Phone (USA) +1 212-348-5610
Whatsapp: +1 516-336-9307
WeChat: chembuyersguide
Chemical Search

Conier Chem&Pharma Limited.

Country: China

11F,#5 Building,
Asia pacific enterprise valley,
Chongqing, China.

Phone: +86-23-62922305
Phone 2: +86-139 9626 9627
FAX: +86-23-62457927
E-Mail:E-Mail this Supplier

Conier Chem&Pharma Limited.

Page: Home | 1 | 2 | 3 | 4 | 5 | 6 | 7 | 8 | 9 | 10 | 11 | 12 | 13 | 14 | 15 | 16 | 17 | 18 | 19 | 20 | 21 | 22 | 23 | 24 | 25 | 26 | 27 | 28 | 29 | 30 | 31 | 32 | 33 | 34 | 35 | 36 | 37 | 38 | 39 | 40 | 41 | 42 | 43 | 44 | 45 | 46 | 47 | 48 | 49 | 50 | 51 | 52 | 53 | 54 | 55 | 56 | 57 | 58 | 59 | 60 | 61 | 62 | 63 | 64 | 65 | 66 | 67 | 68 | 69 | 70 | 71 | 72 | 73 | 74 | 75 | 76 | 77 | 78 | 79 | 80 | 81 | 82 | 83 | 84 | 85 | 86 | 87 | 88 | 89 | 90 | 91 | 92 | 93 | 94 | 95 | 96 | 97 | 98 | 99 | 100 | 101 | 102 | 103 | 104 | 105 | 106 | 107 | 108 | 109 | 110 | 111 | 112 | 113 | 114 | 115 | 116 | 117 | 118 | 119 | 120 | 121 | 122 | 123 | 124 | 125 | 126 | 127 | 128 | 129 | 130 | 131 | 132 | 133 | 134 | 135 | 136 | 137 | 138 | 139 | 140 | 141 | 142 | 143 | 144 | 145 | 146 | 147 | 148 | 149 | 150 | 151 | 152 | 153 | 154 | 155 | 156 | 157 | 158 | 159 | 160 | 161 | 162 | 163 | 164 | 165 | 166 | 167 | 168 | 169 | 170 | 171 | 172 | 173 | 174 | 175 | 176 | 177 | 178 | 179 | 180 | 181 | 182 | 183 | 184 | 185 | 186 | 187 | 188 | 189 | 190 | 191 | 192 | 193 | 194 | 195 | 196 | 197 | 198 | 199 | 200 | 201 | 202 | 203 | 204 | 205 | 206 | 207 | 208 | 209 | 210 | 211 | 212 | 213 | 214 | 215 | 216 | 217 | 218 | 219 | 220 | 221 | 222 | 223 | 224 | 225 | 226 | 227 | 228 | 229 | 230 | 231 | 232 | 233 | 234 | 235 | 236 | 237 | 238 | 239 | 240 | 241 | 242 | 243 | 244 | 245 | 246 | 247 | 248 | 249 | 250 | 251 | 252 | 253 | 254 | 255 | 256 | 257 | 258 | 259 | 260 | 261 | 262 | 263 | 264 | 265 | 266 | 267 | 268 | 269 | 270 | 271 | 272 | 273 | 274 | 275 | 276 | 277 | 278 | 279 | 280 | 281 | 282 | 283 | 284 | 285 | 286 | 287 | 288 | 289 | 290 | 291 | 292 | 293 | 294 | 295 | 296 | 297 | 298 | 299 | 300 | 301 | 302 | 303 | 304 | 305 | 306 | 307 | 308 | 309 | 310 | 311 | 312 | 313 | 314 | 315 | 316 | 317 | 318 | 319 | 320 | 321 | 322 | 323 | 324 | 325 | 326 | 327 | 328 | 329 | 330 | 331 | 332 | 333 | 334 | 335 | 336 | 337 | 338 | 339 | 340 | 341 | 342 | 343 | 344 | 345 | 346 | 347 | 348 | 349 | 350 | 351 | 352 | 353 | 354 | 355 | 356 | 357 | 358 | 359 | 360 | 361 | 362 | 363 | 364 | 365 | 366 |

Product List

Formula: #
Formula: C10H12N6NaO5P
Formula: #
Formula: #
Formula: #
Formula: C48H48N2O5
Formula: C38H40N2O5
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C9H13D2N3O5
Formula: C10H12D2N2O5
Formula: C10H14N2O5
Formula: (C16H6O6?C12H12N2O)x
Formula: #
Formula: C7H11Cl6O5P
Formula: C28H41NO3
Formula: C25H20O12
Formula: C27H22O14
Formula: C16H12O10S
Formula: C12H24GdN3O9P3
Formula: C17H18O2
Formula: C19H26O8S
Formula: C18H34O6
Formula: C9H13N2O9P
Formula: C16H16N2O6
Formula: C14H22N2O16P2
Formula: C9H13N2O9P
Formula: C9H13N2O14P3
Formula: C12H20N5O4P
Formula: C16H25N5O16P2
Formula: C20H28N12O9PPt
Formula: C15H15NO3
Formula: C8H12NO5P
Formula: C8H11NO5S
Formula: C11H9ClO2
Formula: C10H8ClNO2
Formula: C22H26N2O4S
Formula: C22H27ClN2O4S
Formula: C23H28N2O3S
Formula: C10H6FN2O3S
Formula: C8H8N2O2
Formula: C8H7NO3
Formula: C8H8N2O2
Formula: C9H9NOS2
Formula: C8H8N2O2S
Formula: C6H8N2S
Formula: C12H20O3
Formula: C20H20Cl2N4O2S
Formula: C20H36N8O7
Formula: C28H24N4O7
Formula: C11H11ClN4O2
Formula: C13H22O3
Formula: C21H22N4O4S
Formula: C29H24N4O8
Formula: C15H25N3O16P2
Formula: C30H42N3O12P
Formula: C19H25N8O11P
Formula: C11H11N4O2S
Formula: C11H11NO2
Formula: C11H11ClNO
Formula: C12H11NO5
Formula: C10H11N5O
Formula: C10H8N4O2S2
Formula: C32H55FN3O9P
Formula: C10H14N5O7P
Formula: C21H29N7O14P2
Formula: C27H32N12O15P2
Formula: C27H35N9O15P2
Formula: C27H33N9O15P2S
Formula: C28H32N10O15P2S
Formula: C27H33N9O15P2
Formula: C10H17N5O16P4
Formula: C27H32N8O16P2
Formula: C27H33N9O17P2S
Formula: C10H14N5O7PZn
Formula: C10H15N5O10P2
Formula: C16H16N6O5
Formula: C41H74N7O18P3S
Formula: C26H44N7O18P3S
Formula: C27H34N9O18P3
Formula: C18H22N3O9P
Formula: C16H12N2O2
Formula: C13H18O4
Formula: C9H18N2
Formula: C6H9NO2
Formula: C28H41Cl2N3O2
Formula: C23H38Cl2N2O2
Formula: C24H40Cl2N2O2
Formula: C13H14ClNO9S4
Formula: C9H12N4S2
Formula: C8H16N6O2
Formula: C21H36Cl2N2O2
Formula: C22H38Cl2N2O2
Formula: C20H34Cl2N2O2
Formula: C8H13NO2
Formula: C8H14N3O2
Formula: C7H14O4
Formula: C16H19NO3
Formula: C11H16O3
Formula: C21H22N2O2
Formula: C12H12O2
Formula: C22H26O3
Formula: C20H20F2O3
Formula: C20H24O3
Formula: C22H26O3
Formula: C24H28O3
Formula: C10H11N3OS
Formula: C10H11N3O3S
Formula: C7H13BO2SSi
Formula: C7H15N2O8P
Formula: C16H20N6O4
Formula: C30H23N3O6
Formula: C10H17N3O10P2
Formula: C26H46Cl2N2O2
Formula: C23H40Cl2N2O2
Formula: C24H42Cl2N2O2
Formula: C15H18N4O3
Formula: C12H20N2O5S
Formula: C17H27NO5S
Formula: C79H140N4O22S2
Formula: C31H47FeN6O13
Formula: C31H47FeN6O13
Formula: C20H26N6O5
Formula: C25H27Cl2N5O3
Formula: C27H48N10O10
Formula: C15H15N3O7
Formula: C19H16N2O2
Formula: C10H9F3N2OS
Formula: C33H54N7O18P3S3
Formula: C46H78N7O24P3S
Formula: C13H22ClN3O3
Formula: C21H24N10O10P2
Formula: C15H9ClF3NO5
Formula: C24H32O15
Formula: C50H66O32
Formula: C28H42Cl2N2O2
Formula: C23H31ClN4O6
Formula: C23H27N5O5
Formula: C46H79N8O23P3S
Formula: C48H80N9O22P3S
Formula: C31H43NO7
Formula: C19H13Cl2N7O4
Formula: C19H14Cl2N6O2
Formula: C8H14O6
Formula: C20H22O6
Formula: C16H16ClN5O3
Formula: C16H24ClN3O10
Formula: C37H48O20
Formula: C42H30O16
Formula: C15H21ClN2O2
Formula: #
Formula: C7H12N2O5S
Formula: C15H10ClF4NO
Formula: C15H11ClF3NO
Formula: C26H16Cl6N2O2Pd2
Formula: C16H11Cl2N3O
Formula: C21H23ClN4O
Formula: C18H17ClN4O
Formula: C6H8ClNO5S
Formula: C25H46
Formula: C22H38
Formula: C22H40
Formula: C9H12BFO3
Formula: C17H21Cl2FN2
Formula: C12H12N3O3S
Formula: C21H24O11
Formula: C20H22O9
Formula: C56H92O25
Formula: C72H114O27
Formula: C35H46O17
Formula: C15H15NO5
Formula: C14H14N2O4
Formula: C9H14BrN3O2S
Formula: C68H129N2O19P
Formula: #
Formula: C18H19NO9
Formula: C7H7F3O2
Formula: C7H8F3NO
Formula: C26H28N2O10
Formula: C22H17N5O3S
Formula: C25H26
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C35H36O13
Formula: #
Formula: #
Formula: C49H36N4O10
Formula: C27H40O3
Formula: C20H18Cl3N3O2
Formula: C42H42O14
Formula: C15H15NO3
Formula: C22H20Cl2O2
Formula: C31H56N2O11
Formula: C21H17NO3S
Formula: C13H12N2OS
Formula: C20H20ClN5O3S2
Formula: C13H16ClN5O4
Formula: C16H25BrN6O2
Formula: C15H19N5O5
Formula: C14H17N5NaO7P
Formula: C20H17NO5S
Formula: C22H21NO5S
Formula: C15H15N3O4
Formula: C44H29NO8
Formula: C20H22O8
Formula: C22H26O4
Formula: C34H22O10
Formula: C37H27FN4O10
Formula: C9H10ClNO2
Formula: C25H47NO2
Formula: C24H45NO
Formula: C22H27N5O2
Formula: C15H22O4
Formula: C9H16O2
Formula: C17H19Cl2NO4
Formula: C7H9NO2
Formula: C19H15N3O4
Formula: C12H17Cl3Si
Formula: C27H29NO10
Formula: C52H74Cl2O18
Formula: C42H55IN4O11
Formula: C22H33N3O8
Formula: C64H102O30
Formula: C65H106O31
Formula: C70H114O34
Formula: C70H114O35
Formula: C66H108O33
Formula: C15H15ClN4O2
Formula: C21H34N4O4
Formula: C41H47NO11
Formula: C18H19N3O7S2
Formula: C44H71NO14
Formula: C44H73NO14
Formula: C38H32N4O7
Formula: C66H99Cl2NO36
Formula: C12H18N10
Formula: C42H69NO15
Formula: C42H67NO15
Formula: C43H71NO16
Formula: C41H67NO16
Formula: C42H76N2O13
Formula: C38H50O16
Formula: C42H51NO16
Formula: C45H73NO16
Formula: C39H63NO15
Formula: C41H67NO15
Formula: C40H65NO15
Formula: C45H73NO15
Formula: C39H61NO16
Formula: C41H65NO16
Formula: C40H63NO16
Formula: C43H66O15
Formula: C50H70O23
Formula: C31H31NO2
Formula: C31H25NO2
Formula: C24H20O11
Formula: C21H13Br4ClN2O3
Formula: C21H27NO2
Formula: C7H4ClF5N2
Formula: #
Formula: C25H34
Formula: #
Formula: #
Formula: #
Formula: C48H48ClN5O3
Formula: C13H14FN3O3
Formula: C27H25NO4S
Formula: C25H34O6
Formula: C24H23NO9
Formula: C9H18O11S3
Formula: C14H11F3N2O3
Formula: C19H27NO4
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C22H26O4
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C21H23ClN2
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C16H16N2O5S
Formula: C15H14ClN3O4S
Formula: C22H27N5O8S2
Formula: C18H18N2O7S
Formula: C35H31N5O7S2
Formula: C18H18ClN5O8S2
Formula: C17H17N5O8S2
Formula: C10H16O4S
Formula: C21H33NO8
Formula: C13H19BrN3O2
Formula: C20H16O2
Formula: C20H31NO7
Formula: C27H12ClCuF2N7Na4O15S4
Formula: C17H21N5S4
Formula: C38H38O12
Formula: C21H16O8
Formula: C8H7D3N4O3
Formula: C20H18Cl2N2O3
Formula: C16H11Cl2N3O3
Formula: C16H13ClFN3
Formula: C28H52
Formula: C25H46
Formula: C53H58I4N6S2
Formula: C53H58I4N6O2
Formula: C25H32O8
Formula: C40H70O15
Formula: #
Formula: C14H21N3O3
Formula: C31H56N2O8
Formula: C28H32
Formula: C28H34
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C53H90O22
Formula: C61H95NO25
Formula: C48H72O22
Formula: C23H32N2O4
Formula: C24H16O2
Formula: C20H22O6
Formula: C11H11N5O4S
Formula: C19H20N5O3
Formula: C19H20ClN5O3
Formula: C28H38BrNO4
Formula: C31H34BrNO3
Formula: C23H34O6
Formula: C25H31ClN2O3
Formula: C25H34N2O9
Formula: C24H32N2O9
Formula: C23H30N2O9
Formula: C30H34NO3
Formula: #
Formula: #
Formula: #
Formula: C28H32N2O4
Formula: C28H31ClN2O7
Formula: C24H23ClN2O3
Formula: C30H36N2O7S
Formula: #
Formula: C19H25ClO8
Formula: C21H29ClO8
Formula: C23H18N4O
Formula: C19H15NO2
Formula: C29H31NO3
Formula: C16H17N6O17P3S
Formula: C28H37NO4
Formula: C27H35NO4
Formula: C17H15NO4
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C9H13N3O3
Formula: C11H13NO3
Formula: C15H21NO4
Formula: C11H13NO3
Formula: C21H15Cl2NO3
Formula: C16H15NO3
Formula: C14H13NO5S
Formula: C16H15NO3S
Formula: C29H38INO3
Formula: C27H25NO6
Formula: C18H17NO3
Formula: C14H12FNO5S
Formula: C11H11NO6
Formula: C11H11NO6
Formula: C9H9NO6S
Formula: C12H22O8Si2
Formula: C9H13NO8P2S
Formula: C7H8ClN3O2
Formula: C7H11NO7P2
Formula: C12H13ClN7O
Formula: C10H25NO6P2S
Formula: C8H14N2O6P2
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C48H68N14O12
Formula: C16H14ClNO4
Formula: C17H17NO5
Formula: C17H17NO4
Formula: C20H23NO4
Formula: C22H19NO5
Formula: C20H26Cl2N2O
Formula: C22H31O3P
Formula: C17H25NO6
Formula: C19H19F23INO3
Formula: C13H21NO3
Formula: C20H27ClN2O2
Formula: C17H28O2
Formula: #
Formula: C9H16N3O5P
Formula: C11H28N3O2P
Formula: C10H26N3O2P
Formula: C6H18N3O2P
Formula: #
Formula: C13H20S2
Formula: C9H27N2PSi3
Formula: #
Formula: C27H26O2
Formula: C9H6F6O4S2
Formula: #
Formula: C9H23N3O15P5
Formula: C18H24N4O
Formula: C14H19NO5
Formula: C14H19NO4
Formula: C13H16N2O6
Formula: C17H25NO4
Formula: C22H41O10P3
Formula: C16H27ClN2O
Formula: C37H72O6S3Sn
Formula: C14H12N2
Formula: C92H72N8O4Pb
Formula: C5H16N2O13P4
Formula: C12H15NO5
Formula: C3H9ClNO3P
Formula: C9H10Cl2N2O4
Formula: C8H8IN3O
Formula: C22H19Cl2NO3
Formula: C21H18Cl2N2O3
Formula: C25H22BrNO3
Formula: C34H34ClN2O8PS
Formula: C22H19Cl2NO3
Formula: C26H25NO3
Formula: C8H18N2O4PtS
Formula: C10H26N2O12P4.xNa
Formula: #
Formula: #
Formula: C30H40N6O6S
Formula: C74H106N20O13S
Formula: C46H65N13O11S2
Formula: #
Formula: C26H22O
Formula: C24H20O2P2
Formula: C10H18O7Si
Formula: C12H18F6O4Sn
Formula: C22H28O6Sn
Formula: C30H44O4Sn
Formula: C40H82O4SSn2
Formula: C52H106O5Sn2
Formula: C32H66O5Sn2
Formula: C22H36O10Sn
Formula: C32H56O8Sn
Formula: C24H40O8Sn
Formula: C36H64O8Sn
Formula: C40H72O8Sn
Formula: C20H32O8Sn
Formula: C48H88O8Sn
Formula: C32H56O8Sn
Formula: C22H36O8Sn
Formula: C22H36O8Sn
Formula: C44H84O4Sn
Formula: C26H48N2O7Sn2
Formula: C14H12Cl2O2S
Formula: C14H19NO6S
Formula: C34H30FeN4O4
Formula: C6H19NOSi2
Formula: C38H72O4Sn
Formula: #
Formula: #
Formula: #
Formula: C9H11ClN2O3
Formula: C11H14N2
Formula: #
Formula: C19H20F3NO2
Formula: C6H16K4N2O12P4
Formula: C176H278N58O54S7
Formula: C7H9IO4S
Formula: C20H39O7P
[HYDROXY-[(3E,7E,11E,15E,19E,23E,27E,31E)-4,8,12,16,20,24,28,32,36-NONAMETHYLHEPTATRIACONTA-3,7,11,15,19,23,27,31,35-NONAENOXY]PHOSPHORYL]OXYPHOSPHONIC ACID
Formula: C45H76O7P2
Formula: C10H17N2O13P3S
Formula: C16H26N2O15P2
Formula: C17H28N2O14P2
Formula: C10H16N2O11P2
Formula: C6H11CaN3S4
Formula: C21H28O4
Formula: C20H15NS
Formula: C178H279N57O56S7
Formula: C38H19Cu2N5Na4O16S4
Formula: C18H14O2
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C8H10ClNO2S2
Formula: C15H15N3O2
Formula: C21H19N3O2
Formula: C53H67N9O5
Formula: C25H34N2O4
Formula: C15H10N2
Formula: C6H18O21Y2
Formula: C12H11BHg2O3
Formula: H4Mo12O40Si
Formula: C42H24Cu3N8O18S4
Formula: C9H12N5O2
Formula: C4H14Cl2N6
Formula: C16H17ClN4O3
Formula: C6H18N6O4S
Formula: C7H20Cl2N6
Formula: C10H26Cl2N6
Formula: C8H11ClFN5
Formula: C11H19Cl2N9
Formula: C10H18N6OS
Formula: C52H64CuN16O8S4
Formula: C53H64CuN14O12S3
Formula: C41H37CuN11
Formula: C18H16N4O2
Formula: C25H31N3NiO3
Formula: #
Formula: C14H17ClN2O3
Formula: C11H34N3O13P3
Formula: C3H12NO10P3
Formula: C3H6NO9P3Zn3
Formula: C4H8N8O12
Formula: C5H10N10O14
Formula: C12H15N3O4
Formula: #
Formula: C61H100N22O15
Formula: #
Formula: C33H44O4S2
Formula: C41H36B2F8N2P2Pd
Formula: C12H12O5
Formula: C18H18O4
Formula: C17H21NO4S2
Formula: C20H17NOS
Formula: C27H24S2
Formula: #
Formula: C20H31NO10S2
Formula: #
Formula: C10H15NO4S
Formula: C13H19ClN2O
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C6H11NO
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C5H7NO
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C18H23NO4
Formula: C10H18O
Formula: C14H15NO3
Formula: C35H38ClNO3S
Formula: C13H22O
Formula: C10H16ClNO
Formula: C11H23NO3
Formula: C17H16Cl2N2O6
Formula: C29H44Cl2N2O8
Formula: C16H17NO4S
Formula: C39H39NO3
Formula: C11H14O3
Formula: C28H45Cl2NO6S
Formula: C8H8FeKO12
Formula: C4H4MnO6
Formula: C4H4K2O6
Formula: C4H4Na2O6
Formula: C12H12Fe2O18
Formula: C15H24Cl2N2
Formula: C14H16N2O2
Formula: C4H10N2O2
Formula: C18H24ClN5O3
Formula: C20H22N2O3
Formula: C34H34N2O3
Formula: C21H28CLNO
Formula: C17H31N3O4
Formula: C12H20ClNO
Formula: C12H19NO
Formula: C29H38N6O6S2
Formula: C28H36N6O7S
Formula: C5H12N2O3S
Formula: C22H43NO4
Formula: C10H18O
Formula: C13H22O
Formula: #
Formula: #
Formula: #
Formula: C17H26O2S
Formula: C9H12O3
Formula: C16H16N2O4
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C13H18O2
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C10H9NO
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C13H23NO3
Formula: #
Formula: C6H13ClN2O3
Formula: C7H11NO
Formula: C10H18O
Formula: C10H15N
Formula: C16H17NO4S
Formula: C11H18ClNO
Formula: C29H51I2N7O4
Formula: C4H10N4O4
Formula: C19H26ClNO
Formula: C10H18O
Formula: C11H10AgN2O2S2
Formula: C12H11NO2
Formula: C8H15NO
Formula: C14H14N2Na2O6S3
Formula: #
Formula: Cl4H12N4Pd2
Formula: C18Cl12O6PC16H36N
Formula: C32H12Cl4CuN8
Formula: C30H46O6
Formula: C60H12CuF60N8
Formula: C32H12CuN12O8
Formula: C20H35N
Formula: C13H26N2
Formula: C32H46
Formula: C35H19Cl3CuN8
Formula: C13H37ClO3Si5
Formula: C9H27AsSi3-3
Formula: C31H41N9O7
Formula: C75H102N20O27
Formula: C51H81N13O18
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C10H12NO6S
Formula: C12H10BrNO2
Formula: C10H12N2O3
Formula: #
Formula: C10H10NO3S
Formula: C9H9N2O6S
Formula: C8H6F3NO2S
Formula: C11H7N2O5S
Formula: C8H5N2O4S
Formula: C12H12ClN3O2S
Formula: C8H6Cl2F3N3O2S
Formula: C3H7N3O2.HCl
Formula: #
Formula: #
Formula: C11H17NO2
Formula: #
Formula: C14H12Cl2O2
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C3H7ClO
Formula: C9H10
Formula: C21H20O7
Formula: C12H38BF4N7P2
Formula: CCl2FCCl2CF3
Formula: C12H30Si2
1 1 3 3 5 5-HEXAMETHYL-1 5-BIS(2-(5-NOR&
Formula: C24H44O2Si3
Formula: (CH3SO3C10H6)2
Formula: C22H20FeP2
Formula: C27H27IN2
Formula: H2C=CHC(CH3)2NHC(CH3)2CH2C(CH3)3
Formula: C13H25N
Formula: C20H38
Formula: C6H6(CO2H)6H2O
Formula: C14H13NO22H2O
Formula: C8H18O3
Formula: Br2C6H2(OC8H17)2
Formula: C6Cl2H4
Formula: Cl14CH214CH2Cl
Formula: C27H51Na2O8P
Formula: C10F6H15N3O4S2
Formula: C12F9H15N2O6S3
Formula: C7H10IN
Formula: C39H67N4O11P1
Formula: C57H102O6
Formula: C48H79N4O13P1
Formula: C41H77O8P
Formula: C12H20O8S
1 3 5 7 9 11 13 15-OCTACYCLOPENTYLPENTA&
Formula: C40H72O12Si8
1 3 5 7 9 11 13-HEPTACYCLOPENTYL-15-
Formula: C37H66O12Si8
1 3 5 7 9 11 13-HEPTACYCLOPENTYL-15-(2-&
Formula: C49H77O12PSi8
Formula: C10H18B2N4
Formula: C13H22N2O4
Formula: C11H21N3O4
Formula: C6H4[Si(OC2H5)3]2
Formula: C27H30N6O
Formula: C13H25N3O5
Formula: C13H23N3O6
Formula: C11H23N2BF4
Formula: C11H21BF4N2
Formula: C18F3H16N3O6S1
Formula: C3H8N2O1
Formula: [[H2C=CHSi(CH3)2O]2Si(C6H11)]2O
Formula: C26H24N2O
Formula: C9H19BF4N2
Formula: C6H4N2O4
Formula: C8H4N2S2
Formula: C6H4[OCH2CH2CH(CH3)(CH2)3CH(CH3)2]2
Formula: C20H34O8
Formula: C28H42
Formula: [CH3(CH2)3CH(CH2CH3)CH2O]2C6H4
Formula: C32H50
Formula: (BrCH2)2C6H2[O(CH2)5CH3]2
Formula: C26H46O2
Formula: C18H34O6Si2
Formula: C6H5C(CF3)(OH)C=C(OH)(CF3)C6H5
Formula: C22H36I2
Formula: C26H44I2
Formula: C26H46
Formula: C10H18O5
Formula: C8H14O2S2
Formula: C26H44O2Br2
Formula: C18H24I2
Formula: C30H52I2
Formula: C22H36I2
Formula: C12H12N2O6
Formula: C22H38
Formula: C7H13N1O2
Formula: C10H9D
Formula: C10H8O3
Formula: C12H13NO2
Formula: C20H30N6
Formula: C12H28N4
Formula: C48H85N3O15P2
Formula: C44H81N3O15P2
Formula: C14H26N4O11P2
Formula: C11H14N4O4S
Formula: C23H37N7O16P3S
Formula: C3H8Si
Formula: C5H5Ge
Formula: C5H5Sn
Formula: C5H4S3
Formula: N4S4
Formula: C37H65NO14
Formula: C14H22N2O
Formula: C13H12N4O
Formula: C78H16
Formula: C20H27N7O6
Formula: #
Formula: #
Formula: #
Formula: C10H12N2
Formula: #
Formula: C10H12N2
Formula: C23H24O8
Formula: #
Formula: C11H10N2O2
Formula: C19H18N4O4
Formula: C21H20N4O7
Formula: C27H35N4O6
Formula: C23H24O7
Formula: C23H24O6
Formula: C13H17N
Formula: C12H16N2O4
Formula: C19H17N3O5
Formula: C19H18N2O3
Formula: C19H19NO
Formula: C19H19NO2
Formula: #
Formula: #
Formula: C25H25NO4
Formula: #
Formula: C20H20N2O4
Formula: C11H15N3
Formula: #
Formula: C63H7N
Formula: #
Formula: C23H19N5O3
Formula: C19H12
Formula: C20H27NO4
Formula: C50H46N6O4
Formula: C20H28N2O2
Formula: C18H25ClN2O2
Formula: C34H41N5
Formula: C16H28N2O4
Formula: C27H38N2O5
Formula: C28H39Cl3N4O
Formula: C21H32Cl2FN3O2
Formula: C12H10O
Formula: C13H14O4
Formula: C12H14O3
Formula: #
Formula: C21H23NO3
Formula: C20H23ClN2O
Formula: C15H20N2O
Formula: C13H16N2O
Formula: C13H16N2O
Formula: C14H18N2O
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C13H21NO
Formula: C16H23NO3
Formula: C24H21ClFN3O7
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C16H17NO6
Formula: C14H15NO2
Formula: C12H14N2O
Formula: C12H14N2O
Formula: C29H35NO5
Formula: C13H13NO4
Formula: #
Formula: C22H28ClNO
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C10H10O6S
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C33H49N
Formula: #
Formula: C34H51N
Formula: #
Formula: C15H22O
Formula: C8H11Cl2NO
Formula: C8H15NO
Formula: C7H16N2O2S
1(2H)-CHRYSENONE, 3,4,4A,4B,5,6,10B,11,12,12A-DECAHYDRO-7-HYDROXY-12A-METHYL-, (4AR,4BR,10BR,12AR)-REL-
Formula: #
Formula: C8H12N2O3
Formula: C9H8N2
Formula: C11H15NO4
Formula: C11H11NO
Formula: C11H11NO
Formula: C12H9NO
Formula: C12H15NO2
Formula: C12H13NO3
Formula: C14H17NO
Formula: C12H13NO2
Formula: C10H9NO2
Formula: C9H8N2O
Formula: C9H6FNO
Formula: C10H15FO
Formula: #
Formula: C13H16O3
Formula: #
Formula: #
Formula: C12H14O3
Formula: C10H9NO5
Formula: C12H14O3
Formula: C10H9F2NO2
Formula: C11H13NO
Formula: C11H13NO
Formula: C11H13NO
Formula: C18H15Cl2NO2
Formula: C16H13Cl2NO
Formula: C11H13NO
Formula: C12H15NO2
Formula: C9H7NO
Formula: C12H16O3
Formula: C13H22O2
Formula: C11H18O
Formula: C10H16O
Formula: C8H6N2S
Formula: #
Formula: #
Formula: C8H6N2O
Formula: C7 H9 N3 O3