Phone (USA) +1 212-348-5610
Whatsapp: +1 516-336-9307
WeChat: chembuyersguide
Chemical Search

Conier Chem&Pharma Limited.

Country: China

11F,#5 Building,
Asia pacific enterprise valley,
Chongqing, China.

Phone: +86-23-62922305
Phone 2: +86-139 9626 9627
FAX: +86-23-62457927
E-Mail:E-Mail this Supplier

Conier Chem&Pharma Limited.

Page: Home | 1 | 2 | 3 | 4 | 5 | 6 | 7 | 8 | 9 | 10 | 11 | 12 | 13 | 14 | 15 | 16 | 17 | 18 | 19 | 20 | 21 | 22 | 23 | 24 | 25 | 26 | 27 | 28 | 29 | 30 | 31 | 32 | 33 | 34 | 35 | 36 | 37 | 38 | 39 | 40 | 41 | 42 | 43 | 44 | 45 | 46 | 47 | 48 | 49 | 50 | 51 | 52 | 53 | 54 | 55 | 56 | 57 | 58 | 59 | 60 | 61 | 62 | 63 | 64 | 65 | 66 | 67 | 68 | 69 | 70 | 71 | 72 | 73 | 74 | 75 | 76 | 77 | 78 | 79 | 80 | 81 | 82 | 83 | 84 | 85 | 86 | 87 | 88 | 89 | 90 | 91 | 92 | 93 | 94 | 95 | 96 | 97 | 98 | 99 | 100 | 101 | 102 | 103 | 104 | 105 | 106 | 107 | 108 | 109 | 110 | 111 | 112 | 113 | 114 | 115 | 116 | 117 | 118 | 119 | 120 | 121 | 122 | 123 | 124 | 125 | 126 | 127 | 128 | 129 | 130 | 131 | 132 | 133 | 134 | 135 | 136 | 137 | 138 | 139 | 140 | 141 | 142 | 143 | 144 | 145 | 146 | 147 | 148 | 149 | 150 | 151 | 152 | 153 | 154 | 155 | 156 | 157 | 158 | 159 | 160 | 161 | 162 | 163 | 164 | 165 | 166 | 167 | 168 | 169 | 170 | 171 | 172 | 173 | 174 | 175 | 176 | 177 | 178 | 179 | 180 | 181 | 182 | 183 | 184 | 185 | 186 | 187 | 188 | 189 | 190 | 191 | 192 | 193 | 194 | 195 | 196 | 197 | 198 | 199 | 200 | 201 | 202 | 203 | 204 | 205 | 206 | 207 | 208 | 209 | 210 | 211 | 212 | 213 | 214 | 215 | 216 | 217 | 218 | 219 | 220 | 221 | 222 | 223 | 224 | 225 | 226 | 227 | 228 | 229 | 230 | 231 | 232 | 233 | 234 | 235 | 236 | 237 | 238 | 239 | 240 | 241 | 242 | 243 | 244 | 245 | 246 | 247 | 248 | 249 | 250 | 251 | 252 | 253 | 254 | 255 | 256 | 257 | 258 | 259 | 260 | 261 | 262 | 263 | 264 | 265 | 266 | 267 | 268 | 269 | 270 | 271 | 272 | 273 | 274 | 275 | 276 | 277 | 278 | 279 | 280 | 281 | 282 | 283 | 284 | 285 | 286 | 287 | 288 | 289 | 290 | 291 | 292 | 293 | 294 | 295 | 296 | 297 | 298 | 299 | 300 | 301 | 302 | 303 | 304 | 305 | 306 | 307 | 308 | 309 | 310 | 311 | 312 | 313 | 314 | 315 | 316 | 317 | 318 | 319 | 320 | 321 | 322 | 323 | 324 | 325 | 326 | 327 | 328 | 329 | 330 | 331 | 332 | 333 | 334 | 335 | 336 | 337 | 338 | 339 | 340 | 341 | 342 | 343 | 344 | 345 | 346 | 347 | 348 | 349 | 350 | 351 | 352 | 353 | 354 | 355 | 356 | 357 | 358 | 359 | 360 | 361 | 362 | 363 | 364 | 365 | 366 |

Product List

Formula: C8H8ClKO
Formula: C6H2ClKN2O7S
Formula: C6H4ClKNO5S
Formula: C6H4ClKO
Formula: C18H29KO3S
Formula: C9H9KO3
Formula: C6H4FKO3S
Formula: C6H4BF4K
Formula: C6H3I2KO4S
Formula: C20H19KN2O7S
Formula: C6H7KO4S
Formula: C6H4IKO3S
Formula: C8H7KO3
Formula: C8H7KO3
Formula: C7H7KO2
Formula: C8H7KO4
Formula: C6H9KO3
Formula: C9H9BF3K
Formula: C7H7KO3S
Formula: C7H7BF3K
Formula: C6H5NO6S.K
Formula: C14H21KO
Formula: C5H6KNO4S3
Formula: C19H15KO4
Formula: C11H13KO2
Formula: C10H13KO
Formula: C14H13KN2O4S4
Formula: C13H10KNO4
Formula: C13H17KN2O4S3
Formula: C21H35KO4
Formula: C12H6Cl3KO2
Formula: C8H5N2S3.K
Formula: C11H8KNO3
Formula: #
Formula: C10H9KN2O4S2
Formula: C5H6KNO3
Formula: #
Formula: C16H18KN3O4S
Formula: C17H14KNO3S
Formula: C13H18KNO4S
Formula: C17H11F3KN3O4S
Formula: C16H10ClKN2O3
Formula: C10H7O4S.K
Formula: C16H10KN3O5
Formula: C14H16KN5O3
Formula: C14H6KNO7S
Formula: C14H6KNO7S
Formula: C14H7KO5S
Formula: C18H35KO4
Formula: C14H7KO8S2
Formula: C14H7KO5S
Formula: C14H7KO5S
Formula: C14H28BO.K
Formula: C2H5KO3
Formula: C2H3KO2
Formula: C5H9KO3
Formula: C2K
Formula: #
Formula: C3H5BF3KO
Formula: AlH7KO5
Formula: H2KN
Formula: C4H10KN3S4
Formula: H4KNO4S
Formula: C6H11OS2.K
Formula: #
Formula: C8H4K2O12Sb2
Formula: C8H10KO13Sb
Formula: C8H4K2O12Sb2.3(H2O)
Formula: AsKO3
Formula: H2KN
Formula: KN3
Formula: #
Formula: C7H5KO2
Formula: C6H4KN3
Formula: C7H5KO7S
Formula: C16H17KN2O4S
Formula: C7H7BF3K
Formula: C3H6KNO2
Formula: C8H7BF3K
Formula: HI2KO6
Formula: KHC2O4
Formula: C16H34KO4P
Formula: C10H22KO2PS2
Formula: F2NO4S2.K
Formula: #
Formula: C6H18KNSi2
Formula: C6H9KO8
Formula: C8F18KNO4S2
Formula: KHSO4
Formula: K2B4O7
Formula: KBH4
Formula: C2BrF2KO2
Formula: C5H9KOS2
Formula: C4H9KO
Formula: C9H17KO4
Formula: C11H13KO3
Formula: C4H10KO4P
Formula: C14H15KO3S
Formula: C4H9BF3K
Formula: C5H9OS2.K
Formula: C2H6AsKO2
Formula: C11H15KO2
Formula: C2H3KN2O3
Formula: CK2O3
Formula: #
Formula: CH2K2O4
Formula: K2CO3
Formula: C16H34O4P.K
Formula: #
Formula: ClKO3
Formula: KCl
Formula: ClKO2
Formula: ClCrKO3
Formula: K2PdCl4
Formula: K2PtCl6
Formula: K2CrO4
Formula: CrKO8S2
Formula: C9H7KO2
Formula: C6H5K3O7
Formula: C8H8KNO5
Formula: C6H5CoKO7
Formula: CoK3N6O12
Formula: C7H7KO
Formula: KOCN
Formula: CKN
Formula: KCN
Formula: CBD3KN
Formula: #
Formula: C10H17KO2
Formula: C7H11KO2
Formula: C7H11KOS2
Formula: C6H11BF3K
Formula: C5H5K
Formula: C6H11BF3K
Formula: C3H5BF3.K
Formula: #
Formula: #
Formula: C8F15KO3S
Formula: C10H19KO2
Formula: C10H21KO4S
Formula: DK
Formula: DKO
Formula: C6H14KO2PS2
Formula: C8H18KO4P
Formula: CH3KN2O
Formula: C14H14KO4P
Formula: #
Formula: C8H18KO2PS2
Formula: C8H18KO4P
Formula: C2HCl2KO2
Formula: K2Cr2O7
Formula: C2AgN2.K
Formula: C2AuKN2
Formula: KAu(CN)2
Formula: D2KO4P
Formula: C4H10KO4P
Formula: CH2O2.CHKO2
Formula: C32H66KO4P
Formula: C6H6BKN4
Formula: C6H7KO7
Formula: CH3K3O3Si
Formula: KH2PO4
Formula: AsH2KO4
Formula: #
Formula: C2H6KO2PS2
Formula: C9H12KNO5
Formula: C8H11KOSi
Formula: C3H6KNS2
Formula: C16H34KO4P
Formula: C18H16BKN4
Formula: C12H10KP
Formula: C6H14KO2PS2
Formula: KNb5O15Sr2
Formula: #
Formula: K2O4S2
Formula: Cr2HKO9Zn2
Formula: C22H43KO2
Formula: C22H45KO4S
Formula: B12H12.2K
Formula: B10H12K2O
Formula: C12H25KO3S
Formula: C12H21D2KO2
Formula: C12D23KO2
Formula: C12H25K2O3P
Formula: C2H3KO4S
Formula: C6H7KO4
Formula: C3H7KS3
Formula: C2H5KO
Formula: C4H7HgKO2S
Formula: C2H5BF3K
Formula: C3H5KOS2
Formula: C2HBF3.K
Formula: K3.[Fe(CN)6]
Formula: K4.[Fe(CN)6].3(H2O)
Formula: KF
Formula: KF.2(H2O)
Formula: FH8KO4
Formula: C2H2FKO2
Formula: KAlF4
Formula: K2SiF6
Formula: FKO3S
Formula: FKO2S
Formula: CHKO2
Formula: C7H13KO8
Formula: C6H11KO7
Formula: C3H5KO4
Formula: C3H7K2O6P
Formula: C2AuKN2
Formula: KAu.(CN)4
Formula: #
Formula: 2(C7H7KO5S).H2O
Formula: C8HF17KO3S
Formula: C17H33KO2
Formula: C7H13KO2
Formula: C8H15KOS2
Formula: Br6K2Os
Formula: Br6K2Pd
Formula: Br6K2Re
Formula: Br6K2Te
Formula: Cl6K2Pd
Formula: Cl6K2Pt
Formula: Cl6K2Re
Formula: Cl6K2Te
Formula: C6K2N6Pt
Formula: K4Ru(CN)6xH2O
Formula: C16H29D2KO2
Formula: C16H33KO4S
Formula: C22H37KO3S
Formula: K3AlF6
Formula: F6KSb
Formula: AsF6K
Formula: F6K2Ni+
Formula: KPF6
Formula: F6KTa
Formula: K2TiF6
Formula: K2ZrF6
Formula: K2ReI6
Formula: IrK3N6O12
Formula: K3N6O12Rh
Formula: #
Formula: C7H13KOS2
Formula: C6H13KO4S
Formula: HK
Formula: C6H6KNO6S2
Formula: C5H5KO5
Formula: C7H5KO5S
Formula: C7H5BF3KO2
Formula: C10H8KNO7S2
Formula: C4H2K2O5
Formula: C9H13KO7
Formula: C4H6KNO4
Formula: KHF2
Formula: C4H5KO5
Formula: C8H5KO4
Formula: C8H5KO4
Formula: AsH5K2O6
Formula: KHCO3
Formula: C6H16B.K
Formula: C30H31BKN9
Formula: C15H22BKN6
Formula: C27H25BKN9
Formula: C16H30BK2N2
Formula: HKO
Formula: KOH
Formula: H3KO2
Formula: C6H7KO8
Formula: C8H9KO4S
Formula: CH3KO4S
Formula: C7H7KO4S
Formula: HK2N5O10Ru
Formula: KClO
Formula: KH2PO2
Formula: C20H37KO2
Formula: C20H39KO2
Formula: C20H41KO4S
Formula: HK2NO6S2
Formula: KI
Formula: C4H9KO
Formula: #
Formula: C9H17KO2
Formula: C18H35KO2
Formula: C8H15O2.K
Formula: C6H12OS2.K
Formula: C3H5BF3.K
Formula: C4H7OS2.K
Formula: C5H9KO2
Formula: C3H6KNO2
Formula: C4H6KNO4
Formula: C3H5KO3
Formula: C3H5KO3
Formula: C12H23KO2
Formula: C18H31KO2
Formula: C4H2K2O4
Formula: K2O5S2
Formula: BHKO2
Formula: BH4KO4
Formula: KPO3
Formula: K4O7V2
Formula: CH3KO
Formula: C2H3KOS2
Formula: CH3KO4S
Formula: C2H4KNS2
Formula: K2MoO4
Formula: FK2O3P
Formula: #
Formula: C5H8KNOS2
Formula: #
Formula: Cl10H2K4O2Ru2
Formula: C14H27KO2
Formula: C8H9KN2O4S
Formula: C3H6KNO3
Formula: C11H12F3KN2O3S
Formula: C12H7F17KNO4S
Formula: C8H7F9KNO4S
Formula: C11H7F15KNO4S
Formula: C10H7F13KNO4S
Formula: C9H7F11KNO4S
Formula: C9H12KNO2S
Formula: C12H26KNO2
Formula: C3H6KNOS2
Formula: #
Formula: C10H7KO
Formula: C10H7KO
Formula: C10H7KO4S
Formula: C10H7KO3S
Formula: KNbO3
Formula: KNO3
Formula: KNO2
Formula: K2NO7S2 *
Formula: C4F9KO3S
Formula: C4F9KO
Formula: C8F15KO3S
Formula: C9H14KO4
Formula: C9H17KO2
Formula: C7H7KO
Formula: C5H10OS2.K
Formula: C18H33D2KO2
Formula: C18D35KO2
Formula: C18H37KO4S
Formula: C8H16KO2
Formula: C8H18KO4P
Formula: C8H17KO4S
Formula: #
Formula: C9H17KOS2
Formula: C18H33KO2
Formula: C5H3KN2O4
Formula: K3O4V
Formula: K2OsO4.2(H2O)
Formula: C2KO4
Formula: K2C2O4.H2O
Formula: K2C2O4
Formula: C2H2NO3.K
Formula: HK2O
Formula: C6H5KO2P
Formula: C4H2KN3O4
Formula: C4H8KO5P
Formula: C7H6ClKO
Formula: B10K2O16
Formula: C6Cl5KO
Formula: K2RuCl5.H2O
Formula: C15H29KO2
Formula: C21H35KO3S
Formula: C6F5KO
Formula: F5KZr
Formula: C5H7KO2
Formula: C5H9KO2
Formula: #
Formula: C6H11KOS2
Formula: BKO3
Formula: KClO4
Formula: C4F9KO4S
Formula: C7F15O3S.K
Formula: C6F13O3S.K
Formula: C5F11KO3S
Formula: #
Formula: KIO4
Formula: KMnO4
Formula: H3K5O18S4
Formula: KHSO5
Formula: 2(KHSO5).KHSO4.K2SO4
Formula: KReO4
Formula: KO4Ru
Formula: K2S2O8
Formula: C8H9BF3K
Formula: HOC6H4SO3K
Formula: C6H6KO
Formula: C6H5KO4S
Formula: C8H7KO2
Formula: C8H7KO3
Formula: C8H7KOS2
Formula: #
Formula: H6K3O7P
Formula: K3PO4
Formula: C8H4KNO2
Formula: C6H10KNS2
Formula: C6H10KNO2
Formula: (C3H6O2)n.(C3H5KO2)m
Formula: C4H5KOS2
Formula: C3HKO2
Formula: C4H7KOS2
Formula: C3H5KO2
Formula: C10H11KO3
Formula: C23H31KO4
Formula: C6H4KNO2
Formula: C6H4KNO2
Formula: K4P2O7
Formula: K2S2O7
Formula: C3H3KO3
Formula: C5H9KO6
Formula: C7H5KO3
Formula: C4H11O3PS
Formula: K2O4Se
Formula: KSeCN
Formula: K4SiO4
Formula: CAgKNS
Formula: AgKO3S
Formula: C34H28KN4NaO8S2
Formula: C7H2Cl2KNaO3
Formula: C29H23FKN7NaO11S3
Formula: #
Formula: C30H20KN6NaO6S2
Formula: C26H18KN4NaO8S2
Formula: C18H13ClFKN7NaO7S2
Formula: C37H25KN7NaO9S
Formula: C22H21KN3NaO12S4
Formula: C36H21FKN9NaO15S5
Formula: C16H10KN2NaO7S2
Formula: C22H14KN4NaO7S2
Formula: KNa
Formula: CKNaO3
Formula: KNaNb2O6
Formula: C6H8KNaO4
Formula: HKNaO4P
Formula: KNaO4S
Formula: #
Formula: C4H4KNaO6
Formula: C23H24N2O2
Formula: C4H4KNaO6.4(H2O)
Formula: C6H7KO2
Formula: C6H7KO2
Formula: K2SnO3
Formula: H6K2O6Sn
Formula: C18H35KO2
Formula: #
Formula: H2NO3S.K
Formula: HKS
Formula: K2SO4
Formula: K2O3S
Formula: KO2
Formula: KO3Ta
Formula: #
Formula: C4H4K2O6
Formula: 2(K2C4H4O6).H2O
Formula: C4H4K2O6
Formula: C15H13Cl2F3N2O4
Formula: H2K2O5Te
Formula: C4H9KO
Formula: #
Formula: C5H11KO
Formula: #
Formula: AuBr4K
Formula: Br4K2Pd
Formula: AlCl4K
Formula: KAuCl4
Formula: AuCl4H2KO
Formula: Cl4CuH4K2O2
Formula: K.[B(CN)4]
Formula: K2.[Ni(CN)4].x(H2O)
Formula: K2Pt.(CN)4.3(H2O)
Formula: C14H25D2KO2
Formula: C14D27KO2
Formula: C14H29KO4S
Formula: AsF4K
Formula: KBF4
Formula: I4K2Pt
Formula: C16H12BKS4
Formula: C32H12BF24.K
Formula: B1C48H36K1
Formula: C24BF20K
Formula: #
Formula: C9H13K
Formula: K2N4O8Pt
Formula: K4Zr[C2O4]4
Formula: C24H20BK
Formula: #
Formula: KH3.(C2O4)2.2(H2O)
Formula: K4Hf[C2O4]4
Formula: C2H3KOS
Formula: CKNS
Formula: CKNS
Formula: CKNS
Formula: KCNS
Formula: C2H3KO2S
Formula: C2H4KN3S3
Formula: K2O3S2
Formula: H2K2O4S2
Formula: K2TiO3
Formula: #
Formula: K2TiO.(C2O4)2
Formula: KO5PTi
Formula: C7H7KO3S
Formula: C10H19BF3K
Formula: #
Formula: Al3H6KO14S2
Formula: Al3H2KO12Si3
Formula: K[(H2C=CH2)PtCl3]xH2O
Formula: H2Cl3KNPt
Formula: C4KN3
Formula: C13H25KO2
Formula: C6H12BF3N.K
Formula: C5H10BF3N.K
Formula: C7H5BF3KO
Formula: C5H10BF3NO.K
Formula: CH2BF3I.K
Formula: CBF6K
Formula: C2F3KO2
Formula: F3KMg
Formula: CF3KO3S
Formula: CH3BF3.K
Formula: #
Formula: C2H4K2O6
Formula: I3K
Formula: C9H22BO3.K
Formula: C3H9KOSi
Formula: C6H6FeK3O15
Formula: C9H12BKN6O
Formula: C6CoO12
Formula: C6F11KO3S
Formula: C11H21KO2
Formula: #
Formula: #
Formula: C5H3KN4O3
Formula: #
Formula: C2H3BF3K
Formula: KO4PZn
Formula: KO4SZn
Formula: K2O3Zr
Formula: KO4SZr
Formula: #
Formula: K
Formula: C6H12FeKO6
Formula: C24H27KN4O10S
Formula: C6Cl5KN6O6
Formula: C4H5KN
Formula: KO2Sb
Formula: Fe4KN7O7S3
Formula: C24H16BCl4K
Formula: C16H22GeKO17
Formula: CrKO2
Formula: C18H32KNO2S
Formula: C2H6Cl3KOPt
Formula: C2H4Cl3KPt
Formula: C8H2F15KO2
Formula: C18H15KN2O6S
Formula: Cl6H2IKPt
Formula: C6Fe2KN6
Formula: FeKO2
Formula: KNbO3
Formula: KO3V
Formula: CrKOZn
Formula: CrKO5Zn
Formula: C6H5KO5S
Formula: #
Formula: #
Formula: #
Formula: C5H10KNO2S2
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C4K2N4Pt
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C6H9I2NO
Formula: #
Formula: C17H17N7
Formula: C16H16N6O
Formula: C62H95N16O28P
Formula: C21H33Cl3N6O3
Formula: #
Formula: #
Formula: #
Formula: C20H40O3
Formula: #
Formula: #
Formula: C17H36O2
PPG-6 C9-11 PARETH-5
Formula: #
Formula: #
Formula: C24H22N2O3
Formula: #
Formula: C18H16ClN3O2
Formula: C15H7N3O7
Formula: C31H40N4O7
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C20H30N4O2
Formula: C34H41N7O5.CH4O3S
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C21H22O7
Formula: C21H22O7
Formula: C24H26O7
Formula: C24H26O7
Formula: C24H28O7
Formula: C24H28O7
Formula: C24H28O7
Formula: C23H33N2O2+
Formula: C23H33N2O2.C4H5O6
Formula: C7H9N2O.I
Formula: C19H24O3
Formula: C42H50N8O5
Formula: #
Formula: C10H17N3S.2(HCl)
Formula: C10H17N3S.HI
Formula: C10H17N3S.2(HCl).H2O
Formula: C10H17N3S
Formula: C14H27N3O2.H2SO4
Formula: C14H27N3O2
Formula: C171H267N51O53S2.x(C2H4O2).x(H2O)
Formula: C171H267N51O53S2
Formula: C17H27NO3.HCl
Formula: C20H27NO4
Formula: #
Formula: C16H14O4
Formula: C25H24N2O6
Formula: 2(C27H23N5O4).H2O
Formula: C27H23N5O4
Formula: C18H26ClNO2
Formula: C15H13NO3
Formula: Pr
Formula: C15H21O6Pr
Formula: Ba2Cu3O8Pr2
Formula: B6Pr
Formula: Br3Pr
Formula: #
Formula: CH15Cl3O7
Formula: PrCl3
Formula: PrF3
Formula: H3Pr
Formula: I3Pr
Formula: NPr
Formula: C6O12Pr2
Formula: C6H2O13Pr2
Formula: O3Pr2
Formula: PR6O11
Formula: Cl3H2O13Pr
Formula: Pr2Se3
Formula: H4PrSi2
Formula: H16O20Pr2S3
Formula: PrTe
Formula: Br3O9Pr
Formula: C16H13F9O6
Formula: C42H42F21O6Pr
Formula: O9PrV3+
Formula: C3O9Pr2
Formula: H3O3Pr
Formula: Pr2S3
Formula: C21H15O6Pr
Formula: C30H48O12Pr2
Formula: C6H11O7Pr
Formula: C15H25O8Pr
Formula: Pr(C5H7O2)3xH2O
Formula: PrBr3.XH2O
Formula: PrCl3.6(H2O)
Formula: Cl3H2OPr
Formula: C9H21O3Pr
Formula: Pr(NO3)3.6(H2O)
Formula: Cl3O12Pr
Formula: H2O13Pr2S3
Formula: C3F9O9PrS3
Formula: C18H12N3O6Pr
Formula: C20H20FNO3S.HCL
Formula: C18H20FNO3S
Formula: C20H20FNO3S
Formula: #
Formula: C23H26N2O3
Formula: C31H55NO7
Formula: C23H35NaO7
Formula: C23H36O7
Formula: C4H6N4
Formula: #
Formula: C80H102ClN23O12
Formula: C19H24N2O2
Formula: #
Formula: C19H21N5O4.HCl
Formula: C19H21N5O4
Formula: #
Formula: #
Formula: C31H42O11
Formula: C13H16O3
Formula: #
Formula: #
Formula: C22H27N5O8S2.C6H15N
Formula: C14H22O
Formula: C34H47N2O9P
Formula: C27H36O8
Formula: C27H39NO6
Formula: C28H31NaO9S
Formula: #
Formula: C26H36O6
Formula: C36H50O6
Formula: C21H27Na2O8P
Formula: C25H31NaO8
Formula: C41H64O8
Formula: C25H32O8
Formula: C27H38O6
Formula: C28H38O7
Formula: C23H30O6
Formula: C23H36N8O3
Formula: C21H28O5
Formula: C23H30O6
Formula: C21H26O5
Formula: C23H28O6
Formula: C19H18F3NO2
Formula: C21H30O2
Formula: #
PREGN-3,17,21-TRIOL-20-ONE, 3,9-EPOXY-3-O-METHYL-11-[2-(N-ACETYL)
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C21H30O2.HCl
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
PREGN-5-EN-20-ONE, 16,17-EPOXY-3-HYDROXY-16-METHYL-, (3.BETA.,16.BETA.)-
Formula: C22H32O3
Formula: C21H32O3
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C25H31FO7
Formula: C21H28O3
Formula: C21H26O3
Formula: C21H25Na2O8P
Formula: C21H28NaO8P
Formula: C21H27NaO8S
Formula: C81H124F3N5O28
Formula: C33H35ClF2INO7
Formula: C24H30Cl2O5
Formula: #
Formula: C21H28O2
Formula: #
Formula: #
Formula: #
Formula: C21H32O3
Formula: #
Formula: C23H34O4
PREGNAN-3-OL, 11,18:18,20-DIEPOXY-, (3ALPHA,5BETA,11BETA,20S)-
Formula: C21H32O3
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C21H36O5S
Formula: #
Formula: #
Formula: C21H34O4
Formula: #
Formula: #
Formula: C21H36O3
Formula: #
Formula: C23H34O3
Formula: C21H31NaO5S
Formula: #
Formula: C21H32O2
Formula: C22H30O6
Formula: C21H26FN3O4
Formula: C18H21NaO5S
Formula: #
Formula: C15H15N3O
Formula: C12H18KNO6S
Formula: C12H19NO3
Formula: #
Formula: C8H15NO2S
Formula: C25H29NO2
Formula: C23H27N3O
Formula: C7H12O2
Formula: C12H21O2-
Formula: C24H27N
Formula: C27H33NO3
Formula: C25H28O6
Formula: #
Formula: #
Formula: C15H21Br2ClO3
Formula: #
Formula: C152H236N38O51S3
Formula: C173H270N44O57
Formula: #
PREPRO-TRH (53-74)
Formula: C118H182N32O32
Formula: #
Formula: #
Formula: C94H171N31O28
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C19H26Cl2N4O
Formula: C22H36N2O4S
Formula: C35H41N5O5
Formula: #
Formula: C18H22ClNO5
Formula: C25H46N4O4
Formula: C26H31N3O2S
Formula: C17H26ClNO2
Formula: C21H14O8
Formula: #
Formula: C28H44O
Formula: #
Formula: C16H26CuN6O6
Formula: #
Formula: #
Formula: #
Formula: C16H23NO3
Formula: #
Formula: C23H24FN3O3
Formula: C20H25NO
Formula: C19H24O2S
Formula: C22H28N.Br
Formula: C14H16N2O
Formula: C13H20N2O.HCl
Formula: C13H20N2O
Formula: C21H26O11
Formula: C15H21N3O.2(H3PO4)
Formula: C15H21N3O
Formula: #
Formula: C20H28O13
Formula: C12H14N2O2
Formula: C15H12F4N4O7S
Formula: C14H10F4N4O7S
Formula: C30H50O3
Formula: C54H88O23
Formula: C20H28O13
Formula: #
Formula: C49H33N7O6S7
Formula: #
Formula: C15H10FNO3
Formula: C35H48ClN3O9S4
Formula: C18H21N3O5S2
Formula: C15H13N3O2
Formula: C21H28N4O5
Formula: C21H26O2
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C19H38O
Formula: C30H40O4
Formula: #
Formula: C72H91N17O14
PRO(4)-TRP(7,9,10)-SUBSTANCE P (4-11)
Formula: C62H74N14O10S
PRO(4)-VAL(8)-TRP(7,9,10)-SUBSTANCE P (4-11)
Formula: C26H38N6O7
Formula: C22H27ClN4O3
Formula: C27H40F3N9O7
Formula: #
Formula: C60H77N13O10
Formula: C16H23N7O4
Formula: C66H111N19O18S
Formula: #
Formula: C123H195N39O47S
Formula: #
Formula: C30H38ClN7O5
Formula: C24H37N5O7
Formula: C21H28N4O5
Formula: C44H61N11O10
Formula: C24H36N8O7
Formula: C23H32ClNO2
Formula: C23H32ClNO2
Formula: C30H26O12
Formula: C31H28O12
Formula: C13H19NO4S
Formula: C31H48O2S2
Formula: C13H23N3O5S
Formula: C13H21N3O2
Formula: #
Formula: C13H21N3O.HCl
Formula: #
Formula: C13H20ClN5O
Formula: C13H18N4O2
Formula: C13H21ClN2O2
Formula: C13H19ClN2O2T2
Formula: C16H18N2O4S.C13H20N2O2
Formula: C16H18N2O4S.C13H20N2O2.H2O
Formula: C13H20N2O2
Formula: #
Formula: #
Formula: C12H19N3O.HCl
Formula: C12H19N3O
Formula: C15H17N4NaO7S
Formula: C16H23ClN2O3
Formula: C16H22N2O3.HCl
Formula: C16H22N2O3.HCl
Formula: C16H22N2O3
Formula: C60H64Cl14MnN12O8
Formula: C15H16Cl3N3O2
Formula: C22H32ClN3O6S3
Formula: C21H28ClN3O3S2
Formula: C20H24ClN3S
Formula: #
Formula: #
Formula: C19H10Cl2N6Na2O7S2
Formula: #
Formula: C16H14Cl2O
Formula: #
Formula: C15H22O10
Formula: #
Formula: C30H26O12
PROCYANIDIN B3;PROANTHOCYANIDIN B3; PROCYANIDOL B3; (4,8''-BIFLAVAN)-3,3',3'',3''',4',4''',5,5'',7,7''-DECOL STEREOISOMER; (2R,2'R,3S,3'S,4S)-2,2'-BIS(3,4-DIHYDROXYPHENYL)-3,3',4,4'-TETRAHYDRO-(4,8'-BI-2H-1-BENZOPYRAN)-3,3',5,5',7,7'-HEXOL
Formula: C30H26O12
Formula: C30H26O12
Formula: C30H26O13
Formula: C10H13ClN6
Formula: C19H29NO
Formula: C13H11Cl2NO2