Phone (USA) +1 212-348-5610
Whatsapp: +1 516-336-9307
WeChat: chembuyersguide
Chemical Search

Conier Chem&Pharma Limited.

Country: China

11F,#5 Building,
Asia pacific enterprise valley,
Chongqing, China.

Phone: +86-23-62922305
Phone 2: +86-139 9626 9627
FAX: +86-23-62457927
E-Mail:E-Mail this Supplier

Conier Chem&Pharma Limited.

Page: Home | 1 | 2 | 3 | 4 | 5 | 6 | 7 | 8 | 9 | 10 | 11 | 12 | 13 | 14 | 15 | 16 | 17 | 18 | 19 | 20 | 21 | 22 | 23 | 24 | 25 | 26 | 27 | 28 | 29 | 30 | 31 | 32 | 33 | 34 | 35 | 36 | 37 | 38 | 39 | 40 | 41 | 42 | 43 | 44 | 45 | 46 | 47 | 48 | 49 | 50 | 51 | 52 | 53 | 54 | 55 | 56 | 57 | 58 | 59 | 60 | 61 | 62 | 63 | 64 | 65 | 66 | 67 | 68 | 69 | 70 | 71 | 72 | 73 | 74 | 75 | 76 | 77 | 78 | 79 | 80 | 81 | 82 | 83 | 84 | 85 | 86 | 87 | 88 | 89 | 90 | 91 | 92 | 93 | 94 | 95 | 96 | 97 | 98 | 99 | 100 | 101 | 102 | 103 | 104 | 105 | 106 | 107 | 108 | 109 | 110 | 111 | 112 | 113 | 114 | 115 | 116 | 117 | 118 | 119 | 120 | 121 | 122 | 123 | 124 | 125 | 126 | 127 | 128 | 129 | 130 | 131 | 132 | 133 | 134 | 135 | 136 | 137 | 138 | 139 | 140 | 141 | 142 | 143 | 144 | 145 | 146 | 147 | 148 | 149 | 150 | 151 | 152 | 153 | 154 | 155 | 156 | 157 | 158 | 159 | 160 | 161 | 162 | 163 | 164 | 165 | 166 | 167 | 168 | 169 | 170 | 171 | 172 | 173 | 174 | 175 | 176 | 177 | 178 | 179 | 180 | 181 | 182 | 183 | 184 | 185 | 186 | 187 | 188 | 189 | 190 | 191 | 192 | 193 | 194 | 195 | 196 | 197 | 198 | 199 | 200 | 201 | 202 | 203 | 204 | 205 | 206 | 207 | 208 | 209 | 210 | 211 | 212 | 213 | 214 | 215 | 216 | 217 | 218 | 219 | 220 | 221 | 222 | 223 | 224 | 225 | 226 | 227 | 228 | 229 | 230 | 231 | 232 | 233 | 234 | 235 | 236 | 237 | 238 | 239 | 240 | 241 | 242 | 243 | 244 | 245 | 246 | 247 | 248 | 249 | 250 | 251 | 252 | 253 | 254 | 255 | 256 | 257 | 258 | 259 | 260 | 261 | 262 | 263 | 264 | 265 | 266 | 267 | 268 | 269 | 270 | 271 | 272 | 273 | 274 | 275 | 276 | 277 | 278 | 279 | 280 | 281 | 282 | 283 | 284 | 285 | 286 | 287 | 288 | 289 | 290 | 291 | 292 | 293 | 294 | 295 | 296 | 297 | 298 | 299 | 300 | 301 | 302 | 303 | 304 | 305 | 306 | 307 | 308 | 309 | 310 | 311 | 312 | 313 | 314 | 315 | 316 | 317 | 318 | 319 | 320 | 321 | 322 | 323 | 324 | 325 | 326 | 327 | 328 | 329 | 330 | 331 | 332 | 333 | 334 | 335 | 336 | 337 | 338 | 339 | 340 | 341 | 342 | 343 | 344 | 345 | 346 | 347 | 348 | 349 | 350 | 351 | 352 | 353 | 354 | 355 | 356 | 357 | 358 | 359 | 360 | 361 | 362 | 363 | 364 | 365 | 366 |

Product List

Formula: C18H27ClO3
Formula: C10H11ClO3
Formula: C10H11ClO3
Formula: #
Formula: C6H9N3O2
Formula: C16H12O6
Formula: C24H27NO9
Formula: C24H29NO9
Formula: C13H17ClN2
Formula: C13H16N2.HCl
Formula: C13H16N2
Formula: C25H26N2O2
Formula: C36H56O11
Formula: C16H8O6
Formula: C16H14O4
Formula: C30H46O6
Formula: C20H23NO6
Formula: C14H12O4
Formula: C15H17NO2
Formula: C16H19NO3
Formula: #
Formula: C13H16N2O6
Formula: #
Formula: C21H24O7
Formula: C27H36O5
Formula: C9H8N2O
Formula: C26H28ClNO10
Formula: C23H32O2
Formula: C24H34O4
Formula: C18H23NO2
Formula: #
Formula: C16H14N2O2S
Formula: C15H15NO2
Formula: C16H13N3O4
Formula: C19H27NO5S
Formula: C16H18Cl2N2O4
Formula: C12H10Cl2N2O4
Formula: C32H38N2O8
Formula: C15H25ClN2O3
Formula: C17H16F6N2O.HCl
Formula: C41H44Cl2F6N10O5S
Formula: C17H16F6N2O
Formula: C11H13F3N2O3S
Formula: C13H19ClN2O5S2
Formula: C17H35NO6
Formula: C16H33NO6
Formula: C27H45NO2
Formula: C46H82N2O16
Formula: #
Formula: C13H24O4
Formula: C24H32O4
Formula: C22H30O3
Formula: C17H16ClNO4
Formula: C29H37N3O13
Formula: C36H62GdN5O21
Formula: C28H26N4O3
Formula: C27H30O7
Formula: C29H30O3
Formula: C9H8N2O2
Formula: #
Formula: C17H12N2O2
Formula: C19H19BrN2OS
Formula: #
Formula: C6H9N9O3
Formula: C4H8N6O
Formula: C3H7ClN6
Formula: C3H6N6.HF
Formula: C10H14N6O3S
Formula: C3H6N6.(H3PO4)n
Formula: C3H6N6.(H3PO4)n
Formula: C3H6N6.H4P2O7
Formula: C3H6N6O4S
Formula: C3D6N6
Formula: C3H9N6O4P
Formula: C3H6N6.(H3O4P)n
Formula: C3H6N6
Formula: C39H71N9O13
Formula: C89H139N27O24S4
Formula: C105H160N30O26S4
Formula: #
Formula: #
Formula: C50H69N15O9
Formula: C78H111N21O19
Formula: #
Formula: C4H5AsKO5
Formula: C12H15AsN6OS2
Formula: C13H16N2O2
Formula: C13H16N2O2
Formula: C23H23N5O4
Formula: C23H30O3
Formula: C25H32O4
Formula: #
Formula: #
Formula: C30H46O4
Formula: C30H44O4
Formula: #
Formula: #
Formula: C17H15NO5
Formula: C30H46O3
Formula: C30H48O3
Formula: C15H18O8
Formula: C13H12N2
Formula: #
Formula: C39H50O24
Formula: C21H25N.HCl
Formula: C21H25N
Formula: C131H229N39O31
Formula: C10H10O3
Formula: C12H6O12
Formula: C12O9
Formula: C10H6O8
Formula: C15H21FN6O
Formula: C39H62O13
Formula: C20H20N2O2
Formula: C14H10D3N3O4S2
Formula: C14H13N3O4S2
Formula: C16H23ClFNO
Formula: C13H18Cl2N2O2
Formula: C15H16N4O3
Formula: C12H21N
Formula: C12H21N.HCl
Formula: C12H21N
Formula: #
Formula: #
Formula: #
Formula: C37H58Cl2N2O3
Formula: C15H14O4
Formula: C11H8O8P2.4Na.6(H2O)
Formula: C11H10O5S.C6H8N2O
Formula: C11H10O5S.C6H6N2O
Formula: #
Formula: C11H9NaO5S
Formula: C11H9NaO5S
Formula: C11H8O2
Formula: #
Formula: #
Formula: C31H40O2
Formula: C15H14O4
Formula: #
Formula: C14H26O3
Formula: C14H19NO7
Formula: #
Formula: C28H31NO10
Formula: C21H24O9
Formula: C10H14O
Formula: C16H31NO7
Formula: C13H24O3
Formula: C10H18O
Formula: C10H18O
Formula: #
Formula: C12H22O2
Formula: C12H22O2
Formula: C17H25NO2
Formula: C23H18ClNO
Formula: C12H21ClO2
Formula: C11H20O2
Formula: C15H28O2
Formula: C13H24O3
Formula: C20H41NO5Si
Formula: C17H24O3
Formula: C27H14F5NO6
Formula: #
Formula: C22H36N6O6S
Formula: C26H45BN4O8
Formula: C31H41N5O9
Formula: C22H35ClN4O7
Formula: C21H34N4O8
Formula: C35H42F3N5O10
Formula: C32H49N7O11S
Formula: C23H30ClN3O.2(HCl).2(H2O)
Formula: C14H13N3
Formula: C59H86N2O19
Formula: #
Formula: C21H26NO3.Br
Formula: C10H14O3
Formula: C11H17N
Formula: C8H16NO3PS2
Formula: C7H16N.Cl
Formula: C7H16N
Formula: #
Formula: C15H22N2O.HCl
Formula: C15H22N2O
Formula: C26H32O8
Formula: C22H28O5
Formula: #
Formula: C24H34NO2
Formula: C7H16BrNO
Formula: #
Formula: C17H19NO2
Formula: C13H18O5
Formula: C31H44O8
Formula: C19H23NO2S
Formula: C14H21NO2
Formula: C14H22ClNO2
Formula: C15H23NO.HCl
Formula: C15H23NO
Formula: C17H23N3O.C4H4O4
Formula: C21H25IN2S
Formula: C20H22N2OS
Formula: C20H22N2S
Formula: #
Formula: C19H23F2N3O3
Formula: C19H10HgI2NaO7S
Formula: C16H25HgN6O8
Formula: C15H16O4
Formula: C15H18O5
Formula: C11H9N3O3S
Formula: C20H8Br2HgO6.2Na
Formula: #
Formula: #
Formula: C14H10HgO4S2
Formula: #
Formula: C35H49ClO5S
Formula: C4H6O4S2Sr
Formula: #
Formula: C2H4OS
Formula: #
Formula: C6H12O2S2
Formula: C9H10O2S
Formula: #
Formula: C2H4O2SSr
Formula: #
Formula: #
Formula: C4H5AuO4S
Formula: #
Formula: C11H15NO2S
Formula: C4H7NaO2S
Formula: C5H8O2S
Formula: #
Formula: #
Formula: C3H8N2OS
Formula: C3H10SSi
Formula: C4H4Na2O4S
Formula: C4H6O4S
Formula: #
Formula: #
Formula: C12H16HgNO6
Formula: #
Formula: #
Formula: C5H4N4S
Formula: C14H10HgO4
Formula: C6Cl2HgO4
Formula: C12H10Hg3O14
Formula: C2HgN2
Formula: C6H12HgN2S4
Formula: C16H30HgO4
Formula: HgI2O6
Formula: C6H10HgO6
Formula: Hg(NO3)2.2(H2O)
Formula: Cl2HgO8
Formula: Hg3O8P2
Formula: Cl3HgK
Formula: C7H4HgO3
Formula: #
Formula: HgSO4
Formula: C4HgK2N4S4
Formula: C4F6HgO4
Formula: #
Formula: Hg2O
Formula: C10H13ClHgO
Formula: C21H32HgN5NaO7
Formula: Hg2N6
Formula: Br2Hg2
Formula: #
Formula: Hg2Cl2
Formula: HgNO3
Formula: C2Hg2O4
Formula: ClHgO4
Formula: Hg
Formula: C4H4F2HgO4
Formula: 2(C2H4O2).Hg
Formula: #
Formula: #
Formula: Br2Hg
Formula: CdHgTe
Formula: #
Formula: HgCl2
Formula: C2Hg2N2O
Formula: C20H34HgO4
Formula: C12H26Hg
Formula: F2Hg
Formula: F2Hg
Formula: C2HgN2O2
Formula: C6H11HgO7
Formula: HgI
Formula: Hg2I2
Formula: HgO
Formula: Hg(NO3)2
Formula: #
Formula: #
Formula: K2.[Hg(CN)4]
Formula: AgHgI3
Formula: C36H70HgO4
Formula: HgS
Formula: HgTe
Formula: ClHgO4
Formula: C2F3HgO2
Formula: Hg
Formula: HgN2O6
Formula: CHgINS
Formula: C36H66HgO4
Formula: C26H22HgN8S2
Formula: C30H42HgO18S2
Formula: C5H11ClHgN2O2
Formula: C12H8HgN2O6
Formula: C8H8HgN2O4
Formula: C10H16HgN2O2S4
Formula: C2HgO4
Formula: Hg3O6S
Formula: C2F6HgS2
Formula: BrHgO3
Formula: C4H4Cl2HgO4
Formula: C2H3HgO2
Formula: #
Formula: #
Formula: HgI2
Formula: C2H6HgO6S2
Formula: Hg3O8P2
Formula: C2F6HgO6S2
Formula: C15H7Cl6HgNO2
Formula: #
Formula: C6H7ClHgN2O2
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C33H43N5O5
Formula: #
Formula: C20H18O7
Formula: #
Formula: C7H8N2
Formula: C3H8HgO2
Formula: C17H25N3O5S
Formula: C17H25N3O5S
Formula: C9H15NO2
Formula: #
Formula: C80H128N20O21S4
Formula: C13H17HgNO6
Formula: #
Formula: C47H61N4O14P
Formula: C10H11HgI2NaO3S
Formula: C15H20O3
Formula: #
Formula: C6H13NO4S.H2O
Formula: C6H12NNaO4S
Formula: C5H10N4O2
Formula: C5H6O4
Formula: C33H45NO11
Formula: C11H18ClNO3
Formula: C17H21NO3
Formula: C17H23NO3
Formula: C50H70O6
Formula: C10H12O
Formula: CH3COCH2C(CH3)2COOH
Formula: C6H10O
Formula: C18H2D20O
Formula: C11H13N
Formula: C11H13ClO
Formula: C9H11Cu
Formula: C9H11NO2.H
Formula: C9H12
Formula: C11H12O3
Formula: C2H5NaO3S2
Formula: C4H12N2O2
Formula: C4H6Br4
Formula: C16H20N2O2
Formula: C14H14N4O4
Formula: C16H14F6N2
Formula: C14H14O2
Formula: C14H16N2
Formula: #
Formula: C12H18N4O4
Formula: C4H10O2
Formula: C4H4Br2O4
Formula: C4H4Br2O4
Formula: 4028-56-2
Formula: C6H10O4
Formula: C20H22O4
Formula: #
Formula: #
Formula: C6H8Na2O4S2
Formula: C22H22Cl2SiZr
Formula: C20H16Cl2Zr
Formula: #
Formula: C28H36N4
Formula: C44H38N8
Formula: C48H30N4O8
Formula: C72H66N8O12S4
Formula: #
Formula: C60H36N4Pd1
Formula: C33H38N4O6
Formula: C18H18N4O2
Formula: C17H21N5O9S2
Formula: C22H32N2
Formula: C14H13NO7S
Formula: C14H13NO7S
Formula: C3H2O5
Formula: C3H5NaO6
Formula: C25H30O4S
Formula: C9H13BrN2O2
Formula: C21H26O2
Formula: C14H10O5
Formula: #
Formula: C19H24N2O4S
Formula: C7H10N2O5S2
Formula: C14H12S2
Formula: C19H27ClN2O5S
Formula: C30H39N5O7S
Formula: C8H16N2O3S
Formula: C22H36Cl2Ru2S2 10*
Formula: #
Formula: C29H40N6O8S
Formula: C39H59N13O9S
Formula: C42H56N10O9S
Formula: C27H36N6O6S
Formula: C44H59N13O10S
Formula: C20H31N3O4S
Formula: C61H94N18O13S
Formula: C34H46N6O6S
Formula: #
Formula: #
Formula: C12H18O4
Formula: #
Formula: H3O9P3
Formula: C7H9NO
Formula: C20H28O4
Formula: BHO2
Formula: C13H9Br2NO2
Formula: C13H20N2O2
Formula: C17H28N2O3
Formula: C18H18BrClN2O
Formula: C22H22N2O8.HCl
Formula: #
Formula: C8H11NO3.C5H7NO3
Formula: #
Formula: C24H16F6N4O2
Formula: C14H21N3O3S
Formula: #
Formula: C23H25ClN8O3S
Formula: #
Formula: C15H21NO4
Formula: C23H33MnN5O4S8Zn
Formula: C15H21NO4
Formula: (C2H4O)n
Formula: C8H16O4
Formula: C7H14N4S2
Formula: C75H117N28O37Se7
Formula: #
Formula: C11H18N2O3S
Formula: C2H4NNaS2
Formula: C11H11N3O
Formula: C11H15NO
Formula: C23H18ClFN2O4
Formula: C10H10N4O
Formula: C26H32MgN6O8S2
Formula: C10H14N2
Formula: C18H16N4O7S2?Na
Formula: C24H20N4O7S2?Na
Formula: C6H7NO3S
Formula: #
Formula: C19H23NO5
Formula: #
Formula: CeH6O9P3
Formula: H4O6P2Zn
Formula: LiO3P
Formula: AgO3P
Formula: CaNaO9P3
Formula: #
Formula: C16H18N2
Formula: C9H13NO2.C4H6O6
Formula: C19H22O6
Formula: H2O3Sn
Formula: C6H15O3PS2
Formula: #
Formula: C11H17NO2
Formula: C12H15NO3
Formula: C14H16ClN3O
Formula: C15H21BrNO
Formula: #
Formula: C18H25N5O4
Formula: C17H16O3
Formula: C20H31NO2
Formula: #
Formula: C17H22ClN3O
Formula: #
Formula: C12H10NaO6
Formula: #
Formula: C17H25NO2
Formula: C4H11N5.HCl
Formula: C4H11N5
Formula: C10H11N3OS
Formula: C8H18BrNO2
Formula: C8H18ClNO2
Formula: C7H13O5PS
Formula: #
Formula: C10H10N4O4
Formula: C4H6O
Formula: C4H9NO5S
Formula: C4H7NO
Formula: C7H15NOSi
Formula: C4H9NO5S
Formula: C4H5O2
Formula: C4H9NO2
Formula: C8H10NiO4
Formula: C8H10O4Sr
Formula: C16H18O6
Formula: C9H18NO2.Cl
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C14H20O2
Formula: #
Formula: C21H37NO6
Formula: (C5H8O2)x
Formula: #
Formula: #
Formula: #
Formula: C8H12O2
Formula: C18H32N2O6
Formula: C4H6O2
Formula: C8H10O3
Formula: #
Formula: C16H15O2Sb
Formula: C11H22O5Si
Formula: C8H16GeO2
Formula: C14H34O5Si4
Formula: C9H20O3Si2
Formula: #
Formula: C13H23NO5Si
Formula: C16H25ClN2O
Formula: C4H5ClO
Formula: #
Formula: C4H5FO
Formula: C9H13FO3
Formula: #
Formula: C15H22ClNO2
Formula: C7H10O2
Formula: C11H24N2O5S
Formula: C16H25NO5S
Formula: C22H22N2O8
Formula: C29H42IN2O4
Formula: #
Formula: #
Formula: C21H24D3NOHCl
Formula: C18H22O3
Formula: C6H10O2
Formula: C7H10O2
Formula: C4H8O
Formula: C5H7N
Formula: C5H7NS
Formula: C4H8S
Formula: C8H12O2
Formula: C10H12O
Formula: C8H14S
Formula: C8H14Cl2Ni2
Formula: C10H12S
Formula: #
Formula: C12H16ClN3O4S3
Formula: C2H4NNaS2
Formula: C2H8NO2PS
Formula: #
Formula: C17H19N3O4S
Formula: CHD3O
Formula: C2D6O4S
Formula: C3H5F4N
Formula: C3H5F4N
Formula: C7H17NO
Formula: C7H14N2
Formula: C8H9N3S
Formula: C13H16N2O
Formula: C13H16N2O
Formula: C8H11NO2
Formula: C6H9N3O2
Formula: C7H15NO
Formula: C9H12N2
Formula: C9H12N2
Formula: C8H15N
Formula: C7H10N2
Formula: C13H17NO
Formula: C7H8N2O
Formula: C7H8N2O
Formula: C6H7NOS
Formula: C10H17N
Formula: C6H12N2S
Formula: C5H10N2S
Formula: C7H8N2O
Formula: C7H12N2
Formula: C7H12N2
Formula: C9H9N
Formula: C5H7Cl2N
Formula: C11H15NO3
Formula: C8H7NO2
Formula: C8H10N2
Formula: C11H11NO
Formula: C11H15N
Formula: C9H14N2
Formula: C8H10N2O
Formula: C8H10N2O
Formula: C10H13NO
Formula: C7H13N3S
Formula: C7H12N2
Formula: C6H8N2
Formula: C6H8N2
Formula: C8H11NO2
Formula: C3H10N2S2
Formula: CH6N2O3
Formula: C20H23N5
Formula: #
Formula: #
Formula: C26H40O4
Formula: CH4
Formula: CH3D
Formula: CH3N3O2S
Formula: #
Formula: #
Formula: CH4
Formula: CHD3
Formula: CHD3S
Formula: CD4
Formula: C16H64Br2
Formula: C2H8Sr5
Formula: CH5NO3
Formula: CH4U
Formula: CH8Cl2N2
Formula: C5H14N2O2
Formula: C5H8N4
Formula: C4H11N3O2
Formula: C6H16N2O
Formula: C5H14N2O2
Formula: C5H10N4S
Formula: CH2N2
Formula: CH4O2
Formula: C10H10N2O2
Formula: C6H8N2O2
Formula: C8H9FO2
Formula: C8H9FO2
Formula: C4H7N3O2
Formula: C7H7NO4
Formula: C7H7NO4.H
Formula: C5H5NO5
Formula: C8H8N2O2
Formula: C10H8O2
Formula: C6H7NO2
Formula: C6H7NO2
Formula: C6H7NO2
Formula: C10H16O4
Formula: C8H8O3
Formula: CH4O6S2
Formula: CH2Cl2O4S2
Formula: C19H33PS2
Formula: C9H13N3
Formula: C6H14N4
Formula: C10H12N4S
Formula: CH2Se
Formula: CH4O2Se
Formula: CH3Se
Formula: C6H8N2S
Formula: #
Formula: C3H8N2O2S
Formula: C6H13NO4S
Formula: #
Formula: C3H5NOS
Formula: CH5NO2S
Formula: C7H5F4NO2S
Formula: C7H5F4NO2S
Formula: C7H6F3NO3S
Formula: CHF3N2O4S
Formula: CF3N2O4S
Formula: C6H13N3O2S
Formula: C5H9N3O2S
Formula: C8H5F3N2O2S
Formula: C9H13NO3S
Formula: C8H5F3N2O2S
Formula: C9H6F3NO2S
Formula: C5H9N3O2S
Formula: C11H14N2O3S2
Formula: C12H16N2O3S2
Formula: C4H7NO4S
Formula: C7H11NO7S
Formula: C4H6N2O3S
Formula: C2HF3N2O2S
Formula: C11H11NO2S
Formula: C11H11NO2S
Formula: C8H11NO3S
Formula: C8H12N2O4S
Formula: C32H61NO6S
Formula: C20H22N2O7S2
Formula: C21H31NO4S
Formula: C18H21NO3S
Formula: C4H10O3S
Formula: C5H12O3S
Formula: #
Formula: C3H7FO3S
Formula: C6H14O4S
Formula: #
Formula: C5H12O3S
Formula: C6H9F5O3S
Formula: C7H8NNaO3S
Formula: C5H12O3S
Formula: C2H6CaO6S2
Formula: C23H46O3S
Formula: CH6N2O2S
Formula: C2H6MgO6S2
Formula: CH3KO3S
Formula: C4H10O3S
Formula: C5H12O3S
Formula: C3H7NO3S2
Formula: C22H28F3N3O5S
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C13H21NO3S
Formula: C13H21NO3S
Formula: C11H19NO3S
Formula: C16H23N7O6S2
Formula: C18H26N6O6S2
Formula: C18H23F3N6O6S2
Formula: C24H27NO5S
Formula: C24H30N2O4S
Formula: C23H32N2O4S3
Formula: C35H42N6O6S2
Formula: C15H25N3O5S
Formula: C23H25N3O6S2
Formula: CH4O3S
Formula: #
Formula: CH3NaO2S2
Formula: #
Formula: CH3ClO2S
Formula: CH3FO2S
Formula: C7H14O5S
Formula: C3H6O4S
Formula: #
Formula: #
Formula: #
Formula: C5N4
Formula: #
Formula: C3H3N3S2
Formula: C3H3N3S2
Formula: C6H13NS
Formula: C9H8N2OS
Formula: C4H6O2S
Formula: C8H6N2OS
Formula: C8H5NOS2
Formula: C3H6OS
Formula: C8H7NS3
Formula: CH3NaO2S2
Formula: C7H10O6
Formula: C10H17N3O2
Formula: C7H10O6
Formula: CH4O9S3
Formula: CH3N3
Formula: CH3N
Formula: CsI
Formula: C10H10N6O2
Formula: C8H16N2
Formula: C10H12N4
Formula: C7H12N2O
Formula: C7H11N3O
Formula: C7H11N3O
Formula: C8H13N3O
Formula: C6H10N4
Formula: C7H10N4
Formula: C7H10N4
Formula: C5H12N2O2
Formula: C8H14N4
Formula: C6H10N4O
Formula: C7H9N5
Formula: C6H9N3
Formula: C7H7FN2O
Formula: C6H14N2O
Formula: C6H14N2O
Formula: C6H9N3O2
Formula: C9H10N2O
Formula: C6H7N3O
Formula: C7H10N4
Formula: C7H8N4O
Formula: C7H9N3
Formula: C6H8N4
Formula: C10H11N3OS
Formula: C4H6N4S
Formula: C10H10FN3S
Formula: C6H15N3
Formula: C8H11ClN4O
Formula: C6H10N4
Formula: C8H7N3S
Formula: C10H11N3S
Formula: C11H13N3S
Formula: C8H7N3OS
Formula: C8H14N2
Formula: C6H7N3
Formula: C11H10N4
Formula: C5H6N4
Formula: C11H10N4
Formula: #
Formula: #
Formula: C8H7N3OS
Formula: C12H13N3
Formula: C7H6N4
Formula: C9H10N4O
Formula: C9H9N3OS
Formula: C9H9N3O2S
Formula: C9H9N3OS
Formula: C5H7N3OS
Formula: C5H7N3OS
Formula: C7H9N3O2
Formula: C9H13N3O2
Formula: C9H9N3O
Formula: C5H8N4S
Formula: #
Formula: C8H8FNO
Formula: C5H6N6
Formula: C5H6N6
Formula: C6H6N4O
Formula: C10H10N2OS
Formula: C5H6N2S2
Formula: #
Formula: CH2D2O
Formula: CH4BCl3O
Formula: 2(CH3O).Mg
Formula: #
Formula: C10H12O
Formula: C10H12O
Formula: C10H12O
Formula: C5H11NO3
Formula: C9H10O2
Formula: C9H8O
Formula: C5H8O3S-2
Formula: C5H14N2O2
Formula: C6H16N2O2
Formula: C5H8N2OS
Formula: C8H10N2O
Formula: C5H14N2O3
Formula: C8H12N4O2
Formula: C8H12N4O2
Formula: C9H7NO
Formula: C9H7NO
Formula: C8H7FO2
Formula: CH4O
Formula: CH4O
Formula: CH4O
Formula: CD4O
Formula: CH7O5P
Formula: CH3OH
Formula: #
Formula: C8H10N2O
Formula: C20H19ClN2O3
Formula: C10H8ClFO
Formula: C14H15NO
Formula: C10H8F2O
Formula: C11H11FO2
Formula: C11H11FO
Formula: #
Formula: C13H10Cl2N2O
Formula: C10H7F3O
Formula: C13H12O3
Formula: C13H12O3
Formula: C14H14N2OS
Formula: C15H15NO
Formula: C6H2Cl2O
Formula: #
Formula: C12H13NO3
Formula: C11H11NOS
Formula: C13H18N3O2-
Formula: C18H20N3O2-
Formula: C10H8ClFO
Formula: C11H11N3OS
Formula: C7H5NO3
Formula: C27H23NO6
Formula: C26H21NO5
Formula: C19H17NO2
Formula: C30H23NO5
Formula: C19H12FNO4
Formula: #
Formula: C15H12O4
Formula: C8H12O3
Formula: C8H6N2OS
Formula: C13H16N2O
Formula: C13H21FO
Formula: C12H15NO2
Formula: C8H8N2O
Formula: C15H9F3N2OS2
Formula: C7H4N2O3
Formula: C7H10N4
Formula: C14H19N3S
Formula: C40H50N6O12S2
Formula: C16H15ClN2O
Formula: C16H7D7N2O
Formula: C5H8O2
Formula: #
Formula: C13H15NO2
Formula: C9H11NO4S2
Formula: C5H8N4O3S2
Formula: C18H20N2S
Formula: C9H16Cl2N4
Formula: C9H9NO3.C6H12N4
Formula: #
Formula: C14H20N4O3
Formula: C22H32O3
Formula: C27H42O3
Formula: C16H23NO2
Formula: C12H14N2O2
Formula: C14H15NO2
Formula: C17H19N2NaO6S
Formula: C6H11N2O4PS3
Formula: #
Formula: C4H6N2S
Formula: C11H15NO3S
Formula: C19H24N2S2
Formula: C5H12N2OS
Formula: C10H20CuN2O4S2
Formula: #
Formula: C44H60N10O11S
Formula: C12H14N2OS2
Formula: C5H13N3OS
Formula: C41H61N11O10S
Formula: #
Formula: C52H80N14O11S2
Formula: C50H71N15O11S
Formula: C74H121N21O14S
Formula: #
Formula: C24H28N2O4S2
Formula: C12H17ClN5S
Formula: C12H19N2NaO2S2
Formula: C20H23NS.HCL.H2O
Formula: C11H15NO5
Formula: #
Formula: C36H62N4O2.4(HCl)
Formula: C36H63ClN4O2
Formula: C11H10Cl2N4
Formula: C14H17N2NaO3
Formula: C3H7NOS
Formula: C6H12N2O3S
Formula: C11H15NO2
Formula: C39H44ClN3O13S
Formula: C19H34O3
Formula: C16H28O3
Formula: C22H26N2O5S
Formula: C11H21N5OS
Formula: C18H24BrNO4