Phone (USA) +1 212-348-5610
Whatsapp: +1 516-336-9307
WeChat: chembuyersguide
Chemical Search

Conier Chem&Pharma Limited.

Country: China

11F,#5 Building,
Asia pacific enterprise valley,
Chongqing, China.

Phone: +86-23-62922305
Phone 2: +86-139 9626 9627
FAX: +86-23-62457927
E-Mail:E-Mail this Supplier

Conier Chem&Pharma Limited.

Page: Home | 1 | 2 | 3 | 4 | 5 | 6 | 7 | 8 | 9 | 10 | 11 | 12 | 13 | 14 | 15 | 16 | 17 | 18 | 19 | 20 | 21 | 22 | 23 | 24 | 25 | 26 | 27 | 28 | 29 | 30 | 31 | 32 | 33 | 34 | 35 | 36 | 37 | 38 | 39 | 40 | 41 | 42 | 43 | 44 | 45 | 46 | 47 | 48 | 49 | 50 | 51 | 52 | 53 | 54 | 55 | 56 | 57 | 58 | 59 | 60 | 61 | 62 | 63 | 64 | 65 | 66 | 67 | 68 | 69 | 70 | 71 | 72 | 73 | 74 | 75 | 76 | 77 | 78 | 79 | 80 | 81 | 82 | 83 | 84 | 85 | 86 | 87 | 88 | 89 | 90 | 91 | 92 | 93 | 94 | 95 | 96 | 97 | 98 | 99 | 100 | 101 | 102 | 103 | 104 | 105 | 106 | 107 | 108 | 109 | 110 | 111 | 112 | 113 | 114 | 115 | 116 | 117 | 118 | 119 | 120 | 121 | 122 | 123 | 124 | 125 | 126 | 127 | 128 | 129 | 130 | 131 | 132 | 133 | 134 | 135 | 136 | 137 | 138 | 139 | 140 | 141 | 142 | 143 | 144 | 145 | 146 | 147 | 148 | 149 | 150 | 151 | 152 | 153 | 154 | 155 | 156 | 157 | 158 | 159 | 160 | 161 | 162 | 163 | 164 | 165 | 166 | 167 | 168 | 169 | 170 | 171 | 172 | 173 | 174 | 175 | 176 | 177 | 178 | 179 | 180 | 181 | 182 | 183 | 184 | 185 | 186 | 187 | 188 | 189 | 190 | 191 | 192 | 193 | 194 | 195 | 196 | 197 | 198 | 199 | 200 | 201 | 202 | 203 | 204 | 205 | 206 | 207 | 208 | 209 | 210 | 211 | 212 | 213 | 214 | 215 | 216 | 217 | 218 | 219 | 220 | 221 | 222 | 223 | 224 | 225 | 226 | 227 | 228 | 229 | 230 | 231 | 232 | 233 | 234 | 235 | 236 | 237 | 238 | 239 | 240 | 241 | 242 | 243 | 244 | 245 | 246 | 247 | 248 | 249 | 250 | 251 | 252 | 253 | 254 | 255 | 256 | 257 | 258 | 259 | 260 | 261 | 262 | 263 | 264 | 265 | 266 | 267 | 268 | 269 | 270 | 271 | 272 | 273 | 274 | 275 | 276 | 277 | 278 | 279 | 280 | 281 | 282 | 283 | 284 | 285 | 286 | 287 | 288 | 289 | 290 | 291 | 292 | 293 | 294 | 295 | 296 | 297 | 298 | 299 | 300 | 301 | 302 | 303 | 304 | 305 | 306 | 307 | 308 | 309 | 310 | 311 | 312 | 313 | 314 | 315 | 316 | 317 | 318 | 319 | 320 | 321 | 322 | 323 | 324 | 325 | 326 | 327 | 328 | 329 | 330 | 331 | 332 | 333 | 334 | 335 | 336 | 337 | 338 | 339 | 340 | 341 | 342 | 343 | 344 | 345 | 346 | 347 | 348 | 349 | 350 | 351 | 352 | 353 | 354 | 355 | 356 | 357 | 358 | 359 | 360 | 361 | 362 | 363 | 364 | 365 | 366 |

Product List

Formula: #
Formula: #
Formula: C15H21N3O18
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C41H74O6
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C20H32O10S2
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C27H49INO6P
Formula: C39H60O14S
Formula: C15H18O8
Formula: #
Formula: C28H47IN5O9P
Formula: C48H91NO13
Formula: C10H11N5O3
Formula: C9H21NO10P2
Formula: C28H56NO7P
Formula: C33H54O11S
Formula: #
Formula: C29H58N2O8
Formula: C28H55NO8
Formula: C27H53NO8
Formula: #
Formula: C40H79NO8
Formula: C48H93NO13
Formula: #
Formula: C28H21Cl3O9
Formula: C28H24O9
Formula: C28H24O9
Formula: C28H30O6
Formula: #
Formula: C17H24O5
Formula: C14H25NO11
Formula: C12H22O11
Formula: C12H24O11
Formula: C25H39NO2
Formula: C10H12O3
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C10H14O3
Formula: C12H22O11
Formula: C27H32O11
Formula: C16H24O10
Formula: C21H30O9
Formula: C36H58N2O9S
Formula: C44H84NO7P
Formula: C44H84NO7P
Formula: C12H26NO7P
Formula: C44H80NO8P
Formula: C19H41NO2
Formula: C46H82NO7P
Formula: C26H55N2O7P
Formula: C21H42O4
Formula: C25H54NO6P
Formula: C20H42O3
Formula: C19H40O3
Formula: C24H52NO6P
Formula: C19H40O3
Formula: #
Formula: C14H9ClN2OS
Formula: #
Formula: #
Formula: C6H12O4
Formula: #
Formula: #
Formula: C21H22Cl4O5
Formula: C20H18Cl4O5
Formula: #
Formula: #
Formula: #
Formula: C7H11NaO7
Formula: #
Formula: #
Formula: C19H36O5
Formula: C23H47O7P
Formula: C26H56NO6P
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C8H8N4S
Formula: C11H12O2
Formula: C11H9NO2
Formula: C28H58O
Formula: C84H171O4P
Formula: C18H40ClN
Formula: #
Formula: C18H38O3S
Formula: C46H84NO8P
Formula: C44H82NO8P
Formula: C23H43NO3
Formula: C18H36
Formula: #
Formula: C40H53N3O5S
Formula: C21H42N2O
Formula: C31H48BrN
Formula: C33H50BrN
Formula: C23H42NNaO3
Formula: C23H43NO3
Formula: C21H40N2O2
Formula: C28H44
Formula: C22H39NO2
Formula: C36H74S
Formula: C18H34
Formula: C8HD17O
Formula: C8H20ClN
Formula: C8H17NaO3S
Formula: C8HD17S
Formula: C8H19NO2S
Formula: C8H19NaO4S
Formula: C8H17ClO2S
Formula: #
Formula: C8H17FO2S
Formula: C8H18S
Formula: C24H50O2S2
Formula: C9H20O2S2
Formula: C16H34O2S2
Formula: C8H18O
1-OCTANONE, 2,2,3,3,4,4,5,5,6,6,7,7,8,8-TETRADECAFLUORO-1-PHENYL-
Formula: #
Formula: C14H19N3O
1-OCTEN-2-OL (9CI)
Formula: C8H16O
Formula: C8H16O
Formula: C8H14O
Formula: C10H18O2
Formula: C11H20O2
Formula: C8H12
Formula: C8H16O
Formula: C8H16
Formula: (C8H16)n.(C6H12)k.(C2H4)x
Formula: #
Formula: C16H32
Formula: CH3(CH2)5CH=CD2
Formula: #
Formula: C24H49O3P
Formula: C9H17NS
Formula: C11H20N2
Formula: C9H19N5
Formula: C13H25N2.BF4
Formula: C13H25N2.C2F6NO4S2
Formula: C13H25N2.Br
Formula: C13H25N2.Cl
Formula: C13H25N2.PF6
Formula: #
Formula: C17H25N
Formula: C9H20N2S
Formula: C14H23N3S
Formula: #
Formula: C12H23N2.C3HF6O4S2
Formula: C12H23N2.C4F6NO2
Formula: C12H23BrN2
Formula: C12H23ClN2
Formula: C12H23N2.C2N3
Formula: C12H23F6N2P
Formula: C12H23N2.NO3
Formula: C12H23N2.HSO4
Formula: C12H23BF4N2
Formula: #
Formula: C13H23NO3
Formula: C12H19NO2
Formula: C8H19BO2
Formula: #
Formula: C9H23N3O4S
Formula: C11H20N2O2
Formula: #
Formula: C8H17Cl2OP
Formula: C12H26N2
Formula: C13H22BrN
Formula: C16H34OS
Formula: C16H34O4S2
Formula: C8H14
Formula: C9H16
Formula: C20H40Sn
Formula: C38H64N5O11P
Formula: C23H42O5
Formula: C48H82NO8P
Formula: C39H70O5
Formula: C19H36NaO7P
Formula: C21H40O4
Formula: C20H37NO
Formula: C9H15NO2
Formula: #
Formula: C9H16N2O3
Formula: C9H16N2O2
Formula: C8H14N2O3
Formula: C8H12N2O3
Formula: C8H14N2O2
Formula: C9H16N2O2
Formula: #
Formula: C7H10N2O3
Formula: C8H11NO3
Formula: C10H17NO2
Formula: C10H17NO2
Formula: C10H17NO2
Formula: C10H17NO2
Formula: C10H17NO2
Formula: C10H17NO2
Formula: C12H21NO2
Formula: C8H15NO
Formula: C9H13NO3
Formula: C9H13NO3
Formula: C9H13NO3
Formula: C10H17NO2
Formula: C11H11NO3
Formula: C9H15NO3
Formula: C11H17NO3
Formula: C9H13NO3
Formula: C12H26N2OS3
Formula: C5H11N3O
Formula: C8H22N3O
Formula: C9H16N2O2
Formula: C7H12N2O2
Formula: C7H9NO3
Formula: C10H16N2O
Formula: C10H19NO2
Formula: C8H15NO
Formula: C9H17NO
Formula: C4H8HgO
Formula: C7H10O4S
Formula: C7H12O2S
Formula: #
Formula: C8H13NO3
Formula: C11H19NO3
Formula: C8H13NO3
Formula: C4H5N3OS
Formula: C8 H10 N2 O3
Formula: C10H17NO3
Formula: C6H11NO
Formula: C7H13NO
Formula: C12H21NO3
Formula: C7H8N2O2
Formula: C10H16N2O
Formula: #
Formula: C6H12N2O
Formula: C9H5NO
Formula: C7H13NO
Formula: C12H21NO3
Formula: C8H15NO
Formula: C8H13NO2
Formula: C8H15NO
Formula: C8H16ClNO
Formula: C9H17NO
Formula: C11H20O2
Formula: C16H30O2
Formula: C14H26O2
Formula: C13H24O2
Formula: C12H22O2
Formula: C10H16O3
Formula: C10H16O3
Formula: C9H14O2
Formula: C8H12O3
Formula: C5H8O
Formula: C6H10O2
Formula: C7H10O3
Formula: C8H12O2
Formula: C9H14O
Formula: C9H14O
Formula: C8H12Cl2O
Formula: C7H11BrO
Formula: C9H14O2
Formula: C10H14O
Formula: C8H11NO2
Formula: C8H12O3
Formula: C7H12O2
Formula: C10H16O
Formula: C10H16O
1-OXASPIRO[2.5]OCT-5-ENE, 2,6-DIMETHYL-, (S)- (9CI)
Formula: C9H14O
Formula: C7H4F2O2
Formula: C9H12O3
Formula: C7H12O
Formula: C9H12O
Formula: C11H20O
Formula: C8H11NO
Formula: C8H12O3
Formula: C11H18O3
Formula: C8H14O2
Formula: C8H14O
Formula: #
Formula: #
Formula: C7H8Cl2O2
Formula: C11H11NO3
Formula: C11H11NO3
Formula: #
Formula: C8H14O2
Formula: C8H14O
Formula: C8H12F2O
Formula: C8H10O3
Formula: C10H13ClO3
Formula: #
Formula: C9H11ClO3
Formula: C10H17NO3
Formula: C11H15ClO3
Formula: C9H15FO
Formula: #
Formula: C10H16O2
Formula: C11H20O
Formula: C10H16O2
Formula: C13H22O2
Formula: C18H26N2O2
Formula: C18H18N2O2
Formula: C24H36N2O2
Formula: C24H34N2O2
Formula: C6H11NO3S
Formula: C6H13NO2S
Formula: C4H3N5O2
Formula: C8H13NO
Formula: C7H4N2O3
Formula: C14H9NO2
Formula: C17H17N3O4S
Formula: C6H4N2O
Formula: C5H7N2O
Formula: #
Formula: C18H12O
Formula: C11H10O2
Formula: C12H18O7
Formula: C10H7NO3
Formula: C10H7NO3
Formula: C10H7NO2
Formula: C9H10BrNO
Formula: #
Formula: #
Formula: C12H10N2O3
Formula: C14H14N2O3
Formula: C12H20N2O3
Formula: C12H20N2O3
Formula: C13H22N2O3
Formula: #
Formula: #
Formula: C12H13NO3
Formula: C10H12O4
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C10H8O3
Formula: C23H22N4O2
Formula: #
Formula: C10H8O3
Formula: C10H8O3
Formula: C8H5NO
Formula: C5H8O3
Formula: C6H6O7
Formula: #
Formula: C13H25N3O2PS
Formula: #
Formula: C15H14O
Formula: C14H12N2S
Formula: #
Formula: C12H11NO2
Formula: C12H12F3NO
Formula: C17H14
Formula: C12H15NO
Formula: C10H15N
Formula: C11H12O2
Formula: C10H12O
Formula: C10H10N2
Formula: C45H68NO8P
Formula: C31H52N5O10P
Formula: C33H64N2O10P
Formula: C42H82NO9P
Formula: C47H74NO8P
Formula: C42H80NO8P
Formula: C55H100O6
Formula: C40H77O10P
Formula: C40H76NO10P
Formula: C42H82NO8P
Formula: #
Formula: C39H71F3N3O10P
Formula: C50H76NO8P
Formula: C19H37ClO3
Formula: #
Formula: C22H43NNaO9P
Formula: C21H44NO7P
Formula: C21H42O4
Formula: C17H16O2
Formula: C25H52O
Formula: #
Formula: C15H31NaO3S
Formula: C15H32S
Formula: C15H32O
Formula: C15H30
Formula: C30H62O
Formula: C20H41NO
Formula: C15H28
Formula: C10H17N
Formula: C11H19NO2
Formula: C12H17ClO
Formula: C9H13ClO
Formula: C9H10O2
Formula: C9H12O2
Formula: C9H12O2
Formula: C9H10O2
Formula: C9H13NO4
Formula: C12H18O3
Formula: C9H7NO
Formula: C10H14O
Formula: C10H18O
Formula: C16H26
Formula: C14H22
Formula: C9H21NO
Formula: #
Formula: C10H21NO2
Formula: C8H19N
Formula: C5H11NaO3S
Formula: C5H12S
Formula: #
Formula: C6H14N2O3
Formula: C6H14N2O3
Formula: #
Formula: C5H11MgO
Formula: C8H19NO
Formula: C8H19NO
Formula: C10H16N2O2
Formula: C5H12O
Formula: C12H17NO3
Formula: C10H14O
Formula: C11H19FO
Formula: C10H12F2O3
Formula: C10H12F2O3
Formula: C11H12F2O2
Formula: C11H12F2O2
Formula: C8H13BrO
Formula: C9H11ClO2
Formula: C10H12ClNO
Formula: C11H19ClO
Formula: C12H15FO
Formula: C12H15FO
Formula: C12H13NOS
Formula: C13H18O2
Formula: C9H13NO2
Formula: C13H16F3NO2
Formula: C5H11BO2
Formula: C9H16O2
Formula: C14H20O2
Formula: C5H10O
Formula: C7H9F3O
Formula: C6H7F3O
Formula: C5H6Cl2O
Formula: C9H12N2O
Formula: C5H5ClF2O
Formula: C7H10F2O2
Formula: C5H7BrO
Formula: C6H10O2
Formula: C6H10O2
1-PENTEN-3-ONE, 5-(1,3-DIOXOLAN-2-YL)-
Formula: C8H12O3
Formula: C5H8O
Formula: C5H6O
Formula: C9H12O
Formula: C5H6
Formula: #
Formula: C5H10O
Formula: C5H6
Formula: C5H10
Formula: C11H14
Formula: C11H24O
Formula: CH3(CH2)4NC
Formula: #
Formula: #
Formula: C9H17NO
Formula: C26H27NO
Formula: C24H31NO
Formula: C12H18N2S
Formula: C10H18
Formula: #
Formula: C11H20
Formula: #
Formula: C10H22S2
Formula: C8H14N2
Formula: C13H15NO2
Formula: C5H11BrMg
Formula: C15H18
Formula: C19H32
Formula: C10H21N
Formula: C10H22OS
Formula: C5H8O
Formula: C9H14O
Formula: C9H14N2O3
Formula: C12H13NO2
Formula: C5H8
Formula: C5H7I
Formula: #
Formula: C13H12BrNO
Formula: C16H14O
Formula: C16H12O
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C13H8N2O2
Formula: #
Formula: #
Formula: C13H17NO.HCl
Formula: C24H31NO5
Formula: C19H23NO
Formula: C24H31NO5
Formula: C12H15NO
Formula: #
Formula: C11H12N2
Formula: C13H19N
Formula: C11H14ClN3
Formula: C13H14ClN
Formula: C12H11NO2
Formula: C13H13ClN4
Formula: C8H7KO5S
Formula: C14H11NOS
Formula: C10H14O3
Formula: #
Formula: C9H11ClO
Formula: C9H12O2
Formula: #
Formula: #
Formula: C19H27ClN2O2
Formula: C19H24N2O2
Formula: C19H24N2O
Formula: C17H20O2
Formula: C24H18OS2
Formula: C23H34Cl2N2O5
Formula: C13H20N2O2
Formula: #
Formula: C16H23N3O2
Formula: C17H15N3O4
Formula: C15H20O3
Formula: #
Formula: #
Formula: C15H15N
Formula: C15H15N
Formula: #
Formula: C10H9NO3
Formula: C8H7N3
Formula: C8H9N5
Formula: C16H14
Formula: #
Formula: C8H10O2
Formula: C14H18O4
Formula: C8H10O2
Formula: C9H8O2
Formula: C12H13NO4
Formula: C9H9NO2
Formula: C18H20
Formula: C8H7N3
Formula: C13H18N3O
Formula: C13H24N2OSi2
Formula: C10H10O2
Formula: #
Formula: C17H12N2O2S
Formula: C11H12O2
Formula: C24H24
Formula: C26H30ClNO
Formula: C16H24N2O
Formula: C10H14O
Formula: #
Formula: C10H12
Formula: C10H10
Formula: C13H15N
Formula: C12H12O
Formula: C12H14
Formula: C12H13N
Formula: C10H10O2
Formula: C9H10O
Formula: C18H28O
Formula: C11H10
Formula: C13H20O
Formula: C13H18
Formula: C12H18O
Formula: #
Formula: C12H14O
Formula: #
Formula: #
Formula: C15H20
Formula: C14H22O
Formula: C11H10O
Formula: C11H12O
Formula: C11H12
Formula: C9H12O
Formula: C20H36O2
Formula: C12H12N2
Formula: C10H9N3O2
Formula: C9H7N3O2
Formula: C10H9N3O2
Formula: C8H7N3O
Formula: C9H7N3O
Formula: C15H12N2O
Formula: C14H13N3
Formula: C13H11N3
Formula: C12H9N3
Formula: C13H10N2
Formula: C15H11NO2
Formula: C10H11N3
Formula: C10H8N2O
Formula: C10H8N2O2
Formula: C10H8N2O
Formula: C10H7ClN2O
Formula: C10H8N2O2
Formula: C11H10N6
Formula: C11H9NO
Formula: C10H9N
Formula: C8H7F3O
Formula: C26H28O
Formula: #
Formula: C16H17N
Formula: C14H17P
Formula: C21H28
Formula: #
Formula: #
Formula: C11H12O2
Formula: C17H29O9P
Formula: C11H13N3
Formula: C16H23N
Formula: #
Formula: #
Formula: C16H13N3O
Formula: C24H18
Formula: C17H17N3O2
Formula: C14H13ClO
Formula: #
Formula: C24H18
Formula: C13H11NO
Formula: C12H10N2O
Formula: #
Formula: C15H17NO
Formula: C15H14OS
Formula: C11H17NO
Formula: C11H15NO2
Formula: C14H16ClNO2
Formula: C10H14N2O2S
Formula: C10H15ClN2O2S
Formula: #
Formula: C11H14Si
Formula: C15H14F3N
Formula: C19H18N2O
Formula: #
Formula: C11H17N
Formula: C12H19N
Formula: C11H17N
Formula: C8H8BrO
Formula: C10H14O
Formula: C10H12O
Formula: C10H10O
Formula: C10H12
Formula: C10H8O
Formula: #
Formula: C14H18O
Formula: C13H18O
Formula: #
Formula: C12H16O
Formula: C9H13NO
Formula: C11H14O
Formula: C8H8BrNO3
Formula: C9H9NO2
Formula: #
Formula: #
Formula: C11H11NO3
Formula: C27H19NO2
Formula: C14H12OS
Formula: C12H9N5O6
Formula: C12H16N2O
Formula: C10H12N2O.HCl
Formula: C13H19NO
Formula: C20H23NO2
Formula: C15H16
Formula: C9H12O
Formula: C11H14O2
Formula: C9H8O
Formula: C11H16O2
Formula: C15H16
Formula: C10H14O3S
Formula: C9H8O
Formula: C9H6O
Formula: C12H12N2O
Formula: C12H10N2O
Formula: C13H13NO
Formula: C13H11NO
Formula: C12H12N2O
Formula: C13H17NO
Formula: C10H11NO
Formula: #
Formula: C8H9N3OS
Formula: C10H9NOS
Formula: C11H14Ge
Formula: C25H22N2
Formula: C17H7F17O2
Formula: C8H7N3S
Formula: C13H10N2O
Formula: C7H6N4O
Formula: #
Formula: #
Formula: C17H21NO
Formula: C15H16N2
Formula: C15H13N.HCl
Formula: C15H13N
Formula: #
Formula: C10H9N3S2
Formula: C19H20ClN3
Formula: #
Formula: C23H18Cl2N2
Formula: C25H36
Formula: C24H24
Formula: C15H25N3O
Formula: C21H24N2
Formula: C12H11N3S
Formula: C16H13F3O
Formula: C24H18
Formula: C14H20N2O.HCL
Formula: C11H15N3O
Formula: C24H18
Formula: C14H14N2O2S2
Formula: C20H22N2
Formula: C12H19NO
Formula: C13H20N2
Formula: C13H19NO
Formula: #
Formula: C10H7F3N2O
Formula: C11H7F3N2O2
Formula: C10H7F3N2O
Formula: #
Formula: C18H18N2O2
Formula: #
Formula: C22H18O3
Formula: C17H19O2
Formula: #
Formula: C9H9N3
Formula: C11H9NO2
Formula: C11H13N
Formula: #
Formula: C12H14O2
Formula: C10H12O
Formula: C10H10O
Formula: C9H7Cl
Formula: #
Formula: C15H10N2O
Formula: #
Formula: #
Formula: C10H10N2
Formula: #
Formula: #
Formula: C17H14N2O
Formula: C17H14N2O2
Formula: C19H19N3
Formula: C15H20N2O
Formula: C12H17N3O
Formula: #
Formula: #
Formula: C19H21NO2
Formula: C15H16
Formula: C12H14N2O
Formula: C12H11N3O
Formula: C15H11N3O
Formula: C15H11N3O2
Formula: C15H11N3O
Formula: C14H11NO
Formula: C14H18N2O
Formula: C13H10OS
Formula: C7H9N3S
Formula: C13H14N2
Formula: C15H21NO
Formula: C18H22O
Formula: C18H22N2
Formula: #
Formula: #
Formula: #
Formula: C22H28N2OS
Formula: #
Formula: #
Formula: C21H23NO
Formula: C24H18O
Formula: C15H20ClN3O2
Formula: C16H20N2O2
Formula: #
Formula: C26H20
Formula: C12H14O
Formula: C12H12O
Formula: C9H7IN2
Formula: C12H14O
Formula: C10H12N2O
Formula: C10H10N2
Formula: C11H12O
Formula: C11H13OP
Formula: C12H17NO
Formula: C15H17N3
Formula: C16H22
Formula: #
Formula: C13H16OSi
Formula: C15H15NO
Formula: C16H14N4
Formula: C19H15N
Formula: C14H10N4
Formula: C16H16N4O2S2
Formula: C11H9F3N4O
Formula: C11H6ClF3N2O
Formula: C20H16O2
Formula: C7H7N5
Formula: #
Formula: #
Formula: #
Formula: #
Formula: C13H14N2O3
Formula: C13H13ClN2O
Formula: C13H14N2O2
Formula: C15H18N2O2
Formula: C14H10N3O2
Formula: C11H7F3N2O2
Formula: C13H11F3N2O2
Formula: C11H12N2S
Formula: C9H8N2O
Formula: C16H12N6
Formula: #
Formula: C12H14O
Formula: C25H31N3O
Formula: C22H27N3OS
Formula: C9H11N
Formula: C15H18O2
Formula: C10H15N
Formula: C12H17ClN
Formula: C12H12Cl2O
Formula: C10H11NO
Formula: C8H12N2
Formula: C16H16N2
Formula: C8H5D3O
Formula: C16H19N
Formula: C21H16F6N4O3
Formula: C16H12N2O
Formula: C18H23N
Formula: C14H10N2OS
Formula: C21H20N2
Formula: C20H20N2
Formula: C16H19N
Formula: C14H12N2
Formula: C13H14N2
Formula: C12H15N3
Formula: C12H20ClN
Formula: #
Formula: C11H13NO
Formula: C10H12N2O
Formula: C16H20
Formula: #
Formula: C17H17ClN2O
Formula: C13H17NO2
Formula: C12H15NO2
Formula: #
Formula: C12H17N
Formula: C12H11N
Formula: C9H9NO
Formula: C8H9N
Formula: #
Formula: C13H10N2
Formula: C14H18O
Formula: #
Formula: #
Formula: C8H12ClN5
Formula: C10H12O
Formula: C10H10O2
Formula: #
Formula: C10H14O
Formula: C11H16O3S
Formula: C16H18
Formula: C10H14O2
Formula: CH3C6H4SO2NHN=C(C6H5)CH2CH2CH3
Formula: C10H12O
Formula: #
Formula: #
Formula: C11H11N
Formula: C11H11ClO
Formula: C11H14N2
Formula: C11H12O2
Formula: C10H13N
Formula: C10H13N.HCl
Formula: C13H18O
Formula: C13H20ClN
Formula: C12H16O
Formula: #
Formula: #
Formula: C20H28ClNO2
Formula: C13H16O2
Formula: #
Formula: C11H12O
Formula: C11H14O
Formula: #
Formula: C12H14O
Formula: C12H14O2
Formula: C20H29NO2
Formula: #
Formula: C11H12