Phone (USA) +1 212-348-5610
Whatsapp: +1 516-336-9307
WeChat: chembuyersguide
Chemical Search
 
























Chemenu Inc.




Country: USA

Chemenu Inc.
PO BOX 1541
MT LAUREL NJ 08054

China Office
Lane 3399, Kangxin Highway,Bldg 5,
Shanghai International Medical Zone,
Pudong New District,
Shanghai, China 201321


Phone: 86-21-2022 2982
FAX: 86-21-2096 2272
E-Mail:E-Mail this Supplier


http://www.chemenu.com/

Chemenu Inc.

Page: Home | 1 | 2 | 3 | 4 | 5 | 6 | 7 | 8 | 9 | 10 | 11 | 12 | 13 | 14 | 15 | 16 | 17 | 18 | 19 | 20 | 21 | 22 | 23 | 24 | 25 | 26 | 27 | 28 | 29 | 30 | 31 | 32 | 33 | 34 | 35 | 36 | 37 | 38 | 39 | 40 | 41 | 42 | 43 | 44 | 45 | 46 | 47 | 48 | 49 | 50 | 51 | 52 | 53 | 54 | 55 | 56 | 57 | 58 | 59 | 60 | 61 | 62 | 63 | 64 | 65 | 66 | 67 | 68 | 69 | 70 | 71 | 72 | 73 | 74 | 75 | 76 | 77 | 78 | 79 | 80 | 81 | 82 | 83 | 84 | 85 | 86 | 87 | 88 | 89 | 90 | 91 | 92 | 93 | 94 | 95 | 96 | 97 | 98 | 99 | 100 | 101 | 102 |
 


249824

2,3-DIMETHYL-1H-INDOL-5-AMINE
CAS:16712-58-6
CM236962
NC1=CC2=C(NC(C)=C2C)C=C1
2,3-DIMETHYL-1H-INDOL-5-OL
CAS:36729-22-3
CM238667
OC1=CC2=C(NC(C)=C2C)C=C1
2,3-DIMETHYL-1H-INDOLE-5-CARBOHYDRAZIDE
CAS:5094-42-8
CM334036
O=C(C1=CC2=C(NC(C)=C2C)C=C1)NN
2,3-DIMETHYL-1H-INDOLE-5-CARBOXAMIDE
CAS:6116-47-8
CM240267
O=C(C1=CC2=C(NC(C)=C2C)C=C1)N
2,3-DIMETHYL-1H-INDOLE-7-CARBONITRILE
CAS:103503-07-7
CM235668
N#CC1=CC=CC2=C1NC(C)=C2C
2,3-DIMETHYL-1H-PYRROLE
CAS:600-28-2
CM333253
CC1=C(C)NC=C1
2,3-DIMETHYL-2,3-DIHYDROIMIDAZO[5,1-B]QUINAZOLIN-9(1H)-ONE
CAS:131229-37-3
CM207355
O=C1N(CN(C)C2C)C2=NC3=C1C=CC=C3
2,3-DIMETHYL-2H-1,4-THIAZINE-6-CARBOXAMIDE
CAS:1956322-75-0
CM250913
O=C(C1=CN=C(C)C(C)S1)N
2,3-DIMETHYL-2H-INDAZOL-5-AMINE
CAS:221681-94-3
CM107550
NC1=CC2=C(C)N(C)N=C2C=C1
2,3-DIMETHYL-2H-INDAZOL-6-AMINE
CAS:444731-72-0
CM108007
NC1=CC2=NN(C)C(C)=C2C=C1
2,3-DIMETHYL-2H-INDAZOL-6-AMINE HYDROCHLORIDE
CAS:635702-60-2
CM104093
Cl.CN1N=C2C=C(N)C=CC2=C1C
2,3-DIMETHYL-2H-INDAZOLE-4-CARBONITRILE
CAS:1341034-60-3
CM235674
N#CC1=CC=CC2=NN(C)C(C)=C12
2,3-DIMETHYL-2H-INDAZOLE-5-CARBALDEHYDE
CAS:1234615-83-8
CM239292
O=CC1=CC2=C(C)N(C)N=C2C=C1
2,3-DIMETHYL-2H-INDAZOLE-5-CARBONITRILE
CAS:1234616-59-1
CM231964
CC1=C2C=C(C#N)C=CC2=NN1C
2,3-DIMETHYL-2H-INDAZOLE-5-CARBOXYLIC ACID
CAS:1234615-82-7
CM240524
O=C(C1=CC2=C(C)N(C)N=C2C=C1)O
2,3-DIMETHYL-2H-INDAZOLE-6-CARBALDEHYDE
CAS:1234615-85-0
CM239296
O=CC1=CC2=NN(C)C(C)=C2C=C1
2,3-DIMETHYL-2H-INDAZOLE-6-CARBONITRILE
CAS:1234615-89-4
CM231971
CC1=C2C=CC(C#N)=CC2=NN1C
2,3-DIMETHYL-2H-INDAZOLE-7-CARBONITRILE
CAS:1341038-80-9
CM235644
N#CC1=CC=CC2=C(C)N(C)N=C12
2,3-DIMETHYL-2H-PYRAZOLO[3,4-B]QUINOLIN-4(9H)-ONE
CAS:100548-62-7
CM242995
O=C1C2=C(C)N(C)N=C2NC3=C1C=CC=C3
2,3-DIMETHYL-2H-PYRAZOLO[4,3-D]PYRIMIDIN-7-AMINE
CAS:51222-25-4
CM287961
NC1=NC=NC2=C(C)N(C)N=C21
2,3-DIMETHYL-3H-IMIDAZO[4,5-C]PYRIDINE
CAS:52538-09-7
CM253408
CN1C(C)=NC2=C1C=NC=C2
2,3-DIMETHYL-3H-IMIDAZO[4,5-F]QUINOLINE
CAS:27832-43-5
CM241177
CN1C2=C(C3=CC=CN=C3C=C2)N=C1C
2,3-DIMETHYL-4,5,6,7-TETRAHYDRO-2H-INDAZOLE
CAS:155935-26-5
CM232002
CC1=C2CCCCC2=NN1C
2,3-DIMETHYL-4,5,6,7-TETRAHYDRO-3H-IMIDAZO[4,5-C]PYRIDINE
CAS:933725-60-1
CM268991
CN1C(C)=NC2=C1CNCC2
2,3-DIMETHYL-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PHENOL
CAS:1487353-47-8
CM210186
OC1=CC=C(B2OC(C)(C)C(C)(C)O2)C(C)=C1C
2,3-DIMETHYL-4-NITRO-1H-INDOLE
CAS:13687-74-6
CM238116
O=[N+](C1=CC=CC2=C1C(C)=C(C)N2)[O-]
2,3-DIMETHYL-4-NITROPHENOL
CAS:19499-93-5
CM184548
OC1=CC=C([N+]([O-])=O)C(C)=C1C
2,3-DIMETHYL-4-PHENYL-1,2,3,4-TETRAHYDROISOQUINOLIN-8-AMINE
CAS:65937-02-2
CM224449
NC1=CC=CC2=C1CN(C)C(C)C2C3=CC=CC=C3
2,3-DIMETHYL-5,6,7,8-TETRAHYDROIMIDAZO[1,2-A]PYRIDIN-8-AMINE
CAS:1483092-87-0
CM287649
NC1C2=NC(C)=C(C)N2CCC1
2,3-DIMETHYL-5,6,7,8-TETRAHYDRONAPHTHALEN-1-AMINE
CAS:692754-81-7
CM236529
NC1=C2CCCCC2=CC(C)=C1C
2,3-DIMETHYL-5-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)-1H-INDOLE
CAS:1279710-70-1
CM207055
CC1(C)C(C)(C)OB(C2=CC3=C(NC(C)=C3C)C=C2)O1
2,3-DIMETHYL-5-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PYRIDINE
CAS:741709-65-9
CM216581
CC1(C)C(C)(C)OB(C2=CN=C(C)C(C)=C2)O1
2,3-DIMETHYL-5-NITRO-1H-PYRIDIN-4-ONE
CAS:68707-72-2
CM329227
O=C1C(C)=C(C)NC=C1[N+]([O-])=O
2,3-DIMETHYL-5-NITROANILINE
CAS:109508-62-5
CM182596
NC1=CC([N+]([O-])=O)=CC(C)=C1C
2,3-DIMETHYL-6-(1H-PYRAZOL-1-YL)QUINOXALINE
CAS:941283-15-4
CM221830
CC1=NC2=CC(N3N=CC=C3)=CC=C2N=C1C
2,3-DIMETHYL-6-(1H-PYRROL-1-YL)QUINOXALINE
CAS:941283-13-2
CM221828
CC1=NC2=CC(N3C=CC=C3)=CC=C2N=C1C
2,3-DIMETHYL-6-(PHENYLAMINO)QUINOXALINE-5,8-DIONE
CAS:7706-42-5
CM222174
O=C(C(NC1=CC=CC=C1)=C2)C3=C(N=C(C)C(C)=N3)C2=O
2,3-DIMETHYL-6-(PIPERIDIN-1-YL)QUINOXALINE
CAS:941283-07-4
CM221827
CC1=NC2=CC(N3CCCCC3)=CC=C2N=C1C
2,3-DIMETHYL-6-(PIPERIDIN-1-YL)QUINOXALINE-5,8-DIONE
CAS:7697-89-4
CM222173
O=C(C(N1CCCCC1)=C2)C3=C(N=C(C)C(C)=N3)C2=O
2,3-DIMETHYL-6-(PYRROLIDIN-1-YL)QUINOXALINE
CAS:941283-06-3
CM221826
CC1=NC2=CC(N3CCCC3)=CC=C2N=C1C
2,3-DIMETHYL-6-(TRIFLUOROMETHYL)-3H-IMIDAZO[4,5-B]PYRIDINE
CAS:1956356-14-1
CM269671
FC(C1=CN=C(N(C)C(C)=N2)C2=C1)(F)F
2,3-DIMETHYL-6-(TRIFLUOROMETHYL)QUINOLIN-4-AMINE
CAS:1708159-64-1
CM256646
NC1=C(C)C(C)=NC2=CC=C(C(F)(F)F)C=C12
2,3-DIMETHYL-6-(TRIFLUOROMETHYL)QUINOLIN-4-OL
CAS:217074-30-1
CM256737
OC1=C(C)C(C)=NC2=CC=C(C(F)(F)F)C=C12
2,3-DIMETHYL-6-HYDROXYMETHYL-2H-INDAZOLE
CAS:1234616-80-8
CM239565
OCC1=CC2=NN(C)C(C)=C2C=C1
2,3-DIMETHYL-6-MORPHOLINOQUINOXALINE-5,8-DIONE
CAS:7697-88-3
CM222185
O=C(C(N1CCOCC1)=C2)C3=C(N=C(C)C(C)=N3)C2=O
2,3-DIMETHYL-6-NITRO-2H-INDAZOLE
CAS:444731-73-1
CM104453
CN1N=C2C=C(C=CC2=C1C)[N+]([O-])=O
2,3-DIMETHYL-6-NITROQUINOLIN-4-AMINE
CAS:828930-80-9
CM245019
NC1=C(C)C(C)=NC2=CC=C([N+]([O-])=O)C=C12
2,3-DIMETHYL-6-NITROQUINOXALIN-5-AMINE
CAS:57436-92-7
CM222196
NC1=C2N=C(C)C(C)=NC2=CC=C1[N+]([O-])=O
2,3-DIMETHYL-6-PHENOXYQUINOLIN-4(1H)-ONE
CAS:217074-36-7
CM259371
O=C1C(C)=C(C)NC2=C1C=C(OC3=CC=CC=C3)C=C2
2,3-DIMETHYL-7-(TRIFLUOROMETHYL)QUINOLIN-4-AMINE
CAS:1707586-72-8
CM256645
NC1=C(C)C(C)=NC2=CC(C(F)(F)F)=CC=C12
2,3-DIMETHYL-7-(TRIFLUOROMETHYL)QUINOLIN-4-OL
CAS:1708371-36-1
CM256736
OC1=C(C)C(C)=NC2=CC(C(F)(F)F)=CC=C12
2,3-DIMETHYL-7-AZAINDOLE
CAS:10299-69-1
CM231901
CC1=C(C)NC2=C1C=CC=N2
2,3-DIMETHYLBENZENESULFONYL CHLORIDE
CAS:2905-31-9
CM124803
O=S(C1=CC=CC(C)=C1C)(Cl)=O
2,3-DIMETHYLBENZENETHIOL
CAS:18800-51-6
CM301650
SC1=CC=CC(C)=C1C
2,3-DIMETHYLBENZO[D]THIAZOL-3-IUM IODIDE
CAS:2785-06-0
CM161142
C[N+]1=C(C)SC2=CC=CC=C12.[I-]
2,3-DIMETHYLBENZOIC ACID
CAS:603-79-2
CM101862
O=C(O)C1=CC=CC(C)=C1C
2,3-DIMETHYLBROMOBENZENE
CAS:576-23-8
CM328469
CC1=C(C)C(Br)=CC=C1
2,3-DIMETHYLBUTAN-2-AMINE
CAS:4358-75-2
CM111143
CC(N)(C)C(C)C
2,3-DIMETHYLBUTANE-2,3-DIOL
CAS:76-09-5
CM254942
CC(O)(C)C(O)(C)C
2,3-DIMETHYLHEX-5-EN-3-OL
CAS:19550-90-4
CM111516
CC(C)C(O)(C)CC=C
2,3-DIMETHYLHYDROQUINONE
CAS:608-43-5
CM253981
OC1=CC=C(O)C(C)=C1C
2,3-DIMETHYLIMIDAZO[1,2-A]PYRIDIN-8-AMINE
CAS:119858-51-4
CM270150
NC1=CC=CN2C1=NC(C)=C2C
2,3-DIMETHYLIMIDAZO[1,2-A]PYRIDIN-8-OL
CAS:114095-27-1
CM328939
OC1=CC=CN2C1=NC(C)=C2C
2,3-DIMETHYLIMIDAZO[2,1-B]THIAZOLE-5-CARBOXYLIC ACID
CAS:1007875-84-4
CM330552
CC(S1)=C(C)N2C1=NC=C2C(O)=O
2,3-DIMETHYLINDOLINE
CAS:22120-50-9
CM146477
CC1C(C)NC2=C1C=CC=C2
2,3-DIMETHYLNAPHTHALEN-1-AMINE
CAS:81824-67-1
CM236515
NC1=C2C=CC=CC2=CC(C)=C1C
2,3-DIMETHYLNAPHTHALENE-1,4-DIYL DIACETATE
CAS:77502-18-2
CM231885
CC1=C(C)C(OC(C)=O)=C2C=CC=CC2=C1OC(C)=O
2,3-DIMETHYLPHENYL 2-(4-BROMOPHENYL)QUINOLINE-4-CARBOXYLATE
CAS:355433-76-0
CM228041
O=C(C1=CC(C2=CC=C(Br)C=C2)=NC3=CC=CC=C13)OC4=CC=CC
2,3-DIMETHYLPHENYL 2-(4-CHLOROPHENYL)QUINOLINE-4-CARBOXYLATE
CAS:355433-66-8
CM223940
O=C(C1=CC(C2=CC=C(Cl)C=C2)=NC3=CC=CC=C13)OC4=CC=CC
2,3-DIMETHYLPHENYL 2-(4-METHOXYPHENYL)QUINOLINE-4-CARBOXYLATE
CAS:355433-86-2
CM224282
O=C(C1=CC(C2=CC=C(OC)C=C2)=NC3=CC=CC=C13)OC4=CC=CC
2,3-DIMETHYLPHENYL 2-(P-TOLYL)QUINOLINE-4-CARBOXYLATE
CAS:355433-59-9
CM228160
O=C(C1=CC(C2=CC=C(C)C=C2)=NC3=CC=CC=C13)OC4=CC=CC(
2,3-DIMETHYLPHENYL 2-PHENYLQUINOLINE-4-CARBOXYLATE
CAS:355433-53-3
CM224052
O=C(C1=CC(C2=CC=CC=C2)=NC3=CC=CC=C13)OC4=CC=CC(C)=
2,3-DIMETHYLPHENYL 8-METHYL-2-PHENYLQUINOLINE-4-CARBOXYLATE
CAS:355421-39-5
CM228146
O=C(C1=CC(C2=CC=CC=C2)=NC3=C(C)C=CC=C13)OC4=CC=CC(
2,3-DIMETHYLPHENYLBORONIC ACID
CAS:183158-34-1
CM135267
OB(C1=CC=CC(C)=C1C)O
2,3-DIMETHYLPIPERAZINE
CAS:84468-52-0
CM335108
CC1C(C)NCCN1
2,3-DIMETHYLPYRAZINE
CAS:5910-89-4
CM120364
CC1=NC=CN=C1C
2,3-DIMETHYLPYRAZOLO[3,2-B][1,3]OXAZOLE-6-CARBOXYLIC ACID
CAS:1365940-87-9
CM327215
O=C(C1=NN2C(OC(C)=C2C)=C1)O
2,3-DIMETHYLPYRIDIN-4-AMINE
CAS:122475-57-4
CM103407
NC1=C(C)C(C)=NC=C1
2,3-DIMETHYLPYRIDIN-4-OL
CAS:68707-71-1
CM254529
OC1=C(C)C(C)=NC=C1
2,3-DIMETHYLPYRIDINE-N-OXIDE
CAS:22710-07-2
CM336292
[O-][N+]1=CC=CC(C)=C1C
2,3-DIMETHYLQUINOLIN-4-OL
CAS:10352-60-0
CM239197
OC1=C(C)C(C)=NC2=CC=CC=C12
2,3-DIMETHYLQUINOLINE-4,6-DIAMINE
CAS:828930-83-2
CM240190
NC1=C(C)C(C)=NC2=CC=C(N)C=C12
2,3-DIMETHYLQUINOLINE-4-CARBOXYLIC ACID
CAS:7120-25-4
CM241413
O=C(C1=C(C)C(C)=NC2=CC=CC=C12)O
2,3-DIMETHYLQUINOXALIN-5-AMINE
CAS:19023-68-8
CM222201
NC1=C2N=C(C)C(C)=NC2=CC=C1
2,3-DIMETHYLQUINOXALIN-5-OL
CAS:56183-38-1
CM221700
OC1=C2N=C(C)C(C)=NC2=CC=C1
2,3-DIMETHYLQUINOXALIN-6-OL
CAS:60729-20-6
CM221711
OC1=CC=C2N=C(C)C(C)=NC2=C1
2,3-DIMETHYLQUINOXALINE-5,6-DIAMINE
CAS:57436-96-1
CM222162
NC1=C2N=C(C)C(C)=NC2=CC=C1N
2,3-DIMETHYLQUINOXALINE-5,8-DIONE
CAS:2768-63-0
CM222184
O=C(C=C1)C2=C(N=C(C)C(C)=N2)C1=O
2,3-DIMETHYLQUINOXALINE-5-CARBOXYLIC ACID
CAS:6924-67-0
CM221407
O=C(C1=C2N=C(C)C(C)=NC2=CC=C1)O
2,3-DIMETHYLQUINOXALINE-6-CARBALDEHYDE
CAS:108763-28-6
CM222253
O=CC1=CC=C2N=C(C)C(C)=NC2=C1
2,3-DIMETHYLQUINOXALINE-6-CARBONITRILE
CAS:17635-28-8
CM222248
N#CC1=CC=C2N=C(C)C(C)=NC2=C1
2,3-DIMETHYLSUCCINIC ACID
CAS:13545-04-5
CM109568
CC(C(C)C(O)=O)C(O)=O
2,3-DIMETHYLTHIOPHENE
CAS:632-16-6
CM199991
CC1=C(C)SC=C1
2,3-DINONYLNAPHTHALENE-1-SULFONIC ACID
CAS:25322-17-2
CM140477
O=S(C1=C2C=CC=CC2=CC(CCCCCCCCC)=C1CCCCCCCCC)(O)=O
2,3-DIOXO-1,2,3,4-TETRAHYDROQUINOXALINE-6-CARBONITRILE
CAS:61875-40-9
CM222429
N#CC1=CC2=C(NC(C(N2)=O)=O)C=C1
2,3-DIOXO-1,2,3,4-TETRAHYDROQUINOXALINE-6-CARBOXYLIC ACID HYDRATE
CAS:1255717-69-1
CM221877
O=C(C1=CC2=C(NC(C(N2)=O)=O)C=C1)O.[H]O[H]
2,3-DIOXOINDOLINE-4-CARBONITRILE
CAS:1165892-60-3
CM235640
N#CC1=CC=CC(NC2=O)=C1C2=O
2,3-DIOXOINDOLINE-5-CARBOXAMIDE
CAS:28283-98-9
CM240489
O=C(C1=CC2=C(NC(C2=O)=O)C=C1)N
2,3-DIOXOINDOLINE-5-CARBOXYLIC ACID
CAS:25128-32-9
CM147363
O=C(C1=CC2=C(NC(C2=O)=O)C=C1)O
2,3-DIOXOINDOLINE-6-CARBALDEHYDE
CAS:115542-14-8
CM239334
O=CC1=CC(NC2=O)=C(C=C1)C2=O
2,3-DIPHENYL-1,2,3,4-TETRAHYDROQUINOXALINE-6-CARBOXYLIC ACID
CAS:1706464-34-7
CM222010
O=C(C1=CC2=C(NC(C3=CC=CC=C3)C(C4=CC=CC=C4)N2)C=C1)
2,3-DIPHENYL-1,4-DIAZASPIRO[4.5]DECA-1,3-DIENE
CAS:5396-98-5
CM139533
C1(C2=CC=CC=C2)=NC3(CCCCC3)N=C1C4=CC=CC=C4
2,3-DIPHENYL-1H-INDOLE
CAS:3469-20-3
CM148579
C(N1)(C2=CC=CC=C2)=C(C3=CC=CC=C3)C4=C1C=CC=C4
2,3-DIPHENYL-1H-INDOLE-7-CARBOXYLIC ACID
CAS:197313-74-9
CM263877
O=C(C1=CC=CC2=C1NC(C3=CC=CC=C3)=C2C4=CC=CC=C4)O
2,3-DIPHENYL-2,3-DIHYDROBENZO[G]QUINAZOLIN-4(1H)-ONE
CAS:144221-31-8
CM209696
O=C1N(C2=CC=CC=C2)C(C3=CC=CC=C3)NC4=C1C=C5C(C=CC=C
2,3-DIPHENYL-2,3-DIHYDROIMIDAZO[2,1-B]QUINAZOLIN-5(1H)-ONE
CAS:106727-33-7
CM204624
O=C1N2C(NC(C3=CC=CC=C3)C2C4=CC=CC=C4)=NC5=C1C=CC=C
2,3-DIPHENYL-3,4-DIHYDRONAPHTHALEN-1(2H)-ONE
CAS:23341-32-4
CM262650
O=C1C(C2=CC=CC=C2)C(C3=CC=CC=C3)CC4=C1C=CC=C4
2,3-DIPHENYLBENZO[F]QUINOXALINE
CAS:10322-25-5
CM221193
C1(C2=CC=CC=C2)=NC3=CC=C(C=CC=C4)C4=C3N=C1C5=CC=CC
2,3-DIPHENYLBENZO[G]QUINOXALINE
CAS:36305-72-3
CM222347
C1(C2=CC=CC=C2)=NC3=CC4=CC=CC=C4C=C3N=C1C5=CC=CC=C
2,3-DIPHENYLCYCLOPROP-2-ENONE
CAS:886-38-4
CM203281
O=C1C(C2=CC=CC=C2)=C1C3=CC=CC=C3
2,3-DIPHENYLIMIDAZO[1,2-C]QUINAZOLINE
CAS:52747-80-5
CM214850
N12C=NC3=C(C=CC=C3)C1=NC(C4=CC=CC=C4)=C2C5=CC=CC=C
2,3-DIPHENYLIMIDAZO[2,1-A]ISOQUINOLINE
CAS:58582-13-1
CM226094
C12=NC(C3=CC=CC=C3)=C(C4=CC=CC=C4)N1C=CC5=C2C=CC=C
2,3-DIPHENYLNAPHTHALENE
CAS:70489-30-4
CM230490
C1(C2=CC=CC=C2)=C(C3=CC=CC=C3)C=C4C=CC=CC4=C1
2,3-DIPHENYLPIPERAZINE
CAS:143699-24-5
CM336041
C1(C2=CC=CC=C2)NCCNC1C3=CC=CC=C3
2,3-DIPHENYLPYRAZINE
CAS:1588-89-2
CM120407
C1(C2=CC=CC=C2)=NC=CN=C1C3=CC=CC=C3
2,3-DIPHENYLQUINAZOLIN-4(3H)-ONE
CAS:22686-82-4
CM213315
O=C1N(C2=CC=CC=C2)C(C3=CC=CC=C3)=NC4=C1C=CC=C4
2,3-DIPHENYLQUINOLINE
CAS:22514-82-5
CM229782
C1(C2=CC=CC=C2)=NC3=CC=CC=C3C=C1C4=CC=CC=C4
2,3-DIPHENYLQUINOXALIN-5-AMINE
CAS:32044-95-4
CM222197
NC1=C2N=C(C3=CC=CC=C3)C(C4=CC=CC=C4)=NC2=CC=C1
2,3-DIPHENYLQUINOXALIN-5-OL
CAS:102554-55-2
CM222211
OC1=C2N=C(C3=CC=CC=C3)C(C4=CC=CC=C4)=NC2=CC=C1
2,3-DIPHENYLQUINOXALIN-6-OL
CAS:60729-21-7
CM222271
OC1=CC=C2N=C(C3=CC=CC=C3)C(C4=CC=CC=C4)=NC2=C1
2,3-DIPHENYLQUINOXALINE-5-CARBOXYLIC ACID
CAS:90833-20-8
CM221408
O=C(C1=C2N=C(C3=CC=CC=C3)C(C4=CC=CC=C4)=NC2=CC=C1)
2,3-INDOLINEDIONE
CAS:91-56-5
CM147761
O=C1NC2=C(C=CC=C2)C1=O
2,3-METHANOMETHIONINE
CAS:143169-55-5
CM327538
N[C@](C1CSC)(C1)C(O)=O
2,3-O-ISOPROPYLIDENE-D-RIBOFURANOSE
CAS:4099-88-1
CM195677
OC1[C@@H]([C@@H]([C@@H](CO)O1)O2)OC2(C)C
2,3-PYRAZINEDICARBOXYLIC ANHYDRIDE
CAS:4744-50-7
CM168547
O=C1OC(=O)C2=C1N=CC=N2
2,3-PYRIDINEDICARBOXYLIC ANHYDRIDE
CAS:699-98-9
CM121865
O=C(O1)C2=NC=CC=C2C1=O
2,3-THIAZOLIDINEDICARBOXYLIC ACID, 3-(1,1-DIMETHYLETHYL) ESTER, (2S)-
CAS:891192-95-3
CM108949
O=C([C@@H]1SCCN1C(OC(C)(C)C)=O)O
2,3:4,5-DI-O-ISOPROPYLIDENE-B-D-FRUCTOPYRANOSE
CAS:20880-92-6
CM181785
OC[C@@]1([C@H]([C@@H]([C@@H](CO1)O2)OC2(C)C)O3)OC3
2,4'-BIPYRIDINE
CAS:581-47-5
CM174086
C1(C2=CC=NC=C2)=NC=CC=C1
2,4'-DICHLOROBENZOPHENONE
CAS:85-29-0
CM160619
ClC1=CC=C(C=C1)C(=O)C1=C(Cl)C=CC=C1
2,4'-DIFLUORO-[1,1'-BIPHENYL]-3-CARBOXYLIC ACID
CAS:1214332-32-7
CM304926
O=C(C1=C(F)C(C2=CC=C(F)C=C2)=CC=C1)O
2,4'-DIFLUOROBENZOPHENONE
CAS:342-25-6
CM157183
FC1=CC=C(C=C1)C(=O)C1=C(F)C=CC=C1
2,4'-DIMETHYL-1,1'-BIPHENYL
CAS:611-61-0
CM317885
CC1=CC=C(C2=CC=CC=C2C)C=C1
2,4,4,5,5-PENTAMETHYL-1,3,2-DIOXABOROLANE
CAS:94242-85-0
CM137049
CC1(C)C(C)(C)OB(C)O1
2,4,4,6-TETRABROMOCYCLOHEXA-2,5-DIENONE
CAS:20244-61-5
CM202336
BrC1=CC(Br)(Br)C=C(Br)C1=O
2,4,4-TRIMETHYL-1,2,3,4-TETRAHYDROISOQUINOLINE-6,7-DIOL
CAS:742005-52-3
CM242554
OC1=CC2=C(CN(C)CC2(C)C)C=C1O
2,4,4-TRIMETHYL-3,4-DIHYDROQUINAZOLINE
CAS:883555-06-4
CM217982
CC1(C)NC(C)=NC2=C1C=CC=C2
2,4,5,6,7,8-HEXAHYDROPYRAZOLO[3,4-D]AZEPINE HYDROCHLORIDE
CAS:928774-98-5
CM188176
[H]Cl.C12=NNC=C1CCNCC2
2,4,5,6-TETRACHLOROPYRIMIDINE
CAS:1780-40-1
CM121128
ClC1=C(Cl)C(Cl)=NC(Cl)=N1
2,4,5,6-TETRAHYDRO-1H-PYRROLO[3,2,1-IJ]QUINOLINE
CAS:480-73-9
CM228703
N12CCCC3=C1C(CC2)=CC=C3
2,4,5,6-TETRAHYDRO-2-METHYL-3-CYCLOPENTAPYRAZOLE-CARBOXYLIC ACID
CAS:129560-01-6
CM187769
O=C(C1=C(CCC2)C2=NN1C)O
2,4,5,6-TETRAHYDRO-3-CYCLOPENTAPYRAZOLECARBOXYLIC ACID
CAS:884497-47-6
CM332518
OC(C1=C(CCC2)C2=NN1)=O
2,4,5,6-TETRAHYDROPYRROLO[3,4-C]PYRAZOLE
CAS:6573-19-9
CM123435
C1NCC2=NNC=C12
2,4,5,7-TETRAMETHYLQUINOLINE
CAS:139719-13-4
CM240021
CC1=CC(C)=C2C(C)=CC(C)=NC2=C1
2,4,5-TRIBROMO-1-ETHYL-1H-IMIDAZOLE
CAS:31250-75-6
CM186926
CCN1C(Br)=C(Br)N=C1Br
2,4,5-TRIBROMO-1-METHYL-1H-IMIDAZOLE
CAS:1003-91-4
CM187184
CN1C(Br)=C(Br)N=C1Br
2,4,5-TRIBROMO-1-PROPYL-1H-IMIDAZOLE
CAS:31250-78-9
CM186924
CCCN1C(Br)=C(Br)N=C1Br
2,4,5-TRIBROMO-1H-IMIDAZOLE
CAS:2034-22-2
CM329484
BrC1=C(Br)N=C(Br)N1
2,4,5-TRICHLORO-6-METHYLPYRIMIDINE
CAS:6554-69-4
CM121270
CC1=C(Cl)C(Cl)=NC(Cl)=N1
2,4,5-TRICHLORO-7H-PYRROLO[2,3-D]PYRIMIDINE
CAS:1053228-28-6
CM152401
ClC2=CNC1=NC(Cl)=NC(Cl)=C12
2,4,5-TRICHLOROBENZOIC ACID
CAS:50-82-8
CM157779
O=C(O)C1=CC(Cl)=C(Cl)C=C1Cl
2,4,5-TRICHLOROBROMOBENZENE
CAS:29682-44-8
CM192748
ClC1=CC(Cl)=C(Br)C=C1Cl
2,4,5-TRICHLOROPHENOL
CAS:95-95-4
CM336346
OC1=CC(Cl)=C(Cl)C=C1Cl
2,4,5-TRICHLOROPHENYLBORONIC ACID
CAS:220210-55-9
CM128282
OB(C1=CC(Cl)=C(Cl)C=C1Cl)O
2,4,5-TRICHLOROPYRIMIDINE
CAS:5750-76-5
CM108235
ClC1=CN=C(Cl)N=C1Cl
2,4,5-TRICHLOROQUINAZOLINE
CAS:134517-55-8
CM121392
ClC1=CC=CC2=NC(Cl)=NC(Cl)=C12
2,4,5-TRICHLOROTHIAZOLE
CAS:50844-30-9
CM189608
ClC1=C(Cl)N=C(Cl)S1
2,4,5-TRIFLUORO-3-ETHOXY BENZOIC ACID
CAS:169507-61-3
CM157690
CCOC1=C(F)C(F)=CC(C(O)=O)=C1F
2,4,5-TRIFLUORO-3-METHOXYBENZOIC ACID
CAS:112811-65-1
CM161081
O=C(O)C1=CC(F)=C(F)C(OC)=C1F
2,4,5-TRIFLUORO-3-METHOXYBENZOYL CHLORIDE
CAS:112811-66-2
CM327956
O=C(Cl)C1=CC(F)=C(F)C(OC)=C1F
2,4,5-TRIFLUORO-3-METHYLBENZOIC ACID
CAS:112822-85-2
CM160437
O=C(O)C1=CC(F)=C(F)C(C)=C1F
2,4,5-TRIFLUORO-BENZAMIDINE
CAS:764648-43-3
CM194508
N=C(N)C1=CC(F)=C(F)C=C1F
2,4,5-TRIFLUOROBENZALDEHYDE
CAS:165047-24-5
CM250107
O=CC1=CC(F)=C(F)C=C1F
2,4,5-TRIFLUOROBENZENE-1-SULFONYL CHLORIDE
CAS:220227-21-4
CM101796
O=S(C1=CC(F)=C(F)C=C1F)(Cl)=O
2,4,5-TRIFLUOROBENZENESULFONAMIDE
CAS:287172-63-8
CM251929
O=S(C1=CC(F)=C(F)C=C1F)(N)=O
2,4,5-TRIFLUOROBENZONITRILE
CAS:98349-22-5
CM157309
N#CC1=CC(F)=C(F)C=C1F
2,4,5-TRIFLUORONITROBENZENE
CAS:2105-61-5
CM195541
O=[N+](C1=C(F)C=C(F)C(F)=C1)[O-]
2,4,5-TRIFLUOROPHENOL
CAS:2268-16-8
CM117379
OC1=CC(F)=C(F)C=C1F
2,4,5-TRIFLUOROPHENYLACETIC ACID
CAS:209995-38-0
CM251297
C1=C(C(=CC(=C1F)F)F)CC(O)=O
2,4,5-TRIFLUOROPHENYLBORONIC ACID
CAS:247564-72-3
CM135284
OB(O)C1=C(F)C=C(F)C(F)=C1
2,4,5-TRIFLUOROPYRIDINE
CAS:837365-04-5
CM176696
FC1=CN=C(F)C=C1F
2,4,5-TRIFLUOROPYRIMIDINE
CAS:17573-79-4
CM243405
FC1=CN=C(F)N=C1F
2,4,5-TRIIODO-1H-IMIDAZOLE
CAS:1746-25-4
CM187220
IC1=NC(I)=C(I)N1
2,4,5-TRIMETHOXYANILINE
CAS:26510-91-8
CM126876
COC1=CC(N)=C(OC)C=C1OC
2,4,5-TRIMETHOXYBENZOIC ACID
CAS:490-64-2
CM157749
O=C(O)C1=CC(OC)=C(OC)C=C1OC
2,4,5-TRIMETHYL-1-PHENYL-1H-PYRROLE-3-CARBALDEHYDE
CAS:100710-49-4
CM332801
O=CC1=C(C)N(C2=CC=CC=C2)C(C)=C1C
2,4,5-TRIMETHYL-2,5-DIHYDRO-1,3-THIAZOLE
CAS:60633-24-1
CM363680
CC1SC(C)C(C)=N1
2,4,5-TRIMETHYLBENZOIC ACID
CAS:528-90-5
CM162036
O=C(O)C1=CC(C)=C(C)C=C1C
2,4,5-TRIPHENYL-1H-IMIDAZOLE
CAS:484-47-9
CM187232
C1(C2=CC=CC=C2)=NC(C3=CC=CC=C3)=C(C4=CC=CC=C4)N1
2,4,6,6-TETRAMETHYL-3(6H)-PYRIDINONE
CAS:203524-64-5
CM176464
O=C1C(C)=NC(C)(C)C=C1C
2,4,6,7-TETRACHLOROQUINAZOLINE
CAS:1219456-89-9
CM206045
ClC1=CC2=NC(Cl)=NC(Cl)=C2C=C1Cl
2,4,6,7-TETRAHYDROPYRANO[4,3-C]PYRAZOLE
CAS:258353-57-0
CM330835
C12=NNC=C1COCC2
2,4,6,7-TETRAMETHYLQUINOLINE
CAS:72681-40-4
CM240018
CC1=C(C)C=C2C(C)=CC(C)=NC2=C1
2,4,6,8-TETRACHLOROPYRIMIDO[5,4-D]PYRIMIDINE
CAS:32980-71-5
CM167302
ClC1=NC(Cl)=C(N=C(Cl)N=C2Cl)C2=N1
2,4,6,8-TETRACHLOROQUINOLINE
CAS:1447958-11-3
CM259551
ClC1=C2N=C(Cl)C=C(Cl)C2=CC(Cl)=C1
2,4,6,8-TETRAHYDROXYPYRIMIDO[5,4-D]PYRIMIDINE
CAS:6713-54-8
CM166639
O=C1NC(C2=C(N1)C(=O)NC(=O)N2)=O
2,4,6-CYCLOHEPTATRIEN-1-ONE, 2,3-DIHYDROXY-5-(1-METHYLETHYL)-
CAS:29346-20-1
CM107721
O=C1C(O)=C(O)C=C(C(C)C)C=C1
2,4,6-TRI-TERT-BUTYLANILINE
CAS:961-38-6
CM118646
NC1=C(C(C)(C)C)C=C(C(C)(C)C)C=C1C(C)(C)C
2,4,6-TRI-TERT-BUTYLPYRIMIDINE
CAS:67490-21-5
CM166765
CC(C)(C)C1=CC(=NC(=N1)C(C)(C)C)C(C)(C)C
2,4,6-TRIAMINOPYRIMIDINE
CAS:1004-38-2
CM119079
NC1=CC(N)=NC(N)=N1
2,4,6-TRIAMINOPYRIMIDINE-5-CARBONITRILE
CAS:465531-97-9
CM303149
NC1=NC(N)=C(C#N)C(N)=N1
2,4,6-TRIBROMOBENZENE-1,3,5-TRICARBONITRILE
CAS:60510-14-7
CM219688
N#CC1=C(Br)C(C#N)=C(Br)C(C#N)=C1Br
2,4,6-TRIBROMOPYRIDINE
CAS:2408-70-0
CM120613
BrC1=CC(Br)=CC(Br)=N1
2,4,6-TRICHLORO-3,5-DIFLUORO-PYRIDINE
CAS:52074-51-8
CM171897
FC1=C(Cl)N=C(Cl)C(F)=C1Cl
2,4,6-TRICHLORO-3-NITROPYRIDINE
CAS:60186-13-2
CM170652
O=[N+](C1=C(Cl)C=C(Cl)N=C1Cl)[O-]
2,4,6-TRICHLORO-3-NITROQUINOLINE
CAS:259180-81-9
CM260681
O=[N+](C1=C(Cl)C2=CC(Cl)=CC=C2N=C1Cl)[O-]
2,4,6-TRICHLORO-5-(HYDROXYMETHYL)PYRIMIDINE
CAS:1260682-15-2
CM116090
OCC1=C(Cl)N=C(Cl)N=C1Cl
2,4,6-TRICHLORO-5-(METHYLTHIO)PYRIMIDINE
CAS:24795-76-4
CM167954
CSC1=C(Cl)N=C(Cl)N=C1Cl
2,4,6-TRICHLORO-5-CYANOPYRIMIDINE
CAS:3029-64-9
CM166357
C1(=C(C#N)C(=NC(=N1)Cl)Cl)Cl
2,4,6-TRICHLORO-5-NITROPYRIMIDINE
CAS:4359-87-9
CM129096
O=[N+](C1=C(Cl)N=C(Cl)N=C1Cl)[O-]
2,4,6-TRICHLORO-8-METHOXY-3-NITROQUINOLINE
CAS:1447959-26-3
CM263433
O=[N+](C1=C(Cl)C2=CC(Cl)=CC(OC)=C2N=C1Cl)[O-]
2,4,6-TRICHLORO-8-METHOXYQUINOLIN-3-AMINE
CAS:1447949-19-0
CM260683
NC1=C(Cl)C2=CC(Cl)=CC(OC)=C2N=C1Cl
2,4,6-TRICHLORO-8-METHOXYQUINOLINE
CAS:1447952-97-7
CM259059
COC1=C2N=C(Cl)C=C(Cl)C2=CC(Cl)=C1
2,4,6-TRICHLORO-BENZALDEHYDE-OXIME
CAS:22241-21-0
CM329897
O/N=C/C1=C(Cl)C=C(Cl)C=C1Cl
2,4,6-TRICHLOROBENZALDEHYDE
CAS:24473-00-5
CM251652
ClC1=CC(Cl)=C(C=O)C(Cl)=C1
2,4,6-TRICHLOROBENZENE-1-SULFONYL CHLORIDE
CAS:51527-73-2
CM253321
O=S(C1=C(Cl)C=C(Cl)C=C1Cl)(Cl)=O
2,4,6-TRICHLOROBENZONITRILE
CAS:6575-05-9
CM157931
N#CC1=C(Cl)C=C(Cl)C=C1Cl
2,4,6-TRICHLOROBENZOYLCHLORIDE
CAS:4136-95-2
CM154118
O=C(Cl)C1=C(Cl)C=C(Cl)C=C1Cl
2,4,6-TRICHLOROBENZYL ALCOHOL
CAS:217479-60-2
CM251388
ClC1=C(C(Cl)=CC(Cl)=C1)CO
2,4,6-TRICHLORONICOTINALDEHYDE
CAS:1261269-66-2
CM131364
O=CC1=C(Cl)N=C(Cl)C=C1Cl
2,4,6-TRICHLORONICOTINIC ACID
CAS:69422-72-6
CM178090
O=C(O)C1=C(Cl)N=C(Cl)C=C1Cl
2,4,6-TRICHLOROPHENYL 1,2-DIMETHYL-1H-IMIDAZOLE-4-SULFONATE
CAS:1171919-44-0
CM310113
O=S(C1=CN(C)C(C)=N1)(OC2=C(Cl)C=C(Cl)C=C2Cl)=O
2,4,6-TRICHLOROPHENYL FORMATE
CAS:4525-65-9
CM295487
O=COC1=C(Cl)C=C(Cl)C=C1Cl
2,4,6-TRICHLOROPHENYLBORONIC ACID
CAS:73852-18-3
CM136818
OB(O)C1=C(Cl)C=C(Cl)C=C1Cl
2,4,6-TRICHLOROPYRIDIN-3-OL
CAS:58498-59-2
CM176538
OC1=C(Cl)C=C(Cl)N=C1Cl
2,4,6-TRICHLOROPYRIDINE
CAS:16063-69-7
CM107213
ClC1=CC(Cl)=CC(Cl)=N1
2,4,6-TRICHLOROPYRIMIDIN-5-AMINE
CAS:91322-00-8
CM166692
NC1=C(Cl)N=C(Cl)N=C1Cl
2,4,6-TRICHLOROPYRIMIDINE
CAS:3764-01-0
CM104189
ClC1=CC(Cl)=NC(Cl)=N1
2,4,6-TRICHLOROPYRIMIDINE-5-CARBALDEHYDE
CAS:50270-27-4
CM101050
ClC1=NC(=C(C(=N1)Cl)C=O)Cl
2,4,6-TRICHLOROQUINAZOLINE
CAS:20028-68-6
CM110945
ClC1=CC2=C(Cl)N=C(Cl)N=C2C=C1
2,4,6-TRIETHYL 1,3,5-TRIAZINE-2,4,6-TRICARBOXYLATE
CAS:898-22-6
CM325926
O=C(C1=NC(C(OCC)=O)=NC(C(OCC)=O)=N1)OCC
2,4,6-TRIFLUOROANILINE
CAS:363-81-5
CM118454
NC1=C(F)C=C(F)C=C1F
2,4,6-TRIFLUOROBENZALDEHYDE
CAS:58551-83-0
CM253818
C1=C(C(=C(C=C1F)F)C=O)F
2,4,6-TRIFLUOROBENZENESULFONYL CHLORIDE
CAS:220239-64-5
CM327899
O=S(C1=C(F)C=C(F)C=C1F)(Cl)=O
2,4,6-TRIFLUOROBENZOIC ACID
CAS:28314-80-9
CM157105
O=C(O)C1=C(F)C=C(F)C=C1F
2,4,6-TRIFLUOROBENZONITRILE
CAS:96606-37-0
CM157326
N#CC1=C(F)C=C(F)C=C1F
2,4,6-TRIFLUOROBENZOYL CHLORIDE
CAS:79538-29-7
CM328504
O=C(Cl)C1=C(F)C=C(F)C=C1F
2,4,6-TRIFLUOROPHENYLBORONIC ACID
CAS:182482-25-3
CM135243
OB(O)C1=C(F)C=C(F)C=C1F
2,4,6-TRIFLUOROPYRIDINE
CAS:3512-17-2
CM107830
FC1=CC(F)=CC(F)=N1
2,4,6-TRIFLUOROPYRIDINE-3-CARBOXYLIC ACID
CAS:3512-14-9
CM336514
O=C(O)C1=C(F)N=C(F)C=C1F
2,4,6-TRIFLUOROPYRIMIDINE
CAS:696-82-2
CM167252
FC1=CC(F)=NC(F)=N1
2,4,6-TRIHYDROXYBENZENE-1,3,5-TRICARBALDEHYDE
CAS:34374-88-4
CM252347
O=CC1=C(O)C(C=O)=C(O)C(C=O)=C1O
2,4,6-TRIISOPROPYL-N-(QUINOLIN-8-YL)BENZENESULFONAMIDE
CAS:65286-37-5
CM225529
O=S(C1=C(C(C)C)C=C(C(C)C)C=C1C(C)C)(NC2=C3N=CC=CC3
2,4,6-TRIISOPROPYLBENZENESULFONOHYDRAZIDE
CAS:39085-59-1
CM252674
O=S(C1=C(C(C)C)C=C(C(C)C)C=C1C(C)C)(NN)=O
2,4,6-TRIISOPROPYLBENZENESULFONYL CHLORIDE
CAS:6553-96-4
CM186668
O=S(C1=C(C(C)C)C=C(C(C)C)C=C1C(C)C)(Cl)=O
2,4,6-TRIMETHOXY BENZONITRILE
CAS:2571-54-2
CM155734
N#CC1=C(OC)C=C(OC)C=C1OC
2,4,6-TRIMETHOXY-1,3,5-TRIAZINE
CAS:877-89-4
CM243919
COC1=NC(OC)=NC(OC)=N1
2,4,6-TRIMETHOXYANILINE
CAS:14227-17-9
CM118684
NC1=C(OC)C=C(OC)C=C1OC
2,4,6-TRIMETHOXYBENZALDEHYDE
CAS:830-79-5
CM255207
C1=C(OC)C=C(C(=C1OC)C=O)OC
2,4,6-TRIMETHOXYPHENYLBORONIC ACID
CAS:135159-25-0
CM135093
COC1=CC(OC)=C(B(O)O)C(OC)=C1
2,4,6-TRIMETHOXYQUINOLINE-3-CARBALDEHYDE
CAS:51179-19-2
CM257362
O=CC1=C(OC)C2=CC(OC)=CC=C2N=C1OC
2,4,6-TRIMETHYL(1,3-DIOXOLAN-2-YLMETHYL)BENZENE
CAS:898785-34-7
CM301947
CC1=C(CC2OCCO2)C(C)=CC(C)=C1
2,4,6-TRIMETHYL-1,3,5,2,4,6-TRIOXATRIBORINANE
CAS:823-96-1
CM329260
CB1OB(C)OB(C)O1
2,4,6-TRIMETHYL-1H-INDOLE-3-CARBALDEHYDE
CAS:883547-93-1
CM334172
O=CC1=C(C)NC2=C1C(C)=CC(C)=C2
2,4,6-TRIMETHYL-5,6,7,8-TETRAHYDROQUINOLINE
CAS:651733-52-7
CM239470
CC1CC2=C(N=C(C)C=C2C)CC1
2,4,6-TRIMETHYL-N-(2-METHYLQUINOLIN-8-YL)BENZENESULFONAMIDE
CAS:15011-27-5
CM225527
O=S(C1=C(C)C=C(C)C=C1C)(NC2=C3N=C(C)C=CC3=CC=C2)=O
2,4,6-TRIMETHYL-N-(QUINOLIN-8-YL)BENZENESULFONAMIDE
CAS:16082-60-3
CM225528
O=S(C1=C(C)C=C(C)C=C1C)(NC2=C3N=CC=CC3=CC=C2)=O
2,4,6-TRIMETHYLBENZENE-1,3-DIAMINE
CAS:3102-70-3
CM252107
CC1=CC(C)=C(N)C(C)=C1N
2,4,6-TRIMETHYLBENZENE-1-SULFONYL CHLORIDE
CAS:773-64-8
CM103567
CC1=CC(C)=C(C(C)=C1)S(Cl)(=O)=O
2,4,6-TRIMETHYLBENZYL ALCOHOL
CAS:4170-90-5
CM186531
CC1=C(C(C)=CC(C)=C1)CO
2,4,6-TRIMETHYLBROMOBENZENE
CAS:576-83-0
CM253765
CC1=C(Br)C(C)=CC(C)=C1
2,4,6-TRIMETHYLPHENOL
CAS:527-60-6
CM117357
OC1=C(C)C=C(C)C=C1C
2,4,6-TRIMETHYLPHENYLBORONIC ACID
CAS:5980-97-2
CM134312
OB(C1=C(C)C=C(C)C=C1C)O
2,4,6-TRIMETHYLPHENYLGLYOXAL HYDRATE
CAS:142751-35-7
CM280294
O.CC1=C(C(=CC(=C1)C)C)C(=O)C=O
2,4,6-TRIMETHYLPYRIMIDINE-5-CARBOXYLIC ACID
CAS:108397-75-7
CM109657
O=C(C1=C(C)N=C(C)N=C1C)O
2,4,6-TRIMETHYLQUINOLIN-7-AMINE
CAS:122349-91-1
CM224359
NC1=C(C)C=C2C(C)=CC(C)=NC2=C1
2,4,6-TRIMETHYLQUINOLINE
CAS:2243-89-2
CM239061
CC1=CC=C2N=C(C)C=C(C)C2=C1
2,4,6-TRIMETHYLQUINOLINE SULFATE HYDRATE
CAS:7154-29-2
CM223909
CC1=CC=C2N=C(C)C=C(C)C2=C1.O=S(O)(O)=O.[H]O[H]
2,4,6-TRIS(1-PHENYLETHYL)PHENOL
CAS:61788-44-1
CM186562
OC1=C(C(C2=CC=CC=C2)C)C=C(C(C3=CC=CC=C3)C)C=C1C(C4
2,4,6-TRIS(2-CHLOROPHENYL)-1,3,5-TRIAZINE
CAS:857972-74-8
CM322561
ClC1=CC=CC=C1C2=NC(C3=CC=CC=C3Cl)=NC(C4=CC=CC=C4Cl
2,4,6-TRIS(3-CHLOROPHENYL)-1,3,5-TRIAZINE
CAS:307929-35-7
CM322558
ClC1=CC(C2=NC(C3=CC=CC(Cl)=C3)=NC(C4=CC=CC(Cl)=C4)
2,4,6-TRIS(4-CHLOROPHENYL)-1,3,5-TRIAZINE
CAS:3114-54-3
CM322559
ClC1=CC=C(C2=NC(C3=CC=C(Cl)C=C3)=NC(C4=CC=C(Cl)C=C
2,4,7,8-TETRAMETHYLQUINOLINE
CAS:102872-15-1
CM240020
CC1=C2N=C(C)C=C(C)C2=CC=C1C
2,4,7,9-TETRAMETHYL-5-DECYNE-4,7-DIOL
CAS:126-86-3
CM116326
CC(C)CC(O)(C)C#CC(O)(C)CC(C)C
2,4,7,9-TETRAMETHYLBENZO[B][1,8]NAPHTHYRIDIN-5-AMINE
CAS:309726-06-5
CM236463
NC1=C2C(C)=CC(C)=NC2=NC3=C(C)C=C(C)C=C31
2,4,7-TRICHLORO-6-METHOXYQUINOLINE
CAS:1265883-06-4
CM259058
COC1=C(Cl)C=C2N=C(Cl)C=C(Cl)C2=C1
2,4,7-TRICHLORO-8-FLUOROPYRIDO[4,3-D]PYRIMIDINE
CAS:2454396-80-4
CM336305
FC1=C(Cl)N=CC2=C(Cl)N=C(Cl)N=C21
2,4,7-TRICHLOROPYRIDO[2,3-D]PYRIMIDINE
CAS:938443-20-0
CM104573
ClC1=CC=C2C(Cl)=NC(Cl)=NC2=N1
2,4,7-TRICHLOROQUINAZOLINE
CAS:6625-94-1
CM142506
ClC1=CC2=NC(Cl)=NC(Cl)=C2C=C1
2,4,7-TRIMETHOXYQUINOLINE-3-CARBALDEHYDE
CAS:51179-20-5
CM257363
O=CC1=C(OC)C2=CC=C(OC)C=C2N=C1OC
2,4,7-TRIMETHYL-5,6,7,8-TETRAHYDROQUINOLINE
CAS:809241-55-2
CM239471
CC1CCC2=C(N=C(C)C=C2C)C1
2,4,7-TRIMETHYLQUINOLINE
CAS:71633-43-7
CM239060
CC1=CC=C2C(C)=CC(C)=NC2=C1
2,4,8-TRICHLORO-3-NITROQUINOLINE
CAS:1447953-51-6
CM260682
O=[N+](C1=C(Cl)C2=CC=CC(Cl)=C2N=C1Cl)[O-]
2,4,8-TRICHLOROQUINAZOLINE
CAS:62484-29-1
CM142487
ClC1=CC=CC2=C1N=C(Cl)N=C2Cl
2,4,8-TRICHLOROQUINOLIN-3-AMINE
CAS:1447959-14-9
CM257411
NC1=C(Cl)C2=CC=CC(Cl)=C2N=C1Cl
2,4,8-TRICHLOROQUINOLINE
CAS:1695-58-5
CM246849
ClC1=C2N=C(Cl)C=C(Cl)C2=CC=C1
2,4,8-TRIMETHOXYQUINOLINE-3-CARBALDEHYDE
CAS:55934-30-0
CM257364
O=CC1=C(OC)C2=CC=CC(OC)=C2N=C1OC
2,4,8-TRIMETHYL-1,2,3,4-TETRAHYDROQUINOLINE HYDROBROMIDE
CAS:1050556-42-7
CM367057
Br.CC1CC(C)C2=C(N1)C(C)=CC=C2
2,4,8-TRIMETHYL-5,6,7,8-TETRAHYDROQUINOLINE
CAS:809241-38-1
CM239472
CC1CCCC2=C1N=C(C)C=C2C
2,4,8-TRIMETHYLQUINOLINE
CAS:18441-61-7
CM146294
CC1=C2N=C(C)C=C(C)C2=CC=C1
2,4,9-TRIMETHYLBENZO[B][1,8]NAPHTHYRIDIN-5-AMINE
CAS:510721-85-4
CM236464
NC1=C2C(C)=CC(C)=NC2=NC3=C(C)C=CC=C31
2,4-BIS(BENZYLOXY)PYRIMIDIN-5-YLBORONIC ACID
CAS:70523-24-9
CM135734
OB(O)C1=CN=C(OCC2=CC=CC=C2)N=C1OCC1=CC=CC=C1
2,4-BIS(ISOPROPYLAMINO)-6-CHLORO-1,3,5-TRIAZINE
CAS:139-40-2
CM244359
ClC1=NC(NC(C)C)=NC(NC(C)C)=N1
2,4-BIS(METHYLTHIO)PYRIMIDINE
CAS:5909-26-2
CM253863
CSC1=NC(SC)=NC=C1
2,4-BIS(TRIFLUOROMETHYL)BENZALDEHYDE
CAS:59664-42-5
CM253897
O=CC1=CC=C(C(F)(F)F)C=C1C(F)(F)F
2,4-BIS(TRIFLUOROMETHYL)BENZOIC ACID
CAS:32890-87-2
CM157994
O=C(O)C1=CC=C(C(F)(F)F)C=C1C(F)(F)F
2,4-BIS(TRIFLUOROMETHYL)BENZYLAMINE
CAS:286010-20-6
CM296056
NCC1=CC=C(C(F)(F)F)C=C1C(F)(F)F
2,4-BIS(TRIFLUOROMETHYL)PHENYLACETIC ACID
CAS:177952-39-5
CM250399
O=C(O)CC1=CC=C(C(F)(F)F)C=C1C(F)(F)F
2,4-BIS(TRIFLUOROMETHYL)PHENYLBORONIC ACID
CAS:153254-09-2
CM134866
OB(O)C1=CC=C(C=C1C(F)(F)F)C(F)(F)F
2,4-BIS(TRIFLUOROMETHYL)QUINOLIN-7-OL
CAS:91915-69-4
CM224387
OC1=CC=C2C(C(F)(F)F)=CC(C(F)(F)F)=NC2=C1
2,4-BIS(TRIFLUOROMETHYL)TOLUENE
CAS:136664-96-5
CM295827
CC1=CC=C(C(F)(F)F)C=C1C(F)(F)F
2,4-DI([1,1'-BIPHENYL]-3-YL)-6-CHLORO-1,3,5-TRIAZINE
CAS:1205748-61-3
CM248173
ClC1=NC(C2=CC(C3=CC=CC=C3)=CC=C2)=NC(C4=CC(C5=CC=C
2,4-DI(1H-INDOL-3-YL)BUTAN-1-OL
CAS:198763-45-0
CM263191
OCC(C1=CNC2=C1C=CC=C2)CCC3=CNC4=C3C=CC=C4
2,4-DI(PIPERIDIN-1-YL)ANILINE
CAS:436096-88-7
CM252954
NC1=CC=C(N2CCCCC2)C=C1N3CCCCC3
2,4-DI(PIPERIDIN-1-YL)QUINAZOLINE
CAS:28708-93-2
CM213596
C1(N2CCCCC2)=NC(N3CCCCC3)=C4C=CC=CC4=N1
2,4-DI-TERT-AMYLPHENOL
CAS:120-95-6
CM195531
OC1=CC=C(C(C)(C)CC)C=C1C(C)(C)CC
2,4-DI-TERT-BUTYL-5-NITROPHENOL
CAS:873055-57-3
CM132533
OC1=CC([N+]([O-])=O)=C(C(C)(C)C)C=C1C(C)(C)C
2,4-DI-TERT-BUTYL-6-METHYLPHENOL
CAS:616-55-7
CM186605
OC1=C(C(C)(C)C)C=C(C(C)(C)C)C=C1C
2,4-DIAMINO-5,6,7,8-TETRAHYDROQUINAZOLINE-6-CARBOXYLIC ACID
CAS:6974-25-0
CM216394
O=C(C1CC2=C(N)N=C(N)N=C2CC1)O
2,4-DIAMINO-5-CHLOROQUINAZOLINE-6-CARBONITRILE
CAS:18917-75-4
CM212619
N#CC1=C(Cl)C2=C(N)N=C(N)N=C2C=C1
2,4-DIAMINO-5-METHYLQUINAZOLINE-6-CARBALDEHYDE
CAS:93676-21-2
CM219166
O=CC1=C(C)C2=C(N)N=C(N)N=C2C=C1
2,4-DIAMINO-6-METHYLPHENOL DIHYDROCHLORIDE
CAS:81028-94-6
CM325150
OC1=C(C)C=C(N)C=C1N.[H]Cl.[H]Cl
2,4-DIAMINO-6-METHYLPYRIMIDINE
CAS:1791-73-7
CM119265
CC1=CC(N)=NC(N)=N1
2,4-DIAMINO-7-BROMOQUINAZOLINE
CAS:137553-43-6
CM119111
BrC1=CC2=NC(N)=NC(N)=C2C=C1
2,4-DIAMINO-N,N-DIPROPYLQUINAZOLINE-6-SULFONAMIDE
CAS:21882-32-6
CM213236
O=S(C1=CC2=C(N)N=C(N)N=C2C=C1)(N(CCC)CCC)=O
2,4-DIAMINO-N-(SEC-BUTYL)QUINAZOLINE-6-SULFONAMIDE
CAS:86651-19-6
CM217642
O=S(C1=CC2=C(N)N=C(N)N=C2C=C1)(NC(C)CC)=O
2,4-DIAMINO-N-(TERT-BUTYL)QUINAZOLINE-6-SULFONAMIDE
CAS:86651-16-3
CM217641
O=S(C1=CC2=C(N)N=C(N)N=C2C=C1)(NC(C)(C)C)=O
2,4-DIAMINO-N-BUTYLQUINAZOLINE-6-SULFONAMIDE
CAS:21811-08-5
CM213233
O=S(C1=CC2=C(N)N=C(N)N=C2C=C1)(NCCCC)=O
2,4-DIAMINOBENZALDEHYDE
CAS:98276-57-4
CM132597
O=CC1=CC=C(N)C=C1N
2,4-DIAMINOPHENOL
CAS:95-86-3
CM117288
OC1=CC=C(N)C=C1N
2,4-DIAMINOPHENOL SULFATE
CAS:74283-34-4
CM254858
OS(O)(=O)=O.NC1=CC(N)=C(O)C=C1
2,4-DIAMINOPTERIDINE-6-CARBOXYLIC ACID
CAS:716-74-5
CM332702
O=C(C1=NC2=C(N)N=C(N)N=C2N=C1)O
2,4-DIAMINOPYRIDINE
CAS:461-88-1
CM118924
NC1=CC(N)=NC=C1
2,4-DIAMINOPYRIMIDINE
CAS:156-81-0
CM118933
NC1=NC(N)=NC=C1
2,4-DIAMINOPYRIMIDINE-5-CARBONITRILE
CAS:16462-27-4
CM100005
N#CC1=CN=C(N)N=C1N
2,4-DIAMINOPYRIMIDINE-5-CARBOXAMIDE
CAS:66131-74-6
CM254390
O=C(C1=CN=C(N)N=C1N)N
2,4-DIAMINOQUINAZOLINE
CAS:1899-48-5
CM119178
NC1=C2C=CC=CC2=NC(N)=N1
2,4-DIAMINOQUINAZOLINE-6-CARBONITRILE
CAS:18917-68-5
CM212618
N#CC1=CC2=C(N)N=C(N)N=C2C=C1
2,4-DIAMINOQUINAZOLINE-6-CARBOXYLIC ACID
CAS:207562-23-0
CM213140
O=C(C1=CC2=C(N)N=C(N)N=C2C=C1)O
2,4-DIAMINOQUINAZOLINE-6-SULFONAMIDE
CAS:21811-06-3
CM213232
O=S(C1=CC2=C(N)N=C(N)N=C2C=C1)(N)=O
2,4-DIAZASPIRO[5.5]UNDECANE-1,3,5-TRIONE
CAS:52-44-8
CM214830
O=C1NC(NC(C12CCCCC2)=O)=O
2,4-DIBENZYLOXY BENZALDEHYDE
CAS:13246-46-3
CM243534
O=CC1=CC=C(OCC2=CC=CC=C2)C=C1OCC3=CC=CC=C3
2,4-DIBENZYLOXYBENZYL ALCOHOL
CAS:33617-58-2
CM243535
OCC1=CC=C(OCC2=CC=CC=C2)C=C1OCC3=CC=CC=C3
2,4-DIBROMO-1,1'-BIPHENYL
CAS:53592-10-2
CM253484
BrC1=CC=C(C2=CC=CC=C2)C(Br)=C1
2,4-DIBROMO-1,3,5-TRIFLUOROBENZENE
CAS:363-69-9
CM252498
FC1=C(Br)C(F)=C(Br)C(F)=C1
2,4-DIBROMO-1,3-OXAZOLE
CAS:1240598-59-7
CM326773
BrC1=COC(Br)=N1
2,4-DIBROMO-1,3-THIAZOLE
CAS:4175-77-3
CM100028
BrC1=NC(Br)=CS1
2,4-DIBROMO-1,5-DIFLUORO-3-NITROBENZENE
CAS:144450-58-8
CM249458
O=[N+](C1=C(Br)C(F)=CC(F)=C1Br)[O-]
2,4-DIBROMO-1-((2-(TRIMETHYLSILYL)ETHOXY)METHYL)-1H-IMIDAZOLE
CAS:891270-29-4
CM330426
C[Si](CCOCN1C=C(Br)N=C1Br)(C)C
2,4-DIBROMO-1-(TRIFLUOROMETHYL)BENZENE
CAS:7657-10-5
CM317283
FC(C1=CC=C(Br)C=C1Br)(F)F
2,4-DIBROMO-1-FLUOROBENZENE
CAS:1435-53-6
CM249419
FC1=CC=C(Br)C=C1Br
2,4-DIBROMO-1-METHOXYNAPHTHALENE
CAS:28768-94-7
CM233956
COC1=C2C=CC=CC2=C(Br)C=C1Br
2,4-DIBROMO-1-METHYL-1H-IMIDAZOLE
CAS:53857-60-6
CM123061
CN1C=C(Br)N=C1Br
2,4-DIBROMO-1-METHYLBENZENE
CAS:31543-75-6
CM252138
C1=C(C(=CC=C1Br)C)Br
2,4-DIBROMO-1H-IMIDAZOLE
CAS:64591-03-3
CM186809
BrC1=CN=C(Br)N1
2,4-DIBROMO-3,6-DIFLUOROANILINE
CAS:1000577-86-5
CM316033
NC1=C(F)C=C(Br)C(F)=C1Br
2,4-DIBROMO-3-HYDROXYBENZOIC ACID
CAS:91659-00-6
CM328521
O=C(O)C1=CC=C(Br)C(O)=C1Br
2,4-DIBROMO-3-METHYLANILINE
CAS:80948-78-3
CM123898
NC1=CC=C(Br)C(C)=C1Br
2,4-DIBROMO-3-METHYLPYRIDINE
CAS:128071-93-2
CM175688
CC1=C(Br)C=CN=C1Br
2,4-DIBROMO-3A,4,7,7A-TETRAHYDRO-1H-4,7-METHANOINDENE-1,8-DIONE
CAS:32846-64-3
CM269829
O=C1C(Br)=CC2C(C3=O)(Br)C=CC3C12
2,4-DIBROMO-5,6-DIHYDROBENZO[H]QUINAZOLINE
CAS:1823584-53-7
CM212281
BrC1=C2CCC3=CC=CC=C3C2=NC(Br)=N1
2,4-DIBROMO-5-FLUOROPYRIDINE
CAS:1256805-06-7
CM131322
FC1=CN=C(Br)C=C1Br
2,4-DIBROMO-5-FLUOROPYRIMIDINE
CAS:1372096-33-7
CM121253
FC1=CN=C(Br)N=C1Br
2,4-DIBROMO-5-HYDROXYBENZALDEHYDE
CAS:3111-51-1
CM311661
O=CC1=CC(O)=C(Br)C=C1Br
2,4-DIBROMO-5-HYDROXYBENZOIC ACID
CAS:14348-39-1
CM122380
O=C(O)C1=CC(O)=C(Br)C=C1Br
2,4-DIBROMO-5-METHOXYANILINE
CAS:35736-52-8
CM252457
NC1=CC(OC)=C(Br)C=C1Br
2,4-DIBROMO-5-METHYL-1H-IMIDAZOLE
CAS:219814-29-6
CM100050
CC1=C(Br)N=C(Br)N1
2,4-DIBROMO-5-METHYLPYRIMIDINE
CAS:494194-61-5
CM253177
CC1=CN=C(Br)N=C1Br
2,4-DIBROMO-5-METHYLTHIAZOLE
CAS:1206708-88-4
CM190233
CC1=C(Br)N=C(Br)S1
2,4-DIBROMO-5-NITROPYRIDINE
CAS:4487-57-4
CM103377
O=[N+](C1=CN=C(Br)C=C1Br)[O-]
2,4-DIBROMO-6-(TRIFLUOROMETHYL)ANILINE
CAS:71757-14-7
CM118486
NC1=C(C(F)(F)F)C=C(Br)C=C1Br
2,4-DIBROMO-6-(TRIFLUOROMETHYL)PYRIMIDINE
CAS:785778-00-9
CM303724
FC(F)(F)C1=NC(Br)=NC(Br)=C1
2,4-DIBROMO-6-CHLORO-3-METHYLANILINE
CAS:1195139-59-3
CM319699
NC1=C(Cl)C=C(Br)C(C)=C1Br
2,4-DIBROMO-6-CHLOROPYRIDIN-3-OL
CAS:1232433-08-7
CM248399
OC1=C(Br)C=C(Cl)N=C1Br
2,4-DIBROMO-6-ETHYLANILINE
CAS:81100-30-3
CM316872
NC1=C(CC)C=C(Br)C=C1Br
2,4-DIBROMO-6-FLUOROBENZALDEHYDE
CAS:205683-34-7
CM126755
FC1=CC(Br)=CC(Br)=C1C=O
2,4-DIBROMO-6-FLUOROPYRIDIN-3-OL
CAS:1421602-80-3
CM132179
OC1=C(Br)C=C(F)N=C1Br
2,4-DIBROMO-6-ISOPROPYLANILINE
CAS:81090-45-1
CM316850
NC1=C(C(C)C)C=C(Br)C=C1Br
2,4-DIBROMO-6-METHOXYANILINE
CAS:88149-47-7
CM186110
NC1=C(OC)C=C(Br)C=C1Br
2,4-DIBROMO-6-METHYLPYRIDINE
CAS:79055-52-0
CM129383
CC1=CC(Br)=CC(Br)=N1
2,4-DIBROMO-6-NITROPHENOL
CAS:15969-09-2
CM183106
OC1=C([N+]([O-])=O)C=C(Br)C=C1Br
2,4-DIBROMOANILINE
CAS:615-57-6
CM243513
NC1=CC=C(Br)C=C1Br
2,4-DIBROMOBENZALDEHYDE
CAS:5629-98-1
CM253677
O=CC1=CC=C(Br)C=C1Br
2,4-DIBROMOBENZENE-1,3,5-TRIOL
CAS:84743-75-9
CM185791
OC1=CC(O)=C(Br)C(O)=C1Br
2,4-DIBROMOBENZENE-1-SULFONYL CHLORIDE
CAS:72256-95-2
CM308992
O=S(C1=CC=C(Br)C=C1Br)(Cl)=O
2,4-DIBROMOBENZONITRILE
CAS:78222-69-2
CM154175
N#CC1=CC=C(Br)C=C1Br
2,4-DIBROMONAPHTHALEN-1-AMINE
CAS:20191-76-8
CM141667
NC1=C2C=CC=CC2=C(Br)C=C1Br
2,4-DIBROMONICOTINALDEHYDE
CAS:128071-91-0
CM178727
O=CC1=C(Br)N=CC=C1Br
2,4-DIBROMONICOTINONITRILE
CAS:1152617-14-5
CM176847
N#CC1=C(Br)N=CC=C1Br
2,4-DIBROMOPYRIDINE
CAS:58530-53-3
CM102585
BrC1=CC(Br)=NC=C1
2,4-DIBROMOPYRIMIDINE
CAS:3921-01-5
CM121192
BrC1=NC=CC(=N1)Br
2,4-DIBROMOQUINAZOLINE
CAS:872998-61-3
CM142221
BrC2=NC1=CC=CC=C1C(=N2)Br
2,4-DIBROMOQUINOLINE
CAS:20151-40-0
CM145645
BrC1=NC2=C(C=CC=C2)C(Br)=C1
2,4-DIBROMOTHIAZOLE-5-CARBALDEHYDE
CAS:139669-95-7
CM147955
O=CC1=C(Br)N=C(Br)S1
2,4-DIBROMOTHIAZOLE-5-METHANOL
CAS:170232-68-5
CM189888
BrC1=NC(=C(S1)CO)Br
2,4-DIBROMOTHIOPHENE
CAS:3140-92-9
CM199615
BrC1=CC(Br)=CS1
2,4-DICHLORO-1,2-DIHYDRO-1,8-NAPHTHYRIDINE
CAS:1245646-38-1
CM233050
ClC1=CC(Cl)NC2=C1C=CC=N2
2,4-DICHLORO-1,3,5-TRIAZINE
CAS:2831-66-5
CM104401
ClC1=NC(Cl)=NC=N1
2,4-DICHLORO-1,8-NAPHTHYRIDINE
CAS:59514-89-5
CM140844
ClC1=CC(Cl)=C2C=CC=NC2=N1
2,4-DICHLORO-1-(4-CHLORO-2-METHOXYPHENOXY)BENZENE
CAS:4640-01-1
CM253081
COC1=CC(Cl)=CC=C1OC2=CC=C(Cl)C=C2Cl
2,4-DICHLORO-1-(4-NITROPHENOXY)BENZENE
CAS:1836-75-5
CM250638
ClC1=CC=C(OC2=CC=C([N+]([O-])=O)C=C2)C(Cl)=C1
2,4-DICHLORO-1-[(2,4-DICHLOROPHENYL)METHOXYMETHYL]BENZENE
CAS:207974-13-8
CM327783
COC(C1=CC=C(Cl)C=C1Cl)C2=CC=C(Cl)C=C2Cl
2,4-DICHLORO-1-FLUOROBENZENE
CAS:1435-48-9
CM249415
FC1=CC=C(Cl)C=C1Cl
2,4-DICHLORO-1-METHOXYBENZENE
CAS:553-82-2
CM253625
COC1=CC=C(Cl)C=C1Cl
2,4-DICHLORO-1H-PYRROLO[3,2-D]PYRIMIDINE
CAS:1310680-17-1
CM274019
ClC1=C2C(NC(Cl)=N1)=CC=N2
2,4-DICHLORO-3,6-DIMETHYLPYRIDINE
CAS:83791-90-6
CM174157
CC1=CC(Cl)=C(C)C(Cl)=N1
2,4-DICHLORO-3-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PYRIDINE
CAS:1257651-49-2
CM206826
CC1(C)C(C)(C)OB(C2=C(Cl)C=CN=C2Cl)O1
2,4-DICHLORO-3-(TRIFLUOROMETHYL)PYRIDINE
CAS:1186194-98-8
CM130821
FC(F)(F)C1=C(Cl)C=CN=C1Cl
2,4-DICHLORO-3-AMINOPHENOL HYDROCHLORIDE
CAS:61693-43-4
CM254057
OC1=CC=C(Cl)C(N)=C1Cl.[H]Cl
2,4-DICHLORO-3-CYANO-5-FLUOROBENZOIC ACID
CAS:117528-58-2
CM132133
O=C(O)C1=CC(F)=C(Cl)C(C#N)=C1Cl
2,4-DICHLORO-3-CYANOPHENYLBORONIC ACID
CAS:957120-87-5
CM134770
OB(C1=CC=C(Cl)C(C#N)=C1Cl)O
2,4-DICHLORO-3-FLUOROANILINE
CAS:443-93-6
CM304424
NC1=CC=C(Cl)C(F)=C1Cl
2,4-DICHLORO-3-FLUOROBENZONITRILE
CAS:161612-68-6
CM157608
ClC1=C(C#N)C=CC(=C1F)Cl
2,4-DICHLORO-3-FLUORONITROBENZENE
CAS:393-79-3
CM252695
FC1=C(Cl)C([N+]([O-])=O)=CC=C1Cl
2,4-DICHLORO-3-FLUOROPYRIDINE
CAS:628691-85-0
CM120827
FC1=C(Cl)C=CN=C1Cl
2,4-DICHLORO-3-HYDROXYBENZALDEHYDE
CAS:56962-13-1
CM253716
O=CC1=CC=C(Cl)C(O)=C1Cl
2,4-DICHLORO-3-IODOPYRIDINE
CAS:343781-36-2
CM120973
IC1=C(Cl)C=CN=C1Cl
2,4-DICHLORO-3-METHYL-BETA-OXOBENZENEPROPANOIC ACID ETHYL ESTER
CAS:211576-36-2
CM329352
O=C(OCC)CC(C1=CC=C(Cl)C(C)=C1Cl)=O
2,4-DICHLORO-3-METHYLBENZOIC ACID
CAS:83277-23-0
CM158369
O=C(O)C1=CC=C(Cl)C(C)=C1Cl
2,4-DICHLORO-3-METHYLPYRIDINE
CAS:132097-09-7
CM174264
ClC1=NC=CC(=C1C)Cl
2,4-DICHLORO-3-NITROPYRIDINE
CAS:5975-12-2
CM120502
O=[N+](C1=C(Cl)C=CN=C1Cl)[O-]
2,4-DICHLORO-3-NITROQUINOLINE
CAS:132521-66-5
CM256938
O=[N+](C1=C(Cl)C2=CC=CC=C2N=C1Cl)[O-]
2,4-DICHLORO-3-NITROQUINOLINE-6-CARBONITRILE
CAS:1447961-33-2
CM259707
N#CC1=CC=C2N=C(Cl)C([N+]([O-])=O)=C(Cl)C2=C1
2,4-DICHLORO-3-PHENYLQUINOLINE
CAS:108832-15-1
CM229785
ClC1=C(C2=CC=CC=C2)C(Cl)=NC3=CC=CC=C13
2,4-DICHLORO-5,6,7,8-TETRAHYDROPYRIDO[3,4-D]PYRIMIDINE
CAS:1000578-08-4
CM166486
ClC1=C2C(CNCC2)=NC(Cl)=N1
2,4-DICHLORO-5,6,7,8-TETRAHYDROPYRIDO[4,3-D]PYRIMIDINE
CAS:726697-13-8
CM164966
ClC1=C(CNCC2)C2=NC(Cl)=N1
2,4-DICHLORO-5,6,7,8-TETRAHYDROPYRIDO[4,3-D]PYRIMIDINE HYDROCHLORIDE
CAS:1208901-69-2
CM128654
ClC1=C(CNCC2)C2=NC(Cl)=N1.[H]Cl
2,4-DICHLORO-5,6,7,8-TETRAHYDROQUINAZOLINE
CAS:1127-85-1
CM121427
ClC1=C2CCCCC2=NC(Cl)=N1
2,4-DICHLORO-5,6,7,8-TETRAHYDROQUINOLINE
CAS:858279-01-3
CM108743
ClC1=CC(Cl)=NC2=C1CCCC2
2,4-DICHLORO-5,6,7,8-TETRAHYDROQUINOLINE-3-CARBALDEHYDE
CAS:606971-69-1
CM228499
O=CC1=C(Cl)C2=C(N=C1Cl)CCCC2
2,4-DICHLORO-5,6-DIHYDRO-THIENO[2,3-D]PYRIMIDINE
CAS:74901-61-4
CM108553
ClC1=C(CCS2)C2=NC(Cl)=N1
2,4-DICHLORO-5,6-DIHYDROBENZO[H]QUINAZOLINE
CAS:1186410-71-8
CM205579
ClC1=C2CCC3=CC=CC=C3C2=NC(Cl)=N1
2,4-DICHLORO-5,6-DIMETHYLPYRIMIDINE
CAS:1780-32-1
CM166417
CC1=C(C)C(Cl)=NC(Cl)=N1
2,4-DICHLORO-5,7-DIHYDROFURO[3,4-D]PYRIMIDINE
CAS:848398-41-4
CM165022
ClC1=C2C(COC2)=NC(Cl)=N1
2,4-DICHLORO-5,7-DIMETHYL-7H-PYRROLO[2,3-D]PYRIMIDINE
CAS:1638764-36-9
CM289861
CN1C=C(C)C2=C(Cl)N=C(Cl)N=C21
2,4-DICHLORO-5-((ETHYLTHIO)METHYL)PYRIMIDINE
CAS:108141-35-1
CM167673
CCSCC1=CN=C(Cl)N=C1Cl
2,4-DICHLORO-5-(1,3-DIOXOLAN-2-YL)-1,3-THIAZOLE
CAS:141764-85-4
CM363667
ClC1=NC(Cl)=C(S1)C1OCCO1
2,4-DICHLORO-5-(1-PYRAZOLYL)PYRIMIDINE
CAS:1260860-26-1
CM121249
ClC1=NC(Cl)=NC=C1N2N=CC=C2
2,4-DICHLORO-5-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PHENOL
CAS:1256360-32-3
CM206755
OC1=CC(B2OC(C)(C)C(C)(C)O2)=C(Cl)C=C1Cl
2,4-DICHLORO-5-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PYRIMIDINE
CAS:1073354-24-1
CM204688
CC1(C)C(C)(C)OB(C2=CN=C(Cl)N=C2Cl)O1
2,4-DICHLORO-5-(4-METHOXYPHENYL)PYRIMIDINE
CAS:1523618-07-6
CM107147
COC1=CC=C(C2=CN=C(Cl)N=C2Cl)C=C1
2,4-DICHLORO-5-(ETHOXYMETHYL)PYRIMIDINE
CAS:7627-39-6
CM167613
CCOCC1=CN=C(Cl)N=C1Cl
2,4-DICHLORO-5-(IODOMETHYL)PYRIMIDINE
CAS:7627-44-3
CM254952
ICC1=CN=C(Cl)N=C1Cl
2,4-DICHLORO-5-(METHYLTHIO)PYRIMIDINE
CAS:7401-98-1
CM121212
CSC1=CN=C(Cl)N=C1Cl
2,4-DICHLORO-5-(TRICHLOROMETHYL)PYRIMIDINE
CAS:153600-16-9
CM306850
ClC(C1=CN=C(Cl)N=C1Cl)(Cl)Cl
2,4-DICHLORO-5-(TRIFLUOROMETHYL)BENZENAMINE
CAS:320-53-6
CM329567
NC1=CC(C(F)(F)F)=C(Cl)C=C1Cl
2,4-DICHLORO-5-(TRIFLUOROMETHYL)QUINAZOLINE
CAS:134517-56-9
CM142393
FC(C1=CC=CC2=NC(Cl)=NC(Cl)=C12)(F)F
2,4-DICHLORO-5-CYANOTHIAZOLE
CAS:82554-18-5
CM121669
N#CC1=C(Cl)N=C(Cl)S1
2,4-DICHLORO-5-ETHYLPYRIMIDINE
CAS:34171-40-9
CM121245
CCC1=CN=C(Cl)N=C1Cl
2,4-DICHLORO-5-FLUORO-3-NITROBENZOIC ACID
CAS:106809-14-7
CM162125
OC(=O)C1=C(Cl)C(=C(Cl)C(F)=C1)[N+]([O-])=O
2,4-DICHLORO-5-FLUORO-7H-PYRROLO[2,3-D]PYRIMIDINE
CAS:1053228-29-7
CM152402
FC1=CNC2=C1C(Cl)=NC(Cl)=N2
2,4-DICHLORO-5-FLUOROBENZALDEHYDE
CAS:86522-91-0
CM255408
O=CC1=CC(F)=C(Cl)C=C1Cl
2,4-DICHLORO-5-FLUOROBENZOIC ACID
CAS:86522-89-6
CM160661
OC(=O)C1=C(Cl)C=C(Cl)C(F)=C1
2,4-DICHLORO-5-FLUOROBENZOYL CHLORIDE
CAS:86393-34-2
CM329270
O=C(Cl)C1=CC(F)=C(Cl)C=C1Cl
2,4-DICHLORO-5-FLUOROPHENYLBORONIC ACID
CAS:1417914-09-0
CM209074
OB(C1=CC(F)=C(Cl)C=C1Cl)O
2,4-DICHLORO-5-FLUOROPYRIDINE
CAS:189281-48-9
CM131710
FC1=CN=C(Cl)C=C1Cl
2,4-DICHLORO-5-FLUOROPYRIMIDINE
CAS:2927-71-1
CM219871
FC1=CN=C(Cl)N=C1Cl
2,4-DICHLORO-5-FLUOROQUINAZOLINE
CAS:87611-00-5
CM121393
FC1=CC=CC2=NC(Cl)=NC(Cl)=C12
2,4-DICHLORO-5-IODO-7-METHYL-7H-PYRROLO[2,3-D]PYRIMIDINE
CAS:2007910-59-8
CM289757
CN1C=C(I)C2=C(Cl)N=C(Cl)N=C21
2,4-DICHLORO-5-IODO-7H-PYRROLO[2,3-D]PYRIMIDINE
CAS:1012785-51-1
CM103627
ClC1=NC(Cl)=C2C(I)=CNC2=N1
2,4-DICHLORO-5-IODOPYRIDINE
CAS:343781-49-7
CM120992
IC1=CN=C(Cl)C=C1Cl
2,4-DICHLORO-5-IODOPYRIMIDINE
CAS:13544-44-0
CM112286
IC1=CN=C(Cl)N=C1Cl
2,4-DICHLORO-5-IODOQUINAZOLINE
CAS:959237-30-0
CM121415
IC1=CC=CC2=NC(Cl)=NC(Cl)=C12
2,4-DICHLORO-5-METHOXYANILINE
CAS:98446-49-2
CM118571
NC1=CC(OC)=C(Cl)C=C1Cl
2,4-DICHLORO-5-METHOXYPYRIMIDINE
CAS:19646-07-2
CM112168
COC1=CN=C(Cl)N=C1Cl
2,4-DICHLORO-5-METHOXYQUINAZOLINE
CAS:61948-59-2
CM104467
COC1=CC=CC2=C1C(Cl)=NC(Cl)=N2
2,4-DICHLORO-5-METHYL-5H-PYRROLO[3,2-D]PYRIMIDINE
CAS:129872-81-7
CM104075
CN1C=CC2=C1C(Cl)=NC(Cl)=N2
2,4-DICHLORO-5-METHYL-7H-PYRROLO[2,3-D]PYRIMIDINE
CAS:1060815-86-2
CM105619
CC1=CNC2=NC(Cl)=NC(Cl)=C21
2,4-DICHLORO-5-METHYLANILINE
CAS:17601-75-1
CM250363
CC1=CC(N)=C(Cl)C=C1Cl
2,4-DICHLORO-5-METHYLPYRIMIDINE
CAS:1780-31-0
CM104228
CC1=CN=C(Cl)N=C1Cl
2,4-DICHLORO-5-METHYLQUINAZOLINE
CAS:78052-20-7
CM129931
CC1=CC=CC2=NC(Cl)=NC(Cl)=C12
2,4-DICHLORO-5-METHYLTHIAZOLE
CAS:105315-39-7
CM130375
CC1=C(Cl)N=C(Cl)S1
2,4-DICHLORO-5-NITROBENZOIC ACID
CAS:19861-62-2
CM312273
O=C(O)C1=CC([N+]([O-])=O)=C(Cl)C=C1Cl
2,4-DICHLORO-5-NITROPYRIDINE
CAS:4487-56-3
CM105402
O=[N+](C1=CN=C(Cl)C=C1Cl)[O-]
2,4-DICHLORO-5-NITROPYRIMIDINE
CAS:49845-33-2
CM112208
O=[N+](C1=CN=C(Cl)N=C1Cl)[O-]
2,4-DICHLORO-5-PICOLINE
CAS:56961-78-5
CM102117
CC1=CN=C(Cl)C=C1Cl
2,4-DICHLORO-5-THIAZOLECARBOXYLIC ACID
CAS:62019-56-1
CM190045
O=C(C1=C(Cl)N=C(Cl)S1)O
2,4-DICHLORO-5H,6H,7H,8H-PYRIDO[3,4-D]PYRIMIDINE HYDROCHLORIDE
CAS:1000519-40-3
CM363250
Cl.ClC1=NC(Cl)=C2CCNCC2=N1
2,4-DICHLORO-5H,6H,7H-CYCLOPENTA[D]PYRIMIDINE
CAS:5466-43-3
CM166532
C1(=NC(=NC2=C1CCC2)Cl)Cl
2,4-DICHLORO-5H,6H,7H-PYRROLO[2,3-D]PYRIMIDIN-6-ONE
CAS:1520452-96-3
CM103626
ClC1=NC(Cl)=C2CC(=O)NC2=N1
2,4-DICHLORO-5H,7H-THIENO[3,4-D]PYRIMIDINE
CAS:74901-71-6
CM108554
ClC1=C2C(CSC2)=NC(Cl)=N1
2,4-DICHLORO-5H-PYRROLO[3,2-D]PYRIMIDINE
CAS:63200-54-4
CM104040
ClC1=NC(Cl)=C2NC=CC2=N1
2,4-DICHLORO-5H-PYRROLO[3,2-D]PYRIMIDINE-6-CARBOXYLIC ACID
CAS:1781241-35-7
CM333130
O=C(C1=CC2=NC(Cl)=NC(Cl)=C2N1)O
2,4-DICHLORO-6,7-DIHYDRO-5H-CYCLOPENTA[B]PYRIDINE HYDROCHLORIDE
CAS:1187830-87-0
CM128647
ClC1=C(CCC2)C2=NC(Cl)=C1.[H]Cl
2,4-DICHLORO-6,7-DIHYDRO-5H-PYRROLO[3,4-D]PYRIMIDINE
CAS:785775-01-1
CM152221
ClC1=C2C(CNC2)=NC(Cl)=N1
2,4-DICHLORO-6,7-DIHYDROTHIENO[3,2-D]PYRIMIDINE
CAS:74901-69-2
CM151536
ClC1=C2C(CCS2)=NC(Cl)=N1
2,4-DICHLORO-6,8-DIHYDRO-5H-THIOPYRANO[3,4-D]PYRIMIDINE
CAS:1434142-20-7
CM164683
ClC1=C2C(CSCC2)=NC(Cl)=N1
2,4-DICHLORO-6-(2,2,2-TRIFLUOROETHYL)THIENO[2,3-D]PYRIMIDINE
CAS:2055107-43-0
CM329960
FC(F)(F)CC1=CC2=C(Cl)N=C(Cl)N=C2S1
2,4-DICHLORO-6-(4-ETHOXYNAPHTHALEN-1-YL)-1,3,5-TRIAZINE
CAS:21614-17-5
CM233254
ClC1=NC(Cl)=NC(C2=C3C=CC=CC3=C(OCC)C=C2)=N1
2,4-DICHLORO-6-(4-METHOXYPHENYL)PYRIMIDINE
CAS:163263-91-0
CM121193
COC1=CC=C(C2=CC(Cl)=NC(Cl)=N2)C=C1
2,4-DICHLORO-6-(ETHOXYMETHYL)PYRIMIDINE
CAS:1289385-14-3
CM167714
CCOCC1=CC(Cl)=NC(Cl)=N1
2,4-DICHLORO-6-(METHOXYMETHYL)PYRIMIDINE
CAS:1037543-27-3
CM167414
COCC1=NC(Cl)=NC(Cl)=C1
2,4-DICHLORO-6-(METHYLSULFANYL)-5-NITROPYRIMIDINE
CAS:1451885-60-1
CM107044
O=[N+](C1=C(SC)N=C(Cl)N=C1Cl)[O-]
2,4-DICHLORO-6-(NAPHTHALEN-2-YL)-1,3,5-TRIAZINE
CAS:112719-97-8
CM233248
ClC1=NC(C2=CC=C3C=CC=CC3=C2)=NC(Cl)=N1
2,4-DICHLORO-6-(PIPERAZIN-1-YL)-1,3,5-TRIAZINE
CAS:111373-07-0
CM324862
ClC1=NC(N2CCNCC2)=NC(Cl)=N1
2,4-DICHLORO-6-(TRIFLUOROMETHYL)PYRIDIN-3-OL
CAS:1214361-93-9
CM362543
OC1=C(Cl)C=C(N=C1Cl)C(F)(F)F
2,4-DICHLORO-6-(TRIFLUOROMETHYL)PYRIDINE
CAS:39891-02-6
CM124417
FC(C1=CC(Cl)=CC(Cl)=N1)(F)F
2,4-DICHLORO-6-(TRIFLUOROMETHYL)PYRIMIDINE
CAS:16097-64-6
CM121148
FC(C1=CC(Cl)=NC(Cl)=N1)(F)F
2,4-DICHLORO-6-(TRIFLUOROMETHYL)QUINAZOLINE
CAS:864291-30-5
CM121437
FC(C1=CC2=C(Cl)N=C(Cl)N=C2C=C1)(F)F
2,4-DICHLORO-6-(TRIFLUOROMETHYL)QUINOLINE
CAS:852203-17-9
CM123994
FC(C1=CC=C2N=C(Cl)C=C(Cl)C2=C1)(F)F
2,4-DICHLORO-6-ETHOXY-3-NITROQUINOLINE
CAS:1447953-60-7
CM261643
O=[N+](C1=C(Cl)C2=CC(OCC)=CC=C2N=C1Cl)[O-]
2,4-DICHLORO-6-ETHOXYQUINOLINE
CAS:1447960-17-9
CM256847
CCOC1=CC=C2N=C(Cl)C=C(Cl)C2=C1
2,4-DICHLORO-6-ETHYL-7H-PYRROLO[2,3-D]PYRIMIDINE
CAS:1275608-17-7
CM152261
CCC1=CC2=C(Cl)N=C(Cl)N=C2N1
2,4-DICHLORO-6-FLUORO-3-PHENYLQUINOLINE
CAS:274691-28-0
CM262047
FC1=CC=C2N=C(Cl)C(C3=CC=CC=C3)=C(Cl)C2=C1
2,4-DICHLORO-6-FLUOROANILINE
CAS:3831-70-7
CM319942
NC1=C(F)C=C(Cl)C=C1Cl
2,4-DICHLORO-6-FLUOROBENZOIC ACID
CAS:904285-09-2
CM161969
O=C(O)C1=C(F)C=C(Cl)C=C1Cl
2,4-DICHLORO-6-FLUOROQUINAZOLINE
CAS:134517-57-0
CM121391
FC1=CC2=C(Cl)N=C(Cl)N=C2C=C1
2,4-DICHLORO-6-FLUOROQUINOLINE
CAS:406204-74-8
CM102034
FC1=CC=C2N=C(Cl)C=C(Cl)C2=C1
2,4-DICHLORO-6-IODO-7-(PHENYLSULFONYL)-7H-PYRROLO[2,3-D]PYRIMIDINE
CAS:1638763-86-6
CM270762
O=S(N1C(I)=CC2=C(Cl)N=C(Cl)N=C21)(C3=CC=CC=C3)=O
2,4-DICHLORO-6-IODO-7-METHYL-7H-PYRROLO[2,3-D]PYRIMIDINE
CAS:1638763-42-4
CM270768
CN1C(I)=CC2=C(Cl)N=C(Cl)N=C21
2,4-DICHLORO-6-IODO-7H-PYRROLO[2,3-D]PYRIMIDINE
CAS:1638760-47-0
CM270765
IC1=CC2=C(Cl)N=C(Cl)N=C2N1
2,4-DICHLORO-6-IODOANILINE
CAS:697-90-5
CM118471
NC1=C(I)C=C(Cl)C=C1Cl
2,4-DICHLORO-6-IODOPYRROLO[2,1-F][1,2,4]TRIAZINE
CAS:1313738-97-4
CM295552
IC1=CN2N=C(Cl)N=C(Cl)C2=C1
2,4-DICHLORO-6-IODOQUINAZOLINE
CAS:74173-76-5
CM123729
ClC1=NC2=C(C=C(I)C=C2)C(Cl)=N1
2,4-DICHLORO-6-METHOXY-1,5-NAPHTHYRIDINE
CAS:959990-35-3
CM140400
COC1=CC=C2N=C(Cl)C=C(Cl)C2=N1
2,4-DICHLORO-6-METHOXY-3-NITROQUINOLINE
CAS:259180-83-1
CM260277
O=[N+](C1=C(Cl)C2=CC(OC)=CC=C2N=C1Cl)[O-]
2,4-DICHLORO-6-METHOXY-7-(3-(PYRROLIDIN-1-YL)PROPOXY)QUINAZOLINE
CAS:1320288-30-9
CM207486
COC1=CC2=C(Cl)N=C(Cl)N=C2C=C1OCCCN3CCCC3
2,4-DICHLORO-6-METHOXYPYRIDINE
CAS:1227572-43-1
CM102572
COC1=CC(Cl)=CC(Cl)=N1
2,4-DICHLORO-6-METHOXYPYRIMIDINE
CAS:43212-41-5
CM111979
COC1=CC(Cl)=NC(Cl)=N1
2,4-DICHLORO-6-METHOXYQUINAZOLINE
CAS:105763-77-7
CM102408
COC1=CC=C2N=C(Cl)N=C(Cl)C2=C1
2,4-DICHLORO-6-METHOXYQUINOLINE
CAS:70049-46-6
CM128780
COC1=CC=C2N=C(Cl)C=C(Cl)C2=C1
2,4-DICHLORO-6-METHYL-1,3,5-TRIAZINE
CAS:1973-04-2
CM275742
CC1=NC(Cl)=NC(Cl)=N1
2,4-DICHLORO-6-METHYL-1,5-NAPHTHYRIDINE
CAS:959007-01-3
CM232177
CC1=CC=C2N=C(Cl)C=C(Cl)C2=N1
2,4-DICHLORO-6-METHYL-3-NITROPYRIDINE
CAS:63897-12-1
CM173988
O=[N+](C1=C(Cl)C=C(C)N=C1Cl)[O-]
2,4-DICHLORO-6-METHYL-6H-PYRROLO[3,4-D]PYRIMIDINE,
CAS:1357086-92-0
CM152273
CN1C=C2N=C(Cl)N=C(Cl)C2=C1
2,4-DICHLORO-6-METHYL-7H-PYRROLO[2,3-D]PYRIMIDINE
CAS:1192711-71-9
CM105970
CC1=CC2=C(Cl)N=C(Cl)N=C2N1
2,4-DICHLORO-6-METHYLNICOTINIC ACID
CAS:56022-07-2
CM125678
CC1=CC(Cl)=C(C(O)=O)C(Cl)=N1
2,4-DICHLORO-6-METHYLNICOTINONITRILE
CAS:38367-36-1
CM129253
CC1=CC(Cl)=C(C#N)C(Cl)=N1
2,4-DICHLORO-6-METHYLPHENOL
CAS:1570-65-6
CM249819
OC1=C(C)C=C(Cl)C=C1Cl
2,4-DICHLORO-6-METHYLPYRIDINE
CAS:42779-56-6
CM103310
CC1=CC(Cl)=CC(Cl)=N1
2,4-DICHLORO-6-METHYLPYRIMIDIN-5-AMINE
CAS:13162-27-1
CM110922
NC1=C(C)N=C(Cl)N=C1Cl
2,4-DICHLORO-6-METHYLPYRIMIDINE
CAS:5424-21-5
CM166617
CC1=CC(Cl)=NC(Cl)=N1
2,4-DICHLORO-6-METHYLPYRIMIDINE-5-CARBALDEHYDE
CAS:933686-24-9
CM126409
CC1=NC(Cl)=NC(Cl)=C1C=O
2,4-DICHLORO-6-METHYLQUINAZOLINE
CAS:39576-82-4
CM121434
CC1=CC2=C(Cl)N=C(Cl)N=C2C=C1
2,4-DICHLORO-6-METHYLQUINOLINE
CAS:102878-18-2
CM146346
CC1=CC=C2N=C(Cl)C=C(Cl)C2=C1
2,4-DICHLORO-6-METHYLTHIENO[2,3-D]PYRIMIDINE
CAS:76872-23-6
CM108586
CC1=CC2=C(Cl)N=C(Cl)N=C2S1
2,4-DICHLORO-6-METHYLTHIENO[3,2-D]PYRIMIDINE
CAS:35265-82-8
CM107836
CC1=CC2=NC(Cl)=NC(Cl)=C2S1
2,4-DICHLORO-6-MORPHOLINO-1,3,5-TRIAZINE
CAS:6601-22-5
CM163784
C1(=NC(=NC(=N1)Cl)Cl)N2CCOCC2
2,4-DICHLORO-6-NITROPYRIDINE
CAS:1379337-73-1
CM122335
O=[N+](C1=CC(Cl)=CC(Cl)=N1)[O-]
2,4-DICHLORO-6-NITROPYRROLO[2,1-F][1,2,4]TRIAZINE
CAS:1160995-45-8
CM197766
O=[N+](C1=CN2N=C(Cl)N=C(Cl)C2=C1)[O-]
2,4-DICHLORO-6-NITROQUINAZOLINE
CAS:74173-77-6
CM121436
O=[N+](C1=CC2=C(Cl)N=C(Cl)N=C2C=C1)[O-]
2,4-DICHLORO-6-PHENYLPYRIMIDINE
CAS:26032-72-4
CM167306
ClC1=NC(Cl)=NC(C2=CC=CC=C2)=C1
2,4-DICHLORO-6-PHENYLQUINOLINE
CAS:1152237-15-4
CM363060
ClC1=CC(Cl)=C2C=C(C=CC2=N1)C1=CC=CC=C1
2,4-DICHLORO-6-PROPYLTHIENO[2,3-D]PYRIMIDINE
CAS:902765-62-2
CM147903
CCCC1=CC2=C(Cl)N=C(Cl)N=C2S1
2,4-DICHLORO-7,8-DIHYDRO-5H-THIOPYRANO[4,3-D]PYRIMIDINE 6,6-DIOXIDE
CAS:1187830-50-7
CM128592
ClC1=C(CS2(=O)=O)C(CC2)=NC(Cl)=N1
2,4-DICHLORO-7-(TRIFLUOROMETHYL)QUINAZOLINE
CAS:396-02-1
CM125177
FC(C1=CC2=NC(Cl)=NC(Cl)=C2C=C1)(F)F
2,4-DICHLORO-7-FLUORO-5H-PYRROLO[3,2-D]PYRIMIDINE
CAS:1379307-68-2
CM152136
FC1=CNC2=C(Cl)N=C(Cl)N=C21
2,4-DICHLORO-7-FLUORO-6-METHOXYQUINAZOLINE
CAS:864292-37-5
CM108770
COC1=CC2=C(Cl)N=C(Cl)N=C2C=C1F
2,4-DICHLORO-7-FLUOROPYRIDO[3,2-D]PYRIMIDINE
CAS:1824318-03-7
CM333374
FC1=CC2=NC(Cl)=NC(Cl)=C2N=C1
2,4-DICHLORO-7-FLUOROQUINAZOLINE
CAS:174566-15-5
CM142500
FC1=CC2=NC(Cl)=NC(Cl)=C2C=C1
2,4-DICHLORO-7-IODO-5H-PYRROLO[3,2-D]PYRIMIDINE
CAS:928840-99-7
CM152231
ClC1=NC2=C(NC=C2I)C(Cl)=N1
2,4-DICHLORO-7-IODOQUINAZOLINE
CAS:959237-34-4
CM128450
IC1=CC2=NC(Cl)=NC(Cl)=C2C=C1
2,4-DICHLORO-7-ISOPROPYL-7H-PYRROLO[2,3-D]PYRIMIDINE
CAS:1227635-12-2
CM269074
CC(N1C=CC2=C(Cl)N=C(Cl)N=C21)C
2,4-DICHLORO-7-METHOXY-3-NITROQUINOLINE
CAS:1447961-41-2
CM260278
O=[N+](C1=C(Cl)C2=CC=C(OC)C=C2N=C1Cl)[O-]
2,4-DICHLORO-7-METHOXY-3-PHENYLQUINOLINE
CAS:108832-16-2
CM263150
COC1=CC=C2C(Cl)=C(C3=CC=CC=C3)C(Cl)=NC2=C1
2,4-DICHLORO-7-METHOXYQUINAZOLIN-6-OL
CAS:866823-27-0
CM328099
OC1=CC2=C(Cl)N=C(Cl)N=C2C=C1OC
2,4-DICHLORO-7-METHOXYQUINAZOLINE
CAS:62484-31-5
CM108332
COC1=CC2=NC(Cl)=NC(Cl)=C2C=C1
2,4-DICHLORO-7-METHYL-5,7-DIHYDROFURO[3,4-D]PYRIMIDINE
CAS:1429309-52-3
CM166207
CC1OCC2=C(Cl)N=C(Cl)N=C21
2,4-DICHLORO-7-METHYL-7H-PYRROLO[2,3-D]PYRIMIDINE
CAS:90213-67-5
CM104065
CN1C=CC2=C(Cl)N=C(Cl)N=C12
2,4-DICHLORO-7-METHYL-7H-PYRROLO[2,3-D]PYRIMIDINE-6-CARBOXYLIC ACID
CAS:1638760-84-5
CM270766
O=C(C1=CC2=C(Cl)N=C(Cl)N=C2N1C)O
2,4-DICHLORO-7-METHYLPYRROLO[2,1-F][1,2,4]TRIAZINE
CAS:1613751-73-7
CM333099
CC1=CC=C2C(Cl)=NC(Cl)=NN21
2,4-DICHLORO-7-METHYLQUINAZOLINE
CAS:25171-19-1
CM121435
CC1=CC2=NC(Cl)=NC(Cl)=C2C=C1
2,4-DICHLORO-7-METHYLQUINOLINE
CAS:102878-19-3
CM242872
CC1=CC=C2C(Cl)=CC(Cl)=NC2=C1
2,4-DICHLORO-7-METHYLTHIENO[3,2-D]PYRIMIDINE
CAS:35265-83-9
CM151573
ClC1=NC2=C(C(=N1)Cl)SC=C2C
2,4-DICHLORO-7-TOSYL-7H-PYRROLO[2,3-D]PYRIMIDINE
CAS:934524-10-4
CM152404
ClC1=NC2=C(C(=N1)Cl)C=C[N]2[S](=O)(=O)C3=CC=C(C)C=
2,4-DICHLORO-7H-PYRROLO[2,3-D]PYRIMIDINE
CAS:90213-66-4
CM103618
ClC1=NC(Cl)=C2C=CNC2=N1
2,4-DICHLORO-7H-PYRROLO[2,3-D]PYRIMIDINE-5-CARBALDEHYDE
CAS:1638767-57-3
CM269428
O=CC1=CNC2=NC(Cl)=NC(Cl)=C21
2,4-DICHLORO-7H-PYRROLO[2,3-D]PYRIMIDINE-5-CARBONITRILE
CAS:1379367-43-7
CM104050
ClC1=NC(Cl)=C2C(NC=C2C#N)=N1
2,4-DICHLORO-7H-PYRROLO[2,3-D]PYRIMIDINE-5-CARBOXYLIC ACID
CAS:1638768-02-1
CM270769
O=C(C1=CNC2=NC(Cl)=NC(Cl)=C21)O
2,4-DICHLORO-7H-PYRROLO[2,3-D]PYRIMIDINE-6-CARBOXYLIC ACID
CAS:1638760-72-1
CM270726
O=C(C1=CC2=C(Cl)N=C(Cl)N=C2N1)O
2,4-DICHLORO-8-ETHOXY-3-NITROQUINOLINE
CAS:1447958-14-6
CM261644
O=[N+](C1=C(Cl)C2=CC=CC(OCC)=C2N=C1Cl)[O-]
2,4-DICHLORO-8-ETHOXYQUINOLIN-3-AMINE
CAS:1447962-17-5
CM258509
NC1=C(Cl)C2=CC=CC(OCC)=C2N=C1Cl
2,4-DICHLORO-8-FLUOROQUINAZOLINE
CAS:959237-64-0
CM102409
FC1=CC=CC2=C(Cl)N=C(Cl)N=C12
2,4-DICHLORO-8-FLUOROQUINOLIN-3-AMINE
CAS:1447960-18-0
CM246629
NC1=C(Cl)C2=CC=CC(F)=C2N=C1Cl
2,4-DICHLORO-8-METHOXY-3-PHENYLQUINOLINE
CAS:274691-33-7
CM263149
COC1=C2N=C(Cl)C(C3=CC=CC=C3)=C(Cl)C2=CC=C1
2,4-DICHLORO-8-METHOXY-7-METHYLQUINAZOLINE
CAS:956100-67-7
CM219448
CC1=C(OC)C2=NC(Cl)=NC(Cl)=C2C=C1
2,4-DICHLORO-8-METHOXYQUINAZOLINE
CAS:61948-60-5
CM104445
COC1=CC=CC2=C1N=C(Cl)N=C2Cl
2,4-DICHLORO-8-METHOXYQUINOLINE
CAS:32608-29-0
CM144923
COC1=C2N=C(Cl)C=C(Cl)C2=CC=C1
2,4-DICHLORO-8-METHYL-3-NITROQUINOLINE
CAS:1026839-46-2
CM258506
O=[N+](C1=C(Cl)C2=CC=CC(C)=C2N=C1Cl)[O-]
2,4-DICHLORO-8-METHYLQUINAZOLINE
CAS:39576-83-5
CM121433
CC1=CC=CC2=C(Cl)N=C(Cl)N=C12
2,4-DICHLORO-8-METHYLQUINOLIN-3-AMINE
CAS:1447960-14-6
CM246248
NC1=C(Cl)C2=CC=CC(C)=C2N=C1Cl
2,4-DICHLORO-8-METHYLQUINOLINE
CAS:102878-20-6
CM223080
CC1=C2N=C(Cl)C=C(Cl)C2=CC=C1
2,4-DICHLORO-8-NITROQUINAZOLINE
CAS:174566-19-9
CM211827
O=[N+](C1=CC=CC2=C(Cl)N=C(Cl)N=C12)[O-]
2,4-DICHLORO-D-PHENYLALANINE
CAS:114872-98-9
CM220405
ClC1=C(C[C@@H](N)C(=O)O)C=CC(=C1)Cl
2,4-DICHLORO-N'-(2-CHLOROACETYL)BENZOHYDRAZIDE
CAS:184877-74-5
CM309865
O=C(NNC(CCl)=O)C1=CC=C(Cl)C=C1Cl
2,4-DICHLORO-N-(1-METHYL-1-AZASPIRO[4.5]DECAN-4-YL)BENZAMIDE
CAS:89732-22-9
CM218269
O=C(NC1CCN(C)C12CCCCC2)C3=CC=C(Cl)C=C3Cl
2,4-DICHLORO-N-(NAPHTHALEN-1-YL)BENZAMIDE
CAS:88704-85-2
CM264096
O=C(NC1=C2C=CC=CC2=CC=C1)C3=CC=C(Cl)C=C3Cl
2,4-DICHLORO-N-(PIPERIDIN-2-YLMETHYL)BENZENESULFONAMIDE HYDROCHLORIDE
CAS:1353948-07-8
CM179912
O=S(C1=CC=C(Cl)C=C1Cl)(NCC2NCCCC2)=O.[H]Cl
2,4-DICHLORO-N-(PIPERIDIN-3-YL)BENZENESULFONAMIDE HYDROCHLORIDE
CAS:1353958-62-9
CM179926
O=S(C1=CC=C(Cl)C=C1Cl)(NC2CNCCC2)=O.[H]Cl
2,4-DICHLORO-N-(PYRROLIDIN-2-YLMETHYL)BENZENESULFONAMIDE HYDROCHLORIDE
CAS:1353958-35-6
CM197440
O=S(C1=CC=C(Cl)C=C1Cl)(NCC2NCCC2)=O.[H]Cl
2,4-DICHLORO-N-ISOPROPYL-N-(PYRROLIDIN-2-YLMETHYL)BENZENESULFONAMIDE
CAS:1353980-76-3
CM197451
O=S(C1=CC=C(Cl)C=C1Cl)(N(C(C)C)CC2NCCC2)=O
2,4-DICHLOROBENZENE-1,3-DIOL
CAS:16606-61-4
CM317407
OC1=CC=C(Cl)C(O)=C1Cl
2,4-DICHLOROBENZENESULFONAMIDE
CAS:20532-15-4
CM313380
O=S(C1=CC=C(Cl)C=C1Cl)(N)=O
2,4-DICHLOROBENZO[D]OXAZOLE
CAS:656836-87-2
CM121924
ClC1=C2N=C(Cl)OC2=CC=C1
2,4-DICHLOROBENZO[G]QUINAZOLINE
CAS:33987-01-8
CM213933
ClC1=C2C=C3C(C=CC=C3)=CC2=NC(Cl)=N1
2,4-DICHLOROBENZONITRILE
CAS:6574-98-7
CM329981
N#CC1=CC=C(Cl)C=C1Cl
2,4-DICHLOROBENZOTHIAZOLE
CAS:3622-30-8
CM157225
C1=C(C2=C(C=C1)SC(=N2)Cl)Cl
2,4-DICHLOROBENZYL ALCOHOL
CAS:1777-82-8
CM116008
ClC1=CC=C(C(Cl)=C1)CO
2,4-DICHLOROBENZYLAMINE
CAS:95-00-1
CM117168
NCC1=CC=C(Cl)C=C1Cl
2,4-DICHLOROCINNAMIC ACID
CAS:1201-99-6
CM248145
O=C(O)/C=C/C1=CC=C(Cl)C=C1Cl
2,4-DICHLOROFURO[2,3-D]PYRIMIDINE
CAS:1000577-84-3
CM166485
ClC1=C2C(OC=C2)=NC(Cl)=N1
2,4-DICHLOROFURO[3,2-D]PYRIMIDINE
CAS:956034-07-4
CM109213
ClC1=C(OC=C2)C2=NC(Cl)=N1
2,4-DICHLOROFURO[3,4-D]PYRIMIDIN-7(5H)-ONE
CAS:15783-48-9
CM122386
ClC1=NC2=C(COC2=O)C(Cl)=N1
2,4-DICHLOROINDOLO[2,1-B]QUINAZOLINE-6,12-DIONE
CAS:65618-06-6
CM216124
O=C(C(N12)=NC3=C(C=C(Cl)C=C3Cl)C1=O)C4=C2C=CC=C4
2,4-DICHLORONAPHTHALEN-1-AMINE
CAS:29242-87-3
CM140664
NC1=C2C=CC=CC2=C(Cl)C=C1Cl
2,4-DICHLORONICOTINALDEHYDE
CAS:134031-24-6
CM105401
O=CC1=C(Cl)N=CC=C1Cl
2,4-DICHLORONICOTINC ACID
CAS:262423-77-8
CM102621
O=C(O)C1=C(Cl)N=CC=C1Cl
2,4-DICHLOROPHENYL 2-(4-CHLOROPHENYL)QUINOLINE-4-CARBOXYLATE
CAS:355433-68-0
CM224164
O=C(C1=CC(C2=CC=C(Cl)C=C2)=NC3=CC=CC=C13)OC4=CC=C(
2,4-DICHLOROPHENYL 2-PHENYLQUINOLINE-4-CARBOXYLATE
CAS:355433-56-6
CM227798
O=C(C1=CC(C2=CC=CC=C2)=NC3=CC=CC=C13)OC4=CC=C(Cl)C
2,4-DICHLOROPHENYL 6-METHYL-2-(P-TOLYL)QUINOLINE-4-CARBOXYLATE
CAS:355421-33-9
CM224266
O=C(C1=CC(C2=CC=C(C)C=C2)=NC3=CC=C(C)C=C13)OC4=CC=
2,4-DICHLOROPHENYL 8-METHYL-2-PHENYLQUINOLINE-4-CARBOXYLATE
CAS:355421-43-1
CM224039
O=C(C1=CC(C2=CC=CC=C2)=NC3=C(C)C=CC=C13)OC4=CC=C(C
2,4-DICHLOROPHENYLBORONIC ACID
CAS:68716-47-2
CM135667
C1=CC(=CC(=C1B(O)O)Cl)Cl
2,4-DICHLOROPTERIDINE
CAS:98138-05-7
CM332701
C1=CN=C2C(=N1)C(=NC(=N2)Cl)Cl
2,4-DICHLOROPYRIDIN-3-OL
CAS:405141-76-6
CM170554
OC1=C(Cl)C=CN=C1Cl
2,4-DICHLOROPYRIDINE
CAS:26452-80-2
CM102599
ClC1=CC(Cl)=NC=C1
2,4-DICHLOROPYRIDINE-3-CARBONITRILE
CAS:180995-12-4
CM100072
N#CC1=C(Cl)C=CN=C1Cl
2,4-DICHLOROPYRIDO[2,3-D]PYRIMIDINE
CAS:126728-20-9
CM104515
ClC1=NC2=NC=CC=C2C(Cl)=N1
2,4-DICHLOROPYRIDO[3,2-D]PYRIMIDINE
CAS:39551-54-7
CM107927
ClC1=C2C(C=CC=N2)=NC(Cl)=N1
2,4-DICHLOROPYRIDO[3,4-D]PYRIMIDINE
CAS:908240-50-6
CM166566
ClC1=NC2=C(C=CN=C2)C(Cl)=N1
2,4-DICHLOROPYRIMIDIN-5-OL
CAS:1395037-19-0
CM337231
OC1=CN=C(Cl)N=C1Cl
2,4-DICHLOROPYRIMIDINE
CAS:3934-20-1
CM166462
ClC1=NC(Cl)=NC=C1
2,4-DICHLOROPYRIMIDINE-5-CARBALDEHYDE
CAS:871254-61-4
CM108816
O=CC1=CN=C(Cl)N=C1Cl
2,4-DICHLOROPYRIMIDINE-5-CARBONITRILE
CAS:3177-24-0
CM107765
N#CC1=CN=C(Cl)N=C1Cl
2,4-DICHLOROPYRIMIDINE-5-CARBONYL CHLORIDE
CAS:2972-52-3
CM100730
O=C(Cl)C1=CN=C(Cl)N=C1Cl
2,4-DICHLOROPYRIMIDINE-5-CARBOXAMIDE
CAS:1240390-28-6
CM167387
O=C(C1=CN=C(Cl)N=C1Cl)N
2,4-DICHLOROPYRIMIDINE-5-CARBOXYLIC ACID
CAS:37131-89-8
CM166461
ClC1=NC=C(C(=N1)Cl)C(=O)O
2,4-DICHLOROPYRIMIDINE-5-SULFONYL CHLORIDE
CAS:23920-08-3
CM363212
ClC1=NC(Cl)=C(C=N1)S(Cl)(=O)=O
2,4-DICHLOROPYRROLO[2,1-F][1,2,4]TRIAZINE
CAS:918538-05-3
CM103710
ClC1=NN2C=CC=C2C(Cl)=N1
2,4-DICHLOROPYRROLO[2,1-F][1,2,4]TRIAZINE-7-CARBALDEHYDE
CAS:1001353-82-7
CM332912
O=CC1=CC=C2C(Cl)=NC(Cl)=NN21
2,4-DICHLOROQUINAZOLINE
CAS:607-68-1
CM102022
ClC1=C2C=CC=CC2=NC(Cl)=N1
2,4-DICHLOROQUINAZOLINE-7-CARBOXYLIC ACID
CAS:879274-85-8
CM217895
O=C(C1=CC2=NC(Cl)=NC(Cl)=C2C=C1)O
2,4-DICHLOROQUINAZOLINE-8-CARBONITRILE
CAS:1150617-71-2
CM142587
ClC1=NC2=C(C=CC=C2C(Cl)=N1)C#N
2,4-DICHLOROQUINOLINE
CAS:703-61-7
CM111047
ClC1=CC(Cl)=NC2=CC=CC=C12
2,4-DICHLOROQUINOLINE-3-CARBALDEHYDE
CAS:151387-00-7
CM229787
O=CC1=C(Cl)C2=CC=CC=C2N=C1Cl
2,4-DICHLOROQUINOLINE-3-CARBONITRILE
CAS:69875-54-3
CM146229
N#CC1=C(Cl)C2=CC=CC=C2N=C1Cl
2,4-DICHLOROTHIENO[2,3-D]PYRIMIDINE
CAS:18740-39-1
CM107418
ClC1=C(C=CS2)C2=NC(Cl)=N1
2,4-DICHLOROTHIENO[3,2-D]PYRIMIDINE
CAS:16234-14-3
CM104208
ClC1=NC2=C(SC=C2)C(Cl)=N1
2,4-DIETHOXYBENZALDEHYDE
CAS:22924-16-9
CM113307
O=CC1=CC=C(OCC)C=C1OCC
2,4-DIETHYL 1H-PYRROLE-2,4-DICARBOXYLATE
CAS:55942-40-0
CM103862
CCOC(=O)C1=CC(=CN1)C(=O)OCC
2,4-DIETHYL 3-ETHYL-1H-PYRROLE-2,4-DICARBOXYLATE
CAS:52921-22-9
CM333241
O=C(C1=C(CC)C(C(OCC)=O)=CN1)OCC
2,4-DIETHYL 3-METHYL-1H-PYRROLE-2,4-DICARBOXYLATE
CAS:5448-16-8
CM103868
CCOC(=O)C1=C(C)C(=CN1)C(=O)OCC
2,4-DIETHYL-2-METHYL-1-OXA-3-AZASPIRO[4.5]DECANE
CAS:682321-47-7
CM216300
CC1(CC)OC2(CCCCC2)C(CC)N1
2,4-DIFLUORO-1-(1-(P-TOLYL)ETHYL)BENZENE
CAS:2484888-98-2
CM336402
CC(C1=CC=C(F)C=C1F)C2=CC=C(C)C=C2
2,4-DIFLUORO-1-(TRIFLUOROMETHYL)BENZENE
CAS:64248-61-9
CM329392
FC(C1=CC=C(F)C=C1F)(F)F
2,4-DIFLUORO-3,5-DIMETHOXYBENZOIC ACID
CAS:1003709-80-5
CM162189
COC1=CC(C(O)=O)=C(F)C(OC)=C1F
2,4-DIFLUORO-3-IODOANILINE
CAS:1437316-91-0
CM249428
NC1=CC=C(F)C(I)=C1F
2,4-DIFLUORO-3-IODOPYRIDINE
CAS:837364-88-2
CM120932
IC1=C(F)C=CN=C1F
2,4-DIFLUORO-3-ISOPROPOXYPHENYLBORONIC ACID
CAS:1451390-95-6
CM209854
OB(C1=CC=C(F)C(OC(C)C)=C1F)O
2,4-DIFLUORO-3-METHOXYANILINE
CAS:886499-08-7
CM329522
NC1=CC=C(F)C(OC)=C1F
2,4-DIFLUORO-3-METHOXYBENZALDEHYDE
CAS:870837-66-4
CM280550
COC1=C(F)C=CC(C=O)=C1F
2,4-DIFLUORO-3-METHOXYBENZONITRILE
CAS:220353-20-8
CM157030
N#CC1=CC=C(F)C(OC)=C1F
2,4-DIFLUORO-3-METHOXYBENZYLAMINE
CAS:717094-51-4
CM296392
NCC1=CC=C(F)C(OC)=C1F
2,4-DIFLUORO-3-METHYLANILINE
CAS:76350-70-4
CM118299
NC1=CC=C(F)C(C)=C1F
2,4-DIFLUORO-3-METHYLBENZALDEHYDE
CAS:847502-88-9
CM255275
O=CC1=CC=C(F)C(C)=C1F
2,4-DIFLUORO-3-METHYLBENZOIC ACID
CAS:112857-68-8
CM159039
FC1=C(C(=O)O)C=CC(=C1C)F
2,4-DIFLUORO-3-NITROPYRIDINE
CAS:60186-14-3
CM276530
O=[N+](C1=C(F)C=CN=C1F)[O-]
2,4-DIFLUORO-5-(TRIFLUOROMETHOXY)ANILINE
CAS:123572-59-8
CM248416
NC1=CC(OC(F)(F)F)=C(F)C=C1F
2,4-DIFLUORO-5-FORMYLBENZONITRILE
CAS:633327-10-3
CM254225
N#CC1=CC(C=O)=C(F)C=C1F
2,4-DIFLUORO-5-METHOXYPHENYLBORONIC ACID
CAS:1395417-65-8
CM208823
OB(C1=CC(OC)=C(F)C=C1F)O
2,4-DIFLUORO-5-METHYLBENZALDEHYDE
CAS:315204-36-5
CM192699
CC1=CC(C=O)=C(F)C=C1F
2,4-DIFLUORO-5-METHYLBENZOIC ACID
CAS:367954-99-2
CM157217
FC1=C(C(=O)O)C=C(C(=C1)F)C
2,4-DIFLUORO-5-METHYLBENZONITRILE
CAS:329314-68-3
CM158027
CC1=CC(C#N)=C(F)C=C1F
2,4-DIFLUORO-5-NITROBENZOIC ACID
CAS:153775-33-8
CM157653
OC(=O)C1=C(F)C=C(F)C(=C1)[N+]([O-])=O
2,4-DIFLUORO-5-NITROPHENOL
CAS:113512-57-5
CM247824
OC1=CC([N+]([O-])=O)=C(F)C=C1F
2,4-DIFLUORO-5-NITROPYRIDINE
CAS:60186-15-4
CM174090
[O-][N+](=O)C1=CN=C(F)C=C1F
2,4-DIFLUORO-6-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)ANILINE
CAS:1415568-78-3
CM208997
NC1=C(B2OC(C)(C)C(C)(C)O2)C=C(F)C=C1F
2,4-DIFLUORO-6-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PHENOL
CAS:1451391-16-4
CM209874
OC1=C(B2OC(C)(C)C(C)(C)O2)C=C(F)C=C1F
2,4-DIFLUORO-6-IODOPHENOL
CAS:551002-42-7
CM294915
OC1=C(I)C=C(F)C=C1F
2,4-DIFLUORO-6-NITROPHENOL
CAS:364-31-8
CM252508
OC1=C([N+]([O-])=O)C=C(F)C=C1F
2,4-DIFLUORO-N-METHYLANILINE
CAS:138564-16-6
CM183035
CNC1=CC=C(F)C=C1F
2,4-DIFLUORO-N-METHYLBENZYLAMINE
CAS:696589-32-9
CM118060
CNCC1=CC=C(F)C=C1F
2,4-DIFLUOROBENZALDEHYDE
CAS:1550-35-2
CM249775
O=CC1=CC=C(F)C=C1F
2,4-DIFLUOROBENZAMIDE
CAS:85118-02-1
CM191872
O=C(N)C1=CC=C(F)C=C1F
2,4-DIFLUOROBENZENESULFONAMIDE
CAS:13656-60-5
CM249059
O=S(C1=CC=C(F)C=C1F)(N)=O
2,4-DIFLUOROBENZENESULFONIC ACID
CAS:46020-63-7
CM300920
O=S(C1=CC=C(F)C=C1F)(O)=O
2,4-DIFLUOROBENZENESULFONYL CHLORIDE
CAS:13918-92-8
CM113165
O=S(C1=CC=C(F)C=C1F)(Cl)=O
2,4-DIFLUOROBENZONITRILE
CAS:3939-09-1
CM160199
N#CC1=CC=C(F)C=C1F
2,4-DIFLUOROBENZOYL CHLORIDE
CAS:72482-64-5
CM154154
O=C(Cl)C1=CC=C(F)C=C1F
2,4-DIFLUOROBENZYLAMINE
CAS:72235-52-0
CM117512
NCC1=CC=C(F)C=C1F
2,4-DIFLUOROIODOBENZENE
CAS:2265-93-2
CM195579
IC1=CC=C(F)C=C1F
2,4-DIFLUOROPHENOL
CAS:367-27-1
CM117080
OC1=CC=C(F)C=C1F
2,4-DIFLUOROPHENYLBORONIC ACID
CAS:144025-03-6
CM112212
OB(C1=CC=C(F)C=C1F)O
2,4-DIFLUOROPYRIDINE
CAS:34941-90-7
CM107824
FC1=CC(F)=NC=C1
2,4-DIHYDRO-3H-PYRAZOL-3-ONE
CAS:137-44-0
CM188969
O=C1CC=NN1
2,4-DIHYDRO-4-METHYL-5-(4-PYRIDINYL)-3H-1,2,4-TRIAZOLE-3-THIONE
CAS:3652-32-2
CM336578
S=C1NN=C(C2=CC=NC=C2)N1C
2,4-DIHYDRO-5-METHYL-2-(4-METHYLPHENYL)-3H-PYRAZOL-3-ONE
CAS:86-92-0
CM189199
O=C1CC(C)=NN1C2=CC=C(C)C=C2
2,4-DIHYDROCHROMENO[4,3-C]PYRAZOLE-3-CARBOXYLIC ACID
CAS:909091-78-7
CM284388
O=C(C1=C(COC2=C3C=CC=C2)C3=NN1)O
2,4-DIHYDROXY-2H-BENZO[B][1,4]OXAZIN-3(4H)-ONE
CAS:17359-54-5
CM161497
O=C1N(O)C2=CC=CC=C2OC1O
2,4-DIHYDROXY-3-METHYLBENZALDEHYDE
CAS:6248-20-0
CM254144
C1=CC(=C(C(=C1C=O)O)C)O
2,4-DIHYDROXY-3-METHYLBENZOHYDRAZIDE
CAS:1142211-15-1
CM304792
O=C(NN)C1=CC=C(O)C(C)=C1O
2,4-DIHYDROXY-3-NITROPYRIDINE
CAS:89282-12-2
CM116562
O=[N+](C1=C(O)C=CN=C1O)[O-]
2,4-DIHYDROXY-3-NITROQUINOLINE
CAS:15151-57-2
CM144202
OC1=NC2=CC=CC=C2C(O)=C1[N+]([O-])=O
2,4-DIHYDROXY-5,6-DIMETHYLPYRIMIDINE
CAS:26305-13-5
CM121147
CC1=C(C)C(O)=NC(O)=N1
2,4-DIHYDROXY-5-IODOBENZALDEHYDE
CAS:131088-03-4
CM244394
O=CC1=CC(I)=C(O)C=C1O
2,4-DIHYDROXY-5-ISOPROPYLBENZOIC ACID
CAS:1184181-48-3
CM248018
O=C(O)C1=CC(C(C)C)=C(O)C=C1O
2,4-DIHYDROXY-5-METHOXYBENZALDEHYDE
CAS:51061-83-7
CM274532
O=CC1=CC(OC)=C(O)C=C1O
2,4-DIHYDROXY-5-METHYLBENZALDEHYDE
CAS:39828-37-0
CM243179
O=CC1=CC(C)=C(O)C=C1O
2,4-DIHYDROXY-5-NITROBENZOIC ACID
CAS:13722-96-8
CM156170
O=C(O)C1=CC([N+]([O-])=O)=C(O)C=C1O
2,4-DIHYDROXY-6-METHOXYQUINOLINE
CAS:14300-45-9
CM145614
OC2=NC1=CC=C(C=C1C(=C2)O)OC
2,4-DIHYDROXY-6-METHYLBENZALDEHYDE
CAS:487-69-4
CM253158
O=CC1=C(C)C=C(O)C=C1O
2,4-DIHYDROXY-6-NITROQUINAZOLINE
CAS:32618-85-2
CM117311
O=[N+](C1=CC2=C(O)N=C(O)N=C2C=C1)[O-]
2,4-DIHYDROXY-6-NITROQUINAZOLINE-8-CARBOXYLIC ACID
CAS:331646-89-0
CM213882
O=C(C1=CC([N+]([O-])=O)=CC2=C(O)N=C(O)N=C12)O
2,4-DIHYDROXY-6-TRIFLUOROMETHYLPYRIMIDINE
CAS:672-45-7
CM109303
O=C1NC(=CC(=O)N1)C(F)(F)F
2,4-DIHYDROXY-N-(3-HYDROXYPROPYL)-3,3-DIMETHYLBUTANAMIDE
CAS:16485-10-2
CM250103
CC(C)(CO)C(O)C(=O)NCCCO
2,4-DIHYDROXYACETOPHENONE
CAS:89-84-9
CM334260
CC(C1=CC=C(O)C=C1O)=O
2,4-DIHYDROXYBENZONITRILE
CAS:64419-24-5
CM157960
N#CC1=CC=C(O)C=C1O
2,4-DIHYDROXYBENZOPHENONE
CAS:131-56-6
CM117356
O=C(C1=CC=CC=C1)C2=CC=C(O)C=C2O
2,4-DIHYDROXYPHENYLACETIC ACID
CAS:614-82-4
CM186663
O=C(O)CC1=CC=C(O)C=C1O
2,4-DIHYDROXYPYRIMIDINE-5-CARBONITRILE
CAS:4425-56-3
CM167342
N#CC1=CNC(NC1=O)=O
2,4-DIHYDROXYQUINOLINE-3-CARBALDEHYDE
CAS:529-89-5
CM146201
O=CC1=C(O)C2=CC=CC=C2N=C1O
2,4-DIIODO-5-METHOXYANILINE
CAS:117832-18-5
CM279926
NC1=CC(OC)=C(I)C=C1I
2,4-DIIODO-6-METHYLANILINE
CAS:117832-09-4
CM128643
NC1=C(C)C=C(I)C=C1I
2,4-DIIODOPHENOL
CAS:2012-29-5
CM328583
OC1=CC=C(I)C=C1I
2,4-DIIODOPYRIDIN-3-OL
CAS:750638-97-2
CM108558
OC1=C(I)C=CN=C1I
2,4-DIIODOPYRIMIDINE
CAS:262353-34-4
CM121220
IC1=NC(I)=NC=C1
2,4-DIMETHOXY-1-(2-NITROVINYL)BENZENE
CAS:1891-10-7
CM303259
O=[N+](/C=C/C1=CC=C(OC)C=C1OC)[O-]
2,4-DIMETHOXY-1-NAPHTHALDEHYDE
CAS:75965-84-3
CM244863
O=CC1=C2C=CC=CC2=C(OC)C=C1OC
2,4-DIMETHOXY-5,6-DIMETHYLPYRIMIDINE
CAS:120129-83-1
CM130974
COC1=NC(OC)=C(C)C(C)=N1
2,4-DIMETHOXY-5-FLUOROPYRIMIDINE
CAS:4330-22-7
CM329668
FC1=CN=C(OC)N=C1OC
2,4-DIMETHOXY-5-METHYLPYRIMIDINE
CAS:5151-34-8
CM165355
CC1=CN=C(OC)N=C1OC
2,4-DIMETHOXY-5-NITROPYRIMIDINE
CAS:30561-07-0
CM252074
O=[N+](C1=CN=C(OC)N=C1OC)[O-]
2,4-DIMETHOXY-5H-PYRROLO[3,2-D]PYRIMIDINE
CAS:84538-40-9
CM132705
COC1=NC2=C(NC=C2)C(OC)=N1
2,4-DIMETHOXY-N-METHYLBENZYLAMINE
CAS:102503-23-1
CM118067
CNCC1=CC=C(OC)C=C1OC
2,4-DIMETHOXYBENZALDEHYDE
CAS:613-45-6
CM243667
O=CC1=CC=C(OC)C=C1OC
2,4-DIMETHOXYBENZENESULFONAMIDE
CAS:51770-71-9
CM330038
O=S(C1=CC=C(OC)C=C1OC)(N)=O
2,4-DIMETHOXYBENZOIC ACID
CAS:91-52-1
CM157324
C1=C(OC)C=CC(=C1OC)C(O)=O
2,4-DIMETHOXYBENZYL ALCOHOL
CAS:7314-44-5
CM116125
COC1=CC=C(C(OC)=C1)CO
2,4-DIMETHOXYPHENOL
CAS:13330-65-9
CM248884
COC1=C(C=CC(=C1)OC)O
2,4-DIMETHOXYPHENYLBORONIC ACID
CAS:133730-34-4
CM112273
OB(C1=CC=C(OC)C=C1OC)O
2,4-DIMETHOXYPYRIDINE
CAS:18677-43-5
CM120953
COC1=CC(OC)=NC=C1
2,4-DIMETHOXYPYRIMIDIN-5-AMINE
CAS:14048-15-8
CM167258
NC1=CN=C(OC)N=C1OC
2,4-DIMETHOXYPYRIMIDINE-5-BORONIC ACID
CAS:89641-18-9
CM135566
COC1=NC(OC)=C(C=N1)B(O)O
2,4-DIMETHOXYPYRIMIDINE-5-CARBALDEHYDE
CAS:52606-02-7
CM166621
O=CC1=CN=C(OC)N=C1OC
2,4-DIMETHOXYPYRIMIDINE-5-CARBONITRILE
CAS:14445-57-9
CM321461
N#CC1=CN=C(OC)N=C1OC
2,4-DIMETHOXYPYRIMIDINE-6-CARBOXYLIC ACID
CAS:59864-30-1
CM164856
O=C(C1=NC(OC)=NC(OC)=C1)O
2,4-DIMETHOXYQUINAZOLIN-5-OL
CAS:155824-63-8
CM210490
OC1=CC=CC2=NC(OC)=NC(OC)=C12
2,4-DIMETHOXYQUINOLINE
CAS:40335-00-0
CM223344
COC1=CC(OC)=NC2=CC=CC=C12
2,4-DIMETHOXYQUINOLINE-3-CARBALDEHYDE
CAS:51179-18-1
CM223348
O=CC1=C(OC)C2=CC=CC=C2N=C1OC
2,4-DIMETHYL-1,2,3,4-TETRAHYDROISOQUINOLINE
CAS:20666-00-6
CM227360
CC1CN(C)CC2=C1C=CC=C2
2,4-DIMETHYL-1,2-DIHYDROCYCLOBUTA[C]QUINOLIN-3(4H)-ONE
CAS:87700-47-8
CM226645
O=C1N(C)C2=C(C=CC=C2)C3=C1C(C)C3
2,4-DIMETHYL-1,3-THIAZOLE-5-CARBALDEHYDE
CAS:95453-54-6
CM189979
O=CC1=C(C)N=C(C)S1
2,4-DIMETHYL-1-(PENTAN-3-YL)BENZENE
CAS:204007-77-2
CM307654
CCC(C1=CC=C(C)C=C1C)CC
2,4-DIMETHYL-1-OXO-1,2-DIHYDROISOQUINOLINE-3-CARBONYL CHLORIDE
CAS:89929-03-3
CM247192
O=C(Cl)C1=C(C)C2=C(C(N1C)=O)C=CC=C2
2,4-DIMETHYL-1-OXO-1,2-DIHYDROISOQUINOLINE-3-CARBOXYLIC ACID
CAS:89928-56-3
CM244933
O=C(C1=C(C)C2=C(C(N1C)=O)C=CC=C2)O
2,4-DIMETHYL-1H-IMIDAZOLE-5-CARBALDEHYDE
CAS:68282-52-0
CM128818
CC1=NC(C)=C(N1)C=O
2,4-DIMETHYL-1H-PYRROLO[2,3-B]PYRIDINE
CAS:1190313-73-5
CM243280
CC1=CC=NC2=C1C=C(C)N2
2,4-DIMETHYL-2,3-DIHYDROFURO[3,2-C]QUINOLINE-8-CARBOXYLIC ACID
CAS:361368-55-0
CM256963
O=C(C1=CC=C2N=C(C)C3=C(OC(C)C3)C2=C1)O
2,4-DIMETHYL-2H-INDAZOLE
CAS:17582-90-0
CM232255
CC1=CC=CC2=NN(C)C=C12
2,4-DIMETHYL-2H-PYRAZOLO[3,4-B]PYRIDIN-6(7H)-ONE
CAS:73810-75-0
CM272199
O=C1C=C(C)C2=CN(C)N=C2N1
2,4-DIMETHYL-3-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PYRIDINE
CAS:1421252-89-2
CM209140
CC1(C)C(C)(C)OB(C2=C(C)C=CN=C2C)O1
2,4-DIMETHYL-3-AZASPIRO[5.5]UNDECA-1,4-DIENE-1,5-DICARBONITRILE
CAS:53219-48-0
CM214889
N#CC1=C(C)NC(C)=C(C#N)C12CCCCC2
2,4-DIMETHYL-4H-FURO[3,2-B]PYRROLE-5-CARBOXYLIC ACID
CAS:155445-40-2
CM327216
O=C(C1=CC(OC(C)=C2)=C2N1C)O
2,4-DIMETHYL-4H-THIENO[3,2-B]PYRROLE-5-CARBOXYLIC ACID
CAS:903173-34-2
CM332899
O=C(C1=CC2=C(C=C(C)S2)N1C)O
2,4-DIMETHYL-5,6,7,8-TETRAHYDROQUINAZOLINE
CAS:88268-23-9
CM217971
CC1=C2CCCCC2=NC(C)=N1
2,4-DIMETHYL-5,6,7,8-TETRAHYDROQUINOLINE-8-CARBOTHIOAMIDE
CAS:60169-58-6
CM224545
S=C(C1CCCC2=C1N=C(C)C=C2C)N
2,4-DIMETHYL-5-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PYRIDINE
CAS:1622217-32-6
CM210749
CC1(C)C(C)(C)OB(C2=CN=C(C)C=C2C)O1
2,4-DIMETHYL-5-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)THIAZOLE
CAS:859833-13-9
CM217535
CC1(C)C(C)(C)OB(C2=C(C)N=C(C)S2)O1
2,4-DIMETHYL-5-NITROANILINE
CAS:2124-47-2
CM251323
NC1=CC([N+]([O-])=O)=C(C)C=C1C
2,4-DIMETHYL-5-NITROBENZOIC ACID
CAS:220504-75-6
CM160106
O=C(O)C1=CC([N+]([O-])=O)=C(C)C=C1C
2,4-DIMETHYL-5-NITROPYRIDINE
CAS:1074-99-3
CM121017
O=[N+](C1=CN=C(C)C=C1C)[O-]
2,4-DIMETHYL-5-PYRIMIDINAMINE
CAS:35733-53-0
CM166460
NC1=CN=C(C)N=C1C
2,4-DIMETHYL-6-(PHENYLAMINO)QUINAZOLINE-5,8-DIONE
CAS:61416-89-5
CM215389
O=C(C(NC1=CC=CC=C1)=C2)C3=C(C)N=C(C)N=C3C2=O
2,4-DIMETHYL-6-NITROANILINE
CAS:1635-84-3
CM250048
NC1=C([N+]([O-])=O)C=C(C)C=C1C
2,4-DIMETHYL-6-OXO-1,6-DIHYDROPYRIMIDINE-5-CARBALDEHYDE
CAS:101861-00-1
CM165457
O=CC1=C(C)N=C(C)NC1=O
2,4-DIMETHYL-7-NITROISOINDOLINE-1,3-DIONE
CAS:39519-91-0
CM245415
O=C1N(C)C(C2=C1C([N+]([O-])=O)=CC=C2C)=O
2,4-DIMETHYL-8-(2-NITROPHENYL)IMIDAZO[1,2-A][1,8]NAPHTHYRIDINE
CAS:142271-99-6
CM238104
O=[N+](C1=CC=CC=C1C2=CN3C(C=CC4=C3N=C(C)C=C4C)=N2)
2,4-DIMETHYL-8-NITROQUINOLIN-7-OL
CAS:1378259-98-3
CM245160
OC1=CC=C2C(C)=CC(C)=NC2=C1[N+]([O-])=O
2,4-DIMETHYL-8-PHENYLIMIDAZO[1,2-A][1,8]NAPHTHYRIDINE
CAS:142271-98-5
CM232040
CC1=CC(C)=NC2=C1C=CC3=NC(C4=CC=CC=C4)=CN32
2,4-DIMETHYL-9-(NAPHTHALEN-2-YL)INDENO[2,1-B]PYRAN
CAS:62225-15-4
CM230996
CC(C=C(C)O1)=C2C1=C(C3=CC=C4C=CC=CC4=C3)C5=C2C=CC=
2,4-DIMETHYL-9H-PYRIDO[2,3-B]INDOLE
CAS:13315-71-4
CM231959
CC1=C2C(NC3=C2C=CC=C3)=NC(C)=C1
2,4-DIMETHYL-N,N-DIPHENYLANILINE
CAS:1228-80-4
CM128698
CC1=CC(C)=C(C=C1)N(C1=CC=CC=C1)C1=CC=CC=C1
2,4-DIMETHYL-NICOTINIC ACID HYDROCHLORIDE
CAS:133897-06-0
CM176933
O=C(O)C1=C(C)N=CC=C1C.[H]Cl
2,4-DIMETHYLAZETIDINE;HYDROCHLORIDE
CAS:1803606-22-5
CM326075
CC1CC(C)N1.[H]Cl
2,4-DIMETHYLBENZAMIDE
CAS:73258-94-3
CM300943
O=C(N)C1=CC=C(C)C=C1C
2,4-DIMETHYLBENZENETHIOL
CAS:13616-82-5
CM329323
SC1=CC=C(C)C=C1C
2,4-DIMETHYLBENZO[B][1,8]NAPHTHYRIDIN-5-AMINE
CAS:82756-22-7
CM236466
NC1=C2C(C)=CC(C)=NC2=NC3=CC=CC=C31
2,4-DIMETHYLBENZO[G]QUINOLINE
CAS:14879-95-9
CM225567
CC1=CC(C)=NC2=CC3=CC=CC=C3C=C12
2,4-DIMETHYLBENZOIC ACID
CAS:611-01-8
CM158594
C1=CC(=CC(=C1C(O)=O)C)C
2,4-DIMETHYLBENZOIC ACID METHYL ESTER
CAS:23617-71-2
CM152887
O=C(OC)C1=CC=C(C)C=C1C
2,4-DIMETHYLBENZONITRILE
CAS:21789-36-6
CM251393
N#CC1=CC=C(C)C=C1C
2,4-DIMETHYLIMIDAZOLE
CAS:930-62-1
CM187505
C1=C([NH]C(=N1)C)C
2,4-DIMETHYLISOQUINOLIN-1(2H)-ONE
CAS:33930-75-5
CM239181
O=C1N(C)C=C(C)C2=C1C=CC=C2
2,4-DIMETHYLNAPHTHALEN-1-AMINE
CAS:51671-03-5
CM140279
NC1=C2C=CC=CC2=C(C)C=C1C
2,4-DIMETHYLOXAZOLE
CAS:7208-05-1
CM191396
CC1=COC(C)=N1
2,4-DIMETHYLPENTAN-3-AMINE
CAS:4083-57-2
CM147923
CC(C)C(N)C(C)C
2,4-DIMETHYLPENTAN-3-AMINE HYDROCHLORIDE
CAS:4083-58-3
CM252819
CC(C)C(N)C(C)C.[H]Cl
2,4-DIMETHYLPHENYLBORONIC ACID
CAS:55499-44-0
CM135645
CC1=C(C=CC(=C1)C)B(O)O
2,4-DIMETHYLPIPERIDINE HYDROCHLORIDE
CAS:91846-47-8
CM180616
CC1CC(C)NCC1.[H]Cl
2,4-DIMETHYLPYRIDINE-3-BORONIC ACID
CAS:1029654-16-7
CM204382
OB(C1=C(C)C=CN=C1C)O
2,4-DIMETHYLPYRIMIDIN-5-OL
CAS:412003-95-3
CM166651
OC1=CN=C(C)N=C1C
2,4-DIMETHYLPYRIMIDINE
CAS:14331-54-5
CM249407
CC1=NC(C)=NC=C1
2,4-DIMETHYLPYRIMIDO[1,2-B]INDAZOLE
CAS:54167-66-7
CM332310
CC1=CC(C)=NC2=C3C=CC=CC3=NN21
2,4-DIMETHYLPYRIMIDO[2,1-A]PHTHALAZIN-5-IUM-7-AMINE;CHLORIDE
CAS:54752-92-0
CM325727
NC1=N[N+]2=C(C)C=C(C)N=C2C3=CC=CC=C13.[Cl-]
2,4-DIMETHYLPYRROLE
CAS:625-82-1
CM121301
CC1=CNC(C)=C1
2,4-DIMETHYLPYRROLE-3-CARBOXYLIC ACID
CAS:17106-13-7
CM197608
O=C(C1=C(C)NC=C1C)O
2,4-DIMETHYLQUINOLIN-7-OL
CAS:72365-58-3
CM224388
OC1=CC=C2C(C)=CC(C)=NC2=C1
2,4-DIMETHYLQUINOLIN-8-AMINE
CAS:3393-70-2
CM224484
NC1=C2N=C(C)C=C(C)C2=CC=C1
2,4-DIMETHYLQUINOLINE
CAS:1198-37-4
CM121512
CC1=CC(C)=NC2=CC=CC=C12
2,4-DIMETHYLQUINOLINE-5,8-DIONE
CAS:52824-08-5
CM226970
O=C(C=C1)C2=C(N=C(C)C=C2C)C1=O
2,4-DIMETHYLQUINOLINE-8-SELENOL
CAS:478960-97-3
CM224613
[SeH]C1=C2N=C(C)C=C(C)C2=CC=C1
2,4-DIMETHYLTHIAZOLE
CAS:541-58-2
CM121652
CC1=CSC(C)=N1
2,4-DIMETHYLTHIOPHEN-3-AMINE
CAS:87685-15-2
CM199996
NC1=C(C)SC=C1C
2,4-DINITRO-6-OCTAN-2-YLPHENOL
CAS:3687-22-7
CM329155
OC1=C(C(CCCCCC)C)C=C([N+]([O-])=O)C=C1[N+]([O-])=O
2,4-DINITROBENZENESULFONAMIDE
CAS:73901-01-6
CM123711
NS(=O)(=O)C1=C(C=C(C=C1)[N+]([O-])=O)[N+]([O-])=O
2,4-DIOXO-1,2,3,4-TETRAHYDROPYRIMIDINE-5-CARBALDEHYDE
CAS:1195-08-0
CM167382
O=CC1=CNC(=O)NC1=O
2,4-DIOXO-1,2,3,4-TETRAHYDROPYRIMIDINE-5-CARBOXYLIC ACID
CAS:23945-44-0
CM104193
OC(=O)C1=CNC(=O)NC1=O
2,4-DIOXO-1,2,3,4-TETRAHYDROPYRIMIDO[4,5-B]QUINOLINE-5-CARBOXYLIC ACID
CAS:500300-26-5
CM258518
O=C(C1=C(C(N2)=O)C(NC2=O)=NC3=CC=CC=C13)O
2,4-DIOXO-1,2,3,4-TETRAHYDROQUINAZOLIN-6-YL ACETATE
CAS:119278-36-3
CM205675
O=C(N1)NC2=C(C=C(OC(C)=O)C=C2)C1=O
2,4-DIOXO-1,2,3,4-TETRAHYDROQUINAZOLINE-6-CARBOXYLIC ACID
CAS:1821028-80-1
CM212199
O=C(C1=CC2=C(NC(NC2=O)=O)C=C1)O
2,4-DIOXO-1,2,3,4-TETRAHYDROQUINAZOLINE-7-CARBOXAMIDE
CAS:1207176-13-3
CM205855
O=C(C1=CC(NC(N2)=O)=C(C=C1)C2=O)N
2,4-DIOXO-1,2,3,4-TETRAHYDROQUINOLINE-3-CARBOXYLIC ACID
CAS:143049-22-3
CM242148
O=C(C1C(NC2=C(C=CC=C2)C1=O)=O)O
2,4-DIOXO-1,3-DIAZASPIRO[4.5]DECANE-7-CARBOXYLIC ACID
CAS:26629-10-7
CM213509
O=C(C(CCC1)CC1(NC(N2)=O)C2=O)O
2,4-DIOXO-1,4-DIHYDRO-2H-BENZO[D][1,3]OXAZINE-6-CARBOXYLIC ACID
CAS:77423-13-3
CM155259
OC(=O)C1=CC2=C(NC(=O)OC2=O)C=C1
2,4-DIOXO-3-AZASPIRO[5.5]UNDECANE-1,5-DICARBONITRILE
CAS:4355-15-1
CM214373
N#CC1C(NC(C(C#N)C12CCCCC2)=O)=O
2,4-DIOXO-3-AZASPIRO[5.5]UNDECANE-1-CARBONITRILE
CAS:6627-87-8
CM216163
N#CC1C(NC(CC12CCCCC2)=O)=O
2,4-DIOXOHEXAHYDROPYRIMIDINE-5-CARBOXYLIC ACID
CAS:92264-75-0
CM167646
O=C(C(CN1)C(NC1=O)=O)O
2,4-DIPHENYL-1H-IMIDAZOLE
CAS:670-83-7
CM187256
N1C=C(N=C1C1=CC=CC=C1)C1=CC=CC=C1
2,4-DIPHENYL-2-(PYRAZIN-2-YL)BUTANENITRILE
CAS:109929-60-4
CM332690
N#CC(C1=NC=CN=C1)(C2=CC=CC=C2)CCC3=CC=CC=C3
2,4-DIPHENYL-5,6,7,8-TETRAHYDROQUINAZOLINE
CAS:20954-93-2
CM213151
C1(C2=CC=CC=C2)=NC(C3=CC=CC=C3)=C4CCCCC4=N1
2,4-DIPHENYLBENZO[H]QUINAZOLINE
CAS:36547-38-3
CM214101
C1(C2=CC=CC=C2)=NC(C3=CC=CC=C3)=C4C=CC5=CC=CC=C5C4
2,4-DIPHENYLNAPHTHALEN-1-OL
CAS:16462-05-8
CM262487
OC1=C2C=CC=CC2=C(C3=CC=CC=C3)C=C1C4=CC=CC=C4
2,4-DIPHENYLPHTHALAZIN-1(2H)-ONE
CAS:36503-83-0
CM219767
O=C1N(C2=CC=CC=C2)N=C(C3=CC=CC=C3)C4=C1C=CC=C4
2,4-DIPHENYLPYRIDINE
CAS:26274-35-1
CM170749
C1(C2=CC=CC=C2)=NC=CC(C3=CC=CC=C3)=C1
2,4-DIPHENYLQUINOLIN-6-OL
CAS:5855-62-9
CM262569
OC1=CC=C2N=C(C3=CC=CC=C3)C=C(C4=CC=CC=C4)C2=C1
2,4-DITERT-BUTYL-6-NITROPHENOL
CAS:20039-94-5
CM325337
OC1=C([N+]([O-])=O)C=C(C(C)(C)C)C=C1C(C)(C)C
2,4-PYRROLIDINEDIONE
CAS:37772-89-7
CM198508
O=C(C1)NCC1=O
2,5,6,7-TETRAHYDRO-4H-INDAZOL-4-ONE
CAS:912259-10-0
CM331294
O=C1C2=CNN=C2CCC1
2,5,6,7-TETRAHYDRO-4H-ISOINDOL-4-ONE
CAS:113880-79-8
CM130675
O=C1C2=CNC=C2CCC1
2,5,6-TRICHLORO-1H-BENZIMIDAZOLE
CAS:16865-11-5
CM158606
ClC1=C(Cl)C=C2C(NC(Cl)=N2)=C1
2,5,6-TRICHLORO-1H-INDOLE
CAS:286949-65-3
CM233181
ClC1=CC2=C(C=C1Cl)C=C(Cl)N2
2,5,6-TRICHLORO-1H-INDOLE-3-CARBALDEHYDE
CAS:800400-47-9
CM257518
O=CC1=C(Cl)NC2=C1C=C(Cl)C(Cl)=C2
2,5,6-TRICHLORO-4-METHYLNICOTINONITRILE
CAS:63195-39-1
CM177088
ClC1=NC(=C(C(=C1C#N)C)Cl)Cl
2,5,6-TRICHLORONICOTINAMIDE
CAS:142266-62-4
CM177898
O=C(N)C1=C(Cl)N=C(Cl)C(Cl)=C1
2,5,6-TRICHLORONICOTINIC ACID
CAS:54718-39-7
CM178138
OC(=O)C1=CC(Cl)=C(Cl)N=C1Cl
2,5,6-TRICHLORONICOTINONITRILE
CAS:40381-92-8
CM178708
N#CC1=C(Cl)N=C(Cl)C(Cl)=C1
2,5,6-TRICHLORONICOTINOYL CHLORIDE
CAS:58584-88-6
CM308396
O=C(Cl)C1=C(Cl)N=C(Cl)C(Cl)=C1
2,5,6-TRICHLOROPYRIMIDIN-4-AMINE
CAS:28969-60-0
CM132099
NC1=NC(Cl)=NC(Cl)=C1Cl
2,5,6-TRIFLUORONICOTINONITRILE
CAS:870065-73-9
CM178780
N#CC1=C(F)N=C(F)C(F)=C1
2,5,6-TRIMETHYLBENZO[D]THIAZOLE
CAS:5683-41-0
CM157854
CC1=C(C)C=C2N=C(C)SC2=C1
2,5,6-TRIMETHYLPYRIMIDIN-4-OL
CAS:89943-15-7
CM276166
OC1=NC(C)=NC(C)=C1C
2,5,7-TRIAZASPIRO[3.4]OCTAN-6-ONE HYDROCHLORIDE
CAS:1609406-92-9
CM210664
O=C(NC1)NC21CNC2.[H]Cl
2,5,7-TRIAZASPIRO[3.4]OCTAN-8-ONE
CAS:693773-35-2
CM216359
O=C1NCNC21CNC2
2,5,7-TRIAZASPIRO[3.4]OCTANE-6,8-DIONE HYDROCHLORIDE
CAS:1026796-27-9
CM204352
O=C(NC1=O)NC21CNC2.[H]Cl
2,5,7-TRICHLOROQUINOLIN-8-OL
CAS:101870-58-0
CM227701
OC1=C2N=C(Cl)C=CC2=C(Cl)C=C1Cl
2,5,7-TRIMETHOXYNAPHTHALENE-1,4-DIONE
CAS:5803-58-7
CM257441
O=C(C1=C2C=C(OC)C=C1OC)C=C(OC)C2=O
2,5,7-TRIMETHYL-1,2,3,4-TETRAHYDROQUINOLINE
CAS:42835-95-0
CM239468
CC1=CC2=C(C(C)=C1)CCC(C)N2
2,5,7-TRIMETHYL-1H-INDOLE-3-CARBALDEHYDE
CAS:88611-38-5
CM334176
O=CC1=C(C)NC2=C1C=C(C)C=C2C
2,5,7-TRIMETHYLPYRAZOLO[1,5-A]PYRIMIDINE
CAS:112581-74-5
CM271251
CC1=CC(C)=NC2=CC(C)=NN12
2,5,7-TRIMETHYLPYRAZOLO[1,5-A]PYRIMIDINE-3-CARBOXYLIC ACID
CAS:1158269-53-4
CM268676
O=C(C1=C2N=C(C)C=C(C)N2N=C1C)O
2,5,7-TRIMETHYLQUINOLIN-4-AMINE
CAS:689277-04-1
CM240086
CC1=CC(C)=C2C(N)=CC(C)=NC2=C1
2,5,7-TRIMETHYLQUINOLINE
CAS:102871-67-0
CM227830
CC1=CC(C)=C2C=CC(C)=NC2=C1
2,5,7-TRIMETHYLQUINOLINE-3-CARBOXYLIC ACID
CAS:948290-95-7
CM226976
O=C(C1=CC2=C(C)C=C(C)C=C2N=C1C)O
2,5,7-TRIMETHYLQUINOLINE-4-CARBOXYLIC ACID
CAS:436092-02-3
CM222525
O=C(C1=CC(C)=NC2=CC(C)=CC(C)=C12)O
2,5,8,11,14,17-HEXAOXANONADECAN-19-AMINE
CAS:184357-46-8
CM182369
COCCOCCOCCOCCOCCOCCN
2,5,8,11,14,17-HEXAOXANONADECAN-19-OL
CAS:23601-40-3
CM182089
COCCOCCOCCOCCOCCOCCO
2,5,8,11,14-PENTAOXAHEXADECAN-16-OIC ACID
CAS:16024-66-1
CM329552
COCCOCCOCCOCCOCC(O)=O
2,5,8,11-TETRAMETHYL-1,4,7,10-TETRAAZACYCLODODECANE
CAS:494751-27-8
CM201406
CC1NCC(C)NCC(C)NCC(C)NC1
2,5,8,11-TETRAOXATETRADECAN-14-OIC ACID
CAS:67319-28-2
CM133305
COCCOCCOCCOCCC(O)=O
2,5,8,11-TETRAOXATRIDECAN-13-YL 4-METHYLBENZENESULFONATE
CAS:62921-76-0
CM254186
O=S(C1=CC=C(C)C=C1)(OCCOCCOCCOCCOC)=O
2,5,8-TRIMETHOXY-4-METHYLQUINOLIN-6-AMINE
CAS:49584-51-2
CM257464
NC1=CC(OC)=C2N=C(OC)C=C(C)C2=C1OC
2,5,8-TRIMETHOXY-4-METHYLQUINOLINE
CAS:66570-51-2
CM226977
CC1=CC(OC)=NC2=C(OC)C=CC(OC)=C12
2,5,8-TRIMETHYL-1,2,3,4-TETRAHYDROISOQUINOLINE
CAS:89549-08-6
CM226161
CC1=CC=C(C)C2=C1CN(C)CC2
2,5,8-TRIMETHYLQUINOLIN-4(1H)-ONE
CAS:54598-17-3
CM240159
O=C1C=C(C)NC2=C1C(C)=CC=C2C
2,5,8-TRIMETHYLQUINOLINE-3-CARBOXYLIC ACID
CAS:948291-16-5
CM226978
O=C(C1=CC2=C(C)C=CC(C)=C2N=C1C)O
2,5-BIS(2,2,2-TRIFLUOROETHOXY)BENZOIC ACID
CAS:35480-52-5
CM154689
OC(=O)C1=C(OCC(F)(F)F)C=CC(OCC(F)(F)F)=C1
2,5-BIS(2-METHYLAZIRIDIN-1-YL)BENZENE-1,4-DIOL
CAS:21384-06-5
CM300080
OC1=CC(N2C(C)C2)=C(O)C=C1N3C(C)C3
2,5-BIS(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)SELENOPHENE
CAS:1611991-43-5
CM210683
CC1(C)C(C)(C)OB(C2=CC=C(B3OC(C)(C)C(C)(C)O3)[Se]2)
2,5-BIS(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)THIOPHENE
CAS:175361-81-6
CM110000
CC1(C)C(C)(C)OB(C2=CC=C(B3OC(C)(C)C(C)(C)O3)S2)O1
2,5-BIS(5-(TERT-BUTYL)BENZO-[D]OXAZOL-2-YL)THIOPHENE
CAS:7128-64-5
CM160917
CC(C)(C)C1=CC2=C(OC(=N2)C2=CC=C(S2)C2=NC3=C(O2)C=C
2,5-BIS(BENZYLOXY)BENZALDEHYDE
CAS:6109-54-2
CM324333
O=CC1=CC(OCC2=CC=CC=C2)=CC=C1OCC3=CC=CC=C3
2,5-BIS(BENZYLOXY)BENZOIC ACID
CAS:67127-91-7
CM153583
O=C(O)C1=CC(OCC2=CC=CC=C2)=CC=C1OCC3=CC=CC=C3
2,5-BIS(HEXYL)-1,4-DIBROMOBENZENE
CAS:117635-21-9
CM182753
CCCCCCC1=C(Br)C=C(CCCCCC)C(Br)=C1
2,5-BIS(HYDROXYMETHYL)-1,4-DIOXANE-2,5-DIOL
CAS:26776-70-5
CM181687
OCC1(OCC(CO)(OC1)O)O
2,5-BIS(HYDROXYMETHYL)TETRAHYDROFURAN
CAS:104-80-3
CM116045
OCC1CCC(CO)O1
2,5-BIS(TRIFLUOROMETHYL)ANILINE
CAS:328-93-8
CM118422
NC1=CC(C(F)(F)F)=CC=C1C(F)(F)F
2,5-BIS(TRIFLUOROMETHYL)BENZENEBORONIC ACID
CAS:196083-18-8
CM133842
OB(C1=CC(C(F)(F)F)=CC=C1C(F)(F)F)O
2,5-BIS(TRIFLUOROMETHYL)CHLOROBENZENE
CAS:328-91-6
CM332562
FC(C1=CC=C(C(F)(F)F)C(Cl)=C1)(F)F
2,5-BIS(TRIMETHYLSILYL)THIAZOLE
CAS:79265-34-2
CM216854
C[Si](C1=CN=C([Si](C)(C)C)S1)(C)C
2,5-DI(PYRIDIN-4-YL)-1,3,4-OXADIAZOLE
CAS:15420-02-7
CM176639
C1(C2=CC=NC=C2)=NN=C(C3=CC=NC=C3)O1
2,5-DI-TERT-BUTYLHYDROQUINONE
CAS:88-58-4
CM116804
OC1=CC(C(C)(C)C)=C(O)C=C1C(C)(C)C
2,5-DIACETYL-[1,2,4]TRIAZOLO[4,3-A]QUINOXALINE-1,4(2H,5H)-DIONE
CAS:90042-39-0
CM222080
O=C1N(C(C)=O)N=C2N1C3=C(C=CC=C3)N(C(C)=O)C2=O
2,5-DIAMINEPYRIMIDINE
CAS:22715-27-1
CM167296
C1=C(N)C=NC(=N1)N
2,5-DIAMINO-4,6-DICHLOROPYRIMIDINE
CAS:55583-59-0
CM118926
ClC1=C(N)C(Cl)=NC(N)=N1
2,5-DIAMINOBENZENE-1,3-DISULFONIC ACID
CAS:6409-48-9
CM282870
O=S(C1=CC(N)=CC(S(=O)(O)=O)=C1N)(O)=O
2,5-DIAMINOBENZENE-1,4-DITHIOL DIHYDROCHLORIDE
CAS:75464-52-7
CM254910
SC1=CC(N)=C(S)C=C1N.[H]Cl.[H]Cl
2,5-DIAMINOBENZENESULFONIC ACID
CAS:88-45-9
CM255547
O=S(C1=CC(N)=CC=C1N)(O)=O
2,5-DIAMINOBENZONITRILE
CAS:14346-13-5
CM158970
N#CC1=CC(N)=CC=C1N
2,5-DIAMINOPYRAZINE
CAS:768386-37-4
CM120380
NC1=CN=C(N)C=N1
2,5-DIAMINOPYRIDINE DIHYDROCHLORIDE
CAS:26878-35-3
CM170746
NC1=CN=C(N)C=C1.[H]Cl.[H]Cl
2,5-DIAMINOPYRIMIDINE-4,6-DIOL
CAS:40769-69-5
CM166605
NC1=NC(O)=C(N)C(O)=N1
2,5-DIAZABICYCLO[2.2.1]HEPTANE
CAS:672-28-6
CM335932
C1(C2)CNC2CN1
2,5-DIAZABICYCLO[2.2.1]HEPTANE DIHYDROCHLORIDE
CAS:89487-38-7
CM363590
Cl.Cl.C1NC2CNC1C2
2,5-DIAZABICYCLO[4.1.0]HEPTANE
CAS:87640-95-7
CM335188
C12NCCNC1C2
2,5-DIAZASPIRO[3.4]OCTAN-6-ONE HYDROCHLORIDE
CAS:1630906-86-3
CM107261
O=C(CC1)NC21CNC2.[H]Cl
2,5-DIAZASPIRO[3.5]NONANE DIHYDROCHLORIDE
CAS:1334499-64-7
CM207927
[H]Cl.[H]Cl.C1NCC12NCCCC2
2,5-DIAZATRICYCLO[7.5.0.02,7]TETRADECA-1(9),7-DIEN-6-ONE
CAS:2180068-05-5
CM327453
O=C1NCCN2C3=C(CCCCC3)C=C12
2,5-DIBENZYLTETRAHYDROPYRROLO[3,4-C]PYRROLE-1,3(2H,3AH)-DIONE
CAS:165893-99-2
CM198466
O=C(C1C2CN(CC3=CC=CC=C3)C1)N(CC4=CC=CC=C4)C2=O
2,5-DIBROMO-[1,2,4]TRIAZOLO[1,5-A]PYRIDINE
CAS:1214901-64-0
CM128620
BrC1=CC=CC2=NC(Br)=NN12
2,5-DIBROMO-1,3-DIMETHYLBENZENE
CAS:100189-84-2
CM247244
CC1=CC(Br)=CC(C)=C1Br
2,5-DIBROMO-1,8-NAPHTHYRIDINE
CAS:1260657-29-1
CM230026
BrC1=C2C=CC(Br)=NC2=NC=C1
2,5-DIBROMO-1-(ETHOXYMETHYL)-4-NITRO-1H-IMIDAZOLE
CAS:1100750-08-0
CM330827
O=[N+](C1=C(Br)N(COCC)C(Br)=N1)[O-]
2,5-DIBROMO-1-CHLORO-3-FLUOROBENZENE
CAS:1000572-88-2
CM247230
FC1=C(Br)C(Cl)=CC(Br)=C1
2,5-DIBROMO-1-METHYL-1H-IMIDAZOLE
CAS:53857-59-3
CM104393
CN1C(Br)=CN=C1Br
2,5-DIBROMO-3,4-DIMETHYLPYRIDINE
CAS:125419-92-3
CM176630
CC1=C(C)C(Br)=NC=C1Br
2,5-DIBROMO-3-(BROMOMETHYL)PYRIDINE
CAS:61686-65-5
CM170733
BrCC1=CC(Br)=CN=C1Br
2,5-DIBROMO-3-(TRIFLUOROMETHYL)PYRIDINE
CAS:79623-39-5
CM103375
FC(C1=CC(Br)=CN=C1Br)(F)F
2,5-DIBROMO-3-BUTYLTHIOPHENE
CAS:116971-10-9
CM121723
CCCCC1=C(Br)SC(Br)=C1
2,5-DIBROMO-3-CHLOROPYRAZINE
CAS:21943-16-8
CM168484
ClC1=NC(Br)=CN=C1Br
2,5-DIBROMO-3-CHLOROPYRIDINE
CAS:160599-70-2
CM107212
ClC1=CC(Br)=CN=C1Br
2,5-DIBROMO-3-DECYLTHIOPHENE
CAS:158956-23-1
CM199669
CCCCCCCCCCC1=C(Br)SC(Br)=C1
2,5-DIBROMO-3-DODECYLTHIOPHENE
CAS:148256-63-7
CM199840
CCCCCCCCCCCCC1=C(Br)SC(Br)=C1
2,5-DIBROMO-3-FLUOROPYRIDINE
CAS:156772-60-0
CM109369
FC1=CC(Br)=CN=C1Br
2,5-DIBROMO-3-HEXYLTHIOPHENE
CAS:116971-11-0
CM199907
CCCCCCC1=C(Br)SC(Br)=C1
2,5-DIBROMO-3-ISOPROPYL-6-METHYLCYCLOHEXA-2,5-DIENE-1,4-DIONE
CAS:29096-93-3
CM203760
O=C1C(Br)=C(C(C)C)C(C(Br)=C1C)=O
2,5-DIBROMO-3-METHOXYPYRAZINE
CAS:489431-66-5
CM168235
COC1=NC(Br)=CN=C1Br
2,5-DIBROMO-3-METHYLPYRAZINE
CAS:1260672-37-4
CM294357
CC1=NC(Br)=CN=C1Br
2,5-DIBROMO-3-METHYLPYRIDINE
CAS:3430-18-0
CM102750
CC1=CC(Br)=CN=C1Br
2,5-DIBROMO-3-METHYLTHIOPHENE
CAS:13191-36-1
CM199461
CC1=C(Br)SC(Br)=C1
2,5-DIBROMO-3-NITROPYRIDINE
CAS:15862-37-0
CM107199
O=[N+](C1=CC(Br)=CN=C1Br)[O-]
2,5-DIBROMO-3-OCTYLTHIOPHENE
CAS:149703-84-4
CM199743
CCCCCCCCC1=C(Br)SC(Br)=C1
2,5-DIBROMO-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PYRIDINE
CAS:1451391-18-6
CM209876
CC1(C)C(C)(C)OB(C2=CC(Br)=NC=C2Br)O1
2,5-DIBROMO-4-(CHLOROMETHYL)THIAZOLE
CAS:934236-33-6
CM130041
ClCC1=C(Br)SC(Br)=N1
2,5-DIBROMO-4-(TRIFLUOROMETHYL)PYRIMIDINE
CAS:785777-91-5
CM255059
FC(C1=NC(Br)=NC=C1Br)(F)F
2,5-DIBROMO-4-CHLOROPYRIDINE
CAS:1033203-47-2
CM316466
ClC1=CC(Br)=NC=C1Br
2,5-DIBROMO-4-HYDROXYBENZOIC ACID
CAS:101421-19-6
CM316303
O=C(O)C1=CC(Br)=C(O)C=C1Br
2,5-DIBROMO-4-METHOXYPYRIDINE
CAS:1211520-71-6
CM248208
COC1=CC(Br)=NC=C1Br
2,5-DIBROMO-4-METHYLPYRIDINE
CAS:3430-26-0
CM120671
CC1=CC(Br)=NC=C1Br
2,5-DIBROMO-4-METHYLTHIAZOLE
CAS:79247-78-2
CM111165
CC1=C(Br)SC(Br)=N1
2,5-DIBROMO-4-NITRO-1H-IMIDAZOLE
CAS:6154-30-9
CM187248
[O-][N+](=O)C1=C(Br)NC(Br)=N1
2,5-DIBROMO-4-NITROANILINE
CAS:25462-68-4
CM317723
NC1=CC(Br)=C([N+]([O-])=O)C=C1Br
2,5-DIBROMO-4-PYRIDINYLBORONIC ACID
CAS:1031843-77-2
CM137527
OB(O)C1=CC(Br)=NC=C1Br
2,5-DIBROMO-8-FLUOROQUINOLINE
CAS:1597291-48-9
CM227120
FC1=C2N=C(Br)C=CC2=C(Br)C=C1
2,5-DIBROMOBENZALDEHYDE
CAS:74553-29-0
CM254866
BrC1=C(C=O)C=C(C=C1)Br
2,5-DIBROMOBENZOTHIAZOLE
CAS:1019111-64-8
CM158453
BrC1=NC2=C(S1)C=CC(=C2)Br
2,5-DIBROMOBENZYL ALCOHOL
CAS:147034-01-3
CM116028
BrC1=CC=C(Br)C(CO)=C1
2,5-DIBROMOFURAN
CAS:32460-00-7
CM342028
BrC1=CC=C(Br)O1
2,5-DIBROMOFURAN-3-CARBOXYLIC ACID
CAS:32460-22-3
CM195808
OC(=O)C1=C(Br)OC(Br)=C1
2,5-DIBROMOHYDROQUINONE
CAS:14753-51-6
CM117360
OC1=CC(Br)=C(O)C=C1Br
2,5-DIBROMONICOTINALDEHYDE
CAS:852181-11-4
CM132508
O=CC1=C(Br)N=CC(Br)=C1
2,5-DIBROMONICOTINIC ACID
CAS:29312-99-0
CM178049
BrC1=C(C(=O)O)C=C(C=N1)Br
2,5-DIBROMOPHENOL
CAS:28165-52-8
CM100464
OC1=CC(Br)=CC=C1Br
2,5-DIBROMOPHENYLBORONIC ACID
CAS:1008106-93-1
CM135432
BrC1=C(C=C(C=C1)Br)B(O)O
2,5-DIBROMOPYRAZINE
CAS:23229-26-7
CM111076
BrC1=CN=C(Br)C=N1
2,5-DIBROMOPYRIDIN-1-IUM-1-OLATE
CAS:20734-22-9
CM343102
BrC1=CC=C(Br)[N+]([O-])=C1
2,5-DIBROMOPYRIDIN-3-AMINE
CAS:90902-84-4
CM109008
NC1=CC(Br)=CN=C1Br
2,5-DIBROMOPYRIDIN-3-OL
CAS:857429-79-9
CM176099
OC1=CC(Br)=CN=C1Br
2,5-DIBROMOPYRIDINE-3-BORONIC ACID
CAS:852228-14-9
CM137112
BrC1=CN=C(Br)C(B(O)O)=C1
2,5-DIBROMOPYRIDINE-4-CARBOXYLIC ACID
CAS:942473-59-8
CM172322
BrC1=NC=C(C(=C1)C(=O)O)Br
2,5-DIBROMOPYRIMIDINE
CAS:32779-37-6
CM100014
BrC1=CN=C(Br)N=C1
2,5-DIBROMOTEREPHTALIC ACID
CAS:13731-82-3
CM249099
C1=C(Br)C(=CC(=C1C(O)=O)Br)C(O)=O
2,5-DIBROMOTEREPHTHALALDEHYDE
CAS:63525-48-4
CM132392
BrC1=CC(C=O)=C(Br)C=C1C=O
2,5-DIBROMOTHIAZOLE-4-CARBOXYLIC ACID
CAS:943735-44-2
CM126590
O=C(C1=C(Br)SC(Br)=N1)O
2,5-DIBROMOTHIOPHENE
CAS:3141-27-3
CM121682
BrC1=CC=C(Br)S1
2,5-DIBROMOTHIOPHENE-3,4-DICARBOXYLIC ACID
CAS:190723-12-7
CM132078
O=C(C1=C(Br)SC(Br)=C1C(O)=O)O
2,5-DIBROMOTHIOPHENE-3-CARBOXYLIC ACID
CAS:7311-70-8
CM199659
O=C(C1=C(Br)SC(Br)=C1)O
2,5-DICHLORO-1,3-BENZOXAZOLE
CAS:3621-81-6
CM104268
ClC1=NC2=C(O1)C=CC(Cl)=C2
2,5-DICHLORO-1,6-NAPHTHYRIDINE
CAS:23616-35-5
CM141556
ClC1=C2C=CC(Cl)=NC2=CC=N1
2,5-DICHLORO-1H-BENZIMIDAZOLE
CAS:4887-95-0
CM154915
ClC1=CC=C2C(NC(Cl)=N2)=C1
2,5-DICHLORO-1H-INDOLE
CAS:916258-28-1
CM233203
ClC1=CC2=C(NC(Cl)=C2)C=C1
2,5-DICHLORO-1H-PYRROLO[3,2-B]PYRIDINE
CAS:1000342-87-9
CM105434
ClC1=CC=C(NC(Cl)=C2)C2=N1
2,5-DICHLORO-3,4-DIIODOTHIOPHENE
CAS:57308-89-1
CM243862
IC1=C(Cl)SC(Cl)=C1I
2,5-DICHLORO-3,6-DIMETHYLPYRAZINE
CAS:27023-19-4
CM168925
CC1=C(Cl)N=C(C)C(Cl)=N1
2,5-DICHLORO-3,8-DIMETHYLQUINOLINE
CAS:948291-23-4
CM226979
CC1=C2N=C(Cl)C(C)=CC2=C(Cl)C=C1
2,5-DICHLORO-3-(3-CHLOROPROPYL)-8-METHYLQUINOLINE
CAS:948291-96-1
CM261787
CC1=C2N=C(Cl)C(CCCCl)=CC2=C(Cl)C=C1
2,5-DICHLORO-3-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PYRIDINE
CAS:1073371-98-8
CM135436
CC1(C)OB(OC1(C)C)C1=CC(Cl)=CN=C1Cl
2,5-DICHLORO-3-(CHLOROMETHYL)-8-METHYLQUINOLINE
CAS:948292-13-5
CM258859
CC1=C2N=C(Cl)C(CCl)=CC2=C(Cl)C=C1
2,5-DICHLORO-3-(TRIFLUOROMETHYL)BENZOIC ACID
CAS:871254-76-1
CM124134
O=C(O)C1=CC(Cl)=CC(C(F)(F)F)=C1Cl
2,5-DICHLORO-3-(TRIFLUOROMETHYL)PYRIDINE
CAS:70158-59-7
CM173809
FC(C1=CC(Cl)=CN=C1Cl)(F)F
2,5-DICHLORO-3-ETHYL-8-METHYLQUINOLINE
CAS:1031927-97-5
CM226980
CC1=C2N=C(Cl)C(CC)=CC2=C(Cl)C=C1
2,5-DICHLORO-3-FLUOROPYRIDINE
CAS:103999-77-5
CM121083
FC1=CC(Cl)=CN=C1Cl
2,5-DICHLORO-3-IODOPYRIDINE
CAS:942206-23-7
CM121012
IC1=CC(Cl)=CN=C1Cl
2,5-DICHLORO-3-METHYLPYRIDINE
CAS:59782-88-6
CM120868
CC1=CC(Cl)=CN=C1Cl
2,5-DICHLORO-3-NITROBENZOIC ACID
CAS:88-86-8
CM160832
O=C(O)C1=CC(Cl)=CC([N+]([O-])=O)=C1Cl
2,5-DICHLORO-3-NITROPYRIDINE
CAS:21427-62-3
CM102683
O=[N+](C1=CC(Cl)=CN=C1Cl)[O-]
2,5-DICHLORO-4,6-DIMETHYLNICOTINIC ACID
CAS:142266-66-8
CM178680
O=C(O)C1=C(Cl)N=C(C)C(Cl)=C1C
2,5-DICHLORO-4,6-DIMETHYLPYRIDINE-3-CARBONITRILE
CAS:91591-63-8
CM120715
N#CC1=C(C)C(Cl)=C(C)N=C1Cl
2,5-DICHLORO-4,6-DIMETHYLPYRIMIDINE
CAS:19573-83-2
CM127973
CC1=C(Cl)C(C)=NC(Cl)=N1
2,5-DICHLORO-4-(3,5-DIMETHYLPYRIDIN-2-YL)PYRIDINE
CAS:1373615-78-1
CM327363
CC1=CN=C(C2=CC(Cl)=NC=C2Cl)C(C)=C1
2,5-DICHLORO-4-(3-NITROPHENOXY)PYRIMIDINE
CAS:76661-24-0
CM167839
O=[N+](C1=CC(OC2=NC(Cl)=NC=C2Cl)=CC=C1)[O-]
2,5-DICHLORO-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PYRIDINE
CAS:1073353-98-6
CM135425
CC1(C)OB(OC1(C)C)C1=CC(Cl)=NC=C1Cl
2,5-DICHLORO-4-(TRIFLUOROMETHYL)PYRIDINE
CAS:89719-92-6
CM121082
FC(C1=CC(Cl)=NC=C1Cl)(F)F
2,5-DICHLORO-4-(TRIFLUOROMETHYL)PYRIMIDINE
CAS:785777-98-2
CM126077
FC(C1=NC(Cl)=NC=C1Cl)(F)F
2,5-DICHLORO-4-IODOPYRIDINE
CAS:796851-03-1
CM120740
IC1=CC(Cl)=NC=C1Cl
2,5-DICHLORO-4-IODOPYRIMIDINE
CAS:1137576-41-0
CM326778
IC1=NC(Cl)=NC=C1Cl
2,5-DICHLORO-4-METHOXYBENZALDEHYDE
CAS:381229-74-9
CM327764
O=CC1=CC(Cl)=C(OC)C=C1Cl
2,5-DICHLORO-4-METHOXYBENZOIC ACID
CAS:2500-03-0
CM251696
O=C(O)C1=CC(Cl)=C(OC)C=C1Cl
2,5-DICHLORO-4-METHOXYPYRIMIDINE
CAS:5750-74-3
CM121172
COC1=NC(Cl)=NC=C1Cl
2,5-DICHLORO-4-METHYLPYRIDINE
CAS:886365-00-0
CM175984
CC1=CC(Cl)=NC=C1Cl
2,5-DICHLORO-4-METHYLPYRIMIDINE
CAS:1192064-63-3
CM122162
ClC1=NC=C(C(=N1)C)Cl
2,5-DICHLORO-4-NITRO-1H-IMIDAZOLE
CAS:159965-32-9
CM187604
O=[N+](C1=C(Cl)NC(Cl)=N1)[O-]
2,5-DICHLORO-4-NITROANILINE
CAS:6627-34-5
CM303709
NC1=CC(Cl)=C([N+]([O-])=O)C=C1Cl
2,5-DICHLORO-4-NITROPYRIDIN-1-IUM-1-OLATE
CAS:405230-81-1
CM362361
[O-][N+](=O)C1=CC(Cl)=[N+]([O-])C=C1Cl
2,5-DICHLORO-6-METHOXY-4-METHYLNICOTINONITRILE
CAS:886047-45-6
CM124273
N#CC1=C(Cl)N=C(OC)C(Cl)=C1C
2,5-DICHLORO-6-METHOXY-4-METHYLQUINOLINE
CAS:741233-61-4
CM256843
CC1=CC(Cl)=NC2=CC=C(OC)C(Cl)=C12
2,5-DICHLORO-6-METHYLNICOTINIC ACID
CAS:117449-74-8
CM178919
O=C(O)C1=C(Cl)N=C(C)C(Cl)=C1
2,5-DICHLORO-8-(TRIFLUOROMETHOXY)QUINOLINE
CAS:1403765-06-9
CM261112
FC(F)(F)OC1=C2N=C(Cl)C=CC2=C(Cl)C=C1
2,5-DICHLORO-8-METHYL-3-PHENYLQUINOLINE
CAS:1031928-13-8
CM226981
CC1=C2N=C(Cl)C(C3=CC=CC=C3)=CC2=C(Cl)C=C1
2,5-DICHLORO-8-METHYLQUINOLINE-3-CARBALDEHYDE
CAS:948291-36-9
CM223994
O=CC1=CC2=C(Cl)C=CC(C)=C2N=C1Cl
2,5-DICHLORO-8-METHYLQUINOLINE-3-CARBONITRILE
CAS:948291-30-3
CM256218
N#CC1=CC2=C(Cl)C=CC(C)=C2N=C1Cl
2,5-DICHLORO-8-METHYLQUINOLINE-4-CARBOXYLIC ACID
CAS:1267302-08-8
CM258389
O=C(C1=CC(Cl)=NC2=C(C)C=CC(Cl)=C12)O
2,5-DICHLORO-L-PHENYLALANINE
CAS:754971-91-0
CM194425
O=C(O)[C@@H](N)CC1=CC(Cl)=CC=C1Cl
2,5-DICHLORO-N-(2-(ISOPROPYLSULFONYL)-PHENYL)PYRIMIDIN-4-AMINE
CAS:761440-16-8
CM166463
CC(C)S(=O)(=O)C1=C(NC2=C(Cl)C=NC(Cl)=N2)C=CC=C1
2,5-DICHLORO-N-(2-(ISOPROPYLTHIO)PHENYL)PYRIMIDIN-4-AMINE
CAS:1632485-14-3
CM167749
CC(SC1=CC=CC=C1NC2=NC(Cl)=NC=C2Cl)C
2,5-DICHLORO-N-(2-METHYLQUINOLIN-8-YL)BENZAMIDE
CAS:61388-92-9
CM225400
O=C(NC1=C2N=C(C)C=CC2=CC=C1)C3=CC(Cl)=CC=C3Cl
2,5-DICHLORO-N-(4-METHOXYPHENYL)-N-METHYLQUINAZOLIN-4-AMINE
CAS:827031-22-1
CM217084
CN(C1=CC=C(OC)C=C1)C2=C3C(Cl)=CC=CC3=NC(Cl)=N2
2,5-DICHLORO-N-(5-METHYL-1H-PYRAZOL-3-YL)PYRIMIDIN-4-AMINE
CAS:543712-81-8
CM111974
CC1=CC(NC2=NC(Cl)=NC=C2Cl)=NN1
2,5-DICHLORO-N-(NAPHTHALEN-2-YL)PYRIMIDIN-4-AMINE
CAS:1538540-13-4
CM233238
ClC1=CN=C(Cl)N=C1NC2=CC=C3C=CC=CC3=C2
2,5-DICHLOROBENZALDEHYDE
CAS:6361-23-5
CM254246
C1=C(C(=CC=C1Cl)Cl)C=O
2,5-DICHLOROBENZOIC ACID
CAS:50-79-3
CM101866
O=C(O)C1=CC(Cl)=CC=C1Cl
2,5-DICHLOROBENZONITRILE
CAS:21663-61-6
CM156996
N#CC1=CC(Cl)=CC=C1Cl
2,5-DICHLOROBENZOTHIAZOLE
CAS:2941-48-2
CM162055
C1=CC2=C(C=C1Cl)N=C(Cl)S2
2,5-DICHLOROBENZOTRIFLUORIDE
CAS:320-50-3
CM157177
FC(F)(F)C1=C(Cl)C=CC(Cl)=C1
2,5-DICHLOROBENZOYL CYANIDE
CAS:64985-85-9
CM161198
O=C(C#N)C1=CC(Cl)=CC=C1Cl
2,5-DICHLOROBENZYL ACETATE
CAS:10541-66-9
CM328924
CC(OCC1=CC(Cl)=CC=C1Cl)=O
2,5-DICHLOROBENZYL CYANIDE
CAS:3218-50-6
CM252197
ClC1=CC=C(Cl)C(CC#N)=C1
2,5-DICHLOROISONICOTINALDEHYDE
CAS:102645-33-0
CM179011
O=CC1=C(Cl)C=NC(Cl)=C1
2,5-DICHLOROISONICOTINIC ACID
CAS:88912-26-9
CM102143
O=C(O)C1=C(Cl)C=NC(Cl)=C1
2,5-DICHLORONICOTINALDEHYDE
CAS:176433-49-1
CM178127
O=CC1=C(Cl)N=CC(Cl)=C1
2,5-DICHLORONICOTINIC ACID
CAS:59782-85-3
CM178151
ClC1=C(C(=O)O)C=C(C=N1)Cl
2,5-DICHLORONICOTINONITRILE
CAS:126954-66-3
CM178762
N#CC1=C(Cl)N=CC(Cl)=C1