NH2)COOH
D-1076
MW: 125.2
98 atom % D
L-VALINE-D8-N-T-BOC
CAS:153568-33-3
Formula: (CD3)2CDCD(NH-t-BOC)COOH
D-6200
MW: 225.31
98 atom % D
L-VALINE-D8-N-FMOC
CAS:1007834-06-1
Formula: (CD3)2CDCD(NH-FMOC)COOH
D-6003
MW: 347.44
98 atom % D
M-CRESOL-D3 (METHYL-D3)
CAS:25026-32-8
Formula: CD3C6H4OH
D-5636
MW: 111.16
98 atom % D
M-CRESOL-D7
CAS:202325-51-7
Formula: CD3C6D4OH
D-5637
MW: 115.18
98 atom % D
M-CRESOL-D8
CAS:302911-90-6
Formula: CD3C6D4OD
D-3556
MW: 116.19
98 atom % D
M-TERPHENYL-D14
CAS:17714-84-0
D-5405
MW: 244.39
98 atom % D
M-TOLUIC-D7 ACID
CAS:733046-94-1
Formula: CD3C6D4COOH
D-6338
MW: 143.19
98 atom % D
M-TOLUIDINE-2,4,6-D3
CAS:68408-23-1
Formula: CH3C6HD3NH2
D-5614
MW: 110.17
98 atom % D
M-TOLUIDINE-D9
CAS:352431-22-2
Formula: CD3C6D4ND2
D-5344
MW: 116.21
98 atom % D
M-TOLUNITRILE-D7
CAS:1219795-31-9
Formula: CD3C6D4CN
D-5573
MW: 124.19
98 atom % D
M-XYLENE-α,α,α,α′,α′,α′-D6
CAS:29636-65-5
Formula: C6H4(CD3)2
D-127
MW: 112.2
99 atom % D
M-XYLENE-D10
CAS:116601-58-2
Formula: C6D4(CD3)2
D-2037
MW: 116.23
98 atom % D
M-XYLENE-D4 (RING-D4)
CAS:425420-97-9
Formula: C6D4(CH3)2
D-5160
MW: 110.19
98 atom % D
MYO-INOSITOL-1,2,3,4,5,6-D6
CAS:68922-44-1
Formula: (CDOH)6
D-3019
MW: 186.19
98 atom % D
N-BUTANE-1,1,1,4,4,4-D6 (GAS)
CAS:13183-67-0
Formula: CD3CH2CH2CD3
D-316
MW: 64.16
98 atom % D
N-BUTANE-1,1,1-D3 (GAS)
CAS:53716-51-1
Formula: CH3CH2CH2CD3
D-264
MW: 61.14
98 atom % D
N-BUTANE-1,4-D2 (GAS)
CAS:53716-54-4
Formula: CH2DCH2CH2CH2D
D-5631
MW: 60.14
98 atom % D
N-BUTANE-1-D1 (GAS)
CAS:53716-53-3
Formula: CH3CH2CH2CH2D
D-5309
MW: 59.13
98 atom % D
N-BUTANE-2,2,3,3-D4 (GAS)
CAS:24330-31-2
Formula: CH3CD2CD2CH3
D-2639
MW: 62.14
98 atom % D
N-BUTANE-D10 (GAS)
CAS:2075408
Formula: CD3CD2CD2CD3
D-7
MW: 68.18
98 atom % D
N-BUTYL 4-HYDROXYBENZOATE-2,3,5,6-D4
CAS:1219798-67-0
Formula: HOC6D4COOCH2CH2CH2CH3
D-7235
MW: 198.25
98 atom % D
N-BUTYL ACETATE-D12
CAS:1219799-38-8
Formula: CD3COOCD2CD2CD2CD3
D-5632
MW: 128.23
98 atom % D
N-BUTYL ALCOHOL-D10
CAS:34193-38-9
Formula: CD3CD2CD2CD2OD
D-1181
MW: 84.18
99 atom % D
N-BUTYL ALCOHOL-OD
CAS:4712-38-3
Formula: CH3CH2CH2CH2OD
D-202
MW: 75.13
98 atom % D
N-BUTYL-1,1,2,2,3,3-D6 ALCOHOL
CAS:1219794-84-9
Formula: CH3CD2CD2CD2OH
D-5905
MW: 80.16
98 atom % D
N-BUTYL-1,1,2,2-D4 ALCOHOL
CAS:118104-91-9
Formula: CH3CH2CD2CD2OH
D-5888
MW: 78.15
98 atom % D
N-BUTYL-1,1-D2 ALCOHOL
CAS:32586-14-4
Formula: CH3CH2CH2CD2OH
D-6695
MW: 76.13
99 atom % D
N-BUTYL-2,2,3,3,4,4,4-D7 ALCOHOL
CAS:91732-68-2
Formula: CD3CD2CD2CH2OH
D-5537
MW: 81.17
98 atom % D
N-BUTYL-3,3,4,4,4-D5 ALCOHOL
CAS:64118-16-7
Formula: CD3CD2CH2CH2OH
D-5891
MW: 79.15
98 atom % D
N-BUTYL-4,4,4-D3 ALCOHOL
CAS:64156-70-3
Formula: CD3CH2CH2CH2OH
D-5366
MW: 77.14
99 atom % D
N-BUTYL-4,4,4-D3-BENZENE
CAS:109232-94-2
Formula: C6H5(CH2)3CD3
D-1911
MW: 137.24
98 atom % D
N-BUTYL-D9 ALCOHOL
CAS:25493-17-8
Formula: CD3CD2CD2CD2OH
D-766
MW: 83.18
99 atom % D
N-BUTYL-D9-AMINE
CAS:776285-22-4
Formula: CD3CD2CD2CD2NH2
D-1967
MW: 82.19
98 atom % D
N-BUTYL-D9-AMINE HCL
CAS:344298-86-8
Formula: CD3CD2CD2CD2NH2•HCl
D-2542
MW: 118.65
98 atom % D
N-BUTYL-D9-BENZENE
CAS:65087-59-4
Formula: C6H5(CD2)3CD3
D-1571
MW: 143.28
98 atom % D
N-BUTYL-D9-TIN TRICHLORIDE
Formula: CD3(CD2)3SnCl3
D-6696
MW: 291.22
98 atom % D
N-BUTYLAMINE-D11 DCL
CAS:347841-81-0
Formula: CD3CD2CD2CD2ND2•DCl
D-3383
MW: 121.67
98 atom % D
N-BUTYLAMINE-ND2 DCL
CAS:156235-87-9
Formula: CH3CH2CH2CH2ND2•DCl
D-7132
MW: 112.62
98 atom % D
N-BUTYLBENZENE-2,3,4,5,6-D5
CAS:20329-91-3
Formula: C6D5(CH2)3CH3
D-5595
MW: 139.25
98 atom % D
N-BUTYLBENZENE-D14
CAS:634897-78-2
Formula: C6D5(CD2)3CD3
D-5596
MW: 148.31
98 atom % D
N-BUTYRALDEHYDE-2,2,3,3,4,4,4-D7
CAS:951209-46-4
Formula: CD3CD2CD2CHO
D-5984
MW: 79.15
98 atom % D
N-BUTYRALDEHYDE-2,2-D2
CAS:81214-92-8
Formula: CH3CH2CD2CHO
D-1182
MW: 74.12
98 atom % D
N-BUTYRALDEHYDE-D8
CAS:84965-36-6
Formula: CD3CD2CD2CDO
D-5315
MW: 80.16
99 atom % D
N-DECANE-D22
CAS:16416-29-8
Formula: CD3(CD2)8CD3
D-960
MW: 164.42
98 atom % D
N-DECYL-1,1,2,2-D4 ALCOHOL
CAS:57367-97-2
Formula: CH3(CH2)7CD2CD2OH
D-6306
MW: 162.31
99 atom % D
N-DECYL-9,9,10,10,10-D5 ALCOHOL
CAS:57368-00-0
Formula: CD3CD2(CH2)8OH
D-5892
MW: 163.31
98 atom % D
N-DECYL-D21 ALCOHOL
CAS:110510-78-6
Formula: CD3(CD2)9OH
D-3994
MW: 179.41
98 atom % D
N-DOCOSANE-D46
CAS:260411-88-9
Formula: CD3(CD2)20CD3
D-5232
MW: 356.89
98 atom % D
N-DODECANE-D26
CAS:16416-30-1
Formula: CD3(CD2)10CD3
D-882
MW: 196.5
98 atom % D
N-DODECYL-D25 ALCOHOL
CAS:160776-83-0
Formula: CD3(CD2)11OH
D-3983
MW: 211.49
98 atom % D
N-DODECYL-D25-AMINE
CAS:1219802-72-8
Formula: CD3(CD2)11NH2
D-6219
MW: 210.5
98 atom % D
N-DOTRIACONTANE-D66
CAS:62369-68-0
Formula: CD3(CD2)30CD3
D-973
MW: 517.28
98 atom % D
N-EICOSANE-D42
CAS:62369-67-9
Formula: CD3(CD2)18CD3
D-1532
MW: 324.81
98 atom % D
N-EICOSANYL-D41 ALCOHOL
CAS:349553-89-5
Formula: CD3(CD2)19OH
D-4009
MW: 339.8
99 atom % D
N-HENEICOSANE-D44
CAS:39756-37-1
Formula: CD3(CD2)19CD3
D-6020
MW: 340.85
99 atom % D
N-HEPTADECANE-D36
CAS:39756-35-9
Formula: CD3(CD2)15CD3
D-5039
MW: 276.69
98 atom % D
N-HEPTANE-D16
CAS:33838-52-7
Formula: CD3(CD2)5CD3
D-1142
MW: 116.3
99 atom % D
N-HEPTYL 4-HYDROXYBENZOATE-2,3,5,6-D4
Formula: HOC6D4COO(CH2)6CH3
D-7585
MW: 240.33
98 atom % D
N-HEPTYL-1-D1 ALCOHOL
CAS:38007-42-0
Formula: CH3(CH2)5CHDOH
D-7218
MW: 117.21
99 atom % D
N-HEPTYL-5,5,6,6,7,7,7-D7 ALCOHOL
CAS:1219804-99-5
Formula: CD3CD2CD2(CH2)4OH
D-6920
MW: 123.25
98 atom % D
N-HEPTYL-D15 ALCOHOL
CAS:194793-95-8
Formula: CD3(CD2)6OH
D-3988
MW: 131.29
98 atom % D
N-HEPTYLBENZENE-2,3,4,5,6-D5
CAS:1219799-19-5
Formula: C6D5(CH2)6CH3
D-6730
MW: 181.33
98 atom % D
N-HEPTYLBENZENE-D20
CAS:634897-84-0
Formula: C6D5(CD2)6CD3
D-6732
MW: 196.42
98 atom % D
N-HEXACOSANE-D54
CAS:1219803-91-4
Formula: CD3(CD2)24CD3
D-5611
MW: 421.04
98 atom % D
N-HEXADECANE-D34
CAS:15716-08-2
Formula: CD3(CD2)14CD3
D-821
MW: 260.65
98 atom % D
N-HEXADECYL-1,1,2,2-D4 ALCOHOL
CAS:1398065-49-0
Formula: CH3(CH2)13(CD2)2OH
D-7370
MW: 246.47
99 atom % D
N-HEXADECYL-1,1,2,2-D4 HEXADECANOATE-16,16,16-D3
CAS:1398066-15-3
Formula: CD3(CH2)14COOCD2CD2(CH2)13D-7369
MW: 487.9
99 atom % D
N-HEXADECYL-15,15,16,16,16-D5 ALCOHOL
CAS:1219799-21-9
Formula: CD3CD2(CH2)14OH
D-6547
MW: 247.47
98 atom % D
N-HEXADECYL-16,16,16-D3 ALCOHOL
CAS:75736-52-6
Formula: CD3(CH2)15OH
D-6565
MW: 245.46
99 atom % D
N-HEXADECYL-2,2,16,16,16-D5 ALCOHOL
CAS:1219799-18-4
Formula: CD3(CH2)13CD2CH2OH
D-6520
MW: 247.47
98 atom % D
N-HEXADECYL-2,2,3,3...16,16,16-D31 ALCOHOL
CAS:203633-15-2
Formula: CD3(CD2)14CH2OH
D-5845
MW: 273.63
98 atom % D
N-HEXADECYL-D33 ALCOHOL
CAS:284474-73-3
Formula: CD3(CD2)15OH
D-4008
MW: 275.65
98 atom % D
N-HEXADECYL-D33-AMINE
CAS:1191245-82-5
Formula: CD3(CD2)15NH2
D-6227
MW: 274.66
98 atom % D
N-HEXADECYL-D33-TRIETHYLAMMONIUM BROMIDE
Formula: CD3(CD2)15N(CH2CH3)3Br
D-6935
MW: 439.73
98 atom % D
N-HEXADECYL-D33-TRIMETHYLAMMONIUM BROMIDE
CAS:347841-42-3
Formula: CD3(CD2)15N(CH3)3Br
D-3779
MW: 397.65
98 atom % D
N-HEXADECYL-D33-TRIMETHYLAMMONIUM CHLORIDE
Formula: CD3(CD2)15N(CH3)3Cl
D-6147
MW: 353.2
98 atom % D
N-HEXADECYLPYRIDINIUM-D5 BROMIDE
CAS:143715-91-7
D-6446
MW: 389.47
98 atom % D
N-HEXADECYLTRIMETHYL-D3-AMMONIUM BROMIDE (MONO-METHYL-D3)
CAS:1092921-73-7
Formula: CH3(CH2)15N(CH3)2CD3Br
D-5744
MW: 367.47
99 atom % D
N-HEXADECYLTRIMETHYL-D9-AMMONIUM BROMIDE
CAS:95217-14-4
Formula: CH3(CH2)15N(CD3)3Br
D-7259
MW: 373.51
99 atom % D
N-HEXADECYLTRIMETHYLAMMONIUM-D42 BROMIDE
CAS:907216-28-8
Formula: CD3(CD2)15N(CD3)3Br
D-6146
MW: 406.71
98 atom % D
N-HEXADECYLTRIMETHYLAMMONIUM-D42 CHLORIDE
Formula: CD3(CD2)15N(CD3)3Cl
D-6148
MW: 362.26
98 atom % D
N-HEXANE-1,1,1,2,2,3,3-D7
CAS:32740-31-1
Formula: CH3(CH2)2CD2CD2CD3
D-7330
MW: 93.22
99 atom % D
N-HEXANE-D14
CAS:21666-38-6
Formula: CD3(CD2)4CD3
D-185
MW: 100.26
99 atom % D
N-HEXATRIACONTANE-D74
CAS:16416-34-5
Formula: CD3(CD2)34CD3
D-950
MW: 581.43
98 atom % D
N-HEXYL 4-HYDROXYBENZOATE-2,3,5,6-D4
Formula: HOC6D4COO(CH2)5CH3
D-7586
MW: 226.31
98 atom % D
N-HEXYL ACETATE-D3
CAS:1219805-39-6
Formula: CH3(CH2)5OCOCD3
D-7232
MW: 147.23
99 atom % D
N-HEXYL-1,1-D2 ALCOHOL
CAS:52598-04-6
Formula: CH3(CH2)4CD2OH
D-6705
MW: 104.19
99 atom % D
N-HEXYL-2,2,3,3,4,4,5,5,6,6,6-D11 ALCOHOL
CAS:2159-18-4
Formula: CD3(CD2)4CH2OH
D-6508
MW: 113.24
98 atom % D
N-HEXYL-2,2,3,3,4,4,5,5,6,6,6-D11-TRIPHENYLPHOSPHONIUM BROMIDE
Formula: CD3(CD2)4CH2P(C6H5)3Br
D-6506
MW: 438.43
98 atom % D
N-HEXYL-5,5,6,6,6-D5 ALCOHOL
CAS:64118-18-9
Formula: CD3CD2(CH2)4OH
D-6960
MW: 107.21
98 atom % D
N-HEXYL-D13 ALCOHOL
CAS:204244-84-8
Formula: CD3(CD2)5OH
D-3982
MW: 115.26
98 atom % D
N-HEXYL-D13 CHLOROFORMATE
Formula: CD3(CD2)5OCOCl
D-7631
MW: 177.71
98 atom % D
N-HEXYL-D13-AMINE
CAS:352438-81-4
Formula: CD3(CD2)5NH2
D-5155
MW: 114.27
98 atom % D
N-HEXYLBENZENE-2,3,4,5,6-D5
CAS:1219799-07-1
Formula: C6D5(CH2)5CH3
D-6733
MW: 167.3
98 atom % D
N-NONADECANE-D40
CAS:39756-36-0
Formula: CD3(CD2)17CD3
D-1593
MW: 308.77
98 atom % D
N-NONANE-D20
CAS:121578-11-8
Formula: CD3(CD2)7CD3
D-5054
MW: 148.38
98 atom % D
N-NONYL 4-HYDROXYBENZOATE-2,3,5,6-D4
Formula: HOC6D4COO(CH2)8CH3
D-7587
MW: 268.39
98 atom % D
N-NONYL-6,6,7,7-D4 ALCOHOL
CAS:33975-46-1
Formula: CH3CH2(CD2)2(CH2)5OH
D-6331
MW: 148.28
98 atom % D
N-NONYL-D19 ALCOHOL
CAS:349553-86-2
Formula: CD3(CD2)8OH
D-3999
MW: 163.37
98 atom % D
N-NONYLBENZENE-2,3,4,5,6-D5
CAS:20216-93-7
Formula: C6D5(CH2)8CH3
D-3341
MW: 209.39
98 atom % D
N-NONYLBENZENE-D24
CAS:1219799-13-9
Formula: C6D5(CD2)8CD3
D-6737
MW: 228.5
99 atom % D
N-OCTACOSANE-D58
CAS:16416-33-4
Formula: CD3(CD2)26CD3
D-959
MW: 453.12
98 atom % D
N-OCTADECANE-D38
CAS:16416-31-2
Formula: CD3(CD2)16CD3
D-956
MW: 292.73
98 atom % D
N-OCTADECYL-1,1-D2 ALCOHOL
CAS:86369-69-9
Formula: CH3(CH2)16CD2OH
D-5337
MW: 272.51
99 atom % D
N-OCTADECYL-D37 ALCOHOL
CAS:204259-62-1
Formula: CD3(CD2)17OH
D-4012
MW: 307.72
98 atom % D
N-OCTANE-D18
CAS:17252-77-6
Formula: CD3(CD2)6CD3
D-451
MW: 132.34
99 atom % D
N-OCTATRIACONTANE-D78
CAS:1219803-25-4
Formula: CD3(CD2)36CD3
D-7017
MW: 613.51
98 atom % D
N-OCTYL 4-HYDROXYBENZOATE-2,3,5,6-D4
Formula: HOC6D4COO(CH2)7CH
D-7588
MW: 254.36
98 atom % D
N-OCTYL-1,1-D2 ALCOHOL
CAS:78510-02-8
Formula: CH3(CH2)6CD2OH
D-5055
MW: 132.24
99 atom % D
N-OCTYL-D17 ALCOHOL
CAS:153336-13-1
Formula: CD3(CD2)7OH
D-1947
MW: 147.33
98 atom % D
N-OCTYL-D17-AMINE
CAS:1173022-14-4
Formula: CD3(CD2)7NH2
D-6345
MW: 146.35
98 atom % D
N-OCTYLBENZENE-2,3,4,5,6-D5
CAS:1219799-23-1
Formula: C6D5(CH2)7CH3
D-6738
MW: 195.36
98 atom % D
N-OCTYLBENZENE-D22
CAS:1219799-28-6
Formula: C6D5(CD2)7CD3
D-6740
MW: 212.46
98 atom % D
N-PENTACOSANE-D52
CAS:121578-13-0
Formula: CD3(CD2)23CD3
D-5874
MW: 405
98 atom % D
N-PENTADECANE-D32
CAS:36340-20-2
Formula: CD3(CD2)13CD3
D-3915
MW: 244.61
98 atom % D
N-PENTADECYL-D31 ALCOHOL
CAS:349553-87-3
Formula: CD3(CD2)14OH
D-4001
MW: 259.61
98 atom % D
N-PENTANE-D12
CAS:2031-90-5
Formula: CD3(CD2)3CD3
D-28
MW: 84.22
98 atom % D
N-PENTYL 4-HYDROXYBENZOATE-2,3,5,6-D4
CAS:1219798-66-9
Formula: HOC6D4COO(CH2)4CH3
D-7238
MW: 212.28
98 atom % D
N-PENTYL ALCOHOL-D12
CAS:158778-85-9
Formula: CD3(CD2)4OD
D-5850
MW: 100.22
98 atom % D
N-PENTYL ALCOHOL-OD
CAS:14848-79-4
Formula: CH3(CH2)4OD
D-7242
MW: 89.16
98 atom % D
N-PENTYL-2,2,3,3,4,4,5,5,5-D9 ALCOHOL
CAS:148587-12-6
Formula: CD3(CD2)3CH2OH
D-6766
MW: 97.2
98 atom % D
N-PENTYL-5,5,5-D3 ALCOHOL
CAS:64118-19-0
Formula: CD3(CH2)4OH
D-5259
MW: 91.17
99 atom % D
N-PENTYL-D11 ALCOHOL
CAS:126840-22-0
Formula: CD3(CD2)4OH
D-3976
MW: 99.22
98 atom % D
N-PENTYL-D11 CHLOROFORMATE
CAS:1398065-67-2
Formula: CD3CD2CD2CD2CD2OCOCl
D-7514
MW: 161.67
99 atom % D
N-PENTYLBENZENE-2,3,4,5,6-D5
CAS:68639-73-6
Formula: C6D5(CH2)4CH3
D-6653
MW: 153.28
98 atom % D
N-PROPYL 4-HYDROXYBENZOATE-2,3,5,6-D4
CAS:1219802-67-1
Formula: HOC6D4COOCH2CH2CH3
D-7114
MW: 184.23
98 atom % D
N-PROPYL ALCOHOL-D8
CAS:61393-63-3
Formula: CD3CD2CD2OD
D-2041
MW: 68.14
98 atom % D
N-PROPYL ALCOHOL-OD
CAS:4712-36-1
Formula: CH3CH2CH2OD
D-81
MW: 61.1
98 atom % D
N-PROPYL FORMATE-D1
CAS:61219-61-2
Formula: DCOOCH2CH2CH3
D-5166
MW: 89.11
98 atom % D
N-PROPYL-1,1,2,2-D4 ALCOHOL
CAS:70907-80-1
Formula: CH3CD2CD2OH
D-5824
MW: 64.12
98 atom % D
N-PROPYL-1,1,3,3,3-D5 ALCOHOL
CAS:188894-71-5
Formula: CD3CH2CD2OH
D-6588
MW: 65.13
98 atom % D
N-PROPYL-1,1-D2 ALCOHOL
CAS:40422-04-6
Formula: CH3CH2CD2OH
D-124
MW: 62.11
99 atom % D
N-PROPYL-2,2,3,3,3-D5 ALCOHOL
CAS:64118-40-7
Formula: CD3CD2CH2OH
D-5653
MW: 65.13
98 atom % D
N-PROPYL-2,2,3,3,3-D5-AMINE
CAS:1398066-17-5
Formula: CD3CD2CH2NH2
D-7462
MW: 64.14
98 atom % D
N-PROPYL-2,2,3,3,3-D5-AMINE HCL
CAS:1398065-66-1
Formula: CD3CD2CH2NH2•HCl
D-7494
MW: 100.6
98 atom % D
N-PROPYL-2,2,3,3,3-D5-TRIPHENYLPHOSPHONIUM BROMIDE
Formula: CD3CD2CH2P(C6H5)3Br
D-6393
MW: 390.31
98 atom % D
N-PROPYL-2,2-D2 ALCOHOL
CAS:40422-14-8
Formula: CH3CD2CH2OH
D-287
MW: 62.11
98 atom % D
N-PROPYL-2-D1 ALCOHOL
CAS:89603-83-8
Formula: CH3CHDCH2OH
D-5652
MW: 61.1
98 atom % D
N-PROPYL-3,3,3-D3 ALCOHOL
CAS:61844-01-7
Formula: CD3CH2CH2OH
D-34
MW: 63.11
99 atom % D
N-PROPYL-3,3,3-D3-AMINE
CAS:24300-22-9
Formula: CD3CH2CH2NH2
D-5700
MW: 62.13
99 atom % D
N-PROPYL-3,3,3-D3-AMINE HCL
CAS:478702-86-2
Formula: CD3CH2CH2NH2•HCl
D-5718
MW: 98.59
99 atom % D
N-PROPYL-D7 ALCOHOL
CAS:102910-31-6
Formula: CD3CD2CD2OH
D-1236
MW: 67.14
98 atom % D
N-PROPYL-D7-AMINE
CAS:744184-05-2
Formula: CD3CD2CD2NH2
D-1379
MW: 66.15
98 atom % D
N-PROPYL-D7-AMINE HCL
CAS:344298-88-0
Formula: CD3CD2CD2NH2•HCl
D-2545
MW: 102.61
98 atom % D
N-PROPYL-D7-BENZENE
CAS:65087-58-3
Formula: C6H5CD2CD2CD3
D-1569
MW: 127.24
98 atom % D
N-TETRACONTANE-D82
CAS:1219802-99-9
Formula: CD3(CD2)38CD3
D-972
MW: 645.59
98 atom % D
N-TETRACOSANE-D50
CAS:16416-32-3
Formula: CD3(CD2)22CD3
D-883
MW: 388.96
98 atom % D
N-TETRADECANE-D30
CAS:204244-81-5
Formula: CD3(CD2)12CD3
D-3898
MW: 228.57
98 atom % D
N-TETRADECYL-1,1-D2 ALCOHOL
CAS:169398-02-1
Formula: CH3(CH2)12CD2OH
D-5060
MW: 216.4
98 atom % D
N-TETRADECYL-D29 ALCOHOL
CAS:284474-78-8
Formula: CD3(CD2)13OH
D-3996
MW: 243.57
98 atom % D
N-TETRADECYL-D29-AMINE
CAS:204244-82-6
Formula: CD3(CD2)13NH2
D-6249
MW: 242.58
98 atom % D
N-TETRATRIACONTANE-D70
CAS:1219805-47-6
Formula: CD3(CD2)32CD3
D-7215
MW: 549.35
99 atom % D
N-TRIACONTANE-D62
CAS:93952-07-9
Formula: CD3(CD2)28CD3
D-2708
MW: 485.2
98 atom % D
N-TRICOSANE-D48
CAS:203784-75-2
Formula: CD3(CD2)21CD3
D-4149
MW: 372.93
98 atom % D
N-TRIDECANE-D28
CAS:121578-12-9
Formula: CD3(CD2)11CD3
D-2875
MW: 212.54
98 atom % D
N-TRIDECYL-D27 ALCOHOL
CAS:203633-18-5
Formula: CD3(CD2)12OH
D-4004
MW: 227.53
98 atom % D
N-UNDECANE-D24
CAS:164858-54-2
Formula: CD3(CD2)9CD3
D-5063
MW: 180.46
98 atom % D
N-UNDECYL-1,1,2,2-D4 ALCOHOL
CAS:1219803-47-0
Formula: CH3(CH2)8CD2CD2OH
D-6750
MW: 176.33
98 atom % D
N-UNDECYL-D23 ALCOHOL
CAS:349553-88-4
Formula: CD3(CD2)10OH
D-4007
MW: 195.45
98 atom % D
N-UNDECYL-D23-AMINE
CAS:1219805-57-8
Formula: CD3(CD2)10NH2
D-6255
MW: 194.47
98 atom % D
O-CRESOL-3,4,5,6-D4,OD
CAS:3647-00-5
Formula: CH3C6D4OD
D-4254
MW: 113.17
98 atom % D
O-CRESOL-D3 (METHYL-D3)
CAS:70837-27-3
Formula: CD3C6H4OH
D-6986
MW: 111.16
99 atom % D
O-CRESOL-D7
CAS:202325-50-6
Formula: CD3C6D4OH
D-5635
MW: 115.18
98 atom % D
O-CRESOL-D8
CAS:203645-65-2
Formula: CD3C6D4OD
D-5027
MW: 116.19
98 atom % D
O-TERPHENYL-D14
CAS:5142-67-6
D-4165
MW: 244.39
98 atom % D
O-TOLUIC-D7 ACID
CAS:207742-73-2
Formula: CD3C6D4COOH
D-5871
MW: 143.19
98 atom % D
O-TOLUIDINE-4,6-D2
CAS:68408-20-8
Formula: CH3C6H2D2NH2
D-5613
MW: 109.17
98 atom % D
O-TOLUIDINE-D3 (METHYL-D3)
CAS:151985-13-6
Formula: CD3C6H4NH2
D-6512
MW: 110.17
99 atom % D
O-TOLUIDINE-D9
CAS:194423-47-7
Formula: CD3C6D4ND2
D-3571
MW: 116.21
98 atom % D
O-TOLUNITRILE-D7
CAS:1138681-69-2
Formula: CD3C6D4CN
D-6339
MW: 124.19
98 atom % D
O-TOLYL-D7 ISOCYANATE
CAS:1219802-73-9
Formula: CD3C6D4NCO
D-5958
MW: 140.19
98 atom % D
O-XYLENE-α,α,α,α′,α′,α′-D6
CAS:25319-54-4
Formula: C6H4(CD3)2
D-162
MW: 112.2
99 atom % D
O-XYLENE-D10
CAS:56004-61-6
Formula: C6D4(CD3)2
D-2036
MW: 116.23
99 atom % D
O-XYLENE-D4 (RING-D4)
CAS:62367-40-2
Formula: C6D4(CH3)2
D-3904
MW: 110.19
98 atom % D
P-AZOXYANISOLE-D6 (O,O-DIMETHYL-D6)
CAS:34172-21-9
Formula: CD3OC6H4N=N(O)C6H4OCD3
D-1701
MW: 264.31
98 atom % D
P-CRESOL-2,3,5,6-D4,OD
CAS:3646-98-8
Formula: CH3C6D4OD
D-1837
MW: 113.17
98 atom % D
P-CRESOL-D3 (METHYL-D3)
CAS:108561-00-8
Formula: CD3C6H4OH
D-5638
MW: 111.16
99 atom % D
P-CRESOL-D7
CAS:202325-52-8
Formula: CD3C6D4OH
D-5616
MW: 115.18
98 atom % D
P-CRESOL-D8
CAS:190780-66-6
Formula: CD3C6D4OD
D-5028
MW: 116.19
98 atom % D
P-TERPHENYL-D14
CAS:1718-51-0
D-87
MW: 244.39
98 atom % D
P-TOLUALDEHYDE-2,3,5,6-D4
CAS:1219804-07-5
Formula: CH3C6D4CHO
D-6496
MW: 124.18
98 atom % D
P-TOLUALDEHYDE-D7 (2,3,5,6-D4; METHYL-D3)
CAS:1219805-23-8
Formula: CD3C6D4CHO
D-6497
MW: 127.19
98 atom % D
P-TOLUENE-2,3,5,6-D4-SULFONAMIDE
CAS:1219795-34-2
Formula: CH3C6D4SO2NH2
D-6252
MW: 175.24
98 atom % D
P-TOLUENE-D7-SULFONIC ACID H2O
Formula: CD3C6D4SO3H•H2O
D-5677
MW: 197.25
98 atom % D
P-TOLUENESULFONYLHYDRAZIDE-N,N,N-D3
CAS:109333-73-5
Formula: CH3C6H4SO2NDND2
D-5745
MW: 189.25
98 atom % D
P-TOLUIC-2,3,5,6-D4 ACID
CAS:1219798-71-6
Formula: CH3C6D4COOH
D-5954
MW: 140.17
98 atom % D
P-TOLUIC-D7 ACID
CAS:1219798-76-1
Formula: CD3C6D4COOH
D-6272
MW: 143.19
98 atom % D
P-TOLUIDINE-D3 (METHYL-D3)
CAS:23346-25-0
Formula: CD3C6H4NH2
D-5872
MW: 110.17
98 atom % D
P-TOLUIDINE-D9
CAS:352431-23-3
Formula: CD3C6D4ND2
D-5345
MW: 116.21
98 atom % D
P-TOLUNITRILE-D7
CAS:1219804-01-9
Formula: CD3C6D4CN
D-6340
MW: 124.19
98 atom % D
P-TOLYL-D7 ISOCYANATE
CAS:1219798-59-0
Formula: CD3C6D4NCO
D-5911
MW: 140.19
98 atom % D
P-XYLENE-α,α,α,α′,α′,α′-D6
CAS:25493-13-4
Formula: C6H4(CD3)2
D-89
MW: 112.2
99 atom % D
P-XYLENE-α,α,α-D3
CAS:26204-18-2
Formula: CH3C6H4CD3
D-6435
MW: 109.19
99 atom % D
P-XYLENE-D10
CAS:41051-88-1
Formula: C6D4(CD3)2
D-857
MW: 116.23
98 atom % D
P-XYLENE-D4 (RING-D4)
CAS:16034-43-8
Formula: C6D4(CH3)2
D-2779
MW: 110.19
98 atom % D
TERT-BUTYL ALCOHOL-D10
CAS:53001-22-2
Formula: (CD3)3COD
D-913
MW: 84.18
98 atom % D
TERT-BUTYL ALCOHOL-OD
CAS:3972-25-6
Formula: (CH3)3COD
D-233
MW: 75.13
98 atom % D
TERT-BUTYL METHYL ETHER-D12
CAS:284487-64-5
Formula: (CD3)3COCD3
D-5314
MW: 100.22
99 atom % D
TERT-BUTYL METHYL-D3 ETHER
CAS:29366-08-3
Formula: (CH3)3COCD3
D-4126
MW: 91.17
99 atom % D
TERT-BUTYL-1,1,1,3,3,3-D6 ALCOHOL
CAS:53853-65-9
Formula: (CD3)2C(OH)CH3
D-5448
MW: 80.16
99 atom % D
TERT-BUTYL-1,1,1-D3 ALCOHOL
CAS:33500-15-1
Formula: (CH3)2C(CD3)OH
D-1137
MW: 77.14
99 atom % D
TERT-BUTYL-D9 ACRYLATE (STABILIZED WITH HYDROQUINONE)
CAS:928163-00-2
Formula: CH2=CHCOO(CD3)3
D-7338
MW: 137.23
99 atom % D
TERT-BUTYL-D9 ALCOHOL
CAS:25725-11-5
Formula: (CD3)3COH
D-134
MW: 83.18
99 atom % D
TERT-BUTYL-D9 METHYL ETHER
CAS:1219795-06-8
Formula: (CD3)3COCH3
D-5724
MW: 97.2
98 atom % D
TERT-BUTYLBENZENE-D14
CAS:209963-71-3
Formula: (CD3)3CC6D5
D-5924
MW: 148.31
99 atom % D
TRANS,TRANS-MUCONIC-D4 ACID
Formula: HOOCCD=CDCD=CDCOOH
D-6257
MW: 146.14
99 atom % D
TRANS-4-HYDROXY-L-PROLINE-2,5,5-D3
CAS:1356016-86-8
D-7186
MW: 134.15
99 atom % D
TRANS-4-HYDROXY-2-HEXENAL-5,5,6,6,6-D5 DIMETHYL ACETAL
CAS:1219806-40-2
Formula: CD3CD2CH(OH)CH=CHCH(OCH3)2
D-6821
MW: 165.24
99 atom % D
TRANS-4-HYDROXY-2-NONENAL-5,5,6,6,7,7,8,8,9,9,9-D11 DIMETHYL ACETAL
CAS:350818-64-3
Formula: CD3(CD2)4CH(OH)CH=CHCH(OCH3)2
D-5077
MW: 213.36
98 atom % D
TRANS-4-HYDROXY-3-METHOXY-D3-CINNAMIC ACID
CAS:860605-59-0
D-6669
MW: 197.2
99 atom % D
TRANS-4-HYDROXYCINNAMIC-α,β,2,3,5,6-D6 ACID
Formula: HOC6D4CD=CDCOOH
D-7482
MW: 170.2
99 atom % D
TRANS-CINNAMIC-D5 ACID (PHENYL-D5)
CAS:352431-48-2
Formula: C6D5CH=CHCOOH
D-5284
MW: 153.19
98 atom % D
TRANS-CINNAMIC-D7 ACID
CAS:308796-47-6
Formula: C6D5CD=CDCOOH
D-5781
MW: 155.2
98 atom % D
TRANS-ETHYLENE-1,2-D2 (GAS)
CAS:1517-53-9
Formula: CHD=CHD
D-210
MW: 30.07
98 atom % D
TRANS-STILBENE-α,α′-D2
CAS:5284-44-6
Formula: C6H5CD=CDC6H5
D-5742
MW: 182.26
98 atom % D
TRANS-STILBENE-D10 (RINGS-D10)
CAS:20748-24-7
Formula: C6D5CH=CHC6D5
D-5500
MW: 190.31
98 atom % D
TRANS-STILBENE-D12
CAS:16341-52-9
Formula: C6D5CD=CDC6D5
D-311
MW: 192.32
98 atom % D
1,1,1,2-TETRACHLOROETHANE-D2
CAS:117164-18-8
Formula: ClCD2CCl3
D-5059
MW: 169.86
98 atom % D
1,1,1-TRICHLORO-2,2-BIS(4-CHLOROPHENYL-D4)ETHANE
CAS:93952-18-2
Formula: (ClC6D4)2CHCCl3
D-3006
MW: 362.54
99 atom % D (also 20% deuterated at the 2-position)
1,1,1-TRICHLORO-2-(2-CHLOROPHENYL-D4)-2-(4-CHLOROPHENYL-D4)ETHANE
CAS:221899-88-3
Formula: ClC6D4CH(CCl3)C6D4Cl
D-6380
MW: 362.54
98 atom % D
1,1,1-TRICHLOROETHANE-D3
CAS:2747-58-2
Formula: CD3CCl3
D-1150
MW: 136.42
98 atom % D
1,1,2,2-TETRACHLOROETHANE-D2
CAS:33685-54-0
Formula: Cl2CDCDCl2
D-1416
MW: 169.86
99.6 atom % D
1,1,2-TRICHLOROETHANE-D3
CAS:171086-93-4
Formula: ClCD2CDCl2
D-2409
MW: 136.42
99 atom % D
1,1-CYCLOPROPANE-2,2,3,3-D4-DICARBOXYLIC ACID
CAS:136503-99-6
D-6439
MW: 134.12
99 atom % D
1,1-DICHLORO-2,2-BIS(4-CHLOROPHENYL-D4)ETHANE
CAS:93952-20-6
Formula: (ClC6D4)2CHCHCl2
D-3004
MW: 328.09
99 atom % D
1,1-DICHLORO-2,2-BIS(4-CHLOROPHENYL-D4)ETHYLENE
CAS:93952-19-3
Formula: (ClC6D4)2C=CCl2
D-3005
MW: 326.08
99 atom % D
1,1-DICHLOROETHANE-2,2,2-D3
CAS:56912-77-7
Formula: CD3CHCl2
D-1152
MW: 101.98
98 atom % D
1,1-DICHLOROETHYLENE-D2 (STABILIZED WITH HYDROQUINONE)
CAS:22280-73-5
Formula: CD2=CCl2
D-2201
MW: 98.96
98 atom % D
1,1-DIMETHYL-D6-HYDRAZINE HCL
CAS:1219804-14-4
Formula: (CD3)2NNH2•HCl
D-6677
MW: 102.6
98 atom % D
1,1-DIMETHYL-D6-SULFAMIDE
CAS:1189689-95-9
Formula: H2NSO2N(CD3)2
D-6849
MW: 130.19
99 atom % D
1,1-DIMETHYL-D6-UREA
CAS:1219802-32-0
Formula: H2NCON(CD3)2
D-6218
MW: 94.15
99 atom % D
1,1-DIMETHYLHYDRAZINE-D8 DCL
CAS:1219802-85-3
Formula: (CD3)2NND2•DCl
D-6600
MW: 105.61
98 atom % D
1,10-DECANE-D20-DIOL
CAS:347841-78-5
Formula: HO(CD2)10OH
D-3250
MW: 194.4
98 atom % D
1,10-DECANEDIOIC-2,2,9,9-D4 ACID
CAS:339080-77-2
Formula: HOOCCD2(CH2)6CD2COOH
D-1065
MW: 206.27
98 atom % D
1,10-DECANEDIOIC-D16 ACID
CAS:73351-71-0
Formula: HOOC(CD2)8COOH
D-3449
MW: 218.35
98 atom % D
1,10-DIBROMODECANE-D20
CAS:150017-88-2
Formula: Br(CD2)10Br
D-2659
MW: 320.2
98 atom % D
1,10-PHENANTHROLINE-D8
CAS:90412-47-8
D-2799
MW: 188.26
97 atom % D
1,12-DIBROMODODECANE-D24
CAS:1044544-84-4
Formula: Br(CD2)12Br
D-5873
MW: 352.28
98 atom % D
1,12-DODECANE-D24-DIOL
CAS:1219802-88-6
Formula: HO(CD2)12OH
D-6571
MW: 226.48
98 atom % D
1,12-DODECANEDIOIC-2,2,11,11-D4 ACID
CAS:97543-02-7
Formula: HOOCCD2(CH2)8CD2COOH
D-5089
MW: 234.33
98 atom % D
1,12-DODECANEDIOIC-D20 ACID
CAS:89613-32-1
Formula: HOOC(CD2)10COOH
D-2537
MW: 250.43
98 atom % D
1,14-TETRADECANEDIOIC-D24 ACID
CAS:130348-88-8
Formula: HOOC(CD2)12COOH
D-5074
MW: 282.5
98 atom % D
1,16-HEXADECANEDIOIC-D28 ACID
CAS:130348-90-2
Formula: HOOC(CD2)14COOH
D-5186
MW: 314.58
99 atom % D
1,2,3,4-TETRACHLOROBENZENE-D2
CAS:2199-73-7
Formula: C6D2Cl4
D-5869
MW: 217.91
98 atom % D
1,2,3,4-TETRAMETHYLBENZENE-D14
CAS:350818-60-9
Formula: C6D2(CD3)4
D-5061
MW: 148.31
98 atom % D
1,2,3,5-TETRACHLOROBENZENE-D2
CAS:2199-74-8
Formula: C6D2Cl4
D-5870
MW: 217.91
98 atom % D
1,2,3,5-TETRAMETHYLBENZENE-D14
CAS:1219795-11-5
Formula: C6D2(CD3)4
D-938
MW: 148.31
98 atom % D
1,2,3-TRICHLOROBENZENE-D3
CAS:3907-98-0
Formula: C6D3Cl3
D-2511
MW: 184.47
98 atom % D
1,2,3-TRICHLOROPROPANE-D5
CAS:203578-27-2
Formula: ClCD2CD(Cl)CD2Cl
D-6044
MW: 152.46
98 atom % D
1,2,4,5-BENZENETETRACARBOXYLIC ACID-D6
CAS:344298-79-9
D-2440
MW: 260.19
98 atom % D
1,2,4,5-BENZENETETRACARBOXYLIC DIANHYDRIDE-D2
CAS:106426-63-5
D-3393
MW: 220.13
98 atom % D
1,2,4,5-TETRACHLOROBENZENE-D2
CAS:1198-57-8
Formula: C6D2Cl4
D-1290
MW: 217.91
98 atom % D
1,2,4,5-TETRAMETHYLBENZENE-3,6-D2
CAS:1859-01-4
Formula: C6D2(CH3)4
D-2269
MW: 136.23
98 atom % D
1,2,4,5-TETRAMETHYLBENZENE-D14
CAS:15502-50-8
Formula: C6D2(CD3)4
D-269
MW: 148.31
98 atom % D
1,2,4-TRIAZOLE-D3
CAS:43088-92-2
D-5453
MW: 72.08
98 atom % D
1,2,4-TRICHLOROBENZENE-D3
CAS:2199-72-6
Formula: C6D3Cl3
D-2706
MW: 184.47
98 atom % D
1,2,4-TRIMETHYLBENZENE-D12
CAS:350818-61-0
Formula: (CD3)3C6D3
D-5062
MW: 132.27
98 atom % D
1,2-BENZENE-D4-DIAMINE
CAS:291765-93-0
Formula: C6D4(NH2)2
D-5981
MW: 112.17
98 atom % D
1,2-BENZENEDIAMINE-D8
CAS:1219798-78-3
Formula: C6D4(ND2)2
D-5965
MW: 116.19
98 atom % D
1,2-CYCLOHEXANE-D10-DIAMINE (CIS/TRANS MIXTURE)
D-6058
MW: 124.25
98 atom % D
1,2-DICHLOROBENZENE-D4
CAS:2199-69-1
Formula: C6D4Cl2
D-1191
MW: 151.03
99 atom % D
1,2-DICHLOROETHANE-D4
CAS:17060-07-0
Formula: ClCD2CD2Cl
D-103
MW: 102.98
99 atom % D
1,2-DICHLOROETHYLENE-D2 (CIS/TRANS MIXTURE)
CAS:15075-90-8
Formula: CDCl=CDCl
D-2526
MW: 98.96
98 atom % D
1,2-DIHYDROXYBENZENE-D6
CAS:202656-22-2
Formula: C6D4(OD)2
D-5290
MW: 116.15
98 atom % D
1,2-DIMETHOXY-D6-BENZENE
CAS:24658-24-0
Formula: C6H4(OCD3)2
D-5427
MW: 144.2
99 atom % D
1,2-DIMETHOXYBENZENE-3,4,5,6-D4
CAS:126840-15-1
Formula: C6D4(OCH3)2
D-1193
MW: 142.19
98 atom % D
1,2-DIMETHOXYBENZENE-4,5-D2
CAS:203645-56-1
Formula: C6H2D2(OCH3)2
D-4086
MW: 140.18
98 atom % D
1,2-DIMETHOXYBENZENE-D10
CAS:362049-43-2
Formula: C6D4(OCD3)2
D-5428
MW: 148.23
99 atom % D
1,2-DIPHENYLETHANE-D14
CAS:94371-89-8
Formula: C6D5(CD2)2C6D5
D-1233
MW: 196.35
98 atom % D
1,2-ETHANE-D4-DITHIOL
CAS:100189-81-9
Formula: HSCD2CD2SH
D-5163
MW: 98.21
99 atom % D
1,3,5(10)-ESTRATRIENE-17α-ETHYL-D5-3,17β-DIOL 3-METHYL ETHER
D-6742
MW: 319.5
98 atom % D
1,3,5-BENZENE-2,4,6-D3-TRICARBOXYLIC ACID
CAS:62790-27-6
Formula: C6D3(COOH)3
D-6597
MW: 213.16
98 atom % D
1,3,5-TRIBROMOBENZENE-D3
CAS:52921-77-4
Formula: C6D3Br3
D-6980
MW: 317.82
99 atom % D
1,3,5-TRICHLOROBENZENE-D3
CAS:1198-60-3
Formula: C6D3Cl3
D-687
MW: 184.47
98 atom % D
1,3,5-TRIMETHYLBENZENE-2,4,6-D3
CAS:38574-14-0
Formula: (CH3)3C6D3
D-1140
MW: 123.21
98 atom % D
1,3,5-TRIMETHYLBENZENE-D12
CAS:69441-16-3
Formula: (CD3)3C6D3
D-2911
MW: 132.27
98 atom % D
1,3-BENZENEDIAMINE-D8
CAS:770735-58-5
Formula: C6D4(ND)2
D-3914
MW: 116.19
97 atom % D
1,3-BUTADIENE-1,1,4,4-D4 (GAS) (STABILIZED WITH HYDROQUINONE)
CAS:10545-58-1
Formula: CD2=CHCH=CD2
D-232
MW: 58.11
98 atom % D
1,3-BUTADIENE-2,3-D2 (GAS) (STABILIZED WITH HYDROQUINONE)
CAS:30475
Formula: CH2=CDCD=CH2
D-3482
MW: 56.1
98 atom % D
1,3-BUTADIENE-D6 (GAS) (STABILIZED WITH HYDROQUINONE)
CAS:1441-56-1
Formula: CD2=CDCD=CD2
D-97
MW: 60.13
98 atom % D
1,3-DI-ISO-PROPYLBENZENE-D18
CAS:1398065-59-2
Formula: [(CD3)2CD]2C6D4
D-7363
MW: 180.38
99 atom % D
1,3-DIBROMO-5-FLUOROBENZENE-D3
CAS:1219805-87-4
Formula: Br2C6D3F
D-7217
MW: 256.91
98 atom % D
1,3-DIBROMOPROPANE-1,1,3,3-D4
CAS:64528-94-5
Formula: BrCD2CH2CD2Br
D-999
MW: 205.91
98 atom % D
1,3-DIBROMOPROPANE-D6
CAS:120404-22-0
Formula: BrCD2CD2CD2Br
D-1818
MW: 207.92
99 atom % D
1,3-DICHLORO-ISO-PROPYL-D5 ALCOHOL
CAS:1173020-20-6
Formula: ClCD2CD(OH)CD2Cl
D-5033
MW: 134.02
98 atom % D
1,3-DICHLOROACETONE-D4
CAS:350818-52-9
Formula: ClCD2COCD2Cl
D-5030
MW: 130.99
98 atom % D
1,3-DICHLOROBENZENE-D4
CAS:2199-70-4
Formula: C6D4Cl2
D-2405
MW: 151.03
98 atom % D
1,3-DICHLOROPROPENE-D4 (CIS/TRANS MIXTURE)
CAS:202656-23-3
Formula: ClCD2CD=CDCl
D-2669
MW: 115
98 atom % D
1,3-DIETHYLBENZENE-2,4,5,6-D4
CAS:1219803-29-8
Formula: C6D4(CH2CH3)2
D-6307
MW: 138.25
98 atom % D
1,3-DIETHYLBENZENE-D14
CAS:1219803-40-3
Formula: C6D4(CD2CD3)2
D-6308
MW: 148.31
98 atom % D
1,3-DIFLUOROBENZENE-D4
CAS:1173022-08-6
Formula: C6D4F2
D-7612
MW: 118.18
98 atom % D
1,3-DIHYDROXYBENZENE-D6
CAS:70938-00-0
Formula: C6D4(OD)2
D-1792
MW: 116.15
98 atom % D
1,3-DIMETHOXY-D6-BENZENE
CAS:16469-85-5
Formula: C6H4(OCD3)2
D-5430
MW: 144.2
99 atom % D
1,3-DIMETHOXYBENZENE-2,4,5,6-D4
CAS:362049-44-3
Formula: C6D4(OCH3)2
D-5429
MW: 142.19
98 atom % D
1,3-DIMETHOXYBENZENE-D10
CAS:340257-57-0
Formula: C6D4(OCD3)2
D-1421
MW: 148.23
99 atom % D
1,3-DINITROBENZENE-D4
CAS:54247-05-1
Formula: C6D4(NO2)2
D-1937
MW: 172.13
98 atom % D
1,3-DIPHENYL-D10-UREA
CAS:108009-46-7
Formula: (C6D5NH)2CO
D-7664
MW: 222.31
99 atom % D
1,3-PROPANE-1,1,3,3-D4-DIAMINE
CAS:347840-13-5
Formula: H2NCD2CH2CD2NH2
D-3731
MW: 78.15
99 atom % D
1,3-PROPANE-1,1,3,3-D4-DIAMINE 2HCL
CAS:193945-44-7
Formula: H2NCD2CH2CD2NH2•2HCl
D-5663
MW: 151.07
99 atom % D
1,3-PROPANE-2,2-D2-DIAMINE
CAS:352438-78-9
Formula: H2NCH2CD2CH2NH2
D-5148
MW: 76.14
98 atom % D
1,3-PROPANE-2,2-D2-DIAMINE 2HCL
CAS:352438-79-0
Formula: H2NCH2CD2CH2NH2•2HCl
D-5150
MW: 149.06
99 atom % D
1,3-PROPANE-2,2-D2-DIOL
CAS:38645-14-6
Formula: HOCH2CD2CH2OH
D-5651
MW: 78.11
98 atom % D
1,3-PROPANE-D6-DIAMINE
CAS:90375-98-7
Formula: H2NCD2CD2CD2NH2
D-5960
MW: 80.16
98 atom % D
1,3-PROPANE-D6-DIAMINE 2HCL
CAS:65898-86-4
Formula: H2NCD2CD2CD2NH2•2HCl
D-5964
MW: 153.08
98 atom % D
1,3-PROPANE-D6-DIOL
CAS:284474-77-7
Formula: HOCD2CD2CD2OH
D-253
MW: 82.13
98 atom % D
1,3-PROPANE-D6-DITHIOL
CAS:1219803-51-6
Formula: HSCD2CD2CD2SH
D-6043
MW: 114.25
98 atom % D
1,3-PROPANEDIOL-D8
CAS:285978-25-8
Formula: DOCD2CD2CD2OD
D-2150
MW: 84.14
98 atom % D
1,3-PROPYLENE-D6 THIOUREA
CAS:1219802-05-7
D-5959
MW: 122.22
98 atom % D
1,4-ANDROSTADIEN-3,17-DIONE-6-METHYLENE-16,16-D2
D-7050
MW: 298.42
98 atom % D
1,4-BENZENE-D4-DIAMINE
CAS:119516-83-5
Formula: C6D4(NH2)2
D-3789
MW: 112.17
98 atom % D
1,4-BENZENEDIAMINE-D8
CAS:153200-73-8
Formula: C6D4(ND2)2
D-3394
MW: 116.19
98 atom % D
1,4-BENZOQUINONE-D4
CAS:2237-14-1
D-5194
MW: 112.12
98 atom % D
1,4-BUTANE-2,2,3,3-D4-DIAMINE 2HCL
CAS:88972-24-1
Formula: H2NCH2CD2CD2CH2NH2•2HCl
D-5401
MW: 165.1
98 atom % D
1,4-BUTANE-D8-DIAMINE
CAS:709608-92-4
Formula: H2NCD2CD2CD2CD2NH2
D-6360
MW: 96.2
98 atom % D
1,4-BUTANE-D8-DIAMINE 2HCL
CAS:284665-22-1
Formula: H2NCD2CD2CD2CD2NH2•2HCl
D-3980
MW: 169.12
98 atom % D
1,4-BUTANE-D8-DITHIOL
CAS:1219805-46-5
Formula: HS(CD2)4SH
D-6208
MW: 130.29
99 atom % D
1,4-CYCLOHEXANE-D10-DIAMINE (CIS/TRANS MIXTURE)
CAS:1219802-80-8
D-6137
MW: 124.25
98 atom % D
1,4-DIAZABICYCLO[2.2.2]OCTANE-D12
CAS:119451-78-4
D-6858
MW: 124.25
98 atom % D
1,4-DIBROMOBENZENE-D4
CAS:4165-56-4
Formula: C6D4Br2
D-634
MW: 239.93
99 atom % D
1,4-DIBROMOBUTANE-1,1,4,4-D4
CAS:36684-45-4
Formula: BrCD2(CH2)2CD2Br
D-6504
MW: 219.94
98 atom % D
1,4-DIBROMOBUTANE-2,2,3,3-D4
CAS:52089-63-1
Formula: BrCH2(CD2)2CH2Br
D-1232
MW: 219.94
98 atom % D
1,4-DIBROMOBUTANE-D8
CAS:68375-92-8
Formula: Br(CD2)4Br
D-52
MW: 223.96
99 atom % D
1,4-DICHLOROBENZENE-D4
CAS:3855-82-1
Formula: C6D4Cl2
D-1034
MW: 151.03
98 atom % D
1,4-DICHLOROBUTANE-D8
CAS:83547-96-0
Formula: Cl(CD2)4Cl
D-942
MW: 135.06
99 atom % D
1,4-DIETHYLBENZENE-2,3,5,6-D4
CAS:923561-79-9
Formula: C6D4(CH2CH3)2
D-6309
MW: 138.25
98 atom % D
1,4-DIETHYLBENZENE-D14
CAS:1219803-64-1
Formula: C6D4(CD2CD3)2
D-6310
MW: 148.31
98 atom % D
1,4-DIMETHOXYBENZENE-D10
CAS:74079-00-8
Formula: C6D4(OCD3)2
D-5177
MW: 148.23
98 atom % D
1,4-NAPHTHOQUINONE-D6
CAS:26473-08-5
D-5803
MW: 164.19
98 atom % D
1,4-PREGNADIEN-11β,17α,21-TRIOL-3,20-DIONE-2,4,6,6,21,21-D6
D-6447
MW: 366.48
98 atom % D
1,4-PREGNADIEN-17α,21-DIOL-3,11,20-TRIONE-2,4,6α,9,12,12,21,21-D8
D-7418
MW: 366.48
98 atom % D
1,4-PREGNADIEN-6α-METHYL-11β,17α,21-TRIOL-3,20-DIONE-21,21-D2
D-6007
MW: 376.49
95 atom % D
1,5-DIBROMOPENTANE-1,1,5,5-D4
CAS:1219803-90-3
Formula: BrCD2(CH2)3CD2Br
D-6071
MW: 233.97
99 atom % D
1,5-DIBROMOPENTANE-D10
CAS:1219802-90-0
Formula: Br(CD2)5Br
D-6113
MW: 240
98 atom % D
1,5-DINITRONAPHTHALENE-D6
CAS:1219804-48-4
D-5813
MW: 224.21
99 atom % D
1,5-PENTANE-1,1,5,5-D4-DIAMINE
CAS:95596-35-3
Formula: H2NCD2(CH2)3CD2NH2
D-6025
MW: 106.2
98 atom % D
1,5-PENTANE-D10-DIOL
CAS:1219804-42-8
Formula: HO(CD2)5OH
D-5584
MW: 114.21
98 atom % D
1,6-DIBROMOHEXANE-D12
CAS:169397-96-0
Formula: Br(CD2)6Br
D-3766
MW: 256.04
98 atom % D
1,6-HEXANE-1,1,6,6-D4-DIAMINE
CAS:115797-49-4
Formula: H2NCD2(CH2)4CD2NH2
D-323
MW: 120.23
98 atom % D
1,6-HEXANE-1,1,6,6-D4-DIOL
CAS:6843-76-1
Formula: HOCD2(CH2)4CD2OH
D-6321
MW: 122.2
98 atom % D
1,8-DIMETHYLNAPHTHALENE-D12
CAS:104489-29-4
D-4117
MW: 168.3
98 atom % D
1,8-OCTANEDIOIC-2,2,7,7-D4 ACID
CAS:19031-57-3
Formula: HOOCCD2(CH2)4CD2COOH
D-2008
MW: 178.22
98 atom % D
1,8-OCTANEDIOIC-D12 ACID
CAS:169397-99-3
Formula: HOOC(CD2)6COOH
D-5338
MW: 186.27
98 atom % D
1,9-DIBROMONONANE-D18
CAS:150017-89-3
Formula: Br(CD2)9Br
D-2868
MW: 304.16
98 atom % D
1,9-NONANE-2,2,3,3,4,4,5,5,6,6,7,7,8,8-D14-DIOL
CAS:1219805-89-6
Formula: HOCH2(CD2)7CH2OH
D-7223
MW: 174.34
98 atom % D
1,9-NONANEDIOIC-D14 ACID
CAS:119176-67-9
Formula: HOOC(CD2)7COOH
D-3280
MW: 202.31
98 atom % D
1-(2-METHOXY-D3-PHENYLAZO)-2-NAPHTHOL
CAS:1398109-09-5
D-7361
MW: 281.33
99 atom % D
1-AMINOADAMANTANE-2,2,2′,2′,2″,2″-D6
CAS:1219805-53-4
D-7085
MW: 157.29
98 atom % D (also 9% 3,3',3''-d3 and 17% 4,4,4',4',4'',4''-d6)
1-AMINOCYCLOPROPANE-2,2,3,3-D4-CARBOXYLIC ACID
CAS:84392-07-4
D-6292
MW: 105.13
98 atom % D
1-AMINONAPHTHALENE-D7
CAS:78832-53-8
D-5835
MW: 150.23
98 atom % D
1-AMINONAPHTHALENE-D9
CAS:78832-56-1
D-6685
MW: 152.24
98 atom % D
1-BOC-4-(2-HYDROXYETHYL-D4)PIPERAZINE
CAS:1219802-10-4
D-7109
MW: 234.33
99 atom % D
1-BROMO-2,3,5-TRICHLOROBENZENE-D2
CAS:1219803-86-7
Formula: C6D2BrCl3
D-6847
MW: 262.36
98 atom % D
1-BROMO-2,3-DICHLOROBENZENE-D3
CAS:1219805-59-0
Formula: BrC6D3Cl2
D-7176
MW: 228.92
99 atom % D
1-BROMO-2,4-DIFLUOROBENZENE-D3
CAS:1219803-87-8
Formula: BrC6D3F2
D-6946
MW: 196.01
98 atom % D
1-BROMO-2,5-DIFLUOROBENZENE-D3
CAS:1219795-54-6
Formula: BrC6D3F2
D-6473
MW: 196.01
98 atom % D
1-BROMO-2,6-DIFLUOROBENZENE-D3
CAS:1219803-73-2
Formula: BrC6D3F2
D-6064
MW: 196.01
98 atom % D
1-BROMO-2-CHLOROETHANE-D4
CAS:1219795-52-4
Formula: ClCD2CD2Br
D-6445
MW: 147.44
98 atom % D
1-BROMO-2-ETHYLHEXANE-D17
CAS:1398065-97-8
Formula: CD3(CD2)3CD(CD2CD3)CD2Br
D-7471
MW: 210.23
98 atom % D
1-BROMO-2-METHYL-D3-PROPANE-2,3,3,3-D4
CAS:344299-41-8
Formula: (CD3)2CDCH2Br
D-2119
MW: 144.06
98 atom % D
1-BROMO-2-METHYLPROPANE-3,3,3-D3
CAS:344299-42-9
Formula: CD3CH(CH3)CH2Br
D-2120
MW: 140.04
99 atom % D
1-BROMO-2-METHYLPROPANE-D9
CAS:1080497-35-3
Formula: (CD3)2CDCD2Br
D-5927
MW: 146.07
98 atom % D
1-BROMO-3,4-DIFLUOROBENZENE-D3
CAS:1219799-14-0
Formula: BrC6D3F2
D-6474
MW: 196.01
98 atom % D
1-BROMO-3,5-DICHLOROBENZENE-D3
CAS:1219803-83-4
Formula: BrC6D3Cl2
D-6060
MW: 228.92
98 atom % D
1-BROMO-3,5-DIFLUOROBENZENE-D3
CAS:1219798-73-8
Formula: BrC6D3F2
D-6475
MW: 196.01
98 atom % D
1-BROMO-3-CHLORO-5-FLUOROBENZENE-D3
CAS:1219805-00-1
Formula: BrC6D3(Cl)F
D-7220
MW: 212.46
98 atom % D
1-BROMO-3-CHLOROPROPANE-D6
CAS:1173018-46-6
Formula: Cl(CD2)3Br
D-2519
MW: 163.47
98 atom % D
1-BROMO-4-CHLOROBUTANE-D8
CAS:1219803-72-1
Formula: Cl(CD2)4Br
D-6809
MW: 179.51
99 atom % D
1-BROMOBUTANE-1,1,2,2-D4
CAS:1219805-80-7
Formula: CH3CH2CD2CD2Br
D-6294
MW: 141.04
99 atom % D
1-BROMOBUTANE-2,2,3,3,4,4,4-D7
CAS:223487-53-4
Formula: CD3CD2CD2CH2Br
D-6881
MW: 144.06
98 atom % D
1-BROMOBUTANE-2,2-D2
CAS:55724-40-8
Formula: CH3CH2CD2CH2Br
D-6572
MW: 139.03
99 atom % D
1-BROMOBUTANE-3,3,4,4,4-D5
CAS:1219805-37-4
Formula: CD3CD2CH2CH2Br
D-5889
MW: 142.05
98 atom % D
1-BROMOBUTANE-4,4,4-D3
CAS:55724-42-0
Formula: CD3CH2CH2CH2Br
D-1872
MW: 140.04
99 atom % D
1-BROMOBUTANE-D9
CAS:98195-36-9
Formula: CD3CD2CD2CD2Br
D-1172
MW: 146.07
98 atom % D
1-BROMODECANE-1,1,2,2-D4
CAS:1219805-58-9
Formula: CH3(CH2)7CD2CD2Br
D-6295
MW: 225.2
98 atom % D
1-BROMODECANE-10,10,10-D3
CAS:284474-47-1
Formula: CD3(CH2)9Br
D-3972
MW: 224.2
99 atom % D
1-BROMODECANE-9,9,10,10,10-D5
CAS:1219802-02-4
Formula: CD3CD2(CH2)8Br
D-5890
MW: 226.21
98 atom % D
1-BROMODECANE-D21
CAS:98195-39-2
Formula: CD3(CD2)9Br
D-517
MW: 242.31
98 atom % D
1-BROMODODECANE-12,12,12-D3
CAS:204259-68-7
Formula: CD3(CH2)11Br
D-3973
MW: 252.25
99 atom % D
1-BROMODODECANE-D25
CAS:204259-66-5
Formula: CD3(CD2)11Br
D-3979
MW: 274.39
98 atom % D
1-BROMOEICOSANE-20,20,20-D3
CAS:202480-72-6
Formula: CD3(CH2)19Br
D-5252
MW: 364.47
99 atom % D
1-BROMOEICOSANE-D41
CAS:202480-71-5
Formula: CD3(CD2)19Br
D-4016
MW: 402.7
98 atom % D
1-BROMOHEPTANE-1-D1
CAS:38007-40-8
Formula: CH3(CH2)5CHDBr
D-7219
MW: 180.11
99 atom % D
1-BROMOHEPTANE-5,5,6,6,7,7,7-D7
CAS:1219802-55-7
Formula: CD3(CD2)2(CH2)4Br
D-6781
MW: 186.14
98 atom % D
1-BROMOHEPTANE-6,6,7,7,7-D5
CAS:1219805-66-9
Formula: CD3CD2(CH2)5Br
D-5754
MW: 184.13
99 atom % D
1-BROMOHEPTANE-7,7,7-D3
CAS:344253-18-5
Formula: CD3(CH2)6Br
D-5215
MW: 182.12
99 atom % D
1-BROMOHEPTANE-D15
CAS:98195-42-7
Formula: CD3(CD2)6Br
D-1724
MW: 194.19
98 atom % D
1-BROMOHEXADECANE-1,1,2,2-D4
CAS:1219805-65-8
Formula: CH3(CH2)13CD2CD2Br
D-6402
MW: 309.37
98 atom % D
1-BROMOHEXADECANE-16,16,16-D3
CAS:284474-40-4
Formula: CD3(CH2)15Br
D-3986
MW: 308.36
99 atom % D
1-BROMOHEXADECANE-D33
CAS:284474-41-5
Formula: CD3(CD2)15Br
D-4000
MW: 338.54
98 atom % D
1-BROMOHEXANE-1,1,2,2-D4
CAS:1219802-83-1
Formula: CH3(CH2)3CD2CD2Br
D-7121
MW: 169.1
98 atom % D
1-BROMOHEXANE-1,1-D2
CAS:78904-38-8
Formula: CH3(CH2)4CD2Br
D-7164
MW: 167.08
99 atom % D
1-BROMOHEXANE-2,2,3,3,4,4,5,5,6,6,6-D11
CAS:2159-17-3
Formula: CD3(CD2)4CH2Br
D-6509
MW: 176.14
98 atom % D
1-BROMOHEXANE-4,4,5,5,6,6,6-D7
CAS:1276197-43-3
Formula: CD3CD2CD2(CH2)3Br
D-7332
MW: 172.12
98 atom % D
1-BROMOHEXANE-6,6,6-D3
CAS:350818-70-1
Formula: CD3(CH2)5Br
D-5100
MW: 168.09
99 atom % D
1-BROMOHEXANE-D13
CAS:130131-94-1
Formula: CD3(CD2)5Br
D-1723
MW: 178.15
98 atom % D
1-BROMONAPHTHALENE-D7
CAS:37621-57-1
D-7254
MW: 214.11
99 atom % D
1-BROMONONANE-6,6,7,7-D4
CAS:1219805-44-3
Formula: CH3CH2(CD2)2(CH2)5Br
D-6296
MW: 211.18
98 atom % D
1-BROMONONANE-9,9,9-D3
CAS:1219799-20-8
Formula: CD3(CH2)8Br
D-5387
MW: 210.17
99 atom % D
1-BROMONONANE-D19
CAS:1219805-90-9
Formula: CD3(CD2)8Br
D-1726
MW: 226.27
98 atom % D
1-BROMOOCTADECANE-18,18,18-D3
CAS:349553-85-1
Formula: CD3(CH2)17Br
D-3997
MW: 336.41
99 atom % D
1-BROMOOCTADECANE-D37
CAS:187826-28-4
Formula: CD3(CD2)17Br
D-3945
MW: 370.62
98 atom % D
1-BROMOOCTANE-1,1-D2
CAS:86423-34-9
Formula: CH3(CH2)6CD2Br
D-3476
MW: 195.14
99 atom % D
1-BROMOOCTANE-3,3,4,4-D4
CAS:1219803-37-8
Formula: CH3(CH2)3(CD2)2(CH2)2Br
D-7133
MW: 197.15
98 atom % D
1-BROMOOCTANE-8,8,8-D3
CAS:69373-25-7
Formula: CD3(CH2)7Br
D-5101
MW: 196.14
99 atom % D
1-BROMOOCTANE-D17
CAS:126840-36-6
Formula: CD3(CD2)7Br
D-1725
MW: 210.23
98 atom % D
1-BROMOPENTADECANE-1,1,2,2-D4
CAS:1219798-87-4
Formula: CH3(CH2)12CD2CD2Br
D-6459
MW: 295.34
98 atom % D
1-BROMOPENTADECANE-15,15,15-D3
CAS:1219805-83-0
Formula: CD3(CH2)14Br
D-5705
MW: 294.33
99 atom % D
1-BROMOPENTADECANE-D31
CAS:349553-93-1
Formula: CD3(CD2)14Br
D-4019
MW: 322.5
98 atom % D
1-BROMOPENTANE-1,1,2,2-D4
CAS:1219803-61-8
Formula: CH3(CH2)2(CD2)2Br
D-6638
MW: 155.07
99 atom % D
1-BROMOPENTANE-1,1-D2
CAS:77734-75-9
Formula: CH3(CH2)3CD2Br
D-6065
MW: 153.06
99 atom % D
1-BROMOPENTANE-1-D1
CAS:148404-92-6
Formula: CH3(CH2)3CHDBr
D-6932
MW: 152.05
98 atom % D
1-BROMOPENTANE-2,2,3,3,4,4,5,5,5-D9
CAS:156673-70-0
Formula: CD3(CD2)3CH2Br
D-6767
MW: 160.1
98 atom % D
1-BROMOPENTANE-4,4,5,5,5-D5
CAS:83418-34-2
Formula: CD3CD2(CH2)3Br
D-6629
MW: 156.07
99 atom % D
1-BROMOPENTANE-5,5,5-D3
CAS:75736-50-4
Formula: CD3(CH2)4Br
D-3977
MW: 154.06
99 atom % D
1-BROMOPENTANE-D11
CAS:126840-21-9
Formula: CD3(CD2)4Br
D-1722
MW: 162.11
98 atom % D
1-BROMOPROPANE-1,1,2,2-D4
CAS:163400-21-3
Formula: CH3CD2CD2Br
D-403
MW: 127.02
98 atom % D
1-BROMOPROPANE-1,1,3,3,3-D5
CAS:163400-20-2
Formula: CD3CH2CD2Br
D-343
MW: 128.02
98 atom % D
1-BROMOPROPANE-1,1-D2
CAS:40422-05-7
Formula: CH3CH2CD2Br
D-158
MW: 125
99 atom % D
1-BROMOPROPANE-1-D1
CAS:43217-00-1
Formula: CH3CH2CDHBr
D-7257
MW: 124
99 atom % D
1-BROMOPROPANE-2,2,3,3,3-D5
CAS:61066-67-9
Formula: CD3CD2CH2Br
D-225
MW: 128.02
98 atom % D
1-BROMOPROPANE-2,2-D2
CAS:40422-15-9
Formula: CH3CD2CH2Br
D-82
MW: 125
98 atom % D
1-BROMOPROPANE-3,3,3-D3
CAS:61809-88-9
Formula: CD3CH2CH2Br
D-256
MW: 126.01
99 atom % D
1-BROMOPROPANE-D7
CAS:61909-26-0
Formula: CD3CD2CD2Br
D-310
MW: 130.03
98 atom % D
1-BROMOTETRADECANE-1,1,2,2-D4
CAS:1219798-81-8
Formula: CH3(CH2)11CD2CD2Br
D-6510
MW: 281.31
98 atom % D
1-BROMOTETRADECANE-14,14,14-D3
CAS:347840-09-9
Formula: CD3(CH2)13Br
D-3603
MW: 280.31
99 atom % D
1-BROMOTETRADECANE-D29
CAS:347841-80-9
Formula: CD3(CD2)13Br
D-3297
MW: 306.46
98 atom % D
1-BROMOTRIDECANE-1,1,2,2-D4
CAS:284474-45-9
Formula: CH3(CH2)10CD2CD2Br
D-6460
MW: 267.28
98 atom % D
1-BROMOTRIDECANE-D27
CAS:349553-91-9
Formula: CD3(CD2)12Br
D-4011
MW: 290.43
98 atom % D
1-BROMOUNDECANE-1,1,2,2-D4
CAS:1219802-82-0
Formula: CH3(CH2)8(CD2)2Br
D-6751
MW: 239.23
98 atom % D
1-BROMOUNDECANE-11,11,11-D3
CAS:1219805-63-6
Formula: CD3(CH2)10Br
D-6357
MW: 238.23
98 atom % D
1-BROMOUNDECANE-D23
CAS:349553-92-0
Formula: CD3(CD2)10Br
D-4014
MW: 258.35
98 atom % D
1-BUTANE-D9-SULFONYL CHLORIDE
CAS:1219794-70-3
Formula: CD3(CD2)3SO2Cl
D-6021
MW: 165.68
98 atom % D
1-BUTANE-D9-THIOL
CAS:352431-09-5
Formula: CD3(CD2)3SH
D-5311
MW: 99.24
98 atom % D
1-BUTENE-1,1-D2 (GAS)
CAS:26119-76-6
Formula: CH3CH2CH=CD2
D-567
MW: 58.12
98 atom % D
1-BUTENE-4,4,4-D3 (GAS)
CAS:23086-03-5
Formula: CD3CH2CH=CH2
D-1452
MW: 59.13
99 atom % D
1-BUTYNE-3,3,4,4,4-D5 (GAS)
CAS:60173-50-4
Formula: CD3CD2C≡CH
D-7555
MW: 59.12
99 atom % D
1-CHLORO-2,4-DINITROBENZENE-D3
CAS:347840-12-4
Formula: ClC6D3(NO2)2
D-3702
MW: 205.57
98 atom % D
1-CHLOROADAMANTANE-D15
CAS:352431-55-1
D-5303
MW: 185.77
98 atom % D
1-CHLOROBUTANE-D9
CAS:175540-76-8
Formula: CD3CD2CD2CD2Cl
D-1085
MW: 101.62
98 atom % D
1-CHLOROHEXADECANE-D33
CAS:352431-13-1
Formula: CD3(CD2)15Cl
D-5319
MW: 294.09
98 atom % D
1-CHLOROHEXANE-D13
CAS:1219798-45-4
Formula: CD3(CD2)5Cl
D-6476
MW: 133.7
98 atom % D
1-CHLOROOCTANE-D17
CAS:1219803-93-6
Formula: CD3(CD2)7Cl
D-6697
MW: 165.78
98 atom % D
1-CHLOROPROPANE-1,1-D2
CAS:125640-23-5
Formula: CH3CH2CD2Cl
D-5931
MW: 80.55
98 atom % D
1-CHLOROPROPANE-D7
CAS:761374-88-3
Formula: CD3CD2CD2Cl
D-6477
MW: 85.58
98 atom % D
1-DODECANE-D25-THIOL
CAS:869563-00-8
Formula: CD3(CD2)11SH
D-6743
MW: 227.55
98 atom % D
1-HEPTYNE-6,6,7,7,7-D5
CAS:83418-35-3
Formula: CD3CD2CH2CH2CH2C≡CH
D-6628
MW: 101.2
99 atom % D
1-HEXADECANE-D33-THIOL
CAS:218956-22-0
Formula: CD3(CD2)15SH
D-6820
MW: 291.71
98 atom % D
1-HEXANE-D13-THIOL
CAS:1142922-50-6
Formula: CD3(CD2)5SH
D-6419
MW: 131.32
98 atom % D
1-HYDROXYPYRENE-D9
CAS:132603-37-3
D-6040
MW: 227.31
98 atom % D
1-IODOBUTANE-2,2,3,3,4,4,4-D7
Formula: CD3CD2CD2CH2I
D-7652
MW: 191.06
98 atom % D
1-IODOBUTANE-D9 (STABILIZED WITH COPPER)
CAS:59012-24-7
Formula: CD3(CD2)3I
D-1230
MW: 193.07
98 atom % D
1-IODOOCTANE-1,1-D2 (STABILIZED WITH COPPER)
CAS:89232-08-6
Formula: CH3(CH2)6CD2I
D-5831
MW: 242.14
98 atom % D
1-IODOOCTANE-D17 (STABILIZED WITH COPPER)
CAS:340256-37-3
Formula: CD3(CD2)7I
D-1235
MW: 257.23
98 atom % D
1-IODOPENTANE-5,5,5-D3
CAS:920502-31-4
Formula: CD3(CH2)4I
D-6490
MW: 201.06
98 atom % D
1-IODOPROPANE-1,1,2,2-D4 (STABILIZED WITH COPPER)
CAS:1219804-45-1
Formula: CH3CD2CD2l
D-4228
MW: 174.02
98 atom % D
1-IODOPROPANE-1,1,3,3,3-D5 (STABILIZED WITH COPPER)
CAS:1219794-94-1
Formula: CD3CH2CD2I
D-4229
MW: 175.02
98 atom % D
1-IODOPROPANE-1,1-D2 (STABILIZED WITH COPPER)
CAS:25493-14-5
Formula: CH3CH2CD2I
D-36
MW: 172.01
99 atom % D
1-IODOPROPANE-2,2,3,3,3-D5 (STABILIZED WITH COPPER)
CAS:1095269-04-7
Formula: CD3CD2CH2l
D-196
MW: 175.02
98 atom % D
1-IODOPROPANE-2,2-D2 (STABILIZED WITH COPPER)
CAS:25493-15-6
Formula: CH3CD2CH2I
D-328
MW: 172.01
98 atom % D
1-IODOPROPANE-3,3,3-D3 (STABILIZED WITH COPPER)
CAS:25493-16-7
Formula: CD3CH2CH2I
D-4198
MW: 173.01
99 atom % D
1-IODOPROPANE-D7 (STABILIZED WITH COPPER)
CAS:59012-23-6
Formula: CD3(CD2)2I
D-1237
MW: 177.04
98 atom % D
1-METHYL-D3-L-TRYPTOPHAN
D-6971
MW: 221.27
99 atom % D
1-METHYL-D3-5-MERCAPTO-1,2,3,4-TETRAZOLE
CAS:345909-96-8
D-2797
MW: 119.16
99 atom % D
1-METHYL-D3-IMIDAZOLE
CAS:16650-76-3
D-6925
MW: 85.12
99 atom % D
1-METHYLIMIDAZOLE-D3 (RING-D3)
CAS:4166-68-1
D-6425
MW: 85.12
98 atom % D
1-METHYLIMIDAZOLE-D6
CAS:285978-27-0
D-6926
MW: 88.14
98 atom % D
1-METHYLNAPHTHALENE-D10
CAS:38072-94-5
D-1300
MW: 152.26
98 atom % D
1-NAPHTHOL-2,3,4,5,6,7,8-D7
CAS:124251-84-9
Formula: C10D7OH
D-5050
MW: 151.22
98 atom % D
1-NAPHTHOL-D8
CAS:207569-03-7
Formula: C10D7OD
D-2391
MW: 152.22
98 atom % D
1-NITRONAPHTHALENE-D7
CAS:80789-77-1
D-5797
MW: 180.21
98 atom % D
1-NITROPYRENE-D9
CAS:93487-20-8
D-5234
MW: 256.31
98 atom % D
1-O-OCTYL-D17-β-D-GLUCOPYRANOSIDE
CAS:129522-81-2
D-5260
MW: 309.48
98 atom % D
1-OCTADECANE-D37-THIOL
CAS:668433-57-6
Formula: CD3(CD2)17SH
D-6744
MW: 323.78
98 atom % D
1-OCTANE-D17-THIOL
CAS:226999-68-4
Formula: CD3(CD2)7SH
D-6581
MW: 163.39
98 atom % D
1-PENTENE-4,4,5,5,5-D5
CAS:80820-43-5
Formula: CD3CD2CH2CH=CH2
D-5747
MW: 75.16
99 atom % D
1-PHENYL-1-BUTYNE-3,3,4,4,4-D5
CAS:1219803-38-9
Formula: C6H5C≡CCD2CD3
D-6806
MW: 135.22
99 atom % D
1-PHENYL-D5-AZO-2-NAPHTHOL
CAS:752211-63-5
D-6611
MW: 253.31
98 atom % D
1-PHENYLDODECANE-D30
CAS:352431-29-9
Formula: C6D5(CD2)11CD3
D-5230
MW: 276.62
98 atom % D
1-PHENYLPENTADECANE-D36
CAS:352431-31-3
Formula: C6D5(CD2)14CD3
D-5231
MW: 324.74
98 atom % D
1-PROPANE-D7-THIOL
CAS:1219803-52-7
Formula: CD3CD2CD2SH
D-6804
MW: 83.2
98 atom % D
1-PROPANETHIOL-SD
CAS:64071-73-4
Formula: CH3CH2CH2SD
D-222
MW: 77.16
98 atom % D
16α-HYDROXY-17β-ESTRADIOL-2,4,17-D3
CAS:79037-36-8
D-5384
MW: 291.4
98 atom % D
16α-HYDROXY-17β-ESTRADIOL-2,4-D2
CAS:53866-32-3
D-5279
MW: 290.4
98 atom % D
16β-HYDROXY-17β-ESTRADIOL-2,4-D2
CAS:366495-94-5
D-5551
MW: 290.4
98 atom % D
16-(5α)-ANDROSTEN-3-ONE-2,2,4,4-D4
D-7051
MW: 276.45
98 atom % D
16-KETO-17β-ESTRADIOL-2,4,15,15,17-D5
D-5809
MW: 291.4
95 atom % D
17α-ESTRADIOL-2,4-D2
CAS:81586-94-9
D-5431
MW: 274.4
98 atom % D
17α-ETHYNYL-13C2-ESTRADIOL
C-4277
MW: 298.43
99 atom % 13C
17α-ETHYNYLESTRADIOL-16,16-D2 3-METHYL ETHER
D-5990
MW: 312.45
97 atom % D
17α-ETHYNYLESTRADIOL-2,4,16,16-D4
CAS:350820-06-3
D-4319
MW: 300.43
98 atom % D
17α-ETHYNYLESTRADIOL-2,4,16,16-D4 3-METHYL ETHER
D-6142
MW: 314.46
98 atom % D
17α-HYDROXYPREGNENOLONE-21,21,21-D3
CAS:105078-92-0
D-5329
MW: 335.5
97 atom % D
17β-DIHYDROEQUILENIN-4,16,16-D3
D-5659
MW: 271.37
96 atom % D
17β-DIHYDROEQUILIN-16,16,17-D3
CAS:350820-03-0
D-4260
MW: 273.4
98 atom % D
17β-DIHYDROEQUILIN-2,4,16,16,17-D5
D-5833
MW: 275.4
98 atom % D
17β-DIHYDROEQUILIN-2,4,16,16-D4
CAS:350819-99-7
D-4187
MW: 274.39
98 atom % D
17β-ESTRADIOL-16,16,17-D3
CAS:79037-37-9
D-2325
MW: 275.4
98 atom % D
17β-ESTRADIOL-16,16,17-D3 3-BENZOATE
CAS:1192354-74-7
D-7054
MW: 379.51
98 atom % D
17β-ESTRADIOL-16,16-D2
CAS:3188-46-3
D-5433
MW: 274.4
98 atom % D
17β-ESTRADIOL-2,4,16,16,17-D5
CAS:221093-45-4
D-5403
MW: 277.42
98 atom % D
17β-ESTRADIOL-2,4,16,16-D4
CAS:66789-03-5
D-4318
MW: 276.41
98 atom % D
17β-ESTRADIOL-2,4,16,16-D4 17-PENTANOATE
D-7189
MW: 360.53
98 atom % D
17β-ESTRADIOL-2,4-D2
CAS:53866-33-4
D-5432
MW: 274.4
98 atom % D
1H-BENZOTRIAZOLE-4,5,6,7-D4
CAS:1185072-03-0
D-7358
MW: 123.15
99 atom % D
2′,3,4-TRICHLOROBIPHENYL-3′,4′,5′,6′-D4
D-7042
MW: 261.57
98 atom % D
2′,3,5-TRICHLOROBIPHENYL-3′,4′,5′,6′-D4
D-7043
MW: 261.57
98 atom % D
2′-DEOXYURIDINE-5,6-D2
CAS:40632-23-3
D-5352
MW: 230.22
98 atom % D
2′-FLUORODEOXYURIDINE-5,6-D2
CAS:362049-50-1
D-5455
MW: 248.21
98 atom % D
2,2′,3,4,5,5′-HEXACHLOROBIPHENYL-3′,4′,6′-D3
CAS:1219798-51-2
D-6913
MW: 363.9
99 atom % D
2,2′,4,5,5′-PENTACHLOROBIPHENYL-3′,4′,6′-D3
CAS:1219794-68-9
D-6901
MW: 329.45
98 atom % D
2,2′,4,6,6′-PENTACHLOROBIPHENYL-3′,4′,5′-D3
CAS:1219794-64-5
D-6902
MW: 329.45
98 atom % D
2,2′,5,5′-TETRACHLOROBIPHENYL-3,4,6-D3
CAS:1219794-74-7
Formula: C6D3Cl2C6H3Cl2
D-6896
MW: 295.01
98 atom % D
2,2′,5-TRICHLOROBIPHENYL-3,4,4′,6,6′-D5
D-7036
MW: 262.58
98 atom % D
2,2′-DINAPHTHYL-D14
CAS:210487-05-1
D-5746
MW: 268.42
99 atom % D
2,2′-DIPYRIDYL-D8
CAS:32190-42-4
D-1467
MW: 164.24
98 atom % D
2,2,4-TRIMETHYLPENTANE-D18
CAS:51685-57-5
Formula: (CD3)3CCD2CD(CD3)2
D-2010
MW: 132.34
98 atom % D
2,2,6,6-TETRAMETHYLPIPERIDINE-D18-1-OXYL
CAS:205679-68-1
D-7184
MW: 174.36
98 atom % D
2,2-BIS(HYDROXYMETHYL-D2)PROPIONIC-3,3,3-D3 ACID
CAS:1219802-03-5
Formula: (HOCD2)2C(CD3)COOH
D-5483
MW: 141.17
99 atom % D
2,2-DIMETHYLBUTYRIC-D11 ACID
CAS:1219804-04-2
Formula: CD3CD2C(CD3)2COOH
D-5843
MW: 127.23
98 atom % D
2,2-DIMETHYLPROPANE-D12 (GAS)
CAS:5152-54-5
Formula: (CD3)4C
D-105
MW: 84.22
98 atom % D
2,3′,4′,5-TETRACHLOROBIPHENYL-3,4,6-D3
CAS:1219794-77-0
Formula: Cl2C6D3C6H3Cl2
D-6897
MW: 295.01
98 atom % D
2,3′,5-TRICHLOROBIPHENYL-2′,3,4,4′,6,6′-D6
D-7039
MW: 263.58
99 atom % D
2,3,3′,4,4′,5-HEXACHLOROBIPHENYL-2′,6,6′-D3
CAS:1219798-44-3
D-6914
MW: 363.9
98 atom % D
2,3,3′,4,5,5′-HEXACHLOROBIPHENYL-2′,4′,6′-D3
CAS:1219798-69-2
D-6915
MW: 363.9
98 atom % D
2,3,4′-TRICHLOROBIPHENYL-2′,3′,5′,6′-D4
D-7038
MW: 261.57
98 atom % D
2,3,4,4′,5-PENTACHLOROBIPHENYL-2′,3′,5′,6′-D4
CAS:1219799-24-2
D-6912
MW: 330.46
98 atom % D
2,3,4,5,6-PENTACHLOROBIPHENYL-2′,3′,4′,5′,6′-D5
CAS:1219798-92-1
Formula: C6Cl5C6D5
D-6493
MW: 331.47
98 atom % D
2,3,4-TRICHLOROBIPHENYL-2′,3′,4′,5′,6′-D5
CAS:1219805-70-5
D-7037
MW: 262.58
99 atom % D
2,3,4-TRIHYDROXYBENZOPHENONE-2′,3′,4′,5′,6′-D5
Formula: (HO)3C6H2COC6D5
D-7646
MW: 235.25
98 atom % D
2,3,5,6-TETRACHLOROANILINE-D3
CAS:1219806-05-9
Formula: Cl4C6DND2
D-6911
MW: 233.93
99 atom % D
2,3,5,6-TETRACHLOROBIPHENYL-2′,3′,4′,5′,6′-D5
CAS:1219794-80-5
Formula: C6HCl4C6D5
D-6941
MW: 297.02
98 atom % D
2,3,5-TRIMETHYLPHENOL-D11
CAS:362049-46-5
Formula: (CD3)3C6D2OH
D-5441
MW: 147.26
98 atom % D
2,3,6-TRICHLOROANISOLE-D3 (METHOXY-D3)
CAS:1219798-64-7
Formula: Cl3C6H2OCD3
D-5951
MW: 214.49
99 atom % D
2,3,6-TRICHLOROPHENOL-4,5-D2
CAS:93951-81-6
Formula: Cl3C6D2OH
D-2934
MW: 199.46
97 atom % D
2,3,6-TRIMETHYLPHENOL-D11
CAS:347841-83-2
Formula: (CD3)3C6D2OH
D-3384
MW: 147.26
98 atom % D
2,3-BUTANE-1,1,1,4,4,4-D6-DIOL (MIXTURE OF STEREOISOMERS)
CAS:344750-80-7
Formula: CD3CH(OH)CH(OH)CD3
D-3233
MW: 96.16
98 atom % D
2,3-BUTANE-D8-DIOL (MIXTURE OF STEREOISOMERS)
CAS:347841-77-4
Formula: CD3CD(OH)CD(OH)CD3
D-3234
MW: 98.17
98 atom % D
2,3-BUTANEDIONE-D6
CAS:22026-37-5
Formula: CD3COCOCD3
D-3232
MW: 92.13
98 atom % D
2,3-DICHLOROBENZOIC-D3 ACID
CAS:1126107-18-3
Formula: Cl2C6D3COOH
D-6480
MW: 194.03
98 atom % D
2,3-DICHLOROTOLUENE-4,5,6-D3
CAS:1219798-57-8
Formula: Cl2C6D3CH3
D-6481
MW: 164.05
98 atom % D
2,3-DIMETHYLPENTANE-D16
CAS:1219795-08-0
Formula: CD3CD2CD(CD3)CD(CD3)2
D-6997
MW: 116.3
99 atom % D
2,3-DIMETHYLPYRIDINE-D9
CAS:350818-65-4
D-5078
MW: 116.21
98 atom % D
2,3-PENTANEDIONE-1,1,1,4,4-D5
CAS:352431-46-0
Formula: CH3CD2COCOCD3
D-5268
MW: 105.15
98 atom % D
2,4′,5-TRICHLOROBIPHENYL-2′,3′,5′,6′-D4
Formula: Cl2C6H3C6ClD4
D-6892
MW: 261.57
98 atom % D
2,4′-DICHLOROBIPHENYL-D8
CAS:1219795-19-3
D-6917
MW: 231.15
98 atom % D
2,4,4′-TRICHLOROBIPHENYL-2′,3′,5′,6′-D4
D-6994
MW: 261.57
98 atom % D
2,4,5-TRICHLOROANILINE-D4
CAS:1219804-61-1
Formula: Cl3C6D2ND2
D-6996
MW: 200.49
98 atom % D
2,4,5-TRICHLOROBIPHENYL-2′,3′,4′,5′,6′-D5
CAS:1276197-33-1
D-7040
MW: 262.58
99 atom % D
2,4,5-TRICHLOROPHENOL-3,6-D2
CAS:93951-82-7
Formula: Cl3C6D2OH
D-2935
MW: 199.46
98 atom % D
2,4,6-TRIBROMOANISOLE-D5
CAS:1219795-33-1
Formula: Br3C6D2OCD3
D-5678
MW: 349.86
99 atom % D
2,4,6-TRIBROMOPHENOL-3,5-D2
CAS:1219795-42-2
Formula: Br3C6D2OH
D-5656
MW: 332.81
99 atom % D
2,4,6-TRICHLOROANISOLE-D5
CAS:352439-08-8
Formula: Cl3C6D2OCD3
D-5216
MW: 216.51
98 atom % D
2,4,6-TRICHLOROBIPHENYL-2′,3′,4′,5′,6′-D5
CAS:1219794-85-0
Formula: Cl3C6H2C6D5
D-6938
MW: 262.58
98 atom % D
2,4,6-TRICHLOROPHENOL-3,5-D2
CAS:93951-80-5
Formula: Cl3C6D2OH
D-2279
MW: 199.46
98 atom % D
2,4,6-TRIMETHYLPHENOL-D11
CAS:362049-45-4
Formula: (CD3)3C6D2OH
D-5443
MW: 147.26
98 atom % D
2,4,6-TRIMETHYLPYRIDINE-D11
CAS:1219805-54-5
Formula: (CD3)3C5D2N
D-6254
MW: 132.25
98 atom % D
2,4-DIAMINOTOLUENE-α,α,α-D3
CAS:71111-08-5
Formula: CD3C6H3(NH2)2
D-5472
MW: 125.19
98 atom % D
2,4-DIBROMOPHENOL-3,5,6-D3
CAS:1219805-97-6
Formula: Br2C6D3OH
D-5640
MW: 254.92
98 atom % D
2,4-DICHLOROBENZOIC-D3 ACID
CAS:1398065-99-0
Formula: Cl2C6D3COOH
D-7342
MW: 194.03
98 atom % D
2,4-DICHLOROPHENOL-3,5,6-D3
CAS:93951-74-7
Formula: Cl2C6D3OH
D-2281
MW: 166.02
98 atom % D
2,4-DICHLOROTOLUENE-3,5,6-D3
CAS:1398065-47-8
Formula: Cl2C6D3CH3
D-7341
MW: 164.05
98 atom % D
2,4-DIFLUOROBENZOIC-D3 ACID
CAS:1219804-63-3
Formula: F2C6D3COOH
D-6953
MW: 161.12
98 atom % D
2,4-DIFLUOROTOLUENE-3,5,6-D3
CAS:1219798-79-4
Formula: CH3C6D3F2
D-7172
MW: 131.14
99 atom % D
2,4-DIHYDROXYBENZOPHENONE-2′,3′,4′,5′,6′-D5
CAS:91586-06-0
Formula: (HO)2C6H3COC6D5
D-7645
MW: 219.25
98 atom % D
2,4-DIMETHYL-D6-ANILINE
CAS:1071170-27-8
Formula: (CD3)2C6H3NH2
D-7387
MW: 127.22
98 atom % D
2,4-DIMETHYL-D6-ANILINE HCL
CAS:1219805-38-5
Formula: (CD3)2C6H3NH2•HCl
D-5684
MW: 163.68
99 atom % D
2,4-DIMETHYL-D6-NITROBENZENE
CAS:1398065-58-1
Formula: (CD3)2C6H3NO2
D-7386
MW: 157.2
98 atom % D
2,4-DIMETHYLANILINE-D11
CAS:1398065-83-2
Formula: (CD3)2C6D3ND2
D-7355
MW: 132.25
99 atom % D
2,4-DIMETHYLPHENOL-3,5,6-D3
CAS:93951-75-8
Formula: (CH3)2C6D3OH
D-2284
MW: 125.18
98 atom % D
2,4-DIMETHYLPHENOL-D10
CAS:1219794-86-1
Formula: (CD3)2C6D3OD
D-6311
MW: 132.23
98 atom % D
2,4-DINITROTOLUENE-α,α,α-D3
CAS:70786-68-4
Formula: (NO2)2C6H3CD3
D-5093
MW: 185.15
98 atom % D
2,4-DINITROTOLUENE-3,5,6-D3
CAS:93951-68-9
Formula: (NO2)2C6D3CH3
D-2407
MW: 185.15
98 atom % D
2,5-DI-(TERT-BUTYL-D9)-4-METHOXYPHENOL-3,6-D2
CAS:1219802-07-9
D-6274
MW: 256.48
98 atom % D
2,5-DICHLOROANILINE-3,4,6-D3
CAS:783321-80-2
Formula: Cl2C6D3NH2
D-6479
MW: 165.04
98 atom % D
2,5-DICHLOROBIPHENYL-2′,3′,4′,5′,6′-D5
CAS:1219804-50-8
Formula: Cl2C6H3C6D5
D-6895
MW: 228.13
99 atom % D
2,5-DICHLOROPHENOL-3,4,6-D3
CAS:1219803-68-5
Formula: Cl2C6D3OH
D-6641
MW: 166.02
98 atom % D
2,5-DIFLUOROBENZOIC-D3 ACID
CAS:1219798-63-6
Formula: F2C6D3COOH
D-6484
MW: 161.12
98 atom % D
2,5-HEXANEDIONE-D10
CAS:97135-07-4
Formula: CD3COCD2CD2COCD3
D-2296
MW: 124.2
98 atom % D
2,6,10,14-TETRAMETHYLPENTADECANE-D40
CAS:16416-35-6
Formula: C19D40
D-909
MW: 308.77
98 atom % D
2,6,10,15,19,23-HEXAMETHYLTETRACOSANE-D62
CAS:16514-83-3
Formula: C30D62
D-958
MW: 485.2
98 atom % D
2,6-DI-(TERT-BUTYL-D1)-4-METHYL-D3-PHENOL-3,5-D2
CAS:1219805-62-5
D-5566
MW: 227.4
95 atom % D
2,6-DI-(TERT-BUTYL-D9)-4-METHOXYPHENOL-3,5-D2
CAS:1219799-34-4
D-6748
MW: 256.48
98 atom % D
2,6-DI-(TERT-BUTYL-D9)-4-METHYLPHENOL-3,5-D2,OD
CAS:64502-99-4
D-1765
MW: 241.48
98 atom % D
2,6-DI-ISO-PROPYLPHENOL-D18
CAS:1189467-93-3
Formula: [(CD3)2CD]2C6D3OD
D-6546
MW: 196.38
98 atom % D
2,6-DI-TERT-BUTYL-4-METHYLPHENOL-D24
CAS:1219805-92-1
D-5751
MW: 244.5
98 atom % D
2,6-DIAMINOTOLUENE-α,α,α-D3
CAS:362049-58-9
Formula: CD3C6H3(NH2)2
D-5473
MW: 125.19
97 atom % D
2,6-DIBROMOPHENOL-3,4,5-D3
CAS:1219803-14-1
Formula: Br2C6D3OH
D-4349
MW: 254.92
98 atom % D
2,6-DICHLOROANILINE-3,4,5-D3
CAS:77435-48-4
Formula: Cl2C6D3NH2
D-3311
MW: 165.04
98 atom % D
2,6-DICHLOROBENZAMIDE-3,4,5-D3
CAS:1219804-28-0
D-6700
MW: 193.05
98 atom % D
2,6-DICHLOROBENZOIC-D3 ACID
CAS:1219805-50-1
Formula: Cl2C6D3COOH
D-5707
MW: 194.03
98 atom % D
2,6-DICHLOROBIPHENYL-2′,3′,4′,5′,6′-D5
CAS:1276197-38-6
D-7033
MW: 228.13
99 atom % D
2,6-DICHLOROTOLUENE-3,4,5-D3
CAS:358731-95-0
Formula: Cl2C6D3CH3
D-5567
MW: 164.05
98 atom % D
2,6-DIETHYLANILINE-D15
CAS:285132-89-0
Formula: (CD3CD2)2C6D3ND2
D-3023
MW: 164.33
97 atom % D
2,6-DIFLUOROBENZOIC-D3 ACID
CAS:1219804-21-3
Formula: F2C6D3COOH
D-6073
MW: 161.12
98 atom % D
2,6-DIMETHYL-D6-ANILINE
CAS:919785-81-2
Formula: (CD3)2C6H3NH2
D-6578
MW: 127.22
98 atom % D
2,6-DIMETHYL-D6-NITROBENZENE
CAS:285138-83-2
Formula: (CD3)2C6H3NO2
D-3380
MW: 157.2
98 atom % D


e-Chemicals.com


Chemical Suppliers

Policy & Agreement | Privacy Policy © 2000-2017 ChemBuyersGuide.com All rights reserved