Phone (USA) +1 212-348-5610
Whatsapp: +1 516-336-9307
WeChat: chembuyersguide
Chemical Search

Conier Chem&Pharma Limited.

Country: China

11F,#5 Building,
Asia pacific enterprise valley,
Chongqing, China.

Phone: +86-23-62922305
Phone 2: +86-139 9626 9627
FAX: +86-23-62457927
E-Mail:E-Mail this Supplier

Conier Chem&Pharma Limited.

Page: Home | 1 | 2 | 3 | 4 | 5 | 6 | 7 | 8 | 9 | 10 | 11 | 12 | 13 | 14 | 15 | 16 | 17 | 18 | 19 | 20 | 21 | 22 | 23 | 24 | 25 | 26 | 27 | 28 | 29 | 30 | 31 | 32 | 33 | 34 | 35 | 36 | 37 | 38 | 39 | 40 | 41 | 42 | 43 | 44 | 45 | 46 | 47 | 48 | 49 | 50 | 51 | 52 | 53 | 54 | 55 | 56 | 57 | 58 | 59 | 60 | 61 | 62 | 63 | 64 | 65 | 66 | 67 | 68 | 69 | 70 | 71 | 72 | 73 | 74 | 75 | 76 | 77 | 78 | 79 | 80 | 81 | 82 | 83 | 84 | 85 | 86 | 87 | 88 | 89 | 90 | 91 | 92 | 93 | 94 | 95 | 96 | 97 | 98 | 99 | 100 | 101 | 102 | 103 | 104 | 105 | 106 | 107 | 108 | 109 | 110 | 111 | 112 | 113 | 114 | 115 | 116 | 117 | 118 | 119 | 120 | 121 | 122 | 123 | 124 | 125 | 126 | 127 | 128 | 129 | 130 | 131 | 132 | 133 | 134 | 135 | 136 | 137 | 138 | 139 | 140 | 141 | 142 | 143 | 144 | 145 | 146 | 147 | 148 | 149 | 150 | 151 | 152 | 153 | 154 | 155 | 156 | 157 | 158 | 159 | 160 | 161 | 162 | 163 | 164 | 165 | 166 | 167 | 168 | 169 | 170 | 171 | 172 | 173 | 174 | 175 | 176 | 177 | 178 | 179 | 180 | 181 | 182 | 183 | 184 | 185 | 186 | 187 | 188 | 189 | 190 | 191 | 192 | 193 | 194 | 195 | 196 | 197 | 198 | 199 | 200 | 201 | 202 | 203 | 204 | 205 | 206 | 207 | 208 | 209 | 210 | 211 | 212 | 213 | 214 | 215 | 216 | 217 | 218 | 219 | 220 | 221 | 222 | 223 | 224 | 225 | 226 | 227 | 228 | 229 | 230 | 231 | 232 | 233 | 234 | 235 | 236 | 237 | 238 | 239 | 240 | 241 | 242 | 243 | 244 | 245 | 246 | 247 | 248 | 249 | 250 | 251 | 252 | 253 | 254 | 255 | 256 | 257 | 258 | 259 | 260 | 261 | 262 | 263 | 264 | 265 | 266 | 267 | 268 | 269 | 270 | 271 | 272 | 273 | 274 | 275 | 276 | 277 | 278 | 279 | 280 | 281 | 282 | 283 | 284 | 285 | 286 | 287 | 288 | 289 | 290 | 291 | 292 | 293 | 294 | 295 | 296 | 297 | 298 | 299 | 300 | 301 | 302 | 303 | 304 | 305 | 306 | 307 | 308 | 309 | 310 | 311 | 312 | 313 | 314 | 315 | 316 | 317 | 318 | 319 | 320 | 321 | 322 | 323 | 324 | 325 | 326 | 327 | 328 | 329 | 330 | 331 | 332 | 333 | 334 | 335 | 336 | 337 | 338 | 339 | 340 | 341 | 342 | 343 | 344 | 345 | 346 | 347 | 348 | 349 | 350 | 351 | 352 | 353 | 354 | 355 | 356 | 357 | 358 | 359 | 360 | 361 | 362 | 363 | 364 | 365 | 366 |

Product List

Formula: C9H16O4
Formula: #
Formula: #
Formula: C9H16O4
Formula: C10H18N2O5
Formula: #
Formula: C29H24O10
Formula: C7H8D4O4
Formula: C7H10Cl2O2
Formula: C7H16N2O
Formula: C7H15NO2
Formula: C7H9NO2
Formula: #
Formula: C7H11NO2
Formula: C7H10ClNO
Formula: C10H19N
Formula: C7H13N
Formula: C9H19NS
Formula: #
Formula: C7H13O2
Formula: C17H30O2
Formula: C27H50O6
Formula: C22H42O7
Formula: #
Formula: C17H27NO2
Formula: #
Formula: C11H22O2
Formula: C27H54O2
Formula: #
Formula: C12H24O2
Formula: #
Formula: C17H20O4
Formula: C11H22O2
Formula: #
Formula: #
Formula: C25H50O2
Formula: #
Formula: #
Formula: C7H16N2O2
Formula: C7H16N2O2
Formula: C7H16N2O2
Formula: C8H17NO2
Formula: C8H17NO2
Formula: C8H17NO2
Formula: C7H14FNO2
Formula: C7H14FNO2
Formula: C7H14FNO2
Formula: C7H14FNO2
Formula: C7H14FNO2
Formula: C7H14FNO2
Formula: C7H14FNO2
Formula: C7H15NO3
Formula: C7H14FNO2
Formula: C7H14FNO2
Formula: C7H16N2O2
Formula: C7H16N2O2
Formula: C7H16N2O2
Formula: C7H16N2O2
Formula: C12H26O4
Formula: C26H50O9
Formula: C7H14O2
Formula: C14H26O3
Formula: C7H11D3O2
Formula: C7HD13O2
Formula: #
Formula: C13H18O
Formula: C7H13ClO
Formula: #
Formula: C13H24N2O3
Formula: C30H18
Formula: S7Se
Formula: C37H74O
Formula: C18H25N
Formula: #
Formula: C25H46O2
Formula: C25H44O2
Formula: C15H20Cl2O3
Formula: C15H29NO6
Formula: C21H35NO9
Formula: C14H20ClNO2
Formula: C11H17NO2
Formula: C9H18O3
Formula: C12H24O2
Formula: C15H22O2
Formula: C9H18O2S
Formula: C12H24O2
Formula: C16H25NO2
Formula: C14H21NO2
Formula: C14H20O3
Formula: C15H22O3
Formula: C12H24ClNO3
Formula: C9H18O2
Formula: C11H22O2
Formula: C17H34O2
Formula: C15H30O2
Formula: C8H15ClO2
Formula: C16H22O2
Formula: C14H26O2
Formula: C8H16O2
Formula: C14H28O2
Formula: C23H46O2
Formula: C7H16O4S
Formula: C7H16O2
Formula: C8H15NS
Formula: #
Formula: C25H50O2
Formula: C25H48O2
Formula: C12H24O2
Formula: C10H18O2
Formula: C10H20O2
Formula: C14H20O3
Formula: C8H15NS
Formula: C18H34O2
Formula: C13H26O6
Formula: C9H17O2-
Formula: C7H17N
Formula: C12H22O
Formula: C7H18N2
Formula: C7H18N2.HCl
Formula: #
Formula: C9H20O2
Formula: C11H22O
Formula: C25H30P.Br
Formula: #
Formula: C8H18N2O
Formula: C21H25NO
Formula: C16H14O5
Formula: C16H16O6
Formula: C27H34O15
Formula: C22H26O11
Formula: C19H20O6
Formula: C16H14O4
Formula: C11H6O4
Formula: C10H18O
Formula: C27H30O17
Formula: C15H10O7
Formula: #
Formula: #
Formula: C23H29N5O10
Formula: C23H29N5O11
Formula: C18H23N5O9
Formula: C30H42N2O9
Formula: C29H40N2O9
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C15H24O2
Formula: #
Formula: #
Formula: C102H151N25O30
Formula: #
Formula: #
Formula: #
Formula: C29H30O9
Formula: C20H20O6
Formula: C183H296N54O61S
Formula: #
Formula: C29H32N4O3S
Formula: C22H24O11
Formula: C22H24O11
Formula: #
Formula: C16H16O6
Formula: C16H14O6
Formula: C29H36O15
Formula: C28H34O15
Formula: C16H11D3O6
Formula: C19H23N3O4S
Formula: #
Formula: C27H30O8
Formula: C11H6F3NO3
Formula: C30H46O6
Formula: C18H22BrNO3S
Formula: C36H38O20
Formula: C40H58N8O8
Formula: #
Formula: C20H27NO2
Formula: C20H25NO
Formula: C20H27NO
Formula: C20H25NO
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C18H20O2
Formula: C33H24O10
Formula: C188H282N60O68S8
Formula: C6H12O
Formula: C20H36
Formula: C12H14
Formula: C8H12O4
Formula: C6H6O3
Formula: C7H8O3
Formula: C6H10O2
Formula: C6H10N2O4
Formula: C6H9NO4S
Formula: C10H14O3
Formula: C15H18O2
Formula: C8H14O2
Formula: C10H18O2
Formula: C7H12O2
Formula: C12H22O2
Formula: #
Formula: #
Formula: C6H8O
Formula: C6H10O
Formula: #
Formula: #
Formula: C6H10O
Formula: C6H10O
Formula: C6H10O
Formula: C12H16O
Formula: C6H8O
Formula: C6H10O
Formula: C12H18Ir3O13.C2H3O2.3(H2O)
Formula: C42H74O36
Formula: C36H66Sn2
Formula: C6H6
Formula: C6H8
Formula: C6H6O2
Formula: C6H6O2
Formula: C12H10
Formula: C6H8O
Formula: C6H10O
Formula: C7H10O2
Formula: C24H54Sn2
Formula: C18H42N3P
Formula: C24H32O15
Formula: C18H26O12
Formula: Co3H54N18O8P2
Formula: Br2H18N6Ni
Formula: CoCl3.6(NH3)
Formula: #
Formula: CoH14N7O3
Formula: H18I2N6Ni
Formula: B2F8H18N6Ni
Formula: C2H20N6NiO4
Formula: Cl2H18N6Ni
Formula: (NH3)6.RhCl3
Formula: Cl8H18N6RuZn2
Formula: CL3H18N6Ru
Formula: H18I3N6Ru
Formula: Cl2H18N6Ru
Formula: (NH4)6.Mo7O24
Formula: H24N6O12PtS4
Formula: H8N2O4W
Formula: #
Formula: H36N6O18W3
Formula: C48H24
Formula: C42H18
Formula: #
Formula: C12H4Br6
Formula: C12H18Br6
Formula: C6H6Br6
Formula: #
Formula: #
Formula: C2Br6
Formula: C18H30Br6O2
Formula: C40H72O12S3Sn
Formula: C6Cl4O6Ru2
Formula: C6H12O6V
Formula: C26H16
Formula: C4Cl6
Formula: C3Cl6O
Formula: C3H9Cl6OSb
Formula: C6Cl6
Formula: Cl6Cr
Formula: C4Cl6
Formula: C5Cl6
Formula: C5H4Cl6
Formula: C3F2Cl6
Formula: C12H4Cl6O
Formula: Cl6Si2
Formula: AU55[P(C6H5)3]12CL6
Formula: C2Cl6
Formula: H2IrCl6.6(H2O)
Formula: C13H6Cl6O2
Formula: Cl6Ru
Formula: C33H30Cl6Fe2N6O3
Formula: C14H17Cl2N3O
Formula: C60H122
Formula: #
Formula: #
Formula: #
Formula: C26H52
Formula: #
Formula: #
Formula: C26H52O
Formula: C26H54O2
Formula: C26H50O4
Formula: C26H52O2
Formula: #
Formula: C36H62N2O1
Formula: #
Formula: C26H44O2
Formula: C36H62O4
Formula: C30H58O2
Formula: C29H56O2
Formula: C6CrK3N6
Formula: C12H36N6O12S3
Formula: C26H34O9
Formula: C10H10
Formula: C10H10
Formula: C11H9ClO
Formula: #
Formula: C16H20O3
Formula: C16H32O6S2
Formula: C16H30O
Formula: C20H36O4
Formula: C20H36O4
Formula: C16H30
Formula: C16H28O2
Formula: C18H28O2
Formula: Al16BaMg2O27
Formula: C16O16Rh6
Formula: #
Formula: C18H32O2
Formula: C16H31O4P
Formula: C10H2F16O4
Formula: #
Formula: #
Formula: C20H38GaNOSi
Formula: #
Formula: #
Formula: C80H136N8O24
Formula: C21H44O3
Formula: C64H132O4Ti
Formula: C16H34O
Formula: C16H32O
Formula: C16H34O
Formula: C18H40ClN
Formula: C16H32O
Formula: #
Formula: C16H33NO
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C16H34
Formula: #
Formula: C16H34
Formula: C16H33D
Formula: C16H33NaO3S
Formula: C16H34
Formula: C16H30O4
Formula: C18H34O4
Formula: #
Formula: #
Formula: C16H31N
Formula: #
Formula: C16H34S
Formula: C16H31O2
Formula: C16H32O2
Formula: #
Formula: #
Formula: C35H68O5
Formula: C37H74NO8P
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C36H72O5
Formula: #
Formula: #
Formula: C16H34N2O
Formula: C16H31LiO2
Formula: C16H31KO2
Formula: C26H42N2O
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C35H67Na2O8P
Formula: C48H82O20
Formula: C50H84O21
Formula: C65H110O30
Formula: C45H78O20
Formula: C48H82O20
Formula: #
Formula: #
Formula: #
Formula: C30H46Cl6O9
Formula: C29H52O5
Formula: C16H32O2
Formula: C16H31DO2
HEXADECANOIC-15,15,16,16,16-D5 ACID
Formula: C16H30D2O2
Formula: C16D31NaO2
Formula: #
Formula: #
Formula: C36H52N2Na16O70S16
Formula: C27H34N2Na16O70S16
Formula: #
Formula: C16H30O
Formula: C16H32
Formula: #
Formula: #
Formula: C16H33O4P
Formula: C34H64O2
Formula: C20H39NO2
Formula: C25H40O2
Formula: C34H66O2
Formula: C34H69O4P
Formula: C21H36N2O4
Formula: C48H66N2O5
Formula: C34H68O2
Formula: C28H47Cl2NO2
Formula: C24H47NO6
Formula: C30H53NO9
Formula: C18H35ClO2
Formula: C24H48O2
Formula: C23H38O3
Formula: C42H80O4
Formula: C18H36O2S
Formula: C23H38O5
Formula: C31H54O3
Formula: C48H66N2O5
Formula: C20H38O3
Formula: C20H41NO2
Formula: #
Formula: C40H52ClN5O7
Formula: C20H39ClO2
Formula: C24H48O2
Formula: C25H54NO4P
Formula: C19H36O2
Formula: C22H44O6
Formula: C26H52O2
Formula: C28H43O4P
Formula: C32H64O2
Formula: C20H38O5
Formula: C20H45NO6S
Formula: C16H34O4S
Formula: C17H33NS
Formula: C19H38O3
Formula: CH3SO3(CH2)15CH3
Formula: C17H36O2S2
Formula: C20H44NO5P
Formula: C32H42Cl4N4O3
Formula: C22H37NO2
Formula: C34H68O2
Formula: C42H74O4
Formula: C24H48O2
Formula: C16H35O4P
Formula: C19H38O2
Formula: C30H60O2
Formula: C19H42BrN
Formula: C19H42N.Cl
Formula: C19H42FN
Formula: C19H42IN
Formula: C28H40Na2O7S2
Formula: C24H50ClNO
Formula: C20H44ClNO
Formula: C21H42
Formula: C19H9BrD33N
Formula: C36H74ClN
Formula: C36H76ClN
Formula: C18H40ClN
Formula: C21H41NO3
Formula: C22H46N
Formula: C19H42ClN
Formula: C22H49NO4S
Formula: C32H55BrN4O
Formula: C28H54O11
Formula: C16H36ClN
Formula: C22H38
Formula: C20H41NO2
Formula: C16H35BO2
Formula: C27H60ClNO3Si
Formula: C18H39NO
Formula: #
Formula: C16H34S
Formula: C22H48O3Si
Formula: C19H42O3Si
Formula: C19H42N.OH
Formula: C20H45NO4S
Formula: C19H42N2O2
Formula: C70H144BrN
Formula: C34H48BrP
Formula: C6D6O
Formula: C18H30
Formula: C19H33N
Formula: C12H30O6Si2
Formula: C14H30O6
Formula: C12H31NSi2
Formula: C12H30O13P4
Formula: C18H30
Formula: C12H30O3Si3
Formula: C12H30Ge2
Formula: C12H30OSi2
Formula: #
Formula: C19H32O7
Formula: C22H46O7
Formula: C24H50O7
Formula: C20H42O7
Formula: C26H54O7
Formula: C12H26O7
Formula: C13H28O7
Formula: C12H30N3OP
Formula: C16H8Cl2F6N2O3
Formula: #
Formula: C21H14F6O4
Formula: C4Cl4F6
Formula: C4F6
Formula: C4Cl4F6
Formula: C15H10F6
Formula: C6H2F12O2
Formula: C4F6O
Formula: C4F6
Formula: C7H6F6O2
Formula: C3H2F6O
Formula: C3H2F6O
Formula: AsF6Li
Formula: AgAsF6
Formula: C5H5F6NO2
Formula: C6F12N2
Formula: C3F6O.3(H2O)
Formula: C3F6O
Formula: C10H2F12O4Zn
Formula: AsF6H13O6
Formula: C11H14AsF6N3
Formula: AsF6H
Formula: C18H15AsF6S
Formula: C4H8N2
Formula: C4F6
Formula: F6OSi2
Formula: C2F6
Formula: C5H4F6N2O2
Formula: C5H2F6O4
Formula: C5F6O3
Formula: C5Cl2F6O2
Formula: C5F8O2
Formula: F6Fe
Formula: C4H2F6
Formula: C6H3F7O2
Formula: C4H4F6O
Formula: C4H4F6O
Formula: C4HF9O3S
Formula: C6H7F6NO2
Formula: F6Os
Formula: F6P-
Formula: HPF6
Formula: F6Pu
Formula: C9F18
Formula: C9F18
Formula: C6F12
Formula: C3F6O
Formula: C3F6
Formula: F6Re
Formula: H2SiF6
Formula: #
Formula: H2TiF6
Formula: F6Xe
Formula: H2ZrF6
Formula: C36H42Br2N2
Formula: C24H46O4
Formula: C18H38O13
Formula: C12H20N6O7
Formula: C26H16
Formula: C15H24O
Formula: C4H10N2O2S
Formula: C6H11O8P
Formula: C3H9BN2
Formula: C9H12N6
Formula: C21H39N3
Formula: C9H21N3
Formula: C6H15N3
Formula: C3H6N6O6
Formula: C27H57N3
Formula: C18H39N3
Formula: C21H21N3
Formula: C24H27N3
Formula: C30H60N6
Formula: C15H33N3O3
Formula: C24H21N3O6
Formula: C9H21N3O3
Formula: C24H30Cl3N3
Formula: C4H8N6O5
Formula: C13H22O5
Formula: C22H28O9
Formula: #
Formula: C12H10O2
Formula: C15H17IN2O2S.HCl
Formula: #
Formula: #
Formula: #
Formula: C14H22N2
Formula: C14H22N2.2(HCl)
Formula: C10H19N3O
Formula: C10H16N4
Formula: #
Formula: C9H19NO5S
Formula: C12H20Cl2N2
Formula: C13H18ClNO
Formula: C12H15NOS
Formula: C15H18ClIN2O2S
Formula: #
Formula: C19H30N2O
Formula: C18H28N2O
Formula: C13H19NO2
Formula: C7H13NO
Formula: C10H17NO3
Formula: C9H12O3
Formula: C11H16N2
Formula: C20H41NO
Formula: C10H20N2O2.HCl
Formula: C6H14N2
Formula: C6H13NO
Formula: C6H13NO.HCl
Formula: C7H13NO
Formula: C7H14N2O
Formula: C6H14N2O2S
Formula: C7H13NO2
Formula: #
Formula: C7H11NO
Formula: C7H13N
Formula: #
Formula: C10H16O2S2
Formula: C7H16N4
Formula: C6H15N3
Formula: C26H46N8O2
Formula: #
Formula: C17H28N2O2
Formula: C11H17N2
Formula: #
Formula: #
Formula: #
Formula: C7H12N2O
Formula: C9H16ClO2PS
Formula: #
Formula: #
Formula: #
Formula: C13H26N2O5Si
Formula: C9H14N2O2
Formula: C8H13NO2
Formula: C20H35N3O5
Formula: C28H33N5O8
Formula: C15H17N3O3
Formula: C9H16N2
Formula: #
Formula: C12H21N3O2
Formula: C13H17NO2
Formula: C14H19NO2
Formula: C8H15NO4
Formula: C7H14N2O
Formula: #
Formula: C9H12O2
Formula: C5H10N2O2
Formula: C13H16O2
Formula: C11H16O
Formula: C14H28N2O3
Formula: C16H24N2O3
Formula: C19H30N2O2
Formula: C14H19NO3
Formula: #
Formula: C6H14N2O
Formula: C18H30N2O2
Formula: C9H12O3
Formula: C14H23NO5
Formula: C9H15NO2S
Formula: C9H18ClNO
Formula: C14H18N2O5
Formula: C9H12N2O4S
Formula: C14H25NO5
Formula: #
Formula: C16H21NO3
Formula: C9H15NO3.HCl
Formula: C15H17NO3
Formula: C10H20N2O3
Formula: C11H22N2O2
Formula: C13H16N2O3
Formula: C10H19NO
Formula: C17H21NO
Formula: C10H15NO2
Formula: C22H28N2O
Formula: C7H12ClNO
Formula: C6H10O2
Formula: C6H12N2O2
Formula: #
Formula: #
Formula: C18H29N3O3
Formula: C4H10N2
Formula: C7H12N2O
Formula: C7H13ClN2O
Formula: C11H20N2O2
Formula: #
Formula: C25H42O4
Formula: C21H26O6
Formula: C7H11NO
Formula: C15H20
Formula: C15H20
Formula: C9H15NO3
Formula: C8H13NO
Formula: C10H14
Formula: C8H10O3
Formula: C4H10N2
Formula: C4H10N2.2(HCl)
Formula: C7H12N2O
Formula: C7H10N2O2
Formula: C11H20N2O2
Formula: C20H33NOSi
Formula: #
Formula: C6O6.8(H2O)
Formula: (CH3C6H4S)6C6
Formula: C30H18F48N3O6P3
Formula: C42H18F72N3O6P3
Formula: C54H18F96N3O6P3
Formula: C18H12F30N3O6P3
Formula: C72H132O30
Formula: C60H78Sn2
Formula: #
Formula: C12H12Br6
Formula: C66 H90 O24 P6
Formula: C12H36Ga2N6
Formula: C12H36Al2N6
Formula: C15H30N6O6
Formula: #
Formula: IrN6Na3O12
Formula: C6H22Cl2Cu2N12S6
Formula: C18H54O7Si8
Formula: C96H168O42Si6
Formula: C96H180O30
Formula: C108H192O36
Formula: C72H144O24Si6
Formula: C36 H54 I6 O24
Formula: C14H27O18Ru3
Formula: C42H42BiN9O12
Formula: C9H18O2
Formula: #
Formula: As2Mg6O11
Formula: C12H30Br2N2
Formula: C12H32N2O2
Formula: C12H32N2O2
Formula: C6HD18NSi2
Formula: C6D18OSi2
Formula: C6H18Ge2S
Formula: C9H18O
Formula: C12H18
Formula: C12H18O3
Formula: C6H18O3Si3
Formula: C6H18Ge2
Formula: C6H18Si2
Formula: C6H19NSi2
Formula: C6H18OSi2
Formula: C6H18Sn2
Formula: C40H62O6
Formula: C8H12Cl2O4
Formula: C12H18O4
Formula: C62H100N6O18
Formula: C24H36N6O6
Formula: C16H32O6
Formula: C7H13N5S
Formula: C6H16N2
Formula: C13H26N2S2
Formula: C10H28N2O12P4
Formula: C12H26N2O4
Formula: C6H17ClN2
Formula: C6H19N2O4P
Formula: C6H18Br2N2
Formula: C6H18I2N2
Formula: C6H18N4O6
Formula: C6H18N2O4S
Formula: C6H13N
Formula: C8H14N2
Formula: C6H13IN4
Formula: #
Formula: C12H24CaCl2N8
Formula: C6H13Br3N4
Formula: C6H12N4
Formula: C13H18N2O4
Formula: C13H18F18N3P
Formula: C6H18N3OP
Formula: C6D18N3OP
Formula: C6H18N3P
Formula: C20H26N4O2
Formula: C20H26N4O2.2(C2H6O4S)
Formula: #
Formula: Br3H18N6Ru
Formula: #
Formula: C6H14O
Formula: C8H16O2
Formula: C18H36O2
Formula: C9H16O2
Formula: C6H15N
Formula: C6H13NO3
Formula: #
Formula: #
Formula: C12H18N2O
Formula: C8H12O2
Formula: #
Formula: C7H12O2
Formula: C7H12O2
Formula: C7H10O2
Formula: #
Formula: C8H14O2
HEXANAL, 3-ETHYL-5-OXO-, (3R)- (9CI)
Formula: C8H14O2
Formula: C7H12O2
Formula: C7H12O2
Formula: C6H9NO3
Formula: C6H10O3
Formula: #
Formula: C7H10O2
Formula: C7H13NO2
Formula: C6H12O
Formula: C6H13NO
Formula: C8H16N2O
Formula: #
Formula: C8H18N2O
Formula: C8H14N2O
Formula: C8H14N2O
Formula: C32H38INO4
Formula: C12H20N4O3
Formula: C10H17NO4
Formula: C10H17NO4
Formula: C6H14N2
Formula: C6H14
Formula: C6H14
HEXANE, 1,1,1,2,2,3,3,4,4,5,6,6,6-TRIDECAFLUORO-
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C6D14
Formula: C6H14O3
Formula: C6H16N2
Formula: C6H14O2
Formula: C6H14O5
Formula: C6H14O3
Formula: C6H14O3
Formula: C6H17N3
Formula: C9H11N3
Formula: #
Formula: C6H14O2
Formula: #
Formula: C30H62N2O8
Formula: #
Formula: #
Formula: C6H14
Formula: C6H13FO2S
Formula: C6H14O2
Formula: C8H14O3
Formula: C6H14O2
Formula: C6H14S
Formula: C10H22Cl2N2O4
Formula: C6H14
Formula: C6H14N4O2
Formula: C6H14N4
Formula: #
Formula: C62H129ClN18O
Formula: C61H128Cl2N18
Formula: C6H10O4
Formula: C14H16N2O8
Formula: C14H14N2Na2O14S2
Formula: C18H34O6
Formula: C14H26O6
Formula: C20H22O4
Formula: C22H42O8
Formula: C26H50O4
Formula: C42H82O4
Formula: C22H42O4
Formula: C32H62O4
Formula: C32H62O4
Formula: C11H15NO6
Formula: C14H24O5
Formula: C9H16O4S
Formula: C10H18O4
Formula: #
Formula: C6H12N2O3
Formula: #
Formula: #
Formula: C16H28Br2O8
Formula: C16H26Br4O6
Formula: C22H42O4
Formula: #
Formula: C20H28O10
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C31H63N5O5
Formula: C6H10KO4
Formula: C6H9NaO4
Formula: C18H28Na2O14
Formula: C12H18O6
Formula: C18H28O6
Formula: C52H68N18O32P4
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C38H74O4
Formula: C23H42O10
Formula: #
Formula: C22H44ClN3O9
Formula: C16H32O11
Formula: C36H72O13
Formula: C24H46O4
Formula: C9H14O5
Formula: C13H22O10
Formula: #
Formula: #
Formula: C22H34O10
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C28H46N2O11