Phone (USA) +1 212-348-5610
Whatsapp: +1 516-336-9307
WeChat: chembuyersguide
Chemical Search
 


























Chemenu Inc.




Country: USA

Chemenu Inc.
PO BOX 1541
MT LAUREL NJ 08054

China Office
Lane 3399, Kangxin Highway,Bldg 5,
Shanghai International Medical Zone,
Pudong New District,
Shanghai, China 201321


Phone: +86 21 5895 0110
FAX: +86-21-2096 2272
E-Mail:E-Mail this Supplier


http://www.chemenu.com/

Chemenu Inc.

Page: Home | 1 | 2 | 3 | 4 | 5 | 6 | 7 | 8 | 9 | 10 | 11 | 12 | 13 | 14 | 15 | 16 | 17 | 18 | 19 | 20 | 21 | 22 | 23 | 24 | 25 | 26 | 27 | 28 | 29 | 30 | 31 | 32 | 33 | 34 | 35 | 36 | 37 | 38 | 39 | 40 | 41 | 42 | 43 | 44 | 45 | 46 | 47 | 48 | 49 | 50 | 51 | 52 | 53 | 54 | 55 | 56 | 57 | 58 | 59 | 60 | 61 | 62 | 63 | 64 | 65 | 66 | 67 | 68 | 69 | 70 | 71 | 72 | 73 | 74 | 75 | 76 | 77 | 78 | 79 | 80 | 81 | 82 | 83 | 84 | 85 | 86 | 87 | 88 | 89 | 90 | 91 | 92 | 93 | 94 | 95 | 96 | 97 | 98 | 99 | 100 | 101 | 102 | 103 | 104 | 105 | 106 | 107 | 108 | 109 | 110 | 111 | 112 | 113 | 114 | 115 | 116 | 117 | 118 | 119 | 120 | 121 | 122 | 123 | 124 | 125 | 126 | 127 | 128 | 129 | 130 | 131 | 132 | 133 | 134 | 135 | 136 | 137 | 138 | 139 | 140 | 141 | 142 | 143 | 144 | 145 | 146 | 147 | 148 | 149 | 150 | 151 | 152 | 153 | 154 | 155 | 156 | 157 | 158 | 159 | 160 | 161 | 162 | 163 | 164 | 165 | 166 | 167 | 168 | 169 | 170 | 171 | 172 | 173 | 174 | 175 | 176 | 177 | 178 | 179 | 180 | 181 | 182 | 183 | 184 | 185 | 186 | 187 | 188 | 189 | 190 | 191 | 192 | 193 | 194 | 195 | 196 | 197 | 198 | 199 | 200 | 201 | 202 | 203 | 204 | 205 | 206 | 207 | 208 | 209 | 210 | 211 | 212 | 213 | 214 | 215 | 216 | 217 | 218 | 219 | 220 | 221 | 222 | 223 | 224 | 225 | 226 | 227 | 228 | 229 | 230 | 231 | 232 | 233 | 234 | 235 | 236 | 237 | 238 | 239 | 240 | 241 | 242 | 243 | 244 | 245 | 246 | 247 | 248 | 249 | 250 | 251 | 252 | 253 | 254 | 255 | 256 | 257 | 258 | 259 | 260 | 261 | 262 | 263 | 264 | 265 | 266 | 267 | 268 | 269 | 270 | 271 | 272 | 273 | 274 | 275 | 276 | 277 | 278 | 279 | 280 | 281 | 282 | 283 | 284 | 285 | 286 | 287 | 288 | 289 | 290 | 291 | 292 | 293 | 294 | 295 | 296 | 297 | 298 | 299 | 300 | 301 | 302 | 303 | 304 | 305 | 306 |
 


Product List

1,2,3,4-TETRAHYDROISOQUINOLIN-5-YL ACETATE
CAS:164653-60-5
CM240692
CC(OC1=CC=CC2=C1CCNC2)=O
1,2,3,4-TETRAHYDROISOQUINOLIN-6-AMINE
CAS:72299-67-3
CM144988
NC1=CC2=C(CNCC2)C=C1
1,2,3,4-TETRAHYDROISOQUINOLIN-6-AMINE DIHYDROCHLORIDE
CAS:1986456-03-4
CM538373
NC1=CC2=C(CNCC2)C=C1.[H]Cl.[H]Cl
1,2,3,4-TETRAHYDROISOQUINOLIN-6-AMINE HYDROCHLORIDE
CAS:175871-42-8
CM144550
NC1=CC2=C(CNCC2)C=C1.[H]Cl
1,2,3,4-TETRAHYDROISOQUINOLIN-6-OL HYDROCHLORIDE
CAS:63905-73-7
CM145862
OC1=CC2=C(CNCC2)C=C1.[H]Cl
1,2,3,4-TETRAHYDROISOQUINOLIN-7-AMINE DIHYDROCHLORIDE
CAS:200137-80-0
CM227402
NC1=CC2=C(C=C1)CCNC2.[H]Cl.[H]Cl
1,2,3,4-TETRAHYDROISOQUINOLIN-7-AMINE HYDROCHLORIDE
CAS:175871-45-1
CM144556
NC1=CC2=C(C=C1)CCNC2.[H]Cl
1,2,3,4-TETRAHYDROISOQUINOLIN-7-OL HYDROBROMIDE
CAS:110192-19-3
CM119911
OC1=CC2=C(C=C1)CCNC2.[H]Br
1,2,3,4-TETRAHYDROISOQUINOLIN-7-OL HYDROCHLORIDE
CAS:66393-01-9
CM144804
Cl[H].OC1=CC=C2CCNCC2=C1
1,2,3,4-TETRAHYDROISOQUINOLIN-8-AMINE
CAS:924633-49-8
CM118674
NC1=CC=CC2=C1CNCC2
1,2,3,4-TETRAHYDROISOQUINOLIN-8-AMINE HYDROCHLORIDE
CAS:1447606-38-3
CM229056
NC1=CC=CC2=C1CNCC2.[H]Cl
1,2,3,4-TETRAHYDROISOQUINOLIN-8-OL HYDROBROMIDE
CAS:110192-20-6
CM145339
OC1=CC=CC2=C1CNCC2.[H]Br
1,2,3,4-TETRAHYDROISOQUINOLINE
CAS:91-21-4
CM144744
C12=C(CNCC2)C=CC=C1
1,2,3,4-TETRAHYDROISOQUINOLINE HYDROCHLORIDE
CAS:14099-81-1
CM144434
[H]Cl.C12=C(CNCC2)C=CC=C1
1,2,3,4-TETRAHYDROISOQUINOLINE-1-CARBOXYLIC ACID
CAS:41034-52-0
CM145698
OC(=O)C1NCCC2=C1C=CC=C2
1,2,3,4-TETRAHYDROISOQUINOLINE-1-CARBOXYLIC ACID HYDROCHLORIDE
CAS:92932-74-6
CM144108
[H+].C2=C1C(NCCC1=CC=C2)C(O)=O.[Cl-]
1,2,3,4-TETRAHYDROISOQUINOLINE-3-CARBOXAMIDE
CAS:112794-29-3
CM144783
O=C(C1NCC2=C(C=CC=C2)C1)N
1,2,3,4-TETRAHYDROISOQUINOLINE-3-CARBOXYLIC ACID
CAS:67123-97-1
CM145839
OC(=O)C1CC2=C(CN1)C=CC=C2
1,2,3,4-TETRAHYDROISOQUINOLINE-3-CARBOXYLIC ACID HYDROBROMIDE
CAS:190961-50-3
CM144600
O=C(C1NCC2=C(C=CC=C2)C1)O.[H]Br
1,2,3,4-TETRAHYDROISOQUINOLINE-3-CARBOXYLIC ACID HYDROCHLORIDE
CAS:41994-51-8
CM143115
Cl.OC(=O)C1CC2=C(CN1)C=CC=C2
1,2,3,4-TETRAHYDROISOQUINOLINE-3-METHANOL
CAS:63006-93-9
CM144977
OCC1NCC2=C(C=CC=C2)C1
1,2,3,4-TETRAHYDROISOQUINOLINE-4,6,7-TRIOL
CAS:50988-14-2
CM239874
OC1CNCC2=C1C=C(O)C(O)=C2
1,2,3,4-TETRAHYDROISOQUINOLINE-4,6-DIOL
CAS:93202-93-8
CM144097
OC1CNCC2=C1C=C(O)C=C2
1,2,3,4-TETRAHYDROISOQUINOLINE-4-CARBOXYLIC ACID
CAS:116140-19-3
CM144782
OC(=O)C1CNCC2=C1C=CC=C2
1,2,3,4-TETRAHYDROISOQUINOLINE-4-CARBOXYLIC ACID HYDROCHLORIDE
CAS:1841081-68-2
CM468647
Cl.OC(=O)C1CNCC2=C1C=CC=C2
1,2,3,4-TETRAHYDROISOQUINOLINE-5,6-DIAMINE
CAS:156694-28-9
CM238794
NC1=C(N)C=CC2=C1CCNC2
1,2,3,4-TETRAHYDROISOQUINOLINE-5,8-DIAMINE
CAS:917805-10-8
CM238798
NC1=CC=C(N)C2=C1CCNC2
1,2,3,4-TETRAHYDROISOQUINOLINE-5-CARBONITRILE
CAS:215794-24-4
CM145646
N#CC1=CC=CC2=C1CCNC2
1,2,3,4-TETRAHYDROISOQUINOLINE-5-CARBONITRILE HYDROCHLORIDE
CAS:1165924-13-9
CM228380
N#CC1=CC=CC2=C1CCNC2.[H]Cl
1,2,3,4-TETRAHYDROISOQUINOLINE-5-CARBOXYLIC ACID
CAS:1044764-16-0
CM227477
O=C(C1=CC=CC2=C1CCNC2)O
1,2,3,4-TETRAHYDROISOQUINOLINE-5-CARBOXYLIC ACID HYDROCHLORIDE
CAS:1203579-50-3
CM145482
O=C(C1=CC=CC2=C1CCNC2)O.[H]Cl
1,2,3,4-TETRAHYDROISOQUINOLINE-6,7-DIOL
CAS:42887-47-8
CM238885
OC1=CC2=C(C=C1O)CCNC2
1,2,3,4-TETRAHYDROISOQUINOLINE-6,7-DIOL HYDROBROMIDE
CAS:52768-23-7
CM228746
OC1=CC2=C(CNCC2)C=C1O.[H]Br
1,2,3,4-TETRAHYDROISOQUINOLINE-6-CARBALDEHYDE HYDROCHLORIDE
CAS:1205748-65-7
CM223562
O=CC1=CC2=C(CNCC2)C=C1.[H]Cl
1,2,3,4-TETRAHYDROISOQUINOLINE-6-CARBONITRILE
CAS:166398-34-1
CM145628
N#CC1=CC2=C(CNCC2)C=C1
1,2,3,4-TETRAHYDROISOQUINOLINE-6-CARBONITRILE HYDROCHLORIDE
CAS:171084-93-8
CM129069
Cl.N#CC1=CC2=C(CNCC2)C=C1
1,2,3,4-TETRAHYDROISOQUINOLINE-6-CARBOXYLIC ACID
CAS:933752-32-0
CM145877
OC(=O)C1=CC2=C(CNCC2)C=C1
1,2,3,4-TETRAHYDROISOQUINOLINE-6-CARBOXYLIC ACID HYDROCHLORIDE
CAS:2097068-75-0
CM468645
Cl.OC(=O)C1=CC2=C(CNCC2)C=C1
1,2,3,4-TETRAHYDROISOQUINOLINE-7,8-DIAMINE
CAS:724418-79-5
CM238796
NC1=C(N)C2=C(C=C1)CCNC2
1,2,3,4-TETRAHYDROISOQUINOLINE-7-CARBONITRILE
CAS:149355-52-2
CM144494
N#CC1=CC2=C(CCNC2)C=C1
1,2,3,4-TETRAHYDROISOQUINOLINE-7-CARBONITRILE HYDROCHLORIDE
CAS:200137-81-1
CM144235
Cl.N#CC1=CC2=C(CCNC2)C=C1
1,2,3,4-TETRAHYDROISOQUINOLINE-7-CARBOXYLIC ACID
CAS:526219-52-3
CM363750
OC(=O)C1=CC2=C(CCNC2)C=C1
1,2,3,4-TETRAHYDROISOQUINOLINE-7-CARBOXYLIC ACID
CAS:160346-57-6
CM144510
OC(=O)C1=CC2=C(CCNC2)C=C1
1,2,3,4-TETRAHYDROISOQUINOLINE-7-CARBOXYLIC ACID HYDROCHLORIDE
CAS:220247-71-2
CM143022
Cl.OC(=O)C1=CC2=C(CCNC2)C=C1
1,2,3,4-TETRAHYDROISOQUINOLINE-7-SULFONAMIDE
CAS:31404-61-2
CM242932
O=S(C1=CC2=C(C=C1)CCNC2)(N)=O
1,2,3,4-TETRAHYDROISOQUINOLINE-8-CARBONITRILE
CAS:1203682-31-8
CM367077
N#CC1=CC=CC2=C1CNCC2
1,2,3,4-TETRAHYDROISOQUINOLINE-8-CARBONITRILE
CAS:215798-85-9
CM228508
N#CC1=CC=CC2=C1CNCC2
1,2,3,4-TETRAHYDROISOQUINOLINE-8-CARBOXYLIC ACID
CAS:933753-84-5
CM227294
O=C(C1=CC=CC2=C1CNCC2)O
1,2,3,4-TETRAHYDROISOQUINOLINE-8-CARBOXYLIC ACID HYDROCHLORIDE
CAS:1949793-13-8
CM468643
Cl.OC(=O)C1=CC=CC2=C1CNCC2
1,2,3,4-TETRAHYDRONAPHTHALEN-1-AMINE HYDROCHLORIDE
CAS:3459-02-7
CM232908
Cl.NC1CCCC2=C1C=CC=C2
1,2,3,4-TETRAHYDRONAPHTHALEN-1-OL
CAS:529-33-9
CM100008
OC1CCCC2=C1C=CC=C2
1,2,3,4-TETRAHYDRONAPHTHALEN-1-ONE
CAS:529-34-0
CM108141
O=C1CCCC2=C1C=CC=C2
1,2,3,4-TETRAHYDRONAPHTHALEN-2-AMINE
CAS:2954-50-9
CM128313
NC1CCC2=C(C1)C=CC=C2
1,2,3,4-TETRAHYDRONAPHTHALEN-2-OL
CAS:530-91-6
CM238358
OC1CC2=C(C=CC=C2)CC1
1,2,3,4-TETRAHYDRONAPHTHALENE-1,2-DIAMINE
CAS:90872-69-8
CM237337
NC1C(N)CCC2=C1C=CC=C2
1,2,3,4-TETRAHYDRONAPHTHALENE-1,5-DIOL
CAS:40771-26-4
CM141450
OC1CCCC2=C1C=CC=C2O
1,2,3,4-TETRAHYDRONAPHTHALENE-1,7-DIAMINE
CAS:63125-52-0
CM409076
NC1CCCC2=C1C=C(N)C=C2
1,2,3,4-TETRAHYDRONAPHTHALENE-1,8-DIOL
CAS:143536-28-1
CM238852
OC1CCCC2=C1C(O)=CC=C2
1,2,3,4-TETRAHYDRONAPHTHALENE-1-CARBONITRILE
CAS:56536-96-0
CM140830
N#CC1CCCC2=C1C=CC=C2
1,2,3,4-TETRAHYDRONAPHTHALENE-1-CARBOTHIOHYDRAZIDE
CAS:321198-18-9
CM237685
NNC(C1CCCC2=C1C=CC=C2)=S
1,2,3,4-TETRAHYDRONAPHTHALENE-1-CARBOXIMIDAMIDE HYDROCHLORIDE
CAS:1375996-89-6
CM468110
Cl.NC(=N)C1CCCC2=C1C=CC=C2
1,2,3,4-TETRAHYDRONAPHTHALENE-1-CARBOXYLIC ACID
CAS:1914-65-4
CM140699
C2(C1=CC=CC=C1CCC2)C(=O)O
1,2,3,4-TETRAHYDRONAPHTHALENE-1-THIOL
CAS:103324-34-1
CM405269
SC1CCCC2=C1C=CC=C2
1,2,3,4-TETRAHYDRONAPHTHALENE-2-CARBOXIMIDAMIDE HYDROCHLORIDE
CAS:2193068-01-6
CM468109
Cl.NC(=N)C1CCC2=C(C1)C=CC=C2
1,2,3,4-TETRAHYDROPHENANTHREN-4-ONE
CAS:778-48-3
CM544081
O=C1CCCC2=C1C3=C(C=C2)C=CC=C3
1,2,3,4-TETRAHYDROPHTHALAZINE
CAS:13152-89-1
CM308938
C12=C(CNNC2)C=CC=C1
1,2,3,4-TETRAHYDROPHTHALAZINE DIHYDROCHLORIDE
CAS:86437-12-9
CM320985
[H]Cl.[H]Cl.C12=C(CNNC2)C=CC=C1
1,2,3,4-TETRAHYDROPYRAZINE-2,3-DITHIONE
CAS:80458-31-7
CM543939
S=C(NC=CN1)C1=S
1,2,3,4-TETRAHYDROPYRAZINO[1,2-A]INDOL-7-OL
CAS:1521660-19-4
CM336027
OC1=CC2=C(C=C1)C=C3N2CCNC3
1,2,3,4-TETRAHYDROPYRAZINO[1,2-A]INDOL-9-OL
CAS:1515851-04-3
CM336028
OC1=CC=CC2=C1C=C3N2CCNC3
1,2,3,4-TETRAHYDROPYRAZINO[1,2-A]INDOLE
CAS:41838-39-5
CM146553
N12C(CNCC2)=CC3=C1C=CC=C3
1,2,3,4-TETRAHYDROPYRAZINO[2,3-B]QUINOLINE
CAS:143102-05-0
CM239999
C12=NC3=CC=CC=C3C=C1NCCN2
1,2,3,4-TETRAHYDROPYRIDINE HYDROCHLORIDE
CAS:1799434-61-9
CM511638
[H]Cl.C1CCC=CN1
1,2,3,4-TETRAHYDROPYRIDO[1,2-A]PYRAZIN-6-ONE HYDROCHLORIDE
CAS:1421065-64-6
CM327575
O=C1C=CC=C2CNCCN21.[H]Cl
1,2,3,4-TETRAHYDROPYRIDO[2,3-B][1,6]NAPHTHYRIDINE
CAS:387358-41-0
CM230740
C12=CC=NC=C1C=C3CCCNC3=N2
1,2,3,4-TETRAHYDROPYRIDO[2,3-B]PYRAZINE
CAS:35808-40-3
CM168218
N1CCNC2=C1C=CC=N2
1,2,3,4-TETRAHYDROPYRIDO[2,3-D]PYRIDAZIN-8(7H)-ONE
CAS:15375-78-7
CM317422
O=C1C2=C(CCCN2)C=NN1
1,2,3,4-TETRAHYDROPYRIDO[4,3-B][1,6]NAPHTHYRIDINE
CAS:387358-40-9
CM230741
C12=CC=NC=C1C=C3CNCCC3=N2
1,2,3,4-TETRAHYDROPYRIMIDO[1,2-A]INDOLE
CAS:446879-91-0
CM236336
N12C(NCCC2)=CC3=C1C=CC=C3
1,2,3,4-TETRAHYDROPYRIMIDO[1,2-A]INDOLE HYDROCHLORIDE
CAS:42456-83-7
CM230000
[H]Cl.N12C(NCCC2)=CC3=C1C=CC=C3
1,2,3,4-TETRAHYDROPYRROLO[1,2-A]PYRAZINE
CAS:71257-38-0
CM123621
C1CN2C=CC=C2CN1
1,2,3,4-TETRAHYDROPYRROLO[1,2-A]PYRAZINE-1-CARBOXYLIC ACID
CAS:1214086-91-5
CM332984
O=C(O)C1C2=CC=CN2CCN1
1,2,3,4-TETRAHYDROQUINOLIN-2-ONE
CAS:553-03-7
CM112143
O=C1NC2=C(C=CC=C2)CC1
1,2,3,4-TETRAHYDROQUINOLIN-3-AMINE
CAS:40615-02-9
CM145693
NC1CNC2=CC=CC=C2C1
1,2,3,4-TETRAHYDROQUINOLIN-3-AMINE DIHYDROCHLORIDE
CAS:79867-97-3
CM227621
NC1CNC2=C(C=CC=C2)C1.[H]Cl.[H]Cl
1,2,3,4-TETRAHYDROQUINOLIN-3-AMINE HYDROCHLORIDE
CAS:1956310-43-2
CM222993
NC1CNC2=C(C=CC=C2)C1.[H]Cl
1,2,3,4-TETRAHYDROQUINOLIN-3-OL
CAS:3418-45-9
CM116784
OC1CNC2=C(C=CC=C2)C1
1,2,3,4-TETRAHYDROQUINOLIN-4-AMINE
CAS:801156-77-4
CM123811
NC1CCNC2=C1C=CC=C2
1,2,3,4-TETRAHYDROQUINOLIN-4-AMINE DIHYDROCHLORIDE
CAS:7578-79-2
CM145918
NC1CCNC2=C1C=CC=C2.[H]Cl.[H]Cl
1,2,3,4-TETRAHYDROQUINOLIN-4-AMINE HYDROCHLORIDE
CAS:1199782-99-4
CM222903
NC1CCNC2=C1C=CC=C2.[H]Cl
1,2,3,4-TETRAHYDROQUINOLIN-4-OL
CAS:24206-39-1
CM124605
OC1CCNC2=C1C=CC=C2
1,2,3,4-TETRAHYDROQUINOLIN-4-OL HYDROBROMIDE
CAS:24206-40-4
CM143609
OC1CCNC2=C1C=CC=C2.[H]Br
1,2,3,4-TETRAHYDROQUINOLIN-4-OL HYDROCHLORIDE
CAS:1956309-29-7
CM222685
OC1CCNC2=C1C=CC=C2.[H]Cl
1,2,3,4-TETRAHYDROQUINOLIN-5-OL
CAS:61468-43-7
CM227478
OC1=CC=CC2=C1CCCN2
1,2,3,4-TETRAHYDROQUINOLIN-5-OL HYDROCHLORIDE
CAS:1956386-43-8
CM223163
OC1=CC=CC2=C1CCCN2.[H]Cl
1,2,3,4-TETRAHYDROQUINOLIN-6-AMINE
CAS:103796-41-4
CM145818
NC1=CC2=C(NCCC2)C=C1
1,2,3,4-TETRAHYDROQUINOLIN-7-AMINE DIHYDROCHLORIDE
CAS:1309976-14-4
CM144318
NC1=CC2=C(C=C1)CCCN2.[H]Cl.[H]Cl
1,2,3,4-TETRAHYDROQUINOLIN-7-YL ACETATE
CAS:64416-62-2
CM229660
CC(OC1=CC2=C(C=C1)CCCN2)=O
1,2,3,4-TETRAHYDROQUINOLIN-8-AMINE DIHYDROCHLORIDE
CAS:54489-65-5
CM143934
NC1=CC=CC2=C1NCCC2.[H]Cl.[H]Cl
1,2,3,4-TETRAHYDROQUINOLIN-8-AMINE HYDROCHLORIDE
CAS:1427195-46-7
CM222691
NC1=CC=CC2=C1NCCC2.[H]Cl
1,2,3,4-TETRAHYDROQUINOLINE
CAS:635-46-1
CM121443
C12=C(NCCC2)C=CC=C1
1,2,3,4-TETRAHYDROQUINOLINE-2-CARBOXAMIDE
CAS:91842-88-5
CM239536
O=C(C1NC2=C(C=CC=C2)CC1)N
1,2,3,4-TETRAHYDROQUINOLINE-2-CARBOXYLIC ACID
CAS:46185-24-4
CM143825
O=C(C1NC2=C(C=CC=C2)CC1)O
1,2,3,4-TETRAHYDROQUINOLINE-2-CARBOXYLIC ACID HYDROCHLORIDE
CAS:75493-93-5
CM227589
O=C(C1NC2=C(C=CC=C2)CC1)O.[H]Cl
1,2,3,4-TETRAHYDROQUINOLINE-3-CARBOXAMIDE
CAS:4138-23-2
CM408807
NC(=O)C1CNC2=C(C1)C=CC=C2
1,2,3,4-TETRAHYDROQUINOLINE-3-CARBOXYLIC ACID
CAS:114527-53-6
CM142850
OC(=O)C1CNC2=CC=CC=C2C1
1,2,3,4-TETRAHYDROQUINOLINE-3-CARBOXYLIC ACID HYDROCHLORIDE
CAS:1187931-92-5
CM122114
O=C(C1CNC2=C(C=CC=C2)C1)O.[H]Cl
1,2,3,4-TETRAHYDROQUINOLINE-4-CARBOXYLIC ACID
CAS:13337-69-4
CM145714
OC(=O)C1CCNC2=CC=CC=C12
1,2,3,4-TETRAHYDROQUINOLINE-4-CARBOXYLIC ACID HYDROCHLORIDE
CAS:131753-22-5
CM127100
Cl.OC(=O)C1CCNC2=C1C=CC=C2
1,2,3,4-TETRAHYDROQUINOLINE-5,6-DIAMINE
CAS:156694-05-2
CM238793
NC1=C(N)C=CC2=C1CCCN2
1,2,3,4-TETRAHYDROQUINOLINE-5-CARBOXAMIDE
CAS:1016734-68-1
CM239532
O=C(C1=CC=CC2=C1CCCN2)N
1,2,3,4-TETRAHYDROQUINOLINE-5-CARBOXYLIC ACID
CAS:114527-54-7
CM145826
O=C(C1=CC=CC2=C1CCCN2)O
1,2,3,4-TETRAHYDROQUINOLINE-5-CARBOXYLIC ACID HYDROCHLORIDE
CAS:2172259-96-8
CM468642
Cl.OC(=O)C1=CC=CC2=C1CCCN2
1,2,3,4-TETRAHYDROQUINOLINE-5-SULFONAMIDE
CAS:1155515-51-7
CM405743
NS(=O)(=O)C1=CC=CC2=C1CCCN2
1,2,3,4-TETRAHYDROQUINOLINE-6,7-DIAMINE
CAS:49572-38-5
CM238799
NC1=CC2=C(NCCC2)C=C1N
1,2,3,4-TETRAHYDROQUINOLINE-6,8-DICARBONITRILE
CAS:1809195-28-5
CM363059
N#CC1=CC2=C(NCCC2)C(=C1)C#N
1,2,3,4-TETRAHYDROQUINOLINE-6-CARBONITRILE
CAS:50741-36-1
CM132343
N#CC1=CC2=C(NCCC2)C=C1
1,2,3,4-TETRAHYDROQUINOLINE-6-CARBONITRILE HYDROCHLORIDE
CAS:1955548-97-6
CM222741
N#CC1=CC2=C(NCCC2)C=C1.Cl
1,2,3,4-TETRAHYDROQUINOLINE-6-CARBOXYLIC ACID
CAS:5382-49-0
CM143903
OC(=O)C1=CC2=C(NCCC2)C=C1
1,2,3,4-TETRAHYDROQUINOLINE-6-CARBOXYLIC ACID HYDROCHLORIDE
CAS:1251923-10-0
CM223748
O=C(C1=CC2=C(NCCC2)C=C1)O.[H]Cl
1,2,3,4-TETRAHYDROQUINOLINE-6-SULFONAMIDE
CAS:30059-39-3
CM229717
O=S(C1=CC2=C(NCCC2)C=C1)(N)=O
1,2,3,4-TETRAHYDROQUINOLINE-7,8-DIAMINE
CAS:51143-77-2
CM238795
NC1=C(N)C2=C(C=C1)CCCN2
1,2,3,4-TETRAHYDROQUINOLINE-7-CARBONITRILE
CAS:939758-76-6
CM367356
N#CC1=CC2=C(CCCN2)C=C1
1,2,3,4-TETRAHYDROQUINOLINE-7-CARBOXYLIC ACID
CAS:22048-88-0
CM122559
OC(=O)C1=CC2=C(CCCN2)C=C1
1,2,3,4-TETRAHYDROQUINOLINE-7-SULFONIC ACID HYDRATE
CAS:91795-61-8
CM225171
O=S(C1=CC2=C(C=C1)CCCN2)(O)=O.[H]O[H]
1,2,3,4-TETRAHYDROQUINOLINE-8-CARBALDEHYDE
CAS:69906-07-6
CM229427
O=CC1=CC=CC2=C1NCCC2
1,2,3,4-TETRAHYDROQUINOLINE-8-CARBONITRILE
CAS:50741-37-2
CM144939
N#CC1=CC=CC2=C1NCCC2
1,2,3,4-TETRAHYDROQUINOLINE-8-CARBOXYLIC ACID
CAS:34849-19-9
CM222604
O=C(C1=CC=CC2=C1NCCC2)O
1,2,3,4-TETRAHYDROQUINOLINE-8-SULFONIC ACID
CAS:55936-96-4
CM224629
O=S(C1=CC=CC2=C1NCCC2)(O)=O
1,2,3,4-TETRAHYDROQUINOXALIN-2-OL
CAS:123342-22-3
CM221555
OC1NC2=C(C=CC=C2)NC1
1,2,3,4-TETRAHYDROQUINOXALIN-6-AMINE
CAS:6639-91-4
CM123448
NC1=CC2=C(NCCN2)C=C1
1,2,3,4-TETRAHYDROQUINOXALINE
CAS:3476-89-9
CM121557
C12=C(NCCN2)C=CC=C1
1,2,3,4-TETRAHYDROQUINOXALINE-2,3-DIONE
CAS:15804-19-0
CM141957
O=C1NC2=C(C=CC=C2)NC1=O
1,2,3,4-TETRAHYDROQUINOXALINE-2-CARBOXYLIC ACID
CAS:49849-51-6
CM221686
O=C(C1NC2=C(C=CC=C2)NC1)O
1,2,3,4-TETRAHYDROQUINOXALINE-5-CARBOXYLIC ACID
CAS:946386-72-7
CM221894
O=C(C1=CC=CC2=C1NCCN2)O
1,2,3,4-TETRAHYDROQUINOXALINE-6-CARBONITRILE
CAS:744971-10-6
CM221755
N#CC1=CC2=C(NCCN2)C=C1
1,2,3,4-TETRAHYDROQUINOXALINE-6-CARBOXYLIC ACID
CAS:787490-63-5
CM141850
O=C(C1=CC2=C(NCCN2)C=C1)O
1,2,3,4-TETRAMETHOXY-5-METHYLBENZENE
CAS:35896-58-3
CM252466
CC1=CC(OC)=C(OC)C(OC)=C1OC
1,2,3,4-TETRAMETHOXYBENZENE
CAS:21450-56-6
CM379444
COC1=C(OC)C(OC)=C(OC)C=C1
1,2,3,4-TETRAMETHYL-5-(TRIFLUOROMETHYL)CYCLOPENTA-1,3-DIENE
CAS:142701-59-5
CM534369
FC(C1C(C)=C(C)C(C)=C1C)(F)F
1,2,3,4-TETRAMETHYLCYCLOPENTA-1,3-DIENE
CAS:4249-10-9
CM202355
CC1=C(C)C(C)=C(C)C1
1,2,3,4-THIATRIAZOL-5-AMINE
CAS:6630-99-5
CM304052
NC1=NN=NS1
1,2,3,5,6,10B-HEXAHYDROPYRROLO[2,1-A]ISOQUINOLINE
CAS:3327-29-5
CM239235
C1(CCC2)N2CCC3=C1C=CC=C3
1,2,3,5,6,7-HEXAHYDRO-S-INDACEN-4-AMINE
CAS:63089-56-5
CM219878
NC1=C2CCCC2=CC3=C1CCC3
1,2,3,5,6,7-HEXAHYDRO-S-INDACENE
CAS:495-52-3
CM561327
C12=C(CCC2)C=C3CCCC3=C1
1,2,3,5,6,7-HEXAHYDRODICYCLOPENTA[B,E]PYRIDIN-8-AMINE
CAS:62732-43-8
CM336509
NC1=C(CCC2)C2=NC3=C1CCC3
1,2,3,5,6,7-HEXAHYDRODICYCLOPENTA[B,E]PYRIDINE
CAS:34421-99-3
CM411753
C12=NC(CCC3)=C3C=C1CCC2
1,2,3,5,6,7-HEXAHYDROINDOLIZINE-8-CARBALDEHYDE
CAS:868366-91-0
CM238423
O=CC1=C2CCCN2CCC1
1,2,3,5,6,7-HEXAHYDROPYRIDO[3,2,1-IJ]QUINOLIN-9-AMINE
CAS:59056-57-4
CM240324
NC1=CC2=C3N(CCC2)CCCC3=C1
1,2,3,5,6,7-HEXAHYDROPYRIDO[3,2,1-IJ]QUINOLINE
CAS:479-59-4
CM222676
N12CCCC3=C1C(CCC2)=CC=C3
1,2,3,5,6,7-HEXAHYDROPYRIDO[3,2,1-IJ]QUINOLINE-9-CARBONITRILE
CAS:97315-60-1
CM228953
N#CC1=CC2=C3C(CCCN3CCC2)=C1
1,2,3,5,6,7-HEXAHYDROPYRIDO[3,2,1-IJ]QUINOLINE-9-CARBOXYLIC ACID
CAS:500868-84-8
CM228952
O=C(C1=CC2=C3C(CCCN3CCC2)=C1)O
1,2,3,5,6-PENTATHIEPANE
CAS:292-46-6
CM000312
S1SSCSSC1
1,2,3,5,8,8A-HEXAHYDROINDOLIZINE-8A-CARBOXYLIC ACID HYDROCHLORIDE
CAS:2230802-90-9
CM463517
Cl.OC(=O)C12CCCN1CC=CC2
1,2,3,5-TETRACHLORO-4,6-BIS(CHLOROMETHYL)BENZENE
CAS:1133-57-9
CM395558
ClCC1=C(Cl)C(CCl)=C(Cl)C(Cl)=C1Cl
1,2,3,5-TETRACHLORO-4,6-DINITROBENZENE
CAS:28073-03-2
CM479632
[O-][N+](=O)C1=C(Cl)C(=C(Cl)C(Cl)=C1Cl)[N+]([O-])=
1,2,3,5-TETRAFLUORO-4,6-BIS(TRIFLUOROMETHYL)BENZENE
CAS:319-82-4
CM378879
FC1=C(F)C(=C(F)C(=C1F)C(F)(F)F)C(F)(F)F
1,2,3,5-TETRAFLUORO-4-(TRIFLUOROMETHYL)BENZENE
CAS:5360-82-7
CM561624
FC(F)(F)C1=C(F)C=C(F)C(F)=C1F
1,2,3,5-TETRAFLUORO-4-NITROBENZENE
CAS:314-41-0
CM252132
O=[N+](C1=C(F)C=C(F)C(F)=C1F)[O-]
1,2,3,5-TETRAHYDRO-4,1-BENZOXAZEPINE-7-CARBOXYLIC ACID HYDROCHLORIDE
CAS:2225144-10-3
CM471451
Cl.OC(=O)C1=CC2=C(NCCOC2)C=C1
1,2,3,5-TETRAHYDROBENZO[E][1,4]OXAZEPINE HYDROCHLORIDE
CAS:4029-37-2
CM153182
[H]Cl.C12=CC=CC=C1COCCN2
1,2,3,5-TETRAHYDROSPIRO[BENZO[B]AZEPINE-4,1-CYCLOPENT[2]ENE]-3'-CARBOXYLIC ACID
CAS:813426-13-0
CM139330
O=C(C(CC1)=CC21CC3=CC=CC=C3NCC2)O
1,2,3,6,7,8-HEXAHYDROPYRENE
CAS:1732-13-4
CM393320
C1CC2=CC=C3CCCC4=C3C2=C(C1)C=C4
1,2,3,6-TETRAHYDRO-2,3'-BIPYRIDINE
CAS:2743-90-0
CM344893
C1(C2CC=CCN2)=CC=CN=C1
1,2,3,6-TETRAHYDRO-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PYRIDINE
CAS:375853-82-0
CM136868
CC1(C)OB(OC1(C)C)C1=CCNCC1
1,2,3,6-TETRAHYDRO-PYRIDINE-4-CARBOXYLIC ACIDHYDROCHLORIDE
CAS:68547-97-7
CM176012
O=C(C1=CCNCC1)O.[H]Cl
1,2,3,6-TETRAHYDROPYRIDIN-2-ONE
CAS:61892-77-1
CM386983
O=C1CC=CCN1
1,2,3,6-TETRAHYDROPYRIDIN-3-OL HYDROCHLORIDE
CAS:396730-55-5
CM243995
OC1CNCC=C1.[H]Cl
1,2,3,6-TETRAHYDROPYRIDIN-4-YL TRIFLUOROMETHANESULFONATE HYDROCHLORIDE
CAS:873107-95-0
CM124118
O=S(C(F)(F)F)(OC1=CCNCC1)=O.[H]Cl
1,2,3,6-TETRAHYDROPYRIDINE HYDROCHLORIDE
CAS:18513-79-6
CM107407
[H]Cl.C1CC=CCN1
1,2,3,6-TETRAHYDROPYRIDINE-2-CARBOXYLIC ACID
CAS:498-98-6
CM370021
OC(=O)C1CC=CCN1
1,2,3,6-TETRAHYDROPYRIDINE-4-CARBOXYLIC ACID
CAS:64603-90-3
CM170847
O=C(C1=CCNCC1)O
1,2,3,7,8,9-HEXAHYDROCYCLOPENTA[3,4]PYRAZOLO[1,5-A]CYCLOPENTA[D]PYRIMIDIN-6-AMINE
CAS:878417-21-1
CM268620
NC1=C(CCC2)C2=NC3=C(CCC4)C4=NN13
1,2,3,8-TETRAHYDROXY-9,10-DIHYDROANTHRACENE-9,10-DIONE
CAS:10228-40-7
CM553420
OC1=C(O)C(O)=C2C(=O)C3=C(O)C=CC=C3C(=O)C2=C1
1,2,3,9-TETRAHYDRO-9-METHYL-4H-CARBAZOLE-4-ONE
CAS:27387-31-1
CM251855
C[N]1C3=C(C2=CC=CC=C12)C(CCC3)=O
1,2,3,9-TETRAHYDROPYRAZOLO[1,2-A]INDAZOLE
CAS:106662-04-8
CM236342
N12N(CCC2)CC3=C1C=CC=C3
1,2,3-BENZENETRICARBOXYLIC ACID HYDRATE
CAS:732304-21-1
CM471143
O.OC(=O)C1=CC=CC(C(O)=O)=C1C(O)=O
1,2,3-BENZOTHIADIAZOL-5-AMINE
CAS:1753-29-3
CM510921
NC1=CC=C(SN=N2)C2=C1
1,2,3-BENZOTHIADIAZOLE-5-CARBOXYLIC ACID
CAS:192948-09-7
CM363593
OC(=O)C1=CC=C2SN=NC2=C1
1,2,3-BENZOTRIAZIN-4(3H)-ONE, 8-CHLORO-
CAS:18343-45-8
CM466580
ClC1=C2N=NNC(=O)C2=CC=C1
1,2,3-BENZOXATHIAZINE, 6-CHLORO-, 2,2-DIOXIDE
CAS:78224-92-7
CM469298
ClC1=CC=C2OS(=O)(=O)N=CC2=C1
1,2,3-OXATHIAZOLIDINE 2,2-DIOXIDE
CAS:19044-42-9
CM107431
O=S1(OCCN1)=O
1,2,3-OXATHIAZOLIDINE,3-ETHYL-,2,2-DIOXIDE
CAS:153631-34-6
CM107161
CCN1S(OCC1)(=O)=O
1,2,3-PROPANETRICARBOXYLIC ACID TRIBUTYL ESTER
CAS:38094-11-0
CM480095
CCCCOC(=O)CC(CC(=O)OCCCC)C(=O)OCCCC
1,2,3-PROPANETRICARBOXYLIC ACID, 2-HYDROXY-, CALCIUM SALT
CAS:7693-13-2
CM471801
[Ca].OC(=O)CC(O)(CC(O)=O)C(O)=O
1,2,3-PROPANETRICARBOXYLIC ACID, 2-HYDROXY-, CALCIUM SALT (2:1)
CAS:109459-70-3
CM475445
[Ca++].OC(=O)CC(O)(CC(O)=O)C(O)=O.OC(=O)CC(O)(CC(O
1,2,3-PROPANETRICARBOXYLIC ACID, 2-HYDROXY-, COPPER(2+) SALT (1:1)
CAS:5153-00-4
CM480331
[Cu++].OC(=O)CC(O)(CC(O)=O)C(O)=O
1,2,3-PROPANETRICARBOXYLIC ACID, 2-HYDROXY-, POTASSIUM SALT
CAS:7778-49-6
CM471665
[K].OC(=O)CC(O)(CC(O)=O)C(O)=O
1,2,3-PROPANETRICARBOXYLIC ACID, 2-HYDROXY-, SODIUM SALT (1:2)
CAS:144-33-2
CM472741
[Na+].[Na+].OC(=O)CC(O)(CC(O)=O)C(O)=O
1,2,3-PROPANETRICARBOXYLIC ACID, 2-HYDROXY-, SODIUM SALT (1:3)
CAS:1968-04-2
CM478428
[Na+].[Na+].[Na+].OC(=O)CC(O)(CC(O)=O)C(O)=O
1,2,3-PROPANETRICARBOXYLIC ACID, 2-HYDROXY-, TRIAMMONIUM SALT
CAS:3458-72-8
CM474060
[NH4+].[NH4+].[NH4+].OC(=O)CC(O)(CC(O)=O)C(O)=O
1,2,3-PROPANETRICARBOXYLIC ACID, 2-HYDROXY-, TRILITHIUM SALT
CAS:919-16-4
CM468498
[Li].[Li].[Li].OC(=O)CC(O)(CC(O)=O)C(O)=O
1,2,3-PROPANETRIOL, MONOACETATE
CAS:26446-35-5
CM464535
CC(=O)OCC(O)CO
1,2,3-THIADIAZOL-4-AMINE
CAS:4100-27-0
CM560849
NC1=CSN=N1
1,2,3-THIADIAZOL-4-AMINE HYDROCHLORIDE
CAS:152513-89-8
CM535185
NC1=CSN=N1.Cl
1,2,3-THIADIAZOL-5-AMINE
CAS:4100-41-8
CM252826
NC1=CN=NS1
1,2,3-THIADIAZOLE-4-CARBALDEHYDE
CAS:27643-15-8
CM374947
O=CC1=CSN=N1
1,2,3-THIADIAZOLE-4-CARBOHYDRAZIDE
CAS:4100-18-9
CM109709
O=C(C1=CSN=N1)NN
1,2,3-THIADIAZOLE-4-CARBONYL CHLORIDE
CAS:4100-17-8
CM519812
O=C(Cl)C1=CSN=N1
1,2,3-THIADIAZOLE-4-CARBOXAMIDE
CAS:4100-20-3
CM519813
O=C(C1=CSN=N1)N
1,2,3-THIADIAZOLE-4-CARBOXYLIC ACID
CAS:4100-13-4
CM303450
O=C(C1=CSN=N1)O
1,2,3-THIADIAZOLE-5-CARBOXYLIC ACID
CAS:4833-09-4
CM193517
O=C(C1=CN=NS1)O
1,2,3-TRIAZINE-5-CARBONITRILE
CAS:1260898-17-6
CM375011
N#CC1=CN=NN=C1
1,2,3-TRIAZINE-5-CARBOXYLIC ACID
CAS:1234298-93-1
CM307906
O=C(C1=CN=NN=C1)O
1,2,3-TRIBROMO-4-NITROBENZENE
CAS:96558-72-4
CM307912
O=[N+](C1=CC=C(Br)C(Br)=C1Br)[O-]
1,2,3-TRIBROMOPROPANE
CAS:96-11-7
CM361168
BrCC(Br)CBr
1,2,3-TRICHLORO-4-(1,1-DIFLUOROETHYL)BENZENE
CAS:1204296-08-1
CM369340
CC(F)(F)C1=C(Cl)C(Cl)=C(Cl)C=C1
1,2,3-TRICHLORO-4-FLUOROBENZENE
CAS:36556-36-2
CM408713
FC1=C(Cl)C(Cl)=C(Cl)C=C1
1,2,3-TRICHLORO-4-ISOTHIOCYANATOBENZENE
CAS:127142-69-2
CM381364
ClC1=C(Cl)C(Cl)=C(C=C1)N=C=S
1,2,3-TRICHLORO-4-METHYLBENZENE
CAS:7359-72-0
CM254813
CC1=CC=C(Cl)C(Cl)=C1Cl
1,2,3-TRICHLORO-5-FLUOROBENZENE
CAS:3107-21-9
CM252110
ClC1=C(Cl)C(Cl)=CC(F)=C1
1,2,3-TRICHLORO-5-TRIFLUOROMETHANESULFONYLBENZENE
CAS:104614-75-7
CM369480
FC(F)(F)S(=O)(=O)C1=CC(Cl)=C(Cl)C(Cl)=C1
1,2,3-TRIETHYL 2-(ACETYLOXY)PROPANE-1,2,3-TRICARBOXYLATE
CAS:77-89-4
CM395264
CCOC(=O)CC(CC(=O)OCC)(OC(C)=O)C(=O)OCC
1,2,3-TRIFLUORO-4-METHYLBENZENE
CAS:193533-92-5
CM538108
CC1=CC=C(F)C(F)=C1F
1,2,3-TRIFLUORO-4-NITROBENZENE
CAS:771-69-7
CM255000
O=[N+](C1=CC=C(F)C(F)=C1F)[O-]
1,2,3-TRIFLUORO-5-(TRANS-4-PENTYLCYCLOHEXYL)BENZENE
CAS:131819-22-2
CM201641
CCCCC[C@H]1CC[C@H](C2=CC(F)=C(F)C(F)=C2)CC1
1,2,3-TRIFLUORO-5-METHOXY-4-NITROBENZENE
CAS:925890-13-7
CM255805
O=[N+](C1=C(OC)C=C(F)C(F)=C1F)[O-]
1,2,3-TRIFLUORO-5-METHOXYBENZENE
CAS:203245-17-4
CM276974
COC1=CC(F)=C(F)C(F)=C1
1,2,3-TRIFLUORO-5-NITROBENZENE
CAS:66684-58-0
CM254423
C1=C([N+]([O-])=O)C=C(F)C(=C1F)F
1,2,3-TRIFLUOROBENZENE
CAS:1489-53-8
CM379991
FC1=CC=CC(F)=C1F
1,2,3-TRIFLUOROPROPANE
CAS:66794-36-3
CM383469
FCC(F)CF
1,2,3-TRIHEXYL 2-(BUTANOYLOXY)PROPANE-1,2,3-TRICARBOXYLATE
CAS:82469-79-2
CM394996
CCCCCCOC(=O)CC(CC(=O)OCCCCCC)(OC(=O)CCC)C(=O)OCCCC
1,2,3-TRIMETHOXY-5-METHYLBENZENE
CAS:6443-69-2
CM254309
C1=C(C(=C(C=C1C)OC)OC)OC
1,2,3-TRIMETHOXY-6,7,8,9-TETRAHYDRO-5H-BENZO[7]ANNULEN-5-ONE
CAS:408330-93-8
CM519785
O=C1CCCCC2=C(OC)C(OC)=C(OC)C=C21
1,2,3-TRIMETHOXYBENZENE
CAS:634-36-6
CM254231
COC1=C(OC)C(OC)=CC=C1
1,2,3-TRIMETHYL-1H-INDOL-5-AMINE
CAS:143797-94-8
CM236922
NC1=CC2=C(N(C)C(C)=C2C)C=C1
1,2,3-TRIMETHYL-3-BENZYL-3H-BENZ[E]INDOLIUM BROMIDE
CAS:884863-08-5
CM148810
C[N+]1=C(C)C(C)(CC2=CC=CC=C2)C3=C1C=CC4=CC=CC=C34.
1,2,3-TRIMETHYL-3H-BENZO[E]INDOLE
CAS:881219-73-4
CM148683
CN1C(C)=C(C)C2=C1C=CC1=C2C=CC=C1
1,2,3-TRIMETHYL-5-(PYRROLIDIN-2-YL)-1H-INDOLE
CAS:1507816-32-1
CM333744
CC1=C(C)N(C)C2=C1C=C(C3NCCC3)C=C2
1,2,3-TRIMETHYLPIPERAZINE
CAS:1152367-90-2
CM327547
CC1C(C)N(C)CCN1
1,2,3-TRIPHENYLACENAPHTHYLENE
CAS:96416-48-7
CM230491
C1(C2=CC=CC=C2)=C(C3=CC=CC=C3)C4=C(C5=CC=CC=C5)C=C
1,2,3-TRIPHENYLNAPHTHALENE
CAS:1942-39-8
CM230492
C1(C2=CC=CC=C2)=C3C=CC=CC3=CC(C4=CC=CC=C4)=C1C5=CC
1,2,3-TRIPROPYL 2-HYDROXYPROPANE-1,2,3-TRICARBOXYLATE
CAS:1587-21-9
CM395144
CCCOC(=O)CC(O)(CC(=O)OCCC)C(=O)OCCC
1,2,3-TRIS(PROP-2-EN-1-YL) 2-HYDROXYPROPANE-1,2,3-TRICARBOXYLATE
CAS:6299-73-6
CM396574
OC(CC(=O)OCC=C)(CC(=O)OCC=C)C(=O)OCC=C
1,2,4,5,6,7-HEXAHYDRO-3H-PYRAZOLO[3,4-C]PYRIDIN-3-ONE
CAS:654666-65-6
CM290009
O=C1NNC2=C1CCNC2
1,2,4,5,6,7-HEXAHYDROPYRAZOLO[3,4-C]PYRIDIN-3-ONE HYDROCHLORIDE
CAS:1187830-91-6
CM110725
O=C1NNC2=C1CCNC2.[H]Cl
1,2,4,5-BENZENETETRAAMINE TETRAHYDROCHLORIDE
CAS:4506-66-5
CM118768
NC1=CC(N)=C(N)C=C1N.[H]Cl.[H]Cl.[H]Cl.[H]Cl
1,2,4,5-TETRABROMO-3,6-DIMETHYLBENZENE
CAS:23488-38-2
CM101856
CC1=C(Br)C(Br)=C(C)C(Br)=C1Br
1,2,4,5-TETRACHLORO-3,6-BIS(CHLOROMETHYL)BENZENE
CAS:1079-17-0
CM395559
ClCC1=C(Cl)C(Cl)=C(CCl)C(Cl)=C1Cl
1,2,4,5-TETRACHLORO-3,6-DINITROBENZENE
CAS:20098-38-8
CM396816
[O-][N+](=O)C1=C(Cl)C(Cl)=C(C(Cl)=C1Cl)[N+]([O-])=
1,2,4,5-TETRACHLORO-3-ISOTHIOCYANATOBENZENE
CAS:22133-95-5
CM379395
ClC1=CC(Cl)=C(Cl)C(N=C=S)=C1Cl
1,2,4,5-TETRAETHYNYLBENZENE
CAS:70603-31-5
CM543927
C#CC1=C(C=C(C(C#C)=C1)C#C)C#C
1,2,4,5-TETRAFLUORO-3,6-BIS(2,2,3,3-TETRAFLUOROPROPOXY)BENZENE
CAS:89847-88-1
CM376141
FC(F)C(F)(F)COC1=C(F)C(F)=C(OCC(F)(F)C(F)F)C(F)=C1
1,2,4,5-TETRAFLUORO-3,6-BIS(PROPAN-2-YLOXY)BENZENE
CAS:1309602-61-6
CM562472
CC(OC1=C(F)C(F)=C(OC(C)C)C(F)=C1F)C
1,2,4,5-TETRAFLUORO-3,6-DIMETHOXYBENZENE
CAS:362-56-1
CM539806
COC1=C(F)C(F)=C(OC)C(F)=C1F
1,2,4,5-TETRAFLUORO-3,6-DIMETHYLBENZENE
CAS:703-87-7
CM377153
CC1=C(F)C(F)=C(C)C(F)=C1F
1,2,4,5-TETRAFLUORO-3-{3,3,4,4,5,5-HEXAFLUORO-2-[2,3,5,6-TETRAFLUORO-4-(TRIFLUOROMETHYL)PHENYL]CYCLOPENT-1-EN-1-YL}-6-(TRIFLUOROMETHYL)BENZENE
CAS:1821062-80-9
CM396116
FC1=C(F)C(=C(F)C(F)=C1C1=C(C2=C(F)C(F)=C(C(F)=C2F)
1,2,4,5-TETRAFLUORO-3-ISOTHIOCYANATOBENZENE
CAS:20925-31-9
CM379478
FC1=CC(F)=C(F)C(N=C=S)=C1F
1,2,4,5-TETRAFLUORO-3-METHYL-6-(TRIFLUOROMETHYL)BENZENE
CAS:778-35-8
CM543804
FC(F)(F)C1=C(F)C(F)=C(C)C(F)=C1F
1,2,4,5-TETRAFLUORO-3-METHYLBENZENE
CAS:5230-78-4
CM377750
CC1=C(F)C(F)=CC(F)=C1F
1,2,4,5-TETRAFLUORO-3-NITROBENZENE
CAS:6257-03-0
CM254149
O=[N+](C1=C(F)C(F)=CC(F)=C1F)[O-]
1,2,4,5-TETRAFLUOROBENZENE
CAS:327-54-8
CM252230
FC1=C(F)C=C(F)C(F)=C1
1,2,4,5-TETRAKIS(4-CARBOXYPHENYL)BENZENE
CAS:1078153-58-8
CM475356
OC(=O)C1=CC=C(C=C1)C1=CC(C2=CC=C(C=C2)C(O)=O)=C(C=
1,2,4,5-TETRAKIS(BROMOMETHYL)BENZENE
CAS:15442-91-8
CM249767
BrCC1=CC(CBr)=C(CBr)C=C1CBr
1,2,4,5-TETRAKIS(PROPAN-2-YLSULFANYL)BENZENE
CAS:74542-69-1
CM396959
CC(C)SC1=CC(SC(C)C)=C(SC(C)C)C=C1SC(C)C
1,2,4,5-TETRAKIS(TERT-BUTYLTHIO)BENZENE
CAS:447463-65-2
CM252997
CC(SC1=C(SC(C)(C)C)C=C(SC(C)(C)C)C(SC(C)(C)C)=C1)(
1,2,4,5-TETRAKIS(TRIFLUOROMETHYL)BENZENE
CAS:320-23-0
CM369438
FC(F)(F)C1=CC(=C(C=C1C(F)(F)F)C(F)(F)F)C(F)(F)F
1,2,4,5-TETRAMETHOXYBENZENE
CAS:2441-46-5
CM379279
COC1=CC(OC)=C(OC)C=C1OC
1,2,4,5-TETRAMETHYL-1H-IMIDAZOLE
CAS:1739-83-9
CM342866
CC1=C(C)N=C(C)N1C
1,2,4,5-TETRAMETHYL-1H-PYRROLE-3-CARBALDEHYDE
CAS:1087610-71-6
CM275873
O=CC1=C(C)N(C)C(C)=C1C
1,2,4,5-TETRAZIN-3-AMINE, 6-CHLORO-
CAS:254879-87-3
CM329124
NC1=NN=C(Cl)N=N1
1,2,4,6-TETRAMETHYLPIPERAZINE
CAS:1123-66-6
CM486108
CC1CN(C)CC(C)N1C
1,2,4,9-TETRAHYDROSPIRO[CARBAZOLE-3,2'-[1,3]DIOXANE]
CAS:1352305-19-1
CM208154
C1(NC2=C3C=CC=C2)=C3CC4(OCCCO4)CC1
1,2,4,9-TETRAHYDROSPIRO[CARBAZOLE-3,2'-[1,3]DIOXOLANE]
CAS:54621-12-4
CM214958
C1(NC2=C3C=CC=C2)=C3CC4(OCCO4)CC1
1,2,4-BUTANETRICARBOXYLIC ACID
CAS:923-42-2
CM194933
O=C(CC(C(O)=O)CCC(O)=O)O
1,2,4-CYCLOPENTANETRIONE
CAS:15849-14-6
CM336261
O=C1C(CC(C1)=O)=O
1,2,4-OXADIAZOL-3-AMINE
CAS:39512-64-6
CM329163
NC1=NOC=N1
1,2,4-OXADIAZOLE, 3-(2-CHLOROETHYL)-5-METHYL-
CAS:71088-13-6
CM466628
CC1=NC(CCCl)=NO1
1,2,4-OXADIAZOLE, 3-(CHLOROMETHYL)-5-CYCLOHEXYL-
CAS:189130-88-9
CM466627
ClCC1=NOC(=N1)C1CCCCC1
1,2,4-OXADIAZOLE, 5-(CHLOROMETHYL)-3-(2-METHYLPROPYL)-
CAS:929973-39-7
CM466629
CC(C)CC1=NOC(CCl)=N1
1,2,4-OXADIAZOLE, 5-(CHLOROMETHYL)-3-(3-METHOXYPHENYL)-
CAS:660416-39-7
CM470538
COC1=CC=CC(=C1)C1=NOC(CCl)=N1
1,2,4-OXADIAZOLE, 5-(CHLOROMETHYL)-3-PHENYL-
CAS:1822-94-2
CM466615
ClCC1=NC(=NO1)C1=CC=CC=C1
1,2,4-OXADIAZOLE-3-CARBOHYDRAZIDE
CAS:39512-60-2
CM519526
O=C(C1=NOC=N1)NN
1,2,4-OXADIAZOLE-3-CARBONYL AZIDE
CAS:39512-61-3
CM408768
[N-]=[N+]=NC(=O)C1=NOC=N1
1,2,4-OXADIAZOLE-3-CARBOTHIOAMIDE
CAS:39512-80-6
CM519528
S=C(C1=NOC=N1)N
1,2,4-OXADIAZOLE-3-CARBOXAMIDE
CAS:39512-74-8
CM408769
NC(=O)C1=NOC=N1
1,2,4-OXADIAZOLE-3-CARBOXYLIC ACID
CAS:856787-15-0
CM255352
O=C(C1=NOC=N1)O
1,2,4-OXADIAZOLE-5-CARBOXYLIC ACID
CAS:499770-64-8
CM314126
O=C(C1=NC=NO1)O
1,2,4-OXADIAZOLE-5-CARBOXYLIC ACID, 3-ETHYL-, ETHYL ESTER
CAS:139443-40-6
CM464886
CCOC(=O)C1=NC(CC)=NO1
1,2,4-OXADIAZOLIDINE-3,5-DIONE
CAS:24603-68-7
CM183441
O=C(N1)NOC1=O
1,2,4-PIPERAZINETRICARBOXYLIC ACID, 4-(1,1-DIMETHYLETHYL) 1-(9H-FLUOREN-9-YLMETHYL) ESTER, (2R)-
CAS:1217723-28-8
CM476074
CC(C)(C)OC(=O)N1CCN([C@H](C1)C(O)=O)C(=O)OCC1C2=CC
1,2,4-THIADIAZOL-3-AMINE
CAS:56531-89-6
CM276615
NC1=NSC=N1
1,2,4-THIADIAZOL-3-AMINE HYDROCHLORIDE
CAS:103295-01-8
CM404139
Cl.NC1=NSC=N1
1,2,4-THIADIAZOL-5-AMINE
CAS:7552-07-0
CM254915
NC1=NC=NS1
1,2,4-THIADIAZOL-5-AMINE DIHYDROCHLORIDE
CAS:1588440-88-3
CM249849
NC1=NC=NS1.[H]Cl.[H]Cl
1,2,4-THIADIAZOL-5-AMINE HYDROCHLORIDE
CAS:152513-91-2
CM249724
Cl.S1C(=NC=N1)N
1,2,4-THIADIAZOLE, 5-CHLORO-3-(4-NITROPHENYL)-
CAS:88541-07-5
CM473335
[O-][N+](=O)C1=CC=C(C=C1)C1=NSC(Cl)=N1
1,2,4-THIADIAZOLE, 5-CHLORO-3-CYCLOPROPYL-
CAS:122684-54-2
CM463986
ClC1=NC(=NS1)C1CC1
1,2,4-THIADIAZOLE-3,5-DIAMINE
CAS:34283-30-2
CM276192
NC1=NSC(N)=N1
1,2,4-THIADIAZOLE-5-CARBALDEHYDE
CAS:1083317-72-9
CM485425
O=CC1=NC=NS1
1,2,4-THIADIAZOLE-5-CARBOXYLIC ACID
CAS:859536-27-9
CM387150
OC(=O)C1=NC=NS1
1,2,4-TRIAZIN-3-AMINE
CAS:1120-99-6
CM104413
NC1=NC=CN=N1
1,2,4-TRIAZIN-5-AMINE
CAS:822-69-5
CM392353
NC1N=CN=NC=1
1,2,4-TRIAZIN-6(1H)-ONE, 3-(4-CHLOROPHENYL)-2,5-DIHYDRO-
CAS:84586-29-8
CM467848
ClC1=CC=C(C=C1)C1=NCC(=O)NN1
1,2,4-TRIAZINE
CAS:290-38-0
CM372683
C1=CN=NC=N1
1,2,4-TRIAZINE-3,5(2H,4H)-DIONE, 6-CHLORO-
CAS:873-44-9
CM467623
ClC1=NNC(=O)NC1=O
1,2,4-TRIAZINE-3,5-DIOL
CAS:461-89-2
CM193498
OC1=CN=NC(O)=N1
1,2,4-TRIAZINE-3-CARBALDEHYDE
CAS:954241-33-9
CM327212
O=CC1=NC=CN=N1
1,2,4-TRIAZINE-3-CARBOXYLIC ACID
CAS:6498-04-0
CM325927
OC(=O)C1=NC=CN=N1
1,2,4-TRIAZINE-5-CARBOXYLIC ACID
CAS:1260664-79-6
CM563495
O=C(C1=CN=NC=N1)O
1,2,4-TRIAZINE-6-CARBOXYLIC ACID
CAS:859766-68-0
CM526548
O=C(C1=CN=CN=N1)O
1,2,4-TRIAZOLE
CAS:288-88-0
CM121754
N1N=CN=C1
1,2,4-TRIAZOLIDINE-3,5-DIONE
CAS:3232-84-6
CM338160
O=C(N1)NNC1=O
1,2,4-TRIAZOLO[4,3-A]PYRAZINE-3-CARBOXYLIC ACID ETHYL ESTER
CAS:723286-67-7
CM168526
C(C)OC(=O)C1=NN=C2C=NC=C[N]12
1,2,4-TRIAZOLO[4,3-A]PYRAZINE-3-CARBOXYLIC ACID, 5,6,7,8-TETRAHYDRO-, METHYL ESTER
CAS:132606-01-0
CM465159
COC(=O)C1=NN=C2CNCCN12
1,2,4-TRIAZOLO[4,3-A]PYRAZINE-7(8H)-CARBOXYLIC ACID, 5,6-DIHYDRO-3-(HYDROXYMETHYL)-, 1,1-DIMETHYLETHYL ESTER
CAS:1251002-77-3
CM476265
CC(C)(C)OC(=O)N1CCN2C(CO)=NN=C2C1
1,2,4-TRIBROMO-1,1,2-TRIFLUOROBUTANE
CAS:2022-80-2
CM379533
FC(F)(Br)C(F)(Br)CCBr
1,2,4-TRIBROMO-5-FLUOROBENZENE
CAS:7655-70-1
CM376973
FC1=CC(Br)=C(Br)C=C1Br
1,2,4-TRICHLORO-1,1,2-TRIFLUOROBUTANE
CAS:261760-97-8
CM379198
FC(F)(Cl)C(F)(Cl)CCCl
1,2,4-TRICHLORO-3-IODOBENZENE
CAS:38411-20-0
CM480103
ClC1=C(Cl)C(I)=C(Cl)C=C1
1,2,4-TRICHLORO-3-METHOXYBENZENE
CAS:50375-10-5
CM384575
COC1=C(Cl)C(Cl)=CC=C1Cl
1,2,4-TRICHLORO-5-[(2,4,5-TRICHLOROPHENYL)DISULFANYL]BENZENE
CAS:3808-87-5
CM395523
ClC1=CC(Cl)=C(SSC2=C(Cl)C=C(Cl)C(Cl)=C2)C=C1Cl
1,2,4-TRICHLORO-5-IODOBENZENE
CAS:7145-82-6
CM368497
ClC1=CC(Cl)=C(Cl)C=C1I
1,2,4-TRICHLORO-5-ISOTHIOCYANATOBENZENE
CAS:23165-46-0
CM384513
ClC1=CC(Cl)=C(C=C1Cl)N=C=S
1,2,4-TRICHLORO-5-METHYLBENZENE
CAS:6639-30-1
CM361357
CC1=CC(Cl)=C(Cl)C=C1Cl
1,2,4-TRICHLORO-5-NITROBENZENE
CAS:89-69-0
CM303621
O=[N+](C1=C(Cl)C=C(Cl)C(Cl)=C1)[O-]
1,2,4-TRIETHOXYBENZENE
CAS:41827-15-0
CM560911
CCOC1=CC(=C(C=C1)OCC)OCC
1,2,4-TRIFLUORO-3-METHOXYBENZENE
CAS:4920-34-7
CM377897
COC1=C(F)C=CC(F)=C1F
1,2,4-TRIFLUORO-3-NITROBENZENE
CAS:42096-74-2
CM361240
O=[N+](C1=C(F)C(F)=CC=C1F)[O-]
1,2,4-TRIFLUORO-5-METHYLBENZENE
CAS:887267-34-7
CM368102
CC1=CC(F)=C(F)C=C1F
1,2,4-TRIFLUORO-9-METHYL-3-(4-METHYLPIPERAZIN-1-YL)ACRIDINE
CAS:700851-38-3
CM524255
CN1CCN(C2=C(F)C3=NC4=CC=CC=C4C(C)=C3C(F)=C2F)CC1
1,2,4-TRIMETHANESULFONYLBENZENE
CAS:1434128-54-7
CM386563
CS(=O)(=O)C1=CC(=C(C=C1)S(C)(=O)=O)S(C)(=O)=O
1,2,4-TRIMETHOXY-5-[(1E)-PROP-1-EN-1-YL]BENZENE
CAS:2883-98-9
CM395867
COC1=CC(OC)=C(\C=C\C)C=C1OC
1,2,4-TRIMETHYL BENZENE-1,2,4-TRICARBOXYLATE
CAS:2459-10-1
CM397277
COC(=O)C1=CC(C(=O)OC)=C(C=C1)C(=O)OC
1,2,4-TRIMETHYL-1,4-DIHYDROPYRAZINE
CAS:89851-57-0
CM334431
CN1C=C(C)N(C)C=C1
1,2,4-TRIMETHYL-1H-PYRROLE-3-CARBALDEHYDE
CAS:1142201-80-6
CM486287
O=CC1=C(C)N(C)C=C1C
1,2,4-TRIMETHYL-1H-PYRROLE-3-CARBOXYLIC ACID
CAS:71959-94-9
CM524474
O=C(C1=C(C)N(C)C=C1C)O
1,2,4-TRIMETHYL-2,5-DIAZABICYCLO[2.2.2]OCTANE-3,6-DIONE
CAS:817575-51-2
CM525750
O=C(C1(C)N2)N(C)C(CC1)(C)C2=O
1,2,4-TRIMETHYL-5-BENZENESULFONIC ACID
CAS:3453-84-7
CM243747
O=S(C1=C(C)C=C(C)C(C)=C1)(O)=O
1,2,4-TRIMETHYL-5-NITROBENZENE
CAS:610-91-3
CM243759
CC1=CC(C)=C(C)C=C1[N+]([O-])=O
1,2,4-TRIMETHYL-5-PHENYL-1H-PYRROLE-3-CARBOXYLIC ACID
CAS:724744-88-1
CM524539
O=C(C1=C(C)N(C)C(C2=CC=CC=C2)=C1C)O
1,2,4-TRIPHENYLBUTANE-1,4-DIONE
CAS:4441-01-4
CM397399
O=C(CC(C(=O)C1=CC=CC=C1)C1=CC=CC=C1)C1=CC=CC=C1
1,2,4-TRIVINYLCYCLOHEXANE
CAS:2855-27-8
CM201254
C=CC1CC(C=C)C(C=C)CC1
1,2,4A,5,6,8A-HEXAHYDROQUINOLIN-8-AMINE
CAS:136481-57-7
CM238406
NC1=CCCC2C=CCNC12
1,2,4A,8A-TETRAHYDRO-1,8-NAPHTHYRIDIN-2-ONE
CM542841
O=C1NC2N=CC=CC2C=C1
1,2,5,6,7,8-HEXAHYDRO-2,6-NAPHTHYRIDIN-1-ONE
CAS:1170830-85-9
CM141057
O=C1NC=CC2=C1CCNC2
1,2,5,6,7,8-HEXAHYDROPHTHALAZIN-1-ONE
CAS:14250-51-2
CM534327
O=C1NN=CC2=C1CCCC2
1,2,5,6-TETRABROMOCYCLOOCTANE
CAS:3194-57-8
CM201292
BrC1C(Br)CCC(Br)C(Br)CC1
1,2,5,6-TETRABROMOHEXANE
CAS:58443-86-0
CM396849
BrCC(Br)CCC(Br)CBr
1,2,5,6-TETRAHYDRO-1,5-NAPHTHYRIDINE-2,6-DIONE
CAS:27017-70-5
CM538871
O=C1NC2=C(NC(C=C2)=O)C=C1
1,2,5,6-TETRAHYDROPYRIDINE-3-CARBOXYLIC ACID
CAS:498-96-4
CM171324
O=C(C1=CCCNC1)O
1,2,5,6-TETRAHYDROQUINOLIN-8-AMINE
CAS:136702-04-0
CM238356
NC1=CCCC2=C1NCC=C2
1,2,5,6-TETRAMETHYLNAPHTHALENE
CAS:2131-43-3
CM231897
CC1=C(C)C2=CC=C(C)C(C)=C2C=C1
1,2,5,7-TETRAMETHYL-1H-INDOLE-3-CARBALDEHYDE
CAS:883547-21-5
CM334171
O=CC1=C(C)N(C)C2=C1C=C(C)C=C2C
1,2,5-DITHIAZEPANE
CAS:98354-47-3
CM542664
S1SCCNCC1
1,2,5-OXADIAZOL-3-AMINE
CAS:73147-56-5
CM105282
NC1=NON=C1
1,2,5-OXADIAZOL-3-YLMETHYL ACETATE
CAS:79552-34-4
CM464556
CC(=O)OCC1=NON=C1
1,2,5-OXADIAZOLE-3,4-DICARBOXYLIC ACID
CAS:48113-77-5
CM105273
OC(=O)C1=NON=C1C(O)=O
1,2,5-OXADIAZOLE-3-CARBONITRILE
CAS:68776-63-6
CM307908
N#CC1=NON=C1
1,2,5-OXADIAZOLE-3-CARBONYL CHLORIDE
CAS:1079401-91-4
CM382369
ClC(=O)C1=NON=C1
1,2,5-OXADIAZOLE-3-CARBOXYLIC ACID
CAS:88598-08-7
CM103578
OC(=O)C1=NON=C1
1,2,5-THIADIAZOL-3(2H)-ONE, 4-CHLORO-
CAS:5728-15-4
CM467525
ClC1=NSNC1=O
1,2,5-THIADIAZOL-3-AMINE
CAS:6504-55-8
CM392019
NC1=NSN=C1
1,2,5-THIADIAZOL-3-OL
CAS:5728-07-4
CM541093
OC1=NSN=C1
1,2,5-THIADIAZOLE, 3,4-BIS(4-CHLOROPHENYL)-, 1,1-DIOXIDE
CAS:939983-56-9
CM482502
ClC1=CC=C(C=C1)C1=NS(=O)(=O)N=C1C1=CC=C(Cl)C=C1
1,2,5-THIADIAZOLE-3,4-DIAMINE
CAS:55904-36-4
CM522114
NC1=NSN=C1N
1,2,5-THIADIAZOLE-3-CARBOHYDRAZIDE
CAS:62438-04-4
CM523040
O=C(C1=NSN=C1)NN
1,2,5-THIADIAZOLE-3-CARBOXYLIC ACID
CAS:13368-86-0
CM344022
O=C(C1=NSN=C1)O
1,2,5-THIADIAZOLIDINE 1,1-DIOXIDE
CAS:5823-51-8
CM147932
O=S1(NCCN1)=O
1,2,5-TRIFLUORO-3-IODOBENZENE
CAS:622379-51-5
CM553650
FC1=CC(I)=C(F)C(F)=C1
1,2,5-TRIFLUORO-3-METHYLBENZENE
CAS:132992-29-1
CM368107
CC1=CC(F)=CC(F)=C1F
1,2,5-TRIFLUORO-3-NITROBENZENE
CAS:66684-57-9
CM254422
O=[N+](C1=C(F)C(F)=CC(F)=C1)[O-]
1,2,5-TRIMETHYL-1H-IMIDAZOLE
CAS:1739-81-7
CM416366
CC1=CN=C(C)N1C
1,2,5-TRIMETHYL-1H-INDOLE-3-CARBALDEHYDE
CAS:66727-62-6
CM240167
O=CC1=C(C)N(C)C2=C1C=C(C)C=C2
1,2,5-TRIMETHYL-1H-PYRROLE
CAS:930-87-0
CM383252
CN1C(C)=CC=C1C
1,2,5-TRIMETHYL-1H-PYRROLE-3-CARBALDEHYDE
CAS:5449-87-6
CM333244
O=CC1=C(C)N(C)C(C)=C1
1,2,5-TRIMETHYL-1H-PYRROLE-3-CARBONITRILE
CAS:70319-61-8
CM332882
N#CC1=C(C)N(C)C(C)=C1
1,2,5-TRIMETHYL-1H-PYRROLE-3-CARBOXYLIC ACID
CAS:175276-50-3
CM198546
O=C(C1=C(C)N(C)C(C)=C1)O
1,2,5-TRIMETHYL-3-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)-1H-PYRROLE
CAS:1256359-32-6
CM136683
CN1C(C)=CC(B2OC(C)(C)C(C)(C)O2)=C1C
1,2,5-TRIMETHYL-3H-CYCLOPENTA[C]QUINOLIN-4(5H)-ONE
CAS:88368-82-5
CM246075
O=C1N(C)C2=C(C=CC=C2)C3=C1CC(C)=C3C
1,2,5-TRIMETHYL-N-(1-PHENYLETHYL)PIPERIDIN-4-AMINE
CAS:1005054-67-0
CM382624
CC(NC1CC(C)N(C)CC1C)C1=CC=CC=C1
1,2,5-TRIMETHYL-N-(2-PHENYLETHYL)-4-(PROP-2-EN-1-YL)PIPERIDIN-4-AMINE
CAS:436811-32-4
CM378026
CC1CC(CC=C)(NCCC2=CC=CC=C2)C(C)CN1C
1,2,5-TRIMETHYL-N-(2-PHENYLETHYL)PIPERIDIN-4-AMINE
CAS:100096-38-6
CM382650
CC1CN(C)C(C)CC1NCCC1=CC=CC=C1
1,2,5-TRIMETHYLPIPERIDIN-4-AMINE
CAS:18103-90-7
CM408225
CC1CN(C)C(C)CC1N
1,2,5-TRIMETHYLPIPERIDIN-4-ONE
CAS:7516-33-8
CM180486
O=C1CC(C)N(C)CC1C
1,2,6,7-TETRAHYDRO-8H-INDENO[5,4-B]FURAN-8-ONE
CAS:196597-78-1
CM195695
O=C1CCC2=CC=C3OCCC3=C12
1,2,6,8-TETRAMETHYLQUINOLIN-4(1H)-ONE
CAS:1209161-11-4
CM241525
O=C1C=C(C)N(C)C2=C1C=C(C)C=C2C
1,2,6-THIADIAZINANE 1,1-DIOXIDE
CAS:67104-89-6
CM123539
O=S1(=O)NCCCN1
1,2,6-TRIAZASPIRO[2.5]OCT-1-ENE HYDROCHLORIDE
CAS:1803590-98-8
CM537006
[H]Cl.N1=NC12CCNCC2
1,2,6-TRIMETHOXYNAPHTHALENE
CAS:55218-06-9
CM234297
COC1=CC2=CC=C(OC)C(OC)=C2C=C1
1,2,6-TRIMETHYL-1,4-DIHYDROQUINOLIN-4-ONE
CAS:40770-92-1
CM519774
O=C1C=C(C)N(C)C2=C1C=C(C)C=C2
1,2,6-TRIMETHYL-1H-INDOLE
CAS:113418-65-8
CM550291
CN1C(C)=CC2=C1C=C(C)C=C2
1,2,6-TRIMETHYL-1H-INDOLE-3-CARBALDEHYDE
CAS:842971-69-1
CM240168
O=CC1=C(C)N(C)C2=C1C=CC(C)=C2
1,2,6-TRIMETHYL-4-(4-NITROPHENYL)PIPERAZINE
CAS:1417793-84-0
CM301091
O=[N+](C1=CC=C(N2CC(C)N(C)C(C)C2)C=C1)[O-]
1,2,6-TRIMETHYLNAPHTHALENE
CAS:3031-05-8
CM232391
CC1=CC2=CC=C(C)C(C)=C2C=C1
1,2,6-TRIMETHYLPIPERIDIN-4-OL
CAS:90226-91-8
CM528995
OC1CC(C)N(C)C(C)C1
1,2,7-THIADIAZEPANE 1,1-DIOXIDE
CAS:63010-19-5
CM283782
O=S1(=O)NCCCCN1
1,2,7-TRIHYDROXY-9,10-DIHYDROANTHRACENE-9,10-DIONE
CAS:602-65-3
CM384704
OC1=CC=C2C(=O)C3=C(C(O)=C(O)C=C3)C(=O)C2=C1
1,2,7-TRIMETHYL-1H-INDOLE
CAS:620175-89-5
CM232212
CC1=CC=CC2=C1N(C)C(C)=C2
1,2,8,9-TETRAAZATRICYCLO[8.4.0.0,8]TETRADECA-2,4,6,9,11,13-HEXAENE
CAS:881-64-1
CM527289
N12N=C(C=CC=C3)N3N=C1C=CC=C2
1,2,8-TRIAZASPIRO[4.5]DECAN-3-ONE
CAS:561314-54-3
CM215048
O=C1NNC2(CCNCC2)C1
1,2,8-TRIMETHYL-1,4-DIHYDROQUINOLIN-4-ONE
CAS:41151-86-4
CM519830
O=C1C=C(C)N(C)C2=C1C=CC=C2C
1,2-AZIRIDINEDICARBOXYLIC ACID, 1-(1,1-DIMETHYLETHYL) ESTER, (2S)-
CAS:1315000-92-0
CM106472
O=C(N1[C@H](C(O)=O)C1)OC(C)(C)C
1,2-BENZENEDIAMINE, N1-(4-AMINOPHENYL)-4-METHOXY-
CAS:1345687-79-7
CM325299
NC1=CC(OC)=CC=C1NC2=CC=C(N)C=C2
1,2-BENZENEDICARBOXYLIC ACID, 1,2-BIS(2-METHYLBUTYL) ESTER
CAS:42925-80-4
CM480188
CCC(C)COC(=O)C1=C(C=CC=C1)C(=O)OCC(C)CC
1,2-BENZENEDICARBOXYLIC ACID, 1,2-DIISONONYL ESTER
CAS:28553-12-0
CM479639
CC(C)CCCCCCOC(=O)C1=C(C=CC=C1)C(=O)OCCCCCCC(C)C
1,2-BENZENEDICARBOXYLIC ACID, 1-(2-METHOXYETHYL) ESTER
CAS:16501-01-2
CM470424
COCCOC(=O)C1=C(C=CC=C1)C(O)=O
1,2-BENZENEDICARBOXYLIC ACID, 4,5-DIMETHYL-
CAS:5680-10-4
CM462892
CC1=CC(C(O)=O)=C(C=C1C)C(O)=O
1,2-BENZENEDICARBOXYLIC ACID, DIHEPTYL ESTER
CAS:3648-21-3
CM479955
CCCCCCCOC(=O)C1=C(C=CC=C1)C(=O)OCCCCCCC
1,2-BENZENEDICARBOXYLIC ACID, DIUNDECYL ESTER
CAS:3648-20-2
CM479954
CCCCCCCCCCCOC(=O)C1=C(C=CC=C1)C(=O)OCCCCCCCCCCC
1,2-BENZENEDICARBOXYLIC ACID, POTASSIUM SALT (1:2)
CAS:4409-98-7
CM473832
[K+].[K+].OC(=O)C1=C(C=CC=C1)C(O)=O
1,2-BENZENEDIMETHANOL
CAS:612-14-6
CM116118
OCC1=CC=CC=C1CO
1,2-BENZIODOXOLE-1(3H)-CARBONITRILE, 3-OXO-
CAS:172876-96-9
CM250299
N#CI1OC(C2=CC=CC=C21)=O
1,2-BENZISOTHIAZOL-3(2H)-ONE, 2-(CHLOROMETHYL)-, 1,1-DIOXIDE
CAS:13947-21-2
CM471740
ClCN1C(=O)C2=C(C=CC=C2)S1(=O)=O
1,2-BENZISOTHIAZOLE, 2,3-DIHYDRO-, 1,1-DIOXIDE
CAS:936-16-3
CM112481
O=S1(NCC2=C1C=CC=C2)=O
1,2-BENZISOTHIAZOLE,2,3-DIHYDRO-2-(2-PROPYN-1-YL)-,1,1-DIOXIDE
CAS:20044-78-4
CM112003
C#CCN(CC1=C2C=CC=C1)S2(=O)=O
1,2-BENZISOTHIAZOLE-2(3H)-PROPANOIC ACID, 3-OXO-
CAS:89139-48-0
CM470287
OC(=O)CCN1SC2=C(C=CC=C2)C1=O
1,2-BENZISOTHIAZOLE-3-ACETIC ACID
CAS:29266-68-0
CM462834
OC(=O)CC1=NSC2=CC=CC=C12
1,2-BENZISOTHIAZOLE-3-CARBOXYLIC ACID
CAS:40991-34-2
CM153142
O=C(C1=NSC2=C1C=CC=C2)O
1,2-BENZISOTHIAZOLE-5-CARBOXYLIC ACID, 2,3-DIHYDRO-3-OXO-, 1,1-DIOXIDE
CAS:221446-00-0
CM470940
OC(=O)C1=CC2=C(C=C1)S(=O)(=O)NC2=O
1,2-BENZISOXAZOL-3-AMINE
CAS:36216-80-5
CM153021
O1C2=C(C(=N1)N)C=CC=C2
1,2-BENZISOXAZOL-6-OL
CAS:65685-55-4
CM153547
OC2=CC1=C(C=NO1)C=C2
1,2-BENZISOXAZOLE-3-ACETIC ACID
CAS:4865-84-3
CM158096
O=C(O)CC1=NOC2=C1C=CC=C2
1,2-BENZISOXAZOLE-3-CARBOXYLIC ACID
CAS:28691-47-6
CM119958
O=C(C1=NOC2=C1C=CC=C2)O
1,2-BENZOTHIAZOL-3-AMINE
CAS:23031-78-9
CM119231
NC1=NSC2=CC=CC=C12
1,2-BENZOTHIAZOL-3-AMINE
CAS:613262-33-2
CM362334
NC1=NSC2=CC=CC=C12
1,2-BENZOTHIAZOL-3-AMINE HYDROCHLORIDE
CAS:62458-22-4
CM523043
NC1=NSC2=CC=CC=C12.[H]Cl
1,2-BENZOTHIAZOL-5-OL
CAS:75608-07-0
CM524998
OC1=CC2=C(SN=C2)C=C1
1,2-BENZOTHIAZOL-6-AMINE
CAS:97050-36-7
CM386854
NC1=CC=C2C=NSC2=C1
1,2-BENZOTHIAZOL-6-OL
CAS:934180-38-8
CM530132
OC1=CC=C2C=NSC2=C1
1,2-BENZOTHIAZOL-7-AMINE
CAS:89795-79-9
CM528284
NC1=C(SN=C2)C2=CC=C1
1,2-BENZOTHIAZOLE
CAS:272-16-2
CM515996
C12=CC=CC=C1SN=C2
1,2-BENZOTHIAZOLE-3,5-DIAMINE
CAS:613262-29-6
CM522840
NC1=NSC2=CC=C(N)C=C12
1,2-BENZOTHIAZOLE-3-CARBOXAMIDE
CAS:16807-21-9
CM507676
O=C(C1=NSC2=CC=CC=C12)N
1,2-BENZOTHIAZOLE-5-CARBALDEHYDE
CAS:1187243-11-3
CM488286
O=CC1=CC=C(SN=C2)C2=C1
1,2-BENZOTHIAZOLE-5-CARBOXYLIC ACID
CAS:1197944-17-4
CM553126
OC(=O)C1=CC=C2SN=CC2=C1
1,2-BENZOXAZOL-4-OL
CAS:1360931-63-0
CM380833
OC1=CC=CC2=C1C=NO2
1,2-BENZOXAZOLE-3-CARBALDEHYDE
CAS:84395-93-7
CM526121
O=CC1=NOC2=CC=CC=C12
1,2-BENZOXAZOLE-5-CARBALDEHYDE
CAS:933718-95-7
CM530086
O=CC1=CC=C(ON=C2)C2=C1
1,2-BENZOXAZOLE-5-CARBOXYLIC ACID
CAS:933744-95-7
CM389615
OC(=O)C1=CC=C2ON=CC2=C1
1,2-BIS((1H-INDOL-3-YL)METHYLENE)HYDRAZINE
CAS:1233-49-4
CM230419
C1(/C=N/N=C/C2=CNC3=C2C=CC=C3)=CNC4=C1C=CC=C4
1,2-BIS((5-BROMOPYRIDIN-2-YL)OXY)ETHANE
CAS:685862-28-6
CM172142
BrC1=CN=C(OCCOC2=NC=C(Br)C=C2)C=C1
1,2-BIS((DI-TERT-BUTYLPHOSPHANYL)METHYL)BENZENE
CAS:121954-50-5
CM130293
CC(P(CC1=CC=CC=C1CP(C(C)(C)C)C(C)(C)C)C(C)(C)C)(C)
1,2-BIS(1-HYDROXYPROPAN-2-YL) BENZENE-1,2-DICARBOXYLATE
CAS:117-82-8
CM384288
CC(CO)OC(=O)C1=CC=CC=C1C(=O)OC(C)CO
1,2-BIS(1-PHENYL-1H-TETRAZOL-5-YL)DISULFANE
CAS:5117-07-7
CM112398
N1(C2=CC=CC=C2)N=NN=C1SSC3=NN=NN3C4=CC=CC=C4
1,2-BIS(1H-BENZO[D]IMIDAZOL-2-YL)ETHANE-1,2-DIOL
CAS:3314-32-7
CM115879
OC(C1=NC2=CC=CC=C2N1)C(C3=NC4=CC=CC=C4N3)O
1,2-BIS(2,5-DIMETHYL-1H-PYRROL-1-YL)ETHANE
CAS:6306-70-3
CM123185
CC1=CC=C(C)N1CCN2C(C)=CC=C2C
1,2-BIS(2,6-DICHLOROBENZYL)DISULFANE
CAS:5219-69-2
CM193686
ClC1=C(C(Cl)=CC=C1)CSSCC2=C(Cl)C=CC=C2Cl
1,2-BIS(2-(4-(DIBENZO[B,F][1,4]THIAZEPIN-11-YL)PIPERAZIN-1-YL)ETHOXY)ETHANE TETRAHYDROCHLORIDE
CAS:1923194-81-3
CM250831
N1(CCOCCOCCN2CCN(C3=NC4=CC=CC=C4SC5=CC=CC=C35)CC2)
1,2-BIS(2-BROMOETHOXY)ETHANE
CAS:31255-10-4
CM328710
BrCCOCCOCCBr
1,2-BIS(2-BUTOXYETHYL) BENZENE-1,2-DICARBOXYLATE
CAS:117-83-9
CM395110
CCCCOCCOC(=O)C1=CC=CC=C1C(=O)OCCOCCCC
1,2-BIS(2-CHLORO-5-METHOXYPYRIMIDIN-4-YL)HYDRAZINE
CAS:1956386-49-4
CM478421
COC1=C(NNC2=C(OC)C=NC(Cl)=N2)N=C(Cl)N=C1
1,2-BIS(2-CHLOROETHOXY)ETHANE
CAS:112-26-5
CM147880
ClCCOCCOCCCl
1,2-BIS(2-CHLOROPHENYL)-5,6,7,8-TETRAHYDROQUINAZOLINE-4(1H)-THIONE
CAS:62721-88-4
CM215735
S=C1N=C(C2=CC=CC=C2Cl)N(C3=CC=CC=C3Cl)C4=C1CCCC4
1,2-BIS(2-CHLOROPHENYL)HYDRAZINE
CAS:782-74-1
CM543290
ClC1=CC=CC=C1NNC2=CC=CC=C2Cl
1,2-BIS(2-CYANO-5-PHENYL-3-THIENYL)PERFLUOROCYCLOPENTENE
CAS:618360-18-2
CM482918
FC1(F)C(C2=C(SC(=C2)C2=CC=CC=C2)C#N)=C(C2=C(SC(=C2
1,2-BIS(2-ETHYLHEXYL) BENZENE-1,2-DICARBOXYLATE
CAS:117-81-7
CM394462
CCCCC(CC)COC(=O)C1=CC=CC=C1C(=O)OCC(CC)CCCC
1,2-BIS(2-METHYLFURAN-3-YL)DISULFANE
CAS:28588-75-2
CM196286
CC1=C(SSC2=C(C)OC=C2)C=CO1
1,2-BIS(3-FLUOROPHENYL)-6-METHOXY-1,2,3,4-TETRAHYDROISOQUINOLINE
CAS:96719-68-5
CM226677
COC1=CC2=C(C(C3=CC=CC(F)=C3)N(C4=CC=CC(F)=C4)CC2)C
1,2-BIS(3-FLUOROPHENYL)ETHAN-1-ONE
CAS:40281-51-4
CM122885
FC1=CC(CC(C2=CC=CC(F)=C2)=O)=CC=C1
1,2-BIS(3-PHENYL-1,2,4-OXADIAZOL-5-YL)ETHANE
CAS:22020-64-0
CM115275
C1(C2=CC=CC=C2)=NOC(CCC3=NC(C4=CC=CC=C4)=NO3)=N1
1,2-BIS(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)BENZENE
CAS:269410-07-3
CM219924
CC1(C)C(C)(C)OB(C2=CC=CC=C2B3OC(C)(C)C(C)(C)O3)O1
1,2-BIS(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)ETHYNE
CAS:1010840-17-1
CM204215
CC1(C)C(C)(C)OB(C#CB2OC(C)(C)C(C)(C)O2)O1
1,2-BIS(4-(5-METHYLBENZO[D]-OXAZOL-2-YL)PHENYL)ETHENE
CAS:2397-00-4
CM155874
CC1=CC2=C(OC(=N2)C2=CC=C(C=CC3=CC=C(C=C3)C3=NC4=C(
1,2-BIS(4-(BENZO[D]OXAZOL-2-YL)PHENYL)ETHENE
CAS:1533-45-5
CM157655
O1C2=C(C=CC=C2)N=C1C1=CC=C(C=CC2=CC=C(C=C2)C2=NC3=
1,2-BIS(4-AMINOPHENYL)ETHANE-1,2-DIONE
CAS:29602-15-1
CM183535
O=C(C1=CC=C(N)C=C1)C(C2=CC=C(N)C=C2)=O
1,2-BIS(4-BROMOPHENYL)ETHENE
CAS:18869-30-2
CM250760
BrC1=CC=C(/C=C/C2=CC=C(Br)C=C2)C=C1
1,2-BIS(4-BROMOPHENYL)ETHYNE
CAS:2789-89-1
CM251889
BrC1=CC=C(C#CC2=CC=C(Br)C=C2)C=C1
1,2-BIS(4-CHLOROPHENYL)-2-HYDROXYETHAN-1-ONE
CAS:4254-20-0
CM125210
C1=CC(=CC=C1C(C(=O)C2=CC=C(C=C2)Cl)O)Cl
1,2-BIS(4-CHLOROPHENYL)ETHANE-1,2-DIONE
CAS:3457-46-3
CM282512
ClC1=CC=C(C=C1)C(=O)C(=O)C1=CC=C(Cl)C=C1
1,2-BIS(4-FLUOROPHENYL)-2-HYDROXYETHANONE
CAS:53458-16-5
CM253478
OC(C1=CC=C(F)C=C1)C(C2=CC=C(F)C=C2)=O
1,2-BIS(4-FLUOROPHENYL)ETHAN-1-ONE
CAS:366-68-7
CM125104
FC1=CC=C(CC(C2=CC=C(F)C=C2)=O)C=C1
1,2-BIS(4-METHOXYPHENYL)-2-OXOETHYL N-CYCLOHEXYLCARBAMATE
CAS:196599-80-1
CM395885
COC1=CC=C(C=C1)C(OC(=O)NC1CCCCC1)C(=O)C1=CC=C(OC)C
1,2-BIS(4-METHOXYPHENYL)ETHAN-1-ONE
CAS:120-44-5
CM397305
COC1=CC=C(CC(=O)C2=CC=C(OC)C=C2)C=C1
1,2-BIS(4-METHOXYPHENYL)ETHYNE
CAS:2132-62-9
CM131764
COC1=CC=C(C#CC2=CC=C(OC)C=C2)C=C1
1,2-BIS(4-METHYLPHENYL)-1,2-DIPHENYLETHANE-1,2-DIOL
CAS:808-12-8
CM394049
CC1=CC=C(C=C1)C(O)(C1=CC=CC=C1)C(O)(C1=CC=CC=C1)C1
1,2-BIS(4-METHYLQUINOLIN-2-YL)DISULFANE
CAS:66546-28-9
CM228115
CC1=CC(SSC2=NC3=CC=CC=C3C(C)=C2)=NC4=CC=CC=C14
1,2-BIS(4-METHYLTHIAZOL-2-YL)DISULFANE
CAS:23826-98-4
CM189767
CC1=CSC(SSC2=NC(C)=CS2)=N1
1,2-BIS(4-NITROPHENYL)DISULFANE
CAS:100-32-3
CM247256
O=[N+](C1=CC=C(SSC2=CC=C([N+]([O-])=O)C=C2)C=C1)[O
1,2-BIS(5-NITROPYRIDIN-2-YL)DISULFANE
CAS:2127-10-8
CM172585
O=[N+](C1=CN=C(SSC2=NC=C([N+]([O-])=O)C=C2)C=C1)[O
1,2-BIS(6-CHLORO-9H-PURIN-9-YL)ETHANE
CAS:23191-87-9
CM233015
ClC1=C2N=CN(CCN3C=NC4=C(Cl)N=CN=C34)C2=NC=N1
1,2-BIS(BENZO[D]THIAZOL-2-YL)DISULFANE
CAS:120-78-5
CM155636
C1(SSC2=NC3=CC=CC=C3S2)=NC4=CC=CC=C4S1
1,2-BIS(BROMOMETHYL)-3-NITROBENZENE
CAS:66126-16-7
CM129720
[O-][N+](=O)C1=CC=CC(CBr)=C1CBr
1,2-BIS(BROMOMETHYL)-4,5-DIFLUOROBENZENE
CAS:915944-27-3
CM328134
FC1=C(F)C=C(CBr)C(CBr)=C1
1,2-BIS(BROMOMETHYL)-4,5-DIMETHOXYBENZENE
CAS:26726-81-8
CM361400
COC1=C(OC)C=C(CBr)C(CBr)=C1
1,2-BIS(BROMOMETHYL)-4-IODOBENZENE
CAS:689260-54-6
CM397527
BrCC1=C(CBr)C=C(I)C=C1
1,2-BIS(BROMOMETHYL)-4-NITROBENZENE
CAS:6425-66-7
CM123527
[O-][N+](=O)C1=CC(CBr)=C(CBr)C=C1
1,2-BIS(BROMOMETHYL)BENZENE
CAS:91-13-4
CM255724
BrCC1=CC=CC=C1CBr
1,2-BIS(CHLOROMETHYL)BENZENE
CAS:612-12-4
CM395557
ClCC1=C(CCl)C=CC=C1
1,2-BIS(CYANOMETHYL)BENZENE
CAS:613-73-0
CM184464
N#CCC1=CC=CC=C1CC#N
1,2-BIS(DIBROMOMETHYL)-3-NITROBENZENE
CAS:184026-01-5
CM367861
[O-][N+](=O)C1=CC=CC(C(Br)Br)=C1C(Br)Br
1,2-BIS(DIBROMOMETHYL)BENZENE
CAS:13209-15-9
CM248838
BrC(C1=CC=CC=C1C(Br)Br)Br
1,2-BIS(DICHLOROMETHYL)BENZENE
CAS:25641-99-0
CM473761
ClC(Cl)C1=C(C=CC=C1)C(Cl)Cl
1,2-BIS(DICHLOROPHOSPHINO)ETHANE
CAS:28240-69-9
CM471763
ClP(Cl)CCP(Cl)Cl
1,2-BIS(DIFLUOROMETHOXY)NAPHTHALENE
CAS:1261658-31-4
CM234810
FC(F)OC1=CC=C2C=CC=CC2=C1OC(F)F
1,2-BIS(DIFLUOROMETHYL)NAPHTHALENE
CAS:1261799-07-8
CM234502
FC(C1=CC=C2C=CC=CC2=C1C(F)F)F
1,2-BIS(DIMETHYLSILYL)BENZENE
CAS:17985-72-7
CM137787
C[SiH](C1=CC=CC=C1[SiH](C)C)C
1,2-BIS(DIPHENYLPHOSPHINO)BENZENE
CAS:13991-08-7
CM249260
C1(P(C2=CC=CC=C2)C3=CC=CC=C3)=CC=CC=C1P(C4=CC=CC=C
1,2-BIS(DIPHENYLPHOSPHINO)ETHANE
CAS:1663-45-2
CM250130
P(CCP(C1=CC=CC=C1)C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=C
1,2-BIS(FURAN-2-YLMETHYL)DISULFANE
CAS:4437-20-1
CM195753
C1(CSSCC2=CC=CO2)=CC=CO1
1,2-BIS(N,N'-DIPHENYLCARBAMIMIDAMIDO) BENZENE-1,2-DICARBOXYLATE
CAS:17573-13-6
CM370375
N=C(NC1=CC=CC=C1)N(OC(=O)C1=CC=CC=C1C(=O)ON(C(=N)N
1,2-BIS(O-AMINOPHENOXY)ETHANE
CAS:52411-34-4
CM253399
NC1=CC=CC=C1OCCOC2=CC=CC=C2N
1,2-BIS(PROP-2-EN-1-YL) BENZENE-1,2-DICARBOXYLATE
CAS:131-17-9
CM372868
C=CCOC(=O)C1=CC=CC=C1C(=O)OCC=C
1,2-BIS(PROPAN-2-YL) 3,5-DIPHENYL-2,3-DIHYDRO-1H-PYRAZOLE-1,2-DICARBOXYLATE
CAS:936949-04-1
CM375984
CC(C)OC(=O)N1C(C=C(N1C(=O)OC(C)C)C1=CC=CC=C1)C1=CC
1,2-BIS(PROPAN-2-YL)BENZENE
CAS:25321-09-9
CM538696
CC(C)C1=C(C=CC=C1)C(C)C
1,2-BIS(PYRIDIN-4-YL)ETHANE-1,2-DIOL
CAS:6950-04-5
CM363844
OC(C(O)C1=CC=NC=C1)C1=CC=NC=C1
1,2-BIS(TERT-BUTOXY)-1,1,2,2-TETRAMETHYLDISILANE
CAS:78669-53-1
CM393545
CC(C)(C)O[Si](C)(C)[Si](C)(C)OC(C)(C)C
1,2-BIS(THIOPHEN-2-YL)ETHAN-1-ONE
CAS:53119-26-9
CM408917
O=C(CC1=CC=CS1)C1=CC=CS1
1,2-BIS(TRIFLUOROMETHOXY)NAPHTHALENE
CAS:1261658-39-2
CM234740
FC(F)(F)OC1=CC=C2C=CC=CC2=C1OC(F)(F)F
1,2-BIS(TRIFLUOROMETHYL)BENZENE
CAS:433-95-4
CM361546
FC(C1=CC=CC=C1C(F)(F)F)(F)F
1,2-BIS-(2-CHLORO-5-METHYLTHIEN-4-YL)-CYCLOPENTENE
CAS:219537-97-0
CM479248
CC1=C(C=C(Cl)S1)C1=C(CCC1)C1=C(C)SC(Cl)=C1
1,2-BIS-(4-METHYL-PIPERAZIN-1-YL)-ETHANE
CAS:77267-14-2
CM318040
CN1CCN(CCN2CCN(C)CC2)CC1
1,2-BIS[(1R,5R)-3,3,5-TRIMETHYLCYCLOHEXYL] BENZENE-1,2-DICARBOXYLATE
CAS:245652-81-7
CM393122
C[C@H]1C[C@H](CC(C)(C)C1)OC(=O)C1=CC=CC=C1C(=O)O[C
1,2-BIS[(1S,5R)-3,3,5-TRIMETHYLCYCLOHEXYL] BENZENE-1,2-DICARBOXYLATE
CAS:245652-82-8
CM392588
C[C@H]1C[C@@H](CC(C)(C)C1)OC(=O)C1=CC=CC=C1C(=O)O[
1,2-BIS[(OXIRAN-2-YL)METHYL] CYCLOHEX-4-ENE-1,2-DICARBOXYLATE
CAS:21544-03-6
CM396420
O=C(OCC1CO1)C1CC=CCC1C(=O)OCC1CO1
1,2-BIS[(OXIRAN-2-YL)METHYL] CYCLOHEXANE-1,2-DICARBOXYLATE
CAS:5493-45-8
CM396421
O=C(OCC1CO1)C1CCCCC1C(=O)OCC1CO1
1,2-BIS[(PROP-2-YN-1-YLOXY)METHYL]BENZENE
CAS:126422-60-4
CM563519
C#CCOCC1=CC=CC=C1COCC#C
1,2-BIS[6-(PYRIDIN-2-YL)-[2,2'-BIPYRIDIN]-4-YL]ETHAN-1-ONE
CAS:802910-28-7
CM525615
O=C(C1=CC(C2=NC=CC=C2)=NC(C3=NC=CC=C3)=C1)CC4=CC(C
1,2-CYCLOBUTANEDICARBOXYLIC ACID, 1-CYANO-, 1,2-DIMETHYL ESTER
CAS:14132-45-7
CM465638
COC(=O)C1CCC1(C#N)C(=O)OC
1,2-CYCLOBUTANEDICARBOXYLIC ACID, DIMETHYL ESTER, (1S-TRANS)-
CAS:61376-98-5
CM464944
COC(=O)C1CC[C@@H]1C(=O)OC
1,2-CYCLOBUTANEDICARBOXYLIC ACID, DIMETHYL ESTER, TRANS-
CAS:7371-67-7
CM464940
COC(=O)[C@@H]1CC[C@H]1C(=O)OC
1,2-CYCLOHEXANEDICARBONYLDICHLORIDE
CAS:34684-19-0
CM243510
O=C(Cl)C1C(C(Cl)=O)CCCC1
1,2-CYCLOHEXANEDICARBOXIMIDE
CAS:1444-94-6
CM202315
O=C1NC(=O)C2C1CCCC2
1,2-CYCLOPROPANEDICARBOXYLIC ACID, 3,3-DIMETHYL-, CIS-
CAS:936-87-8
CM464174
CC1(C)[C@@H]([C@@H]1C(O)=O)C(O)=O
1,2-CYCLOPROPANEDICARBOXYLIC ACID, 3-METHYL-
CAS:89615-02-1
CM464129
CC1C(C1C(O)=O)C(O)=O
1,2-CYCLOPROPANEDICARBOXYLIC ACID, MONOETHYL ESTER, (1R,2R)-
CAS:31420-66-3
CM464412
CCOC(=O)[C@@H]1C[C@H]1C(O)=O
1,2-DI([1,1'-BIPHENYL]-4-YL)ETHYNE
CAS:21326-80-7
CM328549
ClC1=CC(NCCO)=NC=N1
1,2-DI(1H-INDOL-3-YL)DISULFANE
CAS:61830-39-5
CM230638
C1(SSC2=CNC3=C2C=CC=C3)=CNC4=C1C=CC=C4
1,2-DI(4-PYRIDYL)ETHYLENE
CAS:13362-78-2
CM120501
C1(/C=C/C2=CC=NC=C2)=CC=NC=C1
1,2-DI(BOROLAN-1-YL)ETHYNE
CAS:62654-59-5
CM215729
B1(C#CB2CCCC2)CCCC1
1,2-DI(FURAN-2-YL)-2-HYDROXYETHANONE
CAS:552-86-3
CM196102
OC(C1=CC=CO1)C(C2=CC=CO2)=O
1,2-DI(NAPHTHALEN-1-YL)ETHANE-1,2-DIAMINE
CAS:618092-22-1
CM236351
NC(C1=C2C=CC=CC2=CC=C1)C(C3=C4C=CC=CC4=CC=C3)N
1,2-DI(NAPHTHALEN-2-YL)DISULFANE
CAS:5586-15-2
CM230637
C1(SSC2=CC=C3C=CC=CC3=C2)=CC=C4C=CC=CC4=C1
1,2-DI(PYRIDIN-2-YL)ETHANE
CAS:4916-40-9
CM324978
C1(CCC2=NC=CC=C2)=NC=CC=C1
1,2-DI(PYRIDIN-4-YL)ETHYNE
CAS:73564-69-9
CM170963
C1(C#CC2=CC=NC=C2)=CC=NC=C1
1,2-DI(QUINOLIN-8-YL)DISULFANE
CAS:1160-28-7
CM264431
C12=CC=CC(SSC3=C4N=CC=CC4=CC=C3)=C1N=CC=C2
1,2-DI(THIOPHEN-3-YL)ETHANE-1,2-DIONE
CAS:7333-08-6
CM323670
O=C(C1=CSC=C1)C(C2=CSC=C2)=O
1,2-DI-2-FURYL-1,2-ETHANEDIONE
CAS:492-94-4
CM196362
O=C(C1=CC=CO1)C(C2=CC=CO2)=O
1,2-DI-P-TOLYLDIAZENE
CAS:501-60-0
CM253229
CC1=CC=C(/N=N/C2=CC=C(C)C=C2)C=C1
1,2-DI-P-TOLYLETHANE-1,2-DIONE
CAS:3457-48-5
CM252366
O=C(C1=CC=C(C)C=C1)C(C2=CC=C(C)C=C2)=O
1,2-DI-TERT-BUTYL (2R)-4-OXOPYRROLIDINE-1,2-DICARBOXYLATE
CAS:1098652-11-9
CM547069
CC(C)(C)OC(=O)[C@H]1CC(=O)CN1C(=O)OC(C)(C)C
1,2-DI-TERT-BUTYL (2R)-4-OXOPYRROLIDINE-1,2-DICARBOXYLATE
CAS:1260591-66-9
CM294632
O=C(N1[C@@H](C(OC(C)(C)C)=O)CC(C1)=O)OC(C)(C)C
1,2-DI-TERT-BUTYL (2R,4S)-4-AMINOPYRROLIDINE-1,2-DICARBOXYLATE
CAS:1050191-37-1
CM391667
CC(C)(C)OC(=O)[C@H]1C[C@H](N)CN1C(=O)OC(C)(C)C
1,2-DI-TERT-BUTYL (2S,3R)-3-(HYDROXYMETHYL)AZETIDINE-1,2-DICARBOXYLATE
CAS:1116478-18-2
CM554663
O=C(N1[C@H](C(OC(C)(C)C)=O)[C@H](CO)C1)OC(C)(C)C
1,2-DI-TERT-BUTYL 2-METHYLPIPERAZINE-1,2-DICARBOXYLATE
CAS:1416374-71-4
CM374223
CC(C)(C)OC(=O)N1CCNCC1(C)C(=O)OC(C)(C)C
1,2-DI-TERT-BUTYL 4-AMINOPYRROLIDINE-1,2-DICARBOXYLATE
CAS:2306263-44-3
CM388169
CC(C)(C)OC(=O)C1CC(N)CN1C(=O)OC(C)(C)C
1,2-DI-TERT-BUTYL PYRROLIDINE-1,2-DICARBOXYLATE
CAS:347189-18-8
CM479906
CC(C)(C)OC(=O)C1CCCN1C(=O)OC(C)(C)C
1,2-DIAMINO-3,4-ETHYLENEDIOXYBENZENE
CAS:320386-55-8
CM109894
NC1=C(OCCO2)C2=CC=C1N
1,2-DIAZASPIRO[4.4]NONA-1,3-DIENE
CAS:191332-88-4
CM212669
N1=NC=CC12CCCC2
1,2-DIAZEPANE DIHYDROCHLORIDE
CAS:151540-98-6
CM284592
[H]Cl.[H]Cl.N1NCCCCC1
1,2-DIAZINANE
CAS:505-19-1
CM129135
C1CCCNN1
1,2-DIBENZYL 3-TERT-BUTYL PIPERAZINE-1,2,3-TRICARBOXYLATE
CAS:1822421-45-3
CM512157
O=C(N1C(C(OCC2=CC=CC=C2)=O)C(C(OC(C)(C)C)=O)NCC1)O
1,2-DIBROMO-1,1,2,2-TETRACHLOROETHANE
CAS:630-25-1
CM326150
ClC(Cl)(Br)C(Cl)(Br)Cl
1,2-DIBROMO-2-CHLORO-1,1,3,3,3-PENTAFLUOROPROPANE
CAS:661-93-8
CM377284
FC(F)(F)C(Cl)(Br)C(F)(F)Br
1,2-DIBROMO-2-CHLORO-1,1-DIFLUOROETHANE
CAS:421-36-3
CM378200
FC(F)(Br)C(Cl)Br
1,2-DIBROMO-2-CHLORO-3-FLUOROPROPANE
CAS:70192-60-8
CM383468
FCC(Cl)(Br)CBr
1,2-DIBROMO-2-METHYLPROPANE
CAS:594-34-3
CM377567
CC(C)(Br)CBr
1,2-DIBROMO-3,3-DIMETHYLBUT-1-ENE
CAS:99584-95-9
CM393507
CC(C)(C)C(Br)=CBr
1,2-DIBROMO-3,4,5,6-TETRAFLUOROBENZENE
CAS:827-08-7
CM255191
FC1=C(Br)C(Br)=C(F)C(F)=C1F
1,2-DIBROMO-3,4-DICHLOROBENZENE
CAS:100191-48-8
CM386012
ClC1=C(Cl)C(Br)=C(Br)C=C1
1,2-DIBROMO-3,4-DIFLUORO-5-(FLUOROMETHOXY)BENZENE
CAS:1805471-44-6
CM400134
FCOC1=CC(Br)=C(Br)C(F)=C1F
1,2-DIBROMO-3,4-DIFLUOROBENZENE
CAS:811713-01-6
CM376819
FC1=C(F)C(Br)=C(Br)C=C1
1,2-DIBROMO-3,5-DIFLUOROBENZENE
CAS:139215-43-3
CM396130
FC1=CC(Br)=C(Br)C(F)=C1
1,2-DIBROMO-3-CHLOROPROPANE
CAS:96-12-8
CM375087
ClCC(Br)CBr
1,2-DIBROMO-3-FLUORO-4-[(TRIFLUOROMETHYL)SULFANYL]BENZENE
CAS:1804419-45-1
CM402942
FC1=C(SC(F)(F)F)C=CC(Br)=C1Br
1,2-DIBROMO-3-FLUOROBENZENE
CAS:811711-33-8
CM277091
FC1=C(Br)C(Br)=CC=C1
1,2-DIBROMO-3-FLUOROPROPANE
CAS:453-00-9
CM377982
FCC(Br)CBr
1,2-DIBROMO-3-ISOTHIOCYANATOPROPANE
CAS:51784-10-2
CM377765
BrCC(Br)CN=C=S
1,2-DIBROMO-3-METHOXYBENZENE
CAS:95970-22-2
CM195104
COC1=C(Br)C(Br)=CC=C1
1,2-DIBROMO-4,5-BIS(TRIFLUOROMETHYL)BENZENE
CAS:64219-36-9
CM383411
FC(F)(F)C1=CC(Br)=C(Br)C=C1C(F)(F)F
1,2-DIBROMO-4,5-DIFLUORO-3-[(TRIFLUOROMETHYL)SULFANYL]BENZENE
CAS:1803836-39-6
CM402954
FC1=CC(Br)=C(Br)C(SC(F)(F)F)=C1F
1,2-DIBROMO-4,5-DIFLUORO-3-NITROBENZENE
CAS:1481-57-8
CM249600
[O-][N+](=O)C1=C(F)C(F)=CC(Br)=C1Br
1,2-DIBROMO-4,5-DIIODOBENZENE
CAS:529502-50-9
CM384824
BrC1=C(Br)C=C(I)C(I)=C1
1,2-DIBROMO-4-(1,2-DIBROMOETHYL)CYCLOHEXANE
CAS:3322-93-8
CM203268
BrCC(C1CC(Br)C(Br)CC1)Br
1,2-DIBROMO-4-(TRIFLUOROMETHOXY)BENZENE
CAS:1682-06-0
CM369471
FC(F)(F)OC1=CC(Br)=C(Br)C=C1
1,2-DIBROMO-4-(TRIFLUOROMETHYL)BENZENE
CAS:7657-08-1
CM126020
FC(C1=CC=C(Br)C(Br)=C1)(F)F
1,2-DIBROMO-4-CHLORO-3-FLUOROBENZENE
CAS:1349708-99-1
CM381001
FC1=C(Cl)C=CC(Br)=C1Br
1,2-DIBROMO-4-CHLORO-5-METHYLBENZENE
CAS:1160574-04-8
CM555978
CC1=C(Cl)C=C(Br)C(Br)=C1
1,2-DIBROMO-4-CHLOROBENZENE
CAS:60956-24-3
CM253994
ClC1=CC=C(Br)C(Br)=C1
1,2-DIBROMO-4-ETHOXY-5-FLUOROBENZENE
CAS:1803836-45-4
CM399467
CCOC1=CC(Br)=C(Br)C=C1F
1,2-DIBROMO-4-FLUORO-3-(FLUOROMETHOXY)BENZENE
CAS:1804933-46-7
CM400125
FCOC1=C(F)C=CC(Br)=C1Br
1,2-DIBROMO-4-FLUORO-3-[(TRIFLUOROMETHYL)SULFANYL]BENZENE
CAS:1807182-81-5
CM402935
FC1=C(SC(F)(F)F)C(Br)=C(Br)C=C1
1,2-DIBROMO-4-FLUORO-5-METHYLBENZENE
CAS:202982-77-2
CM368083
CC1=CC(Br)=C(Br)C=C1F
1,2-DIBROMO-4-FLUORO-5-NITROBENZENE
CAS:1807056-85-4
CM250520
O=[N+](C1=C(F)C=C(Br)C(Br)=C1)[O-]
1,2-DIBROMO-4-METHOXYBENZENE
CAS:62415-74-1
CM254137
COC1=CC(Br)=C(Br)C=C1
1,2-DIBROMO-4-METHYL-5-NITROBENZENE
CAS:101580-70-5
CM247320
CC1=CC(Br)=C(Br)C=C1[N+]([O-])=O
1,2-DIBROMO-4-METHYLBENZENE
CAS:60956-23-2
CM253993
CC1=CC=C(Br)C(Br)=C1
1,2-DIBROMO-4-NITROBENZENE
CAS:5411-50-7
CM193812
O=[N+](C1=CC=C(Br)C(Br)=C1)[O-]
1,2-DIBROMO-4-TERT-BUTYLBENZENE
CAS:6683-75-6
CM254431
CC(C)(C)C1=CC(Br)=C(Br)C=C1
1,2-DIBROMO-5-(DIFLUOROMETHOXY)-3-(FLUOROMETHOXY)BENZENE
CAS:1803814-92-7
CM403042
FCOC1=CC(OC(F)F)=CC(Br)=C1Br
1,2-DIBROMO-5-FLUORO-3-(FLUOROMETHYL)BENZENE
CAS:1804417-81-9
CM400083
FCC1=CC(F)=CC(Br)=C1Br
1,2-DIBROMO-5-FLUORO-3-(TRIFLUOROMETHYL)BENZENE
CAS:1027511-90-5
CM369178
FC1=CC(Br)=C(Br)C(=C1)C(F)(F)F
1,2-DIBROMOACENAPHTHYLENE
CAS:13019-33-5
CM230015
BrC1=C(Br)C2=CC=CC3=C2C1=CC=C3
1,2-DIBROMOBUTANE
CAS:533-98-2
CM377718
CCC(Br)CBr
1,2-DIBROMOCYCLOHEX-1-ENE
CAS:49676-92-8
CM384825
BrC1=C(Br)CCCC1
1,2-DIBROMOCYCLOHEXANE
CAS:5401-62-7
CM202497
BrC1CCCCC1Br
1,2-DIBROMOCYCLOPROPANE
CAS:19533-50-7
CM546206
BrC1CC1Br
1,2-DIBUTYL BENZENE-1,2-DICARBOXYLATE
CAS:84-74-2
CM395077
CCCCOC(=O)C1=CC=CC=C1C(=O)OCCCC
1,2-DICHLORO-1,1,2,2-TETRAMETHYLDISILANE
CAS:4342-61-4
CM393174
C[Si](C)(Cl)[Si](C)(C)Cl
1,2-DICHLORO-1,1,3,3,3-PENTAFLUOROPROPANE
CAS:141563-84-0
CM380515
FC(F)(F)C(Cl)C(F)(F)Cl
1,2-DICHLORO-1,2-DIFLUOROETHANE
CAS:431-06-1
CM378145
FC(Cl)C(F)Cl
1,2-DICHLORO-1,2-DIFLUOROETHENE
CAS:598-88-9
CM377555
FC(Cl)=C(F)Cl
1,2-DICHLORO-1,3,3,3-TETRAFLUOROPROP-1-ENE
CAS:431-53-8
CM378135
FC(Cl)=C(Cl)C(F)(F)F
1,2-DICHLORO-1-FLUOROETHANE
CAS:430-57-9
CM378150
FC(Cl)CCl
1,2-DICHLORO-1-FLUOROETHENE
CAS:430-58-0
CM378149
FC(Cl)=CCl
1,2-DICHLORO-2-FLUOROPROPANE
CAS:420-97-3
CM378203
CC(F)(Cl)CCl
1,2-DICHLORO-3,3,3-TRIFLUOROPROP-1-ENE
CAS:431-27-6
CM378141
FC(F)(F)C(Cl)=CCl
1,2-DICHLORO-3,4,5-TRIFLUORO-6-(FLUOROMETHOXY)BENZENE
CAS:1803784-63-5
CM400123
FCOC1=C(F)C(F)=C(F)C(Cl)=C1Cl
1,2-DICHLORO-3,4,5-TRIFLUORO-6-(FLUOROMETHYL)BENZENE
CAS:1807089-82-2
CM400059
FCC1=C(F)C(F)=C(F)C(Cl)=C1Cl
1,2-DICHLORO-3,4,5-TRIFLUORO-6-(TRIFLUOROMETHOXY)BENZENE
CAS:1803782-94-6
CM402909
FC1=C(F)C(Cl)=C(Cl)C(OC(F)(F)F)=C1F
1,2-DICHLORO-3,4,5-TRIFLUORO-6-[(TRIFLUOROMETHYL)SULFANYL]BENZENE
CAS:1806301-37-0
CM402910
FC1=C(F)C(Cl)=C(Cl)C(SC(F)(F)F)=C1F
1,2-DICHLORO-3,4,5-TRIFLUORO-6-NITROBENZENE
CAS:1806356-85-3
CM403409
[O-][N+](=O)C1=C(F)C(F)=C(F)C(Cl)=C1Cl
1,2-DICHLORO-3,4,6-TRIFLUORO-5-(FLUOROMETHOXY)BENZENE
CAS:1805479-09-7
CM400118
FCOC1=C(F)C(Cl)=C(Cl)C(F)=C1F
1,2-DICHLORO-3,4,6-TRIFLUORO-5-(FLUOROMETHYL)BENZENE
CAS:1803854-52-5
CM400055
FCC1=C(F)C(Cl)=C(Cl)C(F)=C1F
1,2-DICHLORO-3,4,6-TRIFLUORO-5-(TRIFLUOROMETHOXY)BENZENE
CAS:1803802-67-6
CM402913
FC1=C(F)C(OC(F)(F)F)=C(F)C(Cl)=C1Cl
1,2-DICHLORO-3,4,6-TRIFLUORO-5-[(TRIFLUOROMETHYL)SULFANYL]BENZENE
CAS:1806277-61-1
CM402914
FC1=C(F)C(SC(F)(F)F)=C(F)C(Cl)=C1Cl
1,2-DICHLORO-3,4,6-TRIFLUORO-5-NITROBENZENE
CAS:1804517-63-2
CM403408
[O-][N+](=O)C1=C(F)C(Cl)=C(Cl)C(F)=C1F
1,2-DICHLORO-3-(2-ISOCYANATOETHYL)BENZENE
CAS:73075-66-8
CM409193
ClC1=C(Cl)C(CCN=C=O)=CC=C1
1,2-DICHLORO-3-(2-NITROETHENYL)BENZENE
CAS:154455-57-9
CM469331
[O-][N+](=O)C=CC1=CC=CC(Cl)=C1Cl
1,2-DICHLORO-3-(3-CHLOROPROP-1-YN-1-YL)BENZENE
CAS:1184162-02-4
CM469621
ClCC#CC1=CC=CC(Cl)=C1Cl
1,2-DICHLORO-3-(CHLOROMETHYL)BENZENE
CAS:3290-01-5
CM395560
ClCC1=C(Cl)C(Cl)=CC=C1
1,2-DICHLORO-3-(DIFLUOROMETHOXY)-4-(FLUOROMETHOXY)BENZENE
CAS:1803806-52-1
CM403021
FCOC1=C(OC(F)F)C(Cl)=C(Cl)C=C1
1,2-DICHLORO-3-(DIFLUOROMETHOXY)-4-[(TRIFLUOROMETHYL)SULFANYL]BENZENE
CAS:1807052-59-0
CM402777
FC(F)OC1=C(SC(F)(F)F)C=CC(Cl)=C1Cl
1,2-DICHLORO-3-(DIFLUOROMETHOXY)-4-ETHOXYBENZENE
CAS:1804884-04-5
CM402093
CCOC1=C(OC(F)F)C(Cl)=C(Cl)C=C1
1,2-DICHLORO-3-(DIFLUOROMETHOXY)-4-ETHYLBENZENE
CAS:1803714-36-4
CM401962
CCC1=C(OC(F)F)C(Cl)=C(Cl)C=C1
1,2-DICHLORO-3-(DIFLUOROMETHOXY)-5-(FLUOROMETHOXY)BENZENE
CAS:1803818-33-8
CM403027
FCOC1=CC(Cl)=C(Cl)C(OC(F)F)=C1
1,2-DICHLORO-3-(DIFLUOROMETHOXY)-5-[(TRIFLUOROMETHYL)SULFANYL]BENZENE
CAS:1807179-07-2
CM402834
FC(F)OC1=CC(SC(F)(F)F)=CC(Cl)=C1Cl
1,2-DICHLORO-3-(DIFLUOROMETHOXY)-5-ETHOXYBENZENE
CAS:1804516-46-8
CM402131
CCOC1=CC(Cl)=C(Cl)C(OC(F)F)=C1
1,2-DICHLORO-3-(DIFLUOROMETHOXY)-5-ETHYLBENZENE
CAS:1803831-84-6
CM401995
CCC1=CC(Cl)=C(Cl)C(OC(F)F)=C1
1,2-DICHLORO-3-(FLUOROMETHOXY)-4-NITROBENZENE
CAS:1806276-31-2
CM403429
[O-][N+](=O)C1=C(OCF)C(Cl)=C(Cl)C=C1
1,2-DICHLORO-3-(FLUOROMETHOXY)-5-NITROBENZENE
CAS:1804886-70-1
CM403455
[O-][N+](=O)C1=CC(Cl)=C(Cl)C(OCF)=C1
1,2-DICHLORO-3-(FLUOROMETHYL)-4-NITROBENZENE
CAS:1806350-16-2
CM403389
[O-][N+](=O)C1=C(CF)C(Cl)=C(Cl)C=C1
1,2-DICHLORO-3-(FLUOROMETHYL)-5-NITROBENZENE
CAS:1803728-11-1
CM403454
[O-][N+](=O)C1=CC(Cl)=C(Cl)C(CF)=C1
1,2-DICHLORO-3-[4-(CHLOROMETHYL)PHENOXY]BENZENE
CAS:1038975-97-1
CM475202
ClCC1=CC=C(OC2=CC=CC(Cl)=C2Cl)C=C1
1,2-DICHLORO-3-ETHOXY-4-FLUOROBENZENE
CAS:1804885-68-4
CM399432
CCOC1=C(F)C=CC(Cl)=C1Cl
1,2-DICHLORO-3-ETHOXY-4-NITROBENZENE
CAS:1027942-43-3
CM403628
CCOC1=C(C=CC(Cl)=C1Cl)[N+]([O-])=O
1,2-DICHLORO-3-ETHOXY-5-FLUOROBENZENE
CAS:1804885-63-9
CM399516
CCOC1=CC(F)=CC(Cl)=C1Cl
1,2-DICHLORO-3-ETHOXY-5-NITROBENZENE
CAS:1803718-23-1
CM403648
CCOC1=CC(=CC(Cl)=C1Cl)[N+]([O-])=O
1,2-DICHLORO-3-ETHYL-4,5,6-TRIFLUOROBENZENE
CAS:1807039-47-9
CM399181
CCC1=C(F)C(F)=C(F)C(Cl)=C1Cl
1,2-DICHLORO-3-ETHYL-5-NITROBENZENE
CAS:1806354-43-7
CM403607
CCC1=CC(=CC(Cl)=C1Cl)[N+]([O-])=O
1,2-DICHLORO-3-FLUORO-4-(FLUOROMETHOXY)BENZENE
CAS:1806302-71-5
CM400119
FCOC1=C(F)C(Cl)=C(Cl)C=C1
1,2-DICHLORO-3-FLUORO-4-(FLUOROMETHYL)BENZENE
CAS:1804886-48-3
CM400056
FCC1=C(F)C(Cl)=C(Cl)C=C1
1,2-DICHLORO-3-FLUORO-4-(TRIFLUOROMETHOXY)BENZENE
CAS:1805479-92-8
CM402933
FC1=C(OC(F)(F)F)C=CC(Cl)=C1Cl
1,2-DICHLORO-3-FLUORO-4-[(TRIFLUOROMETHYL)SULFANYL]BENZENE
CAS:1806302-57-7
CM402945
FC1=C(SC(F)(F)F)C=CC(Cl)=C1Cl
1,2-DICHLORO-3-FLUORO-4-IODOBENZENE
CAS:1188535-58-1
CM555992
IC1=CC=C(Cl)C(Cl)=C1F
1,2-DICHLORO-3-FLUORO-4-NITROBENZENE
CAS:100465-04-1
CM546364
[O-][N+](=O)C1=C(F)C(Cl)=C(Cl)C=C1
1,2-DICHLORO-3-FLUORO-5-(FLUOROMETHOXY)BENZENE
CAS:1803807-10-4
CM400146
FCOC1=CC(Cl)=C(Cl)C(F)=C1
1,2-DICHLORO-3-FLUORO-5-(FLUOROMETHYL)BENZENE
CAS:1803765-91-4
CM400071
FCC1=CC(Cl)=C(Cl)C(F)=C1
1,2-DICHLORO-3-ISOCYANATOBENZENE
CAS:41195-90-8
CM395537
ClC1=CC=CC(N=C=O)=C1Cl
1,2-DICHLORO-3-ISOTHIOCYANATOBENZENE
CAS:6590-97-2
CM377294
ClC1=C(Cl)C(=CC=C1)N=C=S
1,2-DICHLORO-3-METHYL-4-(TRIFLUOROMETHYL)BENZENE
CAS:115571-59-0
CM308989
FC(C1=CC=C(Cl)C(Cl)=C1C)(F)F
1,2-DICHLORO-3-METHYL-5-NITROBENZENE
CAS:51719-46-1
CM466527
CC1=CC(=CC(Cl)=C1Cl)[N+]([O-])=O
1,2-DICHLORO-3-NITRO-4-[(TRIFLUOROMETHYL)SULFANYL]BENZENE
CAS:1803848-28-3
CM403760
[O-][N+](=O)C1=C(SC(F)(F)F)C=CC(Cl)=C1Cl
1,2-DICHLORO-3-NITRO-5-[(TRIFLUOROMETHYL)SULFANYL]BENZENE
CAS:1807082-90-1
CM403810
[O-][N+](=O)C1=CC(SC(F)(F)F)=CC(Cl)=C1Cl
1,2-DICHLORO-3-NITRONAPHTHALENE
CAS:6240-55-7
CM237996
O=[N+](C1=C(Cl)C(Cl)=C2C=CC=CC2=C1)[O-]
1,2-DICHLORO-4,5-DINITROBENZENE
CAS:6306-39-4
CM472592
[O-][N+](=O)C1=CC(Cl)=C(Cl)C=C1[N+]([O-])=O
1,2-DICHLORO-4-(1-CHLOROETHYL)BENZENE
CAS:54965-01-4
CM467818
CC(Cl)C1=CC(Cl)=C(Cl)C=C1
1,2-DICHLORO-4-(2-NITROVINYL)BENZENE
CAS:18984-16-2
CM278381
O=[N+](/C=C/C1=CC=C(Cl)C(Cl)=C1)[O-]
1,2-DICHLORO-4-(4-IODOPHENOXY)-BENZENE
CAS:167990-11-6
CM477623
ClC1=C(Cl)C=C(OC2=CC=C(I)C=C2)C=C1
1,2-DICHLORO-4-(CHLOROMETHOXY)BENZENE
CAS:94637-84-0
CM409718
ClCOC1=CC(Cl)=C(Cl)C=C1
1,2-DICHLORO-4-(DIFLUOROMETHOXY)-3-(FLUOROMETHOXY)BENZENE
CAS:1804884-35-2
CM403023
FCOC1=C(OC(F)F)C=CC(Cl)=C1Cl
1,2-DICHLORO-4-(DIFLUOROMETHOXY)-3-[(TRIFLUOROMETHYL)SULFANYL]BENZENE
CAS:1805126-61-7
CM402770
FC(F)OC1=C(SC(F)(F)F)C(Cl)=C(Cl)C=C1
1,2-DICHLORO-4-(DIFLUOROMETHOXY)-5-(FLUOROMETHOXY)BENZENE
CAS:1803790-85-3
CM403028
FCOC1=CC(Cl)=C(Cl)C=C1OC(F)F
1,2-DICHLORO-4-(DIFLUOROMETHOXY)-5-[(TRIFLUOROMETHYL)SULFANYL]BENZENE
CAS:1806329-12-3
CM402803
FC(F)OC1=CC(Cl)=C(Cl)C=C1SC(F)(F)F
1,2-DICHLORO-4-(DIFLUOROMETHOXY)-5-IODOBENZENE
CAS:1803714-66-0
CM402802
FC(F)OC1=CC(Cl)=C(Cl)C=C1I
1,2-DICHLORO-4-(FLUOROMETHOXY)-3-NITROBENZENE
CAS:1803784-51-1
CM403431
[O-][N+](=O)C1=C(OCF)C=CC(Cl)=C1Cl
1,2-DICHLORO-4-(FLUOROMETHOXY)-5-NITROBENZENE
CAS:1803827-26-0
CM403456
[O-][N+](=O)C1=CC(Cl)=C(Cl)C=C1OCF
1,2-DICHLORO-4-(FLUOROMETHYL)-3-NITROBENZENE
CAS:1804886-80-3
CM403393
[O-][N+](=O)C1=C(CF)C=CC(Cl)=C1Cl
1,2-DICHLORO-4-(ISOTHIOCYANATOMETHYL)BENZENE
CAS:18967-42-5
CM397237
ClC1=C(Cl)C=C(CN=C=S)C=C1
1,2-DICHLORO-4-(TRICHLOROMETHYL)BENZENE
CAS:13014-24-9
CM373165
ClC1=C(Cl)C=C(C=C1)C(Cl)(Cl)Cl
1,2-DICHLORO-4-(TRIFLUOROMETHOXY)BENZENE
CAS:151276-10-7
CM328872
FC(F)(F)OC1=CC=C(Cl)C(Cl)=C1
1,2-DICHLORO-4-ETHOXY-3,5,6-TRIFLUOROBENZENE
CAS:1804885-86-6
CM399424
CCOC1=C(F)C(Cl)=C(Cl)C(F)=C1F
1,2-DICHLORO-4-ETHOXY-3-FLUOROBENZENE
CAS:1803718-22-0
CM399425
CCOC1=C(F)C(Cl)=C(Cl)C=C1
1,2-DICHLORO-4-ETHOXY-3-NITROBENZENE
CAS:1803783-68-7
CM403618
CCOC1=C(C(Cl)=C(Cl)C=C1)[N+]([O-])=O
1,2-DICHLORO-4-ETHYL-3,5,6-TRIFLUOROBENZENE
CAS:1806349-35-8
CM399179
CCC1=C(F)C(Cl)=C(Cl)C(F)=C1F
1,2-DICHLORO-4-ETHYL-5-FLUOROBENZENE
CAS:1803783-90-5
CM399252
CCC1=CC(Cl)=C(Cl)C=C1F
1,2-DICHLORO-4-ETHYNYLBENZENE
CAS:556112-20-0
CM373164
ClC1=C(Cl)C=C(C=C1)C#C
1,2-DICHLORO-4-FLUORO-3-(FLUOROMETHOXY)BENZENE
CAS:1806346-29-1
CM400126
FCOC1=C(F)C=CC(Cl)=C1Cl
1,2-DICHLORO-4-FLUORO-3-(FLUOROMETHYL)BENZENE
CAS:1803787-45-2
CM400061
FCC1=C(F)C=CC(Cl)=C1Cl
1,2-DICHLORO-4-FLUORO-3-[(TRIFLUOROMETHYL)SULFANYL]BENZENE
CAS:1805479-97-3
CM402936
FC1=C(SC(F)(F)F)C(Cl)=C(Cl)C=C1
1,2-DICHLORO-4-FLUORO-3-NITROBENZENE
CAS:1360438-72-7
CM249037
O=[N+](C1=C(Cl)C(Cl)=CC=C1F)[O-]
1,2-DICHLORO-4-FLUORO-5-(FLUOROMETHOXY)BENZENE
CAS:1803725-22-5
CM400147
FCOC1=CC(Cl)=C(Cl)C=C1F
1,2-DICHLORO-4-FLUORO-5-(FLUOROMETHYL)BENZENE
CAS:1803826-84-7
CM400072
FCC1=CC(Cl)=C(Cl)C=C1F
1,2-DICHLORO-4-METHOXY-3-NITROBENZENE
CAS:1806275-40-0
CM537057
O=[N+](C1=C(Cl)C(Cl)=CC=C1OC)[O-]
1,2-DICHLORO-4-METHYL-5-(TRIFLUOROMETHYL)BENZENE
CAS:74483-51-5
CM369349
CC1=CC(Cl)=C(Cl)C=C1C(F)(F)F
1,2-DICHLORO-4-METHYL-5-NITROBENZENE
CAS:7494-45-3
CM244311
CC1=CC(Cl)=C(Cl)C=C1[N+]([O-])=O
1,2-DICHLORO-4-NITRO-3-(TRIFLUOROMETHOXY)BENZENE
CAS:1803847-83-7
CM403743
[O-][N+](=O)C1=C(OC(F)(F)F)C(Cl)=C(Cl)C=C1
1,2-DICHLORO-4-NITRO-3-[(TRIFLUOROMETHYL)SULFANYL]BENZENE
CAS:1803830-96-7
CM403754
[O-][N+](=O)C1=C(SC(F)(F)F)C(Cl)=C(Cl)C=C1
1,2-DICHLORO-4-NITRO-5-[(TRIFLUOROMETHYL)SULFANYL]BENZENE
CAS:1803782-63-9
CM403776
[O-][N+](=O)C1=CC(Cl)=C(Cl)C=C1SC(F)(F)F
1,2-DICHLORO-4-PHENOXYBENZENE
CAS:55538-69-7
CM370258
ClC1=C(Cl)C=C(OC2=CC=CC=C2)C=C1
1,2-DICHLORO-4-VINYLBENZENE
CAS:2039-83-0
CM128013
C=CC1=CC=C(Cl)C(Cl)=C1
1,2-DICHLORO-5-(DIFLUOROMETHOXY)-3-(FLUOROMETHOXY)BENZENE
CAS:1804516-68-4
CM403043
FCOC1=CC(OC(F)F)=CC(Cl)=C1Cl
1,2-DICHLORO-5-(DIFLUOROMETHOXY)-3-[(TRIFLUOROMETHYL)SULFANYL]BENZENE
CAS:1807038-67-0
CM402801
FC(F)OC1=CC(Cl)=C(Cl)C(SC(F)(F)F)=C1
1,2-DICHLORO-5-(DIFLUOROMETHOXY)-3-ETHOXYBENZENE
CAS:1803790-35-3
CM402148
CCOC1=CC(OC(F)F)=CC(Cl)=C1Cl
1,2-DICHLORO-5-(DIFLUOROMETHOXY)-3-IODOBENZENE
CAS:1806328-67-5
CM402800
FC(F)OC1=CC(Cl)=C(Cl)C(I)=C1
1,2-DICHLORO-5-(FLUOROMETHOXY)-3-NITROBENZENE
CAS:1805478-92-5
CM403487
[O-][N+](=O)C1=CC(OCF)=CC(Cl)=C1Cl
1,2-DICHLORO-5-(FLUOROMETHYL)-3-NITROBENZENE
CAS:1803784-68-0
CM403448
[O-][N+](=O)C1=CC(CF)=CC(Cl)=C1Cl
1,2-DICHLORO-5-ETHOXY-3-NITROBENZENE
CAS:1803819-73-9
CM403652
CCOC1=CC(Cl)=C(Cl)C(=C1)[N+]([O-])=O
1,2-DICHLORO-5-ETHYL-3-FLUOROBENZENE
CAS:1803834-55-0
CM399251
CCC1=CC(Cl)=C(Cl)C(F)=C1
1,2-DICHLORO-5-ETHYL-3-NITROBENZENE
CAS:1803806-93-0
CM403612
CCC1=CC(Cl)=C(Cl)C(=C1)[N+]([O-])=O
1,2-DICHLORO-5-FLUORO-3-(FLUOROMETHOXY)BENZENE
CAS:1803725-29-2
CM400158
FCOC1=CC(F)=CC(Cl)=C1Cl
1,2-DICHLORO-5-FLUORO-3-(FLUOROMETHYL)BENZENE
CAS:1803826-92-7
CM400084
FCC1=CC(F)=CC(Cl)=C1Cl
1,2-DICHLORO-5-METHYL-3-(TRIFLUOROMETHYL)BENZENE
CAS:80245-33-6
CM373001
CC1=CC(Cl)=C(Cl)C(=C1)C(F)(F)F
1,2-DICHLORO-5-NITRO-3-(TRIFLUOROMETHYL)BENZENE
CAS:400-65-7
CM252758
FC(C1=C(Cl)C(Cl)=CC([N+]([O-])=O)=C1)(F)F
1,2-DICHLORO-5-NITRO-3-[(TRIFLUOROMETHYL)SULFANYL]BENZENE
CAS:1806290-35-6
CM403775
[O-][N+](=O)C1=CC(Cl)=C(Cl)C(SC(F)(F)F)=C1
1,2-DICHLOROBUTANE
CAS:616-21-7
CM394247
CCC(Cl)CCl
1,2-DICHLOROETHYL ACETATE
CAS:10140-87-1
CM546981
CC(=O)OC(Cl)CCl
1,2-DICHLORONAPHTHALENE
CAS:2050-69-3
CM233109
ClC1=CC=C2C=CC=CC2=C1Cl
1,2-DICYCLOHEXYLDISULFANE
CAS:2550-40-5
CM303371
C1(SSC2CCCCC2)CCCCC1
1,2-DICYCLOPROPYLETHAN-1-ONE
CAS:14113-96-3
CM534064
O=C(CC1CC1)C1CC1
1,2-DIDECYLDISULFANE
CAS:10496-18-1
CM247511
CCCCCCCCCCSSCCCCCCCCCC
1,2-DIETHENYLBENZENE
CAS:1321-74-0
CM393244
C=CC1=CC=CC=C1C=C
1,2-DIETHOXY-1,1,2,2-TETRAMETHYLDISILANE
CAS:18419-84-6
CM212416
CCO[Si](C)(C)[Si](C)(C)OCC
1,2-DIETHOXY-1,2,3,4-TETRAHYDRONAPHTHALENE
CAS:338737-08-9
CM232900
CCOC1C(OCC)C2=C(C=CC=C2)CC1
1,2-DIETHYL (1R,2S)-CYCLOHEXANE-1,2-DICARBOXYLATE
CAS:17351-07-4
CM395221
CCOC(=O)[C@H]1CCCC[C@H]1C(=O)OCC
1,2-DIETHYL (1S,2R)-3,3-DIETHOXYCYCLOBUTANE-1,2-DICARBOXYLATE
CAS:127696-10-0
CM389906
CCOC(=O)[C@@H]1[C@@H](C(=O)OCC)C(OCC)(OCC)C1
1,2-DIETHYL 1,2,3,6-TETRAHYDROPYRIDAZINE-1,2-DICARBOXYLATE
CAS:35691-30-6
CM383118
CCOC(=O)N1CC=CCN1C(=O)OCC
1,2-DIETHYL CYCLOPENT-1-ENE-1,2-DICARBOXYLATE
CAS:70202-92-5
CM468360
CCOC(=O)C1=C(CCC1)C(=O)OCC
1,2-DIETHYL-1H-1,3-BENZODIAZOL-5-AMINE
CAS:879038-05-8
CM376448
CCN1C(CC)=NC2=C1C=CC(N)=C2
1,2-DIETHYL-4-IMINO-1,4-DIHYDROQUINOLINE-3-CARBOXYLIC ACID
CAS:922499-37-4
CM257074
O=C(C1=C(CC)N(CC)C2=C(C=CC=C2)C1=N)O
1,2-DIETHYL-4-OXO-1,4-DIHYDROQUINOLINE-3-CARBOXYLIC ACID
CAS:922499-41-0
CM257153
O=C(C1=C(CC)N(CC)C2=C(C=CC=C2)C1=O)O
1,2-DIETHYLHYDRAZINE DIHYDROCHLORIDE
CAS:7699-31-2
CM397225
Cl.Cl.CCNNCC
1,2-DIFLUORO-3-(FLUOROMETHOXY)-4-NITROBENZENE
CAS:1806357-48-1
CM403430
[O-][N+](=O)C1=C(OCF)C(F)=C(F)C=C1
1,2-DIFLUORO-3-(FLUOROMETHOXY)-5-NITROBENZENE
CAS:1804885-07-1
CM403469
[O-][N+](=O)C1=CC(F)=C(F)C(OCF)=C1
1,2-DIFLUORO-3-(FLUOROMETHYL)-4-NITROBENZENE
CAS:1806367-89-4
CM403391
[O-][N+](=O)C1=C(CF)C(F)=C(F)C=C1
1,2-DIFLUORO-3-(FLUOROMETHYL)-5-NITROBENZENE
CAS:1807084-65-6
CM403468
[O-][N+](=O)C1=CC(F)=C(F)C(CF)=C1
1,2-DIFLUORO-3-(HEXYLOXY)BENZENE
CAS:121219-19-0
CM182780
CCCCCCOC1=C(F)C(F)=CC=C1
1,2-DIFLUORO-3-(PROPAN-2-YLOXY)BENZENE
CAS:1174005-86-7
CM368035
CC(C)OC1=CC=CC(F)=C1F
1,2-DIFLUORO-3-(TRICHLOROMETHOXY)BENZENE
CAS:158178-39-3
CM368733
FC1=C(F)C(OC(Cl)(Cl)Cl)=CC=C1
1,2-DIFLUORO-3-IODO-4-METHOXYBENZENE
CAS:936498-08-7
CM315651
COC1=CC=C(F)C(F)=C1I
1,2-DIFLUORO-3-METHOXY-4-NITROBENZENE
CAS:66684-60-4
CM254425
O=[N+](C1=CC=C(F)C(F)=C1OC)[O-]
1,2-DIFLUORO-3-METHYL-5-NITROBENZENE
CAS:1805056-06-7
CM368082
CC1=CC(=CC(F)=C1F)[N+]([O-])=O
1,2-DIFLUORO-3-NITRO-4-(TRIFLUOROMETHOXY)BENZENE
CAS:1806388-53-3
CM403748
[O-][N+](=O)C1=C(OC(F)(F)F)C=CC(F)=C1F
1,2-DIFLUORO-3-NITRO-4-[(TRIFLUOROMETHYL)SULFANYL]BENZENE
CAS:1803789-45-8
CM403761
[O-][N+](=O)C1=C(SC(F)(F)F)C=CC(F)=C1F
1,2-DIFLUORO-3-NITRO-5-(TRIFLUOROMETHOXY)BENZENE
CAS:1805056-17-0
CM403799
[O-][N+](=O)C1=CC(OC(F)(F)F)=CC(F)=C1F
1,2-DIFLUORO-3-NITRO-5-[(TRIFLUOROMETHYL)SULFANYL]BENZENE
CAS:1806371-27-6
CM403811
[O-][N+](=O)C1=CC(SC(F)(F)F)=CC(F)=C1F
1,2-DIFLUORO-3-PROPOXYBENZENE
CAS:124728-93-4
CM368209
CCCOC1=CC=CC(F)=C1F
1,2-DIFLUORO-4,5-DIIODOBENZENE
CAS:210567-10-5
CM251300
IC1=C(I)C=C(F)C(F)=C1
1,2-DIFLUORO-4,5-DINITROBENZENE
CAS:85686-97-1
CM336270
O=[N+](C1=C([N+]([O-])=O)C=C(F)C(F)=C1)[O-]
1,2-DIFLUORO-4-(2,2,2-TRIFLUOROETHYL)BENZENE
CAS:1092350-16-7
CM551996
FC1=C(F)C=C(CC(F)(F)F)C=C1
1,2-DIFLUORO-4-(FLUOROMETHOXY)-3-NITROBENZENE
CAS:1803790-96-6
CM403432
[O-][N+](=O)C1=C(OCF)C=CC(F)=C1F
1,2-DIFLUORO-4-(FLUOROMETHOXY)-5-NITROBENZENE
CAS:1804413-65-7
CM403471
[O-][N+](=O)C1=CC(F)=C(F)C=C1OCF
1,2-DIFLUORO-4-(FLUOROMETHYL)-3-NITROBENZENE
CAS:1803791-35-6
CM403394
[O-][N+](=O)C1=C(CF)C=CC(F)=C1F
1,2-DIFLUORO-4-(FLUOROMETHYL)-5-NITROBENZENE
CAS:1803836-15-8
CM403470
[O-][N+](=O)C1=CC(F)=C(F)C=C1CF
1,2-DIFLUORO-4-[2-(4-PROPYLPHENYL)ETHYNYL]BENZENE
CAS:145698-43-7
CM374005
CCCC1=CC=C(C=C1)C#CC1=CC(F)=C(F)C=C1
1,2-DIFLUORO-4-{[(3-FLUOROPHENYL)METHYL]SULFANYL}BENZENE
CAS:1443353-14-7
CM380081
FC1=CC=CC(CSC2=CC(F)=C(F)C=C2)=C1
1,2-DIFLUORO-4-{[(3-FLUOROPHENYL)SULFANYL]METHYL}BENZENE
CAS:1443336-92-2
CM380208
FC1=CC=CC(SCC2=CC(F)=C(F)C=C2)=C1
1,2-DIFLUORO-4-ISOCYANATOBENZENE
CAS:42601-04-7
CM396123
FC1=C(F)C=C(C=C1)N=C=O
1,2-DIFLUORO-4-ISOTHIOCYANATOBENZENE
CAS:113028-75-4
CM396124
FC1=C(F)C=C(C=C1)N=C=S
1,2-DIFLUORO-4-METHANESULFONYLBENZENE
CAS:424792-57-4
CM373324
CS(=O)(=O)C1=CC(F)=C(F)C=C1
1,2-DIFLUORO-4-METHOXYBENZENE
CAS:115144-40-6
CM327931
COC1=CC=C(F)C(F)=C1
1,2-DIFLUORO-4-METHYL-3-NITROBENZENE
CAS:1422193-81-4
CM368048
CC1=C(C(F)=C(F)C=C1)[N+]([O-])=O
1,2-DIFLUORO-4-METHYL-5-(TRIFLUOROMETHYL)BENZENE
CAS:1263376-06-2
CM381418
CC1=CC(F)=C(F)C=C1C(F)(F)F
1,2-DIFLUORO-4-NITRO-3-[(TRIFLUOROMETHYL)SULFANYL]BENZENE
CAS:1806304-52-8
CM403755
[O-][N+](=O)C1=C(SC(F)(F)F)C(F)=C(F)C=C1
1,2-DIFLUORO-4-NITRO-5-(TRIFLUOROMETHOXY)BENZENE
CAS:1803809-72-4
CM403788
[O-][N+](=O)C1=CC(F)=C(F)C=C1OC(F)(F)F
1,2-DIFLUORO-4-NITRO-5-[(TRIFLUOROMETHYL)SULFANYL]BENZENE
CAS:1806388-73-7
CM403790
[O-][N+](=O)C1=CC(F)=C(F)C=C1SC(F)(F)F
1,2-DIFLUORO-4-NITROBENZENE
CAS:369-34-6
CM102480
O=[N+](C1=CC=C(F)C(F)=C1)[O-]
1,2-DIFLUORO-4-VINYLBENZENE
CAS:405-03-8
CM276266
C=CC1=CC=C(F)C(F)=C1
1,2-DIFLUORO-5-(FLUOROMETHOXY)-3-NITROBENZENE
CAS:1803729-06-7
CM403488
[O-][N+](=O)C1=CC(OCF)=CC(F)=C1F
1,2-DIFLUORO-5-(FLUOROMETHYL)-3-NITROBENZENE
CAS:1806306-07-9
CM403449
[O-][N+](=O)C1=CC(CF)=CC(F)=C1F
1,2-DIFLUORO-5-NITRO-3-(TRIFLUOROMETHOXY)BENZENE
CAS:1803871-20-6
CM403785
[O-][N+](=O)C1=CC(F)=C(F)C(OC(F)(F)F)=C1
1,2-DIFLUORO-5-NITRO-3-[(TRIFLUOROMETHYL)SULFANYL]BENZENE
CAS:1807176-29-9
CM403787
[O-][N+](=O)C1=CC(F)=C(F)C(SC(F)(F)F)=C1
1,2-DIFLUOROETHANE
CAS:624-72-6
CM377495
FCCF
1,2-DIFLUORONAPHTHALENE
CAS:317-80-6
CM234977
FC1=CC=C2C=CC=CC2=C1F
1,2-DIHYDRO-1'-METHYLSPIRO-[3H-INDOLE-3,4'-PIPERIDINE]
CAS:69584-91-4
CM138937
CN1CCC3(CC1)C2=CC=CC=C2NC3
1,2-DIHYDRO-1,3-DIAZATRIPHENYLEN-2-ONE
CAS:1637465-83-8
CM210851
O=C1NC2=C(C3=CC=CC=C3C4=CC=CC=C42)C=N1
1,2-DIHYDRO-1,5-NAPHTHYRIDIN-2-ONE
CAS:10261-82-2
CM140764
O=C1NC2=CC=CN=C2C=C1
1,2-DIHYDRO-1,6-NAPHTHYRIDIN-2-ONE
CAS:23616-29-7
CM141234
O=C1NC2=C(C=NC=C2)C=C1
1,2-DIHYDRO-1,7-NAPHTHYRIDIN-2-ONE
CAS:54920-82-0
CM140273
O=C1NC2=CN=CC=C2C=C1
1,2-DIHYDRO-1,8-NAPHTHYRIDIN-2-ONE
CAS:15936-09-1
CM107200
O=C1NC2=NC=CC=C2C=C1
1,2-DIHYDRO-1-OXO-PYRROLO[1,2-A]PYRAZINE-3-CARBOXYLIC ACID METHYL ESTER
CAS:119756-20-6
CM465456
COC(=O)C1=CN2C=CC=C2C(=O)N1
1,2-DIHYDRO-2,5-(DIPHENYL)-3H-1,2,4-TRIAZOL-3-ONE
CAS:118946-49-9
CM312640
O=C1N(C2=CC=CC=C2)NC(C3=CC=CC=C3)=N1
1,2-DIHYDRO-2,6-NAPHTHYRIDIN-3(4H)-ONE
CAS:37125-44-3
CM238336
O=C1NCC2=C(C=NC=C2)C1
1,2-DIHYDRO-2,7-NAPHTHYRIDIN-1-ONE
CAS:67988-50-5
CM104545
O=C1NC=CC2=C1C=NC=C2
1,2-DIHYDRO-2,7-NAPHTHYRIDIN-3(4H)-ONE
CAS:1123169-61-8
CM238339
O=C1NCC2=CN=CC=C2C1
1,2-DIHYDRO-2-(4-METHYLPHENYL)-5-PHENYL-3H-1,2,4-TRIAZOL-3-ONE
CAS:118946-50-2
CM316208
O=C1N(C2=CC=C(C)C=C2)NC(C3=CC=CC=C3)=N1
1,2-DIHYDRO-3H-PYRAZOL-3-ONE
CAS:137-45-1
CM120445
O=C1NNC=C1
1,2-DIHYDRO-3H-PYRAZOLO[3,4-B]PYRIDIN-3-ONE
CAS:2942-43-0
CM122775
O=C1NNC2=C1C=CC=N2
1,2-DIHYDRO-3H-PYRAZOLO[4,3-B]PYRIDIN-3-ONE
CAS:51617-92-6
CM132317
O=C1NNC2=C1N=CC=C2
1,2-DIHYDRO-4-HYDROXY-2-OXO-1,8-NAPHTHYRIDINE-3-CARBOXYLIC ACID
CAS:153457-37-5
CM463663
OC(=O)C1=C(O)C2=C(NC1=O)N=CC=C2
1,2-DIHYDRO-NAPHTHALENE-3-BORONIC ACID
CAS:521917-51-1
CM134500
OB(C1=CC2=C(C=CC=C2)CC1)O
1,2-DIHYDROACENAPHTHYLEN-1-OL
CAS:6306-07-6
CM396670
OC1CC2=C3C1=CC=CC3=CC=C2
1,2-DIHYDROACENAPHTHYLEN-1-YL ACETATE
CAS:14966-36-0
CM242919
O=C(OC1CC2=C3C1=CC=CC3=CC=C2)C
1,2-DIHYDROACENAPHTHYLEN-3-AMINE
CAS:55939-13-4
CM236813
NC1=CC=C2C=CC=C3CCC1=C32
1,2-DIHYDROACENAPHTHYLEN-3-AMINE HYDROCHLORIDE
CAS:145040-68-2
CM236814
NC1=CC=C2C=CC=C3CCC1=C32.[H]Cl
1,2-DIHYDROACENAPHTHYLEN-4-AMINE
CAS:4657-97-0
CM236988
NC1=CC2=C3C(CC2)=CC=CC3=C1
1,2-DIHYDROACENAPHTHYLEN-4-OL
CAS:6296-98-6
CM239015
OC1=CC2=C3C(CC2)=CC=CC3=C1
1,2-DIHYDROACENAPHTHYLENE-5,6-DICARBONITRILE
CAS:86528-79-2
CM235511
N#CC1=C2C(C#N)=CC=C3CCC(C=C1)=C32
1,2-DIHYDROACENAPHTHYLENE-5-CARBONITRILE
CAS:71235-81-9
CM235537
N#CC1=C2C=CC=C3CCC(C=C1)=C32
1,2-DIHYDROACENAPHTHYLENE-5-THIOL
CAS:35379-04-5
CM408696
SC1=CC=C2CCC3=C2C1=CC=C3
1,2-DIHYDROBENZO[G]QUINOLINE-3,4,5,10-TETRAONE
CAS:87863-50-1
CM225572
O=C1CNC2=C(C(C3=CC=CC=C3C2=O)=O)C1=O
1,2-DIHYDROCYCLOBUTA[A]NAPHTHALENE
CAS:32277-35-3
CM141441
C12=C3C=CC=CC3=CC=C1CC2
1,2-DIHYDROCYCLOBUTA[B]QUINOLINE
CAS:13353-49-6
CM226642
C12=NC3=CC=CC=C3C=C1CC2
1,2-DIHYDROCYCLOBUTA[B]QUINOLINE-8-CARBOXYLIC ACID
CAS:13848-02-7
CM226643
O=C(C1=C(CC2)C2=NC3=CC=CC=C13)O
1,2-DIHYDROCYCLOBUTA[B]QUINOXALINE
CAS:159850-92-7
CM221593
C12=NC3=CC=CC=C3N=C1CC2
1,2-DIHYDROISOQUINOLINE-4-CARBALDEHYDE
CAS:50624-33-4
CM238536
O=CC1=CNCC2=C1C=CC=C2
1,2-DIHYDRONAPHTHALENE
CAS:447-53-0
CM141143
C12=C(CCC=C2)C=CC=C1
1,2-DIHYDRONAPHTHALENE-1,2-DIONE
CAS:524-42-5
CM140827
O=C1C(C=CC2=C1C=CC=C2)=O
1,2-DIHYDRONAPHTHALENE-1-CARBONYL CHLORIDE
CAS:61836-95-1
CM240841
O=C(Cl)C1CC=CC2=C1C=CC=C2
1,2-DIHYDRONAPHTHO[2,1-B]FURAN-2-CARBOHYDRAZIDE
CAS:400878-27-5
CM246385
O=C(C1CC2=C3C=CC=CC3=CC=C2O1)NN
1,2-DIHYDRONAPHTHO[2,1-B]FURAN-2-CARBOXYLIC ACID
CAS:24758-31-4
CM243100
O=C(C1CC2=C3C=CC=CC3=CC=C2O1)O
1,2-DIHYDROPYRIDAZINE-3,6-DIONE
CAS:123-33-1
CM164496
OC1=NN=C(O)C=C1
1,2-DIHYDROQUINAZOLIN-4-AMINE
CAS:253769-57-2
CM213436
NC1=NCNC2=C1C=CC=C2
1,2-DIHYDROQUINOLIN-3-AMINE
CAS:647026-44-6
CM238298
NC1=CC2=C(NC1)C=CC=C2
1,2-DIHYDROQUINOLIN-8-AMINE
CAS:98952-73-9
CM238297
NC1=CC=CC2=C1NCC=C2
1,2-DIHYDROSPIRO[BENZO[C]AZEPINE-4,4'-PIPERIDIN]-3(5H)-ONE
CAS:1330764-30-1
CM207845
O=C1C2(CCNCC2)CC3=CC=CC=C3CN1
1,2-DIHYDROSPIRO[INDOLE-3,3'-OXOLAN]-2-ONE
CAS:1160487-70-6
CM556340
O=C(C12COCC1)NC3=C2C=CC=C3
1,2-DIHYDROSPIRO[INDOLE-3,3'-PYRROLIDINE]-2-ONE
CAS:6786-41-0
CM108443
O=C1NC2=C(C=CC=C2)C13CNCC3
1,2-DIHYDROSPIRO[INDOLE-3,3'-THIETAN]-2-ONE
CAS:1373029-42-5
CM563421
O=C1NC2=C(C=CC=C2)C13CSC3
1,2-DIHYDROXY-3-METHYL-9,10-DIHYDROANTHRACENE-9,10-DIONE
CAS:602-63-1
CM385600
CC1=CC2=C(C(O)=C1O)C(=O)C1=CC=CC=C1C2=O
1,2-DIHYDROXY-9,10-DIHYDROANTHRACENE-9,10-DIONE
CAS:72-48-0
CM361695
OC(C(O)=CC=C1C(C2=C3C=CC=C2)=O)=C1C3=O
1,2-DIIODO-3,4,5,6-TETRAMETHYLBENZENE
CAS:5503-82-2
CM377677
CC1=C(C)C(I)=C(I)C(C)=C1C
1,2-DIIODO-4,5-BIS(OCTYLOXY)BENZENE
CAS:248277-14-7
CM515625
CCCCCCCCOC1=C(OCCCCCCCC)C=C(I)C(I)=C1
1,2-DIIODO-4-METHYLBENZENE
CAS:1608-47-5
CM334225
CC1=CC=C(I)C(I)=C1
1,2-DIIODOBENZENE
CAS:615-42-9
CM254048
IC1=CC=CC=C1I
1,2-DIIODOETHANE
CAS:624-73-7
CM361085
ICCI
1,2-DIMETHANESULFONYL-1H-PYRROLE
CAS:1373232-67-7
CM501222
O=S(C1=CC=CN1S(=O)(C)=O)(C)=O
1,2-DIMETHOXY-4-(2-NITROETHENYL)BENZENE
CAS:4230-93-7
CM373276
COC1=C(OC)C=C(C=C[N+]([O-])=O)C=C1
1,2-DIMETHOXY-4-(PROP-1-EN-1-YL)BENZENE
CAS:93-16-3
CM395842
COC1=C(OC)C=C(C=CC)C=C1
1,2-DIMETHOXY-4-METHYL-5-NITROBENZENE
CAS:7509-11-7
CM373274
COC1=C(OC)C=C(C(C)=C1)[N+]([O-])=O
1,2-DIMETHOXY-4-METHYLBENZENE
CAS:494-99-5
CM253181
COC1=C(OC)C=C(C)C=C1
1,2-DIMETHOXY-4-NITROBENZENE
CAS:709-09-1
CM395840
COC1=C(OC)C=C(C=C1)[N+]([O-])=O
1,2-DIMETHOXY-5,6,6A,7-TETRAHYDRO-4H-DIBENZO[DE,G]QUINOLIN-10-OL HYDROCHLORIDE
CAS:24999-29-9
CM265234
OC1=CC=C2C(C3=C4C(CCNC4C2)=CC(OC)=C3OC)=C1.[H]Cl
1,2-DIMETHOXYNAPHTHALENE
CAS:57189-64-7
CM234108
COC1=CC=C2C=CC=CC2=C1OC
1,2-DIMETHOXYPROPANE
CAS:7778-85-0
CM395976
COCC(C)OC
1,2-DIMETHYL (1R,2S)-4-OXOCYCLOPENTANE-1,2-DICARBOXYLATE
CAS:28269-02-5
CM538980
O=C([C@H]1[C@@H](C(OC)=O)CC(C1)=O)OC
1,2-DIMETHYL (1R,2S)-4-OXOCYCLOPENTANE-1,2-DICARBOXYLATE
CAS:1001666-74-5
CM302703
O=C([C@H]1[C@@H](C(OC)=O)CC(C1)=O)OC
1,2-DIMETHYL (1R,2S)-CYCLOHEX-4-ENE-1,2-DICARBOXYLATE
CAS:4841-84-3
CM395735
COC(=O)[C@H]1CC=CC[C@H]1C(=O)OC
1,2-DIMETHYL (2S)-PYRROLIDINE-1,2-DICARBOXYLATE
CAS:83541-81-5
CM374789
COC(=O)[C@@H]1CCCN1C(=O)OC
1,2-DIMETHYL 1-(4-METHYLPHENYL)CYCLOPROPANE-1,2-DICARBOXYLATE
CAS:345618-40-8
CM378662
COC(=O)C1CC1(C(=O)OC)C1=CC=C(C)C=C1
1,2-DIMETHYL 3-AMINOBENZENE-1,2-DICARBOXYLATE
CAS:34529-06-1
CM107815
O=C(C1=CC=CC(N)=C1C(OC)=O)OC
1,2-DIMETHYL 3-BROMOBENZENE-1,2-DICARBOXYLATE
CAS:58749-33-0
CM108254
O=C(C1=CC=CC(Br)=C1C(OC)=O)OC
1,2-DIMETHYL 3-HYDROXYBENZENE-1,2-DICARBOXYLATE
CAS:36669-02-0
CM539839
COC(=O)C1=C(C(=CC=C1)O)C(=O)OC
1,2-DIMETHYL 3-NITROBENZENE-1,2-DICARBOXYLATE
CAS:13365-26-9
CM395767
COC(=O)C1=CC=CC(=C1C(=O)OC)[N+]([O-])=O
1,2-DIMETHYL 4-(CHLOROSULFONYL)BENZENE-1,2-DICARBOXYLATE
CAS:1152495-27-6
CM475640
COC(=O)C1=C(C=C(C=C1)S(Cl)(=O)=O)C(=O)OC
1,2-DIMETHYL CYCLOBUT-1-ENE-1,2-DICARBOXYLATE
CAS:1128-10-5
CM202229
O=C(C1=C(C(OC)=O)CC1)OC
1,2-DIMETHYL PYRROLIDINE-1,2-DICARBOXYLATE
CAS:77300-46-0
CM409255
COC(=O)C1CCCN1C(=O)OC
1,2-DIMETHYL-[1,2,4]TRIAZOLO[1,5-B]ISOQUINOLIN-5(1H)-ONE
CAS:52997-85-0
CM243000
O=C1N(N=C(C)N2C)C2=CC3=C1C=CC=C3
1,2-DIMETHYL-1,2,3,4-TETRAHYDROISOQUINOLINE
CAS:14429-09-5
CM227361
CN1C(C)C2=C(C=CC=C2)CC1
1,2-DIMETHYL-1,2,3,4-TETRAHYDROISOQUINOLINE-4,6,7-TRIOL
CAS:35589-37-8
CM226681
OC1=CC2=C(C=C1O)C(O)CN(C)C2C
1,2-DIMETHYL-1,2,3,4-TETRAHYDROISOQUINOLINE-4,6-DIOL
CAS:102830-16-0
CM144191
OC1CN(C)C(C)C2=C1C=C(O)C=C2
1,2-DIMETHYL-1,2,3,4-TETRAHYDROISOQUINOLINE-4,7,8-TRIOL
CAS:102830-22-8
CM242717
OC1CN(C)C(C)C2=C1C=CC(O)=C2O
1,2-DIMETHYL-1,2,3,4-TETRAHYDROISOQUINOLINE-4,8-DIOL
CAS:102830-20-6
CM144193
OC1CN(C)C(C)C2=C1C=CC=C2O
1,2-DIMETHYL-1,2,3,4-TETRAHYDROISOQUINOLINE-6,7-DIOL
CAS:102830-14-8
CM240929
OC1=CC2=C(C(C)N(C)CC2)C=C1O
1,2-DIMETHYL-1,2,3,4-TETRAHYDROQUINOLINE-4-CARBOXYLIC ACID
CAS:1529078-99-6
CM242277
O=C(C1CC(C)N(C)C2=C1C=CC=C2)O
1,2-DIMETHYL-1,2,3,4-TETRAHYDROQUINOLINE-6-CARBALDEHYDE
CAS:76529-12-9
CM240474
O=CC1=CC2=C(N(C)C(C)CC2)C=C1
1,2-DIMETHYL-1,2-DIHYDROISOQUINOLINE
CAS:51843-14-2
CM226680
CN1C(C)C2=C(C=CC=C2)C=C1
1,2-DIMETHYL-1,4,5,6-TETRAHYDROPYRIMIDINE
CAS:4271-96-9
CM166602
CC1=NCCCN1C
1,2-DIMETHYL-1H,6H,7H-PYRROLO[2,3-C]PYRIDIN-7-ONE
CAS:1375471-39-8
CM407146
CN1C(C)=CC2=C1C(=O)NC=C2
1,2-DIMETHYL-1H-1,3-BENZODIAZOLE-5-CARBOXYLIC ACID HYDROCHLORIDE
CAS:1221724-84-0
CM406169
Cl.CN1C(C)=NC2=C1C=CC(=C2)C(O)=O
1,2-DIMETHYL-1H-1,3-BENZODIAZOLE-6-CARBOXYLIC ACID
CAS:6595-00-2
CM153558
CN1C(C)=NC2=CC=C(C=C12)C(O)=O
1,2-DIMETHYL-1H-BENZO[D]IMIDAZOLE
CAS:2876-08-6
CM325049
CC1=NC2=CC=CC=C2N1C
1,2-DIMETHYL-1H-BENZO[D]IMIDAZOLE-5-CARBALDEHYDE
CAS:4597-21-1
CM157438
O=CC1=CC=C2N(C)C(C)=NC2=C1
1,2-DIMETHYL-1H-BENZOIMIDAZOLE-5-CARBOXYLIC ACID
CAS:90915-18-7
CM155426
O=C(C1=CC=C2N(C)C(C)=NC2=C1)O
1,2-DIMETHYL-1H-IMIDAZO[4,5-C]PYRIDINE
CAS:45880-13-5
CM274071
CC(N1C)=NC2=C1C=CN=C2
1,2-DIMETHYL-1H-IMIDAZO[4,5-G]QUINOXALINE
CAS:95140-63-9
CM221834
CC(N1C)=NC2=C1C=C3N=CC=NC3=C2
1,2-DIMETHYL-1H-IMIDAZOL-5-AMINE
CAS:80912-09-0
CM279688
NC1=CN=C(C)N1C
1,2-DIMETHYL-1H-IMIDAZOLE
CAS:1739-84-0
CM187215
CN1C=CN=C1C
1,2-DIMETHYL-1H-IMIDAZOLE-4,5-DICARBONITRILE
CAS:61053-16-5
CM416368
N#CC1=C(C#N)N(C)C(C)=N1
1,2-DIMETHYL-1H-IMIDAZOLE-4,5-DICARBOXYLIC ACID
CAS:1218764-87-4
CM462254
O=C(C1=C(C(O)=O)N(C)C(C)=N1)O
1,2-DIMETHYL-1H-IMIDAZOLE-4-CARBALDEHYDE
CAS:1038776-26-9
CM484707
O=CC1=CN(C)C(C)=N1
1,2-DIMETHYL-1H-IMIDAZOLE-4-SULFONAMIDE
CAS:415913-06-3
CM519909
O=S(C1=CN(C)C(C)=N1)(N)=O
1,2-DIMETHYL-1H-IMIDAZOLE-5-CARBALDEHYDE
CAS:24134-12-1
CM112611
O=CC1=CN=C(C)N1C
1,2-DIMETHYL-1H-IMIDAZOLE-5-CARBOXYLIC ACID
CAS:122222-09-7
CM330578
O=C(C1=CN=C(C)N1C)O
1,2-DIMETHYL-1H-IMIDAZOLE-5-CARBOXYLIC ACID HYDROCHLORIDE
CAS:1803586-59-5
CM461862
O=C(C1=CN=C(C)N1C)O.[H]Cl
1,2-DIMETHYL-1H-IMIDAZOLE-5-SULPHONYL CHLORIDE
CAS:849351-92-4
CM416370
O=S(C1=CN=C(C)N1C)(Cl)=O
1,2-DIMETHYL-1H-INDOL-5-AMINE
CAS:7570-48-1
CM148748
NC1=CC2=C(N(C)C(C)=C2)C=C1
1,2-DIMETHYL-1H-INDOL-5-AMINE HYDROCHLORIDE
CAS:174274-98-7
CM236921
NC1=CC2=C(N(C)C(C)=C2)C=C1.[H]Cl
1,2-DIMETHYL-1H-INDOL-5-OL
CAS:25888-06-6
CM238665
OC1=CC2=C(N(C)C(C)=C2)C=C1
1,2-DIMETHYL-1H-INDOLE
CAS:875-79-6
CM148680
C1=C([N](C2=CC=CC=C12)C)C
1,2-DIMETHYL-1H-INDOLE-3-CARBALDEHYDE
CAS:38292-40-9
CM239188
O=CC1=C(C)N(C)C2=C1C=CC=C2
1,2-DIMETHYL-1H-INDOLE-3-CARBONITRILE
CAS:51072-84-5
CM149033
N#CC1=C(C)N(C)C2=C1C=CC=C2
1,2-DIMETHYL-1H-INDOLE-3-SULFONYL CHLORIDE
CAS:1177425-20-5
CM333520
O=S(C1=C(C)N(C)C2=C1C=CC=C2)(Cl)=O
1,2-DIMETHYL-1H-INDOLE-6-CARBOXYLIC ACID
CAS:1547742-68-6
CM462526
CN1C(C)=CC2=C1C=C(C=C2)C(O)=O
1,2-DIMETHYL-1H-NAPHTHO[2,3-D]IMIDAZOLE
CAS:71675-75-7
CM232493
CC1=NC2=CC3=CC=CC=C3C=C2N1C
1,2-DIMETHYL-1H-PYRROLE-3-CARBALDEHYDE
CAS:1354783-99-5
CM327198
O=CC1=C(C)N(C)C=C1
1,2-DIMETHYL-1H-PYRROLE-3-CARBOXYLIC ACID
CAS:89776-57-8
CM199024
O=C(C1=C(C)N(C)C=C1)O
1,2-DIMETHYL-1H-PYRROLO[3,2-C]PYRIDINE
CAS:680859-99-8
CM149742
CN1C(C)=CC2=CN=CC=C12
1,2-DIMETHYL-3,5-DIPHENYLPYRAZOL-1-IUM;METHYL SULFATE
CAS:43222-48-6
CM332279
CN1[N+](C)=C(C=C1C2=CC=CC=C2)C3=CC=CC=C3.O=S(OC)([
1,2-DIMETHYL-3-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)-1H-INDOLE
CAS:1310940-93-2
CM401041
CN1C(C)=C(B2OC(C)(C)C(C)(C)O2)C2=CC=CC=C12
1,2-DIMETHYL-3-FLUORO-4-IODOBENZENE
CAS:1806323-40-9
CM250512
IC1=CC=C(C)C(C)=C1F
1,2-DIMETHYL-3-METHYLSULFANYLBENZENE
CAS:66794-10-3
CM329220
CSC1=C(C)C(C)=CC=C1
1,2-DIMETHYL-3-OXO-1,2,3,4-TETRAHYDROQUINOXALINE-6-CARBOXYLIC ACID
CAS:1249563-59-4
CM469744
CC1N(C)C2=C(NC1=O)C=C(C=C2)C(O)=O
1,2-DIMETHYL-3-OXO-2,3-DIHYDRO-1H-INDAZOLE-6-CARBOXYLIC ACID
CAS:1784860-42-9
CM536817
O=C1N(C)N(C)C2=CC(C(O)=O)=CC=C12
1,2-DIMETHYL-3-PHENYL-1H-INDOLE
CAS:38445-36-2
CM231402
CC(N1C)=C(C2=CC=CC=C2)C3=C1C=CC=C3
1,2-DIMETHYL-3-PROPYL-1H-IMIDAZOL-3-IUM IODIDE
CAS:218151-78-1
CM187705
[I-].CCC[N+]1=C(C)N(C)C=C1
1,2-DIMETHYL-3H-BENZO[E]INDOLE
CAS:55970-05-3
CM148798
CC(N1)=C(C)C2=C1C=CC3=CC=CC=C23
1,2-DIMETHYL-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)IMIDAZOLE
CAS:2223050-13-1
CM326597
CC1(C)C(C)(C)OB(C2=CN(C)C(C)=N2)O1
1,2-DIMETHYL-4-(4-NITROPHENYL)-1,2,4-TRIAZOLIDINE-3,5-DIONE
CAS:669757-38-4
CM523743
O=C(N1C2=CC=C([N+]([O-])=O)C=C2)N(C)N(C)C1=O
1,2-DIMETHYL-4-NITRO-1H-IMIDAZOLE
CAS:13230-04-1
CM369830
CN1C=C(N=C1C)[N+]([O-])=O
1,2-DIMETHYL-4-NITRO-1H-IMIDAZOLE-5-CARBOXYLIC ACID
CAS:54828-06-7
CM187641
O=C(C1=C([N+]([O-])=O)N=C(C)N1C)O
1,2-DIMETHYL-4-NITRO-3-(TRIFLUOROMETHOXY)BENZENE
CAS:1804432-38-9
CM403872
CC1=C(C)C(OC(F)(F)F)=C(C=C1)[N+]([O-])=O
1,2-DIMETHYL-4-OXO-1,4-DIHYDROQUINOLINE-6-CARBOXYLIC ACID
CAS:1210431-57-4
CM244965
O=C(C1=CC2=C(N(C)C(C)=CC2=O)C=C1)O
1,2-DIMETHYL-4-OXO-N-PHENYL-1,4-DIHYDROQUINOLINE-3-CARBOXAMIDE
CAS:2055840-20-3
CM227314
O=C(C1=C(C)N(C)C2=C(C=CC=C2)C1=O)NC3=CC=CC=C3
1,2-DIMETHYL-4-PHENYL-1H-PYRROLE
CAS:52266-24-7
CM386147
CN1C=C(C=C1C)C1=CC=CC=C1
1,2-DIMETHYL-5-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)-1H-1,3-BENZODIAZOLE
CAS:227306-27-6
CM389498
CN1C(C)=NC2=C1C=CC(=C2)B1OC(C)(C)C(C)(C)O1
1,2-DIMETHYL-5-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)-1H-IMIDAZOLE
CAS:942070-74-8
CM219250
CC1(C)C(C)(C)OB(C2=CN=C(C)N2C)O1
1,2-DIMETHYL-5-(METHYLSULFANYL)-3-NITROBENZENE
CAS:1803607-50-2
CM408154
CSC1=CC(C)=C(C)C(=C1)[N+]([O-])=O
1,2-DIMETHYL-5-(QUINOXALIN-6-YL)-1H-PYRAZOL-3(2H)-ONE
CAS:937279-21-5
CM141869
O=C1N(C)N(C)C(C2=CC=C3N=CC=NC3=C2)=C1
1,2-DIMETHYL-5-(TRIFLUOROMETHYL)-1H-BENZO[D]IMIDAZOLE
CAS:63815-72-5
CM312527
FC(C1=CC=C2N(C)C(C)=NC2=C1)(F)F
1,2-DIMETHYL-5-NITRO-1H-IMIDAZOLE
CAS:551-92-8
CM187242
CN1C(C)=NC=C1[N+]([O-])=O
1,2-DIMETHYL-5-NITRO-3-[(TRIFLUOROMETHYL)SULFANYL]BENZENE
CAS:1806337-20-1
CM403873
CC1=C(C)C(SC(F)(F)F)=CC(=C1)[N+]([O-])=O
1,2-DIMETHYL-5-PHENYL-1H-PYRROLE-3-CARBOXYLIC ACID
CAS:65473-92-9
CM523529
O=C(C1=C(C)N(C)C(C2=CC=CC=C2)=C1)O
1,2-DIMETHYL-6-OXO-1,6-DIHYDROPYRIDINE-3-CARBOXYLIC ACID
CAS:1023813-29-7
CM484410
O=C(C(C=C1)=C(C)N(C)C1=O)O
1,2-DIMETHYL-6-OXOPYRIMIDINE-5-CARBOXYLIC ACID
CAS:1272507-96-6
CM326977
O=C(C1=CN=C(C)N(C)C1=O)O
1,2-DIMETHYL-7-(TRIFLUOROMETHYL)QUINOLIN-4(1H)-ONE
CAS:1208393-24-1
CM256732
O=C1C=C(C)N(C)C2=C1C=CC(C(F)(F)F)=C2
1,2-DIMETHYL-7-NITRONAPHTHALENE
CAS:819871-85-7
CM238155
O=[N+](C1=CC2=C(C)C(C)=CC=C2C=C1)[O-]
1,2-DIMETHYL-8-(TRIFLUOROMETHYL)QUINOLIN-4(1H)-ONE
CAS:1208408-56-3
CM256733
O=C1C=C(C)N(C)C2=C1C=CC=C2C(F)(F)F
1,2-DIMETHYLCYCLOPROPANECARBOXYLIC ACID
CAS:594846-52-3
CM464076
CC1CC1(C)C(O)=O
1,2-DIMETHYLIMIDAZOL-4-AMINE;HYDROCHLORIDE
CAS:1434054-31-5
CM326650
NC1=CN(C)C(C)=N1.[H]Cl
1,2-DIMETHYLIMIDAZOLE-4-CARBOXYLIC ACID
CAS:1211585-57-7
CM326901
O=C(C1=CN(C)C(C)=N1)O
1,2-DIMETHYLIMIDAZOLE-4-SULFONYL CHLORIDE
CAS:137049-02-6
CM187460
CN1C=C(N=C1C)S(Cl)(=O)=O
1,2-DIMETHYLINDOLINE
CAS:26216-93-3
CM232558
CC1N(C)C2=C(C=CC=C2)C1
1,2-DIMETHYLINDOLINE-5-CARBALDEHYDE
CAS:887690-37-1
CM239433
O=CC1=CC2=C(N(C)C(C)C2)C=C1
1,2-DIMETHYLINDOLIZINE
CAS:1125-77-5
CM232434
CC1=CN2C=CC=CC2=C1C
1,2-DIMETHYLPIPERAZINE
CAS:25057-77-6
CM120126
CC1N(C)CCNC1
1,2-DIMETHYLPIPERIDIN-3-AMINE
CAS:1461708-38-2
CM431656
NC1C(C)N(C)CCC1
1,2-DIMETHYLPIPERIDIN-4-AMINE
CAS:89850-92-0
CM317060
NC1CC(C)N(C)CC1
1,2-DIMETHYLPIPERIDIN-4-ONE
CAS:13669-32-4
CM180008
O=C1CC(C)N(C)CC1
1,2-DIMETHYLPYRIDIN-1-IUM IODIDE
CAS:872-73-1
CM366811
[I-].CC1=[N+](C)C=CC=C1
1,2-DIMETHYLQUINAZOLIN-4(1H)-ONE
CAS:7471-65-0
CM142206
O=C1N=C(C)N(C)C2=C1C=CC=C2
1,2-DIMETHYLQUINOLIN-1-IUM IODIDE
CAS:876-87-9
CM367340
[I-].CC1=CC=C2C=CC=CC2=[N+]1C
1,2-DIMETHYLQUINOLIN-1-IUM PERCHLORATE
CAS:20729-86-6
CM227934
CC1=CC=C2C=CC=CC2=[N+]1C.O=Cl(=O)([O-])=O
1,2-DIMETHYLQUINOLIN-4(1H)-ONE
CAS:6760-40-3
CM143323
O=C1C=C(C)N(C)C2=C1C=CC=C2
1,2-DIMORPHOLINOETHANONE
CAS:1440-62-6
CM323900
O=C(N1CCOCC1)CN2CCOCC2
1,2-DINITRO-4-BROMOBENZENE
CAS:610-38-8
CM243530
BrC1=CC=C([N+]([O-])=O)C([N+]([O-])=O)=C1
1,2-DINONYL BENZENE-1,2-DICARBOXYLATE
CAS:84-76-4
CM361733
O=C(OCCCCCCCCC)C1=CC=CC=C1C(OCCCCCCCCC)=O
1,2-DIOCTYL BENZENE-1,2-DICARBOXYLATE
CAS:117-84-0
CM394949
CCCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCCCC
1,2-DIOXO-1,2-DIHYDROACENAPHTHYLENE-5,6-DICARBONITRILE
CAS:929117-72-6
CM235510
N#CC1=C2C(C#N)=CC=C3C(C(C(C=C1)=C32)=O)=O
1,2-DIPHENOXYETHANE
CAS:104-66-5
CM247495
C1(OCCOC2=CC=CC=C2)=CC=CC=C1
1,2-DIPHENYL-1H-BENZO[D]IMIDAZOLE
CAS:2622-67-5
CM153352
C1=CC=C(C=C1)N1C2=CC=CC=C2N=C1C1=CC=CC=C1
1,2-DIPHENYL-1H-IMIDAZOLE
CAS:52179-66-5
CM385034
C1=CN(C(=N1)C1=CC=CC=C1)C1=CC=CC=C1
1,2-DIPHENYL-1H-INDOLE
CAS:18434-12-3
CM236260
N1(C2=CC=CC=C2)C(C3=CC=CC=C3)=CC4=C1C=CC=C4
1,2-DIPHENYL-1H-INDOLE-3-CARBALDEHYDE
CAS:29329-99-5
CM262566
O=CC1=C(C2=CC=CC=C2)N(C3=CC=CC=C3)C4=C1C=CC=C4
1,2-DIPHENYL-1H-PYRROLO[2,3-B]QUINOXALINE
CAS:62356-28-9
CM222420
C12=NC3=CC=CC=C3N=C1C=C(C4=CC=CC=C4)N2C5=CC=CC=C5
1,2-DIPHENYL-2,3,5,6,7,8-HEXAHYDROQUINAZOLIN-4(1H)-ONE
CAS:62582-96-1
CM215717
O=C1NC(C2=CC=CC=C2)N(C3=CC=CC=C3)C4=C1CCCC4
1,2-DIPHENYL-2-(PROPAN-2-YLOXY)ETHAN-1-ONE
CAS:6652-28-4
CM384281
CC(C)OC(C(=O)C1=CC=CC=C1)C1=CC=CC=C1
1,2-DIPHENYL-2-(QUINOLIN-3-YL)ETHANONE
CAS:918648-57-4
CM225788
O=C(C1=CC=CC=C1)C(C2=CC=CC=C2)C3=CC4=CC=CC=C4N=C3
1,2-DIPHENYL-4-(2-(PHENYLTHIO)ETHYL)PYRAZOLIDINE-3,5-DIONE
CAS:3736-92-3
CM188599
O=C(C1CCSC2=CC=CC=C2)N(C3=CC=CC=C3)N(C4=CC=CC=C4)C
1,2-DIPHENYL-5,6,7,8-TETRAHYDROQUINAZOLINE-4(1H)-THIONE
CAS:5021-54-5
CM214706
S=C1N=C(C2=CC=CC=C2)N(C3=CC=CC=C3)C4=C1CCCC4
1,2-DIPHENYLDISULFANE
CAS:882-33-7
CM255532
C1(SSC2=CC=CC=C2)=CC=CC=C1
1,2-DIPHENYLETHAN-1-AMINE
CAS:25611-78-3
CM396257
NC(CC1=CC=CC=C1)C1=CC=CC=C1
1,2-DIPHENYLIMIDAZO[1,2-A]QUINOLINE
CAS:61760-53-0
CM226074
N12C(C=CC3=C2C=CC=C3)=NC(C4=CC=CC=C4)=C1C5=CC=CC=C
1,2-DIPHENYLIMIDAZO[2,1-B]QUINAZOLIN-5(1H)-ONE
CAS:62481-19-0
CM215657
O=C1N2C(N(C3=CC=CC=C3)C(C4=CC=CC=C4)=C2)=NC5=C1C=C
1,2-DIPHENYLPYRAZOLIDINE-3,5-DIONE
CAS:2652-77-9
CM188248
O=C1CC(=O)N(N1C1=CC=CC=C1)C1=CC=CC=C1
1,2-DIPHENYLQUINAZOLIN-4(1H)-ONE
CAS:1236-29-9
CM142322
O=C1N=C(C2=CC=CC=C2)N(C3=CC=CC=C3)C4=C1C=CC=C4
1,2-DIPROPYL BENZENE-1,2-DICARBOXYLATE
CAS:131-16-8
CM395139
CCCOC(=O)C1=CC=CC=C1C(=O)OCCC
1,2-EPOXY-5-CYCLOOCTENE
CAS:637-90-1
CM343986
C1(O2)C2CC/C=C\\CC1
1,2-ETHANEDIOL, 1-PROPANOATE
CAS:24567-27-9
CM464497
CCC(=O)OCCO
1,2-O-ISOPROPYLIDENE-BETA-D-FRUCTOPYRANOSE
CAS:66900-93-4
CM182426
O[C@@H]([C@@H](O)[C@@H]1O)CO[C@@]21COC(C)(C)O2
1,2-OXABOROLANE
CAS:407-53-4
CM403950
B1CCCO1
1,2-OXAZEPANE HYDROCHLORIDE
CAS:22185-38-2
CM408487
Cl.C1CCNOCC1
1,2-OXAZOL-3-AMINE
CAS:1750-42-1
CM104036
NC1=NOC=C1
1,2-OXAZOL-3-YLMETHANAMINE
CAS:131052-58-9
CM105127
NCC1=NOC=C1
1,2-OXAZOL-3-YLMETHANOL
CAS:89102-73-8
CM102499
OCC1=NOC=C1
1,2-OXAZOLE
CAS:288-14-2
CM119959
O1N=CC=C1
1,2-OXAZOLE-3-CARBALDEHYDE
CAS:89180-61-0
CM108951
O=CC1=NOC=C1
1,2-OXAZOLE-3-CARBONITRILE
CAS:68776-57-8
CM105126
N#CC1=NOC=C1
1,2-OXAZOLE-4,5-DICARBONITRILE
CAS:1256633-32-5
CM490903
N#CC1=C(C#N)ON=C1
1,2-OXAZOLE-4-CARBONITRILE
CAS:68776-58-9
CM191415
N#CC1=CON=C1
1,2-OXAZOLE-4-CARBOTHIOAMIDE
CAS:68251-67-2
CM384034
NC(=S)C1=CON=C1
1,2-OXAZOLE-4-CARBOTHIOAMIDE
CAS:885274-81-7
CM527419
NC(C1=CON=C1)=S
1,2-OXAZOLE-4-SULFONYL CHLORIDE
CAS:933740-94-4
CM389098
ClS(=O)(=O)C1=CON=C1
1,2-OXAZOLE-5-CARBONYL CHLORIDE
CAS:62348-13-4
CM362960
ClC(=O)C1=CC=NO1
1,2-OXAZOLE-5-CARBOTHIOAMIDE
CAS:175334-72-2
CM383508
NC(=S)C1=CC=NO1
1,2-OXAZOLIDIN-4-OL
CAS:412279-21-1
CM390725
OC1CONC1
1,2-OXAZOLIDINE
CAS:504-72-3
CM377857
C1CNOC1
1,2-OXAZOLIDINE HYDROCHLORIDE
CAS:39657-45-9
CM190893
O1NCCC1.[H]Cl
1,2-OXAZOLIDINE-3,5-DIONE
CAS:115344-44-0
CM554691
O=C(C1)NOC1=O
1,2-PHENYLENEDIBORONIC ACID
CAS:13506-83-7
CM208103
OB(C1=CC=CC=C1B(O)O)O
1,2-PHENYLENEDIMETHANAMINE DIHYDROCHLORIDE
CAS:21294-14-4
CM304425
NCC1=CC=CC=C1CN.[H]Cl.[H]Cl
1,2-PIPERIDINEDICARBOXYLIC ACID, 4-HYDROXY-, 1-(1,1-DIMETHYLETHYL) ESTER, (2R,4S)-REL-
CAS:1217699-64-3
CM473935
CC(C)(C)OC(=O)[C@H]1C[C@@H](O)CCN1C(O)=O
1,2-PIPERIDINEDICARBOXYLIC ACID, 4-HYDROXY-, 1-(PHENYLMETHYL) ESTER,(2S-CIS)-
CAS:70614-56-1
CM480838
OC1CCN([C@@H](C1)C(O)=O)C(=O)OCC1=CC=CC=C1
1,2-PROPANEDIOL
CAS:57-55-6
CM115918
CC(O)CO
1,2-PROPANEDIOL, 1,2-DIBENZOATE
CAS:19224-26-1
CM478306
CC(COC(=O)C1=CC=CC=C1)OC(=O)C1=CC=CC=C1
1,2-PYRIDAZINEDICARBOXYLIC ACID, 3,6-DIHYDRO-, 1,2-BIS(1,1-DIMETHYLETHYL) ESTER
CAS:13051-19-9
CM476558
CC(C)(C)OC(=O)N1CC=CCN1C(=O)OC(C)(C)C
1,2-PYRROLIDINEDICARBOXYLIC ACID, 1-(2,2,2-TRICHLOROETHYL) ESTER, (S)-
CAS:37888-34-9
CM479985
OC(=O)N1CCC[C@H]1C(=O)OCC(Cl)(Cl)Cl
1,2-PYRROLIDINEDICARBOXYLIC ACID, 3-CYCLOHEXYL-, 1-(1,1-DIMETHYLETHYL) ESTER, (2R,3R)-REL-
CAS:1449586-26-8
CM477218
CC(C)(C)OC(=O)[C@H]1[C@H](CCN1C(O)=O)C1CCCCC1
1,2-PYRROLIDINEDICARBOXYLIC ACID, 3-HYDROXY-, 1-(1,1-DIMETHYLETHYL)2-METHYL ESTER, (2R-CIS)-
CAS:130966-41-5
CM473949
COC1CCN([C@H]1C(=O)OC(C)(C)C)C(O)=O
1,2-PYRROLIDINEDICARBOXYLIC ACID, 3-PHENYL-, 1-(1,1-DIMETHYLETHYL) ESTER,(2R-TRANS)-
CAS:123724-32-3
CM476189
CC(C)(C)OC(=O)[C@H]1C(CCN1C(O)=O)C1=CC=CC=C1
1,2-PYRROLIDINEDICARBOXYLIC ACID, 3-PHENYL-, 1-(9H-FLUOREN-9-YLMETHYL) ESTER, CIS- (9CI)
CAS:181824-45-3
CM478031
OC(=O)[C@H]1[C@H](CCN1C(=O)OCC1C2=CC=CC=C2C2=C1C=C
1,2-PYRROLIDINEDICARBOXYLIC ACID, 4,4-DIFLUORO-, 1-(9H-FLUOREN-9-YLMETHYL) ESTER, (2S)-
CAS:203866-21-1
CM478536
OC(=O)[C@@H]1CC(F)(F)CN1C(=O)OCC1C2=CC=CC=C2C2=C1C
1,2-PYRROLIDINEDICARBOXYLIC ACID, 4-(METHYLTHIO)-, 1-(1,1-DIMETHYLETHYL)ESTER, (2S,4R)-
CAS:876953-58-1
CM481870
CS[C@@H]1C[C@H](N(C1)C(O)=O)C(=O)OC(C)(C)C
1,2-PYRROLIDINEDICARBOXYLIC ACID, 4-(METHYLTHIO)-, 1-(1,1-DIMETHYLETHYL)ESTER, (2S,4S)-
CAS:188109-89-9
CM478187
CS[C@H]1C[C@H](N(C1)C(O)=O)C(=O)OC(C)(C)C
1,2-PYRROLIDINEDICARBOXYLIC ACID, 4-[(7-CHLORO-4-METHOXY-1-ISOQUINOLINYL)OXY]-, 1-(1,1-DIMETHYLETHYL) ESTER, (2S,4R)-
CAS:1028252-15-4
CM475149
COC1=C2C=CC(Cl)=CC2=C(O[C@@H]2C[C@H](N(C2)C(O)=O)C
1,2-PYRROLIDINEDICARBOXYLIC ACID, 4-FLUORO-, 1-(9H-FLUOREN-9-YLMETHYL) ESTER, (2S,4R)-
CAS:203866-20-0
CM478535
OC(=O)[C@@H]1C[C@@H](F)CN1C(=O)OCC1C2=CC=CC=C2C2=C
1,2-PYRROLIDINEDICARBOXYLIC ACID, 4-HYDROXY-, 1-(9H-FLUOREN-9-YLMETHYL) ESTER, (2R,4S)-
CAS:139262-20-7
CM476951
O[C@H]1C[C@@H](N(C1)C(=O)OCC1C2=CC=CC=C2C2=C1C=CC=
1,2-PYRROLIDINEDICARBOXYLIC ACID, 4-METHOXY-, 1-(1,1-DIMETHYLETHYL) ESTER, (2R,4R)-
CAS:200184-87-8
CM473943
CO[C@@H]1C[C@@H](N(C1)C(O)=O)C(=O)OC(C)(C)C
1,2-THIAZINANE 1,1-DIOXIDE
CAS:37441-50-2
CM193054
O=S1(NCCCC1)=O
1,2-THIAZOL-4-AMINE HYDROCHLORIDE
CAS:64527-29-3
CM189363
NC1=CSN=C1.[H]Cl
1,2-THIAZOL-5-AMINE
CAS:82357-92-4
CM189951
NC1=CC=NS1
1,2-THIAZOL-5-AMINE HYDROCHLORIDE
CAS:92815-50-4
CM255818
NC1=CC=NS1.[H]Cl
1,2-THIAZOLE
CAS:288-16-4
CM244004
S1N=CC=C1
1,2-THIAZOLE-3-CARBALDEHYDE
CAS:34490-97-6
CM552949
O=CC1=NSC=C1
1,2-THIAZOLE-3-CARBOXAMIDE
CAS:24342-43-6
CM515532
O=C(C1=NSC=C1)N
1,2-THIAZOLE-4-CARBONITRILE
CAS:3912-37-6
CM125207
N#CC1=CSN=C1
1,2:4,5-DI-O-ISOPROPYLIDENE-BETA-D-ERYTHRO-2,3-HEXODIULO-2,6-PYRANOSE
CAS:18422-53-2
CM139681
O=C1[C@@]2(OC[C@]3([H])[C@@]1([H])OC(C)(O3)C)OC(C)
1,3'-BIAZETIDINE DIHYDROCHLORIDE
CAS:928038-36-2
CM200333
[H]Cl.[H]Cl.N1(C2CNC2)CCC1
1,3'-BIPIPERIDINE DIHYDROCHLORIDE
CAS:813425-61-5
CM307216
[H]Cl.[H]Cl.N1(C2CNCCC2)CCCCC1
1,3'-BIPYRROLIDINE
CAS:267241-99-6
CM283588
N1(C2CNCC2)CCCC1
1,3'-BIPYRROLIDINE DIHYDROCHLORIDE
CAS:957540-36-2
CM128255
[H]Cl.[H]Cl.N1(C2CNCC2)CCCC1
1,3,2-BENZODIOXAPHOSPHOLE, 2-CHLORO-, 2-OXIDE
CAS:1499-17-8
CM466607
ClP1(=O)OC2=C(O1)C=CC=C2
1,3,2-DIOXABOROLANE, 2-[8-FLUORO-3-(METHOXYMETHOXY)-1-NAPHTHALENYL]-4,4,5,5-TETRAMETHYL-
CAS:2621936-17-0
CM482831
COCOC1=CC(B2OC(C)(C)C(C)(C)O2)=C2C(F)=CC=CC2=C1
1,3,2-DIOXABOROLANE, 4,4,5,5-TETRAMETHYL-2-[(1E)-2-(2-METHYL[1,1'-BIPHENYL]-3-YL)ETHENYL]-
CAS:2171558-33-9
CM482830
CC1=C(C=CC=C1\C=C\B1OC(C)(C)C(C)(C)O1)C1=CC=CC=C1
1,3,2-DIOXAPHOSPHOLANE, 2-CHLORO-4,4,5,5-TETRAMETHYL-
CAS:14812-59-0
CM466569
CC1(C)OP(Cl)OC1(C)C
1,3,2-DIOXATHIANE 2-OXIDE
CAS:4176-55-0
CM186555
O=S1OCCCO1
1,3,2-DIOXATHIOLANE 2,2-DIOXIDE
CAS:1072-53-3
CM200070
O=S1(OCCO1)=O
1,3,2-DIOXATHIOLANE, 4-(2-CHLOROETHYL)-, 2,2-DIOXIDE
CAS:1379212-90-4
CM466562
ClCCC1COS(=O)(=O)O1
1,3,2?5-DIOXAPHOSPHOLAN-2-ONE
CAS:1003-11-8
CM552968
O=P1OCCO1
1,3,2?6-BENZODIOXATHIOLE-2,2-DIONE
CAS:4074-55-9
CM519769
O=S1(OC2=CC=CC=C2O1)=O