Phone (USA) +1 212-348-5610
Whatsapp: +1 516-336-9307
WeChat: chembuyersguide
Chemical Search

Conier Chem&Pharma Limited.

Country: China

11F,#5 Building,
Asia pacific enterprise valley,
Chongqing, China.

Phone: +86-23-62922305
Phone 2: +86-139 9626 9627
FAX: +86-23-62457927
E-Mail:E-Mail this Supplier

Conier Chem&Pharma Limited.

Page: Home | 1 | 2 | 3 | 4 | 5 | 6 | 7 | 8 | 9 | 10 | 11 | 12 | 13 | 14 | 15 | 16 | 17 | 18 | 19 | 20 | 21 | 22 | 23 | 24 | 25 | 26 | 27 | 28 | 29 | 30 | 31 | 32 | 33 | 34 | 35 | 36 | 37 | 38 | 39 | 40 | 41 | 42 | 43 | 44 | 45 | 46 | 47 | 48 | 49 | 50 | 51 | 52 | 53 | 54 | 55 | 56 | 57 | 58 | 59 | 60 | 61 | 62 | 63 | 64 | 65 | 66 | 67 | 68 | 69 | 70 | 71 | 72 | 73 | 74 | 75 | 76 | 77 | 78 | 79 | 80 | 81 | 82 | 83 | 84 | 85 | 86 | 87 | 88 | 89 | 90 | 91 | 92 | 93 | 94 | 95 | 96 | 97 | 98 | 99 | 100 | 101 | 102 | 103 | 104 | 105 | 106 | 107 | 108 | 109 | 110 | 111 | 112 | 113 | 114 | 115 | 116 | 117 | 118 | 119 | 120 | 121 | 122 | 123 | 124 | 125 | 126 | 127 | 128 | 129 | 130 | 131 | 132 | 133 | 134 | 135 | 136 | 137 | 138 | 139 | 140 | 141 | 142 | 143 | 144 | 145 | 146 | 147 | 148 | 149 | 150 | 151 | 152 | 153 | 154 | 155 | 156 | 157 | 158 | 159 | 160 | 161 | 162 | 163 | 164 | 165 | 166 | 167 | 168 | 169 | 170 | 171 | 172 | 173 | 174 | 175 | 176 | 177 | 178 | 179 | 180 | 181 | 182 | 183 | 184 | 185 | 186 | 187 | 188 | 189 | 190 | 191 | 192 | 193 | 194 | 195 | 196 | 197 | 198 | 199 | 200 | 201 | 202 | 203 | 204 | 205 | 206 | 207 | 208 | 209 | 210 | 211 | 212 | 213 | 214 | 215 | 216 | 217 | 218 | 219 | 220 | 221 | 222 | 223 | 224 | 225 | 226 | 227 | 228 | 229 | 230 | 231 | 232 | 233 | 234 | 235 | 236 | 237 | 238 | 239 | 240 | 241 | 242 | 243 | 244 | 245 | 246 | 247 | 248 | 249 | 250 | 251 | 252 | 253 | 254 | 255 | 256 | 257 | 258 | 259 | 260 | 261 | 262 | 263 | 264 | 265 | 266 | 267 | 268 | 269 | 270 | 271 | 272 | 273 | 274 | 275 | 276 | 277 | 278 | 279 | 280 | 281 | 282 | 283 | 284 | 285 | 286 | 287 | 288 | 289 | 290 | 291 | 292 | 293 | 294 | 295 | 296 | 297 | 298 | 299 | 300 | 301 | 302 | 303 | 304 | 305 | 306 | 307 | 308 | 309 | 310 | 311 | 312 | 313 | 314 | 315 | 316 | 317 | 318 | 319 | 320 | 321 | 322 | 323 | 324 | 325 | 326 | 327 | 328 | 329 | 330 | 331 | 332 | 333 | 334 | 335 | 336 | 337 | 338 | 339 | 340 | 341 | 342 | 343 | 344 | 345 | 346 | 347 | 348 | 349 | 350 | 351 | 352 | 353 | 354 | 355 | 356 | 357 | 358 | 359 | 360 | 361 | 362 | 363 | 364 | 365 | 366 |

Product List

Formula: C25H42N8O8
Formula: C16H29N3O4
Formula: C53H91N19O11
Formula: C14H26N4O6S
Formula: C16H21N3O3
Formula: C19H29N3O5
Formula: C15H26N4O8
Formula: C22H38N6O7
Formula: C7H12O4
Formula: C5H10O5
Formula: C5H9NO4
Formula: C5H10O5
Formula: C7H12O4
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C55H87N15O16
Formula: #
Formula: C20H36O2
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C20H36O3
Formula: C19H24N2O3.HCl
Formula: C19H24N2O3
Formula: C19H23ClN2O3
Formula: #
Formula: #
Formula: C25H17NO13
Formula: C16H10O7
Formula: #
Formula: C20H26ClNO3
Formula: C18H10O4
Formula: #
Formula: C26H33NO6
Formula: C15H16O4
Formula: C15H18O3
Formula: #
Formula: C12H6Br4N2O3
Formula: #
Formula: #
Formula: C15H24N2O7S
Formula: #
Formula: #
Formula: C12H22O11
Formula: C9H14N4O4
Formula: C3H5O3
Formula: C3H6O3
Formula: C8H16O3
Formula: C17H34O3
Formula: C6H11NO4
Formula: C4H5NO2S
Formula: C6H11NO4
Formula: (C3H5O3)2.Ni
Formula: #
Formula: C12H18O6
Formula: C12H26O12
Formula: C12H24O11
Formula: C32H55NO25
Formula: C32H55NO25
Formula: C40H68N2O31
Formula: C26H45NO21
Formula: C20H35NO16
Formula: C12H22O12
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C19H15ClF3NO7
Formula: C19H15ClF3NO7
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C6H4N2O4
Formula: C5H7BrN2O2
Formula: C3H5NO
Formula: C20H28IN3O4S
Formula: #
Formula: #
Formula: #
Formula: C12H24O12
Formula: #
Formula: C28H38O19
Formula: #
Formula: C12H22O11
Formula: C12H22O11
Formula: #
Formula: C18H32O16
Formula: C12H19HgNO5
Formula: C8H18NO3+
Formula: C32H59N5O10
Formula: C12H22O11
Formula: 2(C16H20N2O2).C4H6O6
Formula: C14H15NO7
Formula: C22H29N3O4S
Formula: #
Formula: C20H36O5
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C24H36O39S6
Formula: C9H10ClF3O2
Formula: C20H28O3
Formula: C20H28O3
Formula: C17H26O12
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C36H48O19
Formula: C8H11N3O3S.C7H6O3
Formula: C8H11N3O3S
Formula: #
Formula: C9H7Cl2N5
Formula: C20H25N3O
Formula: C7H3F3NNaO3
Formula: C18H28N6O
Formula: C26H21Br2N3Na2O9S2
Formula: C49H76O20
Formula: C16H14O4
Formula: C49H76O20
Formula: C49H76O21
Formula: #
Formula: C29H36O10
Formula: C25H40O6
Formula: C89H125N23O25S3
Formula: C25H39N3O8.HCl
Formula: C25H39N3O8
Formula: C21H36N4O8
Formula: C13H22N4O7
Formula: #
Formula: C14H10ClN3S2
Formula: C4H8O3
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C30H50O2
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C30H54
Formula: #
Formula: #
Formula: C30H48O3
Formula: #
Formula: #
Formula: C15H18F3NO.HCl
Formula: C54H69N11O10S2
Formula: #
Formula: C21H20O5
Formula: C21H22O5
Formula: C16H14F3N3O4S
Formula: C16H14F3N3O3S
Formula: C16H14F3N3O2S
Formula: C35H52O5
Formula: C30H46O4
Formula: C6H20La2O22
Formula: C3H2F9LaO10S3
Formula: C6H9LaO6
Formula: C15H21LaO6
Formula: AlLaO3
Formula: 3(C6H18NSi2).La
Formula: Br3La
Formula: Br3H2LaO
Formula: BrLaO
Formula: Br3H14LaO7
Formula: C2La
Formula: C3La2O9
Formula: Cl3H12LaO6
Formula: Cl3H2LaO
Formula: C30H57LaO6
Formula: C6H15LaO12S3
Formula: #
Formula: F3La
Formula: H3La
Formula: H3LaO3
Formula: I3La
Formula: 3(C3H7O).La
Formula: B3LaO6
Formula: La(NO3)3.6(H2O)
Formula: H2LaN3O10
Formula: C6La2O12
Formula: #
Formula: La2O3
Formula: La4O3S3
Formula: Cl3H2LaO13
Formula: C9H9LaO6
Formula: LaSi2
Formula: La2O12S3
Formula: La2S3
Formula: H6La2S3
Formula: La2(SO4)3.8H2O
Formula: LaO3Ti+
Formula: La(C2H3O2)3.x(H2O)
Formula: LaCl3.7(H2O)
Formula: I3LaO9
Formula: H3LaN3O9
Formula: C18H54LaN3Si6
Formula: LaO9V3
Formula: LaO4V
Formula: La2O7Zr2
Formula: Br3LaO9
Formula: H3LaO3
Formula: La2O7Ti2
Formula: La2O9W2
Formula: La2Se3
Formula: F6H2La2O
Formula: C21H15LaO6
Formula: C20H38LaO4
Formula: C24H45LaO6
Formula: C54H99LaO6
Formula: C54H105LaO6
Formula: C12H6La2O12
Formula: LaCl3
Formula: C6H2La2O13
Formula: La2(SO4)39H2O
Formula: La2Te3
Formula: C3F9LaO9S3
Formula: La
Formula: LaNi5
Formula: LaOS
Formula: C6H12N2O4S
Formula: C6H7NO4S
Formula: C18H11NO4
Formula: #
Formula: C29H26ClFN4O4S.2(C7H8O3S)
Formula: C29H26ClFN4O4S.2(C7H8O3S)
Formula: C29H26ClFN4O4S
Formula: C21H35N2O3.Cl
Formula: #
Formula: #
Formula: #
Formula: C32H44N2O8.HBr
Formula: C32H44N2O8
Formula: #
Formula: C19H17ClN2O3
Formula: C32H55N9O10
Formula: C21H42O5
Formula: C20H24O6
Formula: #
Formula: C22H26O7
Formula: C22H28O6
Formula: C16H12O8
Formula: #
Formula: C22H26O8
Formula: C24H38O4
Formula: C22H36O3
Formula: C16H26N2O2.HCl
Formula: C21H19ClFNO4S
Formula: C45H53NO14
Formula: C16H25NaO3S
Formula: C20H33NaO3S
Formula: C34H54O8
Formula: C17H24O4
Formula: #
Formula: C19H18F3N3O2
Formula: C34H39NO8
Formula: C28H31NO2.C4H6O6
Formula: C28H31NO2
Formula: C20H18N6Na2O9S
Formula: C20H20N6O9S
Formula: C23H34O5
Formula: C18H26O4
Formula: C18H24O4
Formula: C26H40O5
Formula: C15H19NO3
Formula: C27H46O
Formula: #
Formula: C20H30O4
Formula: C10H13NO5S
Formula: C20H25NO4
Formula: C17H19NO43H2O
Formula: C18H17NO4
Formula: C12H25NO
Formula: C17H37ClN4O
Formula: #
Formula: #
Formula: #
Formula: C14H33O6P
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C14H27ClO2
Formula: C16H32O2
Formula: C17H34O2
Formula: C16H27NO4
Formula: #
Formula: C12H24O2
Formula: C24H46O4Pb
Formula: #
Formula: #
Formula: C12H24O2
Formula: C24H46O3
Formula: C20H24NO4
Formula: C18H35NO
Formula: C11H21COOH
Formula: C18H19NO4
Formula: C20H23NO4
Formula: C15H29NO3
Formula: C12H23ClO
Formula: C33H54Li4N7O17P3S
Formula: C20H42N2O7
Formula: C19H37NO4.HCl
Formula: C25H49N3O3
Formula: #
Formula: C16H29NO5
Formula: C20H40O2
Formula: C12H28O7P2
Formula: C16H37NO6S
Formula: C12H26O
Formula: C16H33NO2
Formula: C12H25Cl
Formula: C13H25ClO2
Formula: C15H30O3
Formula: C39H64O13
Formula: C19H46O2Si3
Formula: C12H29O5P
Formula: C12H25KO4S
Formula: #
Formula: C14H28O2S
Formula: C12H25NaO4S
Formula: C17H36N2O2
Formula: C18H41NO4S
Formula: C17H30ClN
Formula: C13H28N2O
Formula: C10H18O
Formula: C10H18O
Formula: C22H14N4O4
Formula: C29H50N10O8
Formula: C19H29N5O2
Formula: C14H14O2P2S4
Formula: Lr
Formula: #
Formula: #
Formula: C26H35NO3
Formula: C27H42O4
Formula: #
LBI 46
Formula: #
Formula: C26H33FN4O3S
Formula: #
Formula: #
Formula: C28H36ClN5O3S
Formula: #
Formula: C25H22N6
Formula: C17H11Cl3N2O3
LDS 765
Formula: #
LDS 867
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C26H30O6
Formula: Pb
Formula: C6H6N6O9Pb3
Formula: C36H70O6Pb
Formula: C6HN3O8Pb
Formula: C8H3NO6Pb
Formula: C4H6O4Pb
Formula: C2H4O3Pb
Formula: C4H6O4Pb.3(H2O)
Formula: C6H8O4Pb
Formula: C6H8O4Pb
Formula: PbSb
Formula: As2O8Pb3
Formula: C14H10O8Pb
Formula: 2(C8H15O2).Pb
Formula: C56H86O6PbS2
Formula: C18H34O4Pb
Formula: C23H46O2
Formula: #
Formula: #
Formula: Br2O6Pb
Formula: Br2Pb
Formula: 2(C8H15O2).Pb
Formula: #
Formula: ClPb
Formula: ClHOPb
Formula: Cl2O2Pb3
Formula: Cl2O6Pb3Si2
Formula: ClFPb
Formula: PbCrO4
Formula: CrO5Pb2
Formula: C12H10O14Pb3
Formula: CH2N2Pb
Formula: C2N2O2Pb
Formula: C20H34O4Pb
Formula: C22H44N2PbS4
Formula: C7H10O2Pb
Formula: C8H18O2Pb
Formula: C8H14O4Pb
Formula: PbCl2
Formula: C44H86O4Pb
Formula: C36H62O4Pb
Formula: Pb(NO3)2
Formula: PbO2
Formula: H4O4P2Pb
Formula: C12H4N6O14Pb
Formula: Na2O2Pb
Formula: PbS2-2
Formula: C6FeN6Pb2
Formula: Pb.(BF4)2
Formula: PbF2
Formula: FHOPb
Formula: GeO3Pb
Formula: F6PbSi
Formula: HOPb
Formula: HNO4Pb
Formula: C20H20F14O4Pb
Formula: C20H38O4Pb
Formula: C60H84N4O4S4
Formula: C16H30O4Pb
Formula: Pb
Formula: C12H20O8Pb
Formula: C4H4O5Pb
Formula: C2H6PbS2
Formula: MoO4Pb
Formula: O3PbSi
Formula: PbO
Formula: 2(C11H7O2).Pb
Formula: N2O6Pb
Formula: C2O4Pb
Formula: OPb
Formula: Pb3O4
Formula: C32H62O4Pb
Formula: C12H20N2PbS4
Formula: Cl2H12O14Pb
Formula: HO3PPb
Formula: C8H4O4Pb
Formula: C8H4O4Pb
Formula: #
Formula: #
Formula: PbSe
Formula: PbSe
Formula: O3Pb2
Formula: O3PbSi
Formula: #
Formula: C18H35O2Pb
Formula: C6HN3O8Pb
Formula: H8O8Pb5S
Formula: PbSO4.3(PbO)
Formula: H2PbS
Formula: O6PbTa2
Formula: C8H12O8Pb
Formula: F4Pb
Formula: O3PbSn
Formula: PbTiO3
Formula: O5PbTiZr
Formula: O3PbZr
Formula: O5PbTiZr
Formula: CO3Pb
Formula: C4H6O4Pb
Formula: C2H2O8Pb3
Formula: F2Pb
Formula: N2O4Pb
Formula: O8P2Pb3
Formula: O8Pb3Sb2
Formula: O4PbS
Formula: C18H32O2Pb
Formula: C36H66O4Pb
Formula: C12F10PbS2
Formula: C14H10N4O10Pb
Formula: C8H10O4Pb
Formula: C18H34O4Pb
Formula: C18H34O4Pb
Formula: O6PbV2
Formula: B2O4Pb
Formula: OPbRu
Formula: O7P2Pb2
Formula: C14H8N4O16Pb
Formula: C14H10N4O10Pb
Formula: C36H58O2Pb
Formula: C18H20N2PbS4
Formula: C17H34O2
Formula: C6H3NO4Pb
Formula: #
Formula: Pb3.(CO3)2.(OH)2
Formula: C12H16O17Pb3
Formula: C2H2O4Pb
Formula: #
Formula: H2O2Pb
Formula: PbI2
Formula: C4H5O2Pb
Formula: (CH3O3S)2.Pb
Formula: #
Formula: Cl2H2O9Pb
Formula: Cl2H6O11Pb
Formula: C32H16N8Pb
Formula: C14H10O6Pb
Formula: PbSO4
Formula: C4H4O6Pb
Formula: C2N2PbS2
Formula: H2O6PbS4
Formula: CO3Pb
Formula: Pb
Formula: Pb
Formula: Pb
Formula: #
Formula: C10H20O2
Formula: C8H14O2
Formula: C6H12O
Formula: #
Formula: C16H14O7
Formula: #
Formula: C59H84N16O12
Formula: #
Formula: C44H88NO8P
Formula: C107H179N35O36S7
Formula: #
Formula: #
Formula: C42H48ClFN2O14
Formula: C49H54F2N8O6
Formula: #
Formula: C19H23N5OS
Formula: #
Formula: #
Formula: C12H9F3N2O2
Formula: C23H25N3O6
Formula: #
Formula: #
Formula: C27H34O16
Formula: C23H28N2O
Formula: C142H243N45O39S7
Formula: C142H243N45O39S7
Formula: #
Formula: #
Formula: C15H24O
Formula: C13H18N2O2
Formula: C13H13N3O3
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C24H27FN4O2
Formula: C2H4S5
Formula: #
Formula: (C42H70O35)n
Formula: #
Formula: C15H26N2O
Formula: C14H21O5N3.HCl.H2O
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C10H9NO
Formula: C10H9N
Formula: #
Formula: C6H7ClO3
Formula: C287H440N80O111S6
Formula: #
Formula: C12H24ClN
LEPTIN (93-105) (HUMAN)
Formula: C64H110N20O23
Formula: #
Formula: C32H46O6
Formula: C33H48O6
Formula: C36H41N3O6.HCl
Formula: C36H41N3O6
Formula: #
Formula: C17H18ClN3
Formula: C18H22ClN3O3S
Formula: #
Formula: #
Formula: C26H21N3O4
Formula: #
Formula: LuCl3.Nh2o
Formula: C29H34O15
Formula: C24H26O11
Formula: C10H17NO4S2
Formula: #
Formula: C17H9Cl2FN4O2
Formula: #
Formula: C17H11N5
Formula: C28H37N5O10S
Formula: C34H49N9O8
Formula: #
Formula: C56H84N14O13
Formula: C42H70O13
Formula: C12H24N2O6
Formula: C30H41N5O9
Formula: C6H15N3O
Formula: C7H15NO2
Formula: C7H16N2O2
Formula: C6H13NO4
Formula: C10H19NO3
Formula: C12H23NO3
Formula: C8H13NO5
Formula: C9H17NO4
Formula: C10H18N2O4
Formula: C9H17NO3
Formula: C9H15NO4
Formula: #
Formula: C17H28N2O2
Formula: C62H111N11O13
Formula: C27H32N2O6S2Na2
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C25H31N3
Formula: C15H14O7
Formula: #
Formula: C40H52N12O13
Formula: C16H19N3S
Formula: C59H84N16O15
Formula: C5O5
Formula: C19H22N2O3
Formula: C6H5N5O3
Formula: C26H28O15
Formula: C14H17NO4S
Formula: #
Formula: C23H35N5O4S
Formula: #
Formula: C21H31N7O6
Formula: C40H66N8O10
Formula: C11H20N2O3
Formula: #
Formula: #
Formula: #
Formula: C21H34O3
Formula: C20H34O4
Formula: C20H32O4
Formula: C22H37NO3
Formula: C20H30O4
Formula: C30H47N3O11S
Formula: C30H49N3O9S
Formula: C25H40N2O8S
Formula: C25H40N2O6S
Formula: C23H37NO7S
Formula: C23H37NO5S
Formula: C28H44N2O8S
Formula: #
Formula: #
Formula: 2(C20H38N6O4).H2SO4
Formula: C59H84N16O12
Formula: C59H84N16O12.C2H4O2
Formula: C46H58N4O10
Formula: C45H56N4O10
Formula: C33H40N2O12
Formula: C23H31NO2
Formula: #
Formula: #
Formula: C13H21NO3.HCl
Formula: 2(C13H21NO3).C4H6O6
Formula: C19H25NO
Formula: C23H31NO7
Formula: #
Formula: C11H12N2S.HCl
Formula: C11H15N2O4PS
Formula: C11H12N2S.H3PO4
Formula: C11H12N2S
Formula: C20H25N2O5Cl
Formula: C16H18N2O3
Formula: C8H13NO3
Formula: C8H14N2O2
Formula: C11H17NO3
Formula: C24H28O4
Formula: C66H119N21O19S
Formula: C11H12Cl2N2O
Formula: C18H29NO3.HCl
Formula: C17H25NO3
Formula: C17H25NO3.HCl
Formula: C18H28N2O.HCl
Formula: C18H28N2O
Formula: C26H30ClFN2O2
Formula: C26H29FN2O2
Formula: #
Formula: C21H25ClN2O3.2(HCl)
Formula: C21H25ClN2O3
Formula: #
Formula: C10H13NO4.HCl
Formula: C9H11NO4
Formula: C13H20N2O2
Formula: C13H9F2NO4
Formula: 2(C18H20FN3O4).H2O
Formula: C18H20FN3O4.HCl
Formula: C21H26FN3O7
Formula: C19H24FN3O7S
Formula: C18H20FN3O4
Formula: C13H16N4O6
Formula: C6H6O3
Formula: C20H25N7O6
Formula: C18H25NO3
Formula: C19H24N2OS.HCl
Formula: C19H24N2OS.C4H4O4
Formula: #
Formula: C15H22N2O.HCl
Formula: C15H22N2O
Formula: C13H21NO3
Formula: #
Formula: C19H21FN2O4
Formula: C27H35NO4
Formula: C25H34O3
Formula: C21H28O2
Formula: #
Formula: C22H29NO2
Formula: C32H39NO6S
Formula: C10H21N
Formula: C20H23NO
Formula: C20H24ClNO
Formula: #
Formula: C30H35NO3
Formula: C21H29NO7
Formula: C14H12N6O
Formula: C15H23N3O4S
Formula: C15H20I4NNaO9
Formula: C22H27NO2
Formula: #
Formula: C5H8O2
Formula: C5H8O3
Formula: C11H14N2O2
Formula: C6H11N3O3
Formula: C6H9ClO3
Formula: C6H9ClO3
Formula: C5H8O3
Formula: C5H9NO3
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C20H35NO15
Formula: C20H35NO15
Formula: C21H38NO15
Formula: C2H2ASCL3
Formula: C4H4AsCl3
Formula: C6H6AsCl3
Formula: C29H48O4
Formula: #
Formula: C14H14O3
LF 57
Formula: #
Formula: Br2C11H8N2O2
Formula: C16H14ClF3N2O
LHRH (1-5)
Formula: C34H38N8O9
Formula: C34H40N10O8
Formula: C36H42N10O9
LHRH (2-10), TRP(6)-
Formula: #
Formula: #
Formula: #
LHRH, AC-2-NAL(1)-4-CL-PHE(2)-TRP(3)-SER(RHA)(6)-AZGLYNH2(10)-
Formula: #
Formula: #
Formula: C79H98N18O18
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C41H76O9Ti
Formula: C66H108O12S3Ti
Formula: C60H123O15P3Ti
Formula: C60H123O24P6Ti.3H
Formula: C30H39N3O6Ti
Formula: C15H14N2O2
Formula: C20H20O4
Formula: #
Formula: C20H20O4
Formula: C21H22O4
Formula: C16H14O5
Formula: C21H22O4
Formula: C15H12O5
Formula: C23H22ClNO2
Formula: C20H18O6
Formula: C20H18O6
Formula: C21H22O5
Formula: #
Formula: C42H62O16Zn
Formula: C42H62O16
Formula: C26H31FN2O4
Formula: C12H13NO
Formula: C14H23ClN2O
Formula: C14H22N2O.HCl
Formula: C14H22N2O
Formula: C30H35F2N3O
Formula: C18H11F3N2O2S
Formula: C37H42N2O6.2(HClO4)
Formula: C37H42N2O6.x(HClO4)
Formula: C37H42N2O6
Formula: C19H16N2O2
Formula: #
Formula: C37H34N2O9S3.2Na
Formula: C27H53NO2
Formula: (C15H25NO4)n
Formula: (C33H60N80)n
Formula: (C35H66N8)n=4-5
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C26H30O13
Formula: C21H29NO7
Formula: C35H46O19
Formula: C35H46O17
Formula: C35H46O17
Formula: C35H46O18
Formula: C12H14O2
Formula: C12H14O2
Formula: C9H14O
Formula: C33H40O18
Formula: C25H32O12
Formula: #
Formula: C11H11N
Formula: C29H37NO3
Formula: C14H20O
Formula: C22H36O5
Formula: #
Formula: CaO
Formula: CCaO3
Formula: #
Formula: C10H18O
Formula: #
Formula: C11H18O
Formula: #
Formula: C26H30O10
Formula: C32H42O14
Formula: C26H30O8
Formula: #
Formula: #
Formula: C34H46O15
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C59H79N15O21S6
Formula: #
Formula: C25H28N8O2
Formula: C10H18O2
Formula: C10H18O
Formula: C12H20O2
Formula: C17H23NO2
Formula: C14H24O2
Formula: C11H18O2
Formula: C14H24O2
Formula: C15H26O2
Formula: C18H24O2
Formula: C13H22O2
Formula: C10H17NO6
Formula: #
Formula: C28H32O14
Formula: C18H34N2O6S
Formula: C22H38N2O8S
Formula: C18H34N2O6S.HCl.H2O
Formula: C18H34N2O6S.HCl
Formula: #
Formula: C32H60N4O17S2
Formula: C6H6Cl6
Formula: C6H6Cl6
Formula: C6H6Cl6
Formula: C20H23NO4
Formula: #
Formula: C15H18O2
Formula: C15H16O3
Formula: C15H16O4
Formula: C34H32O10
Formula: #
Formula: CH3(CH2)6CH=CH(CH2)2COOH
Formula: C16H14O5
Formula: C14H17N5O10P2
Formula: #
Formula: #
Formula: #
Formula: C10H16O2
Formula: #
Formula: #
Formula: #
Formula: C16H20FN3O4
Formula: #
Formula: C21H18FN5O
Formula: C14H22N2O.HCl.H2O
Formula: C18H32O2
Formula: C20H26N4O5
Formula: #
Formula: #
Formula: #