Phone (USA) +1 212-348-5610
Whatsapp: +1 516-336-9307
WeChat: chembuyersguide
Chemical Search
 




























Rieke Metals, LLC




Country: USA

Rieke Metals, LLC
1001 Kingbird Road
Lincoln, NE 68521


Phone: (402) 434-2775
FAX: (402) 434-2777
E-Mail:E-Mail this Supplier


http://www.riekemetals.com/

Rieke Metals, LLC

Page: Home | 1 | 2 | 3 | 4 | 5 | 6 | 7 | 8 | 9 | 10 | 11 | 12 | 13 | 14 | 15 | 16 | 17 | 18 | 19 | 20 | 21 | 22 | 23 | 24 | 25 | 26 | 27 | 28 | 29 | 30 | 31 | 32 | 33 | 34 | 35 | 36 | 37 | 38 | 39 | 40 | 41 | 42 | 43 |
 


Product List

2,2,3,3,4,4-HEXAFLUORO-5-(3-METHYLSULFANYL-PHENYL)-5-OXO-PENTANOIC ACID
Formula: O=C(C(C(C(F)(F)C(O)=O)(F)F)(F)F)c1cccc(SC)c1
C0399003
346.25
MFCD22688292
2,2,3,3,4,4-HEXAFLUORO-5-(4-FLUORO-2-METHYL-PHENYL)-5-OXO-PENTANOIC ACID
Formula: O=C(C(F)(F)C(C(C(=O)O)(F)F)(F)F)c1ccc(cc1C)F
C0268003
332.177
MFCD22688187
2,2,3,3,4,4-HEXAFLUORO-5-(4-FLUORO-3-METHYL-PHENYL)-5-OXO-PENTANOIC ACID
Formula: FC(F)(C(F)(F)C(O)=O)C(C(=O)c1cc(c(F)cc1)C)(F)F
C0269003
332.177
MFCD22688198
2,2,3,3,4,4-HEXAFLUORO-5-(4-FLUORO-PHENYL)-5-OXO-PENTANOIC ACID
Formula: FC(C(c1ccc(cc1)F)=O)(C(C(F)(F)C(O)=O)(F)F)F
C0279003
318.149
MFCD02261202
2,2,3,3,4,4-HEXAFLUORO-5-(4-ISOPROPYL-PHENYL)-5-OXO-PENTANOIC ACID
Formula: OC(=O)C(F)(F)C(F)(F)C(C(=O)c1ccc(C(C)C)cc1)(F)F
C0308003
342.24
MFCD22688228
2,2,3,3,4,4-HEXAFLUORO-5-(4-METHOXY-PHENYL)-5-OXO-PENTANOIC ACID
Formula: FC(F)(C(F)(F)C(F)(F)C(=O)c1ccc(OC)cc1)C(=O)O
C0331003
330.186
MFCD02261210
2,2,3,3,4,4-HEXAFLUORO-5-(4-METHYLSULFANYL-PHENYL)-5-OXO-PENTANOIC ACID
Formula: FC(F)(C(F)(F)C(F)(F)C(=O)c1ccc(SC)cc1)C(=O)O
C0400003
346.25
MFCD22688303
2,2,3,3,4,4-HEXAFLUORO-5-(5-FLUORO-2-METHOXY-PHENYL)-5-OXO-PENTANOIC ACID
Formula: COc1c(C(C(C(F)(F)C(C(O)=O)(F)F)(F)F)=O)cc(F)cc1
C0260003
348.176
MFCD22688155
2,2,3,3,4,4-HEXAFLUORO-5-(5-FLUORO-2-METHYL-PHENYL)-5-OXO-PENTANOIC ACID
Formula: O=C(C(C(C(C(c1c(C)ccc(F)c1)=O)(F)F)(F)F)(F)F)O
C0270003
332.177
MFCD22688207
2,2,3,3,4,4-HEXAFLUORO-5-(6-METHOXY-NAPHTHALEN-2-YL)-5-OXO-PENTANOIC ACID
Formula: O=C(C(F)(F)C(F)(F)C(F)(F)C(=O)O)c1cc2ccc(OC)cc2cc1
C0325003
380.246
MFCD22688237
2,2,3,3,4,4-HEXAFLUORO-5-NAPHTHALEN-1-YL-5-OXO-PENTANOIC ACID
Formula: OC(C(C(C(F)(F)C(c1cccc2ccccc21)=O)(F)F)(F)F)=O
C0403003
350.22
MFCD22688308
2,2,3,3,4,4-HEXAFLUORO-5-OXO-5-(2,4,5-TRIMETHYL-PHENYL)-PENTANOIC ACID
Formula: FC(C(C(c1cc(C)c(C)cc1C)=O)(F)F)(F)C(C(O)=O)(F)F
C0498003
342.24
MFCD22688343
2,2,3,3,4,4-HEXAFLUORO-5-OXO-5-(2-TRIFLUOROMETHOXY-PHENYL)-PENTANOIC ACID
Formula: OC(=O)C(C(C(F)(F)C(c1c(cccc1)OC(F)(F)F)=O)(F)F)(F)F
C0525003
384.157
MFCD22688356
2,2,3,3,4,4-HEXAFLUORO-5-OXO-5-(3,4,5-TRIFLUORO-PHENYL)-PENTANOIC ACID
Formula: O=C(C(C(C(F)(F)C(=O)c1cc(c(F)c(c1)F)F)(F)F)(F)F)O
C0489003
354.13
MFCD22688333
2,2,3,3,4,4-HEXAFLUORO-5-OXO-5-(4-PHENOXY-PHENYL)-PENTANOIC ACID
Formula: OC(C(F)(F)C(F)(F)C(F)(F)C(c1ccc(cc1)Oc1ccccc1)=O)=O
C0437003
392.257
MFCD22688315
2,2,3,3,4,4-HEXAFLUORO-5-OXO-5-M-TOLYL-PENTANOIC ACID
Formula: OC(=O)C(F)(F)C(F)(F)C(F)(F)C(c1cc(ccc1)C)=O
C0375003
314.186
MFCD22688281
2,2,3,3,4,4-HEXAFLUORO-5-OXO-5-O-TOLYL-PENTANOIC ACID
Formula: OC(C(C(C(C(c1c(cccc1)C)=O)(F)F)(F)F)(F)F)=O
C0374003
314.186
MFCD22688271
2,2,3,3,4,4-HEXAFLUORO-5-OXO-5-P-TOLYL-PENTANOIC ACID
Formula: O=C(c1ccc(cc1)C)C(C(C(F)(F)C(O)=O)(F)F)(F)F
C0376003
314.186
MFCD22688288
2,2,3,3,4,4-HEXAFLUORO-5-OXO-5-PHENYL-PENTANOIC ACID
Formula: FC(F)(C(F)(F)C(F)(F)C(c1ccccc1)=O)C(=O)O
C0440003
300.159
MFCD22688324
2,2,3,3,4,4-HEXAFLUORO-5-OXO-5-THIOPHEN-2-YL-PENTANOIC ACID
Formula: O=C(C(C(C(C(c1sccc1)=O)(F)F)(F)F)(F)F)O
C0478003
306.185
MFCD22688327
2,2,5-TRIMETHYLHEXANAL
Formula: CC(C)(CCC(C)C)C=O
AL0204
142.243
MFCD11553580
2,2,5-TRIMETHYLHEXANOIC ACID
Formula: O=C(C(C)(C)CCC(C)C)O
C0204
158.243
MFCD11554164
2,2,5-TRIMETHYLHEXANOIC ACID ETHYL ESTER
Formula: CC(C)(C(OCC)=O)CCC(C)C
EE0204
186.297
MFCD11555028
2,2,6,6-TETRAMETHYLPIPERIDINYLMAGNESIUM CHLORIDE LITHIUM CHLORIDE COMPLEX SOLUTION, 1.0 M IN THF
Formula: C1C(N(C(CC1)(C)C)[Mg]Cl)(C)C.[Li]Cl
T2140
242.408
MFCD12546030
2,2,6,6-TETRAMETHYLPIPERIDINYLZINC CHLORIDE LITHIUM CHLORIDE COMPLEX SOLUTION, 1.0 M IN THF
CAS:1145881-09-9
Formula: C1C(N(C(CC1)(C)C)[Zn]Cl)(C)C.[Li]Cl
ZT1702
283.466
MFCD28103502
2,2-DICHLORO-1-(2,3,4,5,6-PENTAMETHYLPHENYL)ETHANONE
Formula: O=C(C(Cl)Cl)c1c(c(c(c(c1C)C)C)C)C
K0426258
259.178
MFCD28409527
2,2-DICHLORO-1-(2,3,5,6-TETRAMETHYLPHENYL)ETHANONE
Formula: Cc1c(c(C)c(cc1C)C)C(=O)C(Cl)Cl
K0477258
245.151
MFCD28409810
2,2-DICHLORO-1-(2,3,5-TRICHLOROPHENYL)ETHANONE
Formula: O=C(c1cc(Cl)cc(c1Cl)Cl)C(Cl)Cl
K1036258
292.378
MFCD28105189
2,2-DICHLORO-1-(2,3-DICHLOROPHENYL)ETHANONE
Formula: ClC(Cl)C(=O)c1c(c(Cl)ccc1)Cl
K1029258
257.932
MFCD28104888
2,2-DICHLORO-1-(2,3-DIFLUOROPHENYL)ETHANONE
Formula: ClC(Cl)C(=O)c1c(c(ccc1)F)F
K1334258
225.023
MFCD28105869
2,2-DICHLORO-1-(2,3-DIHYDROBENZO[B][1,4]DIOXIN-6-YL)ETHANONE
Formula: ClC(C(c1cc2OCCOc2cc1)=O)Cl
K0006258
247.079
MFCD17011093
2,2-DICHLORO-1-(2,3-DIHYDROBENZOFURAN-5-YL)ETHANONE
Formula: ClC(C(c1ccc2c(c1)CCO2)=O)Cl
K0169258
231.08
MFCD28407497
2,2-DICHLORO-1-(2,3-DIMETHYLPHENYL)ETHANONE
Formula: O=C(c1cccc(c1C)C)C(Cl)Cl
K0209258
217.097
MFCD28407804
2,2-DICHLORO-1-(2,4,5-TRIFLUOROPHENYL)ETHANONE
Formula: Fc1c(cc(c(c1)F)C(C(Cl)Cl)=O)F
K1581258
243.014
MFCD28107325
2,2-DICHLORO-1-(2,4,5-TRIMETHYLPHENYL)ETHANONE
Formula: O=C(C(Cl)Cl)c1c(cc(c(c1)C)C)C
K0498258
231.124
MFCD28409874
2,2-DICHLORO-1-(2,4-DICHLORO-5-METHOXYPHENYL)ETHANONE
Formula: Clc1c(OC)cc(c(c1)Cl)C(C(Cl)Cl)=O
K1047258
287.959
MFCD28105670
2,2-DICHLORO-1-(2,4-DICHLOROPHENYL)ETHANONE
Formula: ClC(Cl)C(=O)c1ccc(cc1Cl)Cl
K1033258
257.932
MFCD00018859
2,2-DICHLORO-1-(2,4-DIFLUOROPHENYL)ETHANONE
Formula: O=C(C(Cl)Cl)c1c(F)cc(F)cc1
K1335258
225.023
MFCD28105902
2,2-DICHLORO-1-(2,4-DIMETHOXYPHENYL)ETHANONE
Formula: O=C(c1ccc(cc1OC)OC)C(Cl)Cl
K0180258
249.095
MFCD28407554
2,2-DICHLORO-1-(2,4-DIMETHYLPHENYL)ETHANONE
Formula: ClC(Cl)C(=O)c1c(C)cc(cc1)C
K0210258
217.097
MFCD13173324
2,2-DICHLORO-1-(2,5-DICHLORO-3-FLUOROPHENYL)ETHANONE
Formula: Fc1cc(cc(C(=O)C(Cl)Cl)c1Cl)Cl
K1031258
275.923
MFCD28104958
2,2-DICHLORO-1-(2,5-DICHLOROPHENYL)ETHANONE
Formula: Clc1cc(c(cc1)Cl)C(C(Cl)Cl)=O
K1030258
257.932
MFCD28104919
2,2-DICHLORO-1-(2,5-DIFLUORO-4-METHOXYPHENYL)ETHANONE
Formula: Fc1cc(c(cc1OC)F)C(C(Cl)Cl)=O
K1373258
255.05
MFCD28106194
2,2-DICHLORO-1-(2,5-DIFLUOROPHENYL)ETHANONE
Formula: ClC(Cl)C(c1cc(F)ccc1F)=O
K1336258
225.023
MFCD28105919
2,2-DICHLORO-1-(2,5-DIMETHOXYPHENYL)ETHANONE
Formula: ClC(C(=O)c1cc(OC)ccc1OC)Cl
K0181258
249.095
MFCD28407579
2,2-DICHLORO-1-(2,5-DIMETHYLPHENYL)ETHANONE
Formula: Cc1ccc(cc1C(C(Cl)Cl)=O)C
K0211258
217.097
MFCD28407849
2,2-DICHLORO-1-(2,6-DICHLOROPHENYL)ETHANONE
Formula: Clc1cccc(Cl)c1C(=O)C(Cl)Cl
K1028258
257.932
MFCD05669294
2,2-DICHLORO-1-(2,6-DIFLUOROPHENYL)ETHANONE
Formula: Fc1cccc(F)c1C(=O)C(Cl)Cl
K1337258
225.023
MFCD28105937
2,2-DICHLORO-1-(2,6-DIMETHYLPHENYL)ETHANONE
Formula: Cc1cccc(C)c1C(C(Cl)Cl)=O
K0212258
217.097
MFCD13173323
2,2-DICHLORO-1-(2-(1,1,2,2-TETRAFLUOROETHOXY)PHENYL)ETHANONE
Formula: FC(F)(C(F)F)Oc1c(cccc1)C(C(Cl)Cl)=O
K0643258
305.058
MFCD28104617
2,2-DICHLORO-1-(2-(DIFLUOROMETHOXY)PHENYL)ETHANONE
Formula: FC(Oc1c(C(C(Cl)Cl)=O)cccc1)F
K0642258
255.05
MFCD28104553
2,2-DICHLORO-1-(2-(DIMETHYLAMINO)PHENYL)ETHANONE
Formula: O=C(C(Cl)Cl)c1ccccc1N(C)C
K0189258
232.111
MFCD28407643
2,2-DICHLORO-1-(2-(METHYLTHIO)PHENYL)ETHANONE
Formula: ClC(Cl)C(=O)c1ccccc1SC
K0398258
235.134
MFCD28409280
2,2-DICHLORO-1-(2-(TRIFLUOROMETHOXY)PHENYL)ETHANONE
Formula: ClC(C(=O)c1c(cccc1)OC(F)(F)F)Cl
K0525258
273.04
MFCD28410000
2,2-DICHLORO-1-(2-(TRIFLUOROMETHYL)PHENYL)ETHANONE
Formula: ClC(Cl)C(c1c(cccc1)C(F)(F)F)=O
K0522258
257.041
MFCD28409922
2,2-DICHLORO-1-(2-CHLORO-3-FLUOROPHENYL)ETHANONE
Formula: ClC(Cl)C(c1c(Cl)c(F)ccc1)=O
K1044258
241.478
MFCD28105495
2,2-DICHLORO-1-(2-CHLORO-3-METHYLPHENYL)ETHANONE
Formula: ClC(Cl)C(c1c(c(C)ccc1)Cl)=O
K1046258
237.515
MFCD28105613
2,2-DICHLORO-1-(2-CHLORO-4-(TRIFLUOROMETHYL)PHENYL)ETHANONE
Formula: O=C(c1ccc(C(F)(F)F)cc1Cl)C(Cl)Cl
K1042258
291.486
MFCD28105432
2,2-DICHLORO-1-(2-CHLORO-4-FLUOROPHENYL)ETHANONE
Formula: ClC(Cl)C(=O)c1c(cc(F)cc1)Cl
K0690258
241.478
MFCD28104784
2,2-DICHLORO-1-(2-CHLORO-4-METHOXYPHENYL)ETHANONE
Formula: O=C(c1ccc(OC)cc1Cl)C(Cl)Cl
K1035258
253.514
MFCD28105143
2,2-DICHLORO-1-(2-CHLORO-4-METHYLPHENYL)ETHANONE
Formula: ClC(Cl)C(c1ccc(cc1Cl)C)=O
K1037258
237.515
MFCD28105256
2,2-DICHLORO-1-(2-CHLORO-5-(TRIFLUOROMETHOXY)PHENYL)ETHANONE
Formula: ClC(C(=O)c1cc(OC(F)(F)F)ccc1Cl)Cl
K1045258
307.485
MFCD28105551
2,2-DICHLORO-1-(2-CHLORO-5-(TRIFLUOROMETHYL)PHENYL)ETHANONE
Formula: Clc1ccc(cc1C(=O)C(Cl)Cl)C(F)(F)F
K1032258
291.486
MFCD28105022
2,2-DICHLORO-1-(2-CHLORO-5-FLUOROPHENYL)ETHANONE
Formula: ClC(Cl)C(c1c(ccc(c1)F)Cl)=O
K1039258
241.478
MFCD28105318
2,2-DICHLORO-1-(2-CHLORO-5-METHOXYPHENYL)ETHANONE
Formula: COc1ccc(Cl)c(C(C(Cl)Cl)=O)c1
K1034258
253.514
MFCD28105095
2,2-DICHLORO-1-(2-CHLORO-5-METHYLPHENYL)ETHANONE
Formula: Clc1c(cc(cc1)C)C(C(Cl)Cl)=O
K1041258
237.515
MFCD28105371
2,2-DICHLORO-1-(2-CHLORO-6-METHYLPHENYL)ETHANONE
Formula: Clc1c(c(ccc1)C)C(C(Cl)Cl)=O
K1419258
237.515
MFCD28106614
2,2-DICHLORO-1-(2-CHLOROPHENYL)ETHANONE
Formula: Clc1ccccc1C(C(Cl)Cl)=O
K1027258
223.487
MFCD28104817
2,2-DICHLORO-1-(2-ETHYLPHENYL)ETHANONE
Formula: O=C(c1ccccc1CC)C(Cl)Cl
K0244258
217.097
MFCD28407990
2,2-DICHLORO-1-(2-FLUORO-[1,1'-BIPHENYL]-4-YL)ETHANONE
Formula: O=C(c1ccc(c2ccccc2)c(c1)F)C(Cl)Cl
K0253258
283.132
MFCD28408129
2,2-DICHLORO-1-(2-FLUORO-4-METHYLPHENYL)ETHANONE
Formula: Fc1c(ccc(c1)C)C(=O)C(Cl)Cl
K1329258
221.06
MFCD28105822
2,2-DICHLORO-1-(2-FLUOROPHENYL)ETHANONE
Formula: O=C(C(Cl)Cl)c1ccccc1F
K1371258
207.033
MFCD28106160
2,2-DICHLORO-1-(2-ISOPROPOXYPHENYL)ETHANONE
Formula: CC(Oc1c(cccc1)C(C(Cl)Cl)=O)C
K0539258
247.123
MFCD28410193
2,2-DICHLORO-1-(2-ISOPROPYLPHENYL)ETHANONE
Formula: ClC(Cl)C(c1ccccc1C(C)C)=O
K0306258
231.124
MFCD28408741
2,2-DICHLORO-1-(2-METHOXY-5-(TRIFLUOROMETHYL)PHENYL)ETHANONE
Formula: COc1c(C(C(Cl)Cl)=O)cc(C(F)(F)F)cc1
K0646258
287.067
MFCD28410981
2,2-DICHLORO-1-(2-METHOXY-5-METHYLPHENYL)ETHANONE
Formula: Cc1cc(C(=O)C(Cl)Cl)c(OC)cc1
K0319258
233.096
MFCD28408854
2,2-DICHLORO-1-(2-METHOXYNAPHTHALEN-1-YL)ETHANONE
Formula: O=C(c1c2ccccc2ccc1OC)C(Cl)Cl
K0324258
269.129
MFCD28408919
2,2-DICHLORO-1-(2-METHOXYPHENYL)ETHANONE
Formula: ClC(Cl)C(c1c(cccc1)OC)=O
K0329258
219.069
MFCD13173415
2,2-DICHLORO-1-(2-METHYL-[1,1'-BIPHENYL]-3-YL)ETHANONE
Formula: ClC(Cl)C(c1cccc(c2ccccc2)c1C)=O
K0346258
279.168
MFCD28409045
2,2-DICHLORO-1-(2-METHYL-3-(TRIFLUOROMETHYL)PHENYL)ETHANONE
Formula: FC(F)(F)c1cccc(c1C)C(=O)C(Cl)Cl
K0639258
271.068
MFCD28410879
2,2-DICHLORO-1-(2-METHYLNAPHTHALEN-1-YL)ETHANONE
Formula: Cc1ccc2c(cccc2)c1C(C(Cl)Cl)=O
K0361258
253.13
MFCD28409122
2,2-DICHLORO-1-(2-THIAZOLYL)-ETHANONE
CAS:79265-41-1
Formula: ClC(Cl)C(c1sccn1)=O
NV03428
196.056
MFCD13172922
2,2-DICHLORO-1-(3,4,5-TRIFLUOROPHENYL)ETHANONE
Formula: Fc1c(F)cc(C(=O)C(Cl)Cl)cc1F
K0489258
243.014
MFCD28409842
2,2-DICHLORO-1-(3,4-DICHLOROPHENYL)ETHANONE
Formula: ClC(Cl)C(c1cc(c(Cl)cc1)Cl)=O
K0141258
257.932
MFCD28407167
2,2-DICHLORO-1-(3,4-DIFLUORO-5-METHOXYPHENYL)ETHANONE
Formula: Fc1c(cc(cc1F)C(=O)C(Cl)Cl)OC
K0160258
255.05
MFCD28407253
2,2-DICHLORO-1-(3,4-DIFLUOROPHENYL)ETHANONE
Formula: ClC(C(c1cc(c(F)cc1)F)=O)Cl
K0167258
225.023
MFCD28407459
2,2-DICHLORO-1-(3,4-DIMETHOXYPHENYL)ETHANONE
Formula: COc1ccc(cc1OC)C(C(Cl)Cl)=O
K0182258
249.095
MFCD28407597
2,2-DICHLORO-1-(3,4-DIMETHYLPHENYL)ETHANONE
Formula: ClC(Cl)C(c1ccc(C)c(C)c1)=O
K0213258
217.097
MFCD13173325
2,2-DICHLORO-1-(3,5-DICHLOROPHENYL)ETHANONE
Formula: O=C(c1cc(Cl)cc(c1)Cl)C(Cl)Cl
K0142258
257.932
MFCD28407181
2,2-DICHLORO-1-(3,5-DIFLUORO-2-METHOXYPHENYL)ETHANONE
Formula: Fc1cc(c(c(F)c1)OC)C(=O)C(Cl)Cl
K0161258
255.05
MFCD28407305
2,2-DICHLORO-1-(3,5-DIFLUOROPHENYL)ETHANONE
Formula: Fc1cc(cc(C(C(Cl)Cl)=O)c1)F
K0168258
225.023
MFCD28407473
2,2-DICHLORO-1-(3,5-DIMETHOXYPHENYL)ETHANONE
Formula: ClC(Cl)C(=O)c1cc(OC)cc(OC)c1
K0183258
249.095
MFCD28407609
2,2-DICHLORO-1-(3,5-DIMETHYLPHENYL)ETHANONE
Formula: ClC(C(c1cc(C)cc(c1)C)=O)Cl
K0214258
217.097
MFCD28407915
2,2-DICHLORO-1-(3-((3-FLUOROBENZYL)OXY)PHENYL)ETHANONE
Formula: Fc1cc(ccc1)COc1cc(ccc1)C(C(Cl)Cl)=O
K0251258
313.158
MFCD28408077
2,2-DICHLORO-1-(3-(1,1,2,2-TETRAFLUOROETHOXY)PHENYL)ETHANONE
Formula: O=C(c1cccc(OC(F)(F)C(F)F)c1)C(Cl)Cl
K0644258
305.058
MFCD28104681
2,2-DICHLORO-1-(3-(DIFLUOROMETHOXY)PHENYL)ETHANONE
Formula: ClC(Cl)C(=O)c1cccc(OC(F)F)c1
K0636258
255.05
MFCD28104451
2,2-DICHLORO-1-(3-(DIMETHYLAMINO)PHENYL)ETHANONE
Formula: CN(C)c1cc(ccc1)C(=O)C(Cl)Cl
K0190258
232.111
MFCD28407693
2,2-DICHLORO-1-(3-(METHYLTHIO)PHENYL)ETHANONE
Formula: O=C(c1cc(ccc1)SC)C(Cl)Cl
K0399258
235.134
MFCD28409318
2,2-DICHLORO-1-(3-(TRIFLUOROMETHOXY)PHENYL)ETHANONE
Formula: FC(Oc1cc(ccc1)C(=O)C(Cl)Cl)(F)F
K0526258
273.04
MFCD28410034
2,2-DICHLORO-1-(3-(TRIFLUOROMETHYL)PHENYL)ETHANONE
Formula: FC(c1cccc(C(C(Cl)Cl)=O)c1)(F)F
K0523258
257.041
MFCD28409950
2,2-DICHLORO-1-(3-CHLORO-2-METHYLPHENYL)ETHANONE
Formula: O=C(C(Cl)Cl)c1c(C)c(ccc1)Cl
K0089258
237.515
MFCD28406940
2,2-DICHLORO-1-(3-CHLORO-4-(TRIFLUOROMETHYL)PHENYL)ETHANONE
Formula: O=C(C(Cl)Cl)c1cc(c(C(F)(F)F)cc1)Cl
K0653258
291.486
MFCD28411074
2,2-DICHLORO-1-(3-CHLORO-4-FLUOROPHENYL)ETHANONE
Formula: Fc1c(cc(cc1)C(C(Cl)Cl)=O)Cl
K0081258
241.478
MFCD28406795
2,2-DICHLORO-1-(3-CHLORO-4-METHYLPHENYL)ETHANONE
Formula: Cc1c(Cl)cc(C(C(Cl)Cl)=O)cc1
K0090258
237.515
MFCD28406984
2,2-DICHLORO-1-(3-CHLORO-5-FLUOROPHENYL)ETHANONE
Formula: Fc1cc(cc(C(C(Cl)Cl)=O)c1)Cl
K0082258
241.478
MFCD28406819
2,2-DICHLORO-1-(3-CHLOROPHENYL)ETHANONE
Formula: O=C(c1cccc(c1)Cl)C(Cl)Cl
K0100258
223.487
MFCD28407138
2,2-DICHLORO-1-(3-ETHOXYPHENYL)ETHANONE
Formula: ClC(Cl)C(c1cc(ccc1)OCC)=O
K0232258
233.096
MFCD28407942
2,2-DICHLORO-1-(3-ETHYLPHENYL)ETHANONE
Formula: O=C(C(Cl)Cl)c1cc(ccc1)CC
K0530258
217.097
MFCD28410106
2,2-DICHLORO-1-(3-FLUORO-2-(TRIFLUOROMETHYL)PHENYL)ETHANONE
Formula: FC(F)(F)c1c(C(=O)C(Cl)Cl)cccc1F
K0638258
275.031
MFCD28410831
2,2-DICHLORO-1-(3-FLUORO-2-METHOXYPHENYL)ETHANONE
Formula: ClC(Cl)C(c1cccc(c1OC)F)=O
K0561258
237.059
MFCD28410337
2,2-DICHLORO-1-(3-FLUORO-2-METHYLPHENYL)ETHANONE
Formula: Cc1c(F)cccc1C(=O)C(Cl)Cl
K0265258
221.06
MFCD28408351
2,2-DICHLORO-1-(3-FLUORO-4-(TRIFLUOROMETHOXY)PHENYL)ETHANONE
Formula: Fc1c(OC(F)(F)F)ccc(C(=O)C(Cl)Cl)c1
K0647258
291.031
MFCD28411027
2,2-DICHLORO-1-(3-FLUORO-4-METHOXYPHENYL)ETHANONE
Formula: COc1ccc(C(=O)C(Cl)Cl)cc1F
K0256258
237.059
MFCD28408180
2,2-DICHLORO-1-(3-FLUORO-4-METHYLPHENYL)ETHANONE
Formula: Fc1c(ccc(c1)C(C(Cl)Cl)=O)C
K0266258
221.06
MFCD28408397
2,2-DICHLORO-1-(3-FLUORO-5-(TRIFLUOROMETHYL)PHENYL)ETHANONE
Formula: Fc1cc(cc(c1)C(F)(F)F)C(C(Cl)Cl)=O
K0630258
275.031
MFCD28410693
2,2-DICHLORO-1-(3-FLUORO-5-METHOXYPHENYL)ETHANONE
Formula: COc1cc(C(C(Cl)Cl)=O)cc(c1)F
K0257258
237.059
MFCD28408198
2,2-DICHLORO-1-(3-FLUORO-5-METHYLPHENYL)ETHANONE
Formula: O=C(c1cc(cc(C)c1)F)C(Cl)Cl
K0267258
221.06
MFCD28408425
2,2-DICHLORO-1-(3-FLUOROPHENYL)ETHANONE
Formula: O=C(C(Cl)Cl)c1cc(F)ccc1
K0278258
207.033
MFCD13173073
2,2-DICHLORO-1-(3-ISOPROPOXYPHENYL)ETHANONE
Formula: ClC(C(c1cccc(c1)OC(C)C)=O)Cl
K0304258
247.123
MFCD28408704
2,2-DICHLORO-1-(3-ISOPROPYLPHENYL)ETHANONE
Formula: ClC(Cl)C(c1cccc(C(C)C)c1)=O
K0307258
231.124
MFCD28408792
2,2-DICHLORO-1-(3-METHOXYPHENYL)ETHANONE
Formula: COc1cc(ccc1)C(=O)C(Cl)Cl
K0330258
219.069
MFCD18824011
2,2-DICHLORO-1-(3-METHYLTHIOPHEN-2-YL)ETHANONE
Formula: ClC(C(c1sccc1C)=O)Cl
K0396258
209.095
MFCD28409241
2,2-DICHLORO-1-(4'-PROPYL-[1,1'-BIPHENYL]-4-YL)ETHANONE
Formula: ClC(Cl)C(=O)c1ccc(cc1)c1ccc(CCC)cc1
K0447258
307.222
MFCD28409689
2,2-DICHLORO-1-(4,5-DIFLUORO-2-METHOXYPHENYL)ETHANONE
Formula: Fc1c(F)cc(OC)c(C(C(Cl)Cl)=O)c1
K0163258
255.05
MFCD28407356
2,2-DICHLORO-1-(4-((2,5-DIFLUOROPHENOXY)METHYL)PHENYL)ETHANONE
Formula: Fc1cc(c(cc1)F)OCc1ccc(C(C(Cl)Cl)=O)cc1
K0166258
331.149
MFCD28407408
2,2-DICHLORO-1-(4-((TRIFLUOROMETHYL)THIO)PHENYL)ETHANONE
Formula: O=C(C(Cl)Cl)c1ccc(SC(F)(F)F)cc1
K0625258
289.105
MFCD28410463
2,2-DICHLORO-1-(4-(1,1,2,2-TETRAFLUOROETHOXY)PHENYL)ETHANONE
Formula: FC(F)C(F)(F)Oc1ccc(cc1)C(C(Cl)Cl)=O
K0635258
305.058
MFCD28104386
2,2-DICHLORO-1-(4-(2-(PYRROLIDIN-1-YL)ETHOXY)PHENYL)ETHANONE
Formula: ClC(Cl)C(c1ccc(cc1)OCCN1CCCC1)=O
K0532258
302.203
MFCD28410143
2,2-DICHLORO-1-(4-(DIETHYLAMINO)PHENYL)ETHANONE
Formula: CCN(c1ccc(cc1)C(C(Cl)Cl)=O)CC
K0151258
260.165
MFCD28407209
2,2-DICHLORO-1-(4-(DIFLUOROMETHOXY)PHENYL)ETHANONE
Formula: FC(Oc1ccc(C(C(Cl)Cl)=O)cc1)F
K0632258
255.05
MFCD28104314
2,2-DICHLORO-1-(4-(DIMETHYLAMINO)PHENYL)ETHANONE
Formula: ClC(C(c1ccc(N(C)C)cc1)=O)Cl
K0191258
232.111
MFCD28407740
2,2-DICHLORO-1-(4-(DIPHENYLAMINO)PHENYL)ETHANONE
Formula: O=C(C(Cl)Cl)c1ccc(N(c2ccccc2)c2ccccc2)cc1
K0553258
356.255
MFCD28410286
2,2-DICHLORO-1-(4-(ETHYLTHIO)PHENYL)ETHANONE
Formula: O=C(c1ccc(cc1)SCC)C(Cl)Cl
K0246258
249.161
MFCD28408038
2,2-DICHLORO-1-(4-(METHYLTHIO)PHENYL)ETHANONE
Formula: ClC(C(c1ccc(SC)cc1)=O)Cl
K0400258
235.134
MFCD20128271
2,2-DICHLORO-1-(4-(TRIFLUOROMETHOXY)PHENYL)ETHANONE
Formula: FC(Oc1ccc(C(C(Cl)Cl)=O)cc1)(F)F
K0527258
273.04
MFCD28410068
2,2-DICHLORO-1-(4-(TRIFLUOROMETHYL)PHENYL)ETHANONE
Formula: O=C(c1ccc(C(F)(F)F)cc1)C(Cl)Cl
K0524258
257.041
MFCD28409972
2,2-DICHLORO-1-(4-CHLORO-2-(TRIFLUOROMETHYL)PHENYL)ETHANONE
Formula: O=C(c1ccc(Cl)cc1C(F)(F)F)C(Cl)Cl
K0626258
291.486
MFCD28410510
2,2-DICHLORO-1-(4-CHLORO-2-FLUOROPHENYL)ETHANONE
Formula: O=C(C(Cl)Cl)c1ccc(cc1F)Cl
K1424258
241.478
MFCD28106665
2,2-DICHLORO-1-(4-CHLORO-2-METHYLPHENYL)ETHANONE
Formula: ClC(Cl)C(c1ccc(cc1C)Cl)=O
K0092258
237.515
MFCD28407022
2,2-DICHLORO-1-(4-CHLORO-3,5-DIFLUOROPHENYL)ETHANONE
Formula: Fc1c(c(F)cc(C(=O)C(Cl)Cl)c1)Cl
K0067258
259.468
MFCD28406693
2,2-DICHLORO-1-(4-CHLORO-3,5-DIMETHYLPHENYL)ETHANONE
Formula: ClC(Cl)C(=O)c1cc(c(c(c1)C)Cl)C
K0068258
251.542
MFCD28406745
2,2-DICHLORO-1-(4-CHLORO-3-(TRIFLUOROMETHYL)PHENYL)ETHANONE
Formula: Clc1c(C(F)(F)F)cc(cc1)C(=O)C(Cl)Cl
K0624258
291.486
MFCD28410419
2,2-DICHLORO-1-(4-CHLORO-3-ETHYLPHENYL)ETHANONE
Formula: O=C(C(Cl)Cl)c1ccc(Cl)c(CC)c1
K0540258
251.542
MFCD28410234
2,2-DICHLORO-1-(4-CHLORO-3-FLUOROPHENYL)ETHANONE
Formula: Fc1cc(C(C(Cl)Cl)=O)ccc1Cl
K0083258
241.478
MFCD28406852
2,2-DICHLORO-1-(4-CHLORO-3-METHOXYPHENYL)ETHANONE
Formula: O=C(c1ccc(c(OC)c1)Cl)C(Cl)Cl
K0086258
253.514
MFCD28406886
2,2-DICHLORO-1-(4-CHLORO-3-METHYLPHENYL)ETHANONE
Formula: Cc1c(Cl)ccc(C(C(Cl)Cl)=O)c1
K0093258
237.515
MFCD28407065
2,2-DICHLORO-1-(4-CHLOROPHENYL)ETHANONE
Formula: ClC(Cl)C(=O)c1ccc(cc1)Cl
K0101258
223.487
MFCD00090514
2,2-DICHLORO-1-(4-ETHOXYPHENYL)ETHANONE
Formula: O=C(c1ccc(cc1)OCC)C(Cl)Cl
K0233258
233.096
MFCD28407974
2,2-DICHLORO-1-(4-ETHYLPHENYL)ETHANONE
Formula: ClC(C(c1ccc(CC)cc1)=O)Cl
K0245258
217.097
MFCD13173319
2,2-DICHLORO-1-(4-FLUORO-2-(TRIFLUOROMETHYL)PHENYL)ETHANONE
Formula: O=C(c1c(C(F)(F)F)cc(cc1)F)C(Cl)Cl
K0634258
275.031
MFCD28410739
2,2-DICHLORO-1-(4-FLUORO-2-METHOXYPHENYL)ETHANONE
Formula: ClC(C(=O)c1c(cc(cc1)F)OC)Cl
K0258258
237.059
MFCD28408245
2,2-DICHLORO-1-(4-FLUORO-2-METHYLPHENYL)ETHANONE
Formula: Cc1cc(ccc1C(C(Cl)Cl)=O)F
K0268258
221.06
MFCD28408454
2,2-DICHLORO-1-(4-FLUORO-3-(TRIFLUOROMETHYL)PHENYL)ETHANONE
Formula: ClC(C(=O)c1ccc(F)c(C(F)(F)F)c1)Cl
K0629258
275.031
MFCD28410653
2,2-DICHLORO-1-(4-FLUORO-3-METHOXYPHENYL)ETHANONE
Formula: O=C(C(Cl)Cl)c1cc(c(cc1)F)OC
K0259258
237.059
MFCD28408290
2,2-DICHLORO-1-(4-FLUORO-3-METHYLPHENYL)ETHANONE
Formula: Fc1c(cc(cc1)C(C(Cl)Cl)=O)C
K0269258
221.06
MFCD28408482
2,2-DICHLORO-1-(4-FLUORONAPHTHALEN-1-YL)ETHANONE
Formula: Fc1c2ccccc2c(cc1)C(=O)C(Cl)Cl
K0273258
257.093
MFCD28408523
2,2-DICHLORO-1-(4-FLUOROPHENYL)ETHANONE
Formula: Fc1ccc(C(C(Cl)Cl)=O)cc1
K0279258
207.033
MFCD13173093
2,2-DICHLORO-1-(4-HEPTYLPHENYL)ETHANONE
Formula: ClC(C(c1ccc(CCCCCCC)cc1)=O)Cl
K0291258
287.232
MFCD28408588
2,2-DICHLORO-1-(4-HEXYLPHENYL)ETHANONE
Formula: O=C(c1ccc(CCCCCC)cc1)C(Cl)Cl
K0298258
273.205
MFCD28408638
2,2-DICHLORO-1-(4-ISOBUTYLPHENYL)ETHANONE
Formula: O=C(c1ccc(CC(C)C)cc1)C(Cl)Cl
K0300258
245.151
MFCD28408682
2,2-DICHLORO-1-(4-ISOPROPYLPHENYL)ETHANONE
Formula: O=C(c1ccc(cc1)C(C)C)C(Cl)Cl
K0308258
231.124
MFCD28408840
2,2-DICHLORO-1-(4-METHOXY-2,5-DIMETHYLPHENYL)ETHANONE
Formula: Cc1c(cc(C)c(c1)OC)C(C(Cl)Cl)=O
K0175258
247.123
MFCD28407521
2,2-DICHLORO-1-(4-METHOXY-2-METHYLPHENYL)ETHANONE
Formula: ClC(Cl)C(c1c(C)cc(cc1)OC)=O
K0321258
233.096
MFCD28408870
2,2-DICHLORO-1-(4-METHOXY-3,5-DIMETHYLPHENYL)ETHANONE
Formula: Cc1cc(cc(c1OC)C)C(C(Cl)Cl)=O
K0206258
247.123
MFCD28407774
2,2-DICHLORO-1-(4-METHOXY-3-(TRIFLUOROMETHYL)PHENYL)ETHANONE
Formula: FC(F)(F)c1cc(C(C(Cl)Cl)=O)ccc1OC
K0637258
287.067
MFCD28410784
2,2-DICHLORO-1-(4-METHOXY-3-METHYLPHENYL)ETHANONE
Formula: O=C(c1cc(c(cc1)OC)C)C(Cl)Cl
K0322258
233.096
MFCD28408902
2,2-DICHLORO-1-(4-METHOXYPHENYL)ETHANONE
Formula: COc1ccc(C(=O)C(Cl)Cl)cc1
K0331258
219.069
MFCD13173424
2,2-DICHLORO-1-(4-METHYLNAPHTHALEN-1-YL)ETHANONE
Formula: Cc1ccc(C(C(Cl)Cl)=O)c2c1cccc2
K0362258
253.13
MFCD28409158
2,2-DICHLORO-1-(4-MORPHOLINOPHENYL)ETHANONE
Formula: O=C(c1ccc(cc1)N1CCOCC1)C(Cl)Cl
K0401258
274.149
MFCD28409393
2,2-DICHLORO-1-(4-PENTYLPHENYL)ETHANONE
Formula: ClC(C(c1ccc(CCCCC)cc1)=O)Cl
K0432258
259.178
MFCD28409559
2,2-DICHLORO-1-(4-PHENOXYPHENYL)ETHANONE
Formula: ClC(Cl)C(c1ccc(Oc2ccccc2)cc1)=O
K0437258
281.141
MFCD17976583
2,2-DICHLORO-1-(4-PROPYLPHENYL)ETHANONE
Formula: O=C(C(Cl)Cl)c1ccc(CCC)cc1
K0449258
231.124
MFCD28409739
2,2-DICHLORO-1-(4-VINYLPHENYL)ETHANONE
Formula: ClC(C(=O)c1ccc(cc1)C=C)Cl
K0462258
215.081
MFCD28409760
2,2-DICHLORO-1-(5-CHLORO-2-METHOXYPHENYL)ETHANONE
Formula: COc1ccc(Cl)cc1C(=O)C(Cl)Cl
K0087258
253.514
MFCD28406921
2,2-DICHLORO-1-(5-CHLORO-2-METHYLPHENYL)ETHANONE
Formula: Cc1c(C(=O)C(Cl)Cl)cc(cc1)Cl
K0094258
237.515
MFCD28407101
2,2-DICHLORO-1-(5-CHLORO-3-METHYLBENZO[B]THIOPHEN-2-YL)ETHANONE
Formula: Cc1c2c(ccc(c2)Cl)sc1C(=O)C(Cl)Cl
K1556258
293.601
MFCD28411154
2,2-DICHLORO-1-(5-CHLOROTHIOPHEN-2-YL)ETHANONE
Formula: Clc1ccc(s1)C(C(Cl)Cl)=O
K1346258
229.513
MFCD28411121
2,2-DICHLORO-1-(5-FLUORO-2-METHOXYPHENYL)ETHANONE
Formula: COc1c(C(C(Cl)Cl)=O)cc(F)cc1
K0260258
237.059
MFCD28408331
2,2-DICHLORO-1-(5-FLUORO-2-METHYLPHENYL)ETHANONE
Formula: Cc1c(C(C(Cl)Cl)=O)cc(cc1)F
K0270258
221.06
MFCD28408495
2,2-DICHLORO-1-(5-METHYLTHIOPHEN-2-YL)ETHANONE
Formula: O=C(c1ccc(C)s1)C(Cl)Cl
K0397258
209.095
MFCD13173144
2,2-DICHLORO-1-(6-METHOXYNAPHTHALEN-2-YL)ETHANONE
Formula: COc1ccc2cc(ccc2c1)C(C(Cl)Cl)=O
K0325258
269.129
MFCD28408966
2,2-DICHLORO-1-(M-TOLYL)ETHANONE
Formula: O=C(C(Cl)Cl)c1cc(ccc1)C
K0375258
203.07
MFCD13172942
2,2-DICHLORO-1-(NAPHTHALEN-1-YL)ETHANONE
Formula: O=C(c1cccc2c1cccc2)C(Cl)Cl
K0403258
239.103
MFCD28409439
2,2-DICHLORO-1-(NAPHTHALEN-2-YL)ETHANONE
Formula: ClC(C(c1ccc2ccccc2c1)=O)Cl
K0404258
239.103
MFCD28409462
2,2-DICHLORO-1-(O-TOLYL)ETHANONE
Formula: O=C(c1c(C)cccc1)C(Cl)Cl
K0374258
203.07
MFCD13172950
2,2-DICHLORO-1-(P-TOLYL)ETHANONE
Formula: Cc1ccc(C(C(Cl)Cl)=O)cc1
K0376258
203.07
MFCD13172989
2,2-DICHLORO-1-(PERFLUOROPHENYL)ETHANONE
Formula: Fc1c(c(c(F)c(F)c1C(=O)C(Cl)Cl)F)F
K0424258
278.995
MFCD28409485
2,2-DICHLORO-1-(PHENANTHREN-9-YL)ETHANONE
Formula: ClC(C(c1cc2ccccc2c2ccccc12)=O)Cl
K0434258
289.164
MFCD28409607
2,2-DICHLORO-1-(THIOPHEN-2-YL)ETHANONE
Formula: O=C(c1sccc1)C(Cl)Cl
K0478258
195.068
MFCD20622352
2,2-DICHLORO-1-MESITYLETHANONE
Formula: Cc1cc(C)c(C(C(Cl)Cl)=O)c(c1)C
K0499258
231.124
MFCD28409906
2,2-DICHLORO-1-PHENYLETHANONE
Formula: O=C(C(Cl)Cl)c1ccccc1
K0440258
189.042
MFCD00000844
2,2-DIFLUORO-1,3-BENZODIOXOLE-4-THIOL
Formula: FC1(Oc2c(c(S)ccc2)O1)F
NV02208
190.17
MFCD11111066
2,2-DIFLUORO-1-(2,3,5,6-TETRAMETHYL-PHENYL)-ETHANONE
Formula: Cc1cc(C)c(C)c(c1C)C(=O)C(F)F
K0477203
212.242
MFCD28104114
2,2-DIFLUORO-1-(2,3,5-TRICHLORO-PHENYL)-ETHANONE
Formula: Clc1c(Cl)c(C(=O)C(F)F)cc(Cl)c1
K1036203
259.468
MFCD28105170
2,2-DIFLUORO-1-(2,4,5-TRIFLUOROPHENYL)ETHANONE
Formula: Fc1c(cc(C(C(F)F)=O)c(c1)F)F
K1581203
210.105
MFCD28107310
2,2-DIFLUORO-1-(2,4,5-TRIMETHYL-PHENYL)-ETHANONE
Formula: O=C(C(F)F)c1c(cc(c(c1)C)C)C
K0498203
198.214
MFCD20921380
2,2-DIFLUORO-1-(2,4,6-TRIISOPROPYL-PHENYL)-ETHANONE
Formula: CC(C)c1c(c(C(C)C)cc(c1)C(C)C)C(=O)C(F)F
K0490203
282.377
MFCD28104121
2,2-DIFLUORO-1-(2,4,6-TRIMETHYL-PHENYL)-ETHANONE
Formula: Cc1cc(c(c(c1)C)C(C(F)F)=O)C
K0499203
198.214
MFCD28104134
2,2-DIFLUORO-1-(2-FLUORO-4-METHYLPHENYL)ETHANONE
Formula: O=C(C(F)F)c1ccc(cc1F)C
K1329203
188.151
MFCD28105807
2,2-DIFLUORO-1-(2-FLUORO-BIPHENYL-4-YL)-ETHANONE
Formula: O=C(C(F)F)c1cc(F)c(c2ccccc2)cc1
K0253203
250.222
MFCD28103858
2,2-DIFLUORO-1-(2-FLUOROPHENYL)ETHANONE
Formula: FC(C(c1ccccc1F)=O)F
K1371203
174.124
MFCD16618125
2,2-DIFLUORO-1-(2-ISOPROPOXY-PHENYL)-ETHANONE
Formula: CC(Oc1c(C(=O)C(F)F)cccc1)C
K0539203
214.214
MFCD26045172
2,2-DIFLUORO-1-(2-ISOPROPYL-PHENYL)-ETHANONE
Formula: O=C(c1ccccc1C(C)C)C(F)F
K0306203
198.214
MFCD28103957
2,2-DIFLUORO-1-(2-METHOXY-5-METHYL-PHENYL)-ETHANONE
Formula: Cc1ccc(OC)c(C(C(F)F)=O)c1
K0319203
200.187
MFCD26045125
2,2-DIFLUORO-1-(2-METHOXY-5-TRIFLUOROMETHYL-PHENYL)-ETHANONE
Formula: COc1ccc(C(F)(F)F)cc1C(C(F)F)=O
K0646203
254.158
MFCD28104742
2,2-DIFLUORO-1-(2-METHOXY-PHENYL)-ETHANONE
Formula: O=C(c1ccccc1OC)C(F)F
K0329203
186.16
MFCD16618124
2,2-DIFLUORO-1-(2-METHYL-3-TRIFLUOROMETHYL-PHENYL)-ETHANONE
Formula: FC(c1cccc(c1C)C(C(F)F)=O)(F)F
K0639203
238.159
MFCD28104525
2,2-DIFLUORO-1-(2-METHYL-BIPHENYL-3-YL)-ETHANONE
Formula: Cc1c(C(=O)C(F)F)cccc1c1ccccc1
K0346203
246.259
MFCD28103994
2,2-DIFLUORO-1-(2-METHYL-NAPHTHALEN-1-YL)-ETHANONE
Formula: O=C(C(F)F)c1c2ccccc2ccc1C
K0361203
220.221
MFCD28104006
2,2-DIFLUORO-1-(2-METHYLSULFANYL-PHENYL)-ETHANONE
Formula: CSc1c(cccc1)C(=O)C(F)F
K0398203
202.224
MFCD28104028
2,2-DIFLUORO-1-(2-TRIFLUOROMETHOXY-PHENYL)-ETHANONE
Formula: FC(C(=O)c1ccccc1OC(F)(F)F)F
K0525203
240.131
MFCD20921455
2,2-DIFLUORO-1-(2-TRIFLUOROMETHYL-PHENYL)-ETHANONE
Formula: FC(F)C(c1c(cccc1)C(F)(F)F)=O
K0522203
224.132
MFCD26045123
2,2-DIFLUORO-1-(3,4,5-TRIFLUORO-PHENYL)-ETHANONE
Formula: Fc1c(cc(C(=O)C(F)F)cc1F)F
K0489203
210.105
MFCD20921324
2,2-DIFLUORO-1-(3-FLUORO-2-METHOXY-PHENYL)-ETHANONE
Formula: FC(F)C(=O)c1cccc(F)c1OC
K0561203
204.15
MFCD28104206
2,2-DIFLUORO-1-(3-FLUORO-2-METHYL-PHENYL)-ETHANONE
Formula: O=C(c1c(c(F)ccc1)C)C(F)F
K0265203
188.151
MFCD28103907
2,2-DIFLUORO-1-(3-FLUORO-2-TRIFLUOROMETHYL-PHENYL)-ETHANONE
Formula: FC(c1c(C(C(F)F)=O)cccc1F)(F)F
K0638203
242.122
MFCD28104512
2,2-DIFLUORO-1-(3-FLUORO-4-METHOXY-PHENYL)-ETHANONE
Formula: COc1c(cc(C(C(F)F)=O)cc1)F
K0256203
204.15
MFCD20920936
2,2-DIFLUORO-1-(3-FLUORO-4-METHYL-PHENYL)-ETHANONE
Formula: Fc1c(ccc(C(C(F)F)=O)c1)C
K0266203
188.151
MFCD20920987
2,2-DIFLUORO-1-(3-FLUORO-4-TRIFLUOROMETHOXY-PHENYL)-ETHANONE
Formula: O=C(c1cc(F)c(cc1)OC(F)(F)F)C(F)F
K0647203
258.121
MFCD28104753
2,2-DIFLUORO-1-(3-FLUORO-5-METHOXY-PHENYL)-ETHANONE
Formula: COc1cc(F)cc(C(C(F)F)=O)c1
K0257203
204.15
MFCD28103872
2,2-DIFLUORO-1-(3-FLUORO-5-METHYL-PHENYL)-ETHANONE
Formula: O=C(C(F)F)c1cc(cc(c1)F)C
K0267203
188.151
MFCD20920996
2,2-DIFLUORO-1-(3-FLUORO-5-TRIFLUOROMETHYL-PHENYL)-ETHANONE
Formula: Fc1cc(C(=O)C(F)F)cc(c1)C(F)(F)F
K0630203
242.122
MFCD28104292
2,2-DIFLUORO-1-(3-FLUORO-PHENYL)-ETHANONE
Formula: FC(F)C(c1cccc(F)c1)=O
K0278203
174.124
MFCD16618054
2,2-DIFLUORO-1-(3-ISOPROPOXY-PHENYL)-ETHANONE
Formula: CC(C)Oc1cccc(C(C(F)F)=O)c1
K0304203
214.214
MFCD26045131
2,2-DIFLUORO-1-(3-ISOPROPYL-PHENYL)-ETHANONE
Formula: O=C(C(F)F)c1cc(C(C)C)ccc1
K0307203
198.214
MFCD28103966
2,2-DIFLUORO-1-(3-METHOXY-PHENYL)-ETHANONE
Formula: COc1cc(ccc1)C(C(F)F)=O
K0330203
186.16
MFCD20921143
2,2-DIFLUORO-1-(3-METHYL-THIOPHEN-2-YL)-ETHANONE
Formula: O=C(C(F)F)c1c(C)ccs1
K0396203
176.186
MFCD26045339
2,2-DIFLUORO-1-(3-METHYLSULFANYL-PHENYL)-ETHANONE
Formula: FC(C(c1cc(ccc1)SC)=O)F
K0399203
202.224
MFCD20921199
2,2-DIFLUORO-1-(3-TRIFLUOROMETHOXY-PHENYL)-ETHANONE
Formula: FC(Oc1cc(C(=O)C(F)F)ccc1)(F)F
K0526203
240.131
MFCD26045151
2,2-DIFLUORO-1-(3-TRIFLUOROMETHYL-PHENYL)-ETHANONE
Formula: FC(c1cc(ccc1)C(=O)C(F)F)(F)F
K0523203
224.132
MFCD12828047
2,2-DIFLUORO-1-(4'-PROPYL-BIPHENYL-4-YL)-ETHANONE
Formula: O=C(C(F)F)c1ccc(cc1)c1ccc(CCC)cc1
K0447203
274.313
MFCD28104093
2,2-DIFLUORO-1-(4-FLUORO-2-METHOXY-PHENYL)-ETHANONE
Formula: FC(F)C(=O)c1c(cc(cc1)F)OC
K0258203
204.15
MFCD28103884
2,2-DIFLUORO-1-(4-FLUORO-2-METHYL-PHENYL)-ETHANONE
Formula: FC(F)C(c1c(C)cc(cc1)F)=O
K0268203
188.151
MFCD20921015
2,2-DIFLUORO-1-(4-FLUORO-2-TRIFLUOROMETHYL-PHENYL)-ETHANONE
Formula: Fc1ccc(c(C(F)(F)F)c1)C(=O)C(F)F
K0634203
242.122
MFCD28104357
2,2-DIFLUORO-1-(4-FLUORO-3-METHOXY-PHENYL)-ETHANONE
Formula: Fc1c(cc(cc1)C(C(F)F)=O)OC
K0259203
204.15
MFCD28103895
2,2-DIFLUORO-1-(4-FLUORO-3-METHYL-PHENYL)-ETHANONE
Formula: Fc1ccc(cc1C)C(C(F)F)=O
K0269203
188.151
MFCD20921029
2,2-DIFLUORO-1-(4-FLUORO-3-TRIFLUOROMETHYL-PHENYL)-ETHANONE
Formula: FC(F)C(=O)c1cc(C(F)(F)F)c(cc1)F
K0629203
242.122
MFCD28104281
2,2-DIFLUORO-1-(4-FLUORO-NAPHTHALEN-1-YL)-ETHANONE
Formula: Fc1c2c(c(C(C(F)F)=O)cc1)cccc2
K0273203
224.184
MFCD28103916
2,2-DIFLUORO-1-(4-FLUORO-PHENYL)-ETHANONE
CAS:50562-06-6
Formula: O=C(c1ccc(F)cc1)C(F)F
K0279203
174.124
MFCD16618056
2,2-DIFLUORO-1-(4-HEPTYL-PHENYL)-ETHANONE
Formula: FC(F)C(=O)c1ccc(CCCCCCC)cc1
K0291203
254.323
MFCD28103924
2,2-DIFLUORO-1-(4-HEXYL-PHENYL)-ETHANONE
Formula: FC(C(c1ccc(cc1)CCCCCC)=O)F
K0298203
240.296
MFCD28103938
2,2-DIFLUORO-1-(4-ISOBUTYL-PHENYL)-ETHANONE
Formula: O=C(C(F)F)c1ccc(CC(C)C)cc1
K0300203
212.242
MFCD28103948
2,2-DIFLUORO-1-(4-ISOPROPYL-PHENYL)-ETHANONE
Formula: FC(F)C(c1ccc(cc1)C(C)C)=O
K0308203
198.214
MFCD16618113
2,2-DIFLUORO-1-(4-METHOXY-2,5-DIMETHYL-PHENYL)-ETHANONE
Formula: Cc1cc(c(C)cc1C(C(F)F)=O)OC
K0175203
214.214
MFCD26806693
2,2-DIFLUORO-1-(4-METHOXY-2-METHYL-PHENYL)-ETHANONE
Formula: O=C(C(F)F)c1ccc(cc1C)OC
K0321203
200.187
MFCD26045158
2,2-DIFLUORO-1-(4-METHOXY-3,5-DIMETHYL-PHENYL)-ETHANONE
Formula: Cc1c(OC)c(cc(c1)C(=O)C(F)F)C
K0206203
214.214
MFCD28103818
2,2-DIFLUORO-1-(4-METHOXY-3-METHYL-PHENYL)-ETHANONE
Formula: Cc1c(ccc(C(C(F)F)=O)c1)OC
K0322203
200.187
MFCD28103981
2,2-DIFLUORO-1-(4-METHOXY-3-TRIFLUOROMETHYL-PHENYL)-ETHANONE
Formula: FC(F)(F)c1c(OC)ccc(c1)C(=O)C(F)F
K0637203
254.158
MFCD28104499
2,2-DIFLUORO-1-(4-METHOXY-PHENYL)-ETHANONE
CAS:114829-07-1
Formula: COc1ccc(cc1)C(=O)C(F)F
K0331203
186.16
MFCD13172721
2,2-DIFLUORO-1-(4-METHYL-NAPHTHALEN-1-YL)-ETHANONE
Formula: Cc1c2c(cccc2)c(cc1)C(C(F)F)=O
K0362203
220.221
MFCD28104013
2,2-DIFLUORO-1-(4-METHYLSULFANYL-PHENYL)-ETHANONE
CAS:81170-29-8
Formula: FC(C(=O)c1ccc(cc1)SC)F
K0400203
202.224
MFCD13172969
2,2-DIFLUORO-1-(4-MORPHOLIN-4-YL-PHENYL)-ETHANONE
Formula: FC(F)C(c1ccc(cc1)N1CCOCC1)=O
K0401203
241.24
MFCD28104037
2,2-DIFLUORO-1-(4-PENTYL-PHENYL)-ETHANONE
Formula: CCCCCc1ccc(C(=O)C(F)F)cc1
K0432203
226.269
MFCD28104068
2,2-DIFLUORO-1-(4-PHENOXY-PHENYL)-ETHANONE
Formula: FC(F)C(c1ccc(Oc2ccccc2)cc1)=O
K0437203
248.231
MFCD16618053
2,2-DIFLUORO-1-(4-PROPYL-PHENYL)-ETHANONE
Formula: O=C(c1ccc(CCC)cc1)C(F)F
K0449203
198.214
MFCD26045124
2,2-DIFLUORO-1-(4-TRIFLUOROMETHOXY-PHENYL)-ETHANONE
Formula: FC(F)C(c1ccc(OC(F)(F)F)cc1)=O
K0527203
240.131
MFCD28104155
2,2-DIFLUORO-1-(4-TRIFLUOROMETHYL-PHENYL)-ETHANONE
Formula: O=C(C(F)F)c1ccc(C(F)(F)F)cc1
K0524203
224.132
MFCD16618059
2,2-DIFLUORO-1-(4-TRIFLUOROMETHYLSULFANYL-PHENYL)-ETHANONE
Formula: FC(F)C(c1ccc(SC(F)(F)F)cc1)=O
K0625203
256.196
MFCD28104234
2,2-DIFLUORO-1-(4-VINYL-PHENYL)-ETHANONE
Formula: FC(F)C(c1ccc(cc1)C=C)=O
K0462203
182.171
MFCD13172655
2,2-DIFLUORO-1-(5-FLUORO-2-METHOXY-PHENYL)-ETHANONE
Formula: O=C(C(F)F)c1cc(F)ccc1OC
K0260203
204.15
MFCD20920960
2,2-DIFLUORO-1-(5-FLUORO-2-METHYL-PHENYL)-ETHANONE
Formula: Cc1c(cc(cc1)F)C(=O)C(F)F
K0270203
188.151
MFCD20921036
2,2-DIFLUORO-1-(5-METHYL-THIOPHEN-2-YL)-ETHANONE
Formula: Cc1sc(cc1)C(C(F)F)=O
K0397203
176.186
MFCD26045098
2,2-DIFLUORO-1-(6-METHOXY-NAPHTHALEN-2-YL)-ETHANONE
Formula: FC(F)C(=O)c1cc2ccc(OC)cc2cc1
K0325203
236.22
MFCD20921125
2,2-DIFLUORO-1-[2-(1,1,2,2-TETRAFLUORO-ETHOXY)-PHENYL]-ETHANONE
Formula: FC(F)(C(F)F)Oc1ccccc1C(C(F)F)=O
K0643203
272.149
MFCD28104600
2,2-DIFLUORO-1-[3-(1,1,2,2-TETRAFLUORO-ETHOXY)-PHENYL]-ETHANONE
Formula: FC(F)C(F)(F)Oc1cccc(C(C(F)F)=O)c1
K0644203
272.149
MFCD28104667
2,2-DIFLUORO-1-[3-(3-FLUORO-BENZYLOXY)-PHENYL]-ETHANONE
Formula: FC(F)C(=O)c1cccc(OCc2cc(F)ccc2)c1
K0251203
280.249
MFCD28103844
2,2-DIFLUORO-1-[4-(1,1,2,2-TETRAFLUORO-ETHOXY)-PHENYL]-ETHANONE
Formula: FC(F)C(F)(F)Oc1ccc(cc1)C(=O)C(F)F
K0635203
272.149
MFCD28104369
2,2-DIFLUORO-1-[4-(2-PYRROLIDIN-1-YL-ETHOXY)-PHENYL]-ETHANONE
Formula: FC(F)C(c1ccc(cc1)OCCN1CCCC1)=O
K0532203
269.294
MFCD28104166
2,2-DIFLUORO-1-M-TOLYL-ETHANONE
CAS:50562-05-5
Formula: O=C(C(F)F)c1cc(ccc1)C
K0375203
170.16
MFCD16618101
2,2-DIFLUORO-1-NAPHTHALEN-1-YL-ETHANONE
CAS:715-80-0
Formula: O=C(c1c2c(ccc1)cccc2)C(F)F
K0403203
206.194
MFCD13173095
2,2-DIFLUORO-1-NAPHTHALEN-2-YL-ETHANONE
Formula: FC(F)C(=O)c1ccc2ccccc2c1
K0404203
206.194
MFCD16618115
2,2-DIFLUORO-1-O-TOLYL-ETHANONE
CAS:703-42-4
Formula: Cc1ccccc1C(C(F)F)=O
K0374203
170.16
MFCD16618123
2,2-DIFLUORO-1-P-TOLYL-ETHANONE
CAS:704-36-9
Formula: Cc1ccc(cc1)C(C(F)F)=O
K0376203
170.16
MFCD16618098
2,2-DIFLUORO-1-PENTAFLUOROPHENYL-ETHANONE
Formula: Fc1c(F)c(F)c(c(c1F)F)C(C(F)F)=O
K0424203
246.085
MFCD28104051
2,2-DIFLUORO-1-PENTAMETHYLPHENYL-ETHANONE
Formula: Cc1c(c(C)c(C)c(C)c1C)C(=O)C(F)F
K0426203
226.269
MFCD28104061
2,2-DIFLUORO-1-PHENANTHREN-9-YL-ETHANONE
Formula: FC(F)C(c1c2ccccc2c2ccccc2c1)=O
K0434203
256.254
MFCD28104081
2,2-DIFLUORO-1-THIOPHEN-2-YL-ETHANONE
CAS:2991-99-3
Formula: O=C(c1sccc1)C(F)F
K0478203
162.159
MFCD16618121
2,2-DIFLUORO-BENZO[1,3]DIOXOLE-4-CARBOXYLIC ACID ETHYL ESTER
CAS:773135-44-7
Formula: CCOC(c1cccc2c1OC(O2)(F)F)=O
EE9846
230.17
MFCD06204507
2,2-DIFLUORO-BENZO[1,3]DIOXOLE-5-CARBOXYLIC ACID ETHYL ESTER
CAS:157489-19-5
Formula: FC1(Oc2c(cc(C(=O)OCC)cc2)O1)F
EE9847
230.17
MFCD06204508
2,2-DIFLUOROBENZO-1,3-DIOXOL-5-YLMAGNESIUM BROMIDE, 0.50 M IN 2-METHF
CAS:189035-40-3
Formula: c12c(ccc(c1)[Mg]Br)OC(O2)(F)F
G1709
261.314
MFCD25367642
2,2-DIFLUOROBENZO-1,3-DIOXOL-5-YLMAGNESIUM BROMIDE, 0.50 M IN THF
CAS:189035-40-3
Formula: c12c(ccc(c1)[Mg]Br)OC(O2)(F)F
T1709
261.314
MFCD25367642
2,2-DIFLUOROBENZO-1,3-DIOXOL-5-YLZINC BROMIDE, 0.50 M IN THF
Formula: c12c(ccc(c1)[Zn]Br)OC(O2)(F)F
ZT1709
302.372
MFCD25367653
2,2-DIMETHOXYPROPYL)ZINC BROMIDE, 0.50 M IN THF
Formula: [Zn](CC(OC)(OC)C)Br
ZT1262
248.416
MFCD22685691
2,2-DIMETHYL-1-(2,3,4,5,6-PENTAMETHYLPHENYL)BUTAN-1-ONE
Formula: CCC(C)(C)C(=O)c1c(C)c(c(C)c(c1C)C)C
K0426285
246.396
MFCD19493265
2,2-DIMETHYL-1-(2,3,5,6-TETRAMETHYL-PHENYL)-PROPAN-1-ONE
Formula: O=C(c1c(C)c(cc(c1C)C)C)C(C)(C)C
K0477213
218.342
MFCD11105445
2,2-DIMETHYL-1-(2,3,5,6-TETRAMETHYLPHENYL)BUTAN-1-ONE
Formula: O=C(C(CC)(C)C)c1c(c(cc(c1C)C)C)C
K0477285
232.369
MFCD19493262
2,2-DIMETHYL-1-(2,3,5-TRICHLORO-PHENYL)-PROPAN-1-ONE
Formula: Clc1c(cc(cc1C(=O)C(C)(C)C)Cl)Cl
K1036213
265.569
MFCD28105173
2,2-DIMETHYL-1-(2,3,5-TRICHLOROPHENYL)BUTAN-1-ONE
Formula: CC(C)(CC)C(=O)c1c(Cl)c(cc(Cl)c1)Cl
K1036285
279.596
MFCD28105216
2,2-DIMETHYL-1-(2,4,5-TRIFLUOROPHENYL)BUTAN-1-ONE
Formula: CC(CC)(C)C(c1cc(c(cc1F)F)F)=O
K1581285
230.232
MFCD28107349
2,2-DIMETHYL-1-(2,4,5-TRIFLUOROPHENYL)PROPAN-1-ONE
Formula: Fc1c(C(=O)C(C)(C)C)cc(F)c(c1)F
K1581213
216.205
MFCD28107312
2,2-DIMETHYL-1-(2,4,5-TRIMETHYL-PHENYL)-PROPAN-1-ONE
Formula: O=C(c1c(cc(c(C)c1)C)C)C(C)(C)C
K0498213
204.315
MFCD20921389
2,2-DIMETHYL-1-(2,4,5-TRIMETHYLPHENYL)BUTAN-1-ONE
Formula: Cc1c(C(C(C)(C)CC)=O)cc(C)c(C)c1
K0498285
218.342
MFCD28409890
2,2-DIMETHYL-1-(2,4,6-TRIISOPROPYL-PHENYL)-PROPAN-1-ONE
Formula: CC(C)c1cc(C(C)C)cc(C(C)C)c1C(=O)C(C)(C)C
K0490213
288.477
MFCD28104124
2,2-DIMETHYL-1-(2,4,6-TRIMETHYL-PHENYL)-PROPAN-1-ONE
Formula: Cc1cc(C)c(c(C)c1)C(=O)C(C)(C)C
K0499213
204.315
MFCD11210322
2,2-DIMETHYL-1-(2-(1,1,2,2-TETRAFLUOROETHOXY)PHENYL)BUTAN-1-ONE
Formula: FC(F)C(Oc1c(C(C(C)(C)CC)=O)cccc1)(F)F
K0643285
292.276
MFCD28104644
2,2-DIMETHYL-1-(2-(METHYLTHIO)PHENYL)BUTAN-1-ONE
Formula: CC(C)(C(c1ccccc1SC)=O)CC
K0398285
222.352
MFCD03841128
2,2-DIMETHYL-1-(2-(TRIFLUOROMETHOXY)PHENYL)BUTAN-1-ONE
Formula: O=C(c1c(OC(F)(F)F)cccc1)C(CC)(C)C
K0525285
260.258
MFCD28410014
2,2-DIMETHYL-1-(2-(TRIFLUOROMETHYL)PHENYL)BUTAN-1-ONE
Formula: FC(F)(F)c1ccccc1C(=O)C(C)(C)CC
K0522285
244.259
MFCD03841147
2,2-DIMETHYL-1-(2-METHYL-[1,1'-BIPHENYL]-3-YL)BUTAN-1-ONE
Formula: CC(C)(C(c1c(c(ccc1)c1ccccc1)C)=O)CC
K0346285
266.387
MFCD28409072
2,2-DIMETHYL-1-(2-METHYL-3-(TRIFLUOROMETHYL)PHENYL)BUTAN-1-ONE
Formula: O=C(C(CC)(C)C)c1c(C)c(ccc1)C(F)(F)F
K0639285
258.286
MFCD28410906
2,2-DIMETHYL-1-(2-METHYL-3-TRIFLUOROMETHYL-PHENYL)-PROPAN-1-ONE
Formula: FC(F)(F)c1cccc(c1C)C(C(C)(C)C)=O
K0639213
244.259
MFCD28104528
2,2-DIMETHYL-1-(2-METHYL-BIPHENYL-3-YL)-PROPAN-1-ONE
Formula: CC(C)(C)C(=O)c1cccc(c1C)c1ccccc1
K0346213
252.36
MFCD28103997
2,2-DIMETHYL-1-(2-METHYL-NAPHTHALEN-1-YL)-PROPAN-1-ONE
Formula: O=C(c1c(ccc2ccccc12)C)C(C)(C)C
K0361213
226.321
MFCD03002180
2,2-DIMETHYL-1-(2-METHYLNAPHTHALEN-1-YL)BUTAN-1-ONE
Formula: CC(C)(C(=O)c1c(ccc2c1cccc2)C)CC
K0361285
240.348
MFCD25587178
2,2-DIMETHYL-1-(2-METHYLSULFANYL-PHENYL)-PROPAN-1-ONE
Formula: O=C(c1c(SC)cccc1)C(C)(C)C
K0398213
208.325
MFCD03841173
2,2-DIMETHYL-1-(2-TRIFLUOROMETHOXY-PHENYL)-PROPAN-1-ONE
Formula: O=C(C(C)(C)C)c1ccccc1OC(F)(F)F
K0525213
246.231
MFCD17390038
2,2-DIMETHYL-1-(2-TRIFLUOROMETHYL-PHENYL)-PROPAN-1-ONE
Formula: FC(F)(F)c1ccccc1C(=O)C(C)(C)C
K0522213
230.232
MFCD03841190
2,2-DIMETHYL-1-(3,4,5-TRIFLUORO-PHENYL)-PROPAN-1-ONE
CAS:898789-80-5
Formula: CC(C)(C)C(=O)c1cc(c(c(F)c1)F)F
K0489213
216.205
MFCD03841205
2,2-DIMETHYL-1-(3,4,5-TRIFLUOROPHENYL)BUTAN-1-ONE
Formula: O=C(C(C)(C)CC)c1cc(c(c(F)c1)F)F
K0489285
230.232
MFCD03841162
2,2-DIMETHYL-1-(3-(1,1,2,2-TETRAFLUOROETHOXY)PHENYL)BUTAN-1-ONE
Formula: O=C(c1cc(OC(C(F)F)(F)F)ccc1)C(CC)(C)C
K0644285
292.276
MFCD28104707
2,2-DIMETHYL-1-(3-(METHYLTHIO)PHENYL)BUTAN-1-ONE
Formula: CSc1cc(C(=O)C(C)(C)CC)ccc1
K0399285
222.352
MFCD28409345
2,2-DIMETHYL-1-(3-(TRIFLUOROMETHOXY)PHENYL)BUTAN-1-ONE
Formula: O=C(c1cccc(c1)OC(F)(F)F)C(CC)(C)C
K0526285
260.258
MFCD28410048
2,2-DIMETHYL-1-(3-(TRIFLUOROMETHYL)PHENYL)BUTAN-1-ONE
Formula: FC(F)(F)c1cccc(c1)C(=O)C(CC)(C)C
K0523285
244.259
MFCD03841148
2,2-DIMETHYL-1-(3-METHYL-THIOPHEN-2-YL)-PROPAN-1-ONE
Formula: Cc1c(scc1)C(C(C)(C)C)=O
K0396213
182.286
MFCD16150429
2,2-DIMETHYL-1-(3-METHYLSULFANYL-PHENYL)-PROPAN-1-ONE
Formula: O=C(c1cc(ccc1)SC)C(C)(C)C
K0399213
208.325
MFCD20921208
2,2-DIMETHYL-1-(3-METHYLTHIOPHEN-2-YL)BUTAN-1-ONE
Formula: CCC(C(c1sccc1C)=O)(C)C
K0396285
196.314
MFCD16844561
2,2-DIMETHYL-1-(3-TRIFLUOROMETHOXY-PHENYL)-PROPAN-1-ONE
Formula: O=C(C(C)(C)C)c1cc(OC(F)(F)F)ccc1
K0526213
246.231
MFCD17602174
2,2-DIMETHYL-1-(3-TRIFLUOROMETHYL-PHENYL)-PROPAN-1-ONE
Formula: CC(C(c1cccc(C(F)(F)F)c1)=O)(C)C
K0523213
230.232
MFCD03841191
2,2-DIMETHYL-1-(4'-PROPYL-[1,1'-BIPHENYL]-4-YL)BUTAN-1-ONE
Formula: CCC(C(c1ccc(cc1)c1ccc(cc1)CCC)=O)(C)C
K0447285
294.441
MFCD28409715
2,2-DIMETHYL-1-(4'-PROPYL-BIPHENYL-4-YL)-PROPAN-1-ONE
Formula: CC(C)(C)C(=O)c1ccc(c2ccc(cc2)CCC)cc1
K0447213
280.414
MFCD28104095
2,2-DIMETHYL-1-(4-((TRIFLUOROMETHYL)THIO)PHENYL)BUTAN-1-ONE
Formula: FC(F)(F)Sc1ccc(C(C(C)(C)CC)=O)cc1
K0625285
276.323
MFCD28410488
2,2-DIMETHYL-1-(4-(1,1,2,2-TETRAFLUOROETHOXY)PHENYL)BUTAN-1-ONE
Formula: FC(F)C(Oc1ccc(C(C(CC)(C)C)=O)cc1)(F)F
K0635285
292.276
MFCD28104413
2,2-DIMETHYL-1-(4-(2-(PYRROLIDIN-1-YL)ETHOXY)PHENYL)BUTAN-1-ONE
Formula: O=C(C(C)(C)CC)c1ccc(cc1)OCCN1CCCC1
K0532285
289.421
MFCD28410169
2,2-DIMETHYL-1-(4-(METHYLTHIO)PHENYL)BUTAN-1-ONE
Formula: O=C(C(CC)(C)C)c1ccc(SC)cc1
K0400285
222.352
MFCD03841129
2,2-DIMETHYL-1-(4-(TRIFLUOROMETHOXY)PHENYL)BUTAN-1-ONE
Formula: FC(F)(F)Oc1ccc(C(C(C)(C)CC)=O)cc1
K0527285
260.258
MFCD28410084
2,2-DIMETHYL-1-(4-(TRIFLUOROMETHYL)PHENYL)BUTAN-1-ONE
Formula: FC(F)(F)c1ccc(cc1)C(=O)C(C)(C)CC
K0524285
244.259
MFCD03841149
2,2-DIMETHYL-1-(4-METHYL-NAPHTHALEN-1-YL)-PROPAN-1-ONE
Formula: CC(C(c1c2ccccc2c(cc1)C)=O)(C)C
K0362213
226.321
MFCD20086066
2,2-DIMETHYL-1-(4-METHYLNAPHTHALEN-1-YL)BUTAN-1-ONE
Formula: CCC(C)(C)C(c1c2c(cccc2)c(C)cc1)=O
K0362285
240.348
MFCD20071219
2,2-DIMETHYL-1-(4-METHYLSULFANYL-PHENYL)-PROPAN-1-ONE
CAS:73242-19-0
Formula: CSc1ccc(cc1)C(=O)C(C)(C)C
K0400213
208.325
MFCD00026313
2,2-DIMETHYL-1-(4-MORPHOLIN-4-YL-PHENYL)-PROPAN-1-ONE
Formula: CC(C)(C)C(c1ccc(cc1)N1CCOCC1)=O
K0401213
247.34
MFCD28104039
2,2-DIMETHYL-1-(4-MORPHOLINOPHENYL)BUTAN-1-ONE
Formula: O=C(C(C)(C)CC)c1ccc(cc1)N1CCOCC1
K0401285
261.367
MFCD28409418
2,2-DIMETHYL-1-(4-PENTYL-PHENYL)-PROPAN-1-ONE
Formula: O=C(c1ccc(CCCCC)cc1)C(C)(C)C
K0432213
232.369
MFCD28104070
2,2-DIMETHYL-1-(4-PENTYLPHENYL)BUTAN-1-ONE
Formula: CCC(C(c1ccc(CCCCC)cc1)=O)(C)C
K0432285
246.396
MFCD28409585
2,2-DIMETHYL-1-(4-PHENOXY-PHENYL)-PROPAN-1-ONE
CAS:55814-54-5
Formula: CC(C(c1ccc(cc1)Oc1ccccc1)=O)(C)C
K0437213
254.332
MFCD00009856
2,2-DIMETHYL-1-(4-PHENOXYPHENYL)BUTAN-1-ONE
Formula: CCC(C)(C)C(=O)c1ccc(Oc2ccccc2)cc1
K0437285
268.359
MFCD28409671
2,2-DIMETHYL-1-(4-PROPYL-PHENYL)-PROPAN-1-ONE
Formula: CC(C)(C)C(c1ccc(CCC)cc1)=O
K0449213
204.315
MFCD11105503
2,2-DIMETHYL-1-(4-PROPYLPHENYL)BUTAN-1-ONE
Formula: CCC(C)(C)C(=O)c1ccc(CCC)cc1
K0449285
218.342
MFCD16844528
2,2-DIMETHYL-1-(4-TRIFLUOROMETHYL-PHENYL)-PROPAN-1-ONE
Formula: FC(F)(F)c1ccc(cc1)C(=O)C(C)(C)C
K0524213
230.232
MFCD03841192
2,2-DIMETHYL-1-(4-TRIFLUOROMETHYLSULFANYL-PHENYL)-PROPAN-1-ONE
Formula: O=C(C(C)(C)C)c1ccc(cc1)SC(F)(F)F
K0625213
262.296
MFCD28104236
2,2-DIMETHYL-1-(4-VINYL-PHENYL)-PROPAN-1-ONE
Formula: C=Cc1ccc(C(=O)C(C)(C)C)cc1
K0462213
188.272
MFCD28104105
2,2-DIMETHYL-1-(4-VINYLPHENYL)BUTAN-1-ONE
Formula: C=Cc1ccc(C(C(CC)(C)C)=O)cc1
K0462285
202.299
MFCD28409786
2,2-DIMETHYL-1-(5-METHYL-THIOPHEN-2-YL)-PROPAN-1-ONE
Formula: Cc1ccc(C(C(C)(C)C)=O)s1
K0397213
182.286
MFCD11210818
2,2-DIMETHYL-1-(5-METHYLTHIOPHEN-2-YL)BUTAN-1-ONE
Formula: CCC(C)(C)C(c1ccc(C)s1)=O
K0397285
196.314
MFCD16844535
2,2-DIMETHYL-1-(M-TOLYL)BUTAN-1-ONE
Formula: Cc1cccc(C(=O)C(CC)(C)C)c1
K0375285
190.288
MFCD03841117
2,2-DIMETHYL-1-(NAPHTHALEN-1-YL)BUTAN-1-ONE
Formula: CCC(C)(C)C(=O)c1c2c(cccc2)ccc1
K0403285
226.321
MFCD20071211
2,2-DIMETHYL-1-(NAPHTHALEN-2-YL)BUTAN-1-ONE
Formula: O=C(C(CC)(C)C)c1ccc2c(cccc2)c1
K0404285
226.321
MFCD28409470
2,2-DIMETHYL-1-(O-TOLYL)BUTAN-1-ONE
Formula: CCC(C(=O)c1c(cccc1)C)(C)C
K0374285
190.288
MFCD03841116
2,2-DIMETHYL-1-(P-TOLYL)BUTAN-1-ONE
Formula: CC(C)(CC)C(c1ccc(cc1)C)=O
K0376285
190.288
MFCD03841118
2,2-DIMETHYL-1-(PERFLUOROPHENYL)BUTAN-1-ONE
Formula: Fc1c(F)c(c(F)c(F)c1C(C(CC)(C)C)=O)F
K0424285
266.213
MFCD28409508
2,2-DIMETHYL-1-(PHENANTHREN-9-YL)BUTAN-1-ONE
Formula: CCC(C(c1c2c(c3c(cccc3)c1)cccc2)=O)(C)C
K0434285
276.382
MFCD28409634
2,2-DIMETHYL-1-(THIOPHEN-2-YL)BUTAN-1-ONE
Formula: CC(C)(CC)C(=O)c1cccs1
K0478285
182.286
MFCD16844534
2,2-DIMETHYL-1-[2-(1,1,2,2-TETRAFLUORO-ETHOXY)-PHENYL]-PROPAN-1-ONE
Formula: FC(F)C(F)(F)Oc1c(cccc1)C(C(C)(C)C)=O
K0643213
278.249
MFCD28104603
2,2-DIMETHYL-1-[3-(1,1,2,2-TETRAFLUORO-ETHOXY)-PHENYL]-PROPAN-1-ONE
Formula: FC(F)C(Oc1cccc(C(=O)C(C)(C)C)c1)(F)F
K0644213
278.249
MFCD28104669
2,2-DIMETHYL-1-[4-(1,1,2,2-TETRAFLUORO-ETHOXY)-PHENYL]-PROPAN-1-ONE
Formula: O=C(C(C)(C)C)c1ccc(OC(F)(F)C(F)F)cc1
K0635213
278.249
MFCD28104372
2,2-DIMETHYL-1-[4-(2-PYRROLIDIN-1-YL-ETHOXY)-PHENYL]-PROPAN-1-ONE
Formula: O=C(c1ccc(OCCN2CCCC2)cc1)C(C)(C)C
K0532213
275.394
MFCD16343242
2,2-DIMETHYL-1-M-TOLYL-PROPAN-1-ONE
CAS:50390-49-3
Formula: Cc1cc(C(C(C)(C)C)=O)ccc1
K0375213
176.261
MFCD03841163
2,2-DIMETHYL-1-NAPHTHALEN-1-YL-PROPAN-1-ONE
Formula: O=C(C(C)(C)C)c1cccc2ccccc21
K0403213
212.294
MFCD05863480
2,2-DIMETHYL-1-NAPHTHALEN-2-YL-PROPAN-1-ONE
Formula: O=C(c1ccc2c(cccc2)c1)C(C)(C)C
K0404213
212.294
MFCD00229717
2,2-DIMETHYL-1-O-TOLYL-PROPAN-1-ONE
CAS:2041-37-4
Formula: Cc1c(cccc1)C(C(C)(C)C)=O
K0374213
176.261
MFCD00032321
2,2-DIMETHYL-1-P-TOLYL-PROPAN-1-ONE
CAS:30314-44-4
Formula: CC(C(c1ccc(C)cc1)=O)(C)C
K0376213
176.261
MFCD00090006
2,2-DIMETHYL-1-PENTAFLUOROPHENYL-PROPAN-1-ONE
Formula: Fc1c(c(F)c(F)c(F)c1F)C(=O)C(C)(C)C
K0424213
252.186
MFCD26680862
2,2-DIMETHYL-1-PENTAMETHYLPHENYL-PROPAN-1-ONE
Formula: Cc1c(c(C)c(c(C(C(C)(C)C)=O)c1C)C)C
K0426213
232.369
MFCD11210272
2,2-DIMETHYL-1-PHENANTHREN-9-YL-PROPAN-1-ONE
Formula: O=C(c1cc2c(cccc2)c2ccccc12)C(C)(C)C
K0434213
262.355
MFCD28104083
2,2-DIMETHYL-1-PHENYL-PROPAN-1-ONE
CAS:938-16-9
Formula: O=C(c1ccccc1)C(C)(C)C
K0440213
162.234
MFCD00008844
2,2-DIMETHYL-1-PHENYLBUTAN-1-ONE
Formula: CC(C(=O)c1ccccc1)(C)CC
K0440285
176.261
MFCD00102052
2,2-DIMETHYL-1-THIOPHEN-2-YL-PROPAN-1-ONE
CAS:20409-48-7
Formula: CC(C)(C)C(c1cccs1)=O
K0478213
168.259
MFCD00051668
2,2-DIMETHYL-2'-FLUOROBUTYROPHENONE
CAS:898765-76-9
Formula: C12H15FO
6121-37
194.251
MFCD03841146
2,2-DIMETHYL-2'-FLUOROPROPIOPHENONE
CAS:560085-36-1
Formula: C11H13FO
6122-37
180.224
MFCD03841189
2,2-DIMETHYL-2'-METHOXYBUTYROPHENONE
CAS:898765-04-3
Formula: C13H18O2
6121-05
206.287
MFCD03841119
2,2-DIMETHYL-2'-METHOXYPROPIOPHENONE
CAS:22526-24-5
Formula: C12H16O2
6122-05
192.26
MFCD03841164
2,2-DIMETHYL-2'-THIOMETHYLBUTYROPHENONE
CAS:898765-28-1
Formula: C13H18OS
6121-14
222.352
MFCD03841128
2,2-DIMETHYL-2'-THIOMETHYLPROPIOPHENONE
CAS:507272-92-6
Formula: C12H16OS
6122-14
208.325
MFCD03841173
2,2-DIMETHYL-2'-TRIFLUOROMETHYLBUTYROPHENONE
CAS:898765-78-1
Formula: C13H15F3O
6121-43
244.259
MFCD03841147
2,2-DIMETHYL-2'-TRIFLUOROMETHYLPROPIOPHENONE
CAS:898766-36-4
Formula: C12H13F3O
6122-43
230.232
MFCD03841190
2,2-DIMETHYL-3',4',5'-TRIFLUOROBUTYROPHENONE
CAS:898766-08-0
Formula: C12H13F3O
6121-61
230.232
MFCD03841162
2,2-DIMETHYL-3',4',5'-TRIFLUOROPROPIOPHENONE
CAS:898789-80-5
Formula: C11H11F3O
6122-61
216.205
MFCD03841205
2,2-DIMETHYL-3'-FLUOROBUTYROPHENONE
CAS:898765-46-3
Formula: C12H15FO
6121-22
194.251
MFCD03841134
2,2-DIMETHYL-3'-FLUOROPROPIOPHENONE
CAS:62681-85-0
Formula: C11H13FO
6122-22
180.224
MFCD03841178
2,2-DIMETHYL-3'-METHOXYBUTYROPHENONE
CAS:898765-06-5
Formula: C13H18O2
6121-06
206.287
MFCD03841120
2,2-DIMETHYL-3'-METHOXYPROPIOPHENONE
CAS:32578-12-4
Formula: C12H16O2
6122-06
192.26
MFCD03841165
2,2-DIMETHYL-3'-TRIFLUOROMETHYLBUTYROPHENONE
CAS:898765-80-5
Formula: C13H15F3O
6121-44
244.259
MFCD03841148
2,2-DIMETHYL-3'-TRIFLUOROMETHYLPROPIOPHENONE
CAS:898766-39-7
Formula: C12H13F3O
6122-44
230.232
MFCD03841191
2,2-DIMETHYL-4'-FLUOROBUTYROPHENONE
CAS:898765-49-6
Formula: C12H15FO
6121-23
194.251
MFCD03841135
2,2-DIMETHYL-4'-FLUOROPROPIOPHENONE
CAS:64436-59-5
Formula: C11H13FO
6122-23
180.224
MFCD01938606
2,2-DIMETHYL-4'-METHOXYBUTYROPHENONE
CAS:898765-08-7
Formula: C13H18O2
6121-07
206.287
MFCD03841121
2,2-DIMETHYL-4'-METHOXYPROPIOPHENONE
CAS:2040-26-8
Formula: C12H16O2
6122-07
192.26
MFCD03841166
2,2-DIMETHYL-4'-THIOMETHYLBUTYROPHENONE
CAS:898765-31-6
Formula: C13H18OS
6121-15
222.352
MFCD03841129
2,2-DIMETHYL-4'-THIOMETHYLPROPIOPHENONE
CAS:73242-19-0
Formula: C12H16OS
6122-15
208.325
MFCD00026313
2,2-DIMETHYL-4'-TRIFLUOROMETHYLBUTYROPHENONE
CAS:898765-82-7
Formula: C13H15F3O
6121-45
244.259
MFCD03841149
2,2-DIMETHYL-4'-TRIFLUOROMETHYLPROPIOPHENONE
CAS:586346-65-8
Formula: C12H13F3O
6122-45
230.232
MFCD03841192
2,2-DIMETHYL-4-(1-NAPHTHYL)-4-OXOBUTYRIC ACID
CAS:854904-16-8
Formula: C16H16O3
7247
256.304
MFCD09801815
2,2-DIMETHYL-4-(2,3-DIMETHYLPHENYL)-4-OXOBUTYRIC ACID
CAS:146645-55-8
Formula: C14H18O3
7299
234.298
MFCD09801863
2,2-DIMETHYL-4-(2,4-DIMETHYLPHENYL)-4-OXOBUTYRIC ACID
Formula: C14H18O3
7301
234.298
MFCD09801865
2,2-DIMETHYL-4-(2,5-DIMETHYLPHENYL)-4-OXOBUTYRIC ACID
CAS:681459-16-5
Formula: C14H18O3
7303
234.298
MFCD01108427
2,2-DIMETHYL-4-(2,6-DIMETHYLPHENYL)-4-OXOBUTYRIC ACID
Formula: C14H18O3
7305
234.298
MFCD09801868
2,2-DIMETHYL-4-(2-METHOXYPHENYL)-4-OXOBUTYRIC ACID
CAS:898766-64-8
Formula: C13H16O4
7075
236.27
MFCD01320132
2,2-DIMETHYL-4-(2-METHYLPHENYL)-4-OXOBUTYRIC ACID
CAS:147484-87-5
Formula: C13H16O3
7241
220.271
MFCD09801811
2,2-DIMETHYL-4-(2-NAPHTHYL)-4-OXOBUTYRIC ACID
CAS:854648-79-6
Formula: C16H16O3
7080
256.304
MFCD01320137
2,2-DIMETHYL-4-(3,4-DIMETHYLPHENYL)-4-OXOBUTYRIC ACID
Formula: C14H18O3
7307
234.298
MFCD09801870
2,2-DIMETHYL-4-(3,5-DIMETHYL-4-METHOXYPHENYL)-4-OXOBUTYRIC ACID
Formula: C15H20O4
7285
264.324
MFCD09801851
2,2-DIMETHYL-4-(3,5-DIMETHYLPHENYL)-4-OXOBUTYRIC ACID
CAS:898765-45-2
Formula: C14H18O3
7035
234.298
MFCD01320051
2,2-DIMETHYL-4-(3-ETHOXYPHENYL)-4-OXOBUTYRIC ACID
Formula: C14H18O4
7251
250.297
MFCD09801819
2,2-DIMETHYL-4-(3-FLUORO-2-METHYLPHENYL)-4-OXOBUTYRIC ACID
Formula: C13H15FO3
7318
238.261
MFCD09801879
2,2-DIMETHYL-4-(3-FLUORO-4-METHOXYPHENYL)-4-OXOBUTYRIC ACID
Formula: C13H15FO4
7198
254.261
MFCD09801722
2,2-DIMETHYL-4-(3-FLUOROPHENYL)-4-OXOBUTYRIC ACID
CAS:898766-70-6
Formula: C12H13FO3
7078
224.234
MFCD01320135
2,2-DIMETHYL-4-(3-METHOXY-4-METHYLPHENYL)-4-OXOBUTYRIC ACID
Formula: C14H18O4
7326
250.297
MFCD09801887
2,2-DIMETHYL-4-(3-METHOXYPHENYL)-4-OXOBUTYRIC ACID
CAS:898766-61-5
Formula: C13H16O4
7073
236.27
MFCD01320130
2,2-DIMETHYL-4-(3-METHYL-2-THIENYL)-4-OXOBUTYRIC ACID
Formula: C11H14O3S
7289
226.296
MFCD09801855
2,2-DIMETHYL-4-(3-METHYLPHENYL)-4-OXOBUTYRIC ACID
Formula: C13H16O3
7243
220.271
MFCD09801813
2,2-DIMETHYL-4-(4-ETHOXYPHENYL)-4-OXOBUTYRIC ACID
Formula: C14H18O4
7259
250.297
MFCD09801827
2,2-DIMETHYL-4-(4-ETHYLPHENYL)-4-OXOBUTYRIC ACID
Formula: C14H18O3
7267
234.298
MFCD09801834
2,2-DIMETHYL-4-(4-FLUORO-3-METHYLPHENYL)-4-OXOBUTYRIC ACID
Formula: C13H15FO3
7322
238.261
MFCD09801883
2,2-DIMETHYL-4-(4-ISOPROPYLPHENYL)-4-OXOBUTYRIC ACID
Formula: C15H20O3
7263
248.325
MFCD09801831
2,2-DIMETHYL-4-(4-METHOXY-2-METHYLPHENYL)-4-OXOBUTYRIC ACID
Formula: C14H18O4
7324
250.297
MFCD09801885
2,2-DIMETHYL-4-(4-METHOXYPHENYL)-4-OXOBUTYRIC ACID
CAS:15118-48-6
Formula: C13H16O4
7074
236.27
MFCD01320131
2,2-DIMETHYL-4-(4-METHYLPHENYL)-4-OXOBUTYRIC ACID
CAS:71821-98-2
Formula: C13H16O3
7245
220.271
MFCD09801814
2,2-DIMETHYL-4-(5-FLUORO-2-METHOXYPHENYL)-4-OXOBUTYRIC ACID
Formula: C13H15FO4
7332
254.261
MFCD09801892
2,2-DIMETHYL-4-(5-FLUORO-2-METHYLPHENYL)-4-OXOBUTYRIC ACID
Formula: C13H15FO3
7320
238.261
MFCD09801881
2,2-DIMETHYL-4-(5-METHOXY-2-METHYLPHENYL)-4-OXOBUTYRIC ACID
Formula: C14H18O4
7328
250.297
MFCD09801889
2,2-DIMETHYL-4-[2-(ETHYLTHIO)PHENYL]-4-OXOBUTYRIC ACID
Formula: C14H18O3S
7257
266.362
MFCD09801825
2,2-DIMETHYL-4-[2-(METHYLTHIO)PHENYL]-4-OXOBUTYRIC ACID
Formula: C13H16O3S
7249
252.335
MFCD09801817
2,2-DIMETHYL-4-[3,4-(ETHYLENEDIOXY)PHENYL]-4-OXOBUTYRIC ACID
Formula: C14H16O5
7297
264.281
MFCD09801861
2,2-DIMETHYL-4-[3,4-(METHYLENEDIOXY)PHENYL]-4-OXOBUTYRIC ACID
Formula: C13H14O5
7295
250.254
MFCD09801859
2,2-DIMETHYL-4-[3-(N,N-DIMETHYLAMINO)PHENYL]-4-OXOBUTYRIC ACID
Formula: C14H19NO3
7253
249.312
MFCD09801821
2,2-DIMETHYL-4-[4-(N,N-DIMETHYLAMINO)PHENYL]-4-OXOBUTYRIC ACID
Formula: C14H19NO3
7255
249.312
MFCD09801823
2,2-DIMETHYL-4-OXO-4-(2,3,4,5,6-PENTAMETHYLPHENYL)BUTYRIC ACID
Formula: C17H24O3
7283
276.379
MFCD09801849
2,2-DIMETHYL-4-OXO-4-(2,3,5,6-TETRAMETHYLPHENYL)BUTYRIC ACID
Formula: C16H22O3
7281
262.352
MFCD09801847
2,2-DIMETHYL-4-OXO-4-(2,4,5-TRIMETHYLPHENYL)BUTYRIC ACID
Formula: C15H20O3
7277
248.325
MFCD09801843
2,2-DIMETHYL-4-OXO-4-(2,4,6-TRIMETHYLPHENYL)BUTYRIC ACID
CAS:867130-04-9
Formula: C15H20O3
7279
248.325
MFCD09801845
2,2-DIMETHYL-4-OXO-4-(3,4,5-TRIFLUOROPHENYL)BUTRYIC ACID
CAS:898766-72-8
Formula: C12H11F3O3
7079
260.215
MFCD07700143
2,2-DIMETHYL-4-OXO-4-(3,4,5-TRIMETHOXYPHENYL)BUTYRIC ACID
Formula: C15H20O6
7287
296.323
MFCD09801853
2,2-DIMETHYL-4-OXO-4-(4-N-PENTYLPHENYL)BUTYRIC ACID
Formula: C17H24O3
7273
276.379
MFCD09801839
2,2-DIMETHYL-4-OXO-4-(4-N-PROPYLPHENYL)BUTYRIC ACID
Formula: C15H20O3
7271
248.325
MFCD09801837
2,2-DIMETHYL-4-OXO-4-(4-PHENOXYPHENYL)BUTYRIC ACID
Formula: C18H18O4
7261
298.342
MFCD09801829
2,2-DIMETHYL-4-OXO-4-(4-THIOMETHYLPHENYL)BUTRYIC ACID
CAS:898766-73-9
Formula: C13H16O3S
7081
252.335
MFCD01320138
2,2-DIMETHYL-4-OXO-4-PHENYLBUTYRIC ACID
CAS:15116-34-4
Formula: C12H14O3
7022
206.244
MFCD01320038
2,2-DIMETHYLBUTYROPHENONE
CAS:829-10-7
Formula: C12H16O
6121-01
176.261
MFCD00102052
2,2-DIMETHYLHEXANOIC ACID ETHYL ESTER
Formula: CCOC(=O)C(C)(C)CCCC
EE0358
172.27
MFCD11555077
2,2-DIMETHYLNONANAL
Formula: CCCCCCCC(C=O)(C)C
AL0365
170.297
MFCD11553609
2,2-DIMETHYLNONANOIC ACID ETHYL ESTER
Formula: CC(C)(C(=O)OCC)CCCCCCC
EE0365
214.351
MFCD11555081
2,2-DIMETHYLPENTANOIC ACID ETHYL ESTER
Formula: O=C(OCC)C(CCC)(C)C
EE0369
158.243
MFCD11555084
2,2-DIMETHYLPROPIOPHENONE
CAS:938-16-9
Formula: C11H14O
6122-01
162.234
MFCD00008844
2,2-DIMETHYLPROPYL 2-PYRIDYL KETONE
CAS:138835-86-6
Formula: C11H15NO
5569-13
177.248
MFCD07699214
2,2-DIMETHYLPROPYL 5-(1,3-DIOXOLAN-2-YL)-2-THIENYL KETONE
CAS:898772-86-6
Formula: C13H18O3S
5567-13
254.351
MFCD07699108
2,2-DIMETHYLPROPYLMAGNESIUM CHLORIDE
CAS:13132-23-5
Formula: C5H11ClMg
3210
130.908
MFCD00061550
2,2-DIMETHYLPROPYLMAGNESIUM CHLORIDE
Formula: C5H11ClMg
3253
130.908
MFCD00061550
2,2-DIMETHYLPROPYLMAGNESIUM CHLORIDE, 1.0 M IN 2-METHF
CAS:13132-23-5
Formula: [Mg](CC(C)(C)C)Cl
G0217
130.908
MFCD00061550
2,3',4',5'-TETRAFLUOROBENZOPHENONE
CAS:746651-93-4
Formula: C13H6F4O
5042
254.186
MFCD01319929
2,3',4'-TRICHLOROBENZOPHENONE
CAS:264870-83-9
Formula: C13H7Cl3O
5182-47
285.559
MFCD09801459
2,3',5'-TRICHLOROBENZOPHENONE
Formula: C13H7Cl3O
5182-48
285.559
MFCD09801460
2,3'-BIPYRIDINE
CAS:581-50-0
Formula: C10H8N2
11154
156.189
MFCD00006215
2,3'-DIBROMO-5-METHOXYBENZOPHENONE
CAS:746651-87-6
Formula: C14H10Br2O2
5028
370.043
MFCD00672038
2,3'-DIBROMOBENZOPHENONE
CAS:746651-76-3
Formula: C13H8Br2O
5006
340.016
MFCD00672018
2,3'-DICHLORO-4'-FLUOROBENZOPHENONE
Formula: C13H7Cl2FO
5185-14
269.105
MFCD09801462
2,3'-DICHLORO-4'-METHYLBENZOPHENONE
CAS:861307-17-7
Formula: C14H10Cl2O
5188-14
265.141
MFCD09801494
2,3'-DICHLORO-5'-FLUOROBENZOPHENONE
Formula: C13H7Cl2FO
5186-14
269.105
MFCD09801476
2,3'-DICHLOROBENZOPHENONE
CAS:77008-58-3
Formula: C13H8Cl2O
5182-15
251.114
MFCD09055155
2,3'-DIFURYLMETHANOL
Formula: OC(c1ccco1)c1cocc1
NV01818
164.162
MFCD07782429
2,3'-DIMETHOXYBENZOPHENONE
CAS:21554-74-5
Formula: C15H14O3
5050-05
242.277
MFCD01311507
2,3'-DITHIENYLMETHANOL
Formula: OC(c1ccsc1)c1sccc1
NV01833
196.292
MFCD07782447
2,3,4,5,6-PENTACHLOROPHENYLZINC CHLORIDE, 0.50 M IN THF
Formula: c1(c(c(c(c(c1Cl)[Zn]Cl)Cl)Cl)Cl)Cl
ZT1723
350.155
MFCD25367666
2,3,4,5,6-PENTAFLUOROBENZALDEHYDE
CAS:653-37-2
Formula: Fc1c(c(F)c(c(F)c1F)C=O)F
AL0424
196.077
MFCD00003303
2,3,4,5,6-PENTAFLUOROBENZYLMAGNESIUM BROMIDE, 0.25 M IN 2-METHF
CAS:880347-98-8
Formula: [Mg](Br)Cc1c(c(c(c(c1F)F)F)F)F
G0423
285.302
MFCD11553330
2,3,4,5,6-PENTAFLUOROBENZYLMAGNESIUM BROMIDE, 0.25 M IN ETHER
CAS:880347-98-8
Formula: [Mg](Br)Cc1c(c(c(c(c1F)F)F)F)F
D0423
285.302
MFCD11553330
2,3,4,5,6-PENTAFLUOROBENZYLMAGNESIUM CHLORIDE, 0.25 M IN 2-METHF
Formula: [Mg](Cc1c(c(c(c(c1F)F)F)F)F)Cl
G1364
240.851
MFCD22684735
2,3,4,5,6-PENTAFLUOROBENZYLMAGNESIUM CHLORIDE, 0.25 M IN THF
Formula: [Mg](Cc1c(c(c(c(c1F)F)F)F)F)Cl
T1364
240.851
MFCD22684735
2,3,4,5,6-PENTAFLUOROBENZYLZINC BROMIDE, 0.50 M IN THF
CAS:352534-75-9
Formula: c1(c(c(c(c(c1C[Zn]Br)F)F)F)F)F
ZT0423
326.36
MFCD01311425
2,3,4,5,6-PENTAFLUOROBENZYLZINC CHLORIDE, 0.50 M IN THF
CAS:308796-02-3
Formula: c1(c(c(c(c(c1C[Zn]Cl)F)F)F)F)F
ZT1364
281.909
MFCD02093643
2,3,4,5,6-PENTAFLUOROPHENYL CYCLOHEPTYL KETONE
Formula: Fc1c(F)c(c(F)c(F)c1C(=O)C1CCCCCC1)F
NV03917
292.251
MFCD16250197
2,3,4,5,6-PENTAFLUOROPHENYL CYCLOHEXYL KETONE
Formula: Fc1c(F)c(F)c(c(C(C2CCCCC2)=O)c1F)F
NV03916
278.224
MFCD16250196
2,3,4,5,6-PENTAFLUOROPHENYL CYCLOPENTYL KETONE
Formula: Fc1c(c(F)c(c(F)c1F)F)C(=O)C1CCCC1
NV03915
264.197
MFCD16250195
2,3,4,5,6-PENTAFLUOROPHENYL CYCLOPROPYL KETONE
Formula: Fc1c(c(c(c(F)c1F)C(C1CC1)=O)F)F
NV03914
236.143
MFCD16250194
2,3,4,5,6-PENTAFLUOROPHENYLMAGNESIUM BROMIDE, 0.50 M IN 2-METHF
CAS:879-05-0
Formula: [Mg](Br)c1c(c(c(c(c1F)F)F)F)F
G0424
271.275
MFCD00015720
2,3,4,5,6-PENTAFLUOROPHENYLMAGNESIUM BROMIDE, 0.50 M IN THF
CAS:879-05-0
Formula: [Mg](Br)c1c(c(c(c(c1F)F)F)F)F
T0424
271.275
MFCD00015720
2,3,4,5,6-PENTAFLUOROPHENYLZINC BROMIDE, 0.50 M IN THF
CAS:41242-25-5
Formula: [Zn](Br)c1c(c(c(c(c1F)F)F)F)F
ZT0424
312.333
MFCD22685032
2,3,4,5,6-PENTAMETHYLBENZALDEHYDE
CAS:17432-38-1
Formula: Cc1c(c(C)c(c(C=O)c1C)C)C
AL0426
176.261
MFCD00015560
2,3,4,5,6-PENTAMETHYLBENZOIC ACID
CAS:2243-32-5
Formula: O=C(O)c1c(c(C)c(C)c(c1C)C)C
C0426
192.26
MFCD00013980
2,3,4,5,6-PENTAMETHYLBENZOIC ACID ETHYL ESTER
Formula: CCOC(c1c(C)c(c(C)c(c1C)C)C)=O
EE0426
220.314
MFCD06204367
2,3,4,5,6-PENTAMETHYLBENZYLMAGNESIUM CHLORIDE, 0.25 M IN 2-METHF
Formula: [Mg](Cl)Cc1c(C)c(c(c(c1C)C)C)C
G0425
221.034
MFCD07698757
2,3,4,5,6-PENTAMETHYLBENZYLMAGNESIUM CHLORIDE, 0.25 M IN THF
Formula: [Mg](Cl)Cc1c(C)c(c(c(c1C)C)C)C
T0425
221.034
MFCD07698757
2,3,4,5,6-PENTAMETHYLBENZYLZINC CHLORIDE, 0.50 M IN THF
Formula: [Zn](Cl)Cc1c(C)c(c(c(c1C)C)C)C
ZT0425
262.092
MFCD22685033
2,3,4,5,6-PENTAMETHYLPHENYLMAGNESIUM BROMIDE
CAS:91345-58-3
Formula: C11H15BrMg
3038
251.458
MFCD01311489
2,3,4,5,6-PENTAMETHYLPHENYLMAGNESIUM BROMIDE
CAS:91345-58-3
Formula: C11H15BrMg
3296
251.458
2,3,4,5,6-PENTAMETHYLPHENYLMAGNESIUM BROMIDE, 0.50 M IN 2-METHF
CAS:91345-58-3
Formula: [Mg](Br)c1c(c(C)c(C)c(c1C)C)C
G0426
251.458
MFCD01311489
2,3,4,5,6-PENTAMETHYLPHENYLZINC BROMIDE, 0.50 M IN THF
Formula: [Zn](Br)c1c(c(C)c(C)c(c1C)C)C
ZT0426
292.516
MFCD22685034
2,3,4,5-TETRACHLOROBENZOIC ACID ETHYL ESTER
CAS:119321-79-8
Formula: CCOC(c1cc(c(c(Cl)c1Cl)Cl)Cl)=O
EE9989
287.959
MFCD12024960
2,3,4,5-TETRAFLUORO-6-NITROBENZOIC ACID ETHYL ESTER
Formula: Fc1c(c(c([N+](=O)[O-])c(c1F)C(OCC)=O)F)F
EE9957
267.138
MFCD11046454
2,3,4,5-TETRAFLUOROBENZYLMAGNESIUM CHLORIDE, 0.25 M IN 2-METHF
Formula: [Mg](Cl)Cc1c(c(c(c(c1)F)F)F)F
G0466
222.861
MFCD11553347
2,3,4,5-TETRAFLUOROBENZYLMAGNESIUM CHLORIDE, 0.25 M IN ETHER
Formula: [Mg](Cl)Cc1c(c(c(c(c1)F)F)F)F
D0466
222.861
MFCD11553347
2,3,4,5-TETRAFLUOROBENZYLZINC CHLORIDE, 0.50 M IN THF
Formula: [Zn](Cl)Cc1c(c(c(c(c1)F)F)F)F
ZT0466
263.919
MFCD22685050
2,3,4,5-TETRAFLUOROPHENYL CYCLOHEXYL KETONE
Formula: O=C(C1CCCCC1)c1cc(c(c(F)c1F)F)F
NV03931
260.234
MFCD16250211
2,3,4,5-TETRAFLUOROPHENYL CYCLOPENTYL KETONE
Formula: Fc1c(F)c(cc(c1F)C(=O)C1CCCC1)F
NV03930
246.207
MFCD16250210
2,3,4,5-TETRAFLUOROPHENYL CYCLOPROPYL KETONE
Formula: Fc1cc(c(c(F)c1F)F)C(C1CC1)=O
NV03929
218.152
MFCD16250209
2,3,4,6-TETRAFLUOROBENZOIC ACID ETHYL ESTER
CAS:351354-29-5
Formula: Fc1c(C(=O)OCC)c(cc(F)c1F)F
EE9956
222.141
MFCD14698290
2,3,4-TRIFLUOROBENZYLMAGNESIUM BROMIDE, 0.25 M IN 2-METHF
Formula: [Mg](Br)Cc1c(c(c(cc1)F)F)F
G0482
249.321
MFCD11553356
2,3,4-TRIFLUOROBENZYLMAGNESIUM BROMIDE, 0.25 M IN ETHER
Formula: [Mg](Br)Cc1c(c(c(cc1)F)F)F
D0482
249.321
MFCD11553356
2,3,4-TRIFLUOROBENZYLZINC BROMIDE, 0.50 M IN THF
Formula: [Zn](Br)Cc1c(c(c(cc1)F)F)F
ZT0482
290.379
MFCD22685056
2,3,4-TRIFLUOROPHENYL CYCLOHEXYL KETONE
Formula: O=C(C1CCCCC1)c1c(c(F)c(cc1)F)F
NV03934
242.243
MFCD16250214
2,3,4-TRIFLUOROPHENYL CYCLOPENTYL KETONE
Formula: Fc1c(c(ccc1C(C1CCCC1)=O)F)F
NV03933
228.216
MFCD16250213
2,3,4-TRIFLUOROPHENYL CYCLOPROPYL KETONE
Formula: Fc1c(c(c(C(=O)C2CC2)cc1)F)F
NV03932
200.162
MFCD16250212
2,3,4-TRIMETHOXYBENZALDEHYDE
CAS:2103-57-3
Formula: COc1ccc(c(c1OC)OC)C=O
AL0492
196.205
MFCD00003310
2,3,4-TRIMETHOXYBENZOIC ACID ETHYL ESTER
Formula: CCOC(=O)c1ccc(c(c1OC)OC)OC
EE0492
240.258
MFCD06204287
2,3,4-TRIMETHOXYPHENYLMAGNESIUM BROMIDE, 0.50 M IN 2-METHF
CAS:114605-54-8
Formula: [Mg](Br)c1ccc(c(c1OC)OC)OC
G0492
271.402
MFCD11553364
2,3,4-TRIMETHOXYPHENYLMAGNESIUM BROMIDE, 0.50 M IN THF
CAS:114605-54-8
Formula: [Mg](Br)c1ccc(c(c1OC)OC)OC
T0492
271.402
MFCD11553364
2,3,4-TRIMETHOXYPHENYLZINC BROMIDE, 0.50 M IN THF
Formula: [Zn](Br)c1ccc(c(c1OC)OC)OC
ZT0492
312.46
MFCD22685063
2,3,5,6-TETRAFLUORO-4-METHYL-BENZOIC ACID ETHYL ESTER
CAS:1076197-35-7
Formula: Fc1c(c(F)c(c(C)c1F)F)C(OCC)=O
EE9834
236.168
MFCD11864989
2,3,5,6-TETRAFLUORO-BENZOIC ACID ETHYL ESTER
CAS:259793-41-4
Formula: Fc1c(C(=O)OCC)c(c(F)cc1F)F
EE9864
222.141
MFCD06204464
2,3,5,6-TETRAFLUOROBENZYLMAGNESIUM BROMIDE, 0.25 M IN 2-METHF
Formula: [Mg](Br)Cc1c(c(cc(c1F)F)F)F
G0465
267.312
MFCD11553346
2,3,5,6-TETRAFLUOROBENZYLMAGNESIUM BROMIDE, 0.25 M IN ETHER
Formula: [Mg](Br)Cc1c(c(cc(c1F)F)F)F
D0465
267.312
MFCD11553346
2,3,5,6-TETRAFLUOROBENZYLZINC BROMIDE, 0.50 M IN THF
Formula: [Zn](Br)Cc1c(c(cc(c1F)F)F)F
ZT0465
308.37
MFCD22685049
2,3,5,6-TETRAFLUOROPHENYL-1,4-DIMAGNESIUM BROMIDE, 0.50 M IN 2-METHF
CAS:31103-34-1
Formula: c1(c(c(c(c(c1[Mg]Br)F)F)[Mg]Br)F)F
G2162
356.492
MFCD28103477
2,3,5,6-TETRAFLUOROPHENYL-1,4-DIMAGNESIUM BROMIDE, 0.50 M IN THF
CAS:31103-34-1
Formula: c1(c(c(c(c(c1[Mg]Br)F)F)[Mg]Br)F)F
T2162
356.492
MFCD28103477
2,3,5,6-TETRAFLUOROPHENYLZINC BROMIDE, 0.50 M IN THF
CAS:1391980-71-4
Formula: c1(cc(c(c(c1F)[Zn]Br)F)F)F
ZT2291
294.342
2,3,5,6-TETRAMETHYL-2,2,2-TRIFLUOROACETOPHENONE
Formula: C12H13F3O
6586
230.232
MFCD01319989
2,3,5,6-TETRAMETHYL-BENZOIC ACID ETHYL ESTER
CAS:55352-35-7
Formula: O=C(c1c(c(cc(C)c1C)C)C)OCC
EE9902
206.287
MFCD12024953
2,3,5,6-TETRAMETHYLBENZALDEHYDE
CAS:17432-37-0
Formula: C11H14O
8093
162.234
MFCD02249226
2,3,5,6-TETRAMETHYLBENZALDEHYDE
CAS:17432-37-0
Formula: Cc1c(C=O)c(C)c(cc1C)C
AL0477
162.234
MFCD02249226
2,3,5,6-TETRAMETHYLBENZYLMAGNESIUM CHLORIDE, 0.25 M IN 2-METHF
Formula: [Mg](Cl)Cc1c(c(cc(c1C)C)C)C
G0476
207.007
MFCD11553354
2,3,5,6-TETRAMETHYLBENZYLMAGNESIUM CHLORIDE, 0.25 M IN THF
Formula: [Mg](Cl)Cc1c(c(cc(c1C)C)C)C
T0476
207.007
MFCD11553354
2,3,5,6-TETRAMETHYLBENZYLZINC CHLORIDE, 0.50 M IN THF
Formula: [Zn](Cl)Cc1c(c(cc(c1C)C)C)C
ZT0476
248.065
MFCD22685054
2,3,5,6-TETRAMETHYLPHENYLMAGNESIUM BROMIDE
CAS:75724-98-0
Formula: C10H13BrMg
3047
237.431
MFCD01311498
2,3,5,6-TETRAMETHYLPHENYLMAGNESIUM BROMIDE
CAS:75724-98-0
Formula: C10H13BrMg
3305
237.431
2,3,5,6-TETRAMETHYLPHENYLMAGNESIUM BROMIDE, 0.50 M IN 2-METHF
CAS:75724-98-0
Formula: [Mg](Br)c1c(c(cc(c1C)C)C)C
G0477
237.431
MFCD01311498
2,3,5,6-TETRAMETHYLPHENYLZINC BROMIDE, 0.50 M IN THF
Formula: [Zn](Br)c1c(c(cc(c1C)C)C)C
ZT0477
278.489
MFCD22685055
2,3,5,6-TETRAMETHYLPHENYLZINC IODIDE
CAS:737797-44-3
Formula: C10H13IZn
2192
325.49
MFCD02260180
2,3,5-TRICHLORO-BENZOIC ACID ETHYL ESTER
Formula: Clc1cc(cc(c1Cl)C(=O)OCC)Cl
EE9783
253.514
MFCD06204331
2,3,5-TRICHLOROPHENYLMAGNESIUM BROMIDE, 0.50 M IN 2-METHF
Formula: [Mg](c1c(c(cc(c1)Cl)Cl)Cl)Br
G1036
284.658
MFCD18253721
2,3,5-TRICHLOROPHENYLMAGNESIUM BROMIDE, 0.50 M IN THF
Formula: [Mg](c1c(c(cc(c1)Cl)Cl)Cl)Br
T1036
284.658
MFCD18253721
2,3,5-TRICHLOROPHENYLZINC BROMIDE, 0.50 M IN THF
Formula: [Zn](c1c(c(cc(c1)Cl)Cl)Cl)Br
ZT1036
325.716
MFCD22685480
2,3,5-TRIFLUORO-BENZOIC ACID ETHYL ESTER
CAS:773135-01-6
Formula: Fc1c(C(OCC)=O)cc(F)cc1F
EE9905
204.15
MFCD06204430
2,3,5-TRIFLUOROBENZYLMAGNESIUM BROMIDE, 0.25 M IN 2-METHF
Formula: [Mg](Br)Cc1c(F)c(F)cc(F)c1
G0483
249.321
MFCD11553357
2,3,5-TRIFLUOROBENZYLMAGNESIUM BROMIDE, 0.25 M IN ETHER
Formula: [Mg](Br)Cc1c(F)c(F)cc(F)c1
D0483
249.321
MFCD11553357
2,3,5-TRIFLUOROBENZYLZINC BROMIDE, 0.50 M IN THF
CAS:226717-85-7
Formula: [Zn](Br)Cc1c(F)c(F)cc(F)c1
ZT0483
290.379
MFCD22685057
2,3,6-TRIFLUORO-BENZOIC ACID ETHYL ESTER
CAS:773134-90-0
Formula: CCOC(c1c(F)ccc(F)c1F)=O
EE9904
204.15
MFCD06204406
2,3,6-TRIFLUOROBENZYLMAGNESIUM BROMIDE, 0.25 M IN 2-METHF
Formula: [Mg](Br)Cc1c(c(ccc1F)F)F
G0484
249.321
MFCD11553358
2,3,6-TRIFLUOROBENZYLMAGNESIUM BROMIDE, 0.25 M IN ETHER
Formula: [Mg](Br)Cc1c(c(ccc1F)F)F
D0484
249.321
MFCD11553358
2,3,6-TRIFLUOROBENZYLZINC BROMIDE, 0.50 M IN THF
Formula: [Zn](Br)Cc1c(c(ccc1F)F)F
ZT0484
290.379
MFCD22685058
2,3,6-TRIFLUOROPHENYLZINC BROMIDE, 0.50 M IN THF
Formula: c1cc(c(c(c1F)[Zn]Br)F)F
ZT2295
276.352
2,3,6-TRIMETHOXY-BENZOIC ACID ETHYL ESTER
Formula: O=C(c1c(c(ccc1OC)OC)OC)OCC
EE9827
240.258
MFCD12024967
2,3-DIBROMO-1-(2,3,4,5,6-PENTAMETHYLPHENYL)PROPAN-1-ONE
Formula: BrC(C(c1c(c(c(c(c1C)C)C)C)C)=O)CBr
K0426260
362.107
MFCD28409528
2,3-DIBROMO-1-(2,3,5,6-TETRAMETHYLPHENYL)PROPAN-1-ONE
Formula: Cc1cc(C)c(c(C(=O)C(Br)CBr)c1C)C
K0477260
348.08
MFCD28409811
2,3-DIBROMO-1-(2,3,5-TRICHLOROPHENYL)PROPAN-1-ONE
Formula: BrCC(C(=O)c1cc(cc(Cl)c1Cl)Cl)Br
K1036260
395.307
MFCD28105191
2,3-DIBROMO-1-(2,3-DICHLOROPHENYL)PROPAN-1-ONE
Formula: BrC(CBr)C(c1cccc(Cl)c1Cl)=O
K1029260
360.862
MFCD28104889
2,3-DIBROMO-1-(2,3-DIFLUOROPHENYL)PROPAN-1-ONE
Formula: Fc1c(C(C(CBr)Br)=O)cccc1F
K1334260
327.952
MFCD28105870
2,3-DIBROMO-1-(2,3-DIHYDROBENZO[B][1,4]DIOXIN-6-YL)PROPAN-1-ONE
Formula: O=C(C(CBr)Br)c1cc2c(OCCO2)cc1
K0006260
350.009
MFCD28406308
2,3-DIBROMO-1-(2,3-DIHYDROBENZOFURAN-5-YL)PROPAN-1-ONE
Formula: BrC(CBr)C(c1cc2CCOc2cc1)=O
K0169260
334.009
MFCD28407498
2,3-DIBROMO-1-(2,3-DIMETHYLPHENYL)PROPAN-1-ONE
Formula: Cc1c(cccc1C(C(Br)CBr)=O)C
K0209260
320.026
MFCD28407805
2,3-DIBROMO-1-(2,4,5-TRIFLUOROPHENYL)PROPAN-1-ONE
Formula: BrC(C(=O)c1c(cc(c(c1)F)F)F)CBr
K1581260
345.943
MFCD28107327
2,3-DIBROMO-1-(2,4,5-TRIMETHYLPHENYL)PROPAN-1-ONE
Formula: Cc1c(C(C(Br)CBr)=O)cc(c(C)c1)C
K0498260
334.053
MFCD28409875
2,3-DIBROMO-1-(2,4-DICHLORO-5-METHOXYPHENYL)PROPAN-1-ONE
Formula: BrCC(C(c1c(Cl)cc(Cl)c(OC)c1)=O)Br
K1047260
390.888
MFCD28105672
2,3-DIBROMO-1-(2,4-DICHLOROPHENYL)PROPAN-1-ONE
Formula: Clc1c(ccc(c1)Cl)C(C(Br)CBr)=O
K1033260
360.862
MFCD28105070
2,3-DIBROMO-1-(2,4-DIFLUOROPHENYL)PROPAN-1-ONE
Formula: Fc1c(ccc(F)c1)C(=O)C(CBr)Br
K1335260
327.952
MFCD28105903
2,3-DIBROMO-1-(2,4-DIMETHOXYPHENYL)PROPAN-1-ONE
Formula: BrCC(C(=O)c1ccc(OC)cc1OC)Br
K0180260
352.024
MFCD28407555
2,3-DIBROMO-1-(2,4-DIMETHYLPHENYL)PROPAN-1-ONE
Formula: BrC(CBr)C(c1ccc(C)cc1C)=O
K0210260
320.026
MFCD28407835
2,3-DIBROMO-1-(2,5-DICHLORO-3-FLUOROPHENYL)PROPAN-1-ONE
Formula: Clc1c(cc(cc1C(=O)C(CBr)Br)Cl)F
K1031260
378.852
MFCD28104960
2,3-DIBROMO-1-(2,5-DICHLOROPHENYL)PROPAN-1-ONE
Formula: Clc1c(cc(Cl)cc1)C(C(Br)CBr)=O
K1030260
360.862
MFCD28104920
2,3-DIBROMO-1-(2,5-DIFLUORO-4-METHOXYPHENYL)PROPAN-1-ONE
Formula: BrC(C(c1c(cc(OC)c(F)c1)F)=O)CBr
K1373260
357.979
MFCD28106196
2,3-DIBROMO-1-(2,5-DIFLUOROPHENYL)PROPAN-1-ONE
Formula: Fc1cc(c(cc1)F)C(C(Br)CBr)=O
K1336260
327.952
MFCD28105920
2,3-DIBROMO-1-(2,5-DIMETHOXYPHENYL)PROPAN-1-ONE
Formula: COc1cc(c(cc1)OC)C(=O)C(CBr)Br
K0181260
352.024
MFCD28407580
2,3-DIBROMO-1-(2,5-DIMETHYLPHENYL)PROPAN-1-ONE
Formula: BrC(C(c1c(ccc(C)c1)C)=O)CBr
K0211260
320.026
MFCD28407850
2,3-DIBROMO-1-(2,6-DICHLOROPHENYL)PROPAN-1-ONE
Formula: BrCC(Br)C(c1c(Cl)cccc1Cl)=O
K1028260
360.862
MFCD28104849
2,3-DIBROMO-1-(2,6-DIFLUOROPHENYL)PROPAN-1-ONE
Formula: Fc1cccc(F)c1C(C(Br)CBr)=O
K1337260
327.952
MFCD28105938
2,3-DIBROMO-1-(2,6-DIMETHYLPHENYL)PROPAN-1-ONE
Formula: BrCC(Br)C(=O)c1c(cccc1C)C
K0212260
320.026
MFCD28407866
2,3-DIBROMO-1-(2-(1,1,2,2-TETRAFLUOROETHOXY)PHENYL)PROPAN-1-ONE
Formula: FC(F)(Oc1c(cccc1)C(=O)C(Br)CBr)C(F)F
K0643260
407.987
MFCD28104619
2,3-DIBROMO-1-(2-(DIFLUOROMETHOXY)PHENYL)PROPAN-1-ONE
Formula: FC(F)Oc1c(C(C(Br)CBr)=O)cccc1
K0642260
357.979
MFCD28104555
2,3-DIBROMO-1-(2-(DIMETHYLAMINO)PHENYL)PROPAN-1-ONE
Formula: BrCC(C(c1ccccc1N(C)C)=O)Br
K0189260
335.04
MFCD28407645
2,3-DIBROMO-1-(2-(METHYLTHIO)PHENYL)PROPAN-1-ONE
Formula: CSc1c(C(=O)C(Br)CBr)cccc1
K0398260
338.063
MFCD28409282
2,3-DIBROMO-1-(2-(TRIFLUOROMETHOXY)PHENYL)PROPAN-1-ONE
Formula: BrCC(C(c1c(OC(F)(F)F)cccc1)=O)Br
K0525260
375.969
MFCD28410001
2,3-DIBROMO-1-(2-(TRIFLUOROMETHYL)PHENYL)PROPAN-1-ONE
Formula: BrC(CBr)C(c1ccccc1C(F)(F)F)=O
K0522260
359.97
MFCD28409923
2,3-DIBROMO-1-(2-CHLORO-3-FLUOROPHENYL)PROPAN-1-ONE
Formula: Fc1cccc(C(C(CBr)Br)=O)c1Cl
K1044260
344.407
MFCD28105497
2,3-DIBROMO-1-(2-CHLORO-3-METHYLPHENYL)PROPAN-1-ONE
Formula: O=C(c1c(Cl)c(ccc1)C)C(CBr)Br
K1046260
340.444
MFCD28105615
2,3-DIBROMO-1-(2-CHLORO-4-(TRIFLUOROMETHYL)PHENYL)PROPAN-1-ONE
Formula: O=C(c1ccc(cc1Cl)C(F)(F)F)C(CBr)Br
K1042260
394.415
MFCD28105434
2,3-DIBROMO-1-(2-CHLORO-4-FLUOROPHENYL)PROPAN-1-ONE
Formula: Clc1cc(F)ccc1C(C(Br)CBr)=O
K0690260
344.407
MFCD28104786
2,3-DIBROMO-1-(2-CHLORO-4-METHOXYPHENYL)PROPAN-1-ONE
Formula: BrC(CBr)C(c1ccc(cc1Cl)OC)=O
K1035260
356.443
MFCD28105144
2,3-DIBROMO-1-(2-CHLORO-4-METHYLPHENYL)PROPAN-1-ONE
Formula: BrC(CBr)C(=O)c1c(cc(cc1)C)Cl
K1037260
340.444
MFCD28105258
2,3-DIBROMO-1-(2-CHLORO-5-(TRIFLUOROMETHOXY)PHENYL)PROPAN-1-ONE
Formula: BrC(CBr)C(c1c(ccc(c1)OC(F)(F)F)Cl)=O
K1045260
410.414
MFCD28105553
2,3-DIBROMO-1-(2-CHLORO-5-(TRIFLUOROMETHYL)PHENYL)PROPAN-1-ONE
Formula: BrCC(Br)C(=O)c1cc(C(F)(F)F)ccc1Cl
K1032260
394.415
MFCD28105024
2,3-DIBROMO-1-(2-CHLORO-5-FLUOROPHENYL)PROPAN-1-ONE
Formula: O=C(C(Br)CBr)c1cc(F)ccc1Cl
K1039260
344.407
MFCD28105320
2,3-DIBROMO-1-(2-CHLORO-5-METHOXYPHENYL)PROPAN-1-ONE
Formula: BrCC(Br)C(c1c(Cl)ccc(c1)OC)=O
K1034260
356.443
MFCD28105097
2,3-DIBROMO-1-(2-CHLORO-5-METHYLPHENYL)PROPAN-1-ONE
Formula: Cc1cc(C(C(CBr)Br)=O)c(cc1)Cl
K1041260
340.444
MFCD28105373
2,3-DIBROMO-1-(2-CHLORO-6-METHYLPHENYL)PROPAN-1-ONE
Formula: O=C(C(Br)CBr)c1c(C)cccc1Cl
K1419260
340.444
MFCD28106616
2,3-DIBROMO-1-(2-CHLOROPHENYL)PROPAN-1-ONE
Formula: O=C(c1c(Cl)cccc1)C(Br)CBr
K1027260
326.417
MFCD28104818
2,3-DIBROMO-1-(2-ETHYLPHENYL)PROPAN-1-ONE
Formula: CCc1c(C(C(CBr)Br)=O)cccc1
K0244260
320.026
MFCD28407992
2,3-DIBROMO-1-(2-FLUORO-[1,1'-BIPHENYL]-4-YL)PROPAN-1-ONE
Formula: BrC(CBr)C(=O)c1cc(F)c(cc1)c1ccccc1
K0253260
386.061
MFCD28408131
2,3-DIBROMO-1-(2-FLUORO-4-METHYLPHENYL)PROPAN-1-ONE
Formula: BrC(C(c1ccc(C)cc1F)=O)CBr
K1329260
323.989
MFCD28105824
2,3-DIBROMO-1-(2-FLUOROPHENYL)PROPAN-1-ONE
Formula: O=C(C(CBr)Br)c1c(cccc1)F
K1371260
309.962
MFCD28106161
2,3-DIBROMO-1-(2-ISOPROPOXYPHENYL)PROPAN-1-ONE
Formula: BrC(CBr)C(c1ccccc1OC(C)C)=O
K0539260
350.052
MFCD28410194
2,3-DIBROMO-1-(2-ISOPROPYLPHENYL)PROPAN-1-ONE
Formula: O=C(C(Br)CBr)c1ccccc1C(C)C
K0306260
334.053
MFCD28408743
2,3-DIBROMO-1-(2-METHOXY-5-(TRIFLUOROMETHYL)PHENYL)PROPAN-1-ONE
Formula: FC(c1cc(C(C(CBr)Br)=O)c(OC)cc1)(F)F
K0646260
389.996
MFCD28410983
2,3-DIBROMO-1-(2-METHOXY-5-METHYLPHENYL)PROPAN-1-ONE
Formula: BrCC(Br)C(c1cc(ccc1OC)C)=O
K0319260
336.025
MFCD28408855
2,3-DIBROMO-1-(2-METHOXYNAPHTHALEN-1-YL)PROPAN-1-ONE
Formula: COc1ccc2c(cccc2)c1C(=O)C(CBr)Br
K0324260
372.059
MFCD28408921
2,3-DIBROMO-1-(2-METHOXYPHENYL)PROPAN-1-ONE
Formula: BrC(C(c1c(cccc1)OC)=O)CBr
K0329260
321.998
MFCD28409002
2,3-DIBROMO-1-(2-METHYL-[1,1'-BIPHENYL]-3-YL)PROPAN-1-ONE
Formula: Cc1c(C(C(CBr)Br)=O)cccc1c1ccccc1
K0346260
382.097
MFCD28409047
2,3-DIBROMO-1-(2-METHYL-3-(TRIFLUOROMETHYL)PHENYL)PROPAN-1-ONE
Formula: BrCC(C(=O)c1c(c(C(F)(F)F)ccc1)C)Br
K0639260
373.997
MFCD28410881
2,3-DIBROMO-1-(2-METHYLNAPHTHALEN-1-YL)PROPAN-1-ONE
Formula: BrCC(C(=O)c1c(ccc2ccccc12)C)Br
K0361260
356.059
MFCD28409123
2,3-DIBROMO-1-(3,4,5-TRIFLUOROPHENYL)PROPAN-1-ONE
Formula: Fc1c(cc(cc1F)C(=O)C(CBr)Br)F
K0489260
345.943
MFCD28409844
2,3-DIBROMO-1-(3,4-DICHLOROPHENYL)PROPAN-1-ONE
Formula: BrC(CBr)C(c1cc(Cl)c(Cl)cc1)=O
K0141260
360.862
MFCD28407168
2,3-DIBROMO-1-(3,4-DIFLUORO-5-METHOXYPHENYL)PROPAN-1-ONE
Formula: Fc1cc(C(C(Br)CBr)=O)cc(OC)c1F
K0160260
357.979
MFCD28407255
2,3-DIBROMO-1-(3,4-DIFLUOROPHENYL)PROPAN-1-ONE
Formula: BrC(CBr)C(c1ccc(c(c1)F)F)=O
K0167260
327.952
MFCD28407460
2,3-DIBROMO-1-(3,4-DIMETHOXYPHENYL)PROPAN-1-ONE
Formula: COc1c(cc(C(=O)C(Br)CBr)cc1)OC
K0182260
352.024
MFCD28407598
2,3-DIBROMO-1-(3,4-DIMETHYLPHENYL)PROPAN-1-ONE
Formula: BrC(CBr)C(c1ccc(c(C)c1)C)=O
K0213260
320.026
MFCD28407902
2,3-DIBROMO-1-(3,5-DICHLOROPHENYL)PROPAN-1-ONE
Formula: BrCC(C(=O)c1cc(Cl)cc(Cl)c1)Br
K0142260
360.862
MFCD28407183
2,3-DIBROMO-1-(3,5-DIFLUORO-2-METHOXYPHENYL)PROPAN-1-ONE
Formula: Fc1cc(cc(C(=O)C(CBr)Br)c1OC)F
K0161260
357.979
MFCD28407307
2,3-DIBROMO-1-(3,5-DIFLUOROPHENYL)PROPAN-1-ONE
Formula: BrCC(Br)C(=O)c1cc(cc(c1)F)F
K0168260
327.952
MFCD28407474
2,3-DIBROMO-1-(3,5-DIMETHOXYPHENYL)PROPAN-1-ONE
Formula: COc1cc(OC)cc(C(=O)C(CBr)Br)c1
K0183260
352.024
MFCD28407610
2,3-DIBROMO-1-(3,5-DIMETHYLPHENYL)PROPAN-1-ONE
Formula: BrCC(C(c1cc(C)cc(C)c1)=O)Br
K0214260
320.026
MFCD28407916
2,3-DIBROMO-1-(3-((3-FLUOROBENZYL)OXY)PHENYL)PROPAN-1-ONE
Formula: O=C(c1cccc(OCc2cccc(F)c2)c1)C(Br)CBr
K0251260
416.087
MFCD28408079
2,3-DIBROMO-1-(3-(1,1,2,2-TETRAFLUOROETHOXY)PHENYL)PROPAN-1-ONE
Formula: FC(F)C(Oc1cccc(c1)C(C(CBr)Br)=O)(F)F
K0644260
407.987
MFCD28104683
2,3-DIBROMO-1-(3-(DIFLUOROMETHOXY)PHENYL)PROPAN-1-ONE
Formula: BrCC(Br)C(c1cc(ccc1)OC(F)F)=O
K0636260
357.979
MFCD28104453
2,3-DIBROMO-1-(3-(DIMETHYLAMINO)PHENYL)PROPAN-1-ONE
Formula: CN(C)c1cccc(C(=O)C(Br)CBr)c1
K0190260
335.04
MFCD28407695
2,3-DIBROMO-1-(3-(METHYLTHIO)PHENYL)PROPAN-1-ONE
Formula: BrC(C(c1cc(ccc1)SC)=O)CBr
K0399260
338.063
MFCD28409320
2,3-DIBROMO-1-(3-(TERT-BUTYL)PHENYL)PROPAN-1-ONE
Formula: CC(C)(C)c1cc(C(=O)C(Br)CBr)ccc1
K0059260
348.08
MFCD28406632
2,3-DIBROMO-1-(3-(TRIFLUOROMETHOXY)PHENYL)PROPAN-1-ONE
Formula: O=C(c1cccc(OC(F)(F)F)c1)C(CBr)Br
K0526260
375.969
MFCD28410035
2,3-DIBROMO-1-(3-(TRIFLUOROMETHYL)PHENYL)PROPAN-1-ONE
Formula: BrC(C(=O)c1cc(ccc1)C(F)(F)F)CBr
K0523260
359.97
MFCD28409951
2,3-DIBROMO-1-(3-BROMOTHIOPHEN-2-YL)PROPAN-1-ONE
Formula: BrC(C(c1c(ccs1)Br)=O)CBr
K0040260
376.893
MFCD28406540
2,3-DIBROMO-1-(3-CHLORO-2-METHYLPHENYL)PROPAN-1-ONE
Formula: BrCC(C(c1cccc(Cl)c1C)=O)Br
K0089260
340.444
MFCD28406942
2,3-DIBROMO-1-(3-CHLORO-4-(TRIFLUOROMETHYL)PHENYL)PROPAN-1-ONE
Formula: BrCC(C(=O)c1ccc(c(Cl)c1)C(F)(F)F)Br
K0653260
394.415
MFCD28411076
2,3-DIBROMO-1-(3-CHLORO-4-FLUOROPHENYL)PROPAN-1-ONE
Formula: BrC(CBr)C(c1ccc(c(Cl)c1)F)=O
K0081260
344.407
MFCD28406797
2,3-DIBROMO-1-(3-CHLORO-4-METHYLPHENYL)PROPAN-1-ONE
Formula: O=C(c1cc(Cl)c(cc1)C)C(Br)CBr
K0090260
340.444
MFCD28406986
2,3-DIBROMO-1-(3-CHLORO-5-FLUOROPHENYL)PROPAN-1-ONE
Formula: BrCC(C(=O)c1cc(cc(F)c1)Cl)Br
K0082260
344.407
MFCD28406821
2,3-DIBROMO-1-(3-CHLOROPHENYL)PROPAN-1-ONE
Formula: BrC(C(c1cc(ccc1)Cl)=O)CBr
K0100260
326.417
MFCD28407139
2,3-DIBROMO-1-(3-ETHOXYPHENYL)PROPAN-1-ONE
Formula: BrC(C(=O)c1cc(OCC)ccc1)CBr
K0232260
336.025
MFCD28407943
2,3-DIBROMO-1-(3-ETHYLPHENYL)PROPAN-1-ONE
Formula: BrCC(C(c1cc(CC)ccc1)=O)Br
K0530260
320.026
MFCD28410107
2,3-DIBROMO-1-(3-FLUORO-2-(TRIFLUOROMETHYL)PHENYL)PROPAN-1-ONE
Formula: Fc1c(c(ccc1)C(=O)C(Br)CBr)C(F)(F)F
K0638260
377.96
MFCD28410833
2,3-DIBROMO-1-(3-FLUORO-2-METHOXYPHENYL)PROPAN-1-ONE
Formula: BrCC(Br)C(c1cccc(c1OC)F)=O
K0561260
339.988
MFCD28410339
2,3-DIBROMO-1-(3-FLUORO-2-METHYLPHENYL)PROPAN-1-ONE
Formula: Fc1c(c(C(C(Br)CBr)=O)ccc1)C
K0265260
323.989
MFCD28408353
2,3-DIBROMO-1-(3-FLUORO-4-(TRIFLUOROMETHOXY)PHENYL)PROPAN-1-ONE
Formula: FC(F)(F)Oc1c(F)cc(cc1)C(=O)C(Br)CBr
K0647260
393.96
MFCD28411029
2,3-DIBROMO-1-(3-FLUORO-4-METHOXYPHENYL)PROPAN-1-ONE
Formula: BrC(C(c1cc(c(cc1)OC)F)=O)CBr
K0256260
339.988
MFCD28408181
2,3-DIBROMO-1-(3-FLUORO-4-METHYLPHENYL)PROPAN-1-ONE
Formula: O=C(c1cc(F)c(C)cc1)C(Br)CBr
K0266260
323.989
MFCD28408399
2,3-DIBROMO-1-(3-FLUORO-5-(TRIFLUOROMETHYL)PHENYL)PROPAN-1-ONE
Formula: BrCC(Br)C(c1cc(C(F)(F)F)cc(F)c1)=O
K0630260
377.96
MFCD28410695
2,3-DIBROMO-1-(3-FLUORO-5-METHOXYPHENYL)PROPAN-1-ONE
Formula: Fc1cc(C(C(CBr)Br)=O)cc(OC)c1
K0257260
339.988
MFCD28408200
2,3-DIBROMO-1-(3-FLUORO-5-METHYLPHENYL)PROPAN-1-ONE
Formula: BrCC(C(=O)c1cc(F)cc(c1)C)Br
K0267260
323.989
MFCD28408426
2,3-DIBROMO-1-(3-FLUOROPHENYL)PROPAN-1-ONE
Formula: Fc1cc(ccc1)C(=O)C(Br)CBr
K0278260
309.962
MFCD28408561
2,3-DIBROMO-1-(3-ISOPROPOXYPHENYL)PROPAN-1-ONE
Formula: BrCC(Br)C(c1cccc(OC(C)C)c1)=O
K0304260
350.052
MFCD28408705
2,3-DIBROMO-1-(3-ISOPROPYLPHENYL)PROPAN-1-ONE
Formula: BrC(CBr)C(c1cc(C(C)C)ccc1)=O
K0307260
334.053
MFCD28408794
2,3-DIBROMO-1-(3-METHOXYPHENYL)PROPAN-1-ONE
Formula: BrC(C(c1cccc(OC)c1)=O)CBr
K0330260
321.998
MFCD28409018
2,3-DIBROMO-1-(3-METHYLTHIOPHEN-2-YL)PROPAN-1-ONE
Formula: BrCC(C(=O)c1c(C)ccs1)Br
K0396260
312.024
MFCD28409242
2,3-DIBROMO-1-(4'-PROPYL-[1,1'-BIPHENYL]-4-YL)PROPAN-1-ONE
Formula: BrC(C(c1ccc(cc1)c1ccc(cc1)CCC)=O)CBr
K0447260
410.152
MFCD28409691
2,3-DIBROMO-1-(4,5-DIFLUORO-2-METHOXYPHENYL)PROPAN-1-ONE
Formula: COc1cc(c(cc1C(C(CBr)Br)=O)F)F
K0163260
357.979
MFCD28407358
2,3-DIBROMO-1-(4-((2,5-DIFLUOROPHENOXY)METHYL)PHENYL)PROPAN-1-ONE
Formula: Fc1cc(OCc2ccc(cc2)C(C(Br)CBr)=O)c(cc1)F
K0166260
434.078
MFCD28407410
2,3-DIBROMO-1-(4-((TRIFLUOROMETHYL)THIO)PHENYL)PROPAN-1-ONE
Formula: O=C(C(CBr)Br)c1ccc(cc1)SC(F)(F)F
K0625260
392.034
MFCD28410465
2,3-DIBROMO-1-(4-(1,1,2,2-TETRAFLUOROETHOXY)PHENYL)PROPAN-1-ONE
Formula: BrC(CBr)C(c1ccc(cc1)OC(C(F)F)(F)F)=O
K0635260
407.987
MFCD28104388
2,3-DIBROMO-1-(4-(2-(PYRROLIDIN-1-YL)ETHOXY)PHENYL)PROPAN-1-ONE
Formula: O=C(c1ccc(OCCN2CCCC2)cc1)C(CBr)Br
K0532260
405.132
MFCD28410145
2,3-DIBROMO-1-(4-(DIETHYLAMINO)PHENYL)PROPAN-1-ONE
Formula: O=C(C(CBr)Br)c1ccc(N(CC)CC)cc1
K0151260
363.095
MFCD28407211
2,3-DIBROMO-1-(4-(DIFLUOROMETHOXY)PHENYL)PROPAN-1-ONE
Formula: BrCC(C(=O)c1ccc(cc1)OC(F)F)Br
K0632260
357.979
MFCD28104316
2,3-DIBROMO-1-(4-(DIMETHYLAMINO)PHENYL)PROPAN-1-ONE
Formula: BrC(C(=O)c1ccc(cc1)N(C)C)CBr
K0191260
335.04
MFCD28407741
2,3-DIBROMO-1-(4-(DIPHENYLAMINO)PHENYL)PROPAN-1-ONE
Formula: O=C(c1ccc(N(c2ccccc2)c2ccccc2)cc1)C(Br)CBr
K0553260
459.184
MFCD28410288
2,3-DIBROMO-1-(4-(ETHYLTHIO)PHENYL)PROPAN-1-ONE
Formula: O=C(C(CBr)Br)c1ccc(SCC)cc1
K0246260
352.09
MFCD28408040
2,3-DIBROMO-1-(4-(METHYLTHIO)PHENYL)PROPAN-1-ONE
Formula: O=C(c1ccc(SC)cc1)C(Br)CBr
K0400260
338.063
MFCD28409369
2,3-DIBROMO-1-(4-(TERT-BUTOXY)PHENYL)PROPAN-1-ONE
Formula: O=C(C(CBr)Br)c1ccc(cc1)OC(C)(C)C
K0045260
364.079
MFCD28406564
2,3-DIBROMO-1-(4-(TERT-BUTYL)PHENYL)PROPAN-1-ONE
Formula: O=C(C(CBr)Br)c1ccc(cc1)C(C)(C)C
K0060260
348.08
MFCD28406676
2,3-DIBROMO-1-(4-(TRIFLUOROMETHOXY)PHENYL)PROPAN-1-ONE
Formula: O=C(c1ccc(cc1)OC(F)(F)F)C(CBr)Br
K0527260
375.969
MFCD28410070
2,3-DIBROMO-1-(4-(TRIFLUOROMETHYL)PHENYL)PROPAN-1-ONE
Formula: O=C(C(CBr)Br)c1ccc(C(F)(F)F)cc1
K0524260
359.97
MFCD28409973
2,3-DIBROMO-1-(4-BROMO-2,6-DIFLUOROPHENYL)PROPAN-1-ONE
Formula: Fc1cc(cc(F)c1C(=O)C(CBr)Br)Br
K1599260
406.848
MFCD28107678
2,3-DIBROMO-1-(4-BROMO-2,6-DIMETHYLPHENYL)PROPAN-1-ONE
Formula: BrCC(Br)C(c1c(cc(cc1C)Br)C)=O
K1598260
398.922
MFCD28107613
2,3-DIBROMO-1-(4-BROMO-2-(TRIFLUOROMETHOXY)PHENYL)PROPAN-1-ONE
Formula: O=C(c1ccc(Br)cc1OC(F)(F)F)C(Br)CBr
K1707260
454.865
MFCD28107892
2,3-DIBROMO-1-(4-BROMO-2-(TRIFLUOROMETHYL)PHENYL)PROPAN-1-ONE
Formula: BrCC(C(=O)c1ccc(Br)cc1C(F)(F)F)Br
K1706260
438.866
MFCD28107839
2,3-DIBROMO-1-(4-BROMO-2-CHLOROPHENYL)PROPAN-1-ONE
Formula: O=C(C(Br)CBr)c1ccc(cc1Cl)Br
K1567260
405.313
MFCD28107149
2,3-DIBROMO-1-(4-BROMO-2-FLUOROPHENYL)PROPAN-1-ONE
Formula: Brc1ccc(c(F)c1)C(C(CBr)Br)=O
K1470260
388.858
MFCD28107041
2,3-DIBROMO-1-(4-BROMO-2-METHYLPHENYL)PROPAN-1-ONE
Formula: Cc1cc(ccc1C(C(CBr)Br)=O)Br
K1466260
384.895
MFCD28106943
2,3-DIBROMO-1-(4-BROMO-3-(TRIFLUOROMETHYL)PHENYL)PROPAN-1-ONE
Formula: Brc1ccc(cc1C(F)(F)F)C(=O)C(Br)CBr
K1711260
438.866
MFCD28107955
2,3-DIBROMO-1-(4-BROMO-3-CHLOROPHENYL)PROPAN-1-ONE
Formula: BrC(C(c1ccc(c(Cl)c1)Br)=O)CBr
K1568260
405.313
MFCD28107205
2,3-DIBROMO-1-(4-BROMO-3-FLUOROPHENYL)PROPAN-1-ONE
Formula: BrC(C(c1cc(c(Br)cc1)F)=O)CBr
K1566260
388.858
MFCD28107099
2,3-DIBROMO-1-(4-BROMO-3-METHOXYPHENYL)PROPAN-1-ONE
Formula: COc1c(ccc(c1)C(=O)C(CBr)Br)Br
K1572260
400.894
MFCD28107265
2,3-DIBROMO-1-(4-BROMO-3-METHYLPHENYL)PROPAN-1-ONE
Formula: O=C(C(CBr)Br)c1cc(C)c(cc1)Br
K1467260
384.895
MFCD28106994
2,3-DIBROMO-1-(4-BROMOTHIOPHEN-2-YL)PROPAN-1-ONE
Formula: O=C(C(Br)CBr)c1scc(Br)c1
K0606260
376.893
MFCD28410386
2,3-DIBROMO-1-(4-BUTYLPHENYL)PROPAN-1-ONE
Formula: CCCCc1ccc(cc1)C(C(CBr)Br)=O
K0058260
348.08
MFCD28406609
2,3-DIBROMO-1-(4-CHLORO-2-(TRIFLUOROMETHYL)PHENYL)PROPAN-1-ONE
Formula: BrCC(C(=O)c1ccc(cc1C(F)(F)F)Cl)Br
K0626260
394.415
MFCD28410512
2,3-DIBROMO-1-(4-CHLORO-2-FLUOROPHENYL)PROPAN-1-ONE
Formula: O=C(c1ccc(Cl)cc1F)C(CBr)Br
K1424260
344.407
MFCD28106666
2,3-DIBROMO-1-(4-CHLORO-2-METHYLPHENYL)PROPAN-1-ONE
Formula: Clc1ccc(c(C)c1)C(=O)C(CBr)Br
K0092260
340.444
MFCD28407024
2,3-DIBROMO-1-(4-CHLORO-3,5-DIFLUOROPHENYL)PROPAN-1-ONE
Formula: Fc1cc(cc(F)c1Cl)C(=O)C(CBr)Br
K0067260
362.397
MFCD28406695
2,3-DIBROMO-1-(4-CHLORO-3,5-DIMETHYLPHENYL)PROPAN-1-ONE
Formula: BrCC(C(c1cc(C)c(c(C)c1)Cl)=O)Br
K0068260
354.471
MFCD28406747
2,3-DIBROMO-1-(4-CHLORO-3-(TRIFLUOROMETHYL)PHENYL)PROPAN-1-ONE
Formula: BrC(CBr)C(=O)c1cc(c(Cl)cc1)C(F)(F)F
K0624260
394.415
MFCD28410421
2,3-DIBROMO-1-(4-CHLORO-3-ETHYLPHENYL)PROPAN-1-ONE
Formula: O=C(C(CBr)Br)c1cc(c(cc1)Cl)CC
K0540260
354.471
MFCD28410236
2,3-DIBROMO-1-(4-CHLORO-3-FLUOROPHENYL)PROPAN-1-ONE
Formula: BrC(CBr)C(c1ccc(c(F)c1)Cl)=O
K0083260
344.407
MFCD28406854
2,3-DIBROMO-1-(4-CHLORO-3-METHOXYPHENYL)PROPAN-1-ONE
Formula: COc1c(ccc(C(C(CBr)Br)=O)c1)Cl
K0086260
356.443
MFCD28406887
2,3-DIBROMO-1-(4-CHLORO-3-METHYLPHENYL)PROPAN-1-ONE
Formula: Clc1c(C)cc(C(=O)C(CBr)Br)cc1
K0093260
340.444
MFCD28407067
2,3-DIBROMO-1-(4-CHLOROPHENYL)PROPAN-1-ONE
Formula: BrC(CBr)C(c1ccc(Cl)cc1)=O
K0101260
326.417
MFCD28407157
2,3-DIBROMO-1-(4-ETHOXYPHENYL)PROPAN-1-ONE
Formula: O=C(C(CBr)Br)c1ccc(OCC)cc1
K0233260
336.025
MFCD28407975
2,3-DIBROMO-1-(4-ETHYLPHENYL)PROPAN-1-ONE
Formula: CCc1ccc(C(=O)C(Br)CBr)cc1
K0245260
320.026
MFCD28408026
2,3-DIBROMO-1-(4-FLUORO-2-(TRIFLUOROMETHYL)PHENYL)PROPAN-1-ONE
Formula: Fc1ccc(c(c1)C(F)(F)F)C(=O)C(Br)CBr
K0634260
377.96
MFCD28410741
2,3-DIBROMO-1-(4-FLUORO-2-METHOXYPHENYL)PROPAN-1-ONE
Formula: O=C(C(CBr)Br)c1c(cc(cc1)F)OC
K0258260
339.988
MFCD28408247
2,3-DIBROMO-1-(4-FLUORO-2-METHYLPHENYL)PROPAN-1-ONE
Formula: BrC(CBr)C(=O)c1ccc(cc1C)F
K0268260
323.989
MFCD28408455
2,3-DIBROMO-1-(4-FLUORO-3-(TRIFLUOROMETHYL)PHENYL)PROPAN-1-ONE
Formula: BrC(C(=O)c1cc(C(F)(F)F)c(cc1)F)CBr
K0629260
377.96
MFCD28410655
2,3-DIBROMO-1-(4-FLUORO-3-METHOXYPHENYL)PROPAN-1-ONE
Formula: COc1c(ccc(c1)C(C(CBr)Br)=O)F
K0259260
339.988
MFCD28408292
2,3-DIBROMO-1-(4-FLUORO-3-METHYLPHENYL)PROPAN-1-ONE
Formula: O=C(C(CBr)Br)c1cc(C)c(F)cc1
K0269260
323.989
MFCD28408483
2,3-DIBROMO-1-(4-FLUORONAPHTHALEN-1-YL)PROPAN-1-ONE
Formula: BrCC(C(c1c2c(c(cc1)F)cccc2)=O)Br
K0273260
360.022
MFCD28408524
2,3-DIBROMO-1-(4-FLUOROPHENYL)PROPAN-1-ONE
Formula: BrC(CBr)C(c1ccc(cc1)F)=O
K0279260
309.962
MFCD14582985
2,3-DIBROMO-1-(4-HEPTYLPHENYL)PROPAN-1-ONE
Formula: CCCCCCCc1ccc(C(C(CBr)Br)=O)cc1
K0291260
390.161
MFCD28408590
2,3-DIBROMO-1-(4-HEXYLPHENYL)PROPAN-1-ONE
Formula: BrCC(C(c1ccc(CCCCCC)cc1)=O)Br
K0298260
376.134
MFCD28408640
2,3-DIBROMO-1-(4-ISOBUTYLPHENYL)PROPAN-1-ONE
Formula: BrCC(Br)C(c1ccc(CC(C)C)cc1)=O
K0300260
348.08
MFCD28408683
2,3-DIBROMO-1-(4-ISOPROPYLPHENYL)PROPAN-1-ONE
Formula: BrC(CBr)C(=O)c1ccc(C(C)C)cc1
K0308260
334.053
MFCD28408841
2,3-DIBROMO-1-(4-METHOXY-2,5-DIMETHYLPHENYL)PROPAN-1-ONE
Formula: BrCC(C(c1cc(c(OC)cc1C)C)=O)Br
K0175260
350.052
MFCD28407522
2,3-DIBROMO-1-(4-METHOXY-2-METHYLPHENYL)PROPAN-1-ONE
Formula: BrCC(Br)C(c1ccc(OC)cc1C)=O
K0321260
336.025
MFCD28408871
2,3-DIBROMO-1-(4-METHOXY-3,5-DIMETHYLPHENYL)PROPAN-1-ONE
Formula: BrCC(Br)C(=O)c1cc(C)c(c(C)c1)OC
K0206260
350.052
MFCD28407775
2,3-DIBROMO-1-(4-METHOXY-3-(TRIFLUOROMETHYL)PHENYL)PROPAN-1-ONE
Formula: FC(F)(F)c1cc(ccc1OC)C(C(CBr)Br)=O
K0637260
389.996
MFCD28410786
2,3-DIBROMO-1-(4-METHOXY-3-METHYLPHENYL)PROPAN-1-ONE
Formula: COc1ccc(C(=O)C(Br)CBr)cc1C
K0322260
336.025
MFCD28408903
2,3-DIBROMO-1-(4-METHOXYPHENYL)PROPAN-1-ONE
Formula: O=C(c1ccc(OC)cc1)C(Br)CBr
K0331260
321.998
MFCD28409034
2,3-DIBROMO-1-(4-METHYLNAPHTHALEN-1-YL)PROPAN-1-ONE
Formula: Cc1c2c(c(C(C(CBr)Br)=O)cc1)cccc2
K0362260
356.059
MFCD28409159
2,3-DIBROMO-1-(4-MORPHOLINOPHENYL)PROPAN-1-ONE
Formula: BrC(CBr)C(=O)c1ccc(cc1)N1CCOCC1
K0401260
377.078
MFCD28409395
2,3-DIBROMO-1-(4-PENTYLPHENYL)PROPAN-1-ONE
Formula: BrCC(C(c1ccc(CCCCC)cc1)=O)Br
K0432260
362.107
MFCD28409561
2,3-DIBROMO-1-(4-PHENOXYPHENYL)PROPAN-1-ONE
Formula: BrCC(C(=O)c1ccc(Oc2ccccc2)cc1)Br
K0437260
384.07
MFCD28409656
2,3-DIBROMO-1-(4-PROPYLPHENYL)PROPAN-1-ONE
Formula: CCCc1ccc(C(C(CBr)Br)=O)cc1
K0449260
334.053
MFCD28409740
2,3-DIBROMO-1-(4-VINYLPHENYL)PROPAN-1-ONE
Formula: O=C(C(Br)CBr)c1ccc(C=C)cc1
K0462260
318.01
MFCD28409762
2,3-DIBROMO-1-(5-BROMO-2-FLUOROPHENYL)PROPAN-1-ONE
Formula: Fc1c(cc(cc1)Br)C(C(CBr)Br)=O
K1600260
388.858
MFCD28107728
2,3-DIBROMO-1-(5-BROMOTHIOPHEN-2-YL)PROPAN-1-ONE
Formula: O=C(C(Br)CBr)c1ccc(Br)s1
K1406260
376.893
MFCD28411138
2,3-DIBROMO-1-(5-CHLORO-2-METHOXYPHENYL)PROPAN-1-ONE
Formula: COc1c(C(=O)C(CBr)Br)cc(Cl)cc1
K0087260
356.443
MFCD28406922
2,3-DIBROMO-1-(5-CHLORO-2-METHYLPHENYL)PROPAN-1-ONE
Formula: BrCC(C(=O)c1c(C)ccc(c1)Cl)Br
K0094260
340.444
MFCD28407103
2,3-DIBROMO-1-(5-CHLORO-3-METHYLBENZO[B]THIOPHEN-2-YL)PROPAN-1-ONE
Formula: Cc1c(sc2ccc(Cl)cc21)C(C(Br)CBr)=O
K1556260
396.53
MFCD28411156
2,3-DIBROMO-1-(5-CHLOROTHIOPHEN-2-YL)PROPAN-1-ONE
Formula: O=C(c1ccc(s1)Cl)C(CBr)Br
K1346260
332.442
MFCD28411122
2,3-DIBROMO-1-(5-FLUORO-2-METHOXYPHENYL)PROPAN-1-ONE
Formula: COc1c(C(=O)C(Br)CBr)cc(F)cc1
K0260260
339.988
MFCD28408332
2,3-DIBROMO-1-(5-FLUORO-2-METHYLPHENYL)PROPAN-1-ONE
Formula: BrCC(C(=O)c1cc(F)ccc1C)Br
K0270260
323.989
MFCD28408496
2,3-DIBROMO-1-(5-METHYLTHIOPHEN-2-YL)PROPAN-1-ONE
Formula: O=C(c1ccc(s1)C)C(CBr)Br
K0397260
312.024
MFCD28409263
2,3-DIBROMO-1-(6-METHOXYNAPHTHALEN-2-YL)PROPAN-1-ONE
Formula: BrCC(C(c1ccc2c(ccc(c2)OC)c1)=O)Br
K0325260
372.059
MFCD28408967
2,3-DIBROMO-1-(M-TOLYL)PROPAN-1-ONE
Formula: BrC(C(=O)c1cc(C)ccc1)CBr
K0375260
305.999
MFCD28409215
2,3-DIBROMO-1-(NAPHTHALEN-1-YL)PROPAN-1-ONE
Formula: O=C(c1c2c(cccc2)ccc1)C(Br)CBr
K0403260
342.032
MFCD28409440
2,3-DIBROMO-1-(NAPHTHALEN-2-YL)PROPAN-1-ONE
Formula: BrC(CBr)C(=O)c1cc2ccccc2cc1
K0404260
342.032
MFCD28409463
2,3-DIBROMO-1-(O-TOLYL)PROPAN-1-ONE
Formula: O=C(c1ccccc1C)C(CBr)Br
K0374260
305.999
MFCD28409195
2,3-DIBROMO-1-(P-TOLYL)PROPAN-1-ONE
Formula: BrC(C(=O)c1ccc(cc1)C)CBr
K0376260
305.999
MFCD28409234
2,3-DIBROMO-1-(PERFLUOROPHENYL)PROPAN-1-ONE
Formula: O=C(c1c(F)c(c(c(c1F)F)F)F)C(Br)CBr
K0424260
381.924
MFCD28409487
2,3-DIBROMO-1-(PHENANTHREN-9-YL)PROPAN-1-ONE
Formula: BrCC(Br)C(=O)c1c2c(cccc2)c2c(cccc2)c1
K0434260
392.093
MFCD28409609
2,3-DIBROMO-1-(THIOPHEN-2-YL)PROPAN-1-ONE
Formula: BrCC(Br)C(=O)c1sccc1
K0478260
297.997
MFCD28409832
2,3-DIBROMO-1-MESITYLPROPAN-1-ONE
Formula: Cc1cc(cc(C)c1C(C(CBr)Br)=O)C
K0499260
334.053
MFCD28409907
2,3-DIBROMO-1-PHENYLPROPAN-1-ONE
Formula: BrC(C(c1ccccc1)=O)CBr
K0440260
291.972
MFCD14582988
2,3-DICHLORO-2'-(3-PYRROLINOMETHYL) BENZOPHENONE
CAS:898763-70-7
Formula: C18H15Cl2NO
6126-0900-53
332.232
MFCD03842896
2,3-DICHLORO-2'-(4-METHYLPIPERAZINOMETHYL) BENZOPHENONE
CAS:898762-30-6
Formula: C19H20Cl2N2O
6126-0800-53
363.29
MFCD03842839
2,3-DICHLORO-2'-[8-(1,4-DIOXA-8-AZASPIRO[4.5]DECYL)METHYL]BENZOPHENONE
CAS:898756-48-4
Formula: C21H21Cl2NO3
6126-0600-53
406.312
MFCD03842725
2,3-DICHLORO-2'-MORPHOLINOMETHYL BENZOPHENONE
CAS:898750-98-6
Formula: C18H17Cl2NO2
6126-0100-53
350.248
MFCD03842441
2,3-DICHLORO-2'-PIPERIDINOMETHYL BENZOPHENONE
CAS:898773-65-4
Formula: C19H19Cl2NO
6126-0200-53
348.275
MFCD03842498
2,3-DICHLORO-2'-PYRROLIDINOMETHYL BENZOPHENONE
CAS:898774-93-1
Formula: C18H17Cl2NO
6126-0300-53
334.248
MFCD03842555
2,3-DICHLORO-2'-THIOMORPHOLINOMETHYL BENZOPHENONE
CAS:898782-26-8
Formula: C18H17Cl2NOS
6126-0700-53
366.312
MFCD03842782
2,3-DICHLORO-3'-(1,3-DIOXOLAN-2-YL)BENZOPHENONE
CAS:898759-49-4
Formula: C16H12Cl2O3
6128-00-53
323.178
MFCD07699984
2,3-DICHLORO-3'-(3-PYRROLINOMETHYL) BENZOPHENONE
CAS:898749-47-8
Formula: C18H15Cl2NO
6125-0900-53
332.232
MFCD03842384
2,3-DICHLORO-3'-(4-METHYLPIPERAZINOMETHYL) BENZOPHENONE
CAS:898789-21-4
Formula: C19H20Cl2N2O
6125-0800-53
363.29
MFCD03842327
2,3-DICHLORO-3'-[8-(1,4-DIOXA-8-AZASPIRO[4.5]DECYL)METHYL]BENZOPHENONE
CAS:898762-19-1
Formula: C21H21Cl2NO3
6125-0600-53
406.312
MFCD03842215
2,3-DICHLORO-3'-MORPHOLINOMETHYL BENZOPHENONE
CAS:898792-16-0
Formula: C18H17Cl2NO2
6125-0100-53
350.248
MFCD03841932
2,3-DICHLORO-3'-PIPERIDINOMETHYL BENZOPHENONE
CAS:898793-48-1
Formula: C19H19Cl2NO
6125-0200-53
348.275
MFCD03841989
2,3-DICHLORO-3'-PYRROLIDINOMETHYL BENZOPHENONE
CAS:898770-76-8
Formula: C18H17Cl2NO
6125-0300-53
334.248
MFCD03842046
2,3-DICHLORO-3'-THIOMORPHOLINOMETHYL BENZOPHENONE
CAS:898787-78-5
Formula: C18H17Cl2NOS
6125-0700-53
366.312
MFCD03842271
2,3-DICHLORO-4'-(1,3-DIOXOLAN-2-YL)BENZOPHENONE
CAS:898760-66-2
Formula: C16H12Cl2O3
6129-00-53
323.178
MFCD07700035
2,3-DICHLORO-4'-(3-PYRROLINOMETHYL) BENZOPHENONE
CAS:898764-63-1
Formula: C18H15Cl2NO
6124-0900-53
332.232
MFCD03841875
2,3-DICHLORO-4'-(4-METHYLPIPERAZINOMETHYL) BENZOPHENONE
CAS:898763-18-3
Formula: C19H20Cl2N2O
6124-0800-53
363.29
MFCD03841818
2,3-DICHLORO-4'-[8-(1,4-DIOXA-8-AZASPIRO[4.5]DECYL)METHYL]BENZOPHENONE
CAS:898758-28-6
Formula: C21H21Cl2NO3
6124-0600-53
406.312
MFCD03841704
2,3-DICHLORO-4'-MORPHOLINOMETHYL BENZOPHENONE
CAS:898770-55-3
Formula: C18H17Cl2NO2
6124-0100-53
350.248
MFCD03841420
2,3-DICHLORO-4'-PIPERIDINOMETHYL BENZOPHENONE
CAS:898775-53-6
Formula: C19H19Cl2NO
6124-0200-53
348.275
MFCD03841477
2,3-DICHLORO-4'-PYRROLIDINOMETHYL BENZOPHENONE
CAS:898776-79-9
Formula: C18H17Cl2NO
6124-0300-53
334.248
MFCD03841534
2,3-DICHLORO-4'-THIOMORPHOLINOMETHYL BENZOPHENONE
CAS:898783-10-3
Formula: C18H17Cl2NOS
6124-0700-53
366.312
MFCD03841761
2,3-DICHLOROBENZYLMAGNESIUM CHLORIDE, 0.25 M IN 2-METHF
CAS:946491-90-3
Formula: [Mg](Cl)Cc1c(c(ccc1)Cl)Cl
G0134
219.789
MFCD11553211
2,3-DICHLOROBENZYLMAGNESIUM CHLORIDE, 0.25 M IN ETHER
CAS:946491-90-3
Formula: [Mg](Cl)Cc1c(c(ccc1)Cl)Cl
D0134
219.789
MFCD11553211
2,3-DICHLOROBENZYLZINC CHLORIDE
Formula: C7H5Cl3Zn
2370
260.847
2,3-DICHLOROBENZYLZINC CHLORIDE, 0.50 M IN THF
CAS:697762-17-7
Formula: [Zn](Cl)Cc1c(c(ccc1)Cl)Cl
ZT0134
260.847
MFCD22684859
2,3-DICHLOROPHENYLMAGNESIUM BROMIDE, 0.50 M IN 2-METHF
CAS:413589-33-0
Formula: [Mg](c1cccc(c1Cl)Cl)Br
G1029
250.213
MFCD18253714
2,3-DICHLOROPHENYLMAGNESIUM BROMIDE, 0.50 M IN THF
CAS:413589-33-0
Formula: [Mg](c1cccc(c1Cl)Cl)Br
T1029
250.213
MFCD18253714
2,3-DICHLOROPHENYLZINC BROMIDE, 0.50 M IN THF
Formula: [Zn](c1cccc(c1Cl)Cl)Br
ZT1029
291.271
MFCD22685473
2,3-DICHLOROPHENYLZINC IODIDE
CAS:307531-97-1
Formula: C6H3Cl2IZn
2186
338.271
MFCD02260173
2,3-DICHLOROPYRIDIN-4-YLZINC IODIDE, 0.25 M IN THF
Formula: c1nc(c(c(c1)[Zn]I)Cl)Cl
ZT2247
339.259
2,3-DIFLUORO-1-METHYL-4-(3-METHYLBUT-3-ENYL)BENZENE
Formula: C=C(CCc1ccc(C)c(F)c1F)C
AM0164
196.242
MFCD11553967
2,3-DIFLUORO-4-METHYL-BENZOIC ACID ETHYL ESTER
CAS:773135-56-1
Formula: O=C(OCC)c1ccc(c(c1F)F)C
EE9910
200.187
MFCD06204526
2,3-DIFLUORO-4-METHYLBENZYLMAGNESIUM BROMIDE, 0.25 M IN 2-METHF
Formula: [Mg](Br)Cc1c(c(c(cc1)C)F)F
G0164
245.358
MFCD11553223
2,3-DIFLUORO-4-METHYLBENZYLMAGNESIUM BROMIDE, 0.25 M IN ETHER
Formula: [Mg](Br)Cc1c(c(c(cc1)C)F)F
D0164
245.358
MFCD11553223
2,3-DIFLUORO-4-METHYLBENZYLZINC BROMIDE, 0.50 M IN THF
Formula: [Zn](Br)Cc1c(c(c(cc1)C)F)F
ZT0164
286.416
MFCD22684875
2,3-DIFLUORO-4-TRIFLUOROMETHYL-BENZOIC ACID ETHYL ESTER
Formula: Fc1c(F)c(C(=O)OCC)ccc1C(F)(F)F
EE9782
254.158
MFCD06204486
2,3-DIFLUOROBENZYLMAGNESIUM BROMIDE, 0.25 M IN 2-METHF
Formula: [Mg](Br)Cc1c(c(ccc1)F)F
G0154
231.331
MFCD11113507
2,3-DIFLUOROBENZYLMAGNESIUM BROMIDE, 0.25 M IN ETHER
Formula: [Mg](Br)Cc1c(c(ccc1)F)F
D0154
231.331
MFCD11113507
2,3-DIFLUOROBENZYLZINC BROMIDE
Formula: C7H5BrF2Zn
2347
272.39
2,3-DIFLUOROPHENYL CYCLOHEXYL KETONE
Formula: Fc1c(c(C(C2CCCCC2)=O)ccc1)F
NV03923
224.253
MFCD16250203
2,3-DIFLUOROPHENYL CYCLOPENTYL KETONE
Formula: O=C(c1c(c(ccc1)F)F)C1CCCC1
NV03922
210.226
MFCD16250202
2,3-DIFLUOROPHENYL CYCLOPROPYL KETONE
Formula: O=C(c1c(c(ccc1)F)F)C1CC1
NV03921
182.171
MFCD16250201
2,3-DIFLUOROPHENYLZINC BROMIDE, 0.50 M IN THF
Formula: c1ccc(c(c1[Zn]Br)F)F
ZT1334
258.362
MFCD22685702
2,3-DIHYDRO-1,4-BENZODIOXIN-6-YL(5-METHYLFURAN-2-YL)METHANOL
Formula: OC(c1ccc2OCCOc2c1)c1oc(cc1)C
NV01822
246.265
MFCD07782433
2,3-DIHYDRO-1,4-BENZODIOXIN-6-YL(5-METHYLTHIOPHEN-2-YL)METHANOL
Formula: Cc1ccc(C(c2cc3c(cc2)OCCO3)O)s1
NV01828
262.33
MFCD07782441
2,3-DIHYDRO-1,4-BENZODIOXIN-6-YL(FURAN-2-YL)METHANOL
Formula: OC(c1ccco1)c1ccc2c(OCCO2)c1
NV01816
232.238
MFCD07782426
2,3-DIHYDRO-1,4-BENZODIOXIN-6-YL(FURAN-3-YL)METHANOL
Formula: OC(c1cocc1)c1ccc2c(OCCO2)c1
NV01819
232.238
MFCD07782430
2,3-DIHYDRO-1,4-BENZODIOXIN-6-YL(PYRIDIN-2-YL)METHANOL
Formula: OC(c1ccccn1)c1ccc2OCCOc2c1
NV01813
243.265
MFCD07782422
2,3-DIHYDRO-1,4-BENZODIOXIN-6-YL(THIOPHEN-2-YL)METHANOL
Formula: OC(c1cccs1)c1ccc2c(OCCO2)c1
NV01832
248.303
MFCD07782445
2,3-DIHYDRO-BENZO[1,4]DIOXINE-5-CARBOXYLIC ACID ETHYL ESTER
CAS:261767-10-6
Formula: O=C(c1c2OCCOc2ccc1)OCC
EE9900
208.216
MFCD12090273
2,3-DIHYDRO-BENZO[1,4]DIOXINE-6-CARBOXYLIC ACID ETHYL ESTER
CAS:20825-87-0
Formula: O=C(c1cc2c(cc1)OCCO2)OCC
EE9899
208.216
MFCD06204332
2,3-DIHYDROBENZO[B]FURAN-5-YLMAGNESIUM BROMIDE, 0.50 M IN 2-METHF
CAS:134401-95-9
Formula: [Mg](Br)c1cc2c(OCC2)cc1
G0169
223.36
MFCD11553225
2,3-DIHYDROBENZO[B]FURAN-5-YLMAGNESIUM BROMIDE, 0.50 M IN THF
CAS:134401-95-9
Formula: [Mg](Br)c1cc2c(OCC2)cc1
T0169
223.36
MFCD11553225
2,3-DIHYDROBENZO[B]FURAN-5-YLZINC BROMIDE, 0.50 M IN THF
Formula: [Zn](Br)c1cc2c(OCC2)cc1
ZT0169
264.418
MFCD22684878
2,3-DIHYDROBENZOFURAN-5-CARBALDEHYDE
CAS:55745-70-5
Formula: O=Cc1ccc2c(c1)CCO2
AL0169
148.163
MFCD00068058
2,3-DIHYDROBENZOFURAN-5-CARBOXYLIC ACID ETHYL ESTER
CAS:83751-12-6
Formula: O=C(c1ccc2c(CCO2)c1)OCC
EE0169
192.216
MFCD06204418
2,3-DIMETHOXY-1-NAPHTHYLMAGNESIUM BROMIDE, 0.25 M IN 2-METHF
Formula: [Mg](Br)c1c2c(cccc2)cc(c1OC)OC
G1766
291.436
MFCD11553231
2,3-DIMETHOXY-1-NAPHTHYLMAGNESIUM BROMIDE, 0.25 M IN THF
Formula: [Mg](Br)c1c2c(cccc2)cc(c1OC)OC
T1766
291.436
MFCD11553231
2,3-DIMETHOXY-1-NAPHTHYLZINC BROMIDE, 0.25 M IN THF
Formula: [Zn](Br)c1c2c(cccc2)cc(c1OC)OC
ZT1766
332.494
MFCD25367708
2,3-DIMETHOXY-BENZOIC ACID ETHYL ESTER
CAS:91971-58-3
Formula: CCOC(c1cccc(c1OC)OC)=O
EE9889
210.232
MFCD06204286
2,3-DIMETHOXYBENZOYLACETONITRILE
CAS:199102-80-2
Formula: C11H11NO3
6307
205.215
MFCD02260815
2,3-DIMETHOXYBENZYLMAGNESIUM CHLORIDE
CAS:738580-42-2
Formula: C9H11ClMgO2
3096
210.952
MFCD02260193
2,3-DIMETHOXYBENZYLMAGNESIUM CHLORIDE, 0.25 M IN 2-METHF
CAS:738580-42-2
Formula: [Mg](Cl)Cc1c(c(ccc1)OC)OC
G0171
210.952
MFCD02260193
2,3-DIMETHOXYBENZYLZINC CHLORIDE
CAS:737797-22-7
Formula: C9H11ClO2Zn
2154
252.01
MFCD02260140
2,3-DIMETHYL THIOPHENOL
CAS:18800-51-6
Formula: Cc1cccc(c1C)S
NV00033
138.233
MFCD00040224
2,3-DIMETHYL-2'-(3-PYRROLINOMETHYL) BENZOPHENONE
CAS:898763-20-7
Formula: C20H21NO
6126-0900-26
291.396
MFCD03842878
2,3-DIMETHYL-2'-(4-METHYLPIPERAZINOMETHYL) BENZOPHENONE
CAS:898783-13-6
Formula: C21H26N2O
6126-0800-26
322.454
MFCD03842821
2,3-DIMETHYL-2'-[8-(1,4-DIOXA-8-AZASPIRO[4.5]DECYL)METHYL]BENZOPHENONE
CAS:898756-07-5
Formula: C23H27NO3
6126-0600-26
365.477
MFCD03842708
2,3-DIMETHYL-2'-METHOXYBENZOPHENONE
CAS:750633-49-9
Formula: C16H16O2
5049-26
240.305
MFCD01311509
2,3-DIMETHYL-2'-MORPHOLINOMETHYL BENZOPHENONE
CAS:898750-44-2
Formula: C20H23NO2
6126-0100-26
309.412
MFCD03842423
2,3-DIMETHYL-2'-PIPERIDINOMETHYL BENZOPHENONE
CAS:898773-21-2
Formula: C21H25NO
6126-0200-26
307.44
MFCD03842480
2,3-DIMETHYL-2'-PYRROLIDINOMETHYL BENZOPHENONE
CAS:898774-57-7
Formula: C20H23NO
6126-0300-26
293.412
MFCD03842537
2,3-DIMETHYL-2'-THIOMORPHOLINOMETHYL BENZOPHENONE
CAS:898781-82-3
Formula: C20H23NOS
6126-0700-26
325.476
MFCD03842764
2,3-DIMETHYL-3'-(1,3-DIOXOLAN-2-YL)BENZOPHENONE
CAS:898779-30-1
Formula: C18H18O3
6128-00-26
282.342
MFCD07699966
2,3-DIMETHYL-3'-(3-PYRROLINOMETHYL) BENZOPHENONE
CAS:898790-13-1
Formula: C20H21NO
6125-0900-26
291.396
MFCD03842366
2,3-DIMETHYL-3'-(4-METHYLPIPERAZINOMETHYL) BENZOPHENONE
CAS:898788-70-0
Formula: C21H26N2O
6125-0800-26
322.454
MFCD03842310
2,3-DIMETHYL-3'-[8-(1,4-DIOXA-8-AZASPIRO[4.5]DECYL)METHYL]BENZOPHENONE
CAS:898761-81-4
Formula: C23H27NO3
6125-0600-26
365.477
MFCD03842198
2,3-DIMETHYL-3'-METHOXYBENZOPHENONE
CAS:750633-69-3
Formula: C16H16O2
5050-26
240.305
MFCD01311541
2,3-DIMETHYL-3'-MORPHOLINOMETHYL BENZOPHENONE
CAS:898765-53-2
Formula: C20H23NO2
6125-0100-26
309.412
MFCD03841914
2,3-DIMETHYL-3'-PIPERIDINOMETHYL BENZOPHENONE
CAS:898793-08-3
Formula: C21H25NO
6125-0200-26
307.44
MFCD03841971
2,3-DIMETHYL-3'-PYRROLIDINOMETHYL BENZOPHENONE
CAS:898770-34-8
Formula: C20H23NO
6125-0300-26
293.412
MFCD03842028
2,3-DIMETHYL-3'-THIOMORPHOLINOMETHYL BENZOPHENONE
CAS:898763-11-6
Formula: C20H23NOS
6125-0700-26
325.476
MFCD03842253
2,3-DIMETHYL-4'-(1,3-DIOXOLAN-2-YL)BENZOPHENONE
CAS:898760-16-2
Formula: C18H18O3
6129-00-26
282.342
MFCD07700017
2,3-DIMETHYL-4'-(3-PYRROLINOMETHYL) BENZOPHENONE
CAS:898764-11-9
Formula: C20H21NO
6124-0900-26
291.396
MFCD03841857
2,3-DIMETHYL-4'-(4-METHYLPIPERAZINOMETHYL) BENZOPHENONE
CAS:898783-69-2
Formula: C21H26N2O
6124-0800-26
322.454
MFCD03841800
2,3-DIMETHYL-4'-[8-(1,4-DIOXA-8-AZASPIRO[4.5]DECYL)METHYL]BENZOPHENONE
CAS:898757-88-5
Formula: C23H27NO3
6124-0600-26
365.477
MFCD03841687
2,3-DIMETHYL-4'-METHOXYBENZOPHENONE
CAS:134994-51-7
Formula: C16H16O2
5051-26
240.305
MFCD01311571
2,3-DIMETHYL-4'-MORPHOLINOMETHYL BENZOPHENONE
CAS:898770-02-0
Formula: C20H23NO2
6124-0100-26
309.412
MFCD03841402
2,3-DIMETHYL-4'-PIPERIDINOMETHYL BENZOPHENONE
CAS:898771-46-5
Formula: C21H25NO
6124-0200-26
307.44
MFCD03841459
2,3-DIMETHYL-4'-PYRROLIDINOMETHYL BENZOPHENONE
CAS:898776-41-5
Formula: C20H23NO
6124-0300-26
293.412
MFCD03841516
2,3-DIMETHYL-4'-THIOMORPHOLINOMETHYL BENZOPHENONE
CAS:898782-71-3
Formula: C20H23NOS
6124-0700-26
325.476
MFCD03841743
2,3-DIMETHYL-4-METHOXYPHENYLMAGNESIUM BROMIDE, 0.50 M IN 2-METHF
Formula: [Mg](Br)c1ccc(c(c1C)C)OC
G0205
239.403
MFCD11553243
2,3-DIMETHYL-4-METHOXYPHENYLMAGNESIUM BROMIDE, 0.50 M IN THF
Formula: [Mg](Br)c1ccc(c(c1C)C)OC
T0205
239.403
MFCD11553243
2,3-DIMETHYL-4-METHOXYPHENYLZINC BROMIDE, 0.50 M IN THF
Formula: [Zn](Br)c1ccc(c(c1C)C)OC
ZT0205
280.461
MFCD22684899
2,3-DIMETHYLBENZALDEHYDE
CAS:5779-93-1
Formula: Cc1c(cccc1C)C=O
AL0209
134.179
MFCD00798004
2,3-DIMETHYLBENZOYLACETONITRILE
CAS:898787-06-9
Formula: C11H11NO
6321
173.216
MFCD02260822
2,3-DIMETHYLPHENETHYL ACETATE
Formula: O=C(OCCc1c(c(ccc1)C)C)C
NV03272
192.26
MFCD12964363
2,3-DIMETHYLPHENYL ETHYL SULFIDE
Formula: CCSc1c(C)c(ccc1)C
NV02876
166.287
MFCD11617737
2,3-DIMETHYLPHENYL METHYL SULFIDE
CAS:66794-10-3
Formula: Cc1c(C)c(SC)ccc1
NV02933
152.26
MFCD11617794
2,3-DIMETHYLPHENYL PERFLUOROBUTYL KETONE
Formula: FC(F)(F)C(F)(F)C(F)(F)C(C(c1cccc(c1C)C)=O)(F)F
K0209222
352.202
MFCD20920809
2,3-DIMETHYLPHENYL PERFLUOROETHYL KETONE
Formula: FC(F)(F)C(F)(F)C(=O)c1c(c(C)ccc1)C
K0209220
252.186
MFCD15145690
2,3-DIMETHYLPHENYLMAGNESIUM BROMIDE
CAS:134640-85-0
Formula: C8H9BrMg
3299
209.377
2,3-DIMETHYLPHENYLMAGNESIUM BROMIDE
Formula: C8H9BrMg
3254
209.377
MFCD01311494
2,3-DIMETHYLPHENYLMAGNESIUM BROMIDE
CAS:134640-85-0
Formula: C8H9BrMg
3041
209.377
MFCD01311494
2,3-DIMETHYLPHENYLMAGNESIUM BROMIDE, 0.50 M IN 2-METHF
CAS:134640-85-0
Formula: [Mg](Br)c1cccc(c1C)C
G0209
209.377
MFCD01311494
2,3-DIMETHYLPHENYLZINC BROMIDE, 0.50 M IN THF
Formula: [Zn](Br)c1cccc(c1C)C
ZT0209
250.435
MFCD22684902
2,3-DIMETHYLPHENYLZINC IODIDE
CAS:312692-94-7
Formula: C8H9IZn
2108
297.435
MFCD01311447
2,4'-DIBROMO-5-METHOXYBENZOPHENONE
CAS:890098-03-0
Formula: C14H10Br2O2
5027
370.043
MFCD00672037
2,4'-DIBROMOBENZOPHENONE
CAS:78281-59-1
Formula: C13H8Br2O
5005
340.016
MFCD00672017
2,4'-DICHLORO-3'-FLUOROBENZOPHENONE
Formula: C13H7Cl2FO
5187-14
269.105
MFCD09801480
2,4'-DICHLORO-3'-METHYLBENZOPHENONE
CAS:74617-45-1
Formula: C14H10Cl2O
5189-14
265.141
MFCD09801508
2,4'-DICHLOROBENZOPHENONE
CAS:85-29-0
Formula: C13H8Cl2O
5182-16
251.114
MFCD00038744
2,4'-DIMETHOXYBENZOPHENONE
CAS:5449-69-4
Formula: C15H14O3
5051-05
242.277
MFCD01311508
2,4,4,7-TETRAMETHYLOCT-1-ENE
Formula: CC(C)(CCC(C)C)CC(C)=C
AM0204
168.325
MFCD11553988
2,4,4-TRIMETHYLHEPT-1-ENE
Formula: CC(C)(CC(C)=C)CCC
AM0369
140.271
MFCD11554070
2,4,4-TRIMETHYLOCT-1-ENE
Formula: C=C(C)CC(C)(C)CCCC
AM0358
154.298
MFCD11554063
2,4,4-TRIMETHYLPENTYL 2-PYRIDYL KETONE
CAS:898779-74-3
Formula: C14H21NO
5569-21
219.33
MFCD07699222
2,4,4-TRIMETHYLUNDEC-1-ENE
Formula: C=C(CC(C)(C)CCCCCCC)C
AM0365
196.379
MFCD11554068
2,4,5-TRIFLUORO-3-METHOXYBENZOIC ACID ETHYL ESTER
CAS:351354-45-5
Formula: Fc1c(cc(c(F)c1OC)F)C(OCC)=O
EE9953
234.177
MFCD03094445
2,4,5-TRIFLUOROBENZOYLACETONITRILE
CAS:142501-42-6
Formula: C9H4F3NO
6316
199.134
MFCD02260821
2,4,5-TRIFLUOROBENZYLMAGNESIUM BROMIDE, 0.25 M IN 2-METHF
CAS:1245917-39-8
Formula: [Mg](Br)Cc1c(cc(c(c1)F)F)F
G0485
249.321
MFCD11553359
2,4,5-TRIFLUOROBENZYLMAGNESIUM BROMIDE, 0.25 M IN ETHER
CAS:1245917-39-8
Formula: [Mg](Br)Cc1c(cc(c(c1)F)F)F
D0485
249.321
MFCD11553359
2,4,5-TRIFLUOROBENZYLZINC BROMIDE
Formula: C7H4BrF3Zn
2300
290.379
MFCD13152555
2,4,5-TRIFLUOROPHENYL CYCLOHEXYL KETONE
Formula: Fc1c(F)cc(c(F)c1)C(C1CCCCC1)=O
NV03920
242.243
MFCD16250200
2,4,5-TRIFLUOROPHENYL CYCLOPENTYL KETONE
Formula: O=C(C1CCCC1)c1cc(c(cc1F)F)F
NV03919
228.216
MFCD16250199
2,4,5-TRIFLUOROPHENYL CYCLOPROPYL KETONE
Formula: O=C(c1c(cc(c(c1)F)F)F)C1CC1
NV03918
200.162
MFCD16250198
2,4,5-TRIMETHOXY-BENZOIC ACID ETHYL ESTER
Formula: O=C(OCC)c1c(OC)cc(c(c1)OC)OC
EE9826
240.258
MFCD06204288
2,4,5-TRIMETHYLBENZALDEHYDE
CAS:5779-72-6
Formula: C10H12O
8145
148.207
MFCD00017713
2,4,5-TRIMETHYLBENZOIC ACID ETHYL ESTER
CAS:158792-80-4
Formula: Cc1cc(c(C)cc1C(=O)OCC)C
EE0498
192.26
MFCD06204355
2,4,5-TRIMETHYLBENZYLMAGNESIUM CHLORIDE
Formula: C10H13ClMg
3183
192.98
MFCD07698756
2,4,5-TRIMETHYLPHENETHYL ALCOHOL
Formula: Cc1c(C)cc(c(c1)C)CCO
NV02049
164.25
MFCD09926173
2,4,5-TRIMETHYLPHENYL PERFLUOROBUTYL KETONE
Formula: FC(F)(F)C(F)(F)C(C(F)(F)C(c1c(cc(c(C)c1)C)C)=O)(F)F
K0498222
366.229
MFCD20921394
2,4,5-TRIMETHYLPHENYL PERFLUOROETHYL KETONE
Formula: FC(F)(C(c1cc(C)c(cc1C)C)=O)C(F)(F)F
K0498220
266.213
MFCD15145669
2,4,5-TRIMETHYLPHENYLMAGNESIUM BROMIDE
CAS:160727-03-7
Formula: C9H11BrMg
3145
223.404
MFCD02260239
2,4,5-TRIMETHYLPHENYLMAGNESIUM BROMIDE, 0.50 M IN 2-METHF
CAS:160727-03-7
Formula: [Mg](Br)c1c(cc(c(c1)C)C)C
G0498
223.404
MFCD02260239
2,4,5-TRIMETHYLPHENYLZINC BROMIDE, 0.50 M IN THF
CAS:151073-74-4
Formula: [Zn](Br)c1c(cc(c(c1)C)C)C
ZT0498
264.462
MFCD22685066
2,4,5-TRIMETHYLTHIOPHENOL
CAS:58348-14-4
Formula: Cc1cc(S)c(C)cc1C
NV00038
152.26
MFCD00041418
2,4,6-TRICHLOROBENZOIC ACID ETHYL ESTER
CAS:73981-96-1
Formula: Clc1cc(cc(Cl)c1C(=O)OCC)Cl
EE9986
253.514
MFCD12024964
2,4,6-TRICHLOROPHENYLMAGNESIUM BROMIDE, 0.50 M IN 2-METHF
Formula: [Mg](c1c(cc(cc1Cl)Cl)Cl)Br
G1038
284.658
MFCD18253722
2,4,6-TRICHLOROPHENYLMAGNESIUM BROMIDE, 0.50 M IN THF
Formula: [Mg](c1c(cc(cc1Cl)Cl)Cl)Br
T1038
284.658
MFCD18253722
2,4,6-TRICHLOROPHENYLZINC BROMIDE, 0.50 M IN THF
Formula: [Zn](c1c(cc(cc1Cl)Cl)Cl)Br
ZT1038
325.716
MFCD22685482
2,4,6-TRICHLOROPHENYLZINC IODIDE, 0.50 M IN THF
CAS:737797-45-4
Formula: [Zn](c1c(cc(cc1Cl)Cl)Cl)I
ZT1481
372.716
MFCD02260181
2,4,6-TRIFLUOROBENZOIC ACID ETHYL ESTER
CAS:773134-91-1
Formula: O=C(OCC)c1c(cc(cc1F)F)F
EE9948
204.15
MFCD06204407
2,4,6-TRIFLUOROBENZYLMAGNESIUM BROMIDE, 0.25 M IN 2-METHF
Formula: Br[Mg]Cc1c(F)cc(F)cc1F
G0486
249.321
MFCD11553360
2,4,6-TRIFLUOROBENZYLMAGNESIUM BROMIDE, 0.25 M IN ETHER
Formula: Br[Mg]Cc1c(F)cc(F)cc1F
D0486
249.321
MFCD11553360
2,4,6-TRIFLUOROBENZYLZINC BROMIDE, 0.25 M IN THF
Formula: Br[Zn]Cc1c(cc(cc1F)F)F
ZT0486
290.379
MFCD22685059
2,4,6-TRIFLUOROPHENYLZINC BROMIDE, 0.50 M IN THF
Formula: c1(c(c(cc(c1)F)F)[Zn]Br)F
ZT2294
276.352
2,4,6-TRIISOPROPYLBENZALDEHYDE
Formula: CC(c1cc(c(C=O)c(C(C)C)c1)C(C)C)C
AL0490
232.369
MFCD11553637
2,4,6-TRIISOPROPYLPHENYLMAGNESIUM BROMIDE, 0.50 M IN 2-METHF
CAS:108894-99-1
Formula: [Mg](Br)c1c(cc(cc1C(C)C)C(C)C)C(C)C
G0490
307.567
MFCD11553362
2,4,6-TRIISOPROPYLPHENYLMAGNESIUM BROMIDE, 0.50 M IN THF
CAS:108894-99-1
Formula: [Mg](Br)c1c(cc(cc1C(C)C)C(C)C)C(C)C
T0490
307.567
MFCD11553362
2,4,6-TRIISOPROPYLPHENYLZINC BROMIDE, 0.50 M IN THF
Formula: [Zn](Br)c1c(cc(cc1C(C)C)C(C)C)C(C)C
ZT0490
348.625
MFCD22685061
2,4,6-TRIMETHOXYBENZALDEHYDE
CAS:830-79-5
Formula: O=Cc1c(cc(OC)cc1OC)OC
AL0493
196.205
MFCD00003313
2,4,6-TRIMETHOXYBENZOIC ACID ETHYL ESTER
CAS:142232-19-7
Formula: O=C(c1c(OC)cc(cc1OC)OC)OCC
EE0493
240.258
MFCD06204550
2,4,6-TRIMETHOXYPHENYLMAGNESIUM BROMIDE, 0.50 M IN 2-METHF
CAS:380614-78-8
Formula: [Mg](Br)c1c(cc(cc1OC)OC)OC
G0493
271.402
MFCD11553365
2,4,6-TRIMETHOXYPHENYLMAGNESIUM BROMIDE, 0.50 M IN THF
CAS:380614-78-8
Formula: [Mg](Br)c1c(cc(cc1OC)OC)OC
T0493
271.402
MFCD11553365
2,4,6-TRIMETHOXYPHENYLZINC BROMIDE, 0.50 M IN THF
Formula: [Zn](Br)c1c(cc(cc1OC)OC)OC
ZT0493
312.46
MFCD22685064
2,4,6-TRIMETHYL(1,3-DIOXOLAN-2-YLMETHYL)BENZENE
CAS:898785-34-7
Formula: C13H18O2
8109a
206.287
MFCD08064183
2,4,6-TRIMETHYLBENZALDEHYDE
CAS:487-68-3
Formula: Cc1cc(C)c(C=O)c(C)c1
AL0499
148.207
MFCD00003341
2,4,6-TRIMETHYLBENZYLMAGNESIUM CHLORIDE
CAS:132856-34-9
Formula: C10H13ClMg
3182
192.98
MFCD08064079
2,4,6-TRIMETHYLBENZYLMAGNESIUM CHLORIDE, 0.25 M IN 2-METHF
CAS:132856-34-9
Formula: [Mg](Cl)Cc1c(cc(cc1C)C)C
G0495
192.98
MFCD08064079
2,4,6-TRIMETHYLBENZYLZINC CHLORIDE, 0.50 M IN THF
CAS:664981-06-0
Formula: [Zn](Cl)Cc1c(cc(cc1C)C)C
ZT0495
234.038
MFCD22685065
2,4,6-TRIMETHYLHEPT-1-ENE
Formula: CC(CC(CC(C)=C)C)C
AM0368
140.271
MFCD11554069
2,4,6-TRIMETHYLPHENYLMAGNESIUM BROMIDE
CAS:2633-66-1
Formula: C9H11BrMg
3142
223.404
MFCD00009663
2,4,6-TRIMETHYLPHENYLMAGNESIUM BROMIDE, 1.0 M IN 2-METHF
CAS:2633-66-1
Formula: [Mg](Br)c1c(cc(cc1C)C)C
G0499
223.404
MFCD00009663
2,4,6-TRIMETHYLPHENYLZINC BROMIDE, 0.50 M IN THF
CAS:906100-57-0
Formula: [Zn](Br)c1c(cc(cc1C)C)C
ZT0499
264.462
MFCD22685067
2,4,6-TRIMETHYLPHENYLZINC IODIDE
CAS:718628-26-3
Formula: C9H11IZn
2194
311.462
MFCD07698711
2,4-BIS-TRIFLUOROMETHYL-BENZOIC ACID ETHYL ESTER
CAS:773135-00-5
Formula: O=C(c1c(C(F)(F)F)cc(C(F)(F)F)cc1)OCC
EE0627
286.176
MFCD06204429
2,4-DICHLORO-1-(2,2-DIETHOXYETHYL)BENZENE
Formula: Clc1ccc(CC(OCC)OCC)c(Cl)c1
DA0135
263.166
MFCD11554282
2,4-DICHLORO-1-(3,3-DIETHOXYPROPYL)BENZENE
Formula: CCOC(OCC)CCc1c(cc(Cl)cc1)Cl
DA0140
277.193
MFCD11554286
2,4-DICHLORO-1-(3-METHYLBUT-3-ENYL)BENZENE
Formula: Clc1cc(c(cc1)CCC(=C)C)Cl
AM0135
215.124
MFCD09801242
2,4-DICHLORO-2'-(3-PYRROLINOMETHYL) BENZOPHENONE
CAS:898763-72-9
Formula: C18H15Cl2NO
6126-0900-54
332.232
MFCD03842897
2,4-DICHLORO-2'-(4-METHYLPIPERAZINOMETHYL) BENZOPHENON
CAS:898762-33-9
Formula: C19H20Cl2N2O
6126-0800-54
363.29
MFCD03842840
2,4-DICHLORO-2'-[8-(1,4-DIOXA-8-AZASPIRO[4.5]DECYL)METHYL]BENZOPHENONE
CAS:898756-51-9
Formula: C21H21Cl2NO3
6126-0600-54
406.312
MFCD03842726
2,4-DICHLORO-2'-MORPHOLINOMETHYL BENZOPHENONE
CAS:898751-01-4
Formula: C18H17Cl2NO2
6126-0100-54
350.248
MFCD03842442
2,4-DICHLORO-2'-PIPERIDINOMETHYL BENZOPHENONE
CAS:898773-67-6
Formula: C19H19Cl2NO
6126-0200-54
348.275
MFCD03842499
2,4-DICHLORO-2'-PYRROLIDINOMETHYL BENZOPHENONE
CAS:898774-95-3
Formula: C18H17Cl2NO
6126-0300-54
334.248
MFCD03842556
2,4-DICHLORO-2'-THIOMORPHOLINOMETHYL BENZOPHENONE
CAS:898782-29-1
Formula: C18H17Cl2NOS
6126-0700-54
366.312
MFCD03842783
2,4-DICHLORO-3'-(1,3-DIOXOLAN-2-YL)BENZOPHENONE
CAS:898759-52-9
Formula: C16H12Cl2O3
6128-00-54
323.178
MFCD07699985
2,4-DICHLORO-3'-(3-PYRROLINOMETHYL) BENZOPHENONE
CAS:898749-50-3
Formula: C18H15Cl2NO
6125-0900-54
332.232
MFCD03842385
2,4-DICHLORO-3'-(4-METHYLPIPERAZINOMETHYL) BENZOPHENONE
CAS:898789-23-6
Formula: C19H20Cl2N2O
6125-0800-54
363.29
MFCD03842328
2,4-DICHLORO-3'-[8-(1,4-DIOXA-8-AZASPIRO[4.5]DECYL)METHYL]BENZOPHENONE
CAS:898762-22-6
Formula: C21H21Cl2NO3
6125-0600-54
406.312
MFCD03842216
2,4-DICHLORO-3'-MORPHOLINOMETHYL BENZOPHENONE
CAS:898792-19-3
Formula: C18H17Cl2NO2
6125-0100-54
350.248
MFCD03841933
2,4-DICHLORO-3'-PIPERIDINOMETHYL BENZOPHENONE
CAS:898793-50-5
Formula: C19H19Cl2NO
6125-0200-54
348.275
MFCD03841990
2,4-DICHLORO-3'-PYRROLIDINOMETHYL BENZOPHENONE
CAS:898770-78-0
Formula: C18H17Cl2NO
6125-0300-54
334.248
MFCD03842047
2,4-DICHLORO-3'-THIOMORPHOLINOMETHYL BENZOPHENONE
CAS:898787-81-0
Formula: C18H17Cl2NOS
6125-0700-54
366.312
MFCD03842272
2,4-DICHLORO-4'-(1,3-DIOXOLAN-2-YL)BENZOPHENONE
CAS:898760-68-4
Formula: C16H12Cl2O3
6129-00-54
323.178
MFCD07700036
2,4-DICHLORO-4'-(3-PYRROLINOMETHYL) BENZOPHENONE
CAS:898764-65-3
Formula: C18H15Cl2NO
6124-0900-54
332.232
MFCD03841876
2,4-DICHLORO-4'-(4-METHYLPIPERAZINOMETHYL) BENZOPHENONE
CAS:898763-21-8
Formula: C19H20Cl2N2O
6124-0800-54
363.29
MFCD03841819
2,4-DICHLORO-4'-[8-(1,4-DIOXA-8-AZASPIRO[4.5]DECYL)METHYL]BENZOPHENONE
CAS:898758-31-1
Formula: C21H21Cl2NO3
6124-0600-54
406.312
MFCD03841705
2,4-DICHLORO-4'-MORPHOLINOMETHYL BENZOPHENONE
CAS:898770-57-5
Formula: C18H17Cl2NO2
6124-0100-54
350.248
MFCD03841421
2,4-DICHLORO-4'-PIPERIDINOMETHYL BENZOPHENONE
CAS:898775-55-8
Formula: C19H19Cl2NO
6124-0200-54
348.275
MFCD03841478
2,4-DICHLORO-4'-PYRROLIDINOMETHYL BENZOPHENONE
CAS:898776-81-3
Formula: C18H17Cl2NO
6124-0300-54
334.248
MFCD03841535
2,4-DICHLORO-4'-THIOMORPHOLINOMETHYL BENZOPHENONE
CAS:898783-12-5
Formula: C18H17Cl2NOS
6124-0700-54
366.312
MFCD03841762
2,4-DICHLORO-5-FLUORO-3-NITRO-BENZOIC ACID ETHYL ESTER
CAS:1156940-66-7
Formula: [O-][N+](=O)c1c(Cl)c(cc(c1Cl)C(=O)OCC)F
EE9688
282.057
MFCD12412145
2,4-DICHLORO-5-FLUOROBENZOIC ACID ETHYL ESTER
CAS:103318-75-8
Formula: Clc1c(F)cc(C(OCC)=O)c(c1)Cl
EE9987
237.059
MFCD06205036
2,4-DICHLORO-5-METHOXYPHENYLMAGNESIUM BROMIDE, 0.50 M IN 2-METHF
Formula: [Mg](c1c(cc(c(c1)OC)Cl)Cl)Br
G1047
280.239
MFCD18253731
2,4-DICHLORO-5-METHOXYPHENYLMAGNESIUM BROMIDE, 0.50 M IN THF
Formula: [Mg](c1c(cc(c(c1)OC)Cl)Cl)Br
T1047
280.239
MFCD18253731
2,4-DICHLORO-5-METHOXYPHENYLZINC BROMIDE, 0.50 M IN THF
Formula: [Zn](c1c(cc(c(c1)OC)Cl)Cl)Br
ZT1047
321.297
MFCD22685490
2,4-DICHLORO-5-PYRIMIDYLZINC BROMIDE
Formula: C4HBrCl2N2Zn
2397
293.246
MFCD22685751
2,4-DICHLOROBENZOIC ACID ETHYL ESTER
CAS:56882-52-1
Formula: Clc1c(C(=O)OCC)ccc(Cl)c1
EE9988
219.069
MFCD00277702
2,4-DICHLOROBENZYLMAGNESIUM CHLORIDE
CAS:129752-86-9
Formula: C7H5Cl3Mg
3078
219.789
MFCD01319913
2,4-DICHLOROBENZYLMAGNESIUM CHLORIDE, 0.25 M IN 2-METHF
CAS:129752-86-9
Formula: [Mg](Cl)Cc1c(cc(cc1)Cl)Cl
G0135
219.789
MFCD01319913
2,4-DICHLOROBENZYLZINC CHLORIDE
CAS:737797-16-9
Formula: C7H5Cl3Zn
2150
260.847
MFCD02260135
2,4-DICHLOROPHENETHYLMAGNESIUM BROMIDE, 0.50 M IN 2-METHF
CAS:1357620-35-9
Formula: [Mg](Br)CCc1c(cc(cc1)Cl)Cl
G0140
278.267
MFCD11553212
2,4-DICHLOROPHENETHYLMAGNESIUM BROMIDE, 0.50 M IN THF
CAS:1357620-35-9
Formula: [Mg](Br)CCc1c(cc(cc1)Cl)Cl
T0140
278.267
MFCD11553212
2,4-DICHLOROPHENETHYLZINC BROMIDE, 0.50 M IN THF
Formula: [Zn](Br)CCc1c(cc(cc1)Cl)Cl
ZT0140
319.325
MFCD22684860
2,4-DICHLOROPHENYLMAGNESIUM BROMIDE, 0.50 M IN 2-METHF
CAS:413589-32-9
Formula: [Mg](c1c(cc(cc1)Cl)Cl)Br
G1033
250.213
MFCD18253718
2,4-DICHLOROPHENYLMAGNESIUM BROMIDE, 0.50 M IN THF
CAS:413589-32-9
Formula: [Mg](c1c(cc(cc1)Cl)Cl)Br
T1033
250.213
MFCD18253718
2,4-DICHLOROPHENYLZINC BROMIDE, 0.50 M IN THF
Formula: [Zn](c1c(cc(cc1)Cl)Cl)Br
ZT1033
291.271
MFCD22685477
2,4-DICHLOROPHENYLZINC IODIDE
CAS:352530-42-8
Formula: C6H3Cl2IZn
2187
338.271
MFCD02260174
2,4-DICHLOROPYRIMIDIN-5-YLZINC IODIDE, 0.25 M IN THF
Formula: n1c(nc(c(c1)[Zn]I)OC)OC
ZT2245
331.409
2,4-DIFLUORO-2'-(3-PYRROLINOMETHYL) BENZOPHENONE
CAS:898763-80-9
Formula: C18H15F2NO
6126-0900-58
299.323
MFCD03842901
2,4-DIFLUORO-2'-(4-METHYLPIPERAZINOMETHYL) BENZOPHENONE
CAS:898762-45-3
Formula: C19H20F2N2O
6126-0800-58
330.381
MFCD03842844
2,4-DIFLUORO-2'-[8-(1,4-DIOXA-8-AZASPIRO[4.5]DECYL)METHYL]BENZOPHENONE
CAS:898756-63-3
Formula: C21H21F2NO3
6126-0600-58
373.403
MFCD03842730
2,4-DIFLUORO-2'-MORPHOLINOMETHYL BENZOPHENONE
CAS:898751-13-8
Formula: C18H17F2NO2
6126-0100-58
317.338
MFCD03842446
2,4-DIFLUORO-2'-PIPERIDINOMETHYL BENZOPHENONE
CAS:898773-75-6
Formula: C19H19F2NO
6126-0200-58
315.366
MFCD03842503
2,4-DIFLUORO-2'-PYRROLIDINOMETHYL BENZOPHENONE
CAS:898775-03-6
Formula: C18H17F2NO
6126-0300-58
301.339
MFCD03842560
2,4-DIFLUORO-2'-THIOMORPHOLINOMETHYL BENZOPHENONE
CAS:898782-41-7
Formula: C18H17F2NOS
6126-0700-58
333.403
MFCD03842787
2,4-DIFLUORO-3'-(1,3-DIOXOLAN-2-YL)BENZOPHENONE
CAS:898759-63-2
Formula: C16H12F2O3
6128-00-58
290.269
MFCD07699989
2,4-DIFLUORO-3'-(3-PYRROLINOMETHYL) BENZOPHENONE
CAS:898749-58-1
Formula: C18H15F2NO
6125-0900-58
299.323
MFCD03842389
2,4-DIFLUORO-3'-(4-METHYLPIPERAZINOMETHYL) BENZOPHENONE
CAS:898789-31-6
Formula: C19H20F2N2O
6125-0800-58
330.381
MFCD03842332
2,4-DIFLUORO-3'-[8-(1,4-DIOXA-8-AZASPIRO[4.5]DECYL)METHYL]BENZOPHENONE
CAS:898762-34-0
Formula: C21H21F2NO3
6125-0600-58
373.403
MFCD03842220
2,4-DIFLUORO-3'-MORPHOLINOMETHYL BENZOPHENONE
CAS:898792-28-4
Formula: C18H17F2NO2
6125-0100-58
317.338
MFCD03841937
2,4-DIFLUORO-3'-PIPERIDINOMETHYL BENZOPHENONE
CAS:898793-58-3
Formula: C19H19F2NO
6125-0200-58
315.366
MFCD03841994
2,4-DIFLUORO-3'-PYRROLIDINOMETHYL BENZOPHENONE
CAS:898770-86-0
Formula: C18H17F2NO
6125-0300-58
301.339
MFCD03842051
2,4-DIFLUORO-3'-THIOMORPHOLINOMETHYL BENZOPHENONE
CAS:898787-93-4
Formula: C18H17F2NOS
6125-0700-58
333.403
MFCD03842276
2,4-DIFLUORO-4'-(1,3-DIOXOLAN-2-YL)BENZOPHENONE
CAS:898760-76-4
Formula: C16H12F2O3
6129-00-58
290.269
MFCD07700040
2,4-DIFLUORO-4'-(3-PYRROLINOMETHYL) BENZOPHENONE
CAS:898764-73-3
Formula: C18H15F2NO
6124-0900-58
299.323
MFCD03841880
2,4-DIFLUORO-4'-(4-METHYLPIPERAZINOMETHYL) BENZOPHENONE
CAS:898763-33-2
Formula: C19H20F2N2O
6124-0800-58
330.381
MFCD03841823
2,4-DIFLUORO-4'-[8-(1,4-DIOXA-8-AZASPIRO[4.5]DECYL)METHYL]BENZOPHENONE
CAS:898758-43-5
Formula: C21H21F2NO3
6124-0600-58
373.403
MFCD03841709
2,4-DIFLUORO-4'-MORPHOLINOMETHYL BENZOPHENONE
CAS:898770-65-5
Formula: C18H17F2NO2
6124-0100-58
317.338
MFCD03841425
2,4-DIFLUORO-4'-PIPERIDINOMETHYL BENZOPHENONE
CAS:898775-63-8
Formula: C19H19F2NO
6124-0200-58
315.366
MFCD03841482
2,4-DIFLUORO-4'-PYRROLIDINOMETHYL BENZOPHENONE
CAS:898776-89-1
Formula: C18H17F2NO
6124-0300-58
301.339
MFCD03841539
2,4-DIFLUORO-4'-THIOMORPHOLINOMETHYL BENZOPHENONE
CAS:898783-20-5
Formula: C18H17F2NOS
6124-0700-58
333.403
MFCD03841766
2,4-DIFLUORO-5-NITRO-BENZOIC ACID ETHYL ESTER
CAS:179011-37-1
Formula: O=C(OCC)c1c(cc(F)c([N+](=O)[O-])c1)F
EE9841
231.157
MFCD12172523
2,4-DIFLUOROBENZOYLACETONITRILE
CAS:71682-95-6
Formula: C9H5F2NO
6296
181.143
MFCD02260804
2,4-DIFLUOROBENZYL ETHYL SULFIDE
Formula: Fc1cc(c(cc1)CSCC)F
NV06743
188.241
MFCD23143117
2,4-DIFLUOROBENZYL METHYL SULFIDE
Formula: Fc1cc(ccc1CSC)F
NV06765
174.214
MFCD23143140
2,4-DIFLUOROBENZYLMAGNESIUM BROMIDE
CAS:546122-71-8
Formula: C7H5BrF2Mg
3364
231.331
MFCD07698746
2,4-DIFLUOROBENZYLMAGNESIUM BROMIDE
CAS:546122-71-8
Formula: C7H5BrF2Mg
3099
231.331
MFCD07698746
2,4-DIFLUOROBENZYLMAGNESIUM BROMIDE
CAS:546122-71-8
Formula: C7H5BrF2Mg
3365
231.331
MFCD07698746
2,4-DIFLUOROBENZYLMAGNESIUM BROMIDE, 0.25 M IN 2-METHF
CAS:546122-71-8
Formula: [Mg](Br)Cc1c(cc(cc1)F)F
G0155
231.331
MFCD07698746
2,4-DIFLUOROBENZYLMAGNESIUM CHLORIDE, 0.25 M IN 2-METHF
CAS:161801-27-0
Formula: [Mg](Cl)Cc1c(cc(cc1)F)F
G1576
186.88
MFCD02260196
2,4-DIFLUOROBENZYLMAGNESIUM CHLORIDE, 0.25 M IN ETHER
CAS:161801-27-0
Formula: [Mg](Cl)Cc1c(cc(cc1)F)F
D1576
186.88
MFCD02260196
2,4-DIFLUOROBENZYLZINC BROMIDE
CAS:307496-26-0
Formula: C7H5BrF2Zn
2084
272.389
MFCD01311423
2,4-DIFLUOROBENZYLZINC CHLORIDE, 0.50 M IN THF
CAS:312692-88-9
Formula: c1cc(cc(c1C[Zn]Cl)F)F
ZT1576
227.938
MFCD02093635
2,4-DIFLUOROPHENYL CYCLOHEPTYL KETONE
Formula: O=C(c1c(cc(cc1)F)F)C1CCCCCC1
NV03924
238.28
MFCD16250204
2,4-DIFLUOROPHENYLZINC BROMIDE
CAS:517920-79-5
Formula: C6H3BrF2Zn
2165
258.362
MFCD02260152
2,4-DIMETHOXY-1-(2-METHYLALLYL)BENZENE
Formula: CC(Cc1ccc(OC)cc1OC)=C
AM0180
192.26
MFCD09801178
2,4-DIMETHOXY-6-METHYLBENZALDEHYDE
CAS:7149-90-8
Formula: COc1c(C=O)c(C)cc(OC)c1
AL0179
180.205
MFCD00033851
2,4-DIMETHOXY-6-METHYLBENZOIC ACID ETHYL ESTER
CAS:57749-86-7
Formula: COc1cc(cc(C)c1C(OCC)=O)OC
EE0179
224.259
MFCD00185439
2,4-DIMETHOXY-6-METHYLPHENYLMAGNESIUM BROMIDE, 0.50 M IN 2-METHF
CAS:166587-25-3
Formula: [Mg](Br)c1c(cc(cc1OC)OC)C
G0179
255.403
MFCD11553233
2,4-DIMETHOXY-6-METHYLPHENYLMAGNESIUM BROMIDE, 0.50 M IN THF
CAS:166587-25-3
Formula: [Mg](Br)c1c(cc(cc1OC)OC)C
T0179
255.403
MFCD11553233
2,4-DIMETHOXY-6-METHYLPHENYLZINC BROMIDE, 0.50 M IN THF
Formula: [Zn](Br)c1c(cc(cc1OC)OC)C
ZT0179
296.461
MFCD22684885
2,4-DIMETHOXYBENZALDEHYDE
CAS:613-45-6
Formula: C9H10O3
8118
166.178
MFCD00003311
2,4-DIMETHOXYBENZALDEHYDE
CAS:613-45-6
Formula: O=Cc1c(cc(cc1)OC)OC
AL0180
166.178
MFCD00003311
2,4-DIMETHOXYBENZOIC ACID ETHYL ESTER
CAS:81722-07-8
Formula: COc1cc(c(cc1)C(=O)OCC)OC
EE9932
210.232
MFCD02149437
2,4-DIMETHOXYBENZOYLACETONITRILE
CAS:76569-43-2
Formula: C11H11NO3
6308
205.215
MFCD02260816
2,4-DIMETHOXYBENZYLMAGNESIUM CHLORIDE, 0.25 M IN 2-METHF
CAS:1114400-59-7
Formula: COc1c(ccc(OC)c1)C[Mg]Cl
G1263
210.952
MFCD02260204
2,4-DIMETHOXYBENZYLMAGNESIUM CHLORIDE, 0.25 M IN THF
CAS:1114400-59-7
Formula: COc1c(ccc(OC)c1)C[Mg]Cl
T1263
210.952
MFCD02260204
2,4-DIMETHOXYBENZYLZINC CHLORIDE, 0.50 M IN THF
CAS:480438-24-2
Formula: [Zn](Cc1ccc(cc1OC)OC)Cl
ZT1263
252.01
MFCD02260141
2,4-DIMETHOXYPHENETHYL ACETATE
Formula: COc1cc(c(CCOC(C)=O)cc1)OC
NV03282
224.259
MFCD12964373
2,4-DIMETHOXYPHENYL METHYL SULFIDE
Formula: COc1ccc(c(OC)c1)SC
NV02938
184.259
MFCD11617799
2,4-DIMETHOXYPHENYL-(1-METHYL-2-PYRROLYL)METHANOL
Formula: COc1c(ccc(OC)c1)C(O)c1n(ccc1)C
NV01410
247.296
MFCD07775404
2,4-DIMETHOXYPHENYL-(5-METHYL-2-THIENYL)METHANOL
Formula: OC(c1sc(C)cc1)c1c(cc(cc1)OC)OC
NV01459
264.346
MFCD07775453
2,4-DIMETHOXYPHENYLMAGNESIUM BROMIDE
CAS:138109-49-6
Formula: C8H9BrMgO2
3297
241.376
2,4-DIMETHOXYPHENYLMAGNESIUM BROMIDE
CAS:138109-49-6
Formula: C8H9BrMgO2
3039
241.376
MFCD01311490
2,4-DIMETHOXYPHENYLMAGNESIUM BROMIDE, 0.50 M IN 2-METHF
CAS:138109-49-6
Formula: [Mg](Br)c1c(cc(cc1)OC)OC
G0180
241.376
MFCD01311490
2,4-DIMETHOXYPHENYLZINC BROMIDE, 0.50 M IN THF
CAS:157790-76-6
Formula: [Zn](Br)c1c(cc(cc1)OC)OC
ZT0180
282.434
MFCD22684886
2,4-DIMETHOXYPHENYLZINC IODIDE, 0.50 M IN THF
CAS:738580-36-4
Formula: I[Zn]c1c(cc(cc1)OC)OC
ZT1433
329.434
MFCD07698714
2,4-DIMETHOXYPYRIMIDIN-5-YLMAGNESIUM BROMIDE, 0.25 M IN 2-METHF
Formula: [Mg](Br)c1c(OC)nc(OC)nc1
G1521
243.351
MFCD22684758
2,4-DIMETHOXYPYRIMIDIN-5-YLMAGNESIUM BROMIDE, 0.25 M IN THF
Formula: [Mg](Br)c1c(OC)nc(OC)nc1
T1521
243.351
MFCD22684758
2,4-DIMETHOXYPYRIMIDIN-5-YLZINC BROMIDE, 0.25 M IN THF
Formula: [Zn](Br)c1c(OC)nc(OC)nc1
ZT1521
284.409
MFCD22685743
2,4-DIMETHYL(1,3-DIOXOLAN-2-YLMETHYL)BENZENE
CAS:898759-33-6
Formula: C12H16O2
8057a
192.26
MFCD04117664