Phone (USA) +1 212-348-5610
Whatsapp: +1 516-336-9307
WeChat: chembuyersguide
Chemical Search
 
























Chemenu Inc.




Country: USA

Chemenu Inc.
PO BOX 1541
MT LAUREL NJ 08054

China Office
Lane 3399, Kangxin Highway,Bldg 5,
Shanghai International Medical Zone,
Pudong New District,
Shanghai, China 201321


Phone: 86-21-2022 2982
FAX: 86-21-2096 2272
E-Mail:E-Mail this Supplier


http://www.chemenu.com/

Chemenu Inc.

Page: Home | 1 | 2 | 3 | 4 | 5 | 6 | 7 | 8 | 9 | 10 | 11 | 12 | 13 | 14 | 15 | 16 | 17 | 18 | 19 | 20 | 21 | 22 | 23 | 24 | 25 | 26 | 27 | 28 | 29 | 30 | 31 | 32 | 33 | 34 | 35 | 36 | 37 | 38 | 39 | 40 | 41 | 42 | 43 | 44 | 45 | 46 | 47 | 48 | 49 | 50 | 51 | 52 | 53 | 54 | 55 | 56 | 57 | 58 | 59 | 60 | 61 | 62 | 63 | 64 | 65 | 66 | 67 | 68 | 69 | 70 | 71 | 72 | 73 | 74 | 75 | 76 | 77 | 78 | 79 | 80 | 81 | 82 | 83 | 84 | 85 | 86 | 87 | 88 | 89 | 90 | 91 | 92 | 93 | 94 | 95 | 96 | 97 | 98 | 99 | 100 | 101 | 102 |
 


249824

2'-CHLORO-3-(2-METHYLPHENYL)PROPIOPHENONE
CAS:898789-68-9
CM302274
O=C(C1=CC=CC=C1Cl)CCC2=CC=CC=C2C
2'-CHLORO-3-(3-CHLOROPHENYL)-4'-FLUOROPROPIOPHENONE
CAS:898787-32-1
CM302127
O=C(C1=CC=C(F)C=C1Cl)CCC2=CC=CC(Cl)=C2
2'-CHLORO-3-(3-CHLOROPHENYL)PROPIOPHENONE
CAS:898787-22-9
CM302117
O=C(C1=CC=CC=C1Cl)CCC2=CC=CC(Cl)=C2
2'-CHLORO-3-(3-METHYLPHENYL)PROPIOPHENONE
CAS:898790-96-0
CM302395
O=C(C1=CC=CC=C1Cl)CCC2=CC=CC(C)=C2
2'-CHLORO-3-(4-CHLOROPHENYL)-4'-FLUOROPROPIOPHENONE
CAS:898788-33-5
CM302198
O=C(C1=CC=C(F)C=C1Cl)CCC2=CC=C(Cl)C=C2
2'-CHLORO-3-(4-CHLOROPHENYL)PROPIOPHENONE
CAS:898788-21-1
CM302192
O=C(C1=CC=CC=C1Cl)CCC2=CC=C(Cl)C=C2
2'-CHLORO-4'-FLUORO-3-(2-METHYLPHENYL)PROPIOPHENONE
CAS:898789-85-0
CM302290
O=C(C1=CC=C(F)C=C1Cl)CCC2=CC=CC=C2C
2'-CHLORO-4'-FLUORO-3-(3-METHYLPHENYL)PROPIOPHENONE
CAS:898791-14-5
CM302409
O=C(C1=CC=C(F)C=C1Cl)CCC2=CC=CC(C)=C2
2'-CHLORO-4'-METHYL-5-NITRO-[1,1'-BIPHENYL]-3-CARBOXYLIC ACID
CAS:1261967-52-5
CM303800
O=C(C1=CC(C2=CC=C(C)C=C2Cl)=CC([N+]([O-])=O)=C1)O
2'-CHLORO-4-(5,5-DIMETHYL-1,3-DIOXAN-2-YL)BUTYROPHENONE
CAS:898785-86-9
CM301996
O=C(C1=CC=CC=C1Cl)CCCC2OCC(C)(C)CO2
2'-CHLORO-5'-FLUOROACETOPHENONE
CAS:2965-16-4
CM251993
CC(C1=C(C=CC(=C1)F)Cl)=O
2'-CHLORO-5'-METHOXY-5-NITRO-[1,1'-BIPHENYL]-3-CARBOXYLIC ACID
CAS:1261892-79-8
CM303799
O=C(C1=CC(C2=CC(OC)=CC=C2Cl)=CC([N+]([O-])=O)=C1)O
2'-CHLORO-5-(5,5-DIMETHYL-1,3-DIOXAN-2-YL)VALEROPHENONE
CAS:898785-92-7
CM302001
O=C(C1=CC=CC=C1Cl)CCCCC2OCC(C)(C)CO2
2'-CHLORO-5-FLUORO-[1,1'-BIPHENYL]-3-CARBOXYLIC ACID
CAS:1261959-57-2
CM304556
O=C(C1=CC(C2=CC=CC=C2Cl)=CC(F)=C1)O
2'-CHLORO-6'-FLUORO-3'-METHYLACETOPHENONE
CAS:261762-63-4
CM192273
CC(C1=C(F)C=CC(C)=C1Cl)=O
2'-CHLORO-6'-HYDROXYACETOPHENONE
CAS:55736-04-4
CM117048
CC(C1=C(O)C=CC=C1Cl)=O
2'-CYANO-3-(2,4-DIMETHYLPHENYL)PROPIOPHENONE
CAS:898793-65-2
CM302511
O=C(C1=CC=CC=C1C#N)CCC2=CC=C(C)C=C2C
2'-CYANO-3-(2,5-DIMETHYLPHENYL)PROPIOPHENONE
CAS:898794-86-0
CM302574
O=C(C1=CC=CC=C1C#N)CCC2=CC(C)=CC=C2C
2'-CYANO-3-(2-METHYLPHENYL)PROPIOPHENONE
CAS:898789-22-5
CM302247
O=C(C1=CC=CC=C1C#N)CCC2=CC=CC=C2C
2'-CYANO-3-(3-FLUOROPHENYL)PROPIOPHENONE
CAS:898788-79-9
CM302222
O=C(C1=CC=CC=C1C#N)CCC2=CC=CC(F)=C2
2'-CYANO-3-(3-METHYLPHENYL)PROPIOPHENONE
CAS:898790-43-7
CM302346
O=C(C1=CC=CC=C1C#N)CCC2=CC=CC(C)=C2
2'-Deoxy-2',2'-difluorocytidine hydrochloride
CAS:122111-03-9
CM116605
OC[C@@H]1[C@H](C(F)(F)[C@H](N2C(N=C(C=C2)N)=O)O1)O
2'-DEOXY-2'-FLUOROCYTIDINE HYDRATE
CAS:1820580-34-4
CM250575
OC[C@@H]1[C@H]([C@@H](F)[C@H](N2C(N=C(C=C2)N)=O)O1
2'-DEOXY-2'-FLUOROURIDINE
CAS:784-71-4
CM255054
OC[C@@H]1[C@H]([C@@H](F)[C@H](N2C(NC(C=C2)=O)=O)O1
2'-FLUORO-[1,1'-BIPHENYL]-3-CARBOXYLIC ACID
CAS:103978-23-0
CM182591
O=C(C1=CC(C2=CC=CC=C2F)=CC=C1)O
2'-FLUORO-[1,1'-BIPHENYL]-4-CARBALDEHYDE
CAS:57592-42-4
CM253759
O=CC1=CC=C(C2=CC=CC=C2F)C=C1
2'-FLUORO-2'-DEOXYADENOSINE
CAS:64183-27-3
CM301903
OC[C@@H]1[C@H]([C@@H](F)[C@H](N2C=NC3=C(N=CN=C32)N
2'-FLUORO-2'-DEOXYGUANOSINE
CAS:78842-13-4
CM104609
NC1=NC2=C(N=CN2[C@@H]2O[C@H](CO)[C@@H](O)[C@H]2F)C
2'-FLUORO-3'-METHOXY-[1,1'-BIPHENYL]-3-CARBOXYLIC ACID
CAS:1215206-35-1
CM305706
FC1=C(C=CC=C1OC)C2=CC(=CC=C2)C(=O)O
2'-FLUORO-3-(2-METHYLPHENYL)PROPIOPHENONE
CAS:898789-70-3
CM302276
O=C(C1=CC=CC=C1F)CCC2=CC=CC=C2C
2'-FLUORO-3-(3-METHYLPHENYL)PROPIOPHENONE
CAS:898790-99-3
CM302397
O=C(C1=CC=CC=C1F)CCC2=CC=CC(C)=C2
2'-FLUORO-4'-METHYLACETOPHENONE
CAS:29427-48-3
CM183595
CC(C1=CC=C(C)C=C1F)=O
2'-FLUORO-4-PENTYL-4''-PROPYL-1,1':4',1''-TERPHENYL
CAS:95759-51-6
CM256000
CCCC1=CC=C(C2=CC=C(C3=CC=C(CCCCC)C=C3)C(F)=C2)C=C1
2'-FLUORO-5-METHOXY-5'-METHYL-[1,1'-BIPHENYL]-3-CARBOXYLIC ACID
CAS:1261971-58-7
CM305736
O=C(C1=CC(C2=CC(C)=CC=C2F)=CC(OC)=C1)O
2'-FLUORO-6'-HYDROXYACETOPHENONE
CAS:93339-98-1
CM116965
CC(C1=C(O)C=CC=C1F)=O
2'-FORMYL-[1,1'-BIPHENYL]-3-CARBOXYLIC ACID
CAS:205871-52-9
CM303598
O=C(C1=CC(C2=CC=CC=C2C=O)=CC=C1)O
2'-HYDROXY-[1,1'-BINAPHTHALEN]-2-YL PIVALATE
CAS:114459-67-5
CM230904
CC(C)(C)C(OC1=CC=C2C=CC=CC2=C1C3=C4C=CC=CC4=CC=C3O
2'-HYDROXY-[1,1'-BIPHENYL]-4-CARBALDEHYDE
CAS:400744-38-9
CM122913
O=CC1=CC=C(C2=CC=CC=C2O)C=C1
2'-HYDROXY-[1,1':3',1''-TERPHENYL]-5'-CARBALDEHYDE
CAS:3437-80-7
CM243191
O=CC1=CC(C2=CC=CC=C2)=C(O)C(C3=CC=CC=C3)=C1
2'-HYDROXY-3'-METHYLACETOPHENONE
CAS:699-91-2
CM117414
CC(C1=CC=CC(C)=C1O)=O
2'-HYDROXY-3'-NITRO-[1,1'-BIPHENYL]-3-CARBOXYLIC ACID
CAS:376591-95-6
CM186292
O=C(C1=CC(C2=CC=CC([N+]([O-])=O)=C2O)=CC=C1)O
2'-HYDROXY-5'-METHOXYACETOPHENONE
CAS:705-15-7
CM243411
CC(C1=CC(OC)=CC=C1O)=O
2'-HYDROXY-6'-METHOXYACETOPHENONE
CAS:703-23-1
CM117181
CC(C1=C(OC)C=CC=C1O)=O
2'-HYDROXY-6'-METHYLACETOPHENONE
CAS:41085-27-2
CM116964
CC(C1=C(C)C=CC=C1O)=O
2'-HYDROXY-N,N-DIMETHYL-[1,1'-BIPHENYL]-3-CARBOXAMIDE
CAS:1261984-36-4
CM281805
O=C(C1=CC(C2=CC=CC=C2O)=CC=C1)N(C)C
2'-HYDROXYACETOPHENONE
CAS:118-93-4
CM248063
C1=CC=CC(=C1O)C(=O)C
2'-HYDROXYBUTYROPHENONE
CAS:2887-61-8
CM184732
CCCC(C1=CC=CC=C1O)=O
2'-HYDROXYPROPIOPHENONE
CAS:610-99-1
CM186550
CCC(C1=CC=CC=C1O)=O
2'-ISO-PROPYL-2,2,2-TRIFLUOROACETOPHENONE
CAS:845823-14-5
CM312728
O=C(C1=CC=CC=C1C(C)C)C(F)(F)F
2'-METHOXY-[1,1'-BINAPHTHALEN]-2-OL
CAS:35193-70-5
CM141568
OC1=CC=C2C=CC=CC2=C1C3=C4C=CC=CC4=CC=C3OC
2'-METHOXY-[1,1'-BIPHENYL]-4-CARBALDEHYDE
CAS:421553-62-0
CM252878
O=CC1=CC=C(C2=CC=CC=C2OC)C=C1
2'-METHOXY-3-(2-METHYLPHENYL)PROPIOPHENONE
CAS:898789-13-4
CM302241
O=C(C1=CC=CC=C1OC)CCC2=CC=CC=C2C
2'-METHOXY-3-(3-METHYLPHENYL)PROPIOPHENONE
CAS:898790-37-9
CM302340
O=C(C1=CC=CC=C1OC)CCC2=CC=CC(C)=C2
2'-METHOXY-5'-METHYL-3'-NITROACETOPHENONE
CAS:103204-71-3
CM313583
CC(C1=CC(C)=CC([N+]([O-])=O)=C1OC)=O
2'-METHOXYPHENYL ACETYLENE
CAS:767-91-9
CM254976
COC1=C(C=CC=C1)C#C
2'-METHYL-[1,1'-BIPHENYL]-3-AMINE
CAS:400745-54-2
CM304094
NC1=CC(C2=CC=CC=C2C)=CC=C1
2'-METHYL-[1,1'-BIPHENYL]-3-AMINE HYDROCHLORIDE
CAS:728864-96-8
CM185437
NC1=CC(C2=CC=CC=C2C)=CC=C1.[H]Cl
2'-METHYL-3-(2-METHYLPHENYL)PROPIOPHENONE
CAS:898789-04-3
CM302235
O=C(C1=CC=CC=C1C)CCC2=CC=CC=C2C
2'-METHYL-3-(3-METHYLPHENYL)PROPIOPHENONE
CAS:898790-31-3
CM302334
O=C(C1=CC=CC=C1C)CCC2=CC=CC(C)=C2
2'-METHYL-3-PHENYLPROPIOPHENONE
CAS:93433-65-9
CM302661
O=C(C1=CC=CC=C1C)CCC2=CC=CC=C2
2'-METHYL-5-NITRO-[1,1'-BIPHENYL]-3-CARBOXYLIC ACID
CAS:1261952-79-7
CM303998
O=C(C1=CC(C2=CC=CC=C2C)=CC([N+]([O-])=O)=C1)O
2'-METHYLPROPIOPHENONE
CAS:2040-14-4
CM251141
CCC(C1=CC=CC=C1C)=O
2'-NITRO-[1,1'-BIPHENYL]-3-CARBOXYLIC ACID
CAS:236102-72-0
CM183412
O=C(C1=CC(C2=CC=CC=C2[N+]([O-])=O)=CC=C1)O
2'-NITRO-[1,1'-BIPHENYL]-4-CARBOXYLIC ACID
CAS:3215-92-7
CM192649
O=C(C1=CC=C(C2=CC=CC=C2[N+]([O-])=O)C=C1)O
2'-O-METHYLCYTIDINE
CAS:2140-72-9
CM251341
CO[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C=CC(N)=NC1=O
2'-O-METHYLGUANOSINE
CAS:2140-71-8
CM251340
OC[C@@H]1[C@H]([C@H]([C@H](N2C=NC3=C2N=C(N)NC3=O)O
2'-OXO-2-PHENYLSPIRO[CYCLOPROPANE-1,3'-INDOLINE]-5'-CARBOXYLIC ACID
CAS:1710834-34-6
CM211749
O=C(C1=CC(C23C(C4=CC=CC=C4)C2)=C(NC3=O)C=C1)O
2'-OXOSPIRO[CYCLOPROPANE-1,3'-INDOLINE]-2-CARBOXYLIC ACID
CAS:67503-08-6
CM138932
O=C(C1C2(C(NC3=C2C=CC=C3)=O)C1)O
2'-TOSYL-2',3'-DIHYDRO-1'H-SPIRO[CYCLOBUTANE-1,4'-ISOQUINOLINE]
CAS:1425335-34-7
CM209526
O=S(N(C1)CC2=C(C31CCC3)C=CC=C2)(C4=CC=C(C)C=C4)=O
2'-TRIFLUOROMETHYL-BIPHENYL-4-CARBALDEHYDE
CAS:198205-95-7
CM183301
C1=CC=CC(=C1C2=CC=C(C=C2)C=O)C(F)(F)F
2'-TRIFLUOROMETHYL-BIPHENYL-4-CARBOXYLIC ACID
CAS:198205-79-7
CM183269
O=C(C1=CC=C(C2=CC=CC=C2C(F)(F)F)C=C1)O
2'H-SPIRO[CYCLOPROPANE-1,3'-IMIDAZO[1,2-A]PYRIMIDINE]
CAS:297182-41-3
CM213628
C1(N=CC=CN12)=NCC32CC3
2(1H)-PYRIMIDINONE,4-AMINO-1-B-D-ARABINOFURANOSYL-,HYDROCHLORIDE (1:1)
CAS:69-74-9
CM100871
O=C1N=C(N)C=CN1[C@H]2[C@H]([C@@H]([C@@H](CO)O2)O)O
2(1H)-QUINOLINONE, 4-(BROMOMETHYL)-
CAS:4876-10-2
CM143852
C1=CC=CC2=C1NC(=O)C=C2CBr
2(1H)-QUINOLINONE, 6-(2-BROMOACETYL)-3,4-DIHYDRO-
CAS:70639-82-6
CM108482
O=C1NC2=C(C=C(C(CBr)=O)C=C2)CC1
2(3)-TERT-BUTYL-4-METHOXYPHENOL
CAS:25013-16-5
CM116902
OC1=CC=C(OC)C=C1C(C)(C)C.OC2=CC=C(OC)C(C(C)(C)C)=C
2(S)-PHENYLAZETIDINE
CAS:1956300-02-9
CM329646
[C@H]1(C2=CC=CC=C2)NCC1
2, 4-DIETHYL THIOXANTHONE
CAS:82799-44-8
CM181916
CCC1=CC(CC)=C2SC3=C(C=CC=C3)C(=O)C2=C1
2,1,3-BENZOTHIADIAZOL-4-AMINE
CAS:767-64-6
CM112828
NC1=CC=CC2=NSN=C21
2,1,3-BENZOTHIADIAZOL-5-AMINE
CAS:874-37-3
CM112827
NC1=CC2=NSN=C2C=C1
2,1,3-BENZOTHIADIAZOLE
CAS:273-13-2
CM160474
C1=CC=CC2=NSN=C12
2,1,3-BENZOTHIADIAZOLE-4-SULFONYL CHLORIDE
CAS:73713-79-8
CM112733
O=S(C1=CC=CC2=NSN=C21)(Cl)=O
2,1,3-BENZOXADIAZOLE
CAS:273-09-6
CM160470
O1N=C2C=CC=CC2=N1
2,1,3-BENZOXADIAZOLE-4-CARBALDEHYDE
CAS:32863-32-4
CM158034
O=CC1=CC=CC2=NON=C21
2,1,3-BENZOXADIAZOLE-4-CARBOXYLIC ACID
CAS:32863-21-1
CM325859
O=C(C1=CC=CC2=NON=C21)O
2,1,3-BENZOXADIAZOLE-4-SULFONYL CHLORIDE
CAS:114322-14-4
CM112660
O=S(C1=CC=CC2=NON=C21)(Cl)=O
2,1,3-BENZOXADIAZOLE-5-CARBOXYLIC ACID
CAS:19155-88-5
CM160359
O=C(C1=CC2=NON=C2C=C1)O
2,10,10-TRIMETHYL-6-METHYLENE-1-OXASPIRO[4.5]DEC-7-ENE
CAS:65416-59-3
CM216109
C=C(C=CCC1(C)C)C21CCC(C)O2
2,12-DIFORMYL-DIBENZO[C,H]ACRIDINE
CAS:263708-49-2
CM316656
O=CC1=CC2=C3N=C4C5=CC(C=O)=CC=C5C=CC4=CC3=CC=C2C=C
2,2',2'',2'''-(PROPANE-1,3-DIYLBIS(AZANETRIYL))-TETRAACETIC ACID
CAS:1939-36-2
CM184528
O=C(O)CN(CC(O)=O)CCCN(CC(O)=O)CC(O)=O
2,2',2''-(1,3,5-TRIAZINANE-1,3,5-TRIYL)TRIETHANOL
CAS:4719-04-4
CM253099
OCCN1CN(CCO)CN(CCO)C1
2,2',2''-NITRILOTRIETHANOL PHOSPHATE
CAS:10017-56-8
CM325215
OCCN(CCO)CCO.O=P(O)(O)O
2,2',2''-PHOSPHINETRIYLTRIBENZALDEHYDE
CAS:50777-83-8
CM253275
O=CC1=CC=CC=C1P(C2=CC=CC=C2C=O)C3=CC=CC=C3C=O
2,2',3'-TRIHYDROXY-4,6-DIMETHOXYBENZOPHENONE
CAS:219861-73-1
CM303512
O=C(C1=CC=CC(O)=C1O)C2=C(OC)C=C(OC)C=C2O
2,2',3,3'-TETRAHYDRO-1,1'-SPIROBI[1H-INDENE]-7,7'-DIOL
CAS:223137-87-9
CM116955
OC1=CC=CC2=C1C3(CCC4=C3C(O)=CC=C4)CC2
2,2',3,3'-TETRAHYDRO-1,1'-SPIROBI[INDENE]-6,6'-DIOL
CAS:105480-69-1
CM204560
OC1=CC2=C(C=C1)CCC23CCC4=C3C=C(O)C=C4
2,2',3,3'-TETRAHYDRO-5,5'-BITHIENO[3,4-B][1,4]DIOXINE
CAS:195602-17-6
CM131752
C12=CSC(C3=C4C(OCCO4)=CS3)=C1OCCO2
2,2',4,4'-TETRAHYDROXYBENZOPHENONE
CAS:131-55-5
CM158953
O=C(C1=CC=C(O)C=C1O)C2=CC=C(O)C=C2O
2,2',4-TRIFLUORO-1,1'-BIPHENYL
CAS:115245-05-1
CM247883
FC1=CC=C(C2=CC=CC=C2F)C(F)=C1
2,2',6-TRIBROMO-1,1'-BIPHENYL
CAS:507241-82-9
CM322201
BrC1=C(C2=CC=CC=C2Br)C(Br)=CC=C1
2,2'-(((1-BROMONAPHTHALEN-2-YL)METHYL)AZANEDIYL)DIETHANOL
CAS:856680-59-6
CM230042
BrC1=C2C=CC=CC2=CC=C1CN(CCO)CCO
2,2'-(((2-CHLOROTHIAZOL-5-YL)METHYL)AZANEDIYL)DIETHANOL
CAS:1517576-33-8
CM301701
ClC1=NC=C(CN(CCO)CCO)S1
2,2'-(((6-HYDROXY-8-NITROQUINOLIN-5-YL)METHYL)AZANEDIYL)DIETHANOL
CAS:92462-61-8
CM263383
OC1=CC([N+]([O-])=O)=C2N=CC=CC2=C1CN(CCO)CCO
2,2'-((2,6,8-TRICHLOROQUINAZOLIN-4-YL)AZANEDIYL)DIETHANOL
CAS:88404-47-1
CM218006
ClC1=CC(Cl)=CC2=C(N(CCO)CCO)N=C(Cl)N=C12
2,2'-((2-((1H-PURIN-6-YL)AMINO)-2-OXOETHYL)AZANEDIYL)DIACETIC ACID
CAS:142210-17-1
CM263461
O=C(O)CN(CC(O)=O)CC(NC1=C2N=CN=C2N=CN1)=O
2,2'-((2-(1H-INDOL-3-YL)ETHYL)AZANEDIYL)DIETHANOL
CAS:7144-26-5
CM257512
OCCN(CCO)CCC1=CNC2=C1C=CC=C2
2,2'-((2-(5-HYDROXY-1H-INDOL-3-YL)ETHYL)AZANEDIYL)DIACETIC ACID
CAS:919079-56-4
CM262061
O=C(O)CN(CC(O)=O)CCC1=CNC2=C1C=C(O)C=C2
2,2'-((2-(5-NITROTHIOPHEN-2-YL)QUINAZOLIN-4-YL)AZANEDIYL)DIETHANOL
CAS:33372-39-3
CM213902
O=[N+](C1=CC=C(C2=NC(N(CCO)CCO)=C3C=CC=CC3=N2)S1)[
2,2'-((2-(6-AMINO-9H-PURIN-9-YL)ACETYL)AZANEDIYL)DIACETIC ACID
CAS:918334-50-6
CM263460
O=C(O)CN(C(CN1C=NC2=C(N)N=CN=C12)=O)CC(O)=O
2,2'-((2-(NAPHTHALEN-1-YLAMINO)-2-OXOETHYL)AZANEDIYL)DIACETIC ACID
CAS:88949-81-9
CM264107
O=C(O)CN(CC(O)=O)CC(NC1=C2C=CC=CC2=CC=C1)=O
2,2'-((2-(NAPHTHALEN-2-YLAMINO)-2-OXOETHYL)AZANEDIYL)DIACETIC ACID
CAS:88949-82-0
CM264108
O=C(O)CN(CC(O)=O)CC(NC1=CC=C2C=CC=CC2=C1)=O
2,2'-((2-NAPHTHOYL)AZANEDIYL)DIACETIC ACID
CAS:220335-84-2
CM261655
O=C(O)CN(CC(O)=O)C(C1=CC=C2C=CC=CC2=C1)=O
2,2'-((4-((2-HYDROXYETHYL)AMINO)-3-NITROPHENYL)AZANEDIYL)DIETHANOL
CAS:33229-34-4
CM252283
O=[N+](C1=CC(N(CCO)CCO)=CC=C1NCCO)[O-]
2,2'-((4-(6-AMINO-9H-PURIN-9-YL)PHENYL)AZANEDIYL)DIETHANOL
CAS:16208-02-9
CM236605
NC1=C2N=CN(C3=CC=C(N(CCO)CCO)C=C3)C2=NC=N1
2,2'-((4-AMINOPENTYL)AZANEDIYL)DIETHANOL
CAS:86271-50-3
CM301556
CC(N)CCCN(CCO)CCO
2,2'-((4-FLUORO-3-NITROPHENYL)AZANEDIYL)DIETHANOL
CAS:29705-38-2
CM192500
O=[N+](C1=CC(N(CCO)CCO)=CC=C1F)[O-]
2,2'-((4-VINYLBENZYL)AZANEDIYL)DIACETIC ACID
CAS:46917-20-8
CM186557
O=C(O)CN(CC(O)=O)CC1=CC=C(C=C)C=C1
2,2'-((5-NITROPYRIDIN-2-YL)AZANEDIYL)DIETHANOL
CAS:98961-41-2
CM324912
O=[N+](C1=CN=C(N(CCO)CCO)C=C1)[O-]
2,2'-((6-HYDRAZINYLPYRIDAZIN-3-YL)AZANEDIYL)DIETHANOL
CAS:17259-75-5
CM310137
NNC1=NN=C(N(CCO)CCO)C=C1
2,2'-(1,2-PHENYLENEBIS(OXY))DIACETIC ACID
CAS:5411-14-3
CM243579
O=C(O)COC1=CC=CC=C1OCC(O)=O
2,2'-(1,3-DIOXOLANE-2,2-DIYL)BIS(ETHAN-1-OL)
CAS:5694-95-1
CM125701
OCCC1(CCO)OCCO1
2,2'-(1,3-PHENYLENE)DIACETIC ACID
CAS:19806-17-8
CM250974
O=C(O)CC1=CC=CC(CC(O)=O)=C1
2,2'-(1,4-PHENYLENE)BIS(BENZO[D]OXAZOL-5-AMINE)
CAS:13752-53-9
CM303718
NC1=CC=C(OC(C2=CC=C(C3=NC4=CC(N)=CC=C4O3)C=C2)=N5)
2,2'-(1,4-PHENYLENE)BIS(BENZO[D]OXAZOL-6-AMINE)
CAS:94533-96-7
CM303719
NC1=CC=C2N=C(C3=CC=C(C4=NC5=CC=C(N)C=C5O4)C=C3)OC2
2,2'-(1,4-PHENYLENE)DIACETIC ACID
CAS:7325-46-4
CM254798
OC(=O)CC1=CC=C(CC(O)=O)C=C1
2,2'-(1H-INDOLE-3,6-DIYL)DIACETIC ACID
CAS:857777-65-2
CM246891
O=C(O)CC1=CNC2=C1C=CC(CC(O)=O)=C2
2,2'-(3-METHYLPYRAZINE-2,5-DIYL)DIETHANOL
CAS:96681-84-4
CM334519
CC1=NC(CCO)=CN=C1CCO
2,2'-(5-METHYL-1,3-PHENYLENE)BIS(2-METHYLPROPANENITRILE)
CAS:120511-72-0
CM248168
CC1=CC(C(C)(C)C#N)=CC(C(C)(C)C#N)=C1
2,2'-(5-METHYL-1,3-PHENYLENE)DIACETONITRILE
CAS:120511-74-2
CM282396
CC1=CC(CC#N)=CC(CC#N)=C1
2,2'-(6,7-DIMETHOXYQUINAZOLINE-2,4-DIYL)BIS(HYDRAZINECARBOTHIOAMIDE)
CAS:134749-24-9
CM208065
COC1=CC2=NC(NNC(N)=S)=NC(NNC(N)=S)=C2C=C1OC
2,2'-(6-METHYLQUINOXALINE-2,3-DIYL)BIS(PYRIDIN-4-AMINE)
CAS:143628-60-8
CM222144
CC1=CC=C2N=C(C3=NC=CC(N)=C3)C(C4=NC=CC(N)=C4)=NC2=
2,2'-(9H-FLUORENE-9,9-DIYL)DIETHANOL
CAS:203070-78-4
CM251116
OCCC1(CCO)C2=C(C3=C1C=CC=C3)C=CC=C2
2,2'-(AZANEDIYLBIS(ETHANE-2,1-DIYL))BIS(ISOINDOLINE-1,3-DIONE)
CAS:63563-83-7
CM266622
O=C1N(CCNCCN(C(C2=C3C=CC=C2)=O)C3=O)C(C4=C1C=CC=C4
2,2'-(BENZOFURAN-2,6-DIYL)BIS(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLANE)
CAS:919119-75-8
CM218884
CC1(C)C(C)(C)OB(C2=CC=C3C=C(B4OC(C)(C)C(C)(C)O4)OC
2,2'-(BENZOFURAN-2,7-DIYL)BIS(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLANE)
CAS:919119-74-7
CM218883
CC1(C)C(C)(C)OB(C2=C(OC(B3OC(C)(C)C(C)(C)O3)=C4)C4
2,2'-(BENZYLAZANEDIYL)DIETHANOL
CAS:101-32-6
CM301706
OCCN(CCO)CC1=CC=CC=C1
2,2'-(BUTANE-1,4-DIYL)BIS(N,9-DIMETHYL-9H-PURIN-6-AMINE)
CAS:93288-47-2
CM233652
CN1C=NC2=C(NC)N=C(CCCCC3=NC(NC)=C4N=CN(C)C4=N3)N=C
2,2'-(BUTANE-1,4-DIYLBIS(OXY))DIBENZALDEHYDE
CAS:77354-98-4
CM243176
O=CC1=CC=CC=C1OCCCCOC2=CC=CC=C2C=O
2,2'-(BUTANE-1,4-DIYLDISULFONYL)BIS(ETHAN-1-OL)
CAS:7426-03-1
CM185544
O=S(CCCCS(=O)(CCO)=O)(CCO)=O
2,2'-(BUTYLAZANEDIYL)BIS(QUINOLIN-8-OL)
CAS:82361-90-8
CM224647
CCCCN(C1=NC2=C(O)C=CC=C2C=C1)C3=NC4=C(O)C=CC=C4C=C
2,2'-(CYCLOBUTANE-1,1-DIYL)DIACETIC ACID
CAS:1075-98-5
CM202798
O=C(O)CC1(CC(O)=O)CCC1
2,2'-(DISULFANEDIYLBIS(3,1-PHENYLENE))DIACETIC ACID
CAS:80441-59-4
CM244191
O=C(O)CC1=CC=CC(SSC2=CC(CC(O)=O)=CC=C2)=C1
2,2'-(ETHANE-1,2-DIYL)BIS(QUINOLIN-8-OL)
CAS:249614-38-8
CM224646
OC1=C2N=C(CCC3=NC4=C(O)C=CC=C4C=C3)C=CC2=CC=C1
2,2'-(ETHANE-1,2-DIYLBIS(AZANEDIYL))DIETHANOL
CAS:4439-20-7
CM311665
OCCNCCNCCO
2,2'-(ETHANE-1,2-DIYLBIS(OXY))DIBENZALDEHYDE
CAS:52118-10-2
CM219685
O=CC1=CC=CC=C1OCCOC2=CC=CC=C2C=O
2,2'-(ETHANE-1,2-DIYLDISULFONYL)BIS(ETHAN-1-OL)
CAS:7484-34-6
CM123806
O=S(CCS(=O)(CCO)=O)(CCO)=O
2,2'-(ETHYLENEDIOXY)BIS(ETHYLAMINE)
CAS:929-59-9
CM117552
NCCOCCOCCN
2,2'-(MESITYLMETHYLENE)BIS(1H-PYRROLE)
CAS:159152-14-4
CM197559
CC1=CC(C)=CC(C)=C1C(C2=CC=CN2)C3=CC=CN3
2,2'-(NAPHTHALEN-2-YLAZANEDIYL)DIACETIC ACID
CAS:64660-87-3
CM258727
O=C(O)CN(CC(O)=O)C1=CC=C2C=CC=CC2=C1
2,2'-(NAPHTHALENE-1,5-DIYLBIS(OXY))DIETHANOL
CAS:14031-45-9
CM257493
OCCOC1=C2C=CC=C(OCCO)C2=CC=C1
2,2'-(NAPHTHALENE-2,3-DIYLBIS(OXY))DIETHANOL
CAS:89012-04-4
CM257492
OCCOC1=C(OCCO)C=C2C=CC=CC2=C1
2,2'-(OCTADECYLAZANEDIYL)DIETHANOL
CAS:10213-78-2
CM247359
CCCCCCCCCCCCCCCCCCN(CCO)CCO
2,2'-(OXYBIS(4,1-PHENYLENE))BIS(1-PHENYLETHANE-1,2-DIONE)
CAS:21454-19-3
CM251354
O=C(C1=CC=CC=C1)C(C2=CC=C(OC3=CC=C(C(C(C4=CC=CC=C4
2,2'-(OXYBIS(ETHANE-2,1-DIYLSULFINYL))BIS(ETHAN-1-OL)
CAS:167940-02-5
CM127722
O=S(CCO)CCOCCS(CCO)=O
2,2'-(OXYBIS(METHYLENE))BIS(2-(HYDROXYMETHYL)PROPANE-1,3-DIOL)
CAS:126-58-9
CM248625
OCC(COCC(CO)(CO)CO)(CO)CO
2,2'-(OXYBIS(METHYLENE))BIS(5-NITRO-1H-BENZO[D]IMIDAZOLE)
CAS:1222810-74-3
CM323956
O=[N+](C1=CC=C2NC(COCC3=NC4=CC([N+]([O-])=O)=CC=C4
2,2'-(PERCHLORO-1,2-PHENYLENE)DIACETONITRILE
CAS:60069-96-7
CM123099
ClC1=C(CC#N)C(CC#N)=C(Cl)C(Cl)=C1Cl
2,2'-(PIPERAZINE-1,4-DIYL)BIS(ETHAN-1-AMINE)
CAS:6531-38-0
CM169169
NCCN1CCN(CCN)CC1
2,2'-(PIPERAZINE-1,4-DIYL)DIANILINE
CAS:29549-88-0
CM319250
NC1=CC=CC=C1N2CCN(C3=CC=CC=C3N)CC2
2,2'-(PIPERAZINE-1,4-DIYL)DIETHANESULFONIC ACID
CAS:5625-37-6
CM169568
O=S(CCN1CCN(CCS(=O)(O)=O)CC1)(O)=O
2,2'-(PIPERAZINE-1,4-DIYL)DIETHANOL
CAS:122-96-3
CM169856
OCCN1CCN(CCO)CC1
2,2'-(PROPANE-1,3-DIYL)BIS(BENZENE-1,4-DIOL)
CAS:4289-31-0
CM308138
OC1=CC=C(O)C=C1CCCC2=CC(O)=CC=C2O
2,2'-(PROPANE-1,3-DIYLBIS(AZANEDIYL))DIETHANOL
CAS:10563-27-6
CM303664
OCCNCCCNCCO
2,2'-(PROPANE-1,3-DIYLDISULFINYL)BIS(ETHAN-1-OL)
CAS:76305-83-4
CM194476
O=S(CCO)CCCS(CCO)=O
2,2'-(PYRIDINE-2,5-DIYL)BIS(ETHAN-1-OL)
CAS:1000571-88-9
CM176357
OCCC1=NC=C(CCO)C=C1
2,2'-BI(1,8-NAPHTHYRIDINE)
CAS:69110-33-4
CM230526
C1(C2=NC3=NC=CC=C3C=C2)=NC4=NC=CC=C4C=C1
2,2'-BIBENZO[D][1,3,2]DIOXABOROLE
CAS:13826-27-2
CM160274
B1(B2OC3=CC=CC=C3O2)OC4=CC=CC=C4O1
2,2'-BIPYRIDINE
CAS:366-18-7
CM120509
C1(C2=NC=CC=C2)=NC=CC=C1
2,2'-BIPYRIDINE-4,4'-DICARBOXYLIC ACID
CAS:6813-38-3
CM174083
O=C(C1=CC(C2=NC=CC(C(O)=O)=C2)=NC=C1)O
2,2'-BIPYRIMIDINE
CAS:34671-83-5
CM121247
C1(C2=NC=CC=N2)=NC=CC=N1
2,2'-BIS(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)-1,1'-BIPHENYL
CAS:398128-09-1
CM220006
CC1(C)C(C)(C)OB(C2=CC=CC=C2C3=CC=CC=C3B4OC(C)(C)C(
2,2'-BITHIOPHENE
CAS:492-97-7
CM121691
C1(C2=CC=CS2)=CC=CS1
2,2'-DIAMINO-4,4'-DIBROMOBIPHENYL
CAS:136630-36-9
CM118621
BrC1=CC=C(C2=CC=C(Br)C=C2N)C(N)=C1
2,2'-DIBROMOBIPHENYL
CAS:13029-09-9
CM248743
C1=CC=CC(=C1C2=C(C=CC=C2)Br)Br
2,2'-DIBROMODIETHYL ETHER
CAS:5414-19-7
CM243821
BrCCOCCBr
2,2'-DIFLUORODIPHENYLDISULFIDE
CAS:14135-38-7
CM249297
FC1=CC=CC=C1SSC1=C(F)C=CC=C1
2,2'-DIHYDROXY-4-METHOXYBENZOPHENONE
CAS:131-53-3
CM158628
O=C(C1=CC=C(OC)C=C1O)C2=CC=CC=C2O
2,2'-DIMETHYL-[1,1'-BIPHENYL]-4,4'-DIAMINE HYDROCHLORIDE
CAS:198487-76-2
CM324875
NC1=CC=C(C2=CC=C(N)C=C2C)C(C)=C1.[H]Cl
2,2'-DIMETHYL-1,1',2,2'-TETRAHYDRO-1,1'-BIACENAPHTHYLENE
CAS:139418-62-5
CM232537
CC1C(C2C(C)C3=C4C2=CC=CC4=CC=C3)C5=CC=CC6=CC=CC1=C
2,2'-DIMETHYL-1,1'-BINAPHTHALENE
CAS:32587-64-7
CM232161
CC1=CC=C2C=CC=CC2=C1C3=C4C=CC=CC4=CC=C3C
2,2'-DINAPHTHYL KETONE
CAS:613-56-9
CM261193
O=C(C1=CC=C2C=CC=CC2=C1)C3=CC=C4C=CC=CC4=C3
2,2'-DIPYRIDYL DISULFIDE
CAS:2127-03-9
CM120650
C1(SSC2=NC=CC=C2)=NC=CC=C1
2,2'-METHYLENEBIS(4-AMINOPHENOL) DIHYDROCHLORIDE
CAS:27311-52-0
CM303699
OC1=CC=C(N)C=C1CC2=CC(N)=CC=C2O.[H]Cl.[H]Cl
2,2'-OXYBIS(N,N-DIBUTYLACETAMIDE)
CAS:82846-38-6
CM255198
O=C(N(CCCC)CCCC)COCC(N(CCCC)CCCC)=O
2,2'-OXYBIS(NITROBENZENE)
CAS:2217-65-4
CM251451
O=[N+](C1=CC=CC=C1OC2=CC=CC=C2[N+]([O-])=O)[O-]
2,2'-OXYDIANILINE
CAS:24878-25-9
CM251688
NC1=CC=CC=C1OC2=CC=CC=C2N
2,2,10-TRIMETHYL-3,4-DIHYDRO-2H-PYRANO[2,3-B]QUINOLIN-5(10H)-ONE
CAS:6391-67-9
CM257006
O=C1C(CCC(C)(C)O2)=C2N(C)C3=C1C=CC=C3
2,2,2,4'-TETRAFLUOROACETOPHENONE
CAS:655-32-3
CM186657
FC1=CC=C(C(C(F)(F)F)=O)C=C1
2,2,2-TRICHLORO-1-(1-METHYL-4-NITRO-1H-IMIDAZOL-2-YL)ETHAN-1-ONE
CAS:120095-64-9
CM330208
O=C(C1=NC([N+]([O-])=O)=CN1C)C(Cl)(Cl)Cl
2,2,2-TRICHLORO-1-(1H-PYRROL-2-YL)ETHAN-1-ONE
CAS:35302-72-8
CM103823
ClC(Cl)(Cl)C(=O)C1=CC=CN1
2,2,2-TRICHLORO-1-(1H-PYRROLO[2,3-B]PYRIDIN-3-YL)ETHAN-1-ONE
CAS:163220-69-7
CM127700
ClC(Cl)(Cl)C(C1=CNC2=NC=CC=C21)=O
2,2,2-TRICHLORO-1-(4-(3-METHOXYBENZOYL)-1H-PYRROL-2-YL)ETHANONE
CAS:453557-69-2
CM309361
O=C(C1=CNC(C(C(Cl)(Cl)Cl)=O)=C1)C2=CC=CC(OC)=C2
2,2,2-TRICHLORO-1-(4-(4-METHOXYBENZOYL)-1H-PYRROL-2-YL)ETHANONE
CAS:174417-17-5
CM309444
O=C(C1=CNC(C(C(Cl)(Cl)Cl)=O)=C1)C2=CC=C(OC)C=C2
2,2,2-TRICHLORO-1-(4-(4-METHYLBENZOYL)-1H-PYRROL-2-YL)ETHANONE
CAS:453557-68-1
CM309360
O=C(C1=CNC(C(C(Cl)(Cl)Cl)=O)=C1)C2=CC=C(C)C=C2
2,2,2-TRICHLORO-1-(4-(7-CHLOROQUINOLIN-4-YL)PIPERAZIN-1-YL)ETHANONE
CAS:104667-94-9
CM225846
ClC1=CC=C2C(N3CCN(C(C(Cl)(Cl)Cl)=O)CC3)=CC=NC2=C1
2,2,2-TRICHLORO-1-(5-CHLORO-1H-INDOL-3-YL)ETHANONE
CAS:1823480-57-4
CM333826
ClC1=CC2=C(NC=C2C(C(Cl)(Cl)Cl)=O)C=C1
2,2,2-TRICHLORO-1-(5-FLUORO-1H-INDOL-3-YL)ETHANONE
CAS:1822857-19-1
CM333825
FC1=CC2=C(NC=C2C(C(Cl)(Cl)Cl)=O)C=C1
2,2,2-TRICHLORO-N-CYCLOHEXYLACETAMIDE
CAS:23144-68-5
CM204028
O=C(NC1CCCCC1)C(Cl)(Cl)Cl
2,2,2-TRICHLOROACETONITRILE
CAS:545-06-2
CM328739
N#CC(Cl)(Cl)Cl
2,2,2-TRICHLOROETHANE-1,1-DIOL
CAS:302-17-0
CM329138
OC(O)C(Cl)(Cl)Cl
2,2,2-TRICHLOROETHYL 1H-IMIDAZOLE-1-CARBOXYLATE
CAS:70737-50-7
CM186825
O=C(N1C=CN=C1)OCC(Cl)(Cl)Cl
2,2,2-TRICHLOROETHYL 2-BROMO-2-(3,4-DIMETHOXYPHENYL)ACETATE
CAS:322765-94-6
CM244580
O=C(OCC(Cl)(Cl)Cl)C(Br)C1=CC=C(OC)C(OC)=C1
2,2,2-TRICHLOROETHYL DIHYDROGEN PHOSPHATE
CAS:306-52-5
CM244202
O=P(O)(OCC(Cl)(Cl)Cl)O
2,2,2-TRICHLOROETHYLBENZENE
CAS:3883-13-4
CM329161
ClC(Cl)(Cl)CC1=CC=CC=C1
2,2,2-TRIFLUORO-1-(1-AZASPIRO[4.4]NON-7-EN-1-YL)ETHANONE
CAS:681283-60-3
CM216290
FC(F)(F)C(N1CCCC12CC=CC2)=O
2,2,2-TRIFLUORO-1-(1-METHYL-1H-INDOL-3-YL)ETHANOL
CAS:318-54-7
CM233589
CN1C=C(C(O)C(F)(F)F)C2=C1C=CC=C2
2,2,2-TRIFLUORO-1-(1H-IMIDAZOL-2-YL)ETHAN-1-ONE
CAS:105480-29-3
CM330173
FC(F)(F)C(C1=NC=CN1)=O
2,2,2-TRIFLUORO-1-(1H-IMIDAZOL-4-YL)ETHAN-1-ONE
CAS:105480-28-2
CM187193
FC(F)(F)C(C1=CNC=N1)=O
2,2,2-TRIFLUORO-1-(1H-INDOL-3-YL)-1-ETHANONE
CAS:14618-45-2
CM148663
O=C(C1=CNC2=C1C=CC=C2)C(F)(F)F
2,2,2-TRIFLUORO-1-(1H-INDOL-3-YL)ETHANAMINE
CAS:126954-11-8
CM236356
NC(C1=CNC2=C1C=CC=C2)C(F)(F)F
2,2,2-TRIFLUORO-1-(1H-PYRAZOL-4-YL)ETHANONE
CAS:161957-47-7
CM249967
FC(F)(F)C(C1=CNN=C1)=O
2,2,2-TRIFLUORO-1-(3,4,5-TRICHLOROPHENYL)ETHAN-1-ONE
CAS:158401-00-4
CM132033
ClC1=C(Cl)C(Cl)=CC(C(C(F)(F)F)=O)=C1
2,2,2-TRIFLUORO-1-(3-(TRIFLUOROMETHYL)PHENYL)ETHAN-1-AMINE
CAS:65686-68-2
CM123508
FC(C1=CC(C(N)C(F)(F)F)=CC=C1)(F)F
2,2,2-TRIFLUORO-1-(3-FLUOROPHENYL)ETHANONE
CAS:708-64-5
CM254681
FC1=CC(C(C(F)(F)F)=O)=CC=C1
2,2,2-TRIFLUORO-1-(3-HYDROXY-3-(PYRIDIN-2-YL)AZETIDIN-1-YL)ETHAN-1-ONE
CAS:1415562-33-2
CM219872
O=C(N1CC(C2=NC=CC=C2)(O)C1)C(F)(F)F
2,2,2-TRIFLUORO-1-(3-NITROPHENYL)ETHANONE
CAS:657-15-8
CM254363
O=[N+](C1=CC(C(C(F)(F)F)=O)=CC=C1)[O-]
2,2,2-TRIFLUORO-1-(4-FLUOROPHENYL)ETHAN-1-AMINE HYDROCHLORIDE
CAS:1184980-60-6
CM130869
FC1=CC=C(C(N)C(F)(F)F)C=C1.[H]Cl
2,2,2-TRIFLUORO-1-(4-IODOPHENYL)ETHAN-1-ONE
CAS:23516-84-9
CM131753
FC(F)(F)C(=O)C1=CC=C(I)C=C1
2,2,2-TRIFLUORO-1-(4-METHOXYPHENYL)ETHANONE
CAS:711-38-6
CM244585
COC1=CC=C(C(C(F)(F)F)=O)C=C1
2,2,2-TRIFLUORO-1-(4-PHENOXYPHENYL)ETHANOL
CAS:70783-33-4
CM329933
FC(F)(F)C(O)C1=CC=C(OC2=CC=CC=C2)C=C1
2,2,2-TRIFLUORO-1-(5-(TRIFLUOROMETHYL)PYRIDIN-2-YL)ETHAN-1-ONE
CAS:1060801-98-0
CM174755
FC(C1=CN=C(C(C(F)(F)F)=O)C=C1)(F)F
2,2,2-TRIFLUORO-1-(5-FLUORO-2-METHYLPHENYL)ETHAN-1-ONE
CAS:886369-93-3
CM124320
CC1=CC=C(F)C=C1C(C(F)(F)F)=O
2,2,2-TRIFLUORO-1-(6-HYDROXY-2,2-DIMETHYLQUINOLIN-1(2H)-YL)ETHANONE
CAS:828938-86-9
CM260127
OC1=CC2=C(N(C(C(F)(F)F)=O)C(C)(C)C=C2)C=C1
2,2,2-TRIFLUORO-1-(6-NITRO-3,4-DIHYDROQUINOLIN-1(2H)-YL)ETHANONE
CAS:1290608-21-7
CM227380
O=[N+](C1=CC2=C(N(C(C(F)(F)F)=O)CCC2)C=C1)[O-]
2,2,2-TRIFLUORO-1-(7-FLUORO-1,2,3,4-TETRAHYDROISOQUINOLIN-2-YL)ETHAN-1-ONE
CAS:912846-64-1
CM367347
FC1=CC2=C(CCN(C2)C(=O)C(F)(F)F)C=C1
2,2,2-TRIFLUORO-1-(7-METHOXY-1H-INDOL-3-YL)ETHANONE
CAS:128717-76-0
CM256950
O=C(C1=CNC2=C1C=CC=C2OC)C(F)(F)F
2,2,2-TRIFLUORO-1-(INDOLIN-1-YL)ETHANONE
CAS:90732-28-8
CM234682
FC(F)(F)C(N1CCC2=C1C=CC=C2)=O
2,2,2-TRIFLUORO-1-(PIPERAZIN-1-YL)ETHAN-1-ONE
CAS:6511-88-2
CM169955
O=C(N1CCNCC1)C(F)(F)F
2,2,2-TRIFLUORO-1-(PIPERAZIN-1-YL)ETHANONEHYDROCHLORIDE
CAS:245487-45-0
CM295580
FC(F)(F)C(N1CCNCC1)=O.[H]Cl
2,2,2-TRIFLUORO-1-(PYRAZIN-2-YL)ETHANONE HYDRATE
CAS:1956366-93-0
CM279420
FC(F)(F)C(C1=NC=CN=C1)=O.[H]O[H]
2,2,2-TRIFLUORO-1-(PYRIDIN-2-YL)ETHAN-1-AMINE HYDROCHLORIDE
CAS:1187929-38-9
CM105938
NC(C1=NC=CC=C1)C(F)(F)F.[H]Cl
2,2,2-TRIFLUORO-1-(PYRIDIN-3-YL)ETHAN-1-ONE
CAS:33284-21-8
CM132219
FC(F)(F)C(=O)C1=CN=CC=C1
2,2,2-TRIFLUORO-1-(PYRIDIN-3-YL)ETHANE-1,1-DIOL
CAS:33284-19-4
CM124995
OC(O)(C1=CC=CN=C1)C(F)(F)F
2,2,2-TRIFLUORO-1-(PYRIDIN-3-YL)ETHANONE HYDROCHLORIDE
CAS:1588441-22-8
CM249861
FC(F)(F)C(C1=CC=CN=C1)=O.[H]Cl
2,2,2-TRIFLUORO-1-(PYRIDIN-4-YL)ETHAN-1-OL
CAS:394203-58-8
CM336515
FC(F)(F)C(O)C1=CC=NC=C1
2,2,2-TRIFLUORO-1-(THIOPHEN-2-YL)ETHAN-1-AMINE
CAS:65686-95-5
CM200054
FC(F)(F)C(N)C1=CC=CS1
2,2,2-TRIFLUORO-1-(THIOPHEN-3-YL)ETHAN-1-AMINE
CAS:1207175-66-3
CM200002
FC(F)(F)C(N)C1=CSC=C1
2,2,2-TRIFLUORO-1-[4-(4-METHYLBENZOYL)PIPERIDIN-1-YL]ETHAN-1-ONE
CAS:1198285-26-5
CM363317
CC1=CC=C(C=C1)C(=O)C1CCN(CC1)C(=O)C(F)(F)F
2,2,2-TRIFLUORO-1-P-TOLYLETHANOL
CAS:446-65-1
CM193315
CC1=CC=C(C(O)C(F)(F)F)C=C1
2,2,2-TRIFLUORO-1-P-TOLYLETHANONE
CAS:394-59-2
CM100469
CC1=CC=C(C(C(F)(F)F)=O)C=C1
2,2,2-TRIFLUORO-1-PYRIDIN-2-YLETHANOL
CAS:107040-75-5
CM328925
FC(F)(F)C(O)C1=NC=CC=C1
2,2,2-TRIFLUORO-N'-(PYRAZIN-2-YL)ACETOHYDRAZIDE
CAS:837430-15-6
CM334520
O=C(NNC1=NC=CN=C1)C(F)(F)F
2,2,2-TRIFLUORO-N'-[(2Z)-PIPERAZIN-2-YLIDENE]ACETOHYDRAZIDE
CAS:849832-73-1
CM108718
O=C(N/N=C1NCCNC\1)C(F)(F)F
2,2,2-TRIFLUORO-N-(2-HYDROXYETHYL)ACETAMIDE
CAS:6974-29-4
CM312068
O=C(NCCO)C(F)(F)F
2,2,2-TRIFLUORO-N-(3-(PHENYLETHYNYL)QUINOXALIN-2-YL)ACETAMIDE
CAS:676543-67-2
CM222278
O=C(NC1=NC2=CC=CC=C2N=C1C#CC3=CC=CC=C3)C(F)(F)F
2,2,2-TRIFLUORO-N-(4-((6-METHOXYQUINOLIN-8-YL)AMINO)PENTYL)ACETAMIDE
CAS:88755-75-3
CM224843
O=C(NCCCC(NC1=C2N=CC=CC2=CC(OC)=C1)C)C(F)(F)F
2,2,2-TRIFLUORO-N-(6-CHLOROIMIDAZO-[1,2-B]PYRIDAZIN-2-YL)ACETAMIDE
CAS:947248-50-2
CM320337
O=C(NC1=CN2N=C(Cl)C=CC2=N1)C(F)(F)F
2,2,2-TRIFLUORO-N-(6-OXO-6,9-DIHYDRO-1H-PURIN-2-YL)ACETAMIDE
CAS:21323-85-3
CM257330
O=C(NC(N1)=NC2=C(N=CN2)C1=O)C(F)(F)F
2,2,2-TRIFLUORO-N-(PROP-2-YN-1-YL)ACETAMIDE
CAS:14719-21-2
CM249573
O=C(NCC#C)C(F)(F)F
2,2,2-TRIFLUORO-N-(QUINOLIN-3-YL)ACETAMIDE
CAS:352637-16-2
CM143744
O=C(NC1=CC2=CC=CC=C2N=C1)C(F)(F)F
2,2,2-TRIFLUORO-N-{6-IODOIMIDAZO[1,2-A]PYRIDIN-2-YL}ACETAMIDE
CAS:209971-49-3
CM104227
FC(F)(F)C(=O)NC1=CN2C=C(I)C=CC2=N1
2,2,2-TRIFLUORO-N-METHYLACETIMIDAMIDE
CAS:431-41-4
CM183946
N=C(NC)C(F)(F)F
2,2,2-TRIFLUORO-N-PHENYLETHANIMIDOYL CHLORIDE
CAS:61881-19-4
CM328893
Cl/C(C(F)(F)F)=N\C1=CC=CC=C1
2,2,2-TRIFLUOROACETAMIDE
CAS:354-38-1
CM252443
O=C(N)C(F)(F)F
2,2,2-TRIFLUOROACETIC ACID
CAS:76-05-1
CM328906
O=C(O)C(F)(F)F
2,2,2-TRIFLUOROACETOHYDRAZIDE
CAS:1538-08-5
CM249752
NNC(=O)C(F)(F)F
2,2,2-TRIFLUOROETHANAMINE HYDROCHLORIDE
CAS:373-88-6
CM166380
FC(F)(F)CN.[H]Cl
2,2,2-TRIFLUOROETHANETHIOAMIDE
CAS:421-52-3
CM328737
S=C(N)C(F)(F)F
2,2,2-TRIFLUOROETHYL 4-METHYLBENZENESULFONATE
CAS:433-06-7
CM191544
O=S(C1=CC=C(C)C=C1)(OCC(F)(F)F)=O
2,2,2-TRIFLUOROETHYL MORPHOLINE-4-CARBOXYLATE
CAS:923177-02-0
CM325781
O=C(N1CCOCC1)OCC(F)(F)F
2,2,2-TRIFLUOROETHYL NAPHTHALEN-1-YLCARBAMATE
CAS:363-21-3
CM259877
O=C(OCC(F)(F)F)NC1=C2C=CC=CC2=CC=C1
2,2,2-TRIFLUOROETHYL TRIFLUOROMETHANESULFONATE
CAS:6226-25-1
CM112345
O=S(C(F)(F)F)(OCC(F)(F)F)=O
2,2,2-TRIPHENYLACETALDEHYDE
CAS:42365-04-8
CM243177
O=CC(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3
2,2,2-TRIPHENYLACETIC ACID
CAS:595-91-5
CM219632
OC(=O)C(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1
2,2,3,3,4,4,5,5,6,6-DECADEUTERIOCYCLOHEXAN-1-ONE
CAS:51209-49-5
CM328455
O=C1C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])
2,2,3,3,5,5,6,6-OCTADEUTERIOPIPERAZINE;DIHYDROCHLORIDE
CAS:314062-45-8
CM327874
[2H]C1([2H])C([2H])([2H])NC([2H])([2H])C([2H])([2H
2,2,3,3-TETRAFLUORO-1-PROPANOL
CAS:76-37-9
CM116013
OCC(F)(F)C(F)F
2,2,3,3-TETRAFLUOROPROPYL P-TOLUENESULFONATE
CAS:786-31-2
CM191819
O=S(C1=CC=C(C)C=C1)(OCC(F)(F)C(F)F)=O
2,2,3,3-TETRAMETHYLCYCLOPROPANE-1-CARBONYL CHLORIDE
CAS:24303-61-5
CM329357
O=C(Cl)C1C(C)(C)C1(C)C
2,2,3,8-TETRAMETHYL-2,3-DIHYDROQUINAZOLIN-4(1H)-ONE
CAS:1268332-01-9
CM206979
O=C1N(C)C(C)(C)NC2=C1C=CC=C2C
2,2,3-TRIBROMOPROPANAL
CAS:26944-17-2
CM184661
BrCC(Br)(Br)C=O
2,2,3-TRIMETHYL-1,2-DIHYDROQUINOXALINE
CAS:25716-39-6
CM221639
CC1=NC2=C(NC1(C)C)C=CC=C2
2,2,3-TRIMETHYL-1-THIA-4-AZASPIRO[4.4]NONANE
CAS:195259-31-5
CM212765
CC1C(C)(C)SC2(CCCC2)N1
2,2,3-TRIMETHYL-2,3-DIHYDROQUINAZOLIN-4(1H)-ONE
CAS:91718-05-7
CM218759
O=C1N(C)C(C)(C)NC2=C1C=CC=C2
2,2,3-TRIMETHYL-2H,3H,4H,5H-NAPHTHO[1,2-B]FURAN-4,5-DIONE
CAS:178931-48-1
CM363011
CC1C2=C(OC1(C)C)C1=C(C=CC=C1)C(=O)C2=O
2,2,3-TRIMETHYLCYCLOPENT-3-ENE-1-CARBALDEHYDE
CAS:33843-21-9
CM203780
CC1=CCC(C=O)C1(C)C
2,2,4,4-TETRAMETHYLCYCLOBUTANE-1,3-DIOL
CAS:3010-96-6
CM101752
OC1C(C)(C)C(O)C1(C)C
2,2,4,4-TETRAMETHYLCYCLOPENTANAMINE HYDROCHLORIDE
CAS:1523618-17-8
CM107150
NC1C(C)(C)CC(C)(C)C1.[H]Cl
2,2,4,4-TETRAMETHYLOXETAN-3-AMINE HYDROCHLORIDE
CAS:2173991-84-7
CM326504
NC1C(C)(C)OC1(C)C.[H]Cl
2,2,4,6,6-PENTAMETHYL-7,7A-DIHYDROBENZO[D][1,3]DIOXOL-5(6H)-ONE
CAS:83020-74-0
CM161785
O=C1C(C)=C2OC(C)(C)OC2CC1(C)C
2,2,4,6,7-PENTAMETHYL-2,3-DIHYDRO-BENZOFURAN-5-SULFONYL CHLORIDE
CAS:154445-78-0
CM157660
O=S(C1=C(C)C(C)=C(OC(C)(C)C2)C2=C1C)(Cl)=O
2,2,4,6,7-PENTAMETHYL-2,3-DIHYDROBENZOFURAN-5-SULFONAMIDE
CAS:378230-81-0
CM161939
O=S(C1=C(C)C(C)=C(OC(C)(C)C2)C2=C1C)(N)=O
2,2,4,6-TETRAMETHYL-1,2,3,4-TETRAHYDROQUINOLINE HYDROBROMIDE
CAS:16489-89-7
CM260011
CC1=CC2=C(NC(C)(C)CC2C)C=C1.[H]Br
2,2,4,8-TETRAMETHYL-1,2-DIHYDROQUINOLINE-6-CARBALDEHYDE
CAS:1354783-22-4
CM244730
O=CC1=CC2=C(NC(C)(C)C=C2C)C(C)=C1
2,2,4-TRIMETHYL-1,2,3,4-TETRAHYDROQUINOLIN-8-OL
CAS:61855-47-8
CM222573
OC1=CC=CC2=C1NC(C)(C)CC2C
2,2,4-TRIMETHYL-1,2,3,4-TETRAHYDROQUINOLINE HYDROCHLORIDE
CAS:4071-22-1
CM122900
Cl.CC1CC(C)(C)NC2=C1C=CC=C2
2,2,4-TRIMETHYL-1,2,3,4-TETRAHYDROQUINOLINE-6,8-DIOL
CAS:63095-12-5
CM242557
OC1=CC2=C(NC(C)(C)CC2C)C(O)=C1
2,2,4-TRIMETHYL-1,2,3,4-TETRAHYDROQUINOLINE-8-CARBOXYLIC ACID
CAS:1256628-15-5
CM245358
O=C(C1=CC=CC2=C1NC(C)(C)CC2C)O
2,2,4-TRIMETHYL-1,2-DIHYDROQUINOLIN-7-AMINE
CAS:41148-72-5
CM224358
NC1=CC2=C(C=C1)C(C)=CC(C)(C)N2
2,2,4-TRIMETHYL-1,2-DIHYDROQUINOLIN-8-OL
CAS:117330-56-0
CM224645
OC1=CC=CC2=C1NC(C)(C)C=C2C
2,2,4-TRIMETHYL-1,2-DIHYDROQUINOLINE
CAS:147-47-7
CM121497
CC1=CC(C)(C)NC2=C1C=CC=C2
2,2,4-TRIMETHYL-1,2-DIHYDROQUINOLINE
CAS:26780-96-1
CM367252
CC1=CC(C)(C)NC2=CC=CC=C12
2,2,4-TRIMETHYL-1,2-DIHYDROQUINOLINE-8-CARBOXYLIC ACID
CAS:941266-27-9
CM245071
O=C(C1=CC=CC2=C1NC(C)(C)C=C2C)O
2,2,4-TRIMETHYL-3-PHENYL-1,2,3,4-TETRAHYDROCYCLOPENTA[B]INDOLE
CAS:848623-58-5
CM233697
CN1C2=C(CC(C)(C)C2C3=CC=CC=C3)C4=C1C=CC=C4
2,2,4-TRIMETHYL-7-(TRIFLUOROMETHYL)-1,2-DIHYDROQUINOLINE
CAS:1242835-50-2
CM256767
FC(C1=CC2=C(C=C1)C(C)=CC(C)(C)N2)(F)F
2,2,4-TRIMETHYLPENTANE-1,3-DIYL BIS(2-METHYLPROPANOATE)
CAS:6846-50-0
CM254516
CC(C)C(OC(C(C)C)=O)C(C)(C)COC(C(C)C)=O
2,2,5,5-TETRAMETHYL-TETRAHYDRO-FURAN-3-ONE
CAS:5455-94-7
CM196104
O=C1C(C)(C)OC(C)(C)C1
2,2,5,7,8-PENTAMETHYLCHROMAN-6-SULFONAMIDE
CAS:161117-67-5
CM300622
O=S(C1=C(C)C(CCC(C)(C)O2)=C2C(C)=C1C)(N)=O
2,2,5-TRIFLUOROINDOLINE
CAS:769966-00-9
CM235114
FC1=CC2=C(NC(F)(F)C2)C=C1
2,2,5-TRIMETHYL-1,3-DIOXANE-5-CARBOXYLIC ACID
CAS:16837-14-2
CM181811
O=C(C1(C)COC(C)(C)OC1)O
2,2,6,6-TETRACHLOROCYCLOHEXAN-1-ONE
CAS:3776-30-5
CM203777
O=C1C(Cl)(Cl)CCCC1(Cl)Cl
2,2,6,6-TETRADEUTERIO-1-METHYLPIPERIDIN-4-ONE
CAS:1189723-14-5
CM328267
O=C1CC([2H])([2H])N(C)C([2H])([2H])C1
2,2,6,6-TETRAMETHYLOXAN-4-OL
CAS:20931-50-4
CM326189
OC1CC(C)(C)OC(C)(C)C1
2,2,6,6-TETRAMETHYLOXAN-4-ONE
CAS:1197-66-6
CM103873
CC1(C)CC(=O)CC(C)(C)O1
2,2,6,6-TETRAMETHYLPIPERAZINE
CAS:38515-26-3
CM335115
CC1(C)CNCC(N1)(C)C
2,2,6,6-TETRAMETHYLPIPERIDIN-4-ONE HYDROCHLORIDE
CAS:33973-59-0
CM180956
O=C1CC(C)(C)NC(C)(C)C1.[H]Cl
2,2,6,6-TETRAMETHYLPIPERIDINE
CAS:768-66-1
CM120205
CC1(C)CCCC(C)(C)N1
2,2,6,6-TETRAMETHYLPIPERIDINE-4-CARBOXYLIC ACID
CAS:65728-19-0
CM219785
O=C(C1CC(C)(C)NC(C)(C)C1)O
2,2,6-TRIMETHYL-1,2,3,4-TETRAHYDROQUINOLIN-3-OL
CAS:828939-16-8
CM240748
OC1C(C)(C)NC2=C(C=C(C)C=C2)C1
2,2,6-TRIMETHYLCYCLOHEXANE-1,4-DIONE
CAS:20547-99-3
CM128081
O=C1C(C)(C)CC(CC1C)=O
2,2,6-TRIMETHYLPIPERIDIN-4-AMINE
CAS:778646-89-2
CM327985
NC1CC(C)(C)NC(C)C1
2,2-BIS((ACRYLOYLOXY)METHYL)PROPANE-1,3-DIYL DIACRYLATE
CAS:4986-89-4
CM186567
C=CC(OCC(COC(C=C)=O)(COC(C=C)=O)COC(C=C)=O)=O
2,2-BIS(3-AMINO-4-HYDROXYPHENYL)HEXAFLUOROPROPANE
CAS:83558-87-6
CM117141
OC1=CC=C(C(C(F)(F)F)(C2=CC=C(O)C(N)=C2)C(F)(F)F)C=
2,2-BIS(4-FLUOROPHENYL)ACETIC ACID
CAS:361-63-7
CM129730
OC(=O)C(C1=CC=C(F)C=C1)C1=CC=C(F)C=C1
2,2-BIS(BROMOMETHYL)-1,3-DIOXOLANE
CAS:20599-01-3
CM362988
BrCC1(CBr)OCCO1
2,2-BIS(BROMOMETHYL)-1,3-PROPANEDIOL
CAS:3296-90-0
CM102540
OCC(CBr)(CBr)CO
2,2-BIS(TRIFLUOROMETHYL)OXIRANE
CAS:31898-68-7
CM328410
FC(C1(C(F)(F)F)OC1)(F)F
2,2-DIBROMO-1-(4-FLUORONAPHTHALEN-1-YL)ETHANONE
CAS:951-04-2
CM234853
FC1=C2C=CC=CC2=C(C(C(Br)Br)=O)C=C1
2,2-DIBROMO-1-(4-METHYLPHENYL)ETHANONE
CAS:13664-98-7
CM329324
CC1=CC=C(C(C(Br)Br)=O)C=C1
2,2-DIBROMO-1-(THIOPHEN-2-YL)ETHAN-1-ONE
CAS:68672-88-8
CM363641
BrC(Br)C(=O)C1=CC=CS1
2,2-DIBROMO-1H-INDENE-1,3(2H)-DIONE
CAS:1685-97-8
CM219667
O=C1C(Br)(Br)C(C2=C1C=CC=C2)=O
2,2-DIBUTYLPROPANE-1,3-DIOL
CAS:24765-57-9
CM329122
OCC(CCCC)(CCCC)CO
2,2-DICHLORO-1-(1-METHYL-1,2,3,4-TETRAHYDROQUINOLIN-2-YL)ETHANONE
CAS:114370-15-9
CM225822
CN1C(C(C(Cl)Cl)=O)CCC2=C1C=CC=C2
2,2-DICHLORO-1-(1-OXA-4-AZASPIRO[4.5]DECAN-4-YL)ETHANONE
CAS:71526-07-3
CM216464
ClC(Cl)C(N1CCOC12CCCCC2)=O
2,2-DICHLORO-1-(3,4-DIHYDROISOQUINOLIN-2(1H)-YL)ETHANONE
CAS:10579-62-1
CM225847
ClC(Cl)C(N1CC2=C(C=CC=C2)CC1)=O
2,2-DICHLORO-1-(6,7-DIMETHOXY-3,4-DIHYDROISOQUINOLIN-2(1H)-YL)ETHANONE
CAS:104756-56-1
CM226325
COC1=CC2=C(C=C1OC)CCN(C(C(Cl)Cl)=O)C2
2,2-DICHLORO-1-(6-HYDROXY-3,4-DIHYDROQUINOLIN-1(2H)-YL)ETHANONE
CAS:62265-67-2
CM228496
OC1=CC2=C(N(C(C(Cl)Cl)=O)CCC2)C=C1
2,2-DICHLORO-1-METHYLCYCLOPROPANECARBOXYLIC ACID
CAS:1447-14-9
CM202056
O=C(C1(C)C(Cl)(Cl)C1)O
2,2-DIETHOXY-N,N-DIMETHYLETHANAMINE
CAS:3616-56-6
CM252487
CCOC(OCC)CN(C)C
2,2-DIETHOXYACETONITRILE
CAS:6136-93-2
CM303425
N#CC(OCC)OCC
2,2-DIETHOXYETHANOL
CAS:621-63-6
CM219807
CCOC(OCC)CO
2,2-DIETHYLCYCLOPROPANECARBOXYLIC ACID
CAS:108420-15-1
CM306080
O=C(C1C(CC)(CC)C1)O
2,2-DIETHYLOXETAN-3-AMINE
CAS:2227205-45-8
CM326072
NC1C(CC)(CC)OC1
2,2-DIFLUORO-1,3-BENZODIOXOLE-5-CARBOXYLIC ACID
CAS:656-46-2
CM158011
OC(=O)C1=CC2=C(OC(F)(F)O2)C=C1
2,2-DIFLUORO-1,3-DIMETHYLIMIDAZOLIDINE
CAS:220405-40-3
CM329895
CN1C(F)(F)N(C)CC1
2,2-DIFLUORO-1-PROPYLAMINE HYDROCHLORIDE
CAS:868241-48-9
CM117701
NCC(F)(F)C.[H]Cl
2,2-DIFLUORO-2,3-DIHYDRO-1,3-BIS(2,6-DIISOPROPYLPHENYL)-1H-IMIDAZOLE
CAS:1314657-40-3
CM111954
CC(C1=C(N2C(F)(F)N(C3=C(C(C)C)C=CC=C3C(C)C)C=C2)C(
2,2-DIFLUORO-2-(1-METHYL-1H-1,3-BENZODIAZOL-2-YL)ACETIC ACID
CAS:80944-03-2
CM325707
O=C(O)C(F)(F)C1=NC2=CC=CC=C2N1C
2,2-DIFLUORO-2-(1H-INDOL-3-YL)ETHANAMINE HYDROCHLORIDE
CAS:516521-96-3
CM334038
FC(C1=CNC2=C1C=CC=C2)(F)CN.[H]Cl
2,2-DIFLUORO-2-(4-METHOXYPHENYL)ACETIC ACID
CAS:1027513-97-8
CM329449
O=C(O)C(F)(F)C1=CC=C(OC)C=C1
2,2-DIFLUORO-2-(5-FLUORO-1H-INDOL-3-YL)ETHANAMINE HYDROCHLORIDE
CAS:1923082-60-3
CM333841
FC1=CC2=C(NC=C2C(F)(F)CN)C=C1.[H]Cl
2,2-DIFLUORO-2-(5-METHOXY-1H-INDOL-3-YL)ETHANAMINE HYDROCHLORIDE
CAS:516521-97-4
CM334039
COC1=CC2=C(NC=C2C(F)(F)CN)C=C1.[H]Cl
2,2-DIFLUORO-2-(FURAN-2-YL)ACETIC ACID
CAS:1344257-62-0
CM325636
O=C(O)C(F)(F)C1=CC=CO1
2,2-DIFLUORO-2-(OXAN-3-YL)ACETIC ACID
CAS:1780215-89-5
CM325979
O=C(O)C(F)(F)C1COCCC1
2,2-DIFLUORO-2-(P-TOLYL)ACETIC ACID
CAS:131323-10-9
CM127001
FC(C(=O)O)(C1=CC=C(C=C1)C)F
2,2-DIFLUORO-2-(PYRIDIN-2-YL)ACETIC ACID
CAS:1039621-73-2
CM105569
O=C(O)C(F)(F)C1=NC=CC=C1
2,2-DIFLUORO-2-(PYRIDIN-2-YL)ETHAN-1-OL
CAS:267875-65-0
CM107660
OCC(F)(F)C1=NC=CC=C1
2,2-DIFLUORO-2H-1,3-BENZODIOXOLE-4-CARBALDEHYDE
CAS:119895-68-0
CM105986
O=CC1=C2OC(F)(F)OC2=CC=C1
2,2-DIFLUORO-2H-1,3-BENZODIOXOLE-4-SULFONYL CHLORIDE
CAS:89819-42-1
CM325670
O=S(C1=C2OC(F)(F)OC2=CC=C1)(Cl)=O
2,2-DIFLUORO-4-IODOBENZO[D][1,3]DIOXOLE
CAS:531508-54-0
CM253452
IC1=C2OC(F)(F)OC2=CC=C1
2,2-DIFLUORO-BENZO[1,3]DIOXOLE-5-CARBOXYLIC ACID METHYL ESTER
CAS:773873-95-3
CM162001
COC(=O)C1=CC2=C(OC(F)(F)O2)C=C1
2,2-DIFLUORO-N-METHOXY-N-METHYLACETAMIDE
CAS:142492-01-1
CM327671
O=C(N(OC)C)C(F)F
2,2-DIFLUORO-N-METHOXY-N-METHYLCYCLOPROPANE-1-CARBOXAMIDE
CAS:1202774-49-9
CM332530
O=C(C1C(F)(F)C1)N(OC)C
2,2-DIFLUOROCYCLOHEXAN-1-AMINE
CAS:921753-37-9
CM202024
NC1C(F)(F)CCCC1
2,2-DIFLUOROCYCLOHEXAN-1-AMINE HYDROCHLORIDE
CAS:921602-83-7
CM117830
NC1C(F)(F)CCCC1.[H]Cl
2,2-DIFLUOROCYCLOHEXANE-1,3-DIONE
CAS:183742-84-9
CM325762
O=C1C(F)(F)C(CCC1)=O
2,2-DIFLUOROCYCLOPENTAN-1-OL
CAS:1545583-60-5
CM326813
OC1C(F)(F)CCC1
2,2-DIFLUOROCYCLOPENTANAMINE HYDROCHLORIDE
CAS:921599-70-4
CM117887
NC1C(F)(F)CCC1.[H]Cl
2,2-DIFLUOROCYCLOPROPAN-1-AMINE
CAS:748729-62-6
CM328496
NC1C(F)(F)C1
2,2-DIFLUOROCYCLOPROPAN-1-OL
CAS:811431-40-0
CM329404
OC1C(F)(F)C1
2,2-DIFLUOROCYCLOPROPANAMINE HYDROCHLORIDE
CAS:105614-25-3
CM117900
NC1C(F)(F)C1.[H]Cl
2,2-DIFLUOROCYCLOPROPANE-1-CARBOXYLIC ACID
CAS:107873-03-0
CM105063
OC(=O)C1CC1(F)F
2,2-DIFLUOROETHYL TRIFLUOROMETHANESULFONATE
CAS:74427-22-8
CM328495
O=S(C(F)(F)F)(OCC(F)F)=O
2,2-DIFLUOROHEXANOIC ACID
CAS:175286-61-0
CM127780
CCCCC(F)(F)C(O)=O
2,2-DIFLUOROPENT-4-ENOIC ACID
CAS:55039-89-9
CM253599
C=CCC(F)(F)C(O)=O
2,2-DIFLUOROPENTANEDIOIC ACID
CAS:380-86-9
CM131913
O=C(O)C(F)(F)CCC(O)=O
2,2-DIFLUOROPROPANOL
CAS:33420-52-9
CM101457
CC(F)(F)CO
2,2-DIFLUOROPROPIONIC ACID
CAS:373-96-6
CM186267
CC(F)(F)C(O)=O
2,2-DIFLUOROPROPYL CHLOROFORMATE
CAS:2149714-18-9
CM327627
O=C(Cl)OCC(F)(F)C
2,2-DIHYDROXY-1-(4-(PIPERIDIN-1-YL)PHENYL)ETHANONE
CAS:93290-93-8
CM179746
OC(O)C(C1=CC=C(N2CCCCC2)C=C1)=O
2,2-DIHYDROXY-1-(P-TOLYL)ETHAN-1-ONE
CAS:7466-72-0
CM185525
CC1=CC=C(C=C1)C(=O)C(O)O
2,2-DIHYDROXY-1H-CYCLOPENTA[B]NAPHTHALENE-1,3(2H)-DIONE
CAS:38627-57-5
CM246370
O=C1C(O)(O)C(C2=C1C=C3C=CC=CC3=C2)=O
2,2-DIMETHOXY-N,N-DIMETHYLACETAMIDE
CAS:25408-61-1
CM124649
O=C(N(C)C)C(OC)OC
2,2-DIMETHOXYACETIC ACID
CAS:73569-40-1
CM314333
O=C(O)C(OC)OC
2,2-DIMETHOXYETHAN-1-OL
CAS:30934-97-5
CM303292
COC(OC)CO
2,2-DIMETHOXYPROPAN-1-AMINE
CAS:131713-50-3
CM328870
CC(OC)(OC)CN
2,2-DIMETHYL 1,3-DIHYDROINDENE-2,2-DICARBOXYLATE
CAS:276888-00-7
CM269289
O=C(C1(C(OC)=O)CC2=C(C=CC=C2)C1)OC
2,2-DIMETHYL-1,2-DIHYDROQUINOLINE
CAS:14465-61-3
CM229772
CC1(C)NC2=C(C=CC=C2)C=C1
2,2-DIMETHYL-1,3-BENZODIOXOLE
CAS:14005-14-2
CM160533
CC1(C)OC2=CC=CC=C2O1
2,2-DIMETHYL-1,3-BENZODIOXOLE-5-CARBOXYLIC ACID
CAS:56011-75-7
CM312777
O=C(C1=CC=C(OC(C)(C)O2)C2=C1)O
2,2-DIMETHYL-1,3-CYCLOPENTANEDIONE
CAS:3883-58-7
CM252656
O=C1C(C)(C)C(CC1)=O
2,2-DIMETHYL-1,3-DIOXAN-5-AMINE
CAS:40137-24-4
CM252763
NC1COC(C)(C)OC1
2,2-DIMETHYL-1,3-DIOXAN-5-ONE
CAS:74181-34-3
CM105142
CC1(C)OCC(=O)CO1
2,2-DIMETHYL-1,3-DIOXANE-4,6-DIONE
CAS:2033-24-1
CM105140
CC1(C)OC(=O)CC(=O)O1
2,2-DIMETHYL-1,3-DIOXOLANE-4-CARBALDEHYDE
CAS:5736-03-8
CM301487
O=CC1OC(C)(C)OC1
2,2-DIMETHYL-1,3-DIOXOLANE-4-CARBOXYLIC ACID
CAS:62075-55-2
CM362989
CC1(C)OCC(O1)C(O)=O
2,2-DIMETHYL-1-(1-METHYL-3,4-DIHYDROISOQUINOLIN-2(1H)-YL)PROPAN-1-ONE
CAS:76068-85-4
CM226315
CC1N(C(C(C)(C)C)=O)CCC2=C1C=CC=C2
2,2-DIMETHYL-1-(1H-PYRROL-1-YL)PROPAN-1-ONE
CAS:411208-03-2
CM197008
CC(C)(C)C(N1C=CC=C1)=O
2,2-DIMETHYL-1-(2-METHYLPIPERAZIN-1-YL)BUTAN-1-ONE
CAS:1240578-06-6
CM335739
CCC(C)(C)C(N1C(C)CNCC1)=O
2,2-DIMETHYL-1-(2-METHYLPIPERAZIN-1-YL)PROPAN-1-ONE
CAS:1240568-55-1
CM335101
CC(C)(C)C(N1C(C)CNCC1)=O
2,2-DIMETHYL-1-(2-THIOXOTHIAZOLIDIN-3-YL)PROPAN-1-ONE
CAS:138459-91-3
CM130150
CC(C)(C)C(N1C(SCC1)=S)=O
2,2-DIMETHYL-1-(3-METHYL-6-NITRO-1H-INDAZOL-1-YL)PROPAN-1-ONE
CAS:62235-22-7
CM238162
O=[N+](C1=CC2=C(C=C1)C(C)=NN2C(C(C)(C)C)=O)[O-]
2,2-DIMETHYL-1-(3-METHYLPIPERAZIN-1-YL)BUTAN-1-ONE
CAS:1240565-10-9
CM335097
CCC(C)(C)C(N1CC(C)NCC1)=O
2,2-DIMETHYL-1-(3-METHYLPIPERAZIN-1-YL)PROPAN-1-ONE
CAS:515863-60-2
CM335091
CC(C)(C)C(N1CC(C)NCC1)=O
2,2-DIMETHYL-1-(6-METHYL-1H-INDOL-1-YL)PROPAN-1-ONE
CAS:557763-02-7
CM232295
CC1=CC2=C(C=C1)C=CN2C(C(C)(C)C)=O
2,2-DIMETHYL-1-(NAPHTHALEN-2-YL)PROPAN-1-ONE
CAS:7270-99-7
CM230892
CC(C)(C)C(C1=CC=C2C=CC=CC2=C1)=O
2,2-DIMETHYL-1-(PIPERAZIN-1-YL)BUTAN-1-ONE
CAS:1240581-28-5
CM335630
CCC(C)(C)C(N1CCNCC1)=O
2,2-DIMETHYL-1-(THIOPHEN-2-YL)PROPAN-1-ONE
CAS:20409-48-7
CM200016
O=C(C1=CC=CS1)C(C)(C)C
2,2-DIMETHYL-1-PROPANAMINE HYDROCHLORIDE
CAS:15925-18-5
CM117612
CC(C)(C)CN.[H]Cl
2,2-DIMETHYL-2,3-DIHYDRO-1H-PERIMIDINE
CAS:6364-17-6
CM324957
CC(N1)(C)NC2=CC=CC3=CC=CC1=C23
2,2-DIMETHYL-2,3-DIHYDROBENZOFURAN-5-CARBONITRILE
CAS:903556-72-9
CM161797
N#CC1=CC=C(OC(C)(C)C2)C2=C1
2,2-DIMETHYL-2,3-DIHYDROINDOLIZIN-5(1H)-ONE
CAS:89730-96-1
CM238802
O=C1N2CC(C)(C)CC2=CC=C1
2,2-DIMETHYL-2H,3H,4H-PYRIDO[3,2-B][1,4]OXAZIN-3-ONE
CAS:20348-21-4
CM107475
O=C1NC2=NC=CC=C2OC1(C)C
2,2-DIMETHYL-2H-BENZO[E][1,3]OXAZIN-4(3H)-ONE
CAS:30914-88-6
CM312494
O=C1NC(C)(C)OC2=CC=CC=C12
2,2-DIMETHYL-2H-PYRANO[2,3-B]QUINOLIN-5(10H)-ONE
CAS:143704-18-1
CM246284
O=C1C(C=CC(C)(C)O2)=C2NC3=C1C=CC=C3
2,2-DIMETHYL-3',4',5'-TRIFLUOROPROPIOPHENONE
CAS:898789-80-5
CM302285
CC(C)(C)C(C1=CC(F)=C(F)C(F)=C1)=O
2,2-DIMETHYL-3,4-DIHYDRO-2H-PYRANO[3,2-C]QUINOLIN-5(6H)-ONE
CAS:6391-66-8
CM246496
O=C1NC2=C(C=CC=C2)C3=C1CCC(C)(C)O3
2,2-DIMETHYL-3,4-DIHYDRONAPHTHALEN-1(2H)-ONE
CAS:2977-45-9
CM239326
O=C1C(C)(C)CCC2=C1C=CC=C2
2,2-DIMETHYL-3-(P-TOLYL)-2,3-DIHYDROQUINAZOLIN-4(1H)-ONE
CAS:568592-48-3
CM215083
O=C1N(C2=CC=C(C)C=C2)C(C)(C)NC3=C1C=CC=C3
2,2-DIMETHYL-3-(P-TOLYL)-2,3-DIHYDROQUINAZOLINE-4(1H)-THIONE
CAS:823195-53-5
CM216979
S=C1N(C2=CC=C(C)C=C2)C(C)(C)NC3=C1C=CC=C3
2,2-DIMETHYL-3-[(1,3-THIAZOL-2-YL)CARBAMOYL]CYCLOPROPANE-1-CARBOXYLIC ACID
CAS:1344039-20-8
CM363699
CC1(C)C(C1C(=O)NC1=NC=CS1)C(O)=O
2,2-DIMETHYL-3-OXO-BUTYRIC ACID ETHYL ESTER
CAS:597-04-6
CM194197
CC(C(C)(C)C(OCC)=O)=O
2,2-DIMETHYL-3-OXOBUTANENITRILE
CAS:37719-02-1
CM193051
CC(C(C)(C)C#N)=O
2,2-DIMETHYL-3-OXOCYCLOBUTANE-1-CARBOXYLIC ACID
CAS:3183-43-5
CM107766
O=C(C1C(C)(C)C(C1)=O)O
2,2-DIMETHYL-3-OXOPENTANAL
CAS:106921-60-2
CM101039
CCC(C(C)(C)C=O)=O
2,2-DIMETHYL-3-PENTANOL
CAS:3970-62-5
CM116204
CC(C)(C)C(O)CC
2,2-DIMETHYL-3-PHENYL-2,3-DIHYDROQUINAZOLINE-4(1H)-THIONE
CAS:30161-63-8
CM213647
S=C1N(C2=CC=CC=C2)C(C)(C)NC3=C1C=CC=C3
2,2-DIMETHYL-3-PHENYLPROPAN-1-OL
CAS:13351-61-6
CM195273
OCC(C)(C)CC1=CC=CC=C1
2,2-DIMETHYL-3-PHENYLPROPANOIC ACID
CAS:5669-14-7
CM125667
O=C(O)C(C)(C)CC1=CC=CC=C1
2,2-DIMETHYL-4-(1-NAPHTHYL)-4-OXOBUTYRIC ACID
CAS:854904-16-8
CM258435
O=C(O)C(C)(C)CC(C1=C2C=CC=CC2=CC=C1)=O
2,2-DIMETHYL-4-(2-NAPHTHYL)-4-OXOBUTYRIC ACID
CAS:854648-79-6
CM258436
O=C(O)C(C)(C)CC(C1=CC=C2C=CC=CC2=C1)=O
2,2-DIMETHYL-4-OXO-3,8,11,14,17,20-HEXAOXA-5-AZATRICOSAN-23-OIC ACID
CAS:1347750-78-0
CM248955
CC(C)(C)OC(NCCOCCOCCOCCOCCOCCC(O)=O)=O
2,2-DIMETHYL-4-OXO-3,8,11,14,17-PENTAOXA-5-AZAICOSAN-20-OIC ACID
CAS:756525-91-4
CM254920
CC(C)(C)OC(NCCOCCOCCOCCOCCC(O)=O)=O
2,2-DIMETHYL-4-OXO-3,8,11,14-TETRAOXA-5-AZAHEXADECAN-16-OIC ACID
CAS:462100-06-7
CM253076
CC(C)(C)OC(NCCOCCOCCOCC(O)=O)=O
2,2-DIMETHYL-4-OXO-3,8,11-TRIOXA-5-AZATRIDECAN-13-OIC ACID
CAS:108466-89-3
CM247660
CC(C)(C)OC(NCCOCCOCC(O)=O)=O
2,2-DIMETHYL-4-OXOCYCLOHEXANE-1-CARBOXYLIC ACID
CAS:4029-26-9
CM131956
CC1(C)CC(=O)CCC1C(O)=O
2,2-DIMETHYL-4-VINYL-1,3-DIOXOLANE
CAS:83968-02-9
CM301522
C=CC1OC(C)(C)OC1
2,2-DIMETHYL-5-((PYRIDIN-3-YLAMINO)METHYLENE)-1,3-DIOXANE-4,6-DIONE
CAS:25063-68-7
CM251700
O=C(C1=CNC2=CC=CN=C2)OC(C)(C)OC1=O
2,2-DIMETHYL-5-(PROPAN-2-YLIDENE)-1,3-DIOXANE-4,6-DIONE
CAS:2231-66-5
CM129039
CC(C)=C1C(=O)OC(C)(C)OC1=O
2,2-DIMETHYL-6-(2-METHYLPROPYL)PIPERIDIN-4-AMINE
CAS:861379-55-7
CM328029
NC1CC(C)(C)NC(CC(C)C)C1
2,2-DIMETHYL-6-NITRO-2H-PYRIDO[3,2-B][1,4]OXAZIN-3(4H)-ONE
CAS:1002726-59-1
CM247248
O=C1NC2=NC([N+]([O-])=O)=CC=C2OC1(C)C
2,2-DIMETHYL-6-NITRO-3,4-DIHYDRO-2H-BENZO[B][1,4]OXAZINE
CAS:136545-11-4
CM313525
O=[N+](C1=CC=C2OC(C)(C)CNC2=C1)[O-]
2,2-DIMETHYL-7-(2,4,5-TRIMETHOXYPHENYL)PYRANO[3,2-G]CHROMEN-6-ONE
CAS:211799-56-3
CM182380
CC1(C=CC2=C(O1)C=C3C(=C2)C(=O)C(=CO3)C4=CC(=C(C=C4
2,2-DIMETHYL-7-NITRO-2H-BENZO[B][1,4]OXAZIN-3(4H)-ONE
CAS:85160-83-4
CM123992
O=C1NC2=CC=C([N+]([O-])=O)C=C2OC1(C)C
2,2-DIMETHYL-7-NITRO-3,4-DIHYDRO-2H-BENZO[B][1,4]OXAZINE
CAS:144293-76-5
CM321316
O=[N+](C1=CC=C2C(OC(C)(C)CN2)=C1)[O-]
2,2-DIMETHYL-8-FLUORO-4-CHROMANONE
CAS:885266-62-6
CM162491
O=C1CC(C)(C)OC2=C1C=CC=C2F
2,2-DIMETHYL-8-PRENYLCHROMENE 6-CARBOXYLIC ACID
CAS:151731-50-9
CM162820
O=C(C1=CC(C=CC(C)(C)O2)=C2C(C/C=C(C)\C)=C1)O
2,2-DIMETHYL-N-(4-PYRIDINYL)PROPANAMIDE
CAS:70298-89-4
CM120666
CC(C)(C)C(NC1=CC=NC=C1)=O
2,2-DIMETHYL-TETRAHYDRO-2H-PYRAN-4-CARBALDEHYDE
CAS:34941-21-4
CM182093
CC1(C)CC(CCO1)C=O
2,2-DIMETHYLBUT-3-ENOIC ACID
CAS:10276-09-2
CM247392
CC(C)(C=C)C(O)=O
2,2-DIMETHYLBUT-3-YN-1-OL
CAS:65108-31-8
CM108392
C#CC(C)(C)CO
2,2-DIMETHYLBUT-3-YNOIC ACID
CAS:56663-76-4
CM129373
C#CC(C)(C)C(O)=O
2,2-DIMETHYLBUTANOYL CHLORIDE
CAS:5856-77-9
CM328838
CCC(C)(C)C(Cl)=O
2,2-DIMETHYLCHROMANE-6-CARBOXYLIC ACID
CAS:2039-47-6
CM300190
O=C(C1=CC(CCC(C)(C)O2)=C2C=C1)O
2,2-DIMETHYLCYCLOHEXAN-1-ONE
CAS:1193-47-1
CM130965
CC1(C(=O)CCCC1)C
2,2-DIMETHYLCYCLOHEXANE-1,3-DIONE
CAS:562-13-0
CM108218
O=C1C(C)(C)C(CCC1)=O
2,2-DIMETHYLCYCLOPENTAN-1-ONE
CAS:4541-32-6
CM104667
CC1(C)CCCC1=O
2,2-DIMETHYLCYCLOPROPANAMINE HYDROCHLORIDE
CAS:674367-28-3
CM117932
NC1C(C)(C)C1.[H]Cl
2,2-DIMETHYLCYCLOPROPANECARBOXYLIC ACID
CAS:75885-59-5
CM202168
CC1(C)CC1C(O)=O
2,2-DIMETHYLHEX-5-YN-1-OL
CAS:892875-17-1
CM336394
C#CCCC(C)(C)CO
2,2-DIMETHYLINDOLINE
CAS:18023-30-8
CM231840
CC1(C)NC2=C(C=CC=C2)C1
2,2-DIMETHYLMALONAMIDE
CAS:41882-44-4
CM252864
O=C(N)C(C)(C)C(N)=O
2,2-DIMETHYLMORPHOLINE
CAS:147688-58-2
CM107071
CC1(C)CNCCO1
2,2-DIMETHYLMORPHOLINE HYDROCHLORIDE
CAS:167946-94-3
CM104840
Cl.CC1(C)CNCCO1
2,2-DIMETHYLOXAN-4-AMINE
CAS:25850-22-0
CM362701
CC1(C)CC(N)CCO1
2,2-DIMETHYLOXOLAN-3-ONE
CAS:52662-40-5
CM363722
CC1(C)OCCC1=O
2,2-DIMETHYLPENT-4-EN-1-OL
CAS:3420-42-6
CM192876
CC(C)(CO)CC=C
2,2-DIMETHYLPENT-4-ENYL IODIDE
CAS:95106-80-2
CM329302
C=CCC(C)(C)CI
2,2-DIMETHYLPIPERAZINE
CAS:84477-72-5
CM120143
CC1(C)NCCNC1
2,2-DIMETHYLPIPERIDINE HYDROCHLORIDE
CAS:1254339-11-1
CM278644
CC1(C)NCCCC1.[H]Cl
2,2-DIMETHYLPROPANE-1,3-DIOL
CAS:126-30-7
CM248611
OCC(C)(C)CO
2,2-DIMETHYLPROPANE-1,3-DIYL DIACRYLATE
CAS:2223-82-7
CM195490
CC(C)(COC(C=C)=O)COC(C=C)=O
2,2-DIMETHYLPROPANETHIOAMIDE
CAS:630-22-8
CM244283
CC(C)(C)C(N)=S
2,2-DIMETHYLPYRROLIDINE
CAS:623580-01-8
CM112739
CC1(C)NCCC1
2,2-DIMETHYLPYRROLIDINE
CAS:35018-15-6
CM362657
CC1(C)CCCN1
2,2-DIMETHYLSPIRO[2.4]HEPTA-4,6-DIENE-1-CARBALDEHYDE
CAS:110211-41-1
CM204872
O=CC1C(C)(C)C12C=CC=C2
2,2-DIMETHYLSPIRO[CHROMAN-4,1'-CYCLOPROPANE]-6-CARBALDEHYDE
CAS:1350761-57-7
CM208111
O=CC1=CC(C2(CC2)CC(C)(C)O3)=C3C=C1
2,2-DIMETHYLSUCCINIC ANHYDRIDE
CAS:17347-61-4
CM250309
CC1(C(OC(C1)=O)=O)C
2,2-DIMETHYLTETRAHYDRO-2H-PYRAN-4-CARBOXYLIC ACID
CAS:52916-16-2
CM133592
O=C(C1CC(C)(C)OCC1)O
2,2-DIMETHYLTETRAHYDROPYRAN-4-ONE
CAS:1194-16-7
CM182114
O=C1CC(C)(C)OCC1
2,2-DIMETHYLTHIAZOLIDINE
CAS:19351-18-9
CM118025
CC1(C)SCCN1
2,2-DIPHENYLACETALDEHYDE
CAS:947-91-1
CM255953
O=CC(C1=CC=CC=C1)C2=CC=CC=C2
2,2-DIPHENYLCYCLOPROPANE-1-CARBOXYLIC ACID
CAS:7150-12-1
CM132650
O=C(C1C(C2=CC=CC=C2)(C3=CC=CC=C3)C1)O
2,2-DIPHENYLCYCLOPROPANECARBONITRILE
CAS:30932-41-3
CM202135
N#CC1C(C2=CC=CC=C2)(C3=CC=CC=C3)C1
2,2-DIPHENYLINDOLIN-3-ONE
CAS:1922-77-6
CM261517
O=C1C(C2=CC=CC=C2)(C3=CC=CC=C3)NC4=C1C=CC=C4
2,2A-DIHYDRO-1H-AZETO[1,2-A]QUINOXALINE-1,3(4H)-DIONE
CAS:111781-86-3
CM221523
O=C1CC2N1C3=C(C=CC=C3)NC2=O
2,3',4',5'-TETRAFLUORO-4-((1S,4R)-4-PROPYLCYCLOHEXYL)-1,1'-BIPHENYL
CAS:173837-35-9
CM203461
CCC[C@H]1CC[C@H](C2=CC=C(C3=CC(F)=C(F)C(F)=C3)C(F)
2,3',4',5'-TETRAFLUORO-4-(TRANS-4-PENTYLCYCLOHEXYL)-1,1'-BIPHENYL
CAS:173837-36-0
CM203462
CCCCC[C@H]1CC[C@H](C2=CC=C(C3=CC(F)=C(F)C(F)=C3)C(
2,3',5'-TRIFLUORO-[1,1'-BIPHENYL]-4-CARBALDEHYDE
CAS:1318975-41-5
CM321610
O=CC1=CC=C(C2=CC(F)=CC(F)=C2)C(F)=C1
2,3',5'-TRIFLUORO-[1,1'-BIPHENYL]-4-CARBOXYLIC ACID
CAS:1262006-03-0
CM304901
O=C(C1=CC=C(C2=CC(F)=CC(F)=C2)C(F)=C1)O
2,3'-DIFLUORO-4'-METHYL-[1,1'-BIPHENYL]-4-CARBOXYLIC ACID
CAS:1261893-04-2
CM304924
O=C(C1=CC=C(C2=CC=C(C)C(F)=C2)C(F)=C1)O
2,3'-DIMETHYL-1,1'-BIPHENYL
CAS:611-43-8
CM321014
CC1=CC(C2=CC=CC=C2C)=CC=C1
2,3,3',4',5,6-HEXAHYDRO-2'H-SPIRO[PYRAN-4,1'-PYRROLO[1,2-A]PYRAZINE]
CAS:1542441-75-7
CM335461
N12CCNC3(CCOCC3)C1=CC=C2
2,3,3-TRIMETHYL-1-PROPYL-3H-INDOL-1-IUM IODIDE
CAS:20205-29-2
CM148979
CC1(C)C(C)=[N+](CCC)C2=C1C=CC=C2.[I-]
2,3,3-TRIMETHYL-3H-INDOL-5-AMINE
CAS:773-63-7
CM147221
NC1=CC2=C(N=C(C)C2(C)C)C=C1
2,3,3-TRIMETHYL-5-(PHENYLSULFONYL)-3H-INDOLE
CAS:55203-59-3
CM262743
O=S(C1=CC2=C(N=C(C)C2(C)C)C=C1)(C3=CC=CC=C3)=O
2,3,3-TRIMETHYLBUTAN-2-YL PROP-2-ENOATE
CAS:1033202-90-2
CM333378
C=CC(OC(C(C)(C)C)(C)C)=O
2,3,3A,4,6,6A-HEXAHYDROFURO[3,4-B]FURAN-3-CARBOXYLIC ACID
CAS:2253640-84-3
CM329108
O=C(C1C2C(COC2)OC1)O
2,3,4'-TRIHYDROXY-3',5'-DIMETHOXYPROPIOPHENONE
CAS:33900-74-2
CM303518
O=C(C1=CC(OC)=C(O)C(OC)=C1)C(O)CO
2,3,4,4'-TETRAHYDROXYBENZOPHENONE
CAS:31127-54-5
CM117216
O=C(C1=CC=C(O)C=C1)C2=CC=C(O)C(O)=C2O
2,3,4,4A,5,6-HEXAHYDRO-1H-PYRAZINO[1,2-A]QUINOLINE
CAS:182208-61-3
CM240320
N12C(CNCC2)CCC3=C1C=CC=C3
2,3,4,5,6,7,8,9-OCTAHYDRO-1H-CYCLOPENTA[E]-AS-INDACENE
CAS:1206-79-7
CM203628
C12=C(CCC2)C3=C(CCC3)C4=C1CCC4
2,3,4,5,6,7,8,9-OCTAHYDRO-1H-PYRIDO[3,4-B]INDOL-1-ONE
CAS:1956379-38-6
CM240609
O=C1NCCC2=C1NC3=C2CCCC3
2,3,4,5,6-PENTADEUTERIOBENZALDEHYDE
CAS:14132-51-5
CM329999
O=CC1=C([2H])C([2H])=C([2H])C([2H])=C1[2H]
2,3,4,5,6-PENTADEUTERIOBENZOIC ACID
CAS:1079-02-3
CM328787
O=C(O)C1=C([2H])C([2H])=C([2H])C([2H])=C1[2H]
2,3,4,5,6-PENTAFLUOROBENZALDEHYDE
CAS:653-37-2
CM254342
FC1=C(F)C(F)=C(C=O)C(F)=C1F
2,3,4,5,6-PENTAFLUOROBENZENE-1-SULFONYL CHLORIDE
CAS:832-53-1
CM283239
O=S(C1=C(F)C(F)=C(F)C(F)=C1F)(Cl)=O
2,3,4,5,6-PENTAFLUOROPYRIDINE
CAS:700-16-3
CM329971
FC1=C(F)C(F)=C(F)C(F)=N1
2,3,4,5,6-PENTAMETHYLPHENYLBORONIC ACID
CAS:1028205-76-6
CM204364
OB(C1=C(C)C(C)=C(C)C(C)=C1C)O
2,3,4,5-TETRACHLOROBENZOIC ACID
CAS:50-74-8
CM157823
O=C(O)C1=CC(Cl)=C(Cl)C(Cl)=C1Cl
2,3,4,5-TETRACHLOROPYRIDINE
CAS:2808-86-8
CM132090
ClC1=CN=C(Cl)C(Cl)=C1Cl
2,3,4,5-TETRAFLUOROBENZOIC ACID
CAS:1201-31-6
CM102478
O=C(O)C1=CC(F)=C(F)C(F)=C1F
2,3,4,5-TETRAHYDRO-1H-1,3A,6-TRIAZACYCLOHEPTA[DE]NAPHTHALENE
CAS:156144-61-5
CM230708
C12=C3C(C=CC=C2)=NCCN3CCN1
2,3,4,5-TETRAHYDRO-1H-1,5-METHANOBENZO[D]AZEPINE HYDROCHLORIDE
CAS:230615-52-8
CM153355
[H]Cl.C1(C2)CNCC2C3=CC=CC=C13
2,3,4,5-TETRAHYDRO-1H-1-BENZAZEPIN-9-AMINE
CAS:1780911-57-0
CM327396
NC1=C(NCCCC2)C2=CC=C1
2,3,4,5-TETRAHYDRO-1H-3-BENZAZEPINE HYDROCHLORIDE
CAS:17379-01-0
CM107345
[H]Cl.C12=CC=CC=C1CCNCC2
2,3,4,5-TETRAHYDRO-1H-BENZO-[C]AZEPINE HYDROCHLORIDE
CAS:17724-36-6
CM152781
[H]Cl.C12=CC=CC=C1CNCCC2
2,3,4,5-TETRAHYDRO-1H-BENZO[B]AZEPIN-8-AMINE
CAS:518051-96-2
CM122994
NC1=CC=C2C(NCCCC2)=C1
2,3,4,5-TETRAHYDRO-1H-BENZO[B]AZEPINE
CAS:1701-57-1
CM121914
C12=CC=CC=C1CCCCN2
2,3,4,5-TETRAHYDRO-1H-BENZO[D]AZEPIN-7-OL
CAS:36133-00-3
CM154718
OC1=CC=C2CCNCCC2=C1
2,3,4,5-TETRAHYDRO-1H-BENZO[D]AZEPINE
CAS:4424-20-8
CM110031
C12=CC=CC=C1CCNCC2
2,3,4,5-TETRAHYDRO-1H-PYRIDO[4,3-B]INDOL-1-ONE
CAS:122852-78-2
CM333555
O=C1NCCC(N2)=C1C3=C2C=CC=C3
2,3,4,5-TETRAHYDROBENZO[B][1,4]OXAZEPINE
CAS:7160-97-6
CM322921
C12=CC=CC=C1OCCCN2
2,3,4,5-TETRAHYDROBENZO[F][1,4]OXAZEPINE
CAS:17775-01-8
CM160036
C1COC2=C(CN1)C=CC=C2
2,3,4,6,7,11B-HEXAHYDRO-1H-PYRIDO[2,1-A]ISOQUINOLIN-2-AMINE
CAS:46386-64-5
CM227617
NC(CC1)CC2N1CCC3=C2C=CC=C3
2,3,4,6-TETRA-O-ACETYL-ALPHA-D-GLUCOPYRANOSYL CHLORIDE
CAS:4451-35-8
CM182518
Cl[C@@H]1[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=
2,3,4,6-TETRA-O-ACETYL-BETA-D-GLUCOSE
CAS:3947-62-4
CM183771
O[C@H]1[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)
2,3,4,6-TETRA-O-PIVALOYL-ALPHA-D-GLUCOPYRANOSYL BROMIDE
CAS:81058-27-7
CM100831
CC(C)(C)C(OC[C@@H]1[C@@H](OC(C(C)(C)C)=O)[C@H](OC(
2,3,4,6-TETRAFLUOROPHENOL
CAS:60890-56-4
CM329210
OC1=C(F)C=C(F)C(F)=C1F
2,3,4,9-TETRAHYDRO-1H-CARBAZOL-3-AMINE
CAS:61894-99-3
CM254071
NC1CCC(NC2=C3C=CC=C2)=C3C1
2,3,4,9-TETRAHYDRO-1H-CARBAZOLE
CAS:942-01-8
CM255907
C1(NC2=C3C=CC=C2)=C3CCCC1
2,3,4,9-TETRAHYDRO-1H-CARBAZOLE-3-CARBOXYLIC ACID
CAS:26088-66-4
CM333939
O=C(C1CCC(NC2=C3C=CC=C2)=C3C1)O
2,3,4,9-TETRAHYDRO-1H-CARBAZOLE-6-CARBONITRILE
CAS:100723-77-1
CM333439
N#CC1=CC2=C(NC3=C2CCCC3)C=C1
2,3,4,9-TETRAHYDRO-1H-PYRIDO[3,4-B]INDOLE
CAS:16502-01-5
CM221105
C(N1)(CNCC2)=C2C3=C1C=CC=C3
2,3,4,9-TETRAHYDRO-1H-PYRIDO[3,4-B]INDOLE-1-CARBOXYLIC ACID
CAS:6649-91-8
CM244817
O=C(C1NCCC2=C1NC3=C2C=CC=C3)O
2,3,4,9-TETRAHYDRO-1H-PYRIDO[3,4-B]INDOLE-3-CARBOXYLIC ACID
CAS:6052-68-2
CM146625
O=C(C1CC2=C(CN1)NC3=C2C=CC=C3)O
2,3,4,9-TETRAHYDRO-1H-PYRIDO[3,4-B]INDOLE-5,6-DIOL
CAS:150254-82-3
CM242069
OC1=C(O)C=CC2=C1C3=C(CNCC3)N2
2,3,4-TRI-O-ACETYL-A-D-GLUCURONIC ACID METHYL ESTER
CAS:72692-06-9
CM328899
O[C@@H]1[C@@H]([C@H]([C@@H]([C@@H](C(OC)=O)O1)OC(C
2,3,4-TRI-O-ACETYL-BETA-D-GLUCURONIC ACID METHYL ESTER
CAS:73464-50-3
CM336239
O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](C(OC)=O)O1)OC(C)
2,3,4-TRICHLORO-5-FLUOROBENZOIC ACID
CAS:115549-04-7
CM132125
O=C(O)C1=CC(F)=C(Cl)C(Cl)=C1Cl
2,3,4-TRICHLORO-5-NITROPHENYLBORONIC ACID
CAS:1072946-38-3
CM137038
OB(O)C1=C(Cl)C(Cl)=C(Cl)C(=C1)[N+]([O-])=O
2,3,4-TRICHLORO-6,8-DIMETHOXYQUINOLINE
CAS:1447953-72-1
CM262118
COC1=C2N=C(Cl)C(Cl)=C(Cl)C2=CC(OC)=C1
2,3,4-TRICHLORO-6-(TRIFLUOROMETHYL)QUINOLINE
CAS:1447959-23-0
CM262820
FC(C1=CC=C2N=C(Cl)C(Cl)=C(Cl)C2=C1)(F)F
2,3,4-TRICHLORO-6-FLUOROQUINOLINE
CAS:1447959-25-2
CM257763
FC1=CC=C2N=C(Cl)C(Cl)=C(Cl)C2=C1
2,3,4-TRICHLORO-8-FLUOROQUINOLINE
CAS:1447953-28-7
CM257762
FC1=C2N=C(Cl)C(Cl)=C(Cl)C2=CC=C1
2,3,4-TRICHLORO-8-METHOXY-5-METHYLQUINOLINE
CAS:1447953-54-9
CM260577
CC1=C2C(Cl)=C(Cl)C(Cl)=NC2=C(OC)C=C1
2,3,4-TRICHLOROANILINE
CAS:634-67-3
CM308986
NC1=CC=C(Cl)C(Cl)=C1Cl
2,3,4-TRICHLOROPHENYLBORONIC ACID
CAS:352530-21-3
CM135305
OB(O)C1=C(Cl)C(Cl)=C(Cl)C=C1
2,3,4-TRICHLOROPYRIDINE
CAS:55934-02-6
CM171916
ClC1=C(Cl)C(Cl)=NC=C1
2,3,4-TRICHLOROQUINOLINE
CAS:40335-02-2
CM144693
ClC1=C(Cl)C(Cl)=NC2=CC=CC=C12
2,3,4-TRIFLUORO-5-NITROBENZOIC ACID
CAS:197520-71-1
CM156962
O=C(O)C1=CC([N+]([O-])=O)=C(F)C(F)=C1F
2,3,4-TRIFLUORO-6-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)ANILINE
CAS:1451391-20-0
CM209878
NC1=C(B2OC(C)(C)C(C)(C)O2)C=C(F)C(F)=C1F
2,3,4-TRIFLUORO-6-NITROANILINE
CAS:148416-38-0
CM249610
NC1=C(F)C(F)=C(F)C=C1[N+]([O-])=O
2,3,4-TRIFLUOROANILINE
CAS:3862-73-5
CM118287
NC1=CC=C(F)C(F)=C1F
2,3,4-TRIFLUOROBENZALDEHYDE
CAS:161793-17-5
CM249959
C1=C(C(=C(C(=C1)F)F)F)C=O
2,3,4-TRIFLUOROBENZENEBORONIC ACID
CAS:226396-32-3
CM112281
OB(C1=CC=C(F)C(F)=C1F)O
2,3,4-TRIFLUOROBENZENESULFONYL CHLORIDE
CAS:175278-08-7
CM327638
O=S(C1=CC=C(F)C(F)=C1F)(Cl)=O
2,3,4-TRIFLUOROBENZOIC ACID
CAS:61079-72-9
CM158647
O=C(O)C1=CC=C(F)C(F)=C1F
2,3,4-TRIFLUOROBENZONITRILE
CAS:143879-80-5
CM158976
N#CC1=CC=C(F)C(F)=C1F
2,3,4-TRIFLUOROBENZOYL CHLORIDE
CAS:157373-08-5
CM327675
O=C(Cl)C1=CC=C(F)C(F)=C1F
2,3,4-TRIFLUOROPHENOL
CAS:2822-41-5
CM308287
OC1=CC=C(F)C(F)=C1F
2,3,4-TRIHYDROXYBENZOIC ACID
CAS:610-02-6
CM158601
O=C(O)C1=CC=C(O)C(O)=C1O
2,3,4-TRIMETHOXY-BENZYLAMINE
CAS:41219-16-3
CM186337
NCC1=CC=C(OC)C(OC)=C1OC
2,3,4-TRIMETHOXYBENZOIC ACID
CAS:573-11-5
CM158600
O=C(O)C1=CC=C(OC)C(OC)=C1OC
2,3,4-TRIMETHOXYPHENOL
CAS:19676-64-3
CM184483
COC1=C(OC)C(OC)=C(O)C=C1
2,3,4-TRIMETHOXYPHENYLBORONIC ACID
CAS:118062-05-8
CM135517
COC1=C(OC)C(OC)=C(C=C1)B(O)O
2,3,4-TRIMETHYL-1,5-NAPHTHYRIDINE
CAS:1557262-60-8
CM231880
CC1=C(C)C(C)=NC2=CC=CN=C12
2,3,4-TRIMETHYL-2H-PYRAZOLO[3,4-B]PYRIDIN-6(7H)-ONE
CAS:1018126-19-6
CM272200
O=C1C=C(C)C2=C(C)N(C)N=C2N1
2,3,4-TRIMETHYLQUINOLINE
CAS:51366-52-0
CM239058
CC1=C(C)C(C)=NC2=CC=CC=C12
2,3,4A,5,8,8A-HEXAHYDRONAPHTHALENE-1,4-DIONE
CAS:54963-84-7
CM238849
O=C(C1CC=CCC21)CCC2=O
2,3,5,4'-TETRAHYDROXYSTILBENE-2-O-BETA-D-GLUCOSIDE
CAS:55327-45-2
CM182412
O[C@H]1[C@H](OC2=C(/C=C/C3=CC=C(O)C=C3)C=C(O)C=C2O
2,3,5,6,7,8-HEXAHYDRO-1H-CYCLOPENTA[B]QUINOLIN-9-AMINE HYDROCHLORIDE
CAS:90043-86-0
CM228383
NC1=C(CCC2)C2=NC3=C1CCCC3.[H]Cl
2,3,5,6,7,8-HEXAHYDROPHTHALAZINE-1,4-DIONE
CAS:67279-23-6
CM185210
O=C1NNC(C2=C1CCCC2)=O
2,3,5,6,7,8-HEXAHYDROQUINOLIN-4-AMINE
CAS:116861-56-4
CM238405
NC1=C2CCCCC2=NCC1
2,3,5,6-TETRABROMOPYRIDIN-4-AMINE
CAS:26943-06-6
CM171556
NC1=C(Br)C(Br)=NC(Br)=C1Br
2,3,5,6-TETRACHLORO-4-(METHYLSULFONYL)PYRIDINE
CAS:13108-52-6
CM120982
O=S(C1=C(Cl)C(Cl)=NC(Cl)=C1Cl)(C)=O
2,3,5,6-TETRACHLOROCYCLOHEXA-2,5-DIENE-1,4-DIONE
CAS:118-75-2
CM333373
O=C1C(Cl)=C(Cl)C(C(Cl)=C1Cl)=O
2,3,5,6-TETRACHLOROISONICOTINALDEHYDE
CAS:68054-26-2
CM178955
O=CC1=C(Cl)C(Cl)=NC(Cl)=C1Cl
2,3,5,6-TETRADEUTERIO-4-HYDROXYBENZALDEHYDE
CAS:284474-52-8
CM327842
O=CC1=C([2H])C([2H])=C(O)C([2H])=C1[2H]
2,3,5,6-TETRAFLUORO-4-METHOXYPYRIDINE
CAS:2375-90-8
CM305526
COC1=C(F)C(F)=NC(F)=C1F
2,3,5,6-TETRAFLUORO-4-METHYLPYRIDINE
CAS:16297-14-6
CM362411
CC1=C(F)C(F)=NC(F)=C1F
2,3,5,6-TETRAFLUOROISONICOTINIC ACID
CAS:2875-10-7
CM177349
O=C(O)C1=C(F)C(F)=NC(F)=C1F
2,3,5,6-TETRAFLUOROPHENOL
CAS:769-39-1
CM303463
OC1=C(F)C(F)=CC(F)=C1F
2,3,5,6-TETRAFLUOROPYRIDINE
CAS:2875-18-5
CM120600
FC1=C(F)C=C(F)C(F)=N1
2,3,5,6-TETRAFLUOROPYRIDINE-4-CARBALDEHYDE
CAS:16297-09-9
CM336522
FC1=NC(F)=C(F)C(C=O)=C1F
2,3,5,6-TETRAFLUOROTEREPHTHALONITRILE
CAS:1835-49-0
CM308590
FC1=C(F)C(C#N)=C(F)C(F)=C1C#N
2,3,5,6-TETRAHYDROXYCYCLOHEXA-2,5-DIENE-1,4-DIONE
CAS:319-89-1
CM203111
O=C1C(O)=C(O)C(C(O)=C1O)=O
2,3,5,6-TETRAHYDROXYPIPERAZINE-1,4-DICARBALDEHYDE
CAS:1534-22-1
CM170056
O=CN1C(O)C(O)N(C=O)C(O)C1O
2,3,5,6-TETRAMETHYLPYRAZINE
CAS:1124-11-4
CM120368
CC1=C(C)N=C(C)C(C)=N1
2,3,5-TRI-O-BENZYL-D-RIBONO-1,4-LACTONE
CAS:55094-52-5
CM100830
O=C1O[C@H](COCC2=CC=CC=C2)[C@@H](OCC2=CC=CC=C2)[C@
2,3,5-TRIBROMO-6-METHYLPYRIDINE
CAS:3430-15-7
CM173636
CC1=C(Br)C=C(Br)C(Br)=N1
2,3,5-TRIBROMOPYRAZINE
CAS:32314-09-3
CM129215
BrC1=CN=C(Br)C(Br)=N1
2,3,5-TRIBROMOPYRIDINE
CAS:75806-85-8
CM173659
BrC1=CN=C(Br)C(Br)=C1
2,3,5-TRICHLORO-4-IODOPYRIDINE
CAS:406676-23-1
CM276630
IC1=C(Cl)C(Cl)=NC=C1Cl
2,3,5-TRICHLORO-6-METHYLPYRIDINE
CAS:22109-56-4
CM170453
CC1=C(Cl)C=C(Cl)C(Cl)=N1
2,3,5-TRICHLOROBENZALDEHYDE
CAS:56961-75-2
CM253712
ClC1=CC(C=O)=C(Cl)C(Cl)=C1
2,3,5-TRICHLOROISONICOTINALDEHYDE
CAS:251997-31-6
CM105396
O=CC1=C(Cl)C=NC(Cl)=C1Cl
2,3,5-TRICHLOROISONICOTINONITRILE
CAS:1221791-83-8
CM176947
N#CC1=C(Cl)C=NC(Cl)=C1Cl
2,3,5-TRICHLOROPHENOL
CAS:933-78-8
CM255862
OC1=CC(Cl)=CC(Cl)=C1Cl
2,3,5-TRICHLOROPHENYLBORONIC ACID
CAS:212779-19-6
CM135264
OB(C1=CC(Cl)=CC(Cl)=C1Cl)O
2,3,5-TRICHLOROPYRAZINE
CAS:873-40-5
CM128402
ClC1=NC(Cl)=C(Cl)N=C1
2,3,5-TRICHLOROPYRIDIN-4-OL
CAS:1970-40-7
CM175764
OC1=C(Cl)C(Cl)=NC=C1Cl
2,3,5-TRICHLOROQUINOXALINE
CAS:2958-86-3
CM222025
ClC1=C2N=C(Cl)C(Cl)=NC2=CC=C1
2,3,5-TRIFLUORO-4-IODOPYRIDINE
CAS:1057393-65-3
CM173716
FC1=CN=C(F)C(F)=C1I
2,3,5-TRIFLUOROBENZENESULPHONYL CHLORIDE
CAS:914636-99-0
CM302622
O=S(C1=CC(F)=CC(F)=C1F)(Cl)=O
2,3,5-TRIFLUOROBENZYLAMINE
CAS:244022-72-8
CM117790
NCC1=CC(F)=CC(F)=C1F
2,3,5-TRIFLUOROISONICOTINALDEHYDE
CAS:266312-20-3
CM178937
O=CC1=C(F)C(F)=NC=C1F
2,3,5-TRIFLUOROPHENYLBORONIC ACID
CAS:247564-73-4
CM135286
OB(O)C1=C(F)C(F)=CC(F)=C1
2,3,5-TRIFLUOROPYRIDINE
CAS:76469-41-5
CM326190
FC1=CN=C(F)C(F)=C1
2,3,5-TRIIODO PHENYLAZIDE
CAS:1313738-68-9
CM106465
IC1=CC(I)=C(I)C(N=[N+]=[N-])=C1
2,3,5-TRIMETHOXYBENZOIC ACID
CAS:36873-96-8
CM133506
O=C(O)C1=CC(OC)=CC(OC)=C1OC
2,3,5-TRIMETHYL-1H-INDOLE
CAS:21296-92-4
CM133210
CC1=CC2=C(NC(C)=C2C)C=C1
2,3,5-TRIMETHYL-2H-PYRAZOLO[4,3-D]PYRIMIDIN-7-AMINE
CAS:1394021-57-8
CM287517
NC1=NC(C)=NC2=C(C)N(C)N=C21
2,3,5-TRIMETHYLPHENOL
CAS:697-82-5
CM116950
OC1=CC(C)=CC(C)=C1C
2,3,5-TRIMETHYLPYRIDINE
CAS:695-98-7
CM121004
CC1=CN=C(C)C(C)=C1
2,3,5-TRIMETHYLQUINOXALINE
CAS:17635-19-7
CM221605
CC1=C2N=C(C)C(C)=NC2=CC=C1
2,3,6,7,10,11-HEXAMETHOXYTRIPHENYLENE
CAS:808-57-1
CM255120
COC1=C(OC)C=C2C3=CC(OC)=C(OC)C=C3C4=CC(OC)=C(OC)C=
2,3,6,7,8,9-HEXAHYDRO-1H-BENZO[G]INDOLE
CAS:172078-31-8
CM230682
C12=C(NCC2)C(CCCC3)=C3C=C1
2,3,6,7,8,9-HEXAHYDRO-1H-CYCLOPENTA[A]NAPHTHALEN-1-ONE
CAS:19346-17-9
CM240080
O=C1CCC2=CC=C3CCCCC3=C21
2,3,6,7-TETRAHYDRO-1H,5H-PYRIDO-[3,2,1-IJ]QUINOLINE-9-CARBALDEHYDE
CAS:33985-71-6
CM144717
O=CC1=CC2=C(N3CCC2)C(CCC3)=C1
2,3,6,7-TETRAHYDRO-1H,5H-PYRIDO[3,2,1-IJ]QUINOLINE HYDROBROMIDE
CAS:83646-41-7
CM145585
[H]Br.N1(CCC2)CCCC3=CC=CC2=C31
2,3,6,7-TETRAHYDRO-1H-PYRIDO[2,1-A]ISOQUINOLINE-4(11BH)-THIONE
CAS:115757-45-4
CM245122
S=C1CCCC2N1CCC3=C2C=CC=C3
2,3,6,7-TETRAHYDROAZEPINO[3,2,1-HI]INDOLE-1,4-DIONE
CAS:73356-94-2
CM241484
O=C1CN2C3=C1C=CC=C3CCCC2=O
2,3,6,7-TETRAHYDROBENZO[1,2-B:4,5-B']DIFURAN
CAS:81926-24-1
CM255151
C1(OCCC1=C2)=CC3=C2OCC3
2,3,6,7-TETRAMETHOXY-1-NAPHTHALDEHYDE
CAS:33033-34-0
CM260530
O=CC1=C2C=C(OC)C(OC)=CC2=CC(OC)=C1OC
2,3,6,7-TETRAMETHYLNAPHTHALENE-1,4-DICARBOXAMIDE
CAS:408539-51-5
CM260050
O=C(C1=C2C=C(C)C(C)=CC2=C(C(N)=O)C(C)=C1C)N
2,3,6,7-TETRAMETHYLNAPHTHALENE-1,4-DICARBOXYLIC ACID
CAS:925890-17-1
CM260215
O=C(C1=C2C=C(C)C(C)=CC2=C(C(O)=O)C(C)=C1C)O
2,3,6,7-TETRAMETHYLQUINOXALINE
CAS:6957-19-3
CM142002
CC1=C(C)C=C2N=C(C)C(C)=NC2=C1
2,3,6-TRICHLORO-4-(TRIFLUOROMETHYL)ANILINE
CAS:86399-04-4
CM304383
NC1=C(Cl)C=C(C(F)(F)F)C(Cl)=C1Cl
2,3,6-TRICHLORO-4-(TRIFLUOROMETHYL)PYRIDINE
CAS:81565-20-0
CM173846
FC(C1=C(Cl)C(Cl)=NC(Cl)=C1)(F)F
2,3,6-TRICHLORO-5-NITROPYRIDINE
CAS:55304-72-8
CM171931
O=[N+](C1=C(Cl)N=C(Cl)C(Cl)=C1)[O-]
2,3,6-TRICHLORO-8-METHYLQUINOLINE
CAS:1447961-72-9
CM257304
CC1=C2N=C(Cl)C(Cl)=CC2=CC(Cl)=C1
2,3,6-TRICHLOROANILINE
CAS:88963-39-7
CM255597
NC1=C(Cl)C=CC(Cl)=C1Cl
2,3,6-TRICHLOROBENZALDEHYDE
CAS:4659-47-6
CM308296
O=CC1=C(Cl)C=CC(Cl)=C1Cl
2,3,6-TRICHLORONAPHTHALENE
CAS:55720-40-6
CM233220
ClC1=CC2=CC(Cl)=C(Cl)C=C2C=C1
2,3,6-TRICHLOROPYRIDINE
CAS:29154-14-1
CM329133
ClC1=CC=C(Cl)C(Cl)=N1
2,3,6-TRICHLOROPYRIDINE
CAS:6515-09-9
CM120834
ClC1=CC=C(Cl)C(Cl)=N1
2,3,6-TRICHLOROQUINOXALINE
CAS:2958-87-4
CM141942
ClC1=CC=C2N=C(Cl)C(Cl)=NC2=C1
2,3,6-TRIFLUORO-4-(TRIFLUOROMETHYL)PYRIDINE
CAS:84940-46-5
CM329263
FC(C1=C(F)C(F)=NC(F)=C1)(F)F
2,3,6-TRIFLUOROBENZOIC ACID
CAS:2358-29-4
CM157065
O=C(O)C1=C(F)C=CC(F)=C1F
2,3,6-TRIFLUOROPHENYLBORONIC ACID
CAS:247564-71-2
CM135283
OB(O)C1=C(F)C(F)=CC=C1F
2,3,6-TRIFLUOROPYRIDINE
CAS:3512-18-3
CM107831
FC1=CC=C(F)C(F)=N1
2,3,6-TRIMETHOXYPHENYLBORONIC ACID
CAS:380430-67-1
CM136875
COC1=C(B(O)O)C(OC)=C(OC)C=C1
2,3,6-TRIMETHOXYPYRIDINE
CAS:1364917-21-4
CM325587
COC1=CC=C(OC)C(OC)=N1
2,3,6-TRIMETHOXYPYRIDINE-4-CARBALDEHYDE
CAS:1364917-16-7
CM327060
O=CC1=C(OC)C(OC)=NC(OC)=C1
2,3,6-TRIMETHYL-1H-INDOL-5-AMINE
CAS:165614-76-6
CM333785
NC1=CC2=C(NC(C)=C2C)C=C1C
2,3,6-TRIMETHYL-1H-INDOLE
CAS:22072-35-1
CM363773
CC1=C(C)C2=C(N1)C=C(C)C=C2
2,3,6-TRIMETHYL-5-NITRO-1H-INDOLE
CAS:289685-81-0
CM363769
CC1=C(C)C2=C(N1)C=C(C)C(=C2)[N+]([O-])=O
2,3,6-TRIMETHYLIMIDAZO[2,1-B]THIAZOLE-5-CARBOXYLIC ACID
CAS:1007875-80-0
CM330550
CC(S1)=C(C)N2C1=NC(C)=C2C(O)=O
2,3,6-TRIMETHYLPHENOL
CAS:2416-94-6
CM304834
OC1=C(C)C=CC(C)=C1C
2,3,6-TRIMETHYLQUINOLIN-4-OL
CAS:1447-42-3
CM229777
OC1=C(C)C(C)=NC2=CC=C(C)C=C12
2,3,6-TRIMETHYLQUINOLINE-4-CARBOTHIOAMIDE
CAS:62077-99-0
CM246615
S=C(C1=C(C)C(C)=NC2=CC=C(C)C=C12)N
2,3,6-TRIMETHYLQUINOLINE-4-CARBOXYLIC ACID DIHYDRATE
CAS:1609400-19-2
CM257808
O=C(C1=C(C)C(C)=NC2=CC=C(C)C=C12)O.[H]O[H].[H]O[H]
2,3,6-TRIMETHYLQUINOXALIN-5-AMINE
CAS:205502-10-9
CM221622
NC1=C2N=C(C)C(C)=NC2=CC=C1C
2,3,6-TRIMETHYLQUINOXALINE
CAS:17635-21-1
CM141958
CC1=CC=C2N=C(C)C(C)=NC2=C1
2,3,7,8-TETRAHYDROXYCHROMENO[5,4,3-CDE]CHROMENE-5,10-DIONE HYDRATE
CAS:314041-08-2
CM162736
O=C1OC2=C(C3=C1C=C(O)C(O)=C3OC4=O)C4=CC(O)=C2O.[H]
2,3,7,9-TETRAMETHYLBENZO[B][1,8]NAPHTHYRIDIN-5-AMINE
CAS:510710-87-9
CM236474
NC1=C2C=C(C)C(C)=NC2=NC3=C(C)C=C(C)C=C31
2,3,7-TRIMETHYL-1H-INDOLE
CAS:27505-78-8
CM149138
CC1=CC=CC2=C1NC(C)=C2C
2,3,7-TRIMETHYLINDOLINE
CAS:41652-83-9
CM232219
CC1=CC=CC2=C1NC(C)C2C
2,3,8,9-TETRAHYDRONAPHTHO[2,3-B][1,4]DIOXINE-6-CARBONITRILE
CAS:942631-85-8
CM235784
N#CC1=CCCC2=C1C=C3C(OCCO3)=C2
2,3,8-TRICHLOROQUINOLINE
CAS:1708251-07-3
CM246848
ClC1=C2N=C(Cl)C(Cl)=CC2=CC=C1
2,3,8-TRIHYDROXY-1-NAPHTHIMIDIC ACID
CAS:136843-47-5
CM245261
OC1=C2C(C(O)=N)=C(O)C(O)=CC2=CC=C1
2,3,8-TRIMETHYLQUINOLIN-4(1H)-ONE
CAS:1203-47-0
CM240156
O=C1C(C)=C(C)NC2=C1C=CC=C2C
2,3,9,10-TETRAMETHOXYISOINDOLO[2,1-B]ISOQUINOLIN-5(7H)-ONE
CAS:84245-30-7
CM226134
O=C1N(CC2=C3C=C(OC)C(OC)=C2)C3=CC4=C1C=C(OC)C(OC)=
2,3-BIS((S)-TERT-BUTYL(METHYL)PHOSPHANYL)QUINOXALINE
CAS:1107608-80-9
CM222050
C[P@](C1=NC2=CC=CC=C2N=C1[P@](C(C)(C)C)C)C(C)(C)C
2,3-BIS(2-ETHOXYETHOXY)QUINOXALINE-5,8-DIYL DIACETATE
CAS:2452-34-8
CM222292
CCOCCOC1=NC2=C(OC(C)=O)C=CC(OC(C)=O)=C2N=C1OCCOCC
2,3-BIS(4-CHLORO-3-NITROPHENYL)QUINOXALINE
CAS:130711-05-6
CM221210
O=[N+](C1=CC(C2=NC3=CC=CC=C3N=C2C4=CC=C(Cl)C([N+](
2,3-BIS(4-METHOXYPHENYL)PROPANENITRILE
CAS:72035-46-2
CM254737
N#CC(C1=CC=C(OC)C=C1)CC2=CC=C(OC)C=C2
2,3-BIS(BROMOMETHYL)BENZO[G]QUINOXALINE
CAS:95379-91-2
CM222346
BrCC1=NC2=CC3=CC=CC=C3C=C2N=C1CBr
2,3-BIS(BROMOMETHYL)QUINOXALINE
CAS:3138-86-1
CM141805
BrCC1=NC2=CC=CC=C2N=C1CBr
2,3-BIS(BROMOMETHYL)THIOPHENE
CAS:13250-86-7
CM363653
BrCC1=C(CBr)C=CS1
2,3-BIS(CHLOROMETHYL)NAPHTHALENE
CAS:2744-60-7
CM233317
ClCC1=C(CCl)C=C2C=CC=CC2=C1
2,3-BIS(CHLOROMETHYL)NAPHTHALENE-1,4-DIONE
CAS:31581-11-0
CM258285
O=C1C(CCl)=C(CCl)C(C2=C1C=CC=C2)=O
2,3-BIS(CHLOROMETHYL)PYRIDINE
CAS:45754-12-9
CM175465
ClCC1=CC=CN=C1CCl
2,3-BIS(CHLOROMETHYL)PYRIDINE HYDROCHLORIDE
CAS:27221-49-4
CM278636
ClCC1=CC=CN=C1CCl.[H]Cl
2,3-BIS(DIFLUOROMETHOXY)NAPHTHALENE
CAS:1261453-40-0
CM234786
FC(F)OC1=C(OC(F)F)C=C2C=CC=CC2=C1
2,3-BIS(DIFLUOROMETHYL)NAPHTHALENE
CAS:220926-26-1
CM234408
FC(C1=C(C(F)F)C=C2C=CC=CC2=C1)F
2,3-BIS(ISOPROPYLTHIO)QUINOLIN-7-AMINE
CAS:118210-51-8
CM224348
NC1=CC=C2C=C(SC(C)C)C(SC(C)C)=NC2=C1
2,3-BIS(TRIFLUOROMETHOXY)NAPHTHALENE
CAS:1261658-42-7
CM234688
FC(F)(F)OC1=C(OC(F)(F)F)C=C2C=CC=CC2=C1
2,3-BIS(TRIFLUOROMETHYL)-PYRAZINE
CAS:1186195-14-1
CM334522
FC(C1=NC=CN=C1C(F)(F)F)(F)F
2,3-DI(1H-PYRROL-2-YL)QUINOXALIN-5-AMINE
CAS:500190-97-6
CM222195
NC1=C2N=C(C3=CC=CN3)C(C4=CC=CN4)=NC2=CC=C1
2,3-DI(PYRIDIN-2-YL)PYRAZINE
CAS:25005-96-3
CM334523
C1(C2=NC=CC=C2)=NC=CN=C1C3=NC=CC=C3
2,3-DI(THIAZOL-2-YL)QUINOXALIN-6-AMINE
CAS:832080-78-1
CM222232
NC1=CC=C2N=C(C3=NC=CS3)C(C4=NC=CS4)=NC2=C1
2,3-DIACETYLOXYPROPYL ACETATE
CAS:102-76-1
CM328781
CC(OCC(OC(C)=O)COC(C)=O)=O
2,3-DIAMINO-3H-PURIN-6(7H)-ONE
CAS:556070-77-0
CM238898
O=C1N=C(N)N(N)C2=C1NC=N2
2,3-DIAMINO-4,6-DICHLOROPYRIDINE
CAS:24484-99-9
CM118940
ClC1=CC(Cl)=C(N)C(N)=N1
2,3-DIAMINO-5-BROMO-6-PICOLINE
CAS:59352-90-8
CM178176
NC1=NC(C)=C(Br)C=C1N
2,3-DIAMINO-5-CHLOROPYRIDINE
CAS:25710-20-7
CM171475
NC1=CC(Cl)=CN=C1N
2,3-DIAMINO-5-METHYLPYRIDINE
CAS:24638-29-7
CM118921
CC1=CN=C(N)C(N)=C1
2,3-DIAMINO-5-TRIFLUOROMETHYLPYRIDINE
CAS:107867-51-6
CM174772
NC1=CC(=CN=C1N)C(F)(F)F
2,3-DIAMINO-6-CHLOROBENZONITRILE
CAS:548457-80-3
CM118658
N#CC1=C(Cl)C=CC(N)=C1N
2,3-DIAMINOBENZAMIDE
CAS:711007-44-2
CM108491
O=C(N)C1=CC=CC(N)=C1N
2,3-DIAMINOBENZOIC ACID METHYL ESTER
CAS:107582-20-7
CM162120
COC(C1=C(C(=CC=C1)N)N)=O
2,3-DIAMINOBENZONITRILE
CAS:73629-43-3
CM153691
N#CC1=CC=CC(N)=C1N
2,3-DIAMINOBUTANOIC ACID
CAS:2643-66-5
CM122611
CC(N)C(N)C(O)=O
2,3-DIAMINOPHENOL
CAS:59649-56-8
CM253895
OC1=CC=CC(N)=C1N
2,3-DIAMINOPROPANOIC ACID HYDROCHLORIDE
CAS:54897-59-5
CM112314
O=C(O)C(N)CN.[H]Cl
2,3-DIAMINOPYRAZINE
CAS:13134-31-1
CM120381
NC1=NC=CN=C1N
2,3-DIAMINOPYRIDINE
CAS:452-58-4
CM102616
NC1=CC=CN=C1N
2,3-DIAMINOQUINAZOLIN-4(3H)-ONE
CAS:73095-46-2
CM216531
O=C1N(N)C(N)=NC2=C1C=CC=C2
2,3-DIAMINOSUCCINIC ACID
CAS:921-52-8
CM303065
NC(C(N)C(O)=O)C(O)=O
2,3-DIAMINOTOLUENE
CAS:2687-25-4
CM118176
CC1=CC=CC(N)=C1N
2,3-DIBROMO-1,4-DIFLUOROBENZENE
CAS:179737-33-8
CM250443
FC1=CC=C(F)C(Br)=C1Br
2,3-DIBROMO-1,4-DIMETHOXYBENZENE
CAS:5030-61-5
CM253240
COC1=CC=C(OC)C(Br)=C1Br
2,3-DIBROMO-1,8-NAPHTHYRIDINE
CAS:52626-31-0
CM230202
BrC1=CC2=CC=CN=C2N=C1Br
2,3-DIBROMO-3-PHENYL-1-PROPANOL
CAS:36808-12-5
CM101742
OCC(Br)C(Br)C1=CC=CC=C1
2,3-DIBROMO-4-METHYLPYRIDINE
CAS:871483-22-6
CM128389
CC1=C(Br)C(Br)=NC=C1
2,3-DIBROMO-4-OXO-BUT-2-ENOIC ACID
CAS:90994-06-2
CM329688
O=C(O)/C(Br)=C(Br)/C=O
2,3-DIBROMO-5,6,7,8-TETRAHYDROIMIDAZO[1,2-A]PYRIDINE
CAS:156817-73-1
CM125957
BrC1=C(Br)N=C2CCCCN21
2,3-DIBROMO-5,6-DIMETHOXYPYRIDINE
CAS:106331-71-9
CM362427
COC1=C(OC)N=C(Br)C(Br)=C1
2,3-DIBROMO-5-CHLOROPYRIDINE
CAS:137628-17-2
CM102644
ClC1=CN=C(Br)C(Br)=C1
2,3-DIBROMO-5-FLUOROCHLOROBENZENE
CAS:1000577-62-7
CM295629
FC1=CC(Br)=C(Br)C(Cl)=C1
2,3-DIBROMO-5-FLUOROPYRIDINE
CAS:878207-82-0
CM102749
FC1=CN=C(Br)C(Br)=C1
2,3-DIBROMO-5-NITROPYRIDINE
CAS:15862-36-9
CM120813
O=[N+](C1=CN=C(Br)C(Br)=C1)[O-]
2,3-DIBROMO-6-(BROMOMETHYL)NAPHTHALENE
CAS:132112-62-0
CM230244
BrCC1=CC2=CC(Br)=C(Br)C=C2C=C1
2,3-DIBROMO-6-(TRIFLUOROMETHYL)PYRIDINE
CAS:1159512-35-2
CM130240
FC(C1=CC=C(Br)C(Br)=N1)(F)F
2,3-DIBROMO-6-CHLOROPYRIDINE
CAS:885952-16-9
CM120866
ClC1=CC=C(Br)C(Br)=N1
2,3-DIBROMO-6-METHOXY-1H-PYRROLO[2,3-B]PYRIDINE
CAS:2055841-29-5
CM333160
COC1=NC2=C(C=C1)C(Br)=C(Br)N2
2,3-DIBROMO-6-METHOXYPYRIDINE
CAS:909720-21-4
CM121059
COC1=CC=C(Br)C(Br)=N1
2,3-DIBROMO-6-PICOLINE
CAS:261373-04-0
CM178219
CC1=CC=C(Br)C(Br)=N1
2,3-DIBROMOBENZALDEHYDE
CAS:61563-26-6
CM254049
O=CC1=CC=CC(Br)=C1Br
2,3-DIBROMOBENZOFURAN
CAS:64150-61-4
CM161232
BrC1=C(Br)OC2=CC=CC=C12
2,3-DIBROMOBENZOIC ACID
CAS:603-78-1
CM158561
O=C(O)C1=CC=CC(Br)=C1Br
2,3-DIBROMONAPHTHALENE
CAS:13214-70-5
CM105199
BrC1=CC2=CC=CC=C2C=C1Br
2,3-DIBROMONAPHTHALENE-1,4-DIONE
CAS:13243-65-7
CM264059
O=C1C(Br)=C(Br)C(C2=C1C=CC=C2)=O
2,3-DIBROMOPYRAZINE
CAS:95538-03-7
CM168312
BrC1=NC=CN=C1Br
2,3-DIBROMOPYRIDINE-4-CARBOXYLIC ACID
CAS:1020056-98-7
CM175533
O=C(O)C1=CC=NC(Br)=C1Br
2,3-DIBROMOQUINOLINE
CAS:13721-00-1
CM145710
BrC2=NC1=CC=CC=C1C=C2Br
2,3-DIBROMOTHIOPHENE
CAS:3140-93-0
CM121714
BrC1=C(Br)SC=C1
2,3-DICHLORO-1-FLUORO-4-METHOXYBENZENE
CAS:1378832-35-9
CM244040
COC1=CC=C(F)C(Cl)=C1Cl
2,3-DICHLORO-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PYRIDINE
CAS:1073353-78-2
CM137511
CC1(C)OB(OC1(C)C)C1=C(Cl)C(Cl)=NC=C1
2,3-DICHLORO-4-FLUOROANILINE
CAS:36556-52-2
CM109404
NC1=CC=C(F)C(Cl)=C1Cl
2,3-DICHLORO-4-FLUOROBENZOIC ACID
CAS:154257-76-8
CM160301
ClC1=C(C(=O)O)C=CC(=C1Cl)F
2,3-DICHLORO-4-FLUORONITROBENZENE
CAS:36556-51-1
CM252519
FC1=CC=C([N+]([O-])=O)C(Cl)=C1Cl
2,3-DICHLORO-4-FLUOROPHENOL
CAS:934180-45-7
CM244104
OC1=CC=C(F)C(Cl)=C1Cl
2,3-DICHLORO-4-HYDROXYBENZALDEHYDE
CAS:16861-22-6
CM133632
OC1=C(Cl)C(Cl)=C(C=O)C=C1
2,3-DICHLORO-4-IODOPYRIDINE
CAS:889865-45-6
CM121022
IC1=C(Cl)C(Cl)=NC=C1
2,3-DICHLORO-4-METHYLPYRIDINE
CAS:191419-07-5
CM102562
CC1=C(Cl)C(Cl)=NC=C1
2,3-DICHLORO-4-PYRIDINEBORONIC ACID
CAS:951677-39-7
CM137052
OB(O)C1=C(Cl)C(Cl)=NC=C1
2,3-DICHLORO-5,6,7,8-TETRAHYDROQUINOLINE
CAS:1707371-92-3
CM241555
ClC1=CC2=C(N=C1Cl)CCCC2
2,3-DICHLORO-5,6,7,8-TETRAHYDROQUINOXALINE
CAS:1135213-57-8
CM332613
ClC(N=C(CCCC1)C1=N2)=C2Cl
2,3-DICHLORO-5,6-DIETHYLPYRAZINE
CAS:1461705-47-4
CM332617
ClC1=NC(CC)=C(CC)N=C1Cl
2,3-DICHLORO-5,6-DIMETHYLPYRAZINE
CAS:32493-79-1
CM168195
CC1=NC(Cl)=C(Cl)N=C1C
2,3-DICHLORO-5,6-DIPHENYLPYRAZINE
CAS:57038-62-7
CM362731
ClC1=C(Cl)N=C(C2=CC=CC=C2)C(=N1)C1=CC=CC=C1
2,3-DICHLORO-5-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PYRIDINE
CAS:741709-64-8
CM123780
CC1(C)C(C)(C)OB(C2=CN=C(Cl)C(Cl)=C2)O1
2,3-DICHLORO-5-(METHYLSULFANYL)PYRAZINE
CAS:1174517-48-6
CM105905
CSC1=CN=C(Cl)C(Cl)=N1
2,3-DICHLORO-5-(TRIFLUOROMETHYL)PYRAZINE
CAS:1238230-17-5
CM332615
FC(C1=CN=C(Cl)C(Cl)=N1)(F)F
2,3-DICHLORO-5-(TRIFLUOROMETHYL)PYRIDINE
CAS:69045-84-7
CM103367
FC(C1=CN=C(Cl)C(Cl)=C1)(F)F
2,3-DICHLORO-5-FLUOROPYRIDINE
CAS:185985-40-4
CM173576
FC1=CN=C(Cl)C(Cl)=C1
2,3-DICHLORO-5-HYDROXYPYRIDINE
CAS:110860-92-9
CM117041
OC1=CN=C(Cl)C(Cl)=C1
2,3-DICHLORO-5-IODOPYRAZINE
CAS:1816294-11-7
CM334524
IC1=CN=C(Cl)C(Cl)=N1
2,3-DICHLORO-5-METHOXYQUINOXALINE
CAS:101870-68-2
CM221137
COC1=C2N=C(Cl)C(Cl)=NC2=CC=C1
2,3-DICHLORO-5-METHYLPYRIDINE
CAS:59782-90-0
CM175935
CC1=CN=C(Cl)C(Cl)=C1
2,3-DICHLORO-5-NITROBENZOIC ACID
CAS:13300-61-3
CM317189
O=C(O)C1=CC([N+]([O-])=O)=CC(Cl)=C1Cl
2,3-DICHLORO-5-NITROPYRIDINE
CAS:22353-40-8
CM120730
O=[N+](C1=CN=C(Cl)C(Cl)=C1)[O-]
2,3-DICHLORO-6,7-DIMETHOXYQUINOLINE
CAS:1710846-06-2
CM227426
COC1=C(OC)C=C2C=C(Cl)C(Cl)=NC2=C1
2,3-DICHLORO-6,7-DIMETHYLQUINOXALINE
CAS:63810-80-0
CM111054
CC1=C(C)C=C2N=C(Cl)C(Cl)=NC2=C1
2,3-DICHLORO-6,8-DIMETHYLQUINOLINE
CAS:1447949-09-8
CM246129
CC1=C2N=C(Cl)C(Cl)=CC2=CC(C)=C1
2,3-DICHLORO-6-(TRIFLUOROMETHYL)BENZALDEHYDE
CAS:186517-27-1
CM244426
O=CC1=C(C(F)(F)F)C=CC(Cl)=C1Cl
2,3-DICHLORO-6-(TRIFLUOROMETHYL)PYRIDINE
CAS:89719-90-4
CM176686
FC(F)(F)C1=CC=C(Cl)C(Cl)=N1
2,3-DICHLORO-6-(TRIFLUOROMETHYL)QUINOLINE
CAS:1447961-68-3
CM259422
FC(C1=CC=C2N=C(Cl)C(Cl)=CC2=C1)(F)F
2,3-DICHLORO-6-(TRIFLUOROMETHYL)QUINOXALINE
CAS:55686-95-8
CM125665
FC(C1=CC=C2N=C(Cl)C(Cl)=NC2=C1)(F)F
2,3-DICHLORO-6-FLUOROQUINOLINE
CAS:1447949-04-3
CM244759
FC1=CC=C2N=C(Cl)C(Cl)=CC2=C1
2,3-DICHLORO-6-FLUOROQUINOXALINE
CAS:76089-04-8
CM142050
FC1=CC=C2N=C(Cl)C(Cl)=NC2=C1
2,3-DICHLORO-6-IODOQUINOLINE
CAS:1447959-18-3
CM264644
IC1=CC=C2N=C(Cl)C(Cl)=CC2=C1
2,3-DICHLORO-6-ISOPROPYL-5,6,7,8-TETRAHYDRO-1,6-NAPHTHYRIDINE
CAS:1708401-30-2
CM231463
CC(N1CC2=C(N=C(Cl)C(Cl)=C2)CC1)C
2,3-DICHLORO-6-METHOXYPYRIDINE
CAS:83732-68-7
CM128988
COC1=CC=C(Cl)C(Cl)=N1
2,3-DICHLORO-6-METHOXYQUINOXALINE
CAS:39267-04-4
CM141943
COC1=CC2=C(C=C1)N=C(Cl)C(Cl)=N2
2,3-DICHLORO-6-METHYL-5,6,7,8-TETRAHYDRO-1,6-NAPHTHYRIDINE
CAS:1707727-91-0
CM233732
CN1CC2=C(N=C(Cl)C(Cl)=C2)CC1
2,3-DICHLORO-6-METHYL-5-(TRIFLUOROMETHYL)ANILINE
CAS:1287218-11-4
CM278594
NC1=C(C)C(C(F)(F)F)=CC(Cl)=C1Cl
2,3-DICHLORO-6-NITROANILINE
CAS:65078-77-5
CM118634
NC1=C([N+]([O-])=O)C=CC(Cl)=C1Cl
2,3-DICHLORO-6-NITROBENZALDEHYDE
CAS:75618-41-6
CM329241
O=CC1=C([N+]([O-])=O)C=CC(Cl)=C1Cl
2,3-DICHLORO-6-PHENYLQUINOXALINE
CAS:1420794-75-7
CM221992
ClC1=NC2=CC(C3=CC=CC=C3)=CC=C2N=C1Cl
2,3-DICHLORO-N,N-DIMETHYLQUINOXALINE-6-SULFONAMIDE
CAS:2347-47-9
CM222269
O=S(C1=CC=C2N=C(Cl)C(Cl)=NC2=C1)(N(C)C)=O
2,3-DICHLORO-N-(2,2,2-TRIFLUOROETHYL)QUINOXALINE-6-CARBOXAMIDE
CAS:138452-91-2
CM222254
O=C(C1=CC=C2N=C(Cl)C(Cl)=NC2=C1)NCC(F)(F)F
2,3-DICHLORO-N-METHYLANILINE HYDROCHLORIDE
CAS:1187386-16-8
CM182729
CNC1=CC=CC(Cl)=C1Cl.[H]Cl
2,3-DICHLORO-N-PHENYLQUINOXALINE-6-CARBOXAMIDE
CAS:90332-46-0
CM222255
O=C(C1=CC=C2N=C(Cl)C(Cl)=NC2=C1)NC3=CC=CC=C3
2,3-DICHLOROANILINE
CAS:608-27-5
CM329528
NC1=CC=CC(Cl)=C1Cl
2,3-DICHLOROBENZENETHIOL
CAS:17231-95-7
CM328333
SC1=CC=CC(Cl)=C1Cl
2,3-DICHLOROBENZIMIDAMIDE HYDROCHLORIDE
CAS:55154-87-5
CM123062
N=C(N)C1=CC=CC(Cl)=C1Cl.[H]Cl
2,3-DICHLOROBENZOHYDRAZIDE
CAS:438197-19-4
CM114305
O=C(NN)C1=CC=CC(Cl)=C1Cl
2,3-DICHLOROBENZOIC ACID
CAS:50-45-3
CM100907
O=C(O)C1=CC=CC(Cl)=C1Cl
2,3-DICHLOROBENZONITRILE
CAS:6574-97-6
CM157969
C1=CC=C(C(=C1C#N)Cl)Cl
2,3-DICHLOROBENZOTRIFLUORIDE
CAS:54773-19-2
CM157859
FC(F)(F)C1=CC=CC(Cl)=C1Cl
2,3-DICHLOROBENZOYL CYANIDE
CAS:77668-42-9
CM162000
O=C(C#N)C1=CC=CC(Cl)=C1Cl
2,3-DICHLOROBENZYL ALCOHOL
CAS:38594-42-2
CM183673
OCC1=CC=CC(Cl)=C1Cl
2,3-DICHLOROFURO[3,4-B]PYRAZINE-5,7-DIONE
CAS:144692-85-3
CM249475
O=C1OC(C2=NC(Cl)=C(Cl)N=C21)=O
2,3-DICHLOROISONICOTINALDEHYDE
CAS:884495-41-4
CM178793
O=CC1=CC=NC(Cl)=C1Cl
2,3-DICHLOROISONICOTINIC ACID
CAS:184416-84-0
CM178029
O=C(O)C1=CC=NC(Cl)=C1Cl
2,3-DICHLOROPHENYLBORONIC ACID
CAS:151169-74-3
CM135573
OB(C1=CC=CC(Cl)=C1Cl)O
2,3-DICHLOROPYRAZINE
CAS:4858-85-9
CM104282
ClC1=C(Cl)N=CC=N1
2,3-DICHLOROPYRIDIN-4-AMINE
CAS:184416-83-9
CM127951
NC1=C(Cl)C(Cl)=NC=C1
2,3-DICHLOROPYRIDIN-4-OL
CAS:1174047-06-3
CM102156
OC1=C(Cl)C(Cl)=NC=C1
2,3-DICHLOROPYRIDINE-5-BORONIC ACID
CAS:1072944-15-0
CM137520
OB(O)C1=CN=C(Cl)C(Cl)=C1
2,3-DICHLOROPYRIDO[2,3-B]PYRAZINE
CAS:25710-18-3
CM168187
ClC1=NC2=C(N=CC=C2)N=C1Cl
2,3-DICHLOROPYRIDO[3,4-B]PYRAZINE
CAS:35251-99-1
CM332598
ClC1=NC2=CN=CC=C2N=C1Cl
2,3-DICHLOROQUINOLIN-8-OL
CAS:37396-44-4
CM224817
OC1=C2N=C(Cl)C(Cl)=CC2=CC=C1
2,3-DICHLOROQUINOLINE
CAS:613-18-3
CM143182
ClC1=CC2=CC=CC=C2N=C1Cl
2,3-DICHLOROQUINOXALINE
CAS:2213-63-0
CM121551
ClC1=NC2=CC=CC=C2N=C1Cl
2,3-DICHLOROQUINOXALINE-5-CARBONYL CHLORIDE
CAS:1919-39-7
CM222203
O=C(Cl)C1=C2N=C(Cl)C(Cl)=NC2=CC=C1
2,3-DICHLOROTHIOPHENE-5-SULPHONYL CHLORIDE
CAS:126714-85-0
CM199914
O=S(C1=CC(Cl)=C(Cl)S1)(Cl)=O
2,3-DIETHYL-1,2,3,4-TETRAHYDRO-1,4-ETHANONAPHTHALEN-5-AMINE
CAS:683776-18-3
CM236468
NC1=C2C(CC3)C(CC)C(CC)C3C2=CC=C1
2,3-DIETHYL-5-METHYLPYRAZINE
CAS:18138-04-0
CM168093
CC1=CN=C(CC)C(CC)=N1
2,3-DIETHYL-N,5-DIMETHYLQUINOXALIN-6-AMINE
CAS:161697-01-4
CM222294
CC1=C2N=C(CC)C(CC)=NC2=CC=C1NC
2,3-DIETHYLPYRAZINE
CAS:15707-24-1
CM168543
CCC1=NC=CN=C1CC
2,3-DIETHYLQUINAZOLIN-4(3H)-ONE
CAS:59524-92-4
CM215213
O=C1N(CC)C(CC)=NC2=C1C=CC=C2
2,3-DIFLUORO-1-METHYL-4-NITROBENZENE
CAS:932373-72-3
CM255845
O=[N+](C1=CC=C(C)C(F)=C1F)[O-]
2,3-DIFLUORO-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PHENOL
CAS:1029439-85-7
CM204380
OC1=CC=C(B2OC(C)(C)C(C)(C)O2)C(F)=C1F
2,3-DIFLUORO-4-(METHOXYCARBONYL)PHENYLBORONIC ACID
CAS:1402238-29-2
CM208900
OB(C1=CC=C(C(OC)=O)C(F)=C1F)O
2,3-DIFLUORO-4-(N-HEXYLOXY)PHENYLBORONIC ACID
CAS:121219-20-3
CM137505
FC1=C(C=CC(=C1F)OCCCCCC)B(O)O
2,3-DIFLUORO-4-(TRIFLUOROMETHYL)PYRIDINE
CAS:1215034-77-7
CM336542
FC(C1=C(F)C(F)=NC=C1)(F)F
2,3-DIFLUORO-4-BENZYLOXYPHENYLBORONIC ACID
CAS:156635-87-9
CM133844
OB(O)C1=C(F)C(F)=C(OCC2=CC=CC=C2)C=C1
2,3-DIFLUORO-4-BROMONITROBENZENE
CAS:1003708-24-4
CM247259
FC1=C(C=CC(=C1F)Br)[N+](=O)[O-]
2,3-DIFLUORO-4-HYDROXYBENZALDEHYDE
CAS:676500-39-3
CM254475
O=CC1=CC=C(O)C(F)=C1F
2,3-DIFLUORO-4-HYDROXYBENZOIC ACID
CAS:175968-39-5
CM157684
OC(=O)C1=C(F)C(F)=C(O)C=C1
2,3-DIFLUORO-4-HYDROXYBENZONITRILE
CAS:126162-38-7
CM160560
FC1=C(C#N)C=CC(=C1F)O
2,3-DIFLUORO-4-HYDROXYPHENYLBORONIC ACID
CAS:1261169-72-5
CM136697
OC1=CC=C(B(O)O)C(F)=C1F
2,3-DIFLUORO-4-IODOBENZALDEHYDE
CAS:885590-99-8
CM255556
O=CC1=CC=C(I)C(F)=C1F
2,3-DIFLUORO-4-IODOPYRIDINE
CAS:851386-34-0
CM120995
IC1=C(F)C(F)=NC=C1
2,3-DIFLUORO-4-METHOXYBENZONITRILE
CAS:256417-12-6
CM157095
COC1=C(F)C(F)=C(C=C1)C#N
2,3-DIFLUORO-4-METHYLBENZOIC ACID
CAS:261763-37-5
CM153357
CC1=C(F)C(F)=C(C=C1)C(O)=O
2,3-DIFLUORO-4-METHYLBENZONITRILE
CAS:508203-48-3
CM253279
N#CC1=CC=C(C)C(F)=C1F
2,3-DIFLUORO-4-NITROANISOLE
CAS:66684-59-1
CM254424
COC1=CC=C([N+]([O-])=O)C(F)=C1F
2,3-DIFLUORO-4-NITROPHENOL
CAS:123173-60-4
CM248392
OC1=C(F)C(F)=C(C=C1)[N+]([O-])=O
2,3-DIFLUORO-4-PIPERIDINOPHENYLBORONIC ACID
CAS:1443380-15-1
CM209709
OB(C1=CC=C(N2CCCCC2)C(F)=C1F)O
2,3-DIFLUORO-5-(1-METHYL-1H-PYRAZOL-4-YL)PYRIDINE
CAS:1151801-90-9
CM247882
CN1N=CC(C2=CN=C(F)C(F)=C2)=C1
2,3-DIFLUORO-5-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)ANILINE
CAS:1701449-93-5
CM211104
NC1=CC(B2OC(C)(C)C(C)(C)O2)=CC(F)=C1F
2,3-DIFLUORO-5-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PHENOL
CAS:1220219-43-1
CM206059
OC1=CC(B2OC(C)(C)C(C)(C)O2)=CC(F)=C1F
2,3-DIFLUORO-5-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PYRIDINE
CAS:1154579-82-4
CM133786
CC1(C)C(C)(C)OB(C2=CN=C(F)C(F)=C2)O1
2,3-DIFLUORO-5-CHLOROPYRIDINE
CAS:89402-43-7
CM120653
ClC1=CN=C(F)C(F)=C1
2,3-DIFLUORO-5-HYDROXYBENZOIC ACID
CAS:749230-51-1
CM329581
O=C(O)C1=CC(O)=CC(F)=C1F
2,3-DIFLUORO-5-METHYLPHENYLBORONIC ACID
CAS:934247-79-7
CM219124
OB(C1=CC(C)=CC(F)=C1F)O
2,3-DIFLUORO-5-NITROBENZONITRILE
CAS:1247885-40-0
CM159731
N#CC1=CC([N+]([O-])=O)=CC(F)=C1F
2,3-DIFLUORO-5-NITROPHENOL
CAS:1119455-04-7
CM116881
OC1=CC([N+]([O-])=O)=CC(F)=C1F
2,3-DIFLUORO-5-NITROPYRIDINE
CAS:954219-68-2
CM121035
O=[N+](C1=CN=C(F)C(F)=C1)[O-]
2,3-DIFLUORO-6-(TRIFLUOROMETHYL)ANILINE
CAS:124185-34-8
CM315003
NC1=C(C(F)(F)F)C=CC(F)=C1F
2,3-DIFLUORO-6-(TRIFLUOROMETHYL)BENZONITRILE
CAS:186517-05-5
CM156643
N#CC1=C(C(F)(F)F)C=CC(F)=C1F
2,3-DIFLUORO-6-METHOXYANILINE
CAS:886501-51-5
CM296720
NC1=C(OC)C=CC(F)=C1F
2,3-DIFLUORO-6-METHOXYBENZALDEHYDE
CAS:187543-87-9
CM184410
O=CC1=C(OC)C=CC(F)=C1F
2,3-DIFLUORO-6-METHOXYBENZOIC ACID
CAS:773873-26-0
CM157293
COC1=CC=C(F)C(F)=C1C(O)=O
2,3-DIFLUORO-6-METHOXYBENZONITRILE
CAS:221202-34-2
CM153371
N#CC1=C(OC)C=CC(F)=C1F
2,3-DIFLUORO-6-METHOXYPHENYLBORONIC ACID
CAS:957061-21-1
CM134834
OB(C1=C(OC)C=CC(F)=C1F)O
2,3-DIFLUORO-6-METHYLBENZOIC ACID
CAS:1378671-01-2
CM249131
O=C(O)C1=C(C)C=CC(F)=C1F
2,3-DIFLUORO-6-NITRO-N-PHENYLANILINE
CAS:1393178-31-8
CM321464
O=[N+](C1=C(C(F)=C(F)C=C1)NC2=CC=CC=C2)[O-]
2,3-DIFLUORO-6-NITROANILINE
CAS:211693-73-1
CM118238
NC1=C([N+]([O-])=O)C=CC(F)=C1F
2,3-DIFLUORO-6-NITROPHENOL
CAS:82419-26-9
CM255171
OC1=C([N+]([O-])=O)C=CC(F)=C1F
2,3-DIFLUORO-6-NITROTOLUENE
CAS:914348-35-9
CM255741
CC1=C([N+]([O-])=O)C=CC(F)=C1F
2,3-DIFLUORO-L-PHENYLALANINE
CAS:266360-42-3
CM192389
O=C(O)[C@@H](N)CC1=CC=CC(F)=C1F
2,3-DIFLUORO-N-METHYL-6-NITROANILINE
CAS:170432-54-9
CM318298
O=[N+](C1=C(C(F)=C(F)C=C1)NC)[O-]
2,3-DIFLUORO-N-METHYLANILINE
CAS:470458-54-9
CM316770
CNC1=CC=CC(F)=C1F
2,3-DIFLUOROANILINE
CAS:4519-40-8
CM118209
NC1=CC=CC(F)=C1F
2,3-DIFLUOROANISOLE
CAS:134364-69-5
CM248933
C1=CC=C(C(=C1OC)F)F
2,3-DIFLUOROBENZALDEHYDE
CAS:2646-91-5
CM184705
C1=CC=C(C(=C1F)F)C=O
2,3-DIFLUOROBENZOIC ACID
CAS:4519-39-5
CM157747
O=C(O)C1=CC=CC(F)=C1F
2,3-DIFLUOROBENZOTRIFLUORIDE
CAS:64248-59-5
CM158001
FC(C1=C(F)C(F)=CC=C1)(F)F
2,3-DIFLUOROBENZOYLACETONITRILE
CAS:267880-87-5
CM154426
N#CCC(C1=CC=CC(F)=C1F)=O
2,3-DIFLUOROISONICOTINONITRILE
CAS:1210041-67-0
CM178968
N#CC1=CC=NC(F)=C1F
2,3-DIFLUORONAPHTHALENE
CAS:2993-71-7
CM234850
FC1=C(F)C=C2C=CC=CC2=C1
2,3-DIFLUORONITROBENZENE
CAS:6921-22-8
CM254554
C1=CC=C(F)C(=C1[N+]([O-])=O)F
2,3-DIFLUOROPHENYLBORONIC ACID
CAS:121219-16-7
CM135854
C1=CC=C(F)C(=C1B(O)O)F
2,3-DIFLUOROPYRAZINE
CAS:52751-15-2
CM334525
FC1=NC=CN=C1F
2,3-DIFLUOROPYRIDINE-4-CARBOXYLIC ACID
CAS:851386-31-7
CM173688
FC1=NC=CC(=C1F)C(=O)O
2,3-DIFLUOROTOLUENE
CAS:3828-49-7
CM334235
CC1=CC=CC(F)=C1F
2,3-DIHYDRO-[1,4]DIOXINO[2,3-B]PYRIDINE
CAS:129421-32-5
CM173781
C12=NC=CC=C1OCCO2
2,3-DIHYDRO-1,4-BENZODIOXIN-5-AMINE
CAS:16081-45-1
CM107214
NC1=C2OCCOC2=CC=C1
2,3-DIHYDRO-1,4-BENZODIOXIN-5-OL
CAS:10288-36-5
CM157359
C2=CC=C1OCCOC1=C2O
2,3-DIHYDRO-1,4-BENZODIOXIN-6-AMINE
CAS:22013-33-8
CM158470
NC1=CC=C2OCCOC2=C1
2,3-DIHYDRO-1,4-BENZODIOXINE-2-CARBOXYLIC ACID
CAS:3663-80-7
CM115604
O=C(C1OC2=CC=CC=C2OC1)O
2,3-DIHYDRO-1,4-BENZODIOXINE-6-CARBALDEHYDE
CAS:29668-44-8
CM160419
O=CC1=CC=C(OCCO2)C2=C1
2,3-DIHYDRO-1,4-BENZODIOXINE-6-CARBONYL CHLORIDE
CAS:6761-70-2
CM156902
O=C(Cl)C1=CC=C2OCCOC2=C1
2,3-DIHYDRO-1,4-ETHANOQUINOXALIN-5-OL
CAS:138023-42-4
CM221570
OC1=C2N(CC3)CCN3C2=CC=C1
2,3-DIHYDRO-1,4-ETHANOQUINOXALIN-6-AMINE
CAS:120287-67-4
CM221546
NC1=CC=C2N3CCN(CC3)C2=C1
2,3-DIHYDRO-1,4-ETHANOQUINOXALINE-5-CARBALDEHYDE
CAS:138023-46-8
CM221571
O=CC1=C2N(CC3)CCN3C2=CC=C1
2,3-DIHYDRO-1-BENZOFURAN-5-AMINE
CAS:42933-43-7
CM153137
NC1=CC=C2OCCC2=C1
2,3-DIHYDRO-1-BENZOFURAN-5-CARBONYL CHLORIDE
CAS:55745-71-6
CM159864
O=C(Cl)C1=CC=C(OCC2)C2=C1
2,3-DIHYDRO-1-BENZOFURAN-5-SULFONOYL CHLORIDE
CAS:115010-11-2
CM160503
O=S(C1=CC=C(OCC2)C2=C1)(Cl)=O
2,3-DIHYDRO-1-BENZOFURAN-7-CARBALDEHYDE
CAS:196799-45-8
CM156952
O=CC1=C(OCC2)C2=CC=C1
2,3-DIHYDRO-1-BENZOFURAN-7-CARBOXYLIC ACID
CAS:35700-40-4
CM158713
O=C(C1=C(OCC2)C2=CC=C1)O
2,3-DIHYDRO-1-BENZOFURAN-7-YLBORONIC ACID
CAS:685514-61-8
CM135532
OB(C1=C(OCC2)C2=CC=C1)O
2,3-DIHYDRO-1-OXO-1H-INDENE-5-CARBONITRILE
CAS:25724-79-2
CM251757
C1=C(C=C2C(=C1)C(CC2)=O)C#N
2,3-DIHYDRO-1H-1,3-METHANOCYCLOPENTA[B]QUINOXALINE
CAS:133778-59-3
CM221567
C1(C2)C3=C(C2C1)N=C4C=CC=CC4=N3
2,3-DIHYDRO-1H-BENZO[D]IMIDAZO[1,2-A]IMIDAZOLE
CAS:24134-26-7
CM160119
C12=NC3=CC=CC=C3N1CCN2
2,3-DIHYDRO-1H-BENZO[DE]ISOQUINOLIN-6-AMINE
CAS:393516-81-9
CM239982
NC1=CC=C2CNCC3=C2C1=CC=C3
2,3-DIHYDRO-1H-CYCLOPENTA[A]NAPHTHALEN-1-ONE
CAS:6342-87-6
CM123379
O=C1CCC2=CC=C3C=CC=CC3=C21
2,3-DIHYDRO-1H-CYCLOPENTA[A]NAPHTHALENE-2-CARBOXYLIC ACID
CAS:209224-98-6
CM242918
O=C(C1CC2=CC=C3C=CC=CC3=C2C1)O
2,3-DIHYDRO-1H-CYCLOPENTA[B]QUINOXALIN-5-OL
CAS:116055-54-0
CM221541
OC1=C2N=C3C(CCC3)=NC2=CC=C1
2,3-DIHYDRO-1H-CYCLOPENTA[B]QUINOXALINE
CAS:7193-24-0
CM221750
C12=NC3=CC=CC=C3N=C1CCC2
2,3-DIHYDRO-1H-CYCLOPENTA[C]QUINOLIN-4(5H)-ONE
CAS:4514-03-8
CM240011
O=C1NC2=C(C=CC=C2)C3=C1CCC3
2,3-DIHYDRO-1H-INDAZOLE
CAS:5686-94-2
CM230706
C12=C(NNC2)C=CC=C1
2,3-DIHYDRO-1H-INDEN-1-AMINE
CAS:34698-41-4
CM192999
NC1CCC2=CC=CC=C12
2,3-DIHYDRO-1H-INDEN-2-AMINE HYDROCHLORIDE
CAS:2338-18-3
CM112251
NC1CC2=C(C=CC=C2)C1.[H]Cl
2,3-DIHYDRO-1H-INDEN-4-AMINE
CAS:32202-61-2
CM183612
NC1=C2CCCC2=CC=C1
2,3-DIHYDRO-1H-INDENE-1-CARBONITRILE
CAS:26452-97-1
CM122544
N#CC1CCC2=C1C=CC=C2
2,3-DIHYDRO-1H-INDENE-2-CARBOXYLIC ACID
CAS:25177-85-9
CM251710
OC(=O)C1CC2=CC=CC=C2C1
2,3-DIHYDRO-1H-INDENE-5-SULFONAMIDE
CAS:35203-93-1
CM273223
O=S(C1=CC2=C(CCC2)C=C1)(N)=O
2,3-DIHYDRO-1H-INDOLE-2-CARBOXYLIC ACID
CAS:16851-56-2
CM328009
O=C(C1NC2=C(C=CC=C2)C1)O
2,3-DIHYDRO-1H-INDOLIZINO[6,7-B]INDOL-5(6H)-ONE
CAS:612065-16-4
CM245983
O=C1N2CCCC2=CC3=C1NC4=C3C=CC=C4
2,3-DIHYDRO-1H-ISOINDOL-1-ONE
CAS:480-91-1
CM108068
O=C1NCC2=C1C=CC=C2
2,3-DIHYDRO-1H-NAPHTHO[2,3-D]IMIDAZOLE
CAS:5649-74-1
CM230748
C12=CC3=CC=CC=C3C=C1NCN2
2,3-DIHYDRO-1H-PURIN-6(7H)-ONE
CAS:176181-61-6
CM238265
O=C1NCNC2=C1NC=N2
2,3-DIHYDRO-1H-PYRANO[3,2-F]QUINOLIN-1-ONE
CAS:5252-47-1
CM241269
O=C1CCOC2=CC=C3N=CC=CC3=C21
2,3-DIHYDRO-1H-PYRROLIZINE-7-CARBOXYLIC ACID
CAS:116515-48-1
CM332940
O=C(O)C1=C(CCC2)N2C=C1
2,3-DIHYDRO-1H-PYRROLO[2,3-B]PYRIDIN-4-OL
CAS:1824145-72-3
CM294874
OC1=C2C(NCC2)=NC=C1
2,3-DIHYDRO-1H-PYRROLO[2,3-B]PYRIDIN-5-OL
CAS:100383-04-8
CM328909
OC1=CN=C(NCC2)C2=C1
2,3-DIHYDRO-1H-PYRROLO[2,3-B]PYRIDINE-2-CARBOXYLIC ACID
CAS:1616337-50-8
CM326505
O=C(C1CC2=CC=CN=C2N1)O
2,3-DIHYDRO-1H-PYRROLO[2,3-C]PYRIDINE
CAS:760919-39-9
CM123774
C1(NCC2)=C2C=CN=C1
2,3-DIHYDRO-1H-PYRROLO[3,2-B]PYRIDINE HYDROCHLORIDE
CAS:1956306-76-5
CM250898
[H]Cl.C12=NC=CC=C1NCC2
2,3-DIHYDRO-1H-PYRROLO[3,2-C]PYRIDINE
CAS:23596-28-3
CM277632
C12=C(NCC2)C=CN=C1
2,3-DIHYDRO-1H-QUINOLIN-4-ONE
CAS:4295-36-7
CM144886
O=C1CCNC2=C1C=CC=C2
2,3-DIHYDRO-1H-QUINOLIN-4-ONE HYDROCHLORIDE
CAS:71412-22-1
CM144819
Cl[H].O=C1CCNC2=C1C=CC=C2
2,3-DIHYDRO-2-METHYL-1H-PYRROLO[2,3-B]PYRIDINE
CAS:7546-38-5
CM336419
CC1CC2=CC=CN=C2N1
2,3-DIHYDRO-2-PHENYL-4(1H)-QUINOLINONE
CAS:16619-14-0
CM144525
C1(=CC=CC=C1)C3CC(C2=CC=CC=C2N3)=O
2,3-DIHYDRO-3-OXO-1H-INDAZOLE-6-CARBOXYLIC ACID
CAS:862274-40-6
CM112114
O=C(C1=CC(NN2)=C(C=C1)C2=O)O
2,3-DIHYDRO-3-OXO-1H-INDENE-4-CARBONITRILE
CAS:215362-26-8
CM110969
N#CC1=CC=CC(CC2)=C1C2=O
2,3-DIHYDRO-3-OXO-4H-1,4-BENZOXAZINO-4-PROPIONIC ACID
CAS:23866-15-1
CM156864
O=C(O)CCN1C2=CC=CC=C2OCC1=O
2,3-DIHYDRO-4-HYDROXYINDEN-1-ONE
CAS:40731-98-4
CM112259
O=C1CCC2=C1C=CC=C2O
2,3-DIHYDRO-4-IODOINDEN-1-ONE
CAS:60899-33-4
CM243426
O=C1CCC2=C1C=CC=C2I
2,3-DIHYDRO-4H-THIOCHROMEN-4-ONE
CAS:3528-17-4
CM162564
O=C1CCSC2=C1C=CC=C2
2,3-DIHYDRO-5-HYDROXY-3,3-DIMETHYL-1H-ISOINDOL-1-ONE
CAS:184906-31-8
CM147589
O=C1NC(C)(C)C2=C1C=CC(O)=C2
2,3-DIHYDRO-5-IODOINDEN-1-ONE
CAS:511533-38-3
CM100754
O=C1CCC2=C1C=CC(I)=C2
2,3-DIHYDRO-5-METHOXYINDEN-1-ONE
CAS:5111-70-6
CM100135
O=C1CCC2=C1C=CC(OC)=C2
2,3-DIHYDRO-5-NITRO-(1H)-INDOLE
CAS:32692-19-6
CM146621
O=[N+](C1=CC2=C(NCC2)C=C1)[O-]
2,3-DIHYDRO-6-METHYL-2-THIOXOPYRIMIDIN-4(1H)-ONE
CAS:56-04-2
CM100022
O=C(C=C(C)N1)NC1=S
2,3-DIHYDRO-6-NITRO-(1H)-INDOLE
CAS:19727-83-4
CM147689
O=[N+](C1=CC2=C(C=C1)CCN2)[O-]
2,3-DIHYDRO-6H-[1,4]DIOXINO[2,3-C]PYRROLE
CAS:169616-17-5
CM198863
C12=CNC=C1OCCO2
2,3-DIHYDRO-BENZO[1,4]DIOXINE-2-CARBONITRILE
CAS:1008-92-0
CM157387
N#CC1COC2=CC=CC=C2O1
2,3-DIHYDRO-BENZO[1,4]DIOXINE-2-CARBOXYLIC ACIDETHYL ESTER
CAS:4739-94-0
CM157755
O=C(C1OC2=CC=CC=C2OC1)OCC
2,3-DIHYDRO-BENZO[1,4]DIOXINE-6-SULFONYL CHLORIDE
CAS:63758-12-3
CM158294
ClS(=O)(=O)C1=CC=C2OCCOC2=C1
2,3-DIHYDROBENZO[B][1,4]DIOXINE-5-CARBALDEHYDE
CAS:29668-43-7
CM109637
O=CC1=C2C(OCCO2)=CC=C1
2,3-DIHYDROBENZO[B][1,4]DIOXINE-5-CARBONITRILE
CAS:148703-14-4
CM156361
N#CC1=C2C(OCCO2)=CC=C1
2,3-DIHYDROBENZO[B][1,4]DIOXINE-5-CARBOXAMIDE
CAS:349550-81-8
CM122829
NC(=O)C1=CC=CC2=C1OCCO2
2,3-DIHYDROBENZO[B][1,4]DIOXINE-6-CARBOXAMIDE
CAS:299169-62-3
CM154544
NC(=O)C1=CC2=C(OCCO2)C=C1
2,3-DIHYDROBENZO[B][1,4]OXAZEPIN-4(5H)-ONE
CAS:704-48-3
CM161715
O=C1NC2=CC=CC=C2OCC1
2,3-DIHYDROBENZO[B]FURAN
CAS:496-16-2
CM157822
C1=CC=CC2=C1CCO2
2,3-DIHYDROBENZO[B]THIOPHENE-2-CARBOXYLIC ACID
CAS:27916-82-1
CM276128
O=C(C1CC2=CC=CC=C2S1)O
2,3-DIHYDROBENZO[G]QUINOLIN-4(1H)-ONE
CAS:21516-07-4
CM227713
O=C1CCNC2=C1C=C3C(C=CC=C3)=C2
2,3-DIHYDROBENZO[G]QUINOLINE-4,5,10(1H)-TRIONE
CAS:6566-47-8
CM225573
O=C1CCNC2=C1C(C3=CC=CC=C3C2=O)=O
2,3-DIHYDROBENZOFURAN-2-CARBOXYLIC ACID
CAS:1914-60-9
CM100734
O=C(C1OC2=CC=CC=C2C1)O
2,3-DIHYDROBENZOFURAN-4-CARBALDEHYDE
CAS:209256-42-8
CM123251
O=CC1=C2CCOC2=CC=C1
2,3-DIHYDROBENZOFURAN-5-CARBALDEHYDE
CAS:55745-70-5
CM112216
O=CC1=CC=C(OCC2)C2=C1
2,3-DIHYDROBENZOFURAN-5-YL-5-BORONIC ACID
CAS:227305-69-3
CM111745
OB(C1=CC=C(OCC2)C2=C1)O
2,3-DIHYDROBENZOFURAN-6-AMINE
CAS:57786-34-2
CM243679
NC1=CC=C2CCOC2=C1
2,3-DIHYDROBENZOFURAN-6-CARBALDEHYDE
CAS:55745-96-5
CM276846
O=CC1=CC=C2CCOC2=C1
2,3-DIHYDROBENZOFURAN-6-OL
CAS:23681-89-2
CM152971
OC1=CC=C2CCOC2=C1
2,3-DIHYDROCYCLOPENTA[B]INDOL-1(4H)-ONE
CAS:61364-20-3
CM239029
O=C1CCC(N2)=C1C3=C2C=CC=C3
2,3-DIHYDROFURAN
CAS:1191-99-7
CM328953
O1CCC=C1
2,3-DIHYDROFURO[2,3-B]QUINOLINE
CAS:14694-19-0
CM225954
C12=NC3=CC=CC=C3C=C1CCO2
2,3-DIHYDROIMIDAZO[1,2-A]PYRIDIN-5(1H)-ONE
CAS:1000981-77-0
CM151257
O=C1C=CC=C2N1CCN2
2,3-DIHYDROIMIDAZO[1,2-A]PYRIDIN-5(1H)-ONE HYDROCHLORIDE
CAS:1332581-57-3
CM151141
O=C1C=CC=C2N1CCN2.[H]Cl
2,3-DIHYDROIMIDAZO[1,2-B]ISOQUINOLIN-5(10H)-ONE
CAS:112521-56-9
CM226079
O=C1N2C(CC3=C1C=CC=C3)=NCC2
2,3-DIHYDROIMIDAZO[1,2-B]ISOQUINOLIN-5(1H)-ONE
CAS:25113-57-9
CM240061
O=C1N2C(NCC2)=CC3=C1C=CC=C3
2,3-DIHYDROIMIDAZO[1,2-C]QUINAZOLIN-5(6H)-ONE
CAS:38767-52-1
CM214184
O=C1NC2=C(C=CC=C2)C3=NCCN13
2,3-DIHYDROIMIDAZO[2,1-B]QUINAZOLIN-5(1H)-ONE
CAS:32725-30-7
CM213849
O=C1N2C(NCC2)=NC3=C1C=CC=C3
2,3-DIHYDROINDOLIZIN-5(1H)-ONE
CAS:101773-62-0
CM238251
O=C1N2CCCC2=CC=C1
2,3-DIHYDROISOQUINOLIN-3-ONE
CAS:7651-81-2
CM108579
O=C1NC=C2C=CC=CC2=C1
2,3-DIHYDROISOQUINOLINE-1,4-DIONE
CAS:31053-30-2
CM119925
O=C1NCC(C2=C1C=CC=C2)=O
2,3-DIHYDRONAPHTHO[1,2-B]BENZOFURAN-4(1H)-ONE
CAS:856791-71-4
CM256169
O=C1C2=CC=C3C(OC4=CC=CC=C34)=C2CCC1
2,3-DIHYDRONAPHTHO[2,3-B][1,4]DIOXINE-6-CARBONITRILE
CAS:942631-86-9
CM235524
N#CC1=C2C=C3C(OCCO3)=CC2=CC=C1
2,3-DIHYDROPHTHALAZINE-1,4-DIONE
CAS:1445-69-8
CM249464
O=C1NNC(C2=C1C=CC=C2)=O
2,3-DIHYDROPYRIDAZIN-3-ONE
CAS:504-30-3
CM102240
O=C1NN=CC=C1
2,3-DIHYDROSPIRO[INDENE-1,2'-[1,3]OXATHIOLANE]
CAS:626231-70-7
CM215726
C12=C(C3(OCCS3)CC2)C=CC=C1
2,3-DIHYDROSPIRO[INDENE-1,3'-PYRROLIDINE]-4,5-DIOL
CAS:100038-00-4
CM204117
OC1=C(O)C=CC2=C1CCC23CNCC3
2,3-DIHYDROSPIRO[INDENE-1,3'-PYRROLIDINE]-5,6-DIOL
CAS:100038-04-8
CM204118
OC1=CC2=C(C3(CNCC3)CC2)C=C1O
2,3-DIHYDROSPIRO[INDENE-1,4'-PIPERIDIN]-2-OL
CAS:473929-12-3
CM214482
OC1C2(CCNCC2)C3=C(C=CC=C3)C1
2,3-DIHYDROTHIENO[3,4-B]-1,4-DIOXIN
CAS:126213-50-1
CM195242
C12=CSC=C1OCCO2
2,3-DIHYDROTHIENO[3,4-B][1,4]DIOXINE-5,7-DICARBALDEHYDE
CAS:211235-87-9
CM124467
O=CC1=C2C(OCCO2)=C(C=O)S1
2,3-DIHYDROTHIENO[3,4-B][1,4]DIOXINE-5-CARBALDEHYDE
CAS:204905-77-1
CM251187
O=CC1=C2C(OCCO2)=CS1
2,3-DIHYDROTHIENO[3,4-B][1,4]DITHIINE
CAS:158962-92-6
CM129027
C1CSC2=CSC=C2S1
2,3-DIHYDROXY-4-METHOXYBENZALDEHYDE
CAS:4055-69-0
CM129241
O=CC1=CC=C(OC)C(O)=C1O
2,3-DIHYDROXY-5-METHYLNAPHTHALENE-1,4-DIONE
CAS:104094-16-8
CM241937
O=C(C1=C2C=CC=C1C)C(O)=C(O)C2=O
2,3-DIHYDROXY-6,7-DIMETHYL-4-PROPYL-1-NAPHTHOIC ACID
CAS:213971-33-6
CM260384
O=C(O)C1=C2C=C(C)C(C)=CC2=C(CCC)C(O)=C1O
2,3-DIHYDROXY-6-METHYLNAPHTHALENE-1,4-DIONE
CAS:120376-90-1
CM241935
O=C(C1=C2C=CC(C)=C1)C(O)=C(O)C2=O
2,3-DIHYDROXY-N,N,N-TRIMETHYLPROPAN-1-AMINIUM CHLORIDE
CAS:34004-36-9
CM252325
C[N+](C)(C)CC(O)CO.[Cl-]
2,3-DIHYDROXYBENZONITRILE
CAS:67984-81-0
CM157998
N#CC1=CC=CC(O)=C1O
2,3-DIHYDROXYBUTANEDIOATE;TETRAHYDRATE
CAS:6381-59-5
CM328769
O=C([O-])C(O)C(O)C([O-])=O.[H]O[H].[H]O[H].[H]O[H]
2,3-DIHYDROXYNAPHTHALENE
CAS:92-44-4
CM140756
OC1=C(O)C=C2C=CC=CC2=C1
2,3-DIHYDROXYNAPHTHALENE-1,4-DICARBALDEHYDE
CAS:103860-60-2
CM130255
O=CC1=C2C=CC=CC2=C(C=O)C(O)=C1O
2,3-DIHYDROXYPROPYL 2-(6-METHOXYNAPHTHALEN-2-YL)PROPANOATE
CAS:38835-17-5
CM263166
O=C(OCC(O)CO)C(C)C1=CC=C2C=C(OC)C=CC2=C1
2,3-DIHYDROXYPROPYL DECANOATE
CAS:2277-23-8
CM251502
CCCCCCCCCC(OCC(O)CO)=O
2,3-DIHYDROXYSUCCINIC ACID
CAS:526-83-0
CM186349
O=C(O)C(O)C(O)C(O)=O
2,3-DIHYDROXYTEREPHTHALIC ACID
CAS:19829-72-2
CM250983
O=C(O)C1=CC=C(C(O)=O)C(O)=C1O
2,3-DIIODO-5-(TRIFLUOROMETHYL)PYRIDINE
CAS:1227599-67-8
CM279988
FC(C1=CN=C(I)C(I)=C1)(F)F
2,3-DIIODO-8-(VINYLOXY)QUINOLINE
CAS:71479-89-5
CM224405
C=COC1=C2N=C(I)C(I)=CC2=CC=C1
2,3-DIIODONAPHTHALENE
CAS:27715-43-1
CM235205
IC1=C(I)C=C2C=CC=CC2=C1
2,3-DIMETHOXY-5-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PYRIDINE
CAS:1083168-92-6
CM133750
COC1=CC(B(OC2(C)C)OC2(C)C)=CN=C1OC
2,3-DIMETHOXY-5-NITROPHENOL
CAS:32905-09-2
CM132222
OC1=CC([N+]([O-])=O)=CC(OC)=C1OC
2,3-DIMETHOXY-6,7-DIMETHYL-1-PROPYLNAPHTHALENE
CAS:213971-41-6
CM232720
CCCC1=C2C=C(C)C(C)=CC2=CC(OC)=C1OC
2,3-DIMETHOXY-6,7-DIMETHYL-4-PROPYL-1-NAPHTHALDEHYDE
CAS:213971-66-5
CM261589
O=CC1=C2C=C(C)C(C)=CC2=C(CCC)C(OC)=C1OC
2,3-DIMETHOXY-6,7-DIMETHYL-4-PROPYL-1-NAPHTHOIC ACID
CAS:213971-46-1
CM263030
O=C(O)C1=C2C=C(C)C(C)=CC2=C(CCC)C(OC)=C1OC
2,3-DIMETHOXY-6,7-DIMETHYLQUINOXALINE
CAS:130064-16-3
CM126970
CC1=C(C)C=C2N=C(OC)C(OC)=NC2=C1
2,3-DIMETHOXY-6,8,13,13A-TETRAHYDRO-5H-ISOQUINOLINO[3,2-A]ISOQUINOLINE
CAS:47206-72-4
CM228323
COC1=CC2=C(C3N(CC4=C(C=CC=C4)C3)CC2)C=C1OC
2,3-DIMETHOXY-6-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PYRIDINE
CAS:1131335-62-0
CM205026
CC1(C)C(C)(C)OB(C2=CC=C(OC)C(OC)=N2)O1
2,3-DIMETHOXYBENZALDEHYDE
CAS:86-51-1
CM255406
C1=CC=C(C(=C1C=O)OC)OC
2,3-DIMETHOXYBENZENEBORONIC ACID
CAS:40972-86-9
CM135610
OB(C1=CC=CC(OC)=C1OC)O
2,3-DIMETHOXYBENZOIC ACID
CAS:1521-38-6
CM157612
C1=CC=C(C(=C1OC)OC)C(O)=O
2,3-DIMETHOXYBENZONITRILE
CAS:5653-62-3
CM157841
N#CC1=CC=CC(OC)=C1OC
2,3-DIMETHOXYISOINDOLO[2,1-B]ISOQUINOLIN-5(7H)-ONE
CAS:84245-29-4
CM226135
O=C1N(CC2=C3C=CC=C2)C3=CC4=C1C=C(OC)C(OC)=C4
2,3-DIMETHOXYISONICOTINALDEHYDE
CAS:944900-64-5
CM336492
O=CC1=C(OC)C(OC)=NC=C1
2,3-DIMETHOXYPHENOL
CAS:5150-42-5
CM303662
OC1=CC=CC(OC)=C1OC
2,3-DIMETHOXYPYRIDINE
CAS:52605-97-7
CM121001
COC1=CC=CN=C1OC
2,3-DIMETHOXYQUINOLIN-4-AMINE
CAS:1824056-54-3
CM227291
NC1=C(OC)C(OC)=NC2=CC=CC=C12
2,3-DIMETHOXYQUINOXALINE-5-CARBALDEHYDE
CAS:188699-41-4
CM221872
O=CC1=C2N=C(OC)C(OC)=NC2=CC=C1
2,3-DIMETHYL PIPERAZINE-2,3-DICARBOXYLATE
CAS:98493-22-2
CM325954
O=C(C1NCCNC1C(OC)=O)OC
2,3-DIMETHYL-1,2,3,4-TETRAHYDROISOQUINOLINE
CAS:54365-72-9
CM227359
CC1N(C)CC2=C(C=CC=C2)C1
2,3-DIMETHYL-1,2,3,4-TETRAHYDROQUINOXALINE-5-CARBOXYLIC ACID
CAS:912763-21-4
CM221402
O=C(C1=CC=CC2=C1NC(C)C(C)N2)O
2,3-DIMETHYL-1,2,3,4-TETRAHYDROQUINOXALINE-6-CARBOXYLIC ACID
CAS:912763-19-0
CM221403
O=C(C1=CC2=C(NC(C)C(C)N2)C=C1)O
2,3-DIMETHYL-1,2-DIHYDROQUINOXALINE
CAS:31757-00-3
CM221652
CC1=NC2=C(NC1C)C=CC=C2
2,3-DIMETHYL-1,4-DIHYDROQUINOXALINE
CAS:782423-78-3
CM221770
CC1=C(C)NC2=C(C=CC=C2)N1
2,3-DIMETHYL-1-(PHENYLSULFONYL)INDOLINE
CAS:94460-78-3
CM261692
O=S(N1C(C)C(C)C2=C1C=CC=C2)(C3=CC=CC=C3)=O
2,3-DIMETHYL-1-PHENYL-5-PYRAZOLONE
CAS:60-80-0
CM188466
O=C1C=C(C)N(C)N1C2=CC=CC=C2