Phone (USA) +1 212-348-5610
Whatsapp: +1 516-336-9307
WeChat: chembuyersguide
Chemical Search

Conier Chem&Pharma Limited.

Country: China

11F,#5 Building,
Asia pacific enterprise valley,
Chongqing, China.

Phone: +86-23-62922305
Phone 2: +86-139 9626 9627
FAX: +86-23-62457927
E-Mail:E-Mail this Supplier

Conier Chem&Pharma Limited.

Page: Home | 1 | 2 | 3 | 4 | 5 | 6 | 7 | 8 | 9 | 10 | 11 | 12 | 13 | 14 | 15 | 16 | 17 | 18 | 19 | 20 | 21 | 22 | 23 | 24 | 25 | 26 | 27 | 28 | 29 | 30 | 31 | 32 | 33 | 34 | 35 | 36 | 37 | 38 | 39 | 40 | 41 | 42 | 43 | 44 | 45 | 46 | 47 | 48 | 49 | 50 | 51 | 52 | 53 | 54 | 55 | 56 | 57 | 58 | 59 | 60 | 61 | 62 | 63 | 64 | 65 | 66 | 67 | 68 | 69 | 70 | 71 | 72 | 73 | 74 | 75 | 76 | 77 | 78 | 79 | 80 | 81 | 82 | 83 | 84 | 85 | 86 | 87 | 88 | 89 | 90 | 91 | 92 | 93 | 94 | 95 | 96 | 97 | 98 | 99 | 100 | 101 | 102 | 103 | 104 | 105 | 106 | 107 | 108 | 109 | 110 | 111 | 112 | 113 | 114 | 115 | 116 | 117 | 118 | 119 | 120 | 121 | 122 | 123 | 124 | 125 | 126 | 127 | 128 | 129 | 130 | 131 | 132 | 133 | 134 | 135 | 136 | 137 | 138 | 139 | 140 | 141 | 142 | 143 | 144 | 145 | 146 | 147 | 148 | 149 | 150 | 151 | 152 | 153 | 154 | 155 | 156 | 157 | 158 | 159 | 160 | 161 | 162 | 163 | 164 | 165 | 166 | 167 | 168 | 169 | 170 | 171 | 172 | 173 | 174 | 175 | 176 | 177 | 178 | 179 | 180 | 181 | 182 | 183 | 184 | 185 | 186 | 187 | 188 | 189 | 190 | 191 | 192 | 193 | 194 | 195 | 196 | 197 | 198 | 199 | 200 | 201 | 202 | 203 | 204 | 205 | 206 | 207 | 208 | 209 | 210 | 211 | 212 | 213 | 214 | 215 | 216 | 217 | 218 | 219 | 220 | 221 | 222 | 223 | 224 | 225 | 226 | 227 | 228 | 229 | 230 | 231 | 232 | 233 | 234 | 235 | 236 | 237 | 238 | 239 | 240 | 241 | 242 | 243 | 244 | 245 | 246 | 247 | 248 | 249 | 250 | 251 | 252 | 253 | 254 | 255 | 256 | 257 | 258 | 259 | 260 | 261 | 262 | 263 | 264 | 265 | 266 | 267 | 268 | 269 | 270 | 271 | 272 | 273 | 274 | 275 | 276 | 277 | 278 | 279 | 280 | 281 | 282 | 283 | 284 | 285 | 286 | 287 | 288 | 289 | 290 | 291 | 292 | 293 | 294 | 295 | 296 | 297 | 298 | 299 | 300 | 301 | 302 | 303 | 304 | 305 | 306 | 307 | 308 | 309 | 310 | 311 | 312 | 313 | 314 | 315 | 316 | 317 | 318 | 319 | 320 | 321 | 322 | 323 | 324 | 325 | 326 | 327 | 328 | 329 | 330 | 331 | 332 | 333 | 334 | 335 | 336 | 337 | 338 | 339 | 340 | 341 | 342 | 343 | 344 | 345 | 346 | 347 | 348 | 349 | 350 | 351 | 352 | 353 | 354 | 355 | 356 | 357 | 358 | 359 | 360 | 361 | 362 | 363 | 364 | 365 | 366 |

Product List

Formula: C9H10O3
Formula: C15H20O9
IPP, [1-14C]
Formula: C5H21N3O7P2
Formula: C21H21FO5S
Formula: #
Formula: C20H30BrNO3
Formula: C20H30NO3.Br.H2O
Formula: #
Formula: C12H16N4O3
Formula: C18H16O3
Formula: C19H28N2
Formula: #
Formula: C13H21O3PS
Formula: C40H66ClN13O13
Formula: C11H15ClN2O2
Formula: C13H13Cl2N3O3
Formula: C13H13Cl2N3O3
Formula: C15H20N2O5
Formula: C9H13N3O
Formula: C9H16N3O5P
Formula: C18H28N2O3
Formula: C18H29NO4
Formula: C13H22ClN5S
Formula: C16H13N3O6
Formula: C19H24ClN5O3S
Formula: C10H16O
Formula: C15H23N3
Formula: C40H38Cl3N2.BF4
Formula: C35H43N2NaO6S2
Formula: C32H36ClN2.Cl
Formula: C36H44ClN2.I
Formula: C42H49ClN2O4S
Formula: C31H34Cl2N2
Formula: C40H40ClN2.ClO4
Formula: #
Formula: C17H14N4O2
Formula: C21H21N5O4S
Formula: C33H35F3N6O3
Formula: C22H24N4O6
Formula: C20H20N4O3S
Formula: C20H21N5O4
Formula: C18H13ClFN3OS
Formula: C31H36N6O7
Formula: C25H30N6O2
Formula: C25H28N6O
Formula: C28H33NO9
Formula: 2(C11H12O3).C6H13NO
Formula: C13H16O2.C10H12O2
Formula: C60H87N3O12
Formula: C11H19N5S
Formula: #
Formula: #
Formula: Br3H8IrO4
Formula: #
Formula: Br3Ir
Formula: Cl3H6IrO3
Formula: IrO2
Formula: Cl6Ir
Formula: #
Formula: H2IrO3
Formula: IrCl4
Formula: H4IrO4
Formula: IrI4
Formula: IrCl3
Formula: IrN3O9
Formula: C24H45IrO6
Formula: H3IrO3
Formula: C24H45IrO6
Formula: (CH3CO2)7Ir3O3H2O
Formula: C15H21IrO6
Formula: IrBr3xH2O
Formula: IrCl3.H2O
Formula: IrCl4
Formula: H2IrO3
Formula: #
Formula: #
Formula: #
Formula: C13H10O5
Formula: C19H20O10
Formula: C24H26O13
Formula: C18H16O8
Formula: C16H10O6
Formula: C24H29FN4O
Formula: C33H38N4O6.HCl.3(H2O)
Formula: C33H38N4O6.HCl
Formula: C33H38N4O6
Formula: #
Formula: C20H18O8
Formula: C16H10O6
Formula: C13H20O
Formula: #
Formula: C19H28N2O3
Formula: Br2Fe
Formula: F2Fe
Formula: #
Formula: C9H21FeO3
Formula: C6Fe2O12
Formula: C6H12Fe2O18
Formula: #
Formula: C2H3FeO2
IRON ALLOY, BASE, FE 84,MN 15,MO 0.6,C 0.5
Formula: #
Formula: #
Formula: Al3Fe
Formula: FeSb2
Formula: AsFe2H
Formula: Fe(BF4)2.6(H2O)
Formula: #
Formula: B2Fe2
Formula: Br3Fe
Formula: 2-Feb
Formula: #
Formula: Cl2Fe
Formula: Cl6Fe2H14O7
Formula: ClFeO4S
Formula: C12Fe3O12
Formula: C12H24FeO12
Formula: FeHO2
Formula: C4H5FeO5
Formula: Fe(OH)3
Formula: C36H24F12FeN6P2
Formula: C4H5FeO2
Formula: FeI2
Formula: #
Formula: FeMnO3-
Formula: 2(C11H7O2).Fe
Formula: Fe6N2
Formula: BFeO3
Formula: Fe2H2O4
Formula: Fe3O4
Formula: Fe3O4
Formula: Fe3P
Formula: Fe2HP
Formula: C32H16FeN8
Formula: FeKO8S2
Formula: #
Formula: K2FeO4
Formula: #
Formula: #
Formula: FeSi
Formula: FeNaO7P2
Formula: #
Formula: C12H22FEXO13
Formula: #
Formula: Fe2O5Ti
Formula: C36H69FeO6
Formula: C48H93FeO6
Formula: C18H12Cl3FeO9S3
Formula: FeO4V
Formula: As2Fe3O8
Formula: C2H2FeO4
Formula: Cl2FeO8
Formula: C6FeN6
Formula: C5FeN5
Formula: FeO4S
Formula: C36H24Cl2FeN6O8
Formula: C12H26FeO16
Formula: C30H24Cl2FeN6O8
Formula: C36H36Cl2FeN6O8
Formula: C39H30Cl2FeN6O8
Formula: C39H30FeN6O4S
Formula: C36H21Cl2FeN9O14
Formula: C6H6FeO4
Formula: C12H8FeN2O4
Formula: C6FeN6
Formula: FeO4P
Formula: C6H9FeO6
Formula: C21H15FeO6
Formula: C3Fe2O9
Formula: Cl3FeO9
Formula: FeI3
Formula: Fe2O12S3
Formula: C6H18FeO24P6
IRON(+3) CATION; (9Z,21Z,33Z)-3,15,27-TRIAMINO-10,22,34-TRIMETHYL-7,19,31-TRIOXIDO-1,13,25-TRIOXA-7,19,31-TRIAZACYCLOHEXATRIACONTA-9,21,33-TRIENE-2,8,14,20,26,32-HEXONE
Formula: C33H51FeN6O12
IRON(+3) CATION; (E)-N-[6,15,27-TRIS[3-(ACETYL-OXIDOAMINO)PROPYL]-18-(HYDROXYMETHYL)-12-METHYL-2,5,8,11,14,17,20,23,26,29-DECAOXO-21-PROPAN-2-YL-1-OXA-4,7,10,13,16,19,22,25,28-NONAZACYCLOHENTRIACONT-30-YL]DEC-3-ENAMIDE
Formula: C51H82FeN13O19
Formula: C30H27FeO6
Formula: C54H99FeO6
IRON(+3) CATION; 1,12,23-TRIOXIDO-1,6,12,17,23,28-HEXAZACYCLOTRITRIACONTANE-2,5,13,16,24,27-HEXONE
Formula: C27H45FeN6O9
Formula: C18H15FeO9
Formula: C14H8FeN6
Formula: Fe2O5Pb2
Formula: Fe2Mn2O5
Formula: CH3AsFeO3
Formula: Fe2Mo2O9
Formula: Fe9Ni9S16
Formula: Fe2Ni2O5
Formula: C24H45FeO6
Formula: ClFeO
Formula: Fe2O7Ti2
Formula: Fe2O9W2
Formula: FeO3Y
Formula: FeOZr
Formula: Fe4O21P6
IRON(1+), BIS(1H-IMIDAZOLE-N3)5,10,15,20-TETRAMETHYL-21H,23H-PORPHINATO(2-)-N21,N22,N23,N24-, (OC-6-12)-
Formula: #
Formula: C12H12Fe2K2O18
Formula: C2H10FeN2O8S2
Formula: C30H57FeO6
Formula: B3F12Fe
Formula: FeH6N3O9S3
IRON(II) 1,2,3,4,8,9,10,11,15,16,17,18,22,23,24,25-HEXADECACHLORO-29H,31H-PHTHALOCYANINE
Formula: Cl2FeH4O2
Formula: Cl2FeH12O6
Formula: Cl2FeH2O
Formula: C10H14FeN2O8
Formula: F2FeH8O4
Formula: C6H16FeO9
Formula: FeMoO4
Formula: #
Formula: FEN2O6.6H2O
Formula: Fe3O8P2
Formula: Cl2FeH2O9
Formula: C42H26FeN10
Formula: C6H5FeNaO7
Formula: Fe(BF4)2
Formula: C2F6FeO6S2
Formula: C16H21FeN6O5
Formula: #
Formula: C30H23FeO10S3
Formula: C9H9FeO6
Formula: Cl3FeH12O6
Formula: C6H5FeO7
Formula: C6H7FeO8
Formula: FeC6H5O7.3(H2O)
Formula: C6H15FeO3
Formula: F3Fe
Formula: F3FeH6O3
Formula: #
Formula: C14H10ClNO3
Formula: #
Formula: #
Formula: Fe2H2O4
Formula: C21H21FeO9S3
Formula: (C7H7O3S)3.Fe.6(H2O)
Formula: Cl3FeH2O13
Formula: FeO4P
Formula: C32H16ClFeN8
Formula: Fe2H10O17S3
Formula: #
Formula: Fe2O5Ti
Formula: C3F9FeO9S3
Formula: C6H7FeO6
Formula: C30H28FeN4O4
Formula: #
Formula: C18H12FeN3O9
Formula: #
IRON, (2,3,7,8,12,13,17,18-OCTAETHYL-21H,23H-PORPHINATO(2-)-N21,N22,N23,N24)(PERCHLORATO-O)-, (SP-5-12)-
Formula: C36H44ClFeN4O4
Formula: C18H14FeN4
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: Fe.Ti
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C15H29ClFeO14
Formula: FeH8Mg3O8Si2
Formula: Fe
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C6H16FeO9
Formula: Fe(CO)5
Formula: C346H585N97O102S5
Formula: #
IRS 19
Formula: #
Formula: C9H7Cl2N5.C4H4O4
Formula: C9H7Cl2N5.C4H4O4
Formula: C9H7Cl2N5
Formula: #
Formula: #
IS 145
Formula: #
Formula: #
Formula: C22H23N3O2
Formula: C16H11N3O3
Formula: C16H22N2O2
Formula: C12H20N2O2
Formula: C18H26O2
Formula: C33H59N5O7
Formula: #
Formula: #
Formula: H2NC6H4COCOOH
Formula: C18H25NO7
Formula: C8H6N2O2
Formula: C8H4NNaO5S
Formula: C8H5NO2
Formula: C8H5NO3
Formula: C10H12N4O6S.H2O
Formula: C22H17F2N5OS
Formula: C9H17ClN3O3PS
Formula: C18H19NO2
Formula: C11H16N4O2
Formula: #
Formula: C21H22O4
Formula: C22H43N5O12.H2SO4
Formula: C22H43N5O12
Formula: C22H47N5O20S2
Formula: C4H9NO4S
Formula: C4H9ClNNaO4S
Formula: #
Formula: #
ISIS 3082
Formula: #
Formula: C56H65N7O8
Formula: C15H10O5
Formula: C19H19ClN2
Formula: #
Formula: C5H9NO2
Formula: #
Formula: C9H16O2
Formula: C7H14O2S
Formula: C9H16O2
Formula: C9H14N2
Formula: #
Formula: #
Formula: C208H344N72O68S3
Formula: C13H26O2
Formula: C9H11O3-
Formula: C10H18
Formula: C10H8ClN3O
Formula: C15H22O3
Formula: #
Formula: #
Formula: C10H19O6PS2
Formula: C11H20O2
Formula: C11H22O2
Formula: #
Formula: C6H10
Formula: C11H12F3NO2
Formula: C6H10O2
Formula: #
Formula: C3H4D4O
Formula: C3H4ClD6N
Formula: C8H12
Formula: C10H18
Formula: C15H30O2
Formula: #
Formula: C29H36O15
Formula: C15H20O2
Formula: C8H18
Formula: C10H22
Formula: C13H12O4
Formula: #
Formula: C18H16O6
Formula: C9H18O2S
Formula: C7H14O2
Formula: C5H12O
Formula: C13H17BrO2
Formula: C12H16O2
Formula: C9H18O2
Formula: C9H18O2
Formula: C6H13NO2
Formula: C5H11Cl
Formula: C14H18O2
Formula: C15H26O2
Formula: C5H11I
Formula: C17H34O2
Formula: C5H11NO2
Formula: C5H11NO2
Formula: C13H26O2
Formula: C8H16O2
Formula: C12H16O3
Formula: C12H16O3
Formula: C10H18O2
Formula: C6H11N
Formula: #
Formula: #
Formula: C22H28O6
Formula: C12H14O4
Formula: C17H17NO2
Formula: #
Formula: C45H72O16
Formula: C4H4N2O3
Formula: C20H20O4
Formula: C20H20O4
Formula: #
Formula: C11H14O
Formula: C9H10O2
Formula: C8H7BrO
Formula: #
Formula: C12H8O4
Formula: C11H6O4
Formula: C17H14O4
Formula: C11H16O4
Formula: C9H14O3
Formula: C10H18O
Formula: C14H22O2
Formula: C12H20O2
Formula: C13H20O2
Formula: C12H19BrO2
Formula: C14H24O2
Formula: #
Formula: C14H24O2
Formula: C15H26O2
Formula: C14H22O2
Formula: C13H22O2
Formula: C23H28O11
Formula: C4H10N2O
Formula: C4H10
Formula: C4H11BO2
Formula: C4H9ClO2S
Formula: C8H10O3
Formula: C7H16O2
Formula: #
Formula: C10H18O2
Formula: C6H13NO3
Formula: C11H19NO4P
Formula: C18H30O2
Formula: C18H25NO3
Formula: C45H58N4O9
Formula: C19H30O3
Formula: C8H12N2O3
Formula: C12H14O3C12
Formula: C13H16Cl2O3
Formula: C12H17NO2
Formula: C8H14O2
Formula: C7H13ClO2
Formula: C9H16O2
Formula: C12H24O2
Formula: C9H18O2
Formula: C10H20O2
Formula: C8H14O3
Formula: C13H26O2
Formula: C11H15ClN2O2
Formula: C11H14O3
Formula: C9H16O2
Formula: C10H14O2S
Formula: C15H21ClO3
Formula: C11H14O3
Formula: C11H21ClO2
Formula: C6H12O2
Formula: C8H14O3
Formula: C7H12O2
Formula: C15H15NO4
Formula: C11H15NO2
Formula: C11H14O2
Formula: C12H18O
Formula: C8H16O2
Formula: C14H28O2
Formula: C9H18O3
Formula: C4H9Cl
Formula: C5H9ClO2
Formula: C13H16O2
Formula: C7H11NO2
Formula: C13H24O2
Formula: C11H16O3
Formula: C11H14O5
Formula: C10H16O2
Formula: C10H20O2
Formula: C4H14N2O4S
Formula: C8H12O4
Formula: C12H14O4
Formula: C4H9I
Formula: C16H26O
Formula: C8H16O2
Formula: C5H9NS
Formula: C9H18O2
Formula: C7H14O3
Formula: C8H14O2
Formula: C5H12O
Formula: #
Formula: C18H36O2
Formula: C4H9NO3
Formula: C13H22O2
Formula: C11H16O3S
Formula: C20H40O2
Formula: C12H16O2
Formula: C4H11P
Formula: C7H14O2
Formula: C11H14O3
Formula: C22H44O2
Formula: C9H16O2
Formula: C7H18N2
Formula: C6H12O
Formula: C7H18O2Si
Formula: C5H12ClNO2S
Formula: #
Formula: C11H14F3N
Formula: C4H11Al2O
Formula: C4H12ClN
Formula: C4H11N
Formula: C8H19NO2
Formula: C10H14
Formula: #
Formula: C4H8O
Formula: C4H8S
Formula: C13H18
Formula: C4H8
Formula: C9H22O2Si
Formula: C4H9ClMg
Formula: C7H12O4
Formula: C4H10S
Formula: #
Formula: C4H9NO2
Formula: C4H10ClNO2S
Formula: C5H12N2S
Formula: C7H18O3Si
Formula: C5H12N2O
Formula: C5H9NO
Formula: C4H8O
Formula: C4H9NO
Formula: #
Formula: C8H14Cl3O5P
Formula: C12H7Cl3N2O2
Formula: C8H16O3
Formula: C4H10N2O
Formula: C7H14O2
Formula: C10H12O2
Formula: C8H14N2O2
Formula: C4H8O2
Formula: C8H14O3
Formula: C4H9NO2
Formula: C4H7N
Formula: C10H12O
Formula: #
Formula: C4H7ClO
Formula: C4H7FO
Formula: C20H22O6
Formula: C17H18O7
Formula: C8H10N4O2
Formula: C15H26O2
Formula: C8H14(COOH)2
Formula: C9H14O6
Formula: C6H11N
Formula: C23H28N2O6
Formula: C8H15N3O2
Formula: C11H16NO4PS
Formula: C9H7NO
Formula: #
Formula: #
Formula: C45H53NO14
Formula: C34H68O2
Formula: C25H24O5
Formula: C16H18O9
Formula: C25H24O12
Formula: C25H24O12
Formula: C25H24O12
Formula: C22H24Cl2N2O8
Formula: C10H13NO
Formula: C9H8O2
Formula: C9H10O
Formula: C15H8O4
Formula: C16H8O4
Formula: C6H5Na3O7
Formula: C10H18
Formula: C20H25NO4
Formula: #
Formula: C20H22O6
Formula: #
Formula: C18H14Cl4N2O.HNO3
Formula: C20H30O2
Formula: C19H14NO4.HSO4
Formula: C21H25NO4
Formula: C20H23NO4
Formula: C22H26N2O4
Formula: #
Formula: #
Formula: #
Formula: C20H32O3
Formula: #
Formula: C3H5NO2
Formula: CH3GeNO
Formula: CH3NOSi
Formula: C19H15NOSi
Formula: C4H9NOSi
Formula: #
Formula: C3HNO
Formula: C11H7NO
Formula: CHB12NO37
Formula: #
Formula: C13H15NO2
Formula: C10H6N2O2
Formula: C11H13NO
Formula: C11H13NO
Formula: #
Formula: #
Formula: #
Formula: C17H26N4O5
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C9H7NO2S
Formula: C7H5N
Formula: C8H7N
Formula: C12H15N3O6
Formula: C12H17N3O3
Formula: C18H21N3O9
Formula: #
Formula: C20H32O2
Formula: C9H13N3O5
Formula: C22H22O10
Formula: C4H5N3O
Formula: C13H20O
Formula: #
Formula: C10H23N
Formula: C10H22
Formula: C10H24N2
Formula: C10H22O
Formula: C10H22O
Formula: C19H38O2
Formula: C35H58O6
Formula: C22H31O4P
Formula: C22H31O3P
Formula: C28H56O3
Formula: C24H46O4
Formula: C26H42O4
Formula: #
Formula: C12H24O2S
Formula: C14H26O2
Formula: #
Formula: C26H42O4
Formula: C28H54O2
Formula: C19H38O2
Formula: C16H26O3P
Formula: C15H30O2
Formula: C28H56O2
Formula: #
Formula: C8H8O4
Formula: #
Formula: C19H20O6
Formula: #
Formula: C24H40N5O8
Formula: #
Formula: C18H20N2O6
Formula: C12H26O
Formula: C18H30O
Formula: #
Formula: C12H8Cl6
Formula: #
Formula: #
Formula: C20H42
Formula: C12H16O3
Formula: C12H16O3
Formula: C35H39N5O5
Formula: C25H26O6
Formula: #
Formula: C10H12O2
Formula: C12H14O3
Formula: C6H14ClNO3
Formula: C14H22NO4PS
Formula: C15H24NO5P
Formula: C10H10O4
Formula: C23H18N2O2
Formula: #
Formula: C15H12O2
Formula: C15H10O2
Formula: #
Formula: C9H18O8
Formula: C6F4O2
Formula: C23H29FO6
Formula: C21H27FO5
Formula: C3H2ClF5O
Formula: C29H36O15
Formula: C11H10O5
Formula: C15H20O
Formula: C28H32O6
Formula: C14H10O5
Formula: #
Formula: #
Formula: C32H22O10
Formula: C19H34O15
Formula: #
Formula: #
Formula: C16H14O5
Formula: C19H18ClNO4
Formula: C10H13N5O5
Formula: C6H10ClNO2
Formula: C9H15NO2
Formula: #
Formula: #
Formula: C7H16O
Formula: C7H16
Formula: C26H54O
Formula: C16H32O
Formula: C16H32O2
Formula: C16H34O
Formula: C34H68O2
Formula: #
Formula: C16H32O2
Formula: C29H50O6
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C15H20O7
Formula: C16H14O4
Formula: #
Formula: C8H10ClNO
Formula: C8H10N2.HCl
Formula: C9H11NO
Formula: C8H9N
Formula: C8H10ClN
Formula: C11H19N
Formula: C9H8N2
Formula: C9H10ClNO2
Formula: C8H9N
Formula: #
Formula: #
Formula: C18H28N6O
Formula: C20H24O6
Formula: C7H15NO3
Formula: C6H13NO2
Formula: C60H102N6O18
Formula: C19H36N4O5S
Formula: C25H47N5O6S
Formula: #
Formula: #
Formula: C37H42N2O6
Formula: C15H16O3
Formula: #
Formula: C20H29NO7
Formula: C15H12O4
Formula: C26H30O13
Formula: C21H22O9
Formula: C15H24O
Formula: C15H24
Formula: C15H24O
Formula: C18H18O3
Formula: C30H52O26
Formula: C12H22O11
Formula: C18H32O16
Formula: C19H18O11
Formula: C30H48O3
Formula: C6H10O4
Formula: C31H40O15
Formula: C14H14ClN3O2S
Formula: C16H14O4
Formula: C10H20O
Formula: C10H18O
Formula: #
Formula: C15H16O4
Formula: #
Formula: C28H26ClN7
Formula: C13H25NO6
Formula: C9H19N.C6H10O8
Formula: 2(C9H19N).C6H10O8
Formula: C12H20N4OS
Formula: C16H20O6
Formula: C21H24N2O4
Formula: C60H102O29
Formula: #
Formula: #
Formula: C17H18O5
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C54H70N10O14
Formula: C6H7N3O
Formula: C12H10N4
Formula: C13H12N2O
Formula: C8H10N2O
Formula: C9H12N2O
Formula: C6H6N2O2
Formula: C8H10N2O
Formula: C6H6N2O2
Formula: C7H8N2O2
Formula: C8H10N2O
Formula: C6H6N2O
Formula: #
Formula: #
Formula: C9H9NO2
Formula: C7H11N3O
Formula: C8H9NO2
Formula: C8H10N2O4
Formula: C9H8N2O3
Formula: C7H9N3O2
Formula: C9H11NO2
Formula: C7H9N3O2
Formula: C6H5NO2
Formula: C12H8N2O3
Formula: C6HD4NO2
Formula: C6H4KNO2
Formula: C8H10N2O
Formula: C8H8N2O
Formula: C9H8N2
Formula: C6H4ClNO.HCl
Formula: C6H6N2OS
Formula: C6H12N2O
Formula: C6H11NO2.HCL
Formula: C6H11NO2
Formula: #
Formula: C3H5NO2
Formula: #
Formula: C13H28O2
Formula: C18H40N2O5S
Formula: C17H34O2
Formula: C11H25NO3
Formula: C18H34O4Pb
Formula: C9H18O2
Formula: C12H24O2S
Formula: C11H22O2
Formula: C9H20O
Formula: C16H25NO2
Formula: C9H21O4P
Formula: C10H20O2
Formula: C26H42O4
Formula: C12H24O2
Formula: C27H54O2
Formula: C9H21N
Formula: C15H24O
Formula: C17H28O
Formula: #
Formula: C18H36O
Formula: C18H36O2
Formula: C24H50O7
Formula: C19H38O2
Formula: #
Formula: C21H44O5
Formula: #
Formula: #
Formula: C18H38O
Formula: C22H38O3
Formula: C36H72O2
Formula: C21H42O3
Formula: C23H46O2
Formula: C36H72O2
Formula: #
Formula: C8H18
Formula: C8H16O2
Formula: C8H17K2O4P
Formula: O4P
Formula: C8H18O
Formula: C8H16
Formula: C26H48O2
Formula: #
Formula: C16H32O2
Formula: C18H26O4S
Formula: C11H22O2S
Formula: C26H50O3
Formula: C10H20O2
Formula: C26H51O3 *
Formula: C12H20O4
Formula: C16H22O4
Formula: C10H20O2S
Formula: C24H48O2
Formula: C24H48O2
Formula: C26H52O2
Formula: C13H28O2SSn
Formula: C8H17Cl3Si
Formula: C15H18N6O
Formula: C21H20O11
Formula: #
Formula: C18H18O6
Formula: #
Formula: C15H33N
Formula: C5H12
Formula: C5H11O4P
Formula: C5H21N3O7P2
Formula: C10H18O2
Formula: C15H20O3
Formula: #
Formula: C19H34Cl2N2O2
Formula: #
Formula: C10H22O
Formula: C6H12O2
Formula: C11H22O2
Formula: C9H18O2
Formula: C10H20O2
Formula: C19H38O2
Formula: C5H11NO3
Formula: C13H29O4P
Formula: C23H44O2
Formula: C11H11Cl5O
Formula: C13H20O
Formula: C13H18O2
Formula: C23H46O2
Formula: C10H20O2
Formula: #
Formula: #
Formula: #
Formula: C6H14N2O
Formula: #
Formula: C19H19N
Formula: #
Formula: #
Formula: C10H22N2
ISOPHORONE (3-METHYL-D3, 2,4,4,6,6-D5)
Formula: C9H6D8O
Formula: C39H67N3O12
Formula: C12H18N2O2
Formula: C22H38N2O9
Formula: C9H14O
Formula: #
Formula: C7H15Cl2N2O2P
Formula: C9H7P
Formula: C9H7NO
Formula: C9H7NO
Formula: (C8H6O4)x.(C8H6O4)y.(C2H6O2)z
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C20H12Cl4N2O4
Formula: C40H48O19
Formula: C8H6O4
Formula: C8H10N4O2
Formula: (C13H21NO5)x.(C8H4Cl2O2)x
Formula: C8H4Cl2O2
Formula: C18H32I2N4O2
Formula: #
Formula: C20H40O
Formula: #
Formula: C11H17N3O5
Formula: C16H18N2O3
Formula: #
Formula: C20H30O2
Formula: #
Formula: C13H10O5
Formula: C27H28O6
Formula: C15H18N2O
Formula: C21H34O2
Formula: C11H17NO3.HCl
Formula: 2(C11H17NO3).H2SO4
Formula: C5H8
Formula: #
Formula: C10H12N4O5.3(C9H9NO3).3(C5H13NO)
Formula: C11H15NO2
Formula: C15H20O2
Formula: C15H23N3O4
Formula: C23H33IN2O
Formula: C3H8O
Formula: C3H12NO5P
Formula: C15H36O5Zr
Formula: C5H8O2
Formula: C4H5ClO2
Formula: C9H17BO2
Formula: C3H5BrMg
Formula: C3H5Cl2OP
Formula: #
Formula: C5H10O3
Formula: #
Formula: C9H19BO3
Formula: C9H17NO4
Formula: C9H19GeNO4
Formula: C6H14O2
Formula: C57H112O7Ti