Phone (USA) +1 212-348-5610
Whatsapp: +1 516-336-9307
WeChat: chembuyersguide
Chemical Search

Conier Chem&Pharma Limited.

Country: China

11F,#5 Building,
Asia pacific enterprise valley,
Chongqing, China.

Phone: +86-23-62922305
Phone 2: +86-139 9626 9627
FAX: +86-23-62457927
E-Mail:E-Mail this Supplier

Conier Chem&Pharma Limited.

Page: Home | 1 | 2 | 3 | 4 | 5 | 6 | 7 | 8 | 9 | 10 | 11 | 12 | 13 | 14 | 15 | 16 | 17 | 18 | 19 | 20 | 21 | 22 | 23 | 24 | 25 | 26 | 27 | 28 | 29 | 30 | 31 | 32 | 33 | 34 | 35 | 36 | 37 | 38 | 39 | 40 | 41 | 42 | 43 | 44 | 45 | 46 | 47 | 48 | 49 | 50 | 51 | 52 | 53 | 54 | 55 | 56 | 57 | 58 | 59 | 60 | 61 | 62 | 63 | 64 | 65 | 66 | 67 | 68 | 69 | 70 | 71 | 72 | 73 | 74 | 75 | 76 | 77 | 78 | 79 | 80 | 81 | 82 | 83 | 84 | 85 | 86 | 87 | 88 | 89 | 90 | 91 | 92 | 93 | 94 | 95 | 96 | 97 | 98 | 99 | 100 | 101 | 102 | 103 | 104 | 105 | 106 | 107 | 108 | 109 | 110 | 111 | 112 | 113 | 114 | 115 | 116 | 117 | 118 | 119 | 120 | 121 | 122 | 123 | 124 | 125 | 126 | 127 | 128 | 129 | 130 | 131 | 132 | 133 | 134 | 135 | 136 | 137 | 138 | 139 | 140 | 141 | 142 | 143 | 144 | 145 | 146 | 147 | 148 | 149 | 150 | 151 | 152 | 153 | 154 | 155 | 156 | 157 | 158 | 159 | 160 | 161 | 162 | 163 | 164 | 165 | 166 | 167 | 168 | 169 | 170 | 171 | 172 | 173 | 174 | 175 | 176 | 177 | 178 | 179 | 180 | 181 | 182 | 183 | 184 | 185 | 186 | 187 | 188 | 189 | 190 | 191 | 192 | 193 | 194 | 195 | 196 | 197 | 198 | 199 | 200 | 201 | 202 | 203 | 204 | 205 | 206 | 207 | 208 | 209 | 210 | 211 | 212 | 213 | 214 | 215 | 216 | 217 | 218 | 219 | 220 | 221 | 222 | 223 | 224 | 225 | 226 | 227 | 228 | 229 | 230 | 231 | 232 | 233 | 234 | 235 | 236 | 237 | 238 | 239 | 240 | 241 | 242 | 243 | 244 | 245 | 246 | 247 | 248 | 249 | 250 | 251 | 252 | 253 | 254 | 255 | 256 | 257 | 258 | 259 | 260 | 261 | 262 | 263 | 264 | 265 | 266 | 267 | 268 | 269 | 270 | 271 | 272 | 273 | 274 | 275 | 276 | 277 | 278 | 279 | 280 | 281 | 282 | 283 | 284 | 285 | 286 | 287 | 288 | 289 | 290 | 291 | 292 | 293 | 294 | 295 | 296 | 297 | 298 | 299 | 300 | 301 | 302 | 303 | 304 | 305 | 306 | 307 | 308 | 309 | 310 | 311 | 312 | 313 | 314 | 315 | 316 | 317 | 318 | 319 | 320 | 321 | 322 | 323 | 324 | 325 | 326 | 327 | 328 | 329 | 330 | 331 | 332 | 333 | 334 | 335 | 336 | 337 | 338 | 339 | 340 | 341 | 342 | 343 | 344 | 345 | 346 | 347 | 348 | 349 | 350 | 351 | 352 | 353 | 354 | 355 | 356 | 357 | 358 | 359 | 360 | 361 | 362 | 363 | 364 | 365 | 366 |

Product List

Formula: C12H19NO
Formula: #
Formula: C11H18ClNO
Formula: C8H19O3P
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C9H12ClN
Formula: #
Formula: C16H21ClO2
Formula: C7H7ClOS
Formula: #
Formula: C6H9ClN2O4S
Formula: C11H12O3
Formula: #
Formula: C7H10O2
Formula: C7H8ClNO
Formula: C7H3D5O
Formula: C7HD7O
Formula: C7D8O
Formula: C7H8O
Formula: C7H8O
Formula: C7H8O
Formula: C7H8O4S
Formula: C19H17O4P
Formula: C9H13NO2S
Formula: C13H16O
Formula: #
Formula: #
Formula: 3(C7H12O2P).Al
Formula: C6H11Cl2P
Formula: C10H16N2
Formula: C12H15N
Formula: C14H31O3P
Formula: C28H24N2O2
Formula: C15H15ClN2O2S
Formula: C10H14Cl2N3Zn+
Formula: C12H18N3O+
Formula: C13H14N3O5S
Formula: C11H18N3O4P++
Formula: C4H9NO2
Formula: C6H12O4
Formula: C5H7NO2
Formula: C4H8O2S2
Formula: #
Formula: #
Formula: C3H8ClOP
Formula: C2H5Cl2OP
Formula: C6H15O2P
Formula: C63 H70 O7
Formula: C9H5F7O
Formula: C11H10FNO3
Formula: C16H16F2S
Formula: #
Formula: C11H12N2OS
Formula: C10H10N2OS
Formula: C12H12N2OS
Formula: C11H12N2OS
Formula: C11H12N2S
Formula: #
Formula: C13H20O2
Formula: #
Formula: C12H20ClN
Formula: C13H18O2
Formula: C66H58CaD10F2N4O12
Formula: C12H11N7O4S
Formula: #
Formula: #
Formula: C7H6O2
Formula: C9H7NaO4
Formula: C11H14O
Formula: C15H24O
Formula: #
Formula: C40H48O4
Formula: C11H16O
Formula: #
Formula: C10H13NO2
Formula: C17H18N2O2
Formula: #
Formula: C10H18O2
Formula: C10H18O
Formula: #
Formula: C10H15NO
Formula: #
Formula: C10H16
Formula: #
Formula: #
Formula: C10H16O
Formula: C10H16O
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C29H51O3S
Formula: #
Formula: #
Formula: C10H20
Formula: C10H20O3
Formula: C10H20O2
Formula: C10H20O2
Formula: C10H18S
Formula: C10H20O2
Formula: C24H33NO
Formula: #
Formula: #
Formula: C7H7OSe
Formula: C13H16NO2PS
Formula: C7H17O3P
Formula: C13H13O3P
Formula: C5H13O3P
Formula: C48H48O6
Formula: #
Formula: C10H12BF4N3O
Formula: C25H27IN4O2HCl
Formula: C27H18O2
Formula: C7H6N2O3
Formula: C10H13NO4
Formula: C6H6AsNO5
Formula: #
Formula: C7H5NO4
Formula: C28H25N2O10P
Formula: C15H15N3O5S
Formula: C22H19N3O7S
Formula: C16H16N2O7
Formula: C11H14N2O2
Formula: #
Formula: #
Formula: C12H15NO7S
Formula: C22H31N3O13
Formula: C12H14N4O7
Formula: C15H19NO8
Formula: #
Formula: C15H19NO8
Formula: C30H45NO23
Formula: C36H55NO28
Formula: C24H35NO18
Formula: C7H4N2O3
Formula: C16H32N3O10P
Formula: C9H9NO4
Formula: C24H39NO4
Formula: C11H13NO4
Formula: C12H15NO6S
Formula: C12H15NO6S
Formula: C8H6N2O2
Formula: C6H9N3O6S
Formula: C6H12N3O6P
Formula: C11H17N2O6P
Formula: C7H7NO
Formula: C33H42N2O4
Formula: C26H36N2O4
Formula: #
Formula: C30H22
Formula: #
Formula: C14H19NO8
Formula: C22H39O3P
Formula: C13H10BrCl2O2PS
Formula: #
Formula: C6H8N2.H2SO4
Formula: C6H8N2
Formula: C12H12O4
Formula: C5H13O3P
Formula: #
Formula: C24H18
Formula: #
Formula: C11H16O
Formula: C36H26
Formula: #
Formula: C8H7KO3S
Formula: C28H24O16S4
Formula: C17H29N5O6
Formula: C26H24N2O2S
Formula: C18H14
Formula: C11H14O2
Formula: #
Formula: C88H112O8
Formula: C52H86O5
Formula: C12H16O
Formula: C8H9NO
Formula: C8H8O
Formula: C7H9NO2S
Formula: C9H10N4O2S
Formula: C8H9N5O2S
Formula: C13H13NO2S
Formula: C11H12O3S
Formula: #
Formula: #
Formula: #
Formula: C13H11NO5S
Formula: C23H40O3S
Formula: #
Formula: C7H8O3S.H2O
Formula: C11H16O3S
Formula: C14H22O3S
Formula: C13H20O3S
Formula: C25H44O3S
Formula: C15H24O3S
Formula: C13H12O3S
Formula: #
Formula: C7H8O3S
Formula: C7H7FO2S
Formula: C8H11N3O3S
Formula: C11H17NO2S
Formula: C7H8S
Formula: C7H7KO2S2
Formula: C17H25NO2
Formula: C8H8O2
Formula: C8H10N2O
Formula: C7H6D3N
Formula: C7H9N
Formula: C8H7N
Formula: C8H5F3O
Formula: C7H6O2
Formula: C12H16O2
Formula: C16H14O3
Formula: C17H12N2O4S
Formula: C9H10O2
Formula: C7H9AsO3
Formula: C14H12O2
Formula: C13H18O2
Formula: C8H7NO
Formula: C7H7Cl2O2P
Formula: C10H12O2
Formula: #
Formula: C8H7F3O3S
Formula: C18H26O2
Formula: C9H10O2S
Formula: C9H9ClO
Formula: C7H9O3P
Formula: C11H17O3P
Formula: C12H12O2
Formula: C9H10O
Formula: C9H13ClSi
Formula: C7H7ClHg
Formula: C8H8N2O2S
Formula: C20H17ClN4
Formula: C7H7Cl3Si
Formula: C10H16Si
Formula: C53H50BP
Formula: C8H5Cl5S
Formula: C7H5F3O2
Formula: C13H15F7O3Si
Formula: #
Formula: C11H9N
Formula: C14H18O6
Formula: C11H10CrO3 6*
Formula: #
Formula: C8H10
Formula: C8D10
Formula: C24H22O4
Formula: C18H28N2S4
Formula: C44H38P2
Formula: C8H12O6P2
Formula: C16H28O6P2
Formula: #
Formula: C20H23N10O16P3
Formula: C20H23N10NaO19P4
Formula: C20H25N10O22P5
Formula: C20H24N10NaO21P5
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C14H12F3N3O5
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C23H28N4O2
Formula: #
Formula: #
Formula: C24H41NO
Formula: C15H26N2
Formula: C33H52O5
Formula: #
Formula: C24H44N2
Formula: #
Formula: C47H51NO14.x(C5H9NO4)n
Formula: C24H21NO5
Formula: C47H51N1O14
Formula: C47H51NO14
Formula: C15H20ClN3O
Formula: C18H31F3O2
Formula: C12H15ClN2O2
Formula: C25H40N2O3
Formula: C37H41N5O9PdS
Formula: C14H21NO2
Formula: #
Formula: C16H14O7
Formula: #
Formula: C18H22O11S
Formula: C17H18O6
Formula: C23H28O11
Formula: C10H14O4
Formula: C10H12O4
Formula: C17H18O6
Formula: C10H14O4
Formula: C9H10O3
Formula: C20H28O12
Formula: C18H31N3O3
Formula: #
Formula: C20H20N4O3
Formula: #
Formula: C23H22ClN3O2
Formula: #
Formula: #
Formula: C29H31NO7
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C16H10N4Na2O10S2
Formula: C12H22O11
Formula: C12H22O11
Formula: C12H13Cl2N5
Formula: #
Formula: C22H30O4
Formula: #
Formula: #
Formula: #
Formula: C21H20F7N3O4S
Formula: C4H11Cl2N2O2P
Formula: #
Formula: C39H57FN4O4
Formula: 23H27FN4O3
Formula: #
Formula: #
Formula: C18H10N2O6PdS4
Formula: #
Formula: C16H30O4Pd
Formula: PdBr2
Formula: C2N2Pd
Formula: C28H12Na2O14PdS2
Formula: Pd.(C2H3O2)2
Formula: I2O6Pd
Formula: PdI2
Formula: F2Pd
Formula: C34H36N4O6Pd
Formula: Pd(OH)2
Formula: PdO
Formula: Pd.(NO3)2
Formula: C36H44N4Pd
Formula: C2O4Pd
Formula: O2Pd
Formula: H2O2Pd
Formula: C32H16N8Pd
Formula: #
Formula: PdSO4
Formula: Cl4Pd
Formula: C10H6N8PdS2
Formula: Br4PdRb2
Formula: KO3PdS
Formula: C20H38O4PD
Formula: #
Formula: C10H14O4Pd
Formula: C10H2F12O4Pd
Formula: H4N2O8Pd
Formula: H2N2O7Pd
Formula: H2K2O7PdS4
Formula: C4F6O4Pd
Formula: #
Formula: C84H108N48O36Pd6
Formula: Ag38Pd54Sn8
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C20H12O6
Formula: #
Formula: C21H22ClNO4
Formula: C21H22ClNO4.H2O
Formula: C21H22ClNO4
Formula: C21H22NO4
Formula: C20H20NO4
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C21H44N2O2
Formula: C22H37NO
Formula: C16H30O2
Formula: C16H32O2
Formula: #
Formula: #
Formula: C43H74O6
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C23H36N2O6
Formula: #
Formula: #
Formula: C15H31COOCH2C6H5
Formula: C28H56O2
Formula: C20H35NO4
Formula: #
Formula: C16H31NaO2
Formula: #
Formula: C18H34O2
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C32H62O3
PALMITIC-1 2 3 4-13C4 ACID
Formula: C16H32O2
Formula: #
Formula: #
Formula: C36H70O2
Formula: C18H34O2
Formula: C28H54O2
Formula: C16H30O2
Formula: C16H29ClO
Formula: C16H31ClO
Formula: C24H50NO7P
Formula: #
Formula: #
Formula: #
Formula: C18H34O3S
Formula: C113H196N16O22S3
Formula: C39H66N7O17P3S
Formula: C21H44ClNO2
Formula: #
Formula: C21H44INO2
Formula: C18H37NO2
Formula: C20H39NO3S
Formula: C19H39NO
Formula: C18H36O2
Formula: C24H22O6
Formula: C29H34FN3O6
Formula: C29H35ClFN3O6
Formula: #
Formula: C19H24N2O.HCl
Formula: C19H24N2O.HCl
Formula: C19H24N2O
Formula: C19H22N2O
Formula: C27H30N2O2
Formula: #
Formula: C129H223N3O54
Formula: C7H7BrN4O2.C4H11NO
Formula: #
Formula: #
Formula: #
Formula: [NH2(CH2)2NH2]:(G=5);dendriPAMAM(NH2)128
Formula: [NH2(CH2)2NH2]:(G=6);dendriPAMAM(NH2)256
Formula: #
Formula: #
Formula: C19H29N3O
Formula: C13H20N2O4S
Formula: C3H9NNa2O7P2
Formula: C3H11NO7P2
Formula: #
Formula: C23H16O6
Formula: C12H18O
Formula: C15H15BrO2
Formula: #
Formula: #
Formula: #
Formula: C30H52O3
Formula: C30H52O4
Formula: C17H24O2
Formula: #
Formula: C214H330N68O76S
Formula: C228H360N68O89S
Formula: #
Formula: C186H287N53O56S2
Formula: C192H276N52O58
Formula: #
Formula: #
Formula: #
Formula: C35H60Br2N2O4
Formula: C18H23NO4
Formula: C18H23NO4
Formula: C169H267N53O48S7
Formula: C26H30O4
Formula: #
Formula: C14H27NO8
Formula: #
Formula: C11H8O4
Formula: #
Formula: C14H17NO2
Formula: C14H19NO2
Formula: C13H17NO
Formula: C26H40O8
Formula: C26H40O9
Formula: C15H21N3O4S
Formula: #
Formula: C21H23N3O2
Formula: C25H24F3NO2
Formula: C18H32O16
Formula: #
Formula: #
Formula: C62H78N8O20S2
Formula: #
Formula: C9H19NO4
Formula: #
Formula: 2(C16H14F2N3NaO4S).3(H2O)
Formula: #
Formula: C16H35F2N3NaO4S
Formula: C16H15F2N3O5S
Formula: C16H15F2N3O4S
Formula: C11H23NO4
Formula: #
Formula: C24H25N3O2
Formula: C6H16N4O2
Formula: C20H21NO4.HCl
Formula: #
Formula: C20H18D3NO4
Formula: C20H21NO4
Formula: C16H14BrNO4
Formula: #
Formula: C21H26N4O6
Formula: #
Formula: C16H11N3
Formula: C11H14O5
Formula: #
Formula: C7H5BrO2
Formula: C7H4K2O5S
Formula: C14H13N3O
Formula: C9H12ClNO
Formula: C18H24N2O6S
Formula: #
Formula: #
Formula: C9H9Cl2N3O
Formula: C21H27NO2
Formula: C13H17IO2
Formula: #
Formula: C7H4NNaO3S2
Formula: C54H91N3O41
Formula: C9H10O2
Formula: C8H8BrNO3
Formula: C14H20O2
Formula: C14H11BrO2
Formula: #
Formula: C8H8KNO5S
Formula: #
Formula: C3H6O3X2
Formula: (CH2O)n
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C7H11NO3
Formula: C22H29FO5
Formula: C21H26BrNO3
Formula: #
Formula: #
Formula: C12H14Cl2N2
Formula: C14H20N2O8S2
Formula: C12Cl2H14N2
Formula: C12H14N2
Formula: C61H54N6O8
Formula: C19H18ClN3
Formula: C21H21N3O2
Formula: C19H19N3O
Formula: C8H10NO5PS
Formula: C10H14NO5PS
Formula: C147H234N46O39S2
Formula: C416H677N125O126S2
Formula: #
Formula: C97H150N28O32
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C94H162N26O36
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C142H228N42O58
Formula: #
Formula: #
Formula: #
Formula: C7H5D3N4O2
Formula: C13H17N3O2
Formula: C19H17N2NaO4S
Formula: C19H17N2O4S.Na
Formula: C19H18N2O4S
Formula: #
Formula: C14H26N4O3
Formula: C28H54N8O10S
Formula: C15H24ClNO3
Formula: C16H23NO3
Formula: C22H33BrO5
Formula: C11H13N
Formula: C11H13N.HCl
Formula: C27H44O3
Formula: C17H26N2O2
Formula: C85H120N2O25
Formula: C32H40O19
Formula: C32H40O19
Formula: C45H56O25
Formula: #
Formula: C19H18BrClN4O2
Formula: C23H45N5O14.H2SO4
Formula: #
Formula: #
Formula: C19H20FNO3
Formula: C19H20FNO3.HCl
Formula: C19H20NO3F.C4H4O4
Formula: C19H20FNO3
Formula: C14H18N2O2
Formula: #
Formula: C39H50Cl2F3N5O4S2
Formula: C15H20O3
Formula: C15H20O3
Formula: #
Formula: #
Formula: #
Formula: C16H16O3
Formula: C16H8F8
Formula: #
Formula: #
Formula: C17H16O5
Formula: C7H7NO3.C6H7N3O
Formula: C58H66N10O9
Formula: C27H31NO4
Formula: #
Formula: #
Formula: #
Formula: C15H26
Formula: C15H26O
Formula: C35H50N8O6S2
Formula: C37H46N8O6S2
Formula: C38H48N8O6S2
Formula: C39H50N8O6S2
Formula: C8H6O4
Formula: #
Formula: C7H6O4
Formula: C12H18O3
Formula: #
Formula: C27H41NO6S
Formula: C29H43NO16
Formula: C28H41NO16
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C27H33NO4
Formula: C23H29NO4
Formula: C23H29NO5
Formula: #
Formula: C25H23CIN4O4
Formula: C25H23ClN4O4
Formula: C21H23N7O2S.HCl
Formula: C21H23N7O2S
Formula: #
Formula: C16H15FN2O4.HCl
Formula: C16H15FN2O4.CH4O3S
Formula: C16H15FN2O4.CH4O3S
Formula: C16H15FN2O4
Formula: #
Formula: C24H40Cl2N2O
Formula: C12H19O10P1
Formula: C58H62N2O24
Formula: #
Formula: #
Formula: #
Formula: #
Formula: (C43H47N3S3)n
Formula: #
Formula: C21H23N3O5
Formula: C17H16N2O3
Formula: C25H24N6O2
Formula: C16H14F3IN2O4
Formula: C24H29N7O2
Formula: C31H32N4O3
Formula: C14H19NO3HCl
Formula: C16H14BrN3O2.HCl
Formula: C26H27Cl2N5O2.2(HCl)
Formula: C17H18BrNO4S
Formula: C20H13FN4O2
Formula: C28H41N7O3
Formula: C17H14ClF2IN2O2
Formula: C16H13BrF3IN2O4
Formula: C16H13NO3
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C22H27N5O2
Formula: #
Formula: C28H22F2N4O4
Formula: #
Formula: #
Formula: C13H14N2
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C19H23ClN2S
Formula: C17H25NO3
Formula: C29H35N3O10
Formula: #
Formula: #
Formula: C47H70O15
Formula: #
Formula: C17H14O6
Formula: C29H34O15
Formula: C29H34O15
Formula: #
Formula: C16H12O7
Formula: C9H14N2O4
Formula: C18H18O6
Formula: C17H26O11
Formula: #
Formula: C196H297N61O60S5
Formula: #
Formula: #
Formula: #
Formula: C36H58O10
Formula: #
Formula: [OC6H4OC6H4COC6H4]n
Formula: C24H38N8O8S1
Formula: C26H34N8O6
Formula: C17H20FN3O3.CH4O3S.2(H2O)
Formula: C17H20FN3O3.CH4O3S
Formula: C17H20FN3O4
Formula: C17H20FN3O3
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C19H38O6
Formula: #
Formula: #
Formula: C28H60ClNO5
Formula: #
Formula: #
Formula: C20H38O4
Formula: C17H28N2O4
Formula: C34H68O10
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C27H45NO3
Formula: C27H43NO3
Formula: C27H41NO3
Formula: #
Formula: C21H25ClN4O2
Formula: C15H11ClO5
Formula: C21H21O10.Cl
Formula: #
Formula: C30H30N2O7
Formula: C24H23ClFN5O2
Formula: C20H25N5O6S
Formula: C8H15NO
Formula: C39H48N2O6
Formula: C14H25NO
Formula: C13H19NO3
Formula: C23H28O2
Formula: C12H11N5O
Formula: #
Formula: #
Formula: C16H18O3
Formula: C15H32N2O
Formula: C20H19N5Na2O6.7(H2O)
Formula: 2(C20H19N5Na2O6).5(H2O)
Formula: C20H19N5Na2O6
Formula: C22H25N5O6
Formula: C10H7KN6O
Formula: #
Formula: #
Formula: C11H12N2O5
Formula: C19H22N2O6S
Formula: C18H29NO2
Formula: C36H60N2O8S
Formula: C57H80ClN13O15
Formula: C10H15N5O3
Formula: C13H15Cl2N3
Formula: C19H21ClN2O
Formula: C23H46N2O3
Formula: C13H19N3O4
Formula: C18H16O7
Formula: #
Formula: C22H31N3O4S.HI
Formula: C22H32IN3O4S
Formula: C15H9F5N2O2
Formula: C28H27ClF5NO
Formula: C51H74O19
Formula: C5H12ClNO2S
Formula: #
Formula: C15H26N4O8S
Formula: C21H24O6
Formula: C14H21N3O6S
Formula: C14H22N2O4S2
Formula: C16H18CaN2O4S
Formula: C16H17N2NaO4S
Formula: C16H18N2O4S
Formula: C13H18KN2O4S2
Formula: #
Formula: C16H20N2.2(C16H18N2O5S).8(H2O)
Formula: C58H82N4O5S
Formula: C16H17KN2O5S
Formula: C24H26N2O6S
Formula: #
Formula: #
Formula: C39H43N5O12S
Formula: C15H22N2O2
Formula: C37H44ClNO6
Formula: C37H45NO5
Formula: C4H4O2
Formula: C16H18N2O2
Formula: #
Formula: C51H82O21
Formula: C16H14F5N5O5S
Formula: C21H32O5
Formula: C17H26O10
Formula: C11H14
Formula: C5H10O5
Formula: C7H8O4
Formula: C5H10O
Formula: C5H10
Formula: C5H6O4
Formula: C5H6O4
Formula: C5H7N
Formula: C5H8O2
Formula: C5H10O
Formula: C5H8O
Formula: C5H8O
Formula: C5H6O
Formula: C5H6O2
Formula: C12H14O3S
Formula: C5H6O
Formula: C5H8O
Formula: C10H16O5
Formula: C18H23N3O4
Formula: C7H12O2
Formula: C19H28O10
Formula: C39H44O6
Formula: C32H32O9
Formula: C32H38O6
Formula: C39H44O6
Formula: C47H48O9Si
Formula: C27H38O6Si
Formula: C11H20O6
Formula: C5H12ClN
Formula: C12H14O3S
Formula: C24H34O10S2
Formula: C5H6
Formula: C8H8
Formula: C5H8
Formula: #
Formula: C40H67N5O26
Formula: C41H32O11
Formula: C25H30O7
Formula: C27H34O15
Formula: C16H22O10S
Formula: C16H22O11
Formula: Al5NaO8
Formula: C3H15F9N5O9OsS3
Formula: Cl3H15N5Ru
Formula: Cl3H15IrN5
Formula: C6H24N8O2Ru
Formula: H20N5O10P3
Formula: #
Formula: C8H16N2O4
Formula: #
Formula: C12HBr9O
Formula: C14H4Br9ClO2
Formula: C14H5Br9O2
Formula: C12HBr10N
Formula: C3HBr5O
Formula: C10H5Br5O2
Formula: C7H2Br6
Formula: #
Formula: C12H3Br5O
Formula: C12H5Br5O
Formula: C6HBr5O
Formula: C9H3Br5O2
Formula: #
Formula: Ca5O20P6
Formula: C5H10ClMnO5
Formula: C42H48N4O10
Formula: C22H14
Formula: #
Formula: C9H5Br2Cl5O
Formula: C4Cl6O
Formula: Cl5H8N2Ru
Formula: C7H2Cl6S
Formula: C6H2Cl5N