Phone (USA) +1 212-348-5610
Whatsapp: +1 516-336-9307
WeChat: chembuyersguide
Chemical Search

Conier Chem&Pharma Limited.

Country: China

11F,#5 Building,
Asia pacific enterprise valley,
Chongqing, China.

Phone: +86-23-62922305
Phone 2: +86-139 9626 9627
FAX: +86-23-62457927
E-Mail:E-Mail this Supplier

Conier Chem&Pharma Limited.

Page: Home | 1 | 2 | 3 | 4 | 5 | 6 | 7 | 8 | 9 | 10 | 11 | 12 | 13 | 14 | 15 | 16 | 17 | 18 | 19 | 20 | 21 | 22 | 23 | 24 | 25 | 26 | 27 | 28 | 29 | 30 | 31 | 32 | 33 | 34 | 35 | 36 | 37 | 38 | 39 | 40 | 41 | 42 | 43 | 44 | 45 | 46 | 47 | 48 | 49 | 50 | 51 | 52 | 53 | 54 | 55 | 56 | 57 | 58 | 59 | 60 | 61 | 62 | 63 | 64 | 65 | 66 | 67 | 68 | 69 | 70 | 71 | 72 | 73 | 74 | 75 | 76 | 77 | 78 | 79 | 80 | 81 | 82 | 83 | 84 | 85 | 86 | 87 | 88 | 89 | 90 | 91 | 92 | 93 | 94 | 95 | 96 | 97 | 98 | 99 | 100 | 101 | 102 | 103 | 104 | 105 | 106 | 107 | 108 | 109 | 110 | 111 | 112 | 113 | 114 | 115 | 116 | 117 | 118 | 119 | 120 | 121 | 122 | 123 | 124 | 125 | 126 | 127 | 128 | 129 | 130 | 131 | 132 | 133 | 134 | 135 | 136 | 137 | 138 | 139 | 140 | 141 | 142 | 143 | 144 | 145 | 146 | 147 | 148 | 149 | 150 | 151 | 152 | 153 | 154 | 155 | 156 | 157 | 158 | 159 | 160 | 161 | 162 | 163 | 164 | 165 | 166 | 167 | 168 | 169 | 170 | 171 | 172 | 173 | 174 | 175 | 176 | 177 | 178 | 179 | 180 | 181 | 182 | 183 | 184 | 185 | 186 | 187 | 188 | 189 | 190 | 191 | 192 | 193 | 194 | 195 | 196 | 197 | 198 | 199 | 200 | 201 | 202 | 203 | 204 | 205 | 206 | 207 | 208 | 209 | 210 | 211 | 212 | 213 | 214 | 215 | 216 | 217 | 218 | 219 | 220 | 221 | 222 | 223 | 224 | 225 | 226 | 227 | 228 | 229 | 230 | 231 | 232 | 233 | 234 | 235 | 236 | 237 | 238 | 239 | 240 | 241 | 242 | 243 | 244 | 245 | 246 | 247 | 248 | 249 | 250 | 251 | 252 | 253 | 254 | 255 | 256 | 257 | 258 | 259 | 260 | 261 | 262 | 263 | 264 | 265 | 266 | 267 | 268 | 269 | 270 | 271 | 272 | 273 | 274 | 275 | 276 | 277 | 278 | 279 | 280 | 281 | 282 | 283 | 284 | 285 | 286 | 287 | 288 | 289 | 290 | 291 | 292 | 293 | 294 | 295 | 296 | 297 | 298 | 299 | 300 | 301 | 302 | 303 | 304 | 305 | 306 | 307 | 308 | 309 | 310 | 311 | 312 | 313 | 314 | 315 | 316 | 317 | 318 | 319 | 320 | 321 | 322 | 323 | 324 | 325 | 326 | 327 | 328 | 329 | 330 | 331 | 332 | 333 | 334 | 335 | 336 | 337 | 338 | 339 | 340 | 341 | 342 | 343 | 344 | 345 | 346 | 347 | 348 | 349 | 350 | 351 | 352 | 353 | 354 | 355 | 356 | 357 | 358 | 359 | 360 | 361 | 362 | 363 | 364 | 365 | 366 |

Product List

Formula: C4H6N4OS2
Formula: C10H9N3O3
Formula: C8H9NO2S
Formula: C4H6N6O3
Formula: C6H9N3O2
Formula: C9H17N3O
Formula: C7H12N2O4
Formula: C6H12N2O2
Formula: C5H9NO3
Formula: C9H16N2O2
Formula: C9H10N2OS
Formula: C8H15NO4
Formula: C9H17NO3
Formula: C10H17NO3
Formula: C8H15NO2
Formula: C10H17NO3
Formula: C10H17NO3
Formula: C8H15NO2
Formula: C8H15NO2
Formula: C10H17NO3
Formula: C7H13N3OS
Formula: C8H17N3O
Formula: C9H19N3O
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C9H8N2OS
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C2H2D3NO
Formula: C2H5NO
Formula: C2H7ClN2
Formula: C2H6N2.HCl
Formula: C3H5F2N3O2
Formula: C4H10N2O2
Formula: C9H15NO5
Formula: C16H23NO3
Formula: C22H15NO6
Formula: C3H8NO4P
Formula: C49H52N4Na2O12S2
Formula: C8H19NO4Si
Formula: C26H25N3O4
Formula: C3H7N3OS
Formula: C2H8ClN3
Formula: C11H14N2O3S
Formula: C13H17N3O4S
Formula: C7H7N5O
Formula: C10H11ClN4
Formula: C10H11ClN4
Formula: C8H4D5NO
Formula: C8H9NO
Formula: C47H34MnN4O2
Formula: (C4H3O4Ru)x
Formula: C12H18N4O6S2
Formula: #
Formula: C4H6N4O3S2
Formula: C8H17O4PS2
Formula: C6H13O4PS2
Formula: C2H6N2O
Formula: C2H4O2
Formula: #
Formula: C8H14O4
Formula: #
Formula: #
Formula: #
Formula: C15H11N5
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C13H16O3
Formula: C12H13ClO2
Formula: #
Formula: #
Formula: C12H10ClNO3
Formula: #
Formula: #
Formula: #
Formula: C6H6F3NO2
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C8H7NO3
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C10H3Cl3N2O2
Formula: #
Formula: C10H12O4
Formula: #
Formula: C5H10N2O
Formula: C9H14N4O4
Formula: #
Formula: #
Formula: #
Formula: C6H12N2O3
Formula: #
Formula: C31H38N4O5
Formula: #
Formula: C11H12O2
Formula: C5H7BrO2
Formula: C10H20O4
Formula: C9H9ClO2
Formula: C9H8N2O2
Formula: C8H16O2
Formula: C10H12O2
Formula: C11H14O4
Formula: C12H24O2
Formula: C11H14O3
Formula: #
Formula: C9H16O2
Formula: C8H16O2
Formula: #
Formula: C10H12O3
Formula: C13H20O2Si
Formula: #
Formula: #
Formula: C13H11NO4
Formula: #
Formula: #
Formula: C8H12O3
Formula: #
Formula: #
Formula: C5H7FO3
Formula: C8H16O3
Formula: #
Formula: #
Formula: C11H14O3
Formula: C16H25NO2
Formula: C16H14O4
Formula: C13H16O4
Formula: C10H12O2
Formula: #
Formula: C10H13NO3
Formula: C9H11NO3
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C9H9NO4
Formula: C8H12O3
Formula: C12H16O2
Formula: C9H12O3
Formula: #
Formula: C8H14O2
Formula: C8H14O3
Formula: #
Formula: #
Formula: C9H8N2O2
Formula: #
Formula: #
Formula: #
Formula: C10H18O2
Formula: #
Formula: C11H20O2
Formula: C12H22O2
Formula: #
Formula: C22H36O2
Formula: #
Formula: C11H20O2
Formula: C11H20O2
Formula: C4H8CuO5
Formula: #
Formula: C7H12N2O
Formula: C14H28O2
Formula: C6H9ErO6
Formula: (C4H6O2)x
Formula: #
Formula: #
Formula: #
Formula: C10H11NaO8S
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C13H22N2O5
Formula: C10H18O6
Formula: C42H80N2O5
Formula: #
Formula: #
Formula: #
Formula: C6H9EuO6
Formula: C6H9GdO6
Formula: C2H3O2
Formula: C2H4O2
Formula: C22H44O2
Formula: C12H24O2
Formula: #
Formula: C6H11LaO7
Formula: C6H9LuO6
Formula: C8H12MgO10U
Formula: C4H8O3
Formula: C16H17N3O2
Formula: C9H10N2O3
Formula: C19H38O2
Formula: C6H9NdO6
Formula: #
Formula: C8H8O2
Formula: C6H11O7Sm
Formula: C6H9O6Tb
Formula: C6H11O7Tb
Formula: #
Formula: C6H11O7Tl
Formula: C12H22O2
Formula: C4H4N2O3S
Formula: C4H4N2O3S
Formula: C9H16N2O2
Formula: C10H20N2O
Formula: C3H4N6O2
Formula: C8H8O6
Formula: C4H9N5O2
Formula: C10H9NO3S
Formula: #
Formula: C10H14N2O3
Formula: C15H15BrN4O5
Formula: C10H10N2O2
Formula: C7H7N3O2
Formula: C8H9NO3
Formula: C9H11NO2S
Formula: C6H6N2O3
Formula: C15H15BrClN3O3
Formula: C18H22BrN3O3
Formula: C6H3FO4
Formula: C5H5NO3S
Formula: C8H12N2O3
Formula: C8H9N3O
Formula: C9H11NO2S
Formula: C9H7NO3S
Formula: C15H15Br2N3O3
Formula: C9H15N3O
Formula: C6H3FO4
Formula: C7H6N2O2
Formula: C9H11NO2S
Formula: C12H18O3
Formula: C10H16O4
Formula: C10H16O4
Formula: C8H12N2O3
Formula: C8H16N2O3
Formula: C8H16N2O3
Formula: C7H14N2O4
Formula: C6H12N2O3
Formula: C6H11NO4
Formula: C6H11NO4
Formula: C8H15NO3
Formula: C6H8N2O3
Formula: C7H10N2O3
Formula: C6H10N2O3
Formula: C4H7NO4
Formula: C9H17N3O
Formula: C5H9NO3S
Formula: C5H9NO3S
Formula: #
Formula: C8H8N2O2
Formula: C8H8N2O2
Formula: #
Formula: C6H11NO5
Formula: C4H4N4O3S
Formula: C8H10NO3S-
Formula: C8H10NO3S-
Formula: C5H10N2O2S
Formula: C9H10O4S
Formula: C9H7F2NO4
Formula: C9H8N2O3S
Formula: C5H8N4O2
Formula: C11H14N2O2
Formula: C8H8O4S
Formula: C11H13NO4
Formula: C12H15NO4
Formula: C9H12N2O3
Formula: C8H10N2O2S
Formula: C9H11NO4
Formula: C8H9NO4
Formula: C8H9NO3S
Formula: C6H11NO4
Formula: C5H8N4O2
Formula: C4H4N4O3S
Formula: C8H10N2O5
Formula: C5H7N3O4
Formula: C11H14N2O2
Formula: C9H12N2O3
Formula: C8H10N2O2S
Formula: C6H5ClN2O3S
Formula: C8H13N3O2S
Formula: C7H11N3O2S
Formula: C8H7FN2O3
Formula: C8H9NO4
Formula: C6H7NO4
Formula: C12H12N2O4S
Formula: C14H16N2O4S
Formula: C9H11NO4
Formula: C6H6N2O4
Formula: C6H13N3O2
Formula: C4H5NO6
Formula: #
Formula: C6H8N2O3
Formula: C6H8N2O3
Formula: C4H6N2O3S
Formula: C4H6N2O3S
Formula: C8H15NO5
Formula: C8H15NO5
Formula: C4H4N2O6
Formula: C5H9N3O3
Formula: C8H15NO5
Formula: C26H35NO8
Formula: C21H29NO6
Formula: C24H33NO7
Formula: C21H29NO6
Formula: C7H14N2O3
Formula: C14H24N2O5S
Formula: C13H17NO4S
Formula: C26H38N4O5S
Formula: C11H17N3O2
Formula: C9H13N3O2
Formula: C12H16N2O2
Formula: C2H4O2
Formula: C8H16N2O3
Formula: C8H16N2O3
Formula: C12H16ClNO5S
Formula: C9H12N4O3
Formula: C21H21ClN2O2S
Formula: C26H38N4O6
Formula: C26H38N4O6
Formula: C26H38N4O6
Formula: C19H25N3O3
Formula: C8H15NO3
Formula: C7H12N2O3
Formula: C10H11N3O
Formula: C10H11N3O
Formula: C10H11N3O
Formula: C7H15N3OS
Formula: C5H10O2.1/2H
ACETIC ACID, 2,2',2'',2'''-((25,26,27,28-TETRAKIS(1,1-DIMETHYLETHYL)PENTACYCLO(,7).1(9,13).1(15,19))OCTACOSA-1(25),3,5,7(28),9,11,13(27),15,17,19(26),21,23-DODECAENE-5,11,17,23-TETRAYL)TETRAKIS(OXY))TETRAKIS-, TETRAMETHYL ESTER
Formula: C56H72O12
ACETIC ACID, 2,2-(1S,3S,7R,8E,11R,15S,17R,21R,23R,25S)-25-(ACETYLOXY)-1,11,21-TRIHYDROXY-17-(1R)-1-HYDROXYETHYL-10,10,26,26-TETRAMETHYL-19-OXO-18,27,28,29-TETRAOXATETRACYCLO21.3.1.13,7.111,15NONACOS-8-ENE-5,13-DIYLIDENEBIS-, DIMETHYL ESTER, (25Z,213E)-
Formula: #
Formula: C5H3NO7
Formula: C5H10N2O4
Formula: #
Formula: #
Formula: C6H8N4O3
Formula: C9H10N4O
Formula: C7H11N5O3
Formula: C9H12N4O3
Formula: C9H9N3OS
Formula: C10H11N3OS
Formula: C6H9N3O2
Formula: C7H8N4O3
Formula: C11H14N2O
Formula: #
Formula: #
Formula: C10H11N3OS
Formula: C7H8ClN3O
Formula: C7H8N4O3
Formula: C10H11N3OS
Formula: C5H8N6O2
Formula: C6H13N3O2
Formula: #
Formula: #
Formula: #
Formula: C4H7N3O4
Formula: C4H7NO4S
Formula: C7H14N2O4
Formula: C8H16N2O4
Formula: C2H4BrNO2
Formula: C6H10N2O3
Formula: C7H12N2O2
Formula: C8H12N2O2
Formula: C7H10N2O3
Formula: C7H10N2O3
Formula: C9H16N4O2
Formula: C10H17N3O2
Formula: C9H9N3O4
Formula: C9H9N3O4
Formula: C9H9N3O4
Formula: C2H2BrNO3
Formula: C7H10BrNO2
Formula: C7H13ClN2O3
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C2H4ClN3O3
Formula: C8H9N3O2
Formula: C6H8N2O3
Formula: C6H8N2O3
Formula: C12H13N3O
Formula: C6H8BrNO2
Formula: #
Formula: C7H9NO3
Formula: C7H9NO3
Formula: C10H11NO3
Formula: C10H11NO3
Formula: C11H15NO2
Formula: C11H15NO2
Formula: C5H5FN2O3
Formula: C6H8N2O3
Formula: C8H12N2O4
Formula: C22H24N2O3S
Formula: C21H22N2O2S
Formula: C9H14N2O2
Formula: C8H5Cl4NO4
Formula: C3H4N2O6
Formula: C19H32O6
Formula: C4H6FNO4
Formula: C2H6N2O.H
Formula: C9H12N2O3
Formula: C9H10N2O4
Formula: C9H10N2O4
Formula: C9H9NO5
Formula: C9H8N2O6
Formula: C7H13NO4
Formula: C10H11NO5
Formula: C9H8N2O6
Formula: C11H13NO5
Formula: C11H13NO4
Formula: #
Formula: C2H3CaO2S
Formula: C7H12O2S
Formula: C10H12N2O4
Formula: C7H13NO4
Formula: C7H11NO4
Formula: C7H11NNa2O6
Formula: C6H9NO4
Formula: C4H3N3O3S
Formula: C5H6N4O3
Formula: C8H6O3
Formula: C8H8O2
Formula: C8H8O2
Formula: C6H9ClO2
Formula: #
Formula: C2H3NaO2
Formula: C2NaO2T3
Formula: #
Formula: #
Formula: C12H18O12UZn
Formula: #
Formula: C2H4O2
Formula: C2H4O2
ACETIC ACID-2-13C,2,2,2-D3
Formula: 13CD3CO2D
Formula: C2H3O2
Formula: C8H17NO
Formula: C22H35NO2
Formula: C22H36N4O10
Formula: C16H28N6O6
Formula: C20H41NO2
Formula: C20H41NO2
Formula: C31H62NO10P
Formula: C10H20N2O4
Formula: C14H20N2O2
Formula: C10H10N4O7
Formula: C56H73N11O12S2
Formula: C21H26N2O2S
Formula: C24H48N2O3
Formula: C6H15NO4
Formula: C26H53NO6
Formula: C13H19N3O4
Formula: C29H46N6O7S
Formula: C27H43N7O7S
Formula: C8H18N8O2
Formula: C13H27N5O5
Formula: C24H46N2O3
Formula: C13H19N3O5
Formula: C10H21N3O5
Formula: C4H11NO3
Formula: C14H18N4O3
Formula: C13H29NO3
Formula: C13H29NO3
Formula: C19H25N3O2
Formula: C11H19N3O2
Formula: C15H15NO2
Formula: C2H7CuNO2
Formula: C6H15NO2
Formula: C12H27NO2
Formula: C76H110N20O25
Formula: C9H9N3O10
Formula: C23H33N5O8
Formula: C13H25N3O6
Formula: C34H46N4O4
Formula: C10H21NO2
Formula: C20H43NO2
Formula: C22H47NO2
Formula: C18H39NO2
Formula: C13H19NO4
Formula: C28H26Cl4N12O6
Formula: C8H21N3O4
Formula: C19H40N2O3
Formula: C25H52N2O3
Formula: C19H24F6N2O5
Formula: C57H81N17O16
Formula: C24H51N3O3
Formula: C24H50N2O4
Formula: C44H90N4O4
Formula: C26H55N3O3
Formula: C26H34N8O8
Formula: C6H15NO2
Formula: C12H13NO2
Formula: C6H15N3O2
Formula: C11H28O5Ti
Formula: C2H4O2Pa
Formula: C16H35NO2
Formula: C2D4O2
Formula: C4H6O3
Formula: #
Formula: C2H4O2
Formula: C2H3NaO2
Formula: C2H4O2
ACETIC-13C2-2-D3 ACID, 97 ATOM % 13C, 97 ATOM % D
Formula: 13CD313CO2H(D)
Formula: C2H4O2
ACETIC-2,2,2-D3 ACID ETHYL-1,1,2,2,2-D5 ESTER
Formula: C2H3NaO2
Formula: C2HD3O2
Formula: C2D7NO2
Formula: C12H24O2
Formula: C15H27O4
Formula: C25H34N6O3
Formula: C7H11N3O2S
Formula: #
Formula: C15H9I3O5
Formula: #
Formula: C12H15NO3
Formula: C4H6O2
Formula: C5H9N3O2
Formula: C4H7NO2
Formula: C5H9NO3
Formula: C10H11NO2
Formula: C4H6O3
Formula: #
Formula: C12H23NO2
Formula: C9H16O3
Formula: C8H14O3
Formula: C12H22O3
Formula: C7H12O3
Formula: C9H16O3
Formula: #
Formula: #
Formula: C4H3F3O3
Formula: C11H15BrO7
Formula: C26H35BrO17
Formula: C26H35BrO17
Formula: C14H20NNaO5S
Formula: C14H20ClNO2
Formula: C8H7O2-
Formula: C15H20N2O4S
Formula: C2H5NO2
Formula: C21H21NO8
Formula: C2H4ClNO
Formula: C4H8O2
Formula: C6H10O3
Formula: C10H14O5
Formula: C3H5DO
Formula: C5H11N3S
Formula: C10H13N3S
Formula: C6H12N2
Formula: C4H7NO
Formula: #
Formula: #
Formula: #
Formula: C12H11N.C3H6O
Formula: C6H12O3
Formula: C3H8N2
Formula: C12H15N3O
Formula: C18H32N4O4
Formula: C3H7NO
Formula: C9H18O6
Formula: C9H12N2
Formula: C11H12N4
Formula: C4H9N3O
Formula: C4H9N3S
ACETONE, [2-14C]
Formula: C3H6O
Formula: C3H6O
Formula: CD313COCD3
Formula: C10H11N3S
Formula: C3D6O
Formula: #
Formula: C3H6O
Formula: C11H18O5
Formula: C7H14O7S2
Formula: #
Formula: C6H14N2
Formula: C2H2KN
Formula: C2H3N
Formula: C23H28N4O4S2
Formula: C7H14N4
Formula: C8H15N3O
Formula: C9H7N3O
Formula: C2H3N
Formula: C2D3N
Formula: C2H3N
Formula: C49H52N3P2Ru.PF6
Formula: C17H12N2O9
Formula: C21H20BrOP
Formula: C24H40N7O17P3S
Formula: C18H22N4
Formula: C6H10O2
Formula: C24H23NO5
Formula: C19H15IO4
Formula: C7H8N2O
Formula: C6H14NO
Formula: C21H20ClOP
Formula: C23H29N3O2S
Formula: C31H37N3O10S
Formula: #
Formula: #
Formula: C10H14N2
Formula: #
Formula: C22H25N3O4
Formula: C15H21N3O2
Formula: C10H11NO3
Formula: C14H18N2O3
Formula: C8H9NO
Formula: C14H14N2
Formula: C9H11N3O
Formula: C9H11N3S
Formula: C15H16N2O2S
Formula: C8H8O
Formula: C14H11ClN4O4
Formula: C9H9Cl2N3O
Formula: C10H13NO
Formula: C8H8O
Formula: C8H8O
Formula: C7H12O3
Formula: C5H6O4
Formula: C14H14N3NaO5S2
Formula: C10H12O4
Formula: C9H10O3
Formula: C11H13NO3
Formula: C12H17NO3S
Formula: C96H141AlO15
Formula: C8H17O5PS
Formula: C13H24N3O5P
Formula: C12H12INO2
Formula: C15H34N2O3Sn
Formula: C4H6O4
Formula: C5H8O3
Formula: C4H5ClO3
Formula: C17H15NO3
Formula: C6H12O2Si
Formula: C6H13ClO2Si
Formula: C5H10Cl2O2Si
Formula: #
Formula: #
Formula: C18H17FO4
Formula: C10H12N2O3
Formula: C7H14O4Si
Formula: C9H20O5Si
Formula: C14H30O5Si
Formula: C8H18O2Pb
Formula: C5H12O2Pb
Formula: C26H54O2Sn
Formula: C17H24O4
Formula: C9H6I3NO3
Formula: C12H14N2O
Formula: #
Formula: C11H12O4
Formula: C9H13FO5
Formula: C12H16N5O8P
Formula: C8H17Cl2NO2
Formula: C9H8O4
Formula: #
Formula: C2H3BrO
Formula: C2H3BrO
Formula: C17H26O2
Formula: C17H26O
Formula: C17H26O
Formula: C2H3ClO
Formula: C23H35Li3N7O17P3S
Formula: C23H37N7NaO17P3S
Formula: C23H35Li3N7O17P3S
Formula: C23H38N7O17P3S
Formula: C23H38N7O17P3S
Formula: C23H35N7O17P3ST3
Formula: C8H14O5S
Formula: C24H26N4O4
Formula: C4H6O4
Formula: C2H3FO
Formula: C18H26O
Formula: C2H3FO2
Formula: C2H3IO
Formula: C3H3NOS
Formula: C4H4O2
Formula: #
Formula: C2H3NO4
Formula: C2H3Li2O5P
Formula: C4H6O2S
Formula: C32H52O2
Formula: C20H18O6
Formula: C20H34O8
Formula: C10H7ClFNO
Formula: #
Formula: C10H9FO3
Formula: C21H40O5
Formula: C20H32AsNO6
Formula: C24H34N4O8
Formula: C32H48O5
Formula: C2H3BrO
Formula: C11H13NO4
Formula: C9H7BrO4
Formula: C23H33N5O5
Formula: C17H23N3O6
Formula: C32H50O4
Formula: C42H62N8O9
Formula: C17H30N8O8
Formula: C38H50N8O13S3
Formula: C9H16N4O4
Formula: C21H29N5O6
Formula: C20H30N4O11
Formula: C20H31N5O10S
Formula: C160H253N39O47S
Formula: C8H18INO2
Formula: C6H11NO3
Formula: C2D3ClO
Formula: C26H30N4O4
Formula: C23H37N7O14P2S
Formula: C9H18ClNO4
Formula: C19H30N4O10S
Formula: C66H92N12O28S
Formula: C2H4O3P
Formula: #
Formula: C21H34N4O10
Formula: C14H26N4O5
Formula: C10H22NO2
Formula: C10H18N2O2
Formula: C10H20N2O2
Formula: C10H13NO
Formula: C31H57N5O9
Formula: C12H12F3NO2
Formula: C24H33N5O6
Formula: C8H18INO2S
Formula: C13H15N3O3S
Formula: C9H18O5S
Formula: C28H38Br2N2O6
Formula: C20H33N5O9
Formula: C23H32N6O10
Formula: C42H68N8O11
Formula: C57H91N11O12
Formula: C28H33N7O9
Formula: C25H36N4O8
Formula: C21H29N5O6
Formula: C23H32N4O8
Formula: C33H42N4O10
Formula: C14H23N3O6
Formula: C23H37N5O10
Formula: C6H12O3
Formula: C4H5NaO3
Formula: C13H19O2Rh
Formula: C12H15O2Rh
Formula: C27H23IrN2O2
Formula: C35H27IrN2O2
Formula: C9H15O2Rh
Formula: C5H6O2.Li
Formula: C10H14MnO4
Formula: C15H21O6Tl
Formula: C36H49NO12
Formula: C6H8O3
Formula: C29H45N9O9
Formula: C10H10FNO3
Formula: #
Formula: C47H74O17
Formula: C2H4O2.x(H3PO4).x(C6H10O5)
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C9H15BrN2O3
Formula: C7H13NO3
Formula: C3H6N2O2
Formula: C26H23FeO2P
Formula: C9H17NO4
Formula: C20H23NO5
Formula: C7H16NO2.Br
Formula: C7H16NO2.Cl
Formula: C7H16INO2
Formula: C7H16NO2.I
Formula: C7H16NO2.ClO4
Formula: C124H188N30O38S2
Formula: C90H136N22O28S2
Formula: C7H16ClNO2
Formula: C7H12ClD4NO2
Formula: C7BrD16NO2
Formula: C7H7ClD9NO2
Formula: C18H18N2O5S
Formula: C33H38O12
Formula: C17H16O7
Formula: #
Formula: #
Formula: C16H23ClN4O2S3
Formula: C14H16N4O5S2
Formula: #
Formula: C2H2
Formula: C12H16O
Formula: C2H2
Formula: C4H4N2O2
Formula: C4HKO4
Formula: C4H2O4
Formula: C24H24O9
Formula: C12H16N4O10S
Formula: C12H12FeO
Formula: C21H29NO8
Formula: #
Formula: C8H10N2O5
Formula: #
Formula: C22H34O4
Formula: C17H22O4
Formula: C46H58N2O13
Formula: #
Formula: C8H15NO3
Formula: C26H38O6
Formula: C5H4N2O
Formula: #
Formula: C9H14O
Formula: C21H36N4O11
Formula: C8H7HgNO5
Formula: C12H16HgO2
Formula: C8H10HgN2O4S
Formula: C5H10HgO3
Formula: C12H17HgNO2
Formula: C9H10HgO2
Formula: C9H10HgO2
Formula: C16H17HgN3O2
Formula: C3H6HgO2
Formula: C8H11HgNO2
Formula: C4H6O3
Formula: C13H16N2O8S
Formula: C17H21NO9
Formula: C35H42N2O18
Formula: C41H44N4O20S
Formula: C29H24O15
Formula: #
Formula: #
Formula: C2H5O5P
Formula: C2H5O4P
Formula: C6H6N2O
Formula: #
Formula: C10H10O4
Formula: C9H8O4
Formula: C16H12O6
Formula: C18H18O6
Formula: C27H40O6
Formula: C45H76N2O15
Formula: C11H12N4O4S2
Formula: C22H32O4
Formula: C34H48O11
Formula: C10H10O2S
Formula: C7H16NOS.Cl
Formula: C7H16ClNO5S
Formula: C7H16NOS+
Formula: C15H18BOPS
Formula: #
Formula: C5H12O2Si
Formula: #
Formula: C11H11ClO3
Formula: C24H32O10
Formula: #
Formula: #
Formula: C6H11NO2
Formula: C37H35N2NaO6S2
Formula: #
Formula: C8H6N2OS2
Formula: C8H11N5NaO3
Formula: C23H15N3Na2O6S
Formula: C22H14N6Na2O9S2
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C40H20CrN6Na3O14S2
Formula: #
Formula: C34H25K2N11O11S3
Formula: #
Formula: #
Formula: C34H26N10Na2O9S3
Formula: C36H23N5O6S2.2Na
Formula: C34H25N11Na2O11S3
Formula: #
Formula: C60H36Cr2N9Na3O21S3
Formula: #
Formula: C38H32CrN8O10S2.H
Formula: #
Formula: #
Formula: C22H14N6O9S2.C16H11N2O4S.3Na
Formula: C27H31N2NaO6S2
Formula: C47H39N2NaO6S2
Formula: C43H48N3NaO6S2
Formula: C32H21N5Na2O6S2
ACID BLUE 117 (C.I. 17055)
Formula: #
Formula: C38H31N4NaO3S
Formula: C37H30N3NaO4S
Formula: C33H23N5Na2O6S2
Formula: C41H26N4Na2O10S2
Formula: C41H26N4O10S2.2Na
Formula: C23H19N2NaO5S
Formula: C32H34N3NaO6S2
Formula: C32H36N2Na2O8S2
Formula: #
Formula: C47H39N2NaO6S2
Formula: C40H22CrN4Na2O10S2
Formula: C40H20CrN4O10S2.H.2Na
Formula: #
Formula: C40H40N2Na2O9S2
Formula: #
Formula: #
Formula: #
Formula: C24H21N2NaO5S